Bump to Buildah v1.11.5

Bump to Buildah v1.11.5.  Most notably changes to the
podman build `--pull` functionality.  `--pull=true` and `--pull=false` now
work as Docker does, `--pull-never` added to supply the functionality
of the old `--pull=false`.

Signed-off-by: TomSweeneyRedHat <tsweeney@redhat.com>

102 files changed, 2122 insertions, 1068 deletions

diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml
new file mode 100644
index 000000000..47d7650fb
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml
@@ -0,0 +1,54 @@
+version = "unstable"
+generator = "gogoctrd"
+plugins = ["grpc", "fieldpath"]
+
+# Control protoc include paths. Below are usually some good defaults, but feel
+# free to try it without them if it works for your project.
+[includes]
+  # Include paths that will be added before all others. Typically, you want to
+  # treat the root of the project as an include, but this may not be necessary.
+  before = ["./protobuf"]
+
+  # Paths that should be treated as include roots in relation to the vendor
+  # directory. These will be calculated with the vendor directory nearest the
+  # target package.
+  packages = ["github.com/gogo/protobuf"]
+
+  # Paths that will be added untouched to the end of the includes. We use
+  # `/usr/local/include` to pickup the common install location of protobuf.
+  # This is the default.
+  after = ["/usr/local/include"]
+
+# This section maps protobuf imports to Go packages. These will become
+# `-M` directives in the call to the go protobuf generator.
+[packages]
+  "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto"
+  "google/protobuf/any.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor"
+  "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types"
+  "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types"
+  "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1"
+
+[[overrides]]
+prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"]
+plugins = ["ttrpc"]
+
+# Lock down runhcs config
+
+[[descriptors]]
+prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options"
+target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt"
+ignore_files = [
+	"google/protobuf/descriptor.proto",
+	"gogoproto/gogo.proto"
+]
+
+[[descriptors]]
+prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats"
+target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt"
+ignore_files = [
+	"google/protobuf/descriptor.proto",
+	"gogoproto/gogo.proto"
+]
\ No newline at end of file
diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml
index a8ec5a593..7f0f81632 100644
--- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml
+++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml
@@ -8,22 +8,34 @@ environment:
   GOPATH: c:\gopath
   PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
 
-stack: go 1.11
+stack: go 1.12.9
 
 build_script:
   - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
   - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
   - gometalinter.exe --config .gometalinter.json ./...
-  - go build ./cmd/wclayer
+  - go build ./cmd/containerd-shim-runhcs-v1
   - go build ./cmd/runhcs
   - go build ./cmd/tar2ext4
+  - go build ./cmd/wclayer
+  - go build ./internal/tools/grantvmgroupaccess 
+  - go build ./internal/tools/uvmboot
+  - go build ./internal/tools/zapdir
   - go test -v ./... -tags admin
+  - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional
+  - go test -c ./test/cri-containerd/ -tags functional
   - go test -c ./test/functional/ -tags functional
-  - go test -c ./test/runhcs/ -tags integration
+  - go test -c ./test/runhcs/ -tags functional
 
 artifacts:
-  - path: 'wclayer.exe'
+  - path: 'containerd-shim-runhcs-v1.exe'
   - path: 'runhcs.exe'
   - path: 'tar2ext4.exe'
+  - path: 'wclayer.exe'
+  - path: 'grantvmgroupaccess.exe'  
+  - path: 'uvmboot.exe'
+  - path: 'zapdir.exe'
+  - path: 'containerd-shim-runhcs-v1.test.exe'
+  - path: 'cri-containerd.test.exe'
   - path: 'functional.test.exe'
   - path: 'runhcs.test.exe'
\ No newline at end of file
diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go
index e142c3154..53c0a3854 100644
--- a/vendor/github.com/Microsoft/hcsshim/container.go
+++ b/vendor/github.com/Microsoft/hcsshim/container.go
@@ -1,8 +1,10 @@
 package hcsshim
 
 import (
+	"context"
 	"fmt"
 	"os"
+	"sync"
 	"time"
 
 	"github.com/Microsoft/hcsshim/internal/hcs"
@@ -52,7 +54,10 @@ const (
 type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
 
 type container struct {
-	system *hcs.System
+	system   *hcs.System
+	waitOnce sync.Once
+	waitErr  error
+	waitCh   chan struct{}
 }
 
 // createComputeSystemAdditionalJSON is read from the environment at initialisation
@@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) {
 		return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
 	}
 
-	system, err := hcs.CreateComputeSystem(id, fullConfig)
+	system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig)
 	if err != nil {
 		return nil, err
 	}
-	return &container{system}, err
+	return &container{system: system}, err
 }
 
 // OpenContainer opens an existing container by ID.
 func OpenContainer(id string) (Container, error) {
-	system, err := hcs.OpenComputeSystem(id)
+	system, err := hcs.OpenComputeSystem(context.Background(), id)
 	if err != nil {
 		return nil, err
 	}
-	return &container{system}, err
+	return &container{system: system}, err
 }
 
 // GetContainers gets a list of the containers on the system that match the query
 func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
-	return hcs.GetComputeSystems(q)
+	return hcs.GetComputeSystems(context.Background(), q)
 }
 
 // Start synchronously starts the container.
 func (container *container) Start() error {
-	return convertSystemError(container.system.Start(), container)
+	return convertSystemError(container.system.Start(context.Background()), container)
 }
 
 // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
 func (container *container) Shutdown() error {
-	return convertSystemError(container.system.Shutdown(), container)
+	err := container.system.Shutdown(context.Background())
+	if err != nil {
+		return convertSystemError(err, container)
+	}
+	return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"}
 }
 
 // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
 func (container *container) Terminate() error {
-	return convertSystemError(container.system.Terminate(), container)
+	err := container.system.Terminate(context.Background())
+	if err != nil {
+		return convertSystemError(err, container)
+	}
+	return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"}
 }
 
 // Waits synchronously waits for the container to shutdown or terminate.
 func (container *container) Wait() error {
-	return convertSystemError(container.system.Wait(), container)
+	err := container.system.Wait()
+	if err == nil {
+		err = container.system.ExitError()
+	}
+	return convertSystemError(err, container)
 }
 
 // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
 // returns false if timeout occurs.
-func (container *container) WaitTimeout(t time.Duration) error {
-	return convertSystemError(container.system.WaitTimeout(t), container)
+func (container *container) WaitTimeout(timeout time.Duration) error {
+	container.waitOnce.Do(func() {
+		container.waitCh = make(chan struct{})
+		go func() {
+			container.waitErr = container.Wait()
+			close(container.waitCh)
+		}()
+	})
+	t := time.NewTimer(timeout)
+	defer t.Stop()
+	select {
+	case <-t.C:
+		return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"}
+	case <-container.waitCh:
+		return container.waitErr
+	}
 }
 
 // Pause pauses the execution of a container.
 func (container *container) Pause() error {
-	return convertSystemError(container.system.Pause(), container)
+	return convertSystemError(container.system.Pause(context.Background()), container)
 }
 
 // Resume resumes the execution of a container.
 func (container *container) Resume() error {
-	return convertSystemError(container.system.Resume(), container)
+	return convertSystemError(container.system.Resume(context.Background()), container)
 }
 
 // HasPendingUpdates returns true if the container has updates pending to install
@@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) {
 
 // Statistics returns statistics for the container. This is a legacy v1 call
 func (container *container) Statistics() (Statistics, error) {
-	properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
+	properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics)
 	if err != nil {
 		return Statistics{}, convertSystemError(err, container)
 	}
@@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) {
 
 // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
 func (container *container) ProcessList() ([]ProcessListItem, error) {
-	properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
+	properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
@@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) {
 
 // This is a legacy v1 call
 func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
-	properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
+	properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
@@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr
 
 // CreateProcess launches a new process within the container.
 func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
-	p, err := container.system.CreateProcess(c)
+	p, err := container.system.CreateProcessNoStdio(c)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
-	return &process{p}, nil
+	return &process{p: p.(*hcs.Process)}, nil
 }
 
 // OpenProcess gets an interface to an existing process within the container.
 func (container *container) OpenProcess(pid int) (Process, error) {
-	p, err := container.system.OpenProcess(pid)
+	p, err := container.system.OpenProcess(context.Background(), pid)
 	if err != nil {
 		return nil, convertSystemError(err, container)
 	}
-	return &process{p}, nil
+	return &process{p: p}, nil
 }
 
 // Close cleans up any state associated with the container but does not terminate or wait for it.
@@ -188,5 +219,5 @@ func (container *container) Close() error {
 
 // Modify the System
 func (container *container) Modify(config *ResourceModificationRequestResponse) error {
-	return convertSystemError(container.system.Modify(config), container)
+	return convertSystemError(container.system.Modify(context.Background(), config), container)
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod
new file mode 100644
index 000000000..5f76d444d
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/go.mod
@@ -0,0 +1,37 @@
+module github.com/Microsoft/hcsshim
+
+go 1.12
+
+require (
+	github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5
+	github.com/blang/semver v3.1.0+incompatible // indirect
+	github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f
+	github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1
+	github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69
+	github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect
+	github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect
+	github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3
+	github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de
+	github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd
+	github.com/gogo/protobuf v1.2.1
+	github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect
+	github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect
+	github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect
+	github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect
+	github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700
+	github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39
+	github.com/pkg/errors v0.8.1
+	github.com/prometheus/procfs v0.0.5 // indirect
+	github.com/sirupsen/logrus v1.4.1
+	github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect
+	github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5
+	github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect
+	github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect
+	github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect
+	go.opencensus.io v0.22.0
+	golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6
+	golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
+	google.golang.org/grpc v1.20.1
+	gotest.tools v2.2.0+incompatible // indirect
+	k8s.io/kubernetes v1.13.0
+)
diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum
new file mode 100644
index 000000000..578b78e81
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/go.sum
@@ -0,0 +1,131 @@
+cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
+github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
+github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
+github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
+github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU=
+github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk=
+github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
+github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
+github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
+github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg=
+github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
+github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw=
+github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
+github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
+github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
+github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4=
+github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
+github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw=
+github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
+github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4=
+github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
+github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y=
+github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
+github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8=
+github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
+github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
+github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
+github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
+github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8=
+github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
+github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE=
+github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
+github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
+github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
+github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
+github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM=
+github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg=
+github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY=
+github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4=
+github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI=
+github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I=
+github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
+github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
+github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
+github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
+github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
+github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4=
+github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
+github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI=
+github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
+github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4=
+github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs=
+github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
+github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
+github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8=
+github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
+github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k=
+github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
+github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
+github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
+github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
+github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI=
+github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
+github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk=
+github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
+github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c=
+github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
+github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
+github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
+github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ=
+github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
+go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
+go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
+golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
+golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
+golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
+golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
+golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
+golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628=
+golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo=
+golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
+golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
+golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
+golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
+golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
+golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
+golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
+golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
+google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
+google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
+google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc=
+google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
+google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY=
+google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
+google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU=
+google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
+gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
+gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
+honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8=
+k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk=
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
index eb013d2c4..09b3860a7 100644
--- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
+++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
@@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) {
 
 // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
 func HotAttachEndpoint(containerID string, endpointID string) error {
+	endpoint, err := GetHNSEndpointByID(endpointID)
+	isAttached, err := endpoint.IsAttached(containerID)
+	if isAttached {
+		return err
+	}
 	return modifyNetworkEndpoint(containerID, endpointID, Add)
 }
 
 // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
 func HotDetachEndpoint(containerID string, endpointID string) error {
+	endpoint, err := GetHNSEndpointByID(endpointID)
+	isAttached, err := endpoint.IsAttached(containerID)
+	if !isAttached {
+		return err
+	}
 	return modifyNetworkEndpoint(containerID, endpointID, Remove)
 }
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
new file mode 100644
index 000000000..8193315f0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
@@ -0,0 +1,83 @@
+package cow
+
+import (
+	"context"
+	"io"
+
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// Process is the interface for an OS process running in a container or utility VM.
+type Process interface {
+	// Close releases resources associated with the process and closes the
+	// writer and readers returned by Stdio. Depending on the implementation,
+	// this may also terminate the process.
+	Close() error
+	// CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever
+	// is appropriate to indicate that no more data is available.
+	CloseStdin(ctx context.Context) error
+	// Pid returns the process ID.
+	Pid() int
+	// Stdio returns the stdio streams for a process. These may be nil if a stream
+	// was not requested during CreateProcess.
+	Stdio() (_ io.Writer, _ io.Reader, _ io.Reader)
+	// ResizeConsole resizes the virtual terminal associated with the process.
+	ResizeConsole(ctx context.Context, width, height uint16) error
+	// Kill sends a SIGKILL or equivalent signal to the process and returns whether
+	// the signal was delivered. It does not wait for the process to terminate.
+	Kill(ctx context.Context) (bool, error)
+	// Signal sends a signal to the process and returns whether the signal was
+	// delivered. The input is OS specific (either
+	// guestrequest.SignalProcessOptionsWCOW or
+	// guestrequest.SignalProcessOptionsLCOW). It does not wait for the process
+	// to terminate.
+	Signal(ctx context.Context, options interface{}) (bool, error)
+	// Wait waits for the process to complete, or for a connection to the process to be
+	// terminated by some error condition (including calling Close).
+	Wait() error
+	// ExitCode returns the exit code of the process. Returns an error if the process is
+	// not running.
+	ExitCode() (int, error)
+}
+
+// ProcessHost is the interface for creating processes.
+type ProcessHost interface {
+	// CreateProcess creates a process. The configuration is host specific
+	// (either hcsschema.ProcessParameters or lcow.ProcessParameters).
+	CreateProcess(ctx context.Context, config interface{}) (Process, error)
+	// OS returns the host's operating system, "linux" or "windows".
+	OS() string
+	// IsOCI specifies whether this is an OCI-compliant process host. If true,
+	// then the configuration passed to CreateProcess should have an OCI process
+	// spec (or nil if this is the initial process in an OCI container).
+	// Otherwise, it should have the HCS-specific process parameters.
+	IsOCI() bool
+}
+
+// Container is the interface for container objects, either running on the host or
+// in a utility VM.
+type Container interface {
+	ProcessHost
+	// Close releases the resources associated with the container. Depending on
+	// the implementation, this may also terminate the container.
+	Close() error
+	// ID returns the container ID.
+	ID() string
+	// Properties returns the requested container properties targeting a V1 schema container.
+	Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error)
+	// PropertiesV2 returns the requested container properties targeting a V2 schema container.
+	PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error)
+	// Start starts a container.
+	Start(ctx context.Context) error
+	// Shutdown sends a shutdown request to the container (but does not wait for
+	// the shutdown to complete).
+	Shutdown(ctx context.Context) error
+	// Terminate sends a terminate request to the container (but does not wait
+	// for the terminate to complete).
+	Terminate(ctx context.Context) error
+	// Wait waits for the container to terminate, or for the connection to the
+	// container to be terminated by some error condition (including calling
+	// Close).
+	Wait() error
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
deleted file mode 100644
index 5d3d0dfef..000000000
--- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
+++ /dev/null
@@ -1,100 +0,0 @@
-package guestrequest
-
-import (
-	"github.com/Microsoft/hcsshim/internal/schema2"
-)
-
-// Arguably, many of these (at least CombinedLayers) should have been generated
-// by swagger.
-//
-// This will also change package name due to an inbound breaking change.
-
-// This class is used by a modify request to add or remove a combined layers
-// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
-// using the specified layers as the parent content. Ignores property ScratchPath
-// since the container path is already the scratch path. For linux, the GCS unions
-// the specified layers and ScratchPath together, placing the resulting union
-// filesystem at ContainerRootPath.
-type CombinedLayers struct {
-	ContainerRootPath string            `json:"ContainerRootPath,omitempty"`
-	Layers            []hcsschema.Layer `json:"Layers,omitempty"`
-	ScratchPath       string            `json:"ScratchPath,omitempty"`
-}
-
-// Defines the schema for hosted settings passed to GCS and/or OpenGCS
-
-// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
-type LCOWMappedVirtualDisk struct {
-	MountPath  string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
-	Lun        uint8  `json:"Lun,omitempty"`
-	Controller uint8  `json:"Controller,omitempty"`
-	ReadOnly   bool   `json:"ReadOnly,omitempty"`
-}
-
-type WCOWMappedVirtualDisk struct {
-	ContainerPath string `json:"ContainerPath,omitempty"`
-	Lun           int32  `json:"Lun,omitempty"`
-}
-
-type LCOWMappedDirectory struct {
-	MountPath string `json:"MountPath,omitempty"`
-	Port      int32  `json:"Port,omitempty"`
-	ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
-	ReadOnly  bool   `json:"ReadOnly,omitempty"`
-}
-
-// Read-only layers over VPMem
-type LCOWMappedVPMemDevice struct {
-	DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
-	MountPath    string `json:"MountPath,omitempty"` // /tmp/pN
-}
-
-type LCOWNetworkAdapter struct {
-	NamespaceID     string `json:",omitempty"`
-	ID              string `json:",omitempty"`
-	MacAddress      string `json:",omitempty"`
-	IPAddress       string `json:",omitempty"`
-	PrefixLength    uint8  `json:",omitempty"`
-	GatewayAddress  string `json:",omitempty"`
-	DNSSuffix       string `json:",omitempty"`
-	DNSServerList   string `json:",omitempty"`
-	EnableLowMetric bool   `json:",omitempty"`
-	EncapOverhead   uint16 `json:",omitempty"`
-}
-
-type ResourceType string
-
-const (
-	// These are constants for v2 schema modify guest requests.
-	ResourceTypeMappedDirectory   ResourceType = "MappedDirectory"
-	ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
-	ResourceTypeNetwork           ResourceType = "Network"
-	ResourceTypeNetworkNamespace  ResourceType = "NetworkNamespace"
-	ResourceTypeCombinedLayers    ResourceType = "CombinedLayers"
-	ResourceTypeVPMemDevice       ResourceType = "VPMemDevice"
-)
-
-// GuestRequest is for modify commands passed to the guest.
-type GuestRequest struct {
-	RequestType  string       `json:"RequestType,omitempty"`
-	ResourceType ResourceType `json:"ResourceType,omitempty"`
-	Settings     interface{}  `json:"Settings,omitempty"`
-}
-
-type NetworkModifyRequest struct {
-	AdapterId   string      `json:"AdapterId,omitempty"`
-	RequestType string      `json:"RequestType,omitempty"`
-	Settings    interface{} `json:"Settings,omitempty"`
-}
-
-type RS4NetworkModifyRequest struct {
-	AdapterInstanceId string      `json:"AdapterInstanceId,omitempty"`
-	RequestType       string      `json:"RequestType,omitempty"`
-	Settings          interface{} `json:"Settings,omitempty"`
-}
-
-// SignalProcessOptions is the options passed to either WCOW or LCOW
-// to signal a given process.
-type SignalProcessOptions struct {
-	Signal int `json:,omitempty`
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
deleted file mode 100644
index e9e45c030..000000000
--- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
+++ /dev/null
@@ -1,69 +0,0 @@
-package guid
-
-import (
-	"crypto/rand"
-	"encoding/json"
-	"fmt"
-	"io"
-	"strconv"
-	"strings"
-)
-
-var _ = (json.Marshaler)(&GUID{})
-var _ = (json.Unmarshaler)(&GUID{})
-
-type GUID [16]byte
-
-func New() GUID {
-	g := GUID{}
-	_, err := io.ReadFull(rand.Reader, g[:])
-	if err != nil {
-		panic(err)
-	}
-	return g
-}
-
-func (g GUID) String() string {
-	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
-}
-
-func FromString(s string) GUID {
-	if len(s) != 36 {
-		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
-	}
-	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
-		panic("invalid GUID format")
-	}
-	indexOrder := [16]int{
-		0, 2, 4, 6,
-		9, 11,
-		14, 16,
-		19, 21,
-		24, 26, 28, 30, 32, 34,
-	}
-	byteOrder := [16]int{
-		3, 2, 1, 0,
-		5, 4,
-		7, 6,
-		8, 9,
-		10, 11, 12, 13, 14, 15,
-	}
-	var g GUID
-	for i, x := range indexOrder {
-		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
-		if err != nil {
-			panic(err)
-		}
-		g[byteOrder[i]] = byte(b)
-	}
-	return g
-}
-
-func (g GUID) MarshalJSON() ([]byte, error) {
-	return json.Marshal(g.String())
-}
-
-func (g *GUID) UnmarshalJSON(data []byte) error {
-	*g = FromString(strings.Trim(string(data), "\""))
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
index f9a922a4b..62ba81751 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
@@ -1,10 +1,13 @@
 package hcs
 
 import (
+	"fmt"
 	"sync"
 	"syscall"
 
 	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/vmcompute"
 	"github.com/sirupsen/logrus"
 )
 
@@ -40,35 +43,83 @@ var (
 )
 
 type hcsNotification uint32
+
+func (hn hcsNotification) String() string {
+	switch hn {
+	case hcsNotificationSystemExited:
+		return "SystemExited"
+	case hcsNotificationSystemCreateCompleted:
+		return "SystemCreateCompleted"
+	case hcsNotificationSystemStartCompleted:
+		return "SystemStartCompleted"
+	case hcsNotificationSystemPauseCompleted:
+		return "SystemPauseCompleted"
+	case hcsNotificationSystemResumeCompleted:
+		return "SystemResumeCompleted"
+	case hcsNotificationSystemCrashReport:
+		return "SystemCrashReport"
+	case hcsNotificationSystemSiloJobCreated:
+		return "SystemSiloJobCreated"
+	case hcsNotificationSystemSaveCompleted:
+		return "SystemSaveCompleted"
+	case hcsNotificationSystemRdpEnhancedModeStateChanged:
+		return "SystemRdpEnhancedModeStateChanged"
+	case hcsNotificationSystemShutdownFailed:
+		return "SystemShutdownFailed"
+	case hcsNotificationSystemGetPropertiesCompleted:
+		return "SystemGetPropertiesCompleted"
+	case hcsNotificationSystemModifyCompleted:
+		return "SystemModifyCompleted"
+	case hcsNotificationSystemCrashInitiated:
+		return "SystemCrashInitiated"
+	case hcsNotificationSystemGuestConnectionClosed:
+		return "SystemGuestConnectionClosed"
+	case hcsNotificationProcessExited:
+		return "ProcessExited"
+	case hcsNotificationInvalid:
+		return "Invalid"
+	case hcsNotificationServiceDisconnect:
+		return "ServiceDisconnect"
+	default:
+		return fmt.Sprintf("Unknown: %d", hn)
+	}
+}
+
 type notificationChannel chan error
 
 type notifcationWatcherContext struct {
 	channels notificationChannels
-	handle   hcsCallback
+	handle   vmcompute.HcsCallback
+
+	systemID  string
+	processID int
 }
 
 type notificationChannels map[hcsNotification]notificationChannel
 
-func newChannels() notificationChannels {
+func newSystemChannels() notificationChannels {
 	channels := make(notificationChannels)
+	for _, notif := range []hcsNotification{
+		hcsNotificationServiceDisconnect,
+		hcsNotificationSystemExited,
+		hcsNotificationSystemCreateCompleted,
+		hcsNotificationSystemStartCompleted,
+		hcsNotificationSystemPauseCompleted,
+		hcsNotificationSystemResumeCompleted,
+	} {
+		channels[notif] = make(notificationChannel, 1)
+	}
+	return channels
+}
 
