Bump to Buildah v1.11.5

Bump to Buildah v1.11.5.  Most notably changes to the
podman build `--pull` functionality.  `--pull=true` and `--pull=false` now
work as Docker does, `--pull-never` added to supply the functionality
of the old `--pull=false`.

Signed-off-by: TomSweeneyRedHat <tsweeney@redhat.com>

2 files changed, 1098 insertions, 0 deletions

diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go
new file mode 100644
index 000000000..7c2a0dc28
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go
@@ -0,0 +1,565 @@
+package vmcompute
+
+import (
+	gcontext "context"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/log"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/oc"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"go.opencensus.io/trace"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess?
+//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+const errVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+// HcsSystem is the handle associated with a created compute system.
+type HcsSystem syscall.Handle
+
+// HcsProcess is the handle associated with a created process in a compute
+// system.
+type HcsProcess syscall.Handle
+
+// HcsCallback is the handle associated with the function to call when events
+// occur.
+type HcsCallback syscall.Handle
+
+// HcsProcessInformation is the structure used when creating or getting process
+// info.
+type HcsProcessInformation struct {
+	// ProcessId is the pid of the created process.
+	ProcessId uint32
+	reserved  uint32
+	// StdInput is the handle associated with the stdin of the process.
+	StdInput syscall.Handle
+	// StdOutput is the handle associated with the stdout of the process.
+	StdOutput syscall.Handle
+	// StdError is the handle associated with the stderr of the process.
+	StdError syscall.Handle
+}
+
+func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error {
+	if timeout > 0 {
+		var cancel gcontext.CancelFunc
+		ctx, cancel = gcontext.WithTimeout(ctx, timeout)
+		defer cancel()
+	}
+
+	done := make(chan error, 1)
+	go func() {
+		done <- f()
+	}()
+	select {
+	case <-ctx.Done():
+		if ctx.Err() == gcontext.DeadlineExceeded {
+			log.G(ctx).WithField(logfields.Timeout, timeout).
+				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+		}
+		return ctx.Err()
+	case err := <-done:
+		return err
+	}
+}
+
+func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("query", query))
+
+	return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			computeSystemsp *uint16
+			resultp         *uint16
+		)
+		err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+		if computeSystemsp != nil {
+			computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(
+		trace.StringAttribute("id", id),
+		trace.StringAttribute("configuration", configuration))
+
+	return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error {
+		var resultp *uint16
+		err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsOpenComputeSystem(id, &computeSystem, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsCloseComputeSystem(computeSystem)
+	})
+}
+
+func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemStart, func() error {
+		var resultp *uint16
+		err := hcsStartComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsShutdownComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsTerminateComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemPause, func() error {
+		var resultp *uint16
+		err := hcsPauseComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemResume, func() error {
+		var resultp *uint16
+		err := hcsResumeComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
+
+	return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			propertiesp *uint16
+			resultp     *uint16
+		)
+		err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp)
+		if propertiesp != nil {
+			properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("configuration", configuration))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsModifyComputeSystem(computeSystem, configuration, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle)
+	})
+}
+
+func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsUnregisterComputeSystemCallback(callbackHandle)
+	})
+}
+
+func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCreateProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("processParameters", processParameters))
+
+	return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsOpenProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.Int64Attribute("pid", int64(pid)))
+
+	return process, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsOpenProcess(computeSystem, pid, &process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCloseProcess")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsCloseProcess(process)
+	})
+}
+
+func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsTerminateProcess(process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsSignalProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsSignalProcess(process, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsGetProcessInfo(process, &processInformation, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			processPropertiesp *uint16
+			resultp            *uint16
+		)
+		err := hcsGetProcessProperties(process, &processPropertiesp, &resultp)
+		if processPropertiesp != nil {
+			processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsModifyProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("settings", settings))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsModifyProcess(process, settings, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
+
+	return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			propertiesp *uint16
+			resultp     *uint16
+		)
+		err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp)
+		if propertiesp != nil {
+			properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsRegisterProcessCallback(process, callback, context, &callbackHandle)
+	})
+}
+
+func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsUnregisterProcessCallback(callbackHandle)
+	})
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go
new file mode 100644
index 000000000..0f2a69f6a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go
@@ -0,0 +1,533 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package vmcompute
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+	procHcsSignalProcess                   = modvmcompute.NewProc("HcsSignalProcess")
+	procHcsGetProcessInfo                  = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties            = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess                   = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties            = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback         = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback       = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+)
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseProcess(process HcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsSignalProcess(process, _p0, result)
+}
+
+func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsSignalProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}