-	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
-	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
-	channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
-
+func newProcessChannels() notificationChannels {
+	channels := make(notificationChannels)
+	for _, notif := range []hcsNotification{
+		hcsNotificationServiceDisconnect,
+		hcsNotificationProcessExited,
+	} {
+		channels[notif] = make(notificationChannel, 1)
+	}
 	return channels
 }
 
@@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
 		return 0
 	}
 
+	log := logrus.WithFields(logrus.Fields{
+		"notification-type": notificationType.String(),
+		"system-id":         context.systemID,
+	})
+	if context.processID != 0 {
+		log.Data[logfields.ProcessID] = context.processID
+	}
+	log.Debug("HCS notification")
+
 	if channel, ok := context.channels[notificationType]; ok {
 		channel <- result
-	} else {
-		logrus.WithFields(logrus.Fields{
-			"notification-type": notificationType,
-		}).Warn("Received a callback of an unsupported type")
 	}
 
 	return 0
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
index 079b56535..9a4705a49 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
@@ -1,14 +1,14 @@
 package hcs
 
 import (
+	"context"
 	"encoding/json"
 	"errors"
 	"fmt"
+	"net"
 	"syscall"
 
-	"github.com/Microsoft/hcsshim/internal/interop"
-	"github.com/Microsoft/hcsshim/internal/logfields"
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/log"
 )
 
 var (
@@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string {
 	return evs
 }
 
-func processHcsResult(resultp *uint16) []ErrorEvent {
-	if resultp != nil {
-		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
-		logrus.WithField(logfields.JSON, resultj).
-			Debug("HCS Result")
+func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent {
+	if resultJSON != "" {
 		result := &hcsResult{}
-		if err := json.Unmarshal([]byte(resultj), result); err != nil {
-			logrus.WithFields(logrus.Fields{
-				logfields.JSON:  resultj,
-				logrus.ErrorKey: err,
-			}).Warning("Could not unmarshal HCS result")
+		if err := json.Unmarshal([]byte(resultJSON), result); err != nil {
+			log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result")
 			return nil
 		}
 		return result.ErrorEvents
@@ -141,6 +135,8 @@ type HcsError struct {
 	Events []ErrorEvent
 }
 
+var _ net.Error = &HcsError{}
+
 func (e *HcsError) Error() string {
 	s := e.Op + ": " + e.Err.Error()
 	for _, ev := range e.Events {
@@ -149,6 +145,16 @@ func (e *HcsError) Error() string {
 	return s
 }
 
+func (e *HcsError) Temporary() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Temporary()
+}
+
+func (e *HcsError) Timeout() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Timeout()
+}
+
 // ProcessError is an error encountered in HCS during an operation on a Process object
 type ProcessError struct {
 	SystemID string
@@ -158,6 +164,8 @@ type ProcessError struct {
 	Events   []ErrorEvent
 }
 
+var _ net.Error = &ProcessError{}
+
 // SystemError is an error encountered in HCS during an operation on a Container object
 type SystemError struct {
 	ID     string
@@ -167,6 +175,8 @@ type SystemError struct {
 	Events []ErrorEvent
 }
 
+var _ net.Error = &SystemError{}
+
 func (e *SystemError) Error() string {
 	s := e.Op + " " + e.ID + ": " + e.Err.Error()
 	for _, ev := range e.Events {
@@ -178,6 +188,16 @@ func (e *SystemError) Error() string {
 	return s
 }
 
+func (e *SystemError) Temporary() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Temporary()
+}
+
+func (e *SystemError) Timeout() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Timeout()
+}
+
 func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
 	// Don't double wrap errors
 	if _, ok := err.(*SystemError); ok {
@@ -200,6 +220,16 @@ func (e *ProcessError) Error() string {
 	return s
 }
 
+func (e *ProcessError) Temporary() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Temporary()
+}
+
+func (e *ProcessError) Timeout() bool {
+	err, ok := e.Err.(net.Error)
+	return ok && err.Timeout()
+}
+
 func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
 	// Don't double wrap errors
 	if _, ok := err.(*ProcessError); ok {
@@ -242,6 +272,9 @@ func IsPending(err error) bool {
 // IsTimeout returns a boolean indicating whether the error is caused by
 // a timeout waiting for the operation to complete.
 func IsTimeout(err error) bool {
+	if err, ok := err.(net.Error); ok && err.Timeout() {
+		return true
+	}
 	err = getInnerError(err)
 	return err == ErrTimeout
 }
@@ -272,6 +305,13 @@ func IsNotSupported(err error) bool {
 		err == ErrVmcomputeUnknownMessage
 }
 
+// IsOperationInvalidState returns true when err is caused by
+// `ErrVmcomputeOperationInvalidState`.
+func IsOperationInvalidState(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationInvalidState
+}
+
 func getInnerError(err error) error {
 	switch pe := err.(type) {
 	case nil:
@@ -285,3 +325,12 @@ func getInnerError(err error) error {
 	}
 	return err
 }
+
+func getOperationLogResult(err error) (string, error) {
+	switch err {
+	case nil:
+		return "Success", nil
+	default:
+		return "Error", err
+	}
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
deleted file mode 100644
index b0d49cbcf..000000000
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
+++ /dev/null
@@ -1,48 +0,0 @@
-// Shim for the Host Compute Service (HCS) to manage Windows Server
-// containers and Hyper-V containers.
-
-package hcs
-
-import (
-	"syscall"
-)
-
-//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
-
-//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
-//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
-//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
-//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
-//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
-//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
-//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
-//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
-//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
-//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
-//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
-//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
-//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
-
-//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
-//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
-//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
-//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
-//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
-//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
-//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
-//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
-//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
-//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
-//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
-
-type hcsSystem syscall.Handle
-type hcsProcess syscall.Handle
-type hcsCallback syscall.Handle
-
-type hcsProcessInformation struct {
-	ProcessId uint32
-	Reserved  uint32
-	StdInput  syscall.Handle
-	StdOutput syscall.Handle
-	StdError  syscall.Handle
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
deleted file mode 100644
index 6d03b17a2..000000000
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
+++ /dev/null
@@ -1,20 +0,0 @@
-package hcs
-
-import "github.com/sirupsen/logrus"
-
-func logOperationBegin(ctx logrus.Fields, msg string) {
-	logrus.WithFields(ctx).Debug(msg)
-}
-
-func logOperationEnd(ctx logrus.Fields, msg string, err error) {
-	// Copy the log and fields first.
-	log := logrus.WithFields(ctx)
-	if err == nil {
-		log.Debug(msg)
-	} else {
-		// Edit only the copied field data to avoid race conditions on the
-		// write.
-		log.Data[logrus.ErrorKey] = err
-		log.Error(msg)
-	}
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
index 41e20bbf9..d366f629f 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
@@ -1,48 +1,45 @@
 package hcs
 
 import (
+	"context"
 	"encoding/json"
 	"io"
 	"sync"
 	"syscall"
 	"time"
 
-	"github.com/Microsoft/hcsshim/internal/guestrequest"
-	"github.com/Microsoft/hcsshim/internal/interop"
-	"github.com/Microsoft/hcsshim/internal/logfields"
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/log"
+	"github.com/Microsoft/hcsshim/internal/oc"
+	"github.com/Microsoft/hcsshim/internal/vmcompute"
+	"go.opencensus.io/trace"
 )
 
 // ContainerError is an error encountered in HCS
 type Process struct {
 	handleLock     sync.RWMutex
-	handle         hcsProcess
+	handle         vmcompute.HcsProcess
 	processID      int
 	system         *System
-	cachedPipes    *cachedPipes
+	stdin          io.WriteCloser
+	stdout         io.ReadCloser
+	stderr         io.ReadCloser
 	callbackNumber uintptr
 
-	logctx logrus.Fields
+	closedWaitOnce sync.Once
+	waitBlock      chan struct{}
+	exitCode       int
+	waitError      error
 }
 
-func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
+func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process {
 	return &Process{
 		handle:    process,
 		processID: processID,
 		system:    computeSystem,
-		logctx: logrus.Fields{
-			logfields.ContainerID: computeSystem.ID(),
-			logfields.ProcessID:   processID,
-		},
+		waitBlock: make(chan struct{}),
 	}
 }
 
-type cachedPipes struct {
-	stdIn  syscall.Handle
-	stdOut syscall.Handle
-	stdErr syscall.Handle
-}
-
 type processModifyRequest struct {
 	Operation   string
 	ConsoleSize *consoleSize `json:",omitempty"`
@@ -58,7 +55,7 @@ type closeHandle struct {
 	Handle string
 }
 
-type ProcessStatus struct {
+type processStatus struct {
 	ProcessID      uint32
 	Exited         bool
 	ExitCode       uint32
@@ -86,120 +83,153 @@ func (process *Process) SystemID() string {
 	return process.system.ID()
 }
 
-func (process *Process) logOperationBegin(operation string) {
-	logOperationBegin(
-		process.logctx,
-		operation+" - Begin Operation")
-}
-
-func (process *Process) logOperationEnd(operation string, err error) {
-	var result string
-	if err == nil {
-		result = "Success"
-	} else {
-		result = "Error"
+func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) {
+	switch err {
+	case nil:
+		return true, nil
+	case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound:
+		select {
+		case <-process.waitBlock:
+			// The process exit notification has already arrived.
+		default:
+			// The process should be gone, but we have not received the notification.
+			// After a second, force unblock the process wait to work around a possible
+			// deadlock in the HCS.
+			go func() {
+				time.Sleep(time.Second)
+				process.closedWaitOnce.Do(func() {
+					log.G(ctx).WithError(err).Warn("force unblocking process waits")
+					process.exitCode = -1
+					process.waitError = err
+					close(process.waitBlock)
+				})
+			}()
+		}
+		return false, nil
+	default:
+		return false, err
 	}
-
-	logOperationEnd(
-		process.logctx,
-		operation+" - End Operation - "+result,
-		err)
 }
 
 // Signal signals the process with `options`.
-func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
+//
+// For LCOW `guestrequest.SignalProcessOptionsLCOW`.
+//
+// For WCOW `guestrequest.SignalProcessOptionsWCOW`.
+func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::Signal"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
-		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+		return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
 	}
 
 	optionsb, err := json.Marshal(options)
 	if err != nil {
-		return err
+		return false, err
 	}
 
-	optionsStr := string(optionsb)
-
-	var resultp *uint16
-	syscallWatcher(process.logctx, func() {
-		err = hcsSignalProcess(process.handle, optionsStr, &resultp)
-	})
-	events := processHcsResult(resultp)
+	resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb))
+	events := processHcsResult(ctx, resultJSON)
+	delivered, err := process.processSignalResult(ctx, err)
 	if err != nil {
-		return makeProcessError(process, operation, err, events)
+		err = makeProcessError(process, operation, err, events)
 	}
-
-	return nil
+	return delivered, err
 }
 
 // Kill signals the process to terminate but does not wait for it to finish terminating.
-func (process *Process) Kill() (err error) {
+func (process *Process) Kill(ctx context.Context) (bool, error) {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::Kill"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
-		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+		return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
 	}
 
-	var resultp *uint16
-	syscallWatcher(process.logctx, func() {
-		err = hcsTerminateProcess(process.handle, &resultp)
-	})
-	events := processHcsResult(resultp)
+	resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle)
+	events := processHcsResult(ctx, resultJSON)
+	delivered, err := process.processSignalResult(ctx, err)
 	if err != nil {
-		return makeProcessError(process, operation, err, events)
+		err = makeProcessError(process, operation, err, events)
 	}
-
-	return nil
+	return delivered, err
 }
 
-// Wait waits for the process to exit.
-func (process *Process) Wait() (err error) {
-	operation := "hcsshim::Process::Wait"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
+// waitBackground waits for the process exit notification. Once received sets
+// `process.waitError` (if any) and unblocks all `Wait` calls.
+//
+// This MUST be called exactly once per `process.handle` but `Wait` is safe to
+// call multiple times.
+func (process *Process) waitBackground() {
+	operation := "hcsshim::Process::waitBackground"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	span.AddAttributes(
+		trace.StringAttribute("cid", process.SystemID()),
+		trace.Int64Attribute("pid", int64(process.processID)))
+
+	var (
+		err      error
+		exitCode = -1
+	)
 
-	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil)
 	if err != nil {
-		return makeProcessError(process, operation, err, nil)
+		err = makeProcessError(process, operation, err, nil)
+		log.G(ctx).WithError(err).Error("failed wait")
+	} else {
+		process.handleLock.RLock()
+		defer process.handleLock.RUnlock()
+
+		// Make sure we didnt race with Close() here
+		if process.handle != 0 {
+			propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle)
+			events := processHcsResult(ctx, resultJSON)
+			if err != nil {
+				err = makeProcessError(process, operation, err, events)
+			} else {
+				properties := &processStatus{}
+				err = json.Unmarshal([]byte(propertiesJSON), properties)
+				if err != nil {
+					err = makeProcessError(process, operation, err, nil)
+				} else {
+					if properties.LastWaitResult != 0 {
+						log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result")
+					} else {
+						exitCode = int(properties.ExitCode)
+					}
+				}
+			}
+		}
 	}
+	log.G(ctx).WithField("exitCode", exitCode).Debug("process exited")
 
-	return nil
+	process.closedWaitOnce.Do(func() {
+		process.exitCode = exitCode
+		process.waitError = err
+		close(process.waitBlock)
+	})
+	oc.SetSpanStatus(span, err)
 }
 
-// WaitTimeout waits for the process to exit or the duration to elapse. It returns
-// false if timeout occurs.
-func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
-	operation := "hcssshim::Process::WaitTimeout"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
-	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
-	if err != nil {
-		return makeProcessError(process, operation, err, nil)
-	}
-
-	return nil
+// Wait waits for the process to exit. If the process has already exited returns
+// the pervious error (if any).
+func (process *Process) Wait() error {
+	<-process.waitBlock
+	return process.waitError
 }
 
 // ResizeConsole resizes the console of the process.
-func (process *Process) ResizeConsole(width, height uint16) (err error) {
+func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::ResizeConsole"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
 		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
@@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
 		return err
 	}
 
-	modifyRequestStr := string(modifyRequestb)
-
-	var resultp *uint16
-	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
-	events := processHcsResult(resultp)
+	resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
 		return makeProcessError(process, operation, err, events)
 	}
@@ -230,104 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
 	return nil
 }
 
-func (process *Process) Properties() (_ *ProcessStatus, err error) {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-
-	operation := "hcsshim::Process::Properties"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
-	if process.handle == 0 {
-		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
-	}
-
-	var (
-		resultp     *uint16
-		propertiesp *uint16
-	)
-	syscallWatcher(process.logctx, func() {
-		err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
-	})
-	events := processHcsResult(resultp)
-	if err != nil {
-		return nil, makeProcessError(process, operation, err, events)
-	}
-
-	if propertiesp == nil {
-		return nil, ErrUnexpectedValue
-	}
-	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
-
-	properties := &ProcessStatus{}
-	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
-		return nil, makeProcessError(process, operation, err, nil)
-	}
-
-	return properties, nil
-}
-
 // ExitCode returns the exit code of the process. The process must have
 // already terminated.
-func (process *Process) ExitCode() (_ int, err error) {
-	operation := "hcsshim::Process::ExitCode"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
-	properties, err := process.Properties()
-	if err != nil {
-		return 0, makeProcessError(process, operation, err, nil)
-	}
-
-	if properties.Exited == false {
-		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
-	}
-
-	if properties.LastWaitResult != 0 {
-		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
+func (process *Process) ExitCode() (int, error) {
+	select {
+	case <-process.waitBlock:
+		if process.waitError != nil {
+			return -1, process.waitError
+		}
+		return process.exitCode, nil
+	default:
+		return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil)
 	}
-
-	return int(properties.ExitCode), nil
 }
 
-// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
-// these pipes does not close the underlying pipes; it should be possible to
-// call this multiple times to get multiple interfaces.
-func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; but this function can only
+// be called once on each Process.
+func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+	operation := "hcsshim::Process::StdioLegacy"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(
+		trace.StringAttribute("cid", process.SystemID()),
+		trace.Int64Attribute("pid", int64(process.processID)))
+
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
-	operation := "hcsshim::Process::Stdio"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
 	if process.handle == 0 {
 		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
 	}
 
-	var stdIn, stdOut, stdErr syscall.Handle
-
-	if process.cachedPipes == nil {
-		var (
-			processInfo hcsProcessInformation
-			resultp     *uint16
-		)
-		err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
-		events := processHcsResult(resultp)
-		if err != nil {
-			return nil, nil, nil, makeProcessError(process, operation, err, events)
-		}
-
-		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
-	} else {
-		// Use cached pipes
-		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
-
-		// Invalidate the cache
-		process.cachedPipes = nil
+	processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle)
+	events := processHcsResult(ctx, resultJSON)
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, err, events)
 	}
 
-	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
 	if err != nil {
 		return nil, nil, nil, makeProcessError(process, operation, err, nil)
 	}
@@ -335,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo
 	return pipes[0], pipes[1], pipes[2], nil
 }
 
+// Stdio returns the stdin, stdout, and stderr pipes, respectively.
+// To close them, close the process handle.
+func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) {
+	return process.stdin, process.stdout, process.stderr
+}
+
 // CloseStdin closes the write side of the stdin pipe so that the process is
 // notified on the read side that there is no more data in stdin.
-func (process *Process) CloseStdin() (err error) {
+func (process *Process) CloseStdin(ctx context.Context) error {
 	process.handleLock.RLock()
 	defer process.handleLock.RUnlock()
 
 	operation := "hcsshim::Process::CloseStdin"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
 
 	if process.handle == 0 {
 		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
@@ -361,96 +334,116 @@ func (process *Process) CloseStdin() (err error) {
 		return err
 	}
 
-	modifyRequestStr := string(modifyRequestb)
-
-	var resultp *uint16
-	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
-	events := processHcsResult(resultp)
+	resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
 		return makeProcessError(process, operation, err, events)
 	}
 
+	if process.stdin != nil {
+		process.stdin.Close()
+	}
 	return nil
 }
 
 // Close cleans up any state associated with the process but does not kill
 // or wait on it.
 func (process *Process) Close() (err error) {
+	operation := "hcsshim::Process::Close"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(
+		trace.StringAttribute("cid", process.SystemID()),
+		trace.Int64Attribute("pid", int64(process.processID)))
+
 	process.handleLock.Lock()
 	defer process.handleLock.Unlock()
 
-	operation := "hcsshim::Process::Close"
-	process.logOperationBegin(operation)
-	defer func() { process.logOperationEnd(operation, err) }()
-
 	// Don't double free this
 	if process.handle == 0 {
 		return nil
 	}
 
-	if err = process.unregisterCallback(); err != nil {
+	if process.stdin != nil {
+		process.stdin.Close()
+	}
+	if process.stdout != nil {
+		process.stdout.Close()
+	}
+	if process.stderr != nil {
+		process.stderr.Close()
+	}
+
+	if err = process.unregisterCallback(ctx); err != nil {
 		return makeProcessError(process, operation, err, nil)
 	}
 
-	if err = hcsCloseProcess(process.handle); err != nil {
+	if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil {
 		return makeProcessError(process, operation, err, nil)
 	}
 
 	process.handle = 0
+	process.closedWaitOnce.Do(func() {
+		process.exitCode = -1
+		process.waitError = ErrAlreadyClosed
+		close(process.waitBlock)
+	})
 
 	return nil
 }
 
-func (process *Process) registerCallback() error {
-	context := &notifcationWatcherContext{
-		channels: newChannels(),
+func (process *Process) registerCallback(ctx context.Context) error {
+	callbackContext := &notifcationWatcherContext{
+		channels:  newProcessChannels(),
+		systemID:  process.SystemID(),
+		processID: process.processID,
 	}
 
 	callbackMapLock.Lock()
 	callbackNumber := nextCallback
 	nextCallback++
-	callbackMap[callbackNumber] = context
+	callbackMap[callbackNumber] = callbackContext
 	callbackMapLock.Unlock()
 
-	var callbackHandle hcsCallback
-	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber)
 	if err != nil {
 		return err
 	}
-	context.handle = callbackHandle
+	callbackContext.handle = callbackHandle
 	process.callbackNumber = callbackNumber
 
 	return nil
 }
 
-func (process *Process) unregisterCallback() error {
+func (process *Process) unregisterCallback(ctx context.Context) error {
 	callbackNumber := process.callbackNumber
 
 	callbackMapLock.RLock()
-	context := callbackMap[callbackNumber]
+	callbackContext := callbackMap[callbackNumber]
 	callbackMapLock.RUnlock()
 
-	if context == nil {
+	if callbackContext == nil {
 		return nil
 	}
 
-	handle := context.handle
+	handle := callbackContext.handle
 
 	if handle == 0 {
 		return nil
 	}
 
-	// hcsUnregisterProcessCallback has its own syncronization
-	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
-	err := hcsUnregisterProcessCallback(handle)
+	// vmcompute.HcsUnregisterProcessCallback has its own synchronization to
+	// wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := vmcompute.HcsUnregisterProcessCallback(ctx, handle)
 	if err != nil {
 		return err
 	}
 
-	closeChannels(context.channels)
+	closeChannels(callbackContext.channels)
 
 	callbackMapLock.Lock()
-	callbackMap[callbackNumber] = nil
+	delete(callbackMap, callbackNumber)
 	callbackMapLock.Unlock()
 
 	handle = 0
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
index 20b242524..98df25bd5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
@@ -1,18 +1,24 @@
 package hcs
 
 import (
+	"context"
 	"encoding/json"
+	"errors"
 	"os"
 	"strconv"
+	"strings"
 	"sync"
 	"syscall"
 	"time"
 
-	"github.com/Microsoft/hcsshim/internal/interop"
-	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/cow"
+	"github.com/Microsoft/hcsshim/internal/log"
+	"github.com/Microsoft/hcsshim/internal/oc"
 	"github.com/Microsoft/hcsshim/internal/schema1"
+	hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
 	"github.com/Microsoft/hcsshim/internal/timeout"
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/vmcompute"
+	"go.opencensus.io/trace"
 )
 
 // currentContainerStarts is used to limit the number of concurrent container
@@ -38,49 +44,37 @@ func init() {
 
 type System struct {
 	handleLock     sync.RWMutex
-	handle         hcsSystem
+	handle         vmcompute.HcsSystem
 	id             string
 	callbackNumber uintptr
 
-	logctx logrus.Fields
+	closedWaitOnce sync.Once
+	waitBlock      chan struct{}
+	waitError      error
+	exitError      error
+
+	os, typ string
 }
 
 func newSystem(id string) *System {
 	return &System{
-		id: id,
-		logctx: logrus.Fields{
-			logfields.ContainerID: id,
-		},
-	}
-}
-
-func (computeSystem *System) logOperationBegin(operation string) {
-	logOperationBegin(
-		computeSystem.logctx,
-		operation+" - Begin Operation")
-}
-
-func (computeSystem *System) logOperationEnd(operation string, err error) {
-	var result string
-	if err == nil {
-		result = "Success"
-	} else {
-		result = "Error"
+		id:        id,
+		waitBlock: make(chan struct{}),
 	}
-
-	logOperationEnd(
-		computeSystem.logctx,
-		operation+" - End Operation - "+result,
-		err)
 }
 
 // CreateComputeSystem creates a new compute system with the given configuration but does not start it.
-func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
+func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) {
 	operation := "hcsshim::CreateComputeSystem"
 
+	// hcsCreateComputeSystemContext is an async operation. Start the outer span
+	// here to measure the full create time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", id))
+
 	computeSystem := newSystem(id)
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
 
 	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
 	if err != nil {
@@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System
 
 	hcsDocument := string(hcsDocumentB)
 
-	logrus.WithFields(computeSystem.logctx).
-		WithField(logfields.JSON, hcsDocument).
-		Debug("HCS ComputeSystem Document")
-
 	var (
-		resultp     *uint16
 		identity    syscall.Handle
+		resultJSON  string
 		createError error
 	)
-	syscallWatcher(computeSystem.logctx, func() {
-		createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
-	})
-
+	computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity)
 	if createError == nil || IsPending(createError) {
-		if err = computeSystem.registerCallback(); err != nil {
+		defer func() {
+			if err != nil {
+				computeSystem.Close()
+			}
+		}()
+		if err = computeSystem.registerCallback(ctx); err != nil {
 			// Terminate the compute system if it still exists. We're okay to
 			// ignore a failure here.
-			computeSystem.Terminate()
+			computeSystem.Terminate(ctx)
 			return nil, makeSystemError(computeSystem, operation, "", err, nil)
 		}
 	}
 
-	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
 	if err != nil {
 		if err == ErrTimeout {
 			// Terminate the compute system if it still exists. We're okay to
 			// ignore a failure here.
-			computeSystem.Terminate()
+			computeSystem.Terminate(ctx)
 		}
 		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
 	}
-
+	go computeSystem.waitBackground()
+	if err = computeSystem.getCachedProperties(ctx); err != nil {
+		return nil, err
+	}
 	return computeSystem, nil
 }
 
 // OpenComputeSystem opens an existing compute system by ID.
-func OpenComputeSystem(id string) (_ *System, err error) {
+func OpenComputeSystem(ctx context.Context, id string) (*System, error) {
 	operation := "hcsshim::OpenComputeSystem"
 
 	computeSystem := newSystem(id)
-	computeSystem.logOperationBegin(operation)
+	handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id)
+	events := processHcsResult(ctx, resultJSON)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+	computeSystem.handle = handle
 	defer func() {
-		if IsNotExist(err) {
-			computeSystem.logOperationEnd(operation, nil)
-		} else {
-			computeSystem.logOperationEnd(operation, err)
+		if err != nil {
+			computeSystem.Close()
 		}
 	}()
+	if err = computeSystem.registerCallback(ctx); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	go computeSystem.waitBackground()
+	if err = computeSystem.getCachedProperties(ctx); err != nil {
+		return nil, err
+	}
+	return computeSystem, nil
+}
 
-	var (
-		handle  hcsSystem
-		resultp *uint16
-	)
-	err = hcsOpenComputeSystem(id, &handle, &resultp)
-	events := processHcsResult(resultp)
+func (computeSystem *System) getCachedProperties(ctx context.Context) error {
+	props, err := computeSystem.Properties(ctx)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, operation, "", err, events)
+		return err
 	}
-
-	computeSystem.handle = handle
-
-	if err = computeSystem.registerCallback(); err != nil {
-		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	computeSystem.typ = strings.ToLower(props.SystemType)
+	computeSystem.os = strings.ToLower(props.RuntimeOSType)
+	if computeSystem.os == "" && computeSystem.typ == "container" {
+		// Pre-RS5 HCS did not return the OS, but it only supported containers
+		// that ran Windows.
+		computeSystem.os = "windows"
 	}
+	return nil
+}
 
-	return computeSystem, nil
+// OS returns the operating system of the compute system, "linux" or "windows".
+func (computeSystem *System) OS() string {
+	return computeSystem.os
+}
+
+// IsOCI returns whether processes in the compute system should be created via
+// OCI.
+func (computeSystem *System) IsOCI() bool {
+	return computeSystem.os == "linux" && computeSystem.typ == "container"
 }
 
 // GetComputeSystems gets a list of the compute systems on the system that match the query
-func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
+func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
 	operation := "hcsshim::GetComputeSystems"
-	fields := logrus.Fields{}
-	logOperationBegin(
-		fields,
-		operation+" - Begin Operation")
-
-	defer func() {
-		var result string
-		if err == nil {
-			result = "Success"
-		} else {
-			result = "Error"
-		}
-
-		logOperationEnd(
-			fields,
-			operation+" - End Operation - "+result,
-			err)
-	}()
 
 	queryb, err := json.Marshal(q)
 	if err != nil {
 		return nil, err
 	}
 
-	query := string(queryb)
-
-	logrus.WithFields(fields).
-		WithField(logfields.JSON, query).
-		Debug("HCS ComputeSystem Query")
-
-	var (
-		resultp         *uint16
-		computeSystemsp *uint16
-	)
-
-	syscallWatcher(fields, func() {
-		err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
-	})
-	events := processHcsResult(resultp)
+	computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb))
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
 		return nil, &HcsError{Op: operation, Err: err, Events: events}
 	}
 
-	if computeSystemsp == nil {
+	if computeSystemsJSON == "" {
 		return nil, ErrUnexpectedValue
 	}
-	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
 	computeSystems := []schema1.ContainerProperties{}
-	if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+	if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil {
 		return nil, err
 	}
 
@@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope
 }
 
 // Start synchronously starts the computeSystem.
-func (computeSystem *System) Start() (err error) {
+func (computeSystem *System) Start(ctx context.Context) (err error) {
+	operation := "hcsshim::System::Start"
+
+	// hcsStartComputeSystemContext is an async operation. Start the outer span
+	// here to measure the full start time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Start"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
 	// This is a very simple backoff-retry loop to limit the number
@@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) {
 		}()
 	}
 
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
+	resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "")
+	events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
 	if err != nil {
-		return makeSystemError(computeSystem, "Start", "", err, events)
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	return nil
@@ -271,360 +255,388 @@ func (computeSystem *System) ID() string {
 	return computeSystem.id
 }
 
-// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
-// it may not actually be shut down until Wait() succeeds.
-func (computeSystem *System) Shutdown() (err error) {
+// Shutdown requests a compute system shutdown.
+func (computeSystem *System) Shutdown(ctx context.Context) error {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Shutdown"
-	computeSystem.logOperationBegin(operation)
-	defer func() {
-		if IsAlreadyStopped(err) {
-			computeSystem.logOperationEnd(operation, nil)
-		} else {
-			computeSystem.logOperationEnd(operation, err)
-		}
-	}()
+	operation := "hcsshim::System::Shutdown"
 
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+		return nil
 	}
 
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events := processHcsResult(resultp)
-	if err != nil {
-		return makeSystemError(computeSystem, "Shutdown", "", err, events)
+	resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "")
+	events := processHcsResult(ctx, resultJSON)
+	switch err {
+	case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
+	default:
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
-
 	return nil
 }
 
-// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
-// it may not actually be shut down until Wait() succeeds.
-func (computeSystem *System) Terminate() (err error) {
+// Terminate requests a compute system terminate.
+func (computeSystem *System) Terminate(ctx context.Context) error {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Terminate"
-	computeSystem.logOperationBegin(operation)
-	defer func() {
-		if IsPending(err) {
-			computeSystem.logOperationEnd(operation, nil)
-		} else {
-			computeSystem.logOperationEnd(operation, err)
-		}
-	}()
+	operation := "hcsshim::System::Terminate"
 
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+		return nil
 	}
 
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events := processHcsResult(resultp)
-	if err != nil && err != ErrVmcomputeAlreadyStopped {
-		return makeSystemError(computeSystem, "Terminate", "", err, events)
+	resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "")
+	events := processHcsResult(ctx, resultJSON)
+	switch err {
+	case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
+	default:
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
-
 	return nil
 }
 
-// Wait synchronously waits for the compute system to shutdown or terminate.
-func (computeSystem *System) Wait() (err error) {
-	operation := "hcsshim::ComputeSystem::Wait"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
-	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
-	if err != nil {
-		return makeSystemError(computeSystem, "Wait", "", err, nil)
-	}
-
-	return nil
+// waitBackground waits for the compute system exit notification. Once received
+// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls.
+//
+// This MUST be called exactly once per `computeSystem.handle` but `Wait` is
+// safe to call multiple times.
+func (computeSystem *System) waitBackground() {
+	operation := "hcsshim::System::waitBackground"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
+	err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	switch err {
+	case nil:
+		log.G(ctx).Debug("system exited")
+	case ErrVmcomputeUnexpectedExit:
+		log.G(ctx).Debug("unexpected system exit")
+		computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil)
+		err = nil
+	default:
+		err = makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	computeSystem.closedWaitOnce.Do(func() {
+		computeSystem.waitError = err
+		close(computeSystem.waitBlock)
+	})
+	oc.SetSpanStatus(span, err)
 }
 
-// WaitExpectedError synchronously waits for the compute system to shutdown or
-// terminate, and ignores the passed error if it occurs.
-func (computeSystem *System) WaitExpectedError(expected error) (err error) {
-	operation := "hcsshim::ComputeSystem::WaitExpectedError"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
+// Wait synchronously waits for the compute system to shutdown or terminate. If
+// the compute system has already exited returns the previous error (if any).
+func (computeSystem *System) Wait() error {
+	<-computeSystem.waitBlock
+	return computeSystem.waitError
+}
 
-	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
-	if err != nil && getInnerError(err) != expected {
-		return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
+// ExitError returns an error describing the reason the compute system terminated.
+func (computeSystem *System) ExitError() error {
+	select {
+	case <-computeSystem.waitBlock:
+		if computeSystem.waitError != nil {
+			return computeSystem.waitError
+		}
+		return computeSystem.exitError
+	default:
+		return errors.New("container not exited")
 	}
-
-	return nil
 }
 
-// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
-// If the timeout expires, IsTimeout(err) == true
-func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
-	operation := "hcsshim::ComputeSystem::WaitTimeout"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
+// Properties returns the requested container properties targeting a V1 schema container.
+func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::System::Properties"
+
+	queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
 
-	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
+	propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
-		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
 	}
 
-	return nil
+	if propertiesJSON == "" {
+		return nil, ErrUnexpectedValue
+	}
+	properties := &schema1.ContainerProperties{}
+	if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	return properties, nil
 }
 
-func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
+// PropertiesV2 returns the requested container properties targeting a V2 schema container.
+func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Properties"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
+	operation := "hcsshim::System::PropertiesV2"
 
-	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types})
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
-	logrus.WithFields(computeSystem.logctx).
-		WithField(logfields.JSON, queryj).
-		Debug("HCS ComputeSystem Properties Query")
-
-	var resultp, propertiesp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
-	})
-	events := processHcsResult(resultp)
+	propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
 	}
 
-	if propertiesp == nil {
+	if propertiesJSON == "" {
 		return nil, ErrUnexpectedValue
 	}
-	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
-	properties := &schema1.ContainerProperties{}
-	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
-		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	properties := &hcsschema.Properties{}
+	if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
 	return properties, nil
 }
 
 // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
-func (computeSystem *System) Pause() (err error) {
+func (computeSystem *System) Pause(ctx context.Context) (err error) {
+	operation := "hcsshim::System::Pause"
+
+	// hcsPauseComputeSystemContext is an async peration. Start the outer span
+	// here to measure the full pause time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Pause"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
+	resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "")
+	events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
 	if err != nil {
-		return makeSystemError(computeSystem, "Pause", "", err, events)
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	return nil
 }
 
 // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
-func (computeSystem *System) Resume() (err error) {
+func (computeSystem *System) Resume(ctx context.Context) (err error) {
+	operation := "hcsshim::System::Resume"
+
+	// hcsResumeComputeSystemContext is an async operation. Start the outer span
+	// here to measure the full restore time.
+	ctx, span := trace.StartSpan(ctx, operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Resume"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
-	})
-	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
+	resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "")
+	events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
 	if err != nil {
-		return makeSystemError(computeSystem, "Resume", "", err, events)
+		return makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	return nil
 }
 
-// CreateProcess launches a new process within the computeSystem.
-func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
+func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::CreateProcess"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
-	var (
-		processInfo   hcsProcessInformation
-		processHandle hcsProcess
-		resultp       *uint16
-	)
-
 	if computeSystem.handle == 0 {
-		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+		return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
 	configurationb, err := json.Marshal(c)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+		return nil, nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
 	configuration := string(configurationb)
+	processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration)
+	events := processHcsResult(ctx, resultJSON)
+	if err != nil {
+		return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events)
+	}
 
-	logrus.WithFields(computeSystem.logctx).
-		WithField(logfields.JSON, configuration).
-		Debug("HCS ComputeSystem Process Document")
+	log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid")
+	return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil
+}
 
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
-	})
-	events := processHcsResult(resultp)
+// CreateProcessNoStdio launches a new process within the computeSystem. The
+// Stdio handles are not cached on the process struct.
+func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) {
+	operation := "hcsshim::System::CreateProcessNoStdio"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
+	process, processInfo, err := computeSystem.createProcess(ctx, operation, c)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+		return nil, err
 	}
+	defer func() {
+		if err != nil {
+			process.Close()
+		}
+	}()
+
+	// We don't do anything with these handles. Close them so they don't leak.
+	syscall.Close(processInfo.StdInput)
+	syscall.Close(processInfo.StdOutput)
+	syscall.Close(processInfo.StdError)
 
-	logrus.WithFields(computeSystem.logctx).
-		WithField(logfields.ProcessID, processInfo.ProcessId).
-		Debug("HCS ComputeSystem CreateProcess PID")
+	if err = process.registerCallback(ctx); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+	go process.waitBackground()
+
+	return process, nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) {
+	operation := "hcsshim::System::CreateProcess"
+	process, processInfo, err := computeSystem.createProcess(ctx, operation, c)
+	if err != nil {
+		return nil, err
+	}
+	defer func() {
+		if err != nil {
+			process.Close()
+		}
+	}()
 
-	process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
-	process.cachedPipes = &cachedPipes{
-		stdIn:  processInfo.StdInput,
-		stdOut: processInfo.StdOutput,
-		stdErr: processInfo.StdError,
+	pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
+	process.stdin = pipes[0]
+	process.stdout = pipes[1]
+	process.stderr = pipes[2]
 
-	if err = process.registerCallback(); err != nil {
-		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	if err = process.registerCallback(ctx); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
+	go process.waitBackground()
 
 	return process, nil
 }
 
 // OpenProcess gets an interface to an existing process within the computeSystem.
-func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
+func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	// Add PID for the context of this operation
-	computeSystem.logctx[logfields.ProcessID] = pid
-	defer delete(computeSystem.logctx, logfields.ProcessID)
-
-	operation := "hcsshim::ComputeSystem::OpenProcess"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
-	var (
-		processHandle hcsProcess
-		resultp       *uint16
-	)
+	operation := "hcsshim::System::OpenProcess"
 
 	if computeSystem.handle == 0 {
-		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+		return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
-	})
-	events := processHcsResult(resultp)
+	processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid))
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
-		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
 	}
 
 	process := newProcess(processHandle, pid, computeSystem)
-	if err = process.registerCallback(); err != nil {
-		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+	if err = process.registerCallback(ctx); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
 	}
+	go process.waitBackground()
 
 	return process, nil
 }
 
 // Close cleans up any state associated with the compute system but does not terminate or wait for it.
 func (computeSystem *System) Close() (err error) {
+	operation := "hcsshim::System::Close"
+	ctx, span := trace.StartSpan(context.Background(), operation)
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, err) }()
+	span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
+
 	computeSystem.handleLock.Lock()
 	defer computeSystem.handleLock.Unlock()
 
-	operation := "hcsshim::ComputeSystem::Close"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
-
 	// Don't double free this
 	if computeSystem.handle == 0 {
 		return nil
 	}
 
-	if err = computeSystem.unregisterCallback(); err != nil {
-		return makeSystemError(computeSystem, "Close", "", err, nil)
+	if err = computeSystem.unregisterCallback(ctx); err != nil {
+		return makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsCloseComputeSystem(computeSystem.handle)
-	})
+	err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle)
 	if err != nil {
-		return makeSystemError(computeSystem, "Close", "", err, nil)
+		return makeSystemError(computeSystem, operation, "", err, nil)
 	}
 
 	computeSystem.handle = 0
+	computeSystem.closedWaitOnce.Do(func() {
+		computeSystem.waitError = ErrAlreadyClosed
+		close(computeSystem.waitBlock)
+	})
 
 	return nil
 }
 
-func (computeSystem *System) registerCallback() error {
-	context := &notifcationWatcherContext{
-		channels: newChannels(),
+func (computeSystem *System) registerCallback(ctx context.Context) error {
+	callbackContext := &notifcationWatcherContext{
+		channels: newSystemChannels(),
+		systemID: computeSystem.id,
 	}
 
 	callbackMapLock.Lock()
 	callbackNumber := nextCallback
 	nextCallback++
-	callbackMap[callbackNumber] = context
+	callbackMap[callbackNumber] = callbackContext
 	callbackMapLock.Unlock()
 
-	var callbackHandle hcsCallback
-	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber)
 	if err != nil {
 		return err
 	}
-	context.handle = callbackHandle
+	callbackContext.handle = callbackHandle
 	computeSystem.callbackNumber = callbackNumber
 
 	return nil
 }
 
-func (computeSystem *System) unregisterCallback() error {
+func (computeSystem *System) unregisterCallback(ctx context.Context) error {
 	callbackNumber := computeSystem.callbackNumber
 
 	callbackMapLock.RLock()
-	context := callbackMap[callbackNumber]
+	callbackContext := callbackMap[callbackNumber]
 	callbackMapLock.RUnlock()
 
-	if context == nil {
+	if callbackContext == nil {
 		return nil
 	}
 
-	handle := context.handle
+	handle := callbackContext.handle
 
 	if handle == 0 {
 		return nil
@@ -632,15 +644,15 @@ func (computeSystem *System) unregisterCallback() error {
 
 	// hcsUnregisterComputeSystemCallback has its own syncronization
 	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
-	err := hcsUnregisterComputeSystemCallback(handle)
+	err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle)
 	if err != nil {
 		return err
 	}
 
-	closeChannels(context.channels)
+	closeChannels(callbackContext.channels)
 
 	callbackMapLock.Lock()
-	callbackMap[callbackNumber] = nil
+	delete(callbackMap, callbackNumber)
 	callbackMapLock.Unlock()
 
 	handle = 0
@@ -649,36 +661,26 @@ func (computeSystem *System) unregisterCallback() error {
 }
 
 // Modify the System by sending a request to HCS
-func (computeSystem *System) Modify(config interface{}) (err error) {
+func (computeSystem *System) Modify(ctx context.Context, config interface{}) error {
 	computeSystem.handleLock.RLock()
 	defer computeSystem.handleLock.RUnlock()
 
-	operation := "hcsshim::ComputeSystem::Modify"
-	computeSystem.logOperationBegin(operation)
-	defer func() { computeSystem.logOperationEnd(operation, err) }()
+	operation := "hcsshim::System::Modify"
 
 	if computeSystem.handle == 0 {
-		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+		return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
 	}
 
-	requestJSON, err := json.Marshal(config)
+	requestBytes, err := json.Marshal(config)
 	if err != nil {
 		return err
 	}
 
-	requestString := string(requestJSON)
-
-	logrus.WithFields(computeSystem.logctx).
-		WithField(logfields.JSON, requestString).
-		Debug("HCS ComputeSystem Modify Document")
-
-	var resultp *uint16
-	syscallWatcher(computeSystem.logctx, func() {
-		err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
-	})
-	events := processHcsResult(resultp)
+	requestJSON := string(requestBytes)
+	resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON)
+	events := processHcsResult(ctx, resultJSON)
 	if err != nil {
-		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+		return makeSystemError(computeSystem, operation, requestJSON, err, events)
 	}
 
 	return nil
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
index 91e212c57..f07f532c1 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
@@ -1,28 +1,34 @@
 package hcs
 
 import (
+	"context"
 	"time"
 
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/log"
 )
 
-func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
-	events := processHcsResult(resultp)
+func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+	events := processHcsResult(ctx, resultJSON)
 	if IsPending(err) {
-		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
+		return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout)
 	}
 
 	return events, err
 }
 
-func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
 	callbackMapLock.RLock()
+	if _, ok := callbackMap[callbackNumber]; !ok {
+		callbackMapLock.RUnlock()
+		log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap")
+		return ErrHandleClose
+	}
 	channels := callbackMap[callbackNumber].channels
 	callbackMapLock.RUnlock()
 
 	expectedChannel := channels[expectedNotification]
 	if expectedChannel == nil {
-		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification")
 		return ErrInvalidNotificationType
 	}
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
deleted file mode 100644
index f85ed3187..000000000
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
+++ /dev/null
@@ -1,41 +0,0 @@
-package hcs
-
-import (
-	"context"
-
-	"github.com/Microsoft/hcsshim/internal/logfields"
-	"github.com/Microsoft/hcsshim/internal/timeout"
-	"github.com/sirupsen/logrus"
-)
-
-// syscallWatcher is used as a very simple goroutine around calls into
-// the platform. In some cases, we have seen HCS APIs not returning due to
-// various bugs, and the goroutine making the syscall ends up not returning,
-// prior to its async callback. By spinning up a syscallWatcher, it allows
-// us to at least log a warning if a syscall doesn't complete in a reasonable
-// amount of time.
-//
-// Usage is:
-//
-// syscallWatcher(logContext, func() {
-//    err = <syscall>(args...)
-// })
-//
-
-func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
-	ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
-	defer cancel()
-	go watchFunc(ctx, logContext)
-	syscallLambda()
-}
-
-func watchFunc(ctx context.Context, logContext logrus.Fields) {
-	select {
-	case <-ctx.Done():
-		if ctx.Err() != context.Canceled {
-			logrus.WithFields(logContext).
-				WithField(logfields.Timeout, timeout.SyscallWatcher).
-				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
-		}
-	}
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
index 59ec7004c..6a1c41e15 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
@@ -3,6 +3,7 @@ package hns
 import (
 	"encoding/json"
 	"net"
+	"strings"
 
 	"github.com/sirupsen/logrus"
 )
@@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
 	return nil, EndpointNotFoundError{EndpointName: endpointName}
 }
 
+type endpointAttachInfo struct {
+	SharedContainers json.RawMessage `json:",omitempty"`
+}
+
+func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) {
+	attachInfo := endpointAttachInfo{}
+	err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo)
+
+	// Return false allows us to just return the err
+	if err != nil {
+		return false, err
+	}
+
+	if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) {
+		return true, nil
+	}
+
+	return false, nil
+
+}
+
 // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
 func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
 	operation := "Create"
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
index 969d1b263..2df4a57f5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
@@ -9,23 +9,30 @@ import (
 	"github.com/sirupsen/logrus"
 )
 
-func hnsCall(method, path, request string, returnResponse interface{}) error {
+func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) {
 	var responseBuffer *uint16
 	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
 
 	err := _hnsCall(method, path, request, &responseBuffer)
 	if err != nil {
-		return hcserror.New(err, "hnsCall ", "")
+		return nil, hcserror.New(err, "hnsCall ", "")
 	}
 	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
 
 	hnsresponse := &hnsResponse{}
 	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
-		return err
+		return nil, err
 	}
+	return hnsresponse, nil
+}
 
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	hnsresponse, err := hnsCallRawResponse(method, path, request)
+	if err != nil {
+		return fmt.Errorf("failed during hnsCallRawResponse: %v", err)
+	}
 	if !hnsresponse.Success {
-		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+		return fmt.Errorf("hns failed with error : %s", hnsresponse.Error)
 	}
 
 	if len(hnsresponse.Output) == 0 {
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
index 7e859de91..b7ae96fdd 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
@@ -2,9 +2,9 @@ package hns
 
 import (
 	"encoding/json"
-	"net"
-
+	"errors"
 	"github.com/sirupsen/logrus"
+	"net"
 )
 
 // Subnet is assoicated with a network and represents a list
@@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) {
 	title := "hcsshim::HNSNetwork::" + operation
 	logrus.Debugf(title+" id=%s", network.Id)
 
+	for _, subnet := range network.Subnets {
+		if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") {
+			return nil, errors.New("network create error, subnet has address prefix but no gateway specified")
+		}
+	}
+
 	jsonString, err := json.Marshal(network)
 	if err != nil {
 		return nil, err
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
index 2318a4fce..61da242ee 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
@@ -55,8 +55,9 @@ type PaPolicy struct {
 
 type OutboundNatPolicy struct {
 	Policy
-	VIP        string   `json:"VIP,omitempty"`
-	Exceptions []string `json:"ExceptionList,omitempty"`
+	VIP          string   `json:"VIP,omitempty"`
+	Exceptions   []string `json:"ExceptionList,omitempty"`
+	Destinations []string `json:",omitempty"`
 }
 
 type ActionType string
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
index 2f6ec029e..922f7c679 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
@@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
 	return str
 }
 
-func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
-	return []byte(ConvertAndFreeCoTaskMemString(buffer))
-}
-
 func Win32FromHresult(hr uintptr) syscall.Errno {
 	if hr&0x1fff0000 == 0x00070000 {
 		return syscall.Errno(hr & 0xffff)
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go
new file mode 100644
index 000000000..ba6b1a4a5
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go
@@ -0,0 +1,23 @@
+package log
+
+import (
+	"context"
+
+	"github.com/sirupsen/logrus"
+	"go.opencensus.io/trace"
+)
+
+// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx`
+// contains an OpenCensus `trace.Span`.
+func G(ctx context.Context) *logrus.Entry {
+	span := trace.FromContext(ctx)
+	if span != nil {
+		sctx := span.SpanContext()
+		return logrus.WithFields(logrus.Fields{
+			"traceID": sctx.TraceID.String(),
+			"spanID":  sctx.SpanID.String(),
+			// "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this?
+		})
+	}
+	return logrus.NewEntry(logrus.StandardLogger())
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go
new file mode 100644
index 000000000..f428bdaf7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go
@@ -0,0 +1,43 @@
+package oc
+
+import (
+	"github.com/sirupsen/logrus"
+	"go.opencensus.io/trace"
+)
+
+var _ = (trace.Exporter)(&LogrusExporter{})
+
+// LogrusExporter is an OpenCensus `trace.Exporter` that exports
+// `trace.SpanData` to logrus output.
+type LogrusExporter struct {
+}
+
+// ExportSpan exports `s` based on the the following rules:
+//
+// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`,
+// `s.ParentSpanID` for correlation
+//
+// 2. Any calls to .Annotate will not be supported.
+//
+// 3. The span itself will be written at `logrus.InfoLevel` unless
+// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel`
+// providing `s.Status.Message` as the error value.
+func (le *LogrusExporter) ExportSpan(s *trace.SpanData) {
+	// Combine all span annotations with traceID, spanID, parentSpanID
+	baseEntry := logrus.WithFields(logrus.Fields(s.Attributes))
+	baseEntry.Data["traceID"] = s.TraceID.String()
+	baseEntry.Data["spanID"] = s.SpanID.String()
+	baseEntry.Data["parentSpanID"] = s.ParentSpanID.String()
+	baseEntry.Data["startTime"] = s.StartTime
+	baseEntry.Data["endTime"] = s.EndTime
+	baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String()
+	baseEntry.Data["name"] = s.Name
+	baseEntry.Time = s.StartTime
+
+	level := logrus.InfoLevel
+	if s.Status.Code != 0 {
+		level = logrus.ErrorLevel
+		baseEntry.Data[logrus.ErrorKey] = s.Status.Message
+	}
+	baseEntry.Log(level, "Span")
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go
new file mode 100644
index 000000000..fee4765cb
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go
@@ -0,0 +1,17 @@
+package oc
+
+import (
+	"go.opencensus.io/trace"
+)
+
+// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If
+// `err` is `nil` assumes `trace.StatusCodeOk`.
+func SetSpanStatus(span *trace.Span, err error) {
+	status := trace.Status{}
+	if err != nil {
+		// TODO: JTERRY75 - Handle errors in a non-generic way
+		status.Code = trace.StatusCodeUnknown
+		status.Message = err.Error()
+	}
+	span.SetStatus(status)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
index 995433ace..fb23617f5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
@@ -4,7 +4,8 @@ import (
 	"encoding/json"
 	"time"
 
-	"github.com/Microsoft/hcsshim/internal/schema2"
+	"github.com/Microsoft/go-winio/pkg/guid"
+	hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
 )
 
 // ProcessConfig is used as both the input of Container.CreateProcess
@@ -62,7 +63,7 @@ type MappedVirtualDisk struct {
 	CreateInUtilityVM bool   `json:",omitempty"`
 	ReadOnly          bool   `json:",omitempty"`
 	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
-	AttachOnly        bool   `json:",omitempty:`
+	AttachOnly        bool   `json:",omitempty"`
 }
 
 // AssignedDevice represents a device that has been directly assigned to a container
@@ -133,9 +134,10 @@ type ContainerProperties struct {
 	State                        string
 	Name                         string
 	SystemType                   string
+	RuntimeOSType                string `json:"RuntimeOsType,omitempty"`
 	Owner                        string
 	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
-	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	RuntimeID                    guid.GUID                           `json:"RuntimeId,omitempty"`
 	IsRuntimeTemplate            bool                                `json:",omitempty"`
 	RuntimeImagePath             string                              `json:",omitempty"`
 	Stopped                      bool                                `json:",omitempty"`
@@ -214,6 +216,7 @@ type MappedVirtualDiskController struct {
 type GuestDefinedCapabilities struct {
 	NamespaceAddRequestSupported bool `json:",omitempty"`
 	SignalProcessSupported       bool `json:",omitempty"`
+	DumpStacksSupported          bool `json:",omitempty"`
 }
 
 // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
index 09456cbc2..bcfeb34d5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Attachment struct {
-
 	Type_ string `json:"Type,omitempty"`
 
 	Path string `json:"Path,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
index 243779eab..c1ea3953b 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type CacheQueryStatsResponse struct {
-
 	L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
 
 	L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
index 88f01707a..b4f9c315b 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type CloseHandle struct {
-
 	Handle string `json:"Handle,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go
index c665be3d5..8bf8cab60 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go
@@ -11,7 +11,6 @@ package hcsschema
 
 //  ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
 type ComPort struct {
-
 	NamedPipe string `json:"NamedPipe,omitempty"`
 
 	OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
index 85785d285..10cea67e0 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
@@ -10,14 +10,13 @@
 package hcsschema
 
 type ComputeSystem struct {
-
 	Owner string `json:"Owner,omitempty"`
 
 	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
 
 	HostingSystemId string `json:"HostingSystemId,omitempty"`
 
-	HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
+	HostedSystem interface{} `json:"HostedSystem,omitempty"`
 
 	Container *Container `json:"Container,omitempty"`
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
index 1a47db7d9..1d5dfe68a 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
@@ -25,37 +25,37 @@ func (c contextKey) String() string {
 
 var (
 	// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
-	ContextOAuth2    	= contextKey("token")
+	ContextOAuth2 = contextKey("token")
 
 	// ContextBasicAuth takes BasicAuth as authentication for the request.
-	ContextBasicAuth 	= contextKey("basic")
+	ContextBasicAuth = contextKey("basic")
 
 	// ContextAccessToken takes a string oauth2 access token as authentication for the request.
-	ContextAccessToken 	= contextKey("accesstoken")
+	ContextAccessToken = contextKey("accesstoken")
 
 	// ContextAPIKey takes an APIKey as authentication for the request
- 	ContextAPIKey 		= contextKey("apikey")
+	ContextAPIKey = contextKey("apikey")
 )
 
-// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth 
+// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth
 type BasicAuth struct {
-	UserName      string            `json:"userName,omitempty"`
-	Password      string            `json:"password,omitempty"`	
+	UserName string `json:"userName,omitempty"`
+	Password string `json:"password,omitempty"`
 }
 
 // APIKey provides API key based authentication to a request passed via context using ContextAPIKey
 type APIKey struct {
-	Key 	string
-	Prefix	string
+	Key    string
+	Prefix string
 }
 
 type Configuration struct {
-	BasePath      string            	`json:"basePath,omitempty"`
-	Host          string            	`json:"host,omitempty"`
-	Scheme        string            	`json:"scheme,omitempty"`
-	DefaultHeader map[string]string 	`json:"defaultHeader,omitempty"`
-	UserAgent     string            	`json:"userAgent,omitempty"`
-	HTTPClient 	  *http.Client
+	BasePath      string            `json:"basePath,omitempty"`
+	Host          string            `json:"host,omitempty"`
+	Scheme        string            `json:"scheme,omitempty"`
+	DefaultHeader map[string]string `json:"defaultHeader,omitempty"`
+	UserAgent     string            `json:"userAgent,omitempty"`
+	HTTPClient    *http.Client
 }
 
 func NewConfiguration() *Configuration {
@@ -69,4 +69,4 @@ func NewConfiguration() *Configuration {
 
 func (c *Configuration) AddDefaultHeader(key string, value string) {
 	c.DefaultHeader[key] = value
-}
\ No newline at end of file
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
index adbe07fe5..68aa04a57 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type ConsoleSize struct {
-
 	Height int32 `json:"Height,omitempty"`
 
 	Width int32 `json:"Width,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go
index 17dce28bc..4fb231076 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Container struct {
-
 	GuestOs *GuestOs `json:"GuestOs,omitempty"`
 
 	Storage *Storage `json:"Storage,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
index 754797e21..1fd7ca5d5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
@@ -11,7 +11,6 @@ package hcsschema
 
 //  memory usage as viewed from within the container
 type ContainerMemoryInformation struct {
-
 	TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
 
 	TotalUsage int32 `json:"TotalUsage,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go
index b2191c571..781a88401 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Devices struct {
-
 	ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
 
 	Scsi map[string]Scsi `json:"Scsi,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
index 4fe592f71..85450c41e 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type EnhancedModeVideo struct {
-
 	ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
index 51011afe4..fe86cab65 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type FlexibleIoDevice struct {
-
 	EmulatorId string `json:"EmulatorId,omitempty"`
 
 	HostingModel string `json:"HostingModel,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
index c5fa76735..af8280048 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type GuestCrashReporting struct {
-
 	WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go
index c708fc7c3..8838519a3 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type GuestOs struct {
-
 	HostName string `json:"HostName,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
index 0797584c5..ea3084bca 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type HostedSystem struct {
-
 	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
 
 	Container *Container `json:"Container,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go
index ef9ffb8dd..23b2ee9e7 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type HvSocket struct {
-
 	Config *HvSocketSystemConfig `json:"Config,omitempty"`
 
 	EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
index a19ba15c1..a017691f0 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
@@ -11,6 +11,5 @@ package hcsschema
 
 //  HvSocket configuration for a VM
 type HvSocket2 struct {
-
 	HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go
index b63b8ef12..176c49d49 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Layer struct {
-
 	Id string `json:"Id,omitempty"`
 
 	Path string `json:"Path,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go
index a823a6d3b..9b86a4045 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type MappedDirectory struct {
-
 	HostPath string `json:"HostPath,omitempty"`
 
 	HostPathType string `json:"HostPathType,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go
index 2d1d2604a..208074e9a 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type MappedPipe struct {
-
 	ContainerPipeName string `json:"ContainerPipeName,omitempty"`
 
 	HostPath string `json:"HostPath,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go
index e1d135a3a..ec93d004e 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type Memory struct {
-
 	SizeInMB int32 `json:"SizeInMB,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go
index 27d0b8c48..b4a36954d 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go
@@ -22,4 +22,9 @@ type Memory2 struct {
 
 	// EnableDeferredCommit is private in the schema. If regenerated need to add back.
 	EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"`
+
+	// EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed
+	// to the VM, allowing it to trim non-zeroed pages from the working set (if supported by
+	// the guest operating system).
+	EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go
index bdd87dffd..811779b04 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go
@@ -10,8 +10,7 @@
 package hcsschema
 
 type MemoryInformationForVm struct {
-
-	VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"`
+	VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"`
 
 	VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"`
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go
index 6214970f6..906ba597f 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go
@@ -11,10 +11,9 @@ package hcsschema
 
 //  Memory runtime statistics
 type MemoryStats struct {
+	MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
 
-	MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"`
+	MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
 
-	MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"`
-
-	MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+	MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go
index c586f66c2..a9c750b34 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type NetworkAdapter struct {
-
 	EndpointId string `json:"EndpointId,omitempty"`
 
 	MacAddress string `json:"MacAddress,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go
index 12c47827c..e5ea187a2 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Networking struct {
-
 	AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"`
 
 	DnsSearchList string `json:"DnsSearchList,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go
index 1cd70d179..d96c9501f 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go
@@ -11,6 +11,5 @@ package hcsschema
 
 //  Notification data that is indicated to components running in the Virtual Machine.
 type PauseNotification struct {
-
 	Reason string `json:"Reason,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go
index 780a5cae2..21707a88e 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go
@@ -11,7 +11,6 @@ package hcsschema
 
 //  Options for HcsPauseComputeSystem
 type PauseOptions struct {
-
 	SuspensionLevel string `json:"SuspensionLevel,omitempty"`
 
 	HostedNotification *PauseNotification `json:"HostedNotification,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go
index 705c677e1..29d8c8012 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type Plan9 struct {
-
 	Shares []Plan9Share `json:"Shares,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go
index eb171817a..41f8fdea0 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Plan9Share struct {
-
 	Name string `json:"Name,omitempty"`
 
 	//  The name by which the guest operation system can access this share, via  the aname parameter in the Plan9 protocol.
@@ -30,4 +29,6 @@ type Plan9Share struct {
 	ReadOnly bool `json:"ReadOnly,omitempty"`
 
 	UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"`
+
+	AllowedFiles []string `json:"AllowedFiles,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go
index 63e0b7f8f..e9a662dd5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go
@@ -15,7 +15,6 @@ import (
 
 //  Information about a process running in a container
 type ProcessDetails struct {
-
 	ProcessId int32 `json:"ProcessId,omitempty"`
 
 	ImageName string `json:"ImageName,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go
index 29bc2e3d0..e4ed095c7 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go
@@ -11,7 +11,6 @@ package hcsschema
 
 //  Passed to HcsRpc_ModifyProcess
 type ProcessModifyRequest struct {
-
 	Operation string `json:"Operation,omitempty"`
 
 	ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go
index 470c55734..82b0d0532 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type ProcessParameters struct {
-
 	ApplicationName string `json:"ApplicationName,omitempty"`
 
 	CommandLine string `json:"CommandLine,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go
index 20793d150..ad9a4fa9a 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go
@@ -11,7 +11,6 @@ package hcsschema
 
 //  Status of a process running in a container
 type ProcessStatus struct {
-
 	ProcessId int32 `json:"ProcessId,omitempty"`
 
 	Exited bool `json:"Exited,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go
index 7a60b0245..bb24e88da 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Processor struct {
-
 	Count int32 `json:"Count,omitempty"`
 
 	Maximum int32 `json:"Maximum,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go
index 40d3e7356..21fe46062 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Processor2 struct {
-
 	Count int32 `json:"Count,omitempty"`
 
 	Limit int32 `json:"Limit,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go
index 9d3b77e57..6157e2522 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go
@@ -11,10 +11,9 @@ package hcsschema
 
 //  CPU runtime statistics
 type ProcessorStats struct {
+	TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"`
 
-	TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"`
+	RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"`
 
-	RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"`
-
-	RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"`
+	RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go
index 6db2a48f6..17558cba0 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go
@@ -9,8 +9,11 @@
 
 package hcsschema
 
-type Properties struct {
+import (
+	v1 "github.com/containerd/cgroups/stats/v1"
+)
 
+type Properties struct {
 	Id string `json:"Id,omitempty"`
 
 	SystemType string `json:"SystemType,omitempty"`
@@ -44,4 +47,8 @@ type Properties struct {
 	SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"`
 
 	GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"`
+
+	// Metrics is not part of the API for HCS but this is used for LCOW v2 to
+	// return the full cgroup metrics from the guest.
+	Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go
index 22b92ffdf..d6d80df13 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go
@@ -9,8 +9,7 @@
 
 package hcsschema
 
-//   By default the basic properties will be returned. This query provides a way to  request specific properties. 
+//   By default the basic properties will be returned. This query provides a way to  request specific properties.
 type PropertyQuery struct {
-
-	PropertyTypes []string `json:"PropertyTypes,omitempty"`
+	PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go
new file mode 100644
index 000000000..f092b737f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go
@@ -0,0 +1,23 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type PropertyType string
+
+const (
+	PTMemory                      PropertyType = "Memory"
+	PTGuestMemory                 PropertyType = "GuestMemory"
+	PTStatistics                  PropertyType = "Statistics"
+	PTProcessList                 PropertyType = "ProcessList"
+	PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed"
+	PTSharedMemoryRegion          PropertyType = "SharedMemoryRegion"
+	PTGuestConnection             PropertyType = "GuestConnection"
+	PTICHeartbeatStatus           PropertyType = "ICHeartbeatStatus"
+)
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go
index 97e453128..8d5f5c171 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type RdpConnectionOptions struct {
-
 	AccessSids []string `json:"AccessSids,omitempty"`
 
 	NamedPipe string `json:"NamedPipe,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go
index fa574ccc8..006906f6e 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type RegistryChanges struct {
-
 	AddValues []RegistryValue `json:"AddValues,omitempty"`
 
 	DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go
index fab03bc60..26fde99c7 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type RegistryKey struct {
-
 	Hive string `json:"Hive,omitempty"`
 
 	Name string `json:"Name,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go
index 1589f4841..3f203176c 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type RegistryValue struct {
-
 	Key *RegistryKey `json:"Key,omitempty"`
 
 	Name string `json:"Name,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go
index bd573f6cd..df9baa921 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go
@@ -10,6 +10,5 @@
 package hcsschema
 
 type SharedMemoryConfiguration struct {
-
 	Regions []SharedMemoryRegion `json:"Regions,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go
index a57b2cba7..825b71865 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type SharedMemoryRegion struct {
-
 	SectionName string `json:"SectionName,omitempty"`
 
 	StartOffset int32 `json:"StartOffset,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go
index d9a50cc7d..f67b08eb5 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type SharedMemoryRegionInfo struct {
-
 	SectionName string `json:"SectionName,omitempty"`
 
 	GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go
index 599c06e8a..5eaf6a7f4 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go
@@ -11,7 +11,6 @@ package hcsschema
 
 //  Silo job information
 type SiloProperties struct {
-
 	Enabled bool `json:"Enabled,omitempty"`
 
 	JobName string `json:"JobName,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go
index 5cb3ed93b..ba7a6b396 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go
@@ -15,12 +15,11 @@ import (
 
 //  Runtime statistics for a container
 type Statistics struct {
-
 	Timestamp time.Time `json:"Timestamp,omitempty"`
 
 	ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"`
 
-	Uptime100ns int32 `json:"Uptime100ns,omitempty"`
+	Uptime100ns uint64 `json:"Uptime100ns,omitempty"`
 
 	Processor *ProcessorStats `json:"Processor,omitempty"`
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go
index 8c5255df1..9c5e6eb53 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type StorageQoS struct {
-
 	IopsMaximum int32 `json:"IopsMaximum,omitempty"`
 
 	BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go
index 198ea57d7..4f042ffd9 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go
@@ -11,12 +11,11 @@ package hcsschema
 
 //  Storage runtime statistics
 type StorageStats struct {
+	ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"`
 
-	ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"`
+	ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"`
 
-	ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"`
+	WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"`
 
-	WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"`
-
-	WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"`
+	WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"`
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go
index af2e3c823..834869940 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Topology struct {
-
 	Memory *Memory2 `json:"Memory,omitempty"`
 
 	Processor *Processor2 `json:"Processor,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go
index ba91178f9..0e48ece50 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Uefi struct {
-
 	EnableDebugger bool `json:"EnableDebugger,omitempty"`
 
 	SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go
index 6620fb2bc..3ab409d82 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type UefiBootEntry struct {
-
 	DeviceType string `json:"DeviceType,omitempty"`
 
 	DevicePath string `json:"DevicePath,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go
index 62c0e4d12..2abfccca3 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type Version struct {
-
 	Major int32 `json:"Major,omitempty"`
 
 	Minor int32 `json:"Minor,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go
index 0958e5606..ec5d0fb93 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type VideoMonitor struct {
-
 	HorizontalResolution int32 `json:"HorizontalResolution,omitempty"`
 
 	VerticalResolution int32 `json:"VerticalResolution,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go
index 48402d8ec..91a3c83d4 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualNodeInfo struct {
-
 	VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"`
 
 	PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go
index 47714444a..70cf2d90d 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualPMemDevice struct {
-
 	HostPath string `json:"HostPath,omitempty"`
 
 	ReadOnly bool `json:"ReadOnly,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go
index 76131b3a7..362df363e 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualSmb struct {
-
 	Shares []VirtualSmbShare `json:"Shares,omitempty"`
 
 	DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go
index b50098a42..915e9b638 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualSmbShare struct {
-
 	Name string `json:"Name,omitempty"`
 
 	Path string `json:"Path,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go
index c1894279d..75196bd8c 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type VirtualSmbShareOptions struct {
-
 	ReadOnly bool `json:"ReadOnly,omitempty"`
 
 	//  convert exclusive access to shared read access
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go
index 39f628667..8e1836dd6 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go
@@ -10,14 +10,13 @@
 package hcsschema
 
 type VmMemory struct {
-
 	AvailableMemory int32 `json:"AvailableMemory,omitempty"`
 
 	AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"`
 
-	ReservedMemory int32 `json:"ReservedMemory,omitempty"`
+	ReservedMemory uint64 `json:"ReservedMemory,omitempty"`
 
-	AssignedMemory int32 `json:"AssignedMemory,omitempty"`
+	AssignedMemory uint64 `json:"AssignedMemory,omitempty"`
 
 	SlpActive bool `json:"SlpActive,omitempty"`
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go
index cf632bbc8..8ed7e566d 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go
@@ -10,7 +10,6 @@
 package hcsschema
 
 type WindowsCrashReporting struct {
-
 	DumpFileName string `json:"DumpFileName,omitempty"`
 
 	MaxDumpSize int64 `json:"MaxDumpSize,omitempty"`
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go
new file mode 100644
index 000000000..7c2a0dc28
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go
@@ -0,0 +1,565 @@
+package vmcompute
+
+import (
+	gcontext "context"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/log"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/oc"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"go.opencensus.io/trace"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess?
+//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+const errVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+// HcsSystem is the handle associated with a created compute system.
+type HcsSystem syscall.Handle
+
+// HcsProcess is the handle associated with a created process in a compute
+// system.
+type HcsProcess syscall.Handle
+
+// HcsCallback is the handle associated with the function to call when events
+// occur.
+type HcsCallback syscall.Handle
+
+// HcsProcessInformation is the structure used when creating or getting process
+// info.
+type HcsProcessInformation struct {
+	// ProcessId is the pid of the created process.
+	ProcessId uint32
+	reserved  uint32
+	// StdInput is the handle associated with the stdin of the process.
+	StdInput syscall.Handle
+	// StdOutput is the handle associated with the stdout of the process.
+	StdOutput syscall.Handle
+	// StdError is the handle associated with the stderr of the process.
+	StdError syscall.Handle
+}
+
+func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error {
+	if timeout > 0 {
+		var cancel gcontext.CancelFunc
+		ctx, cancel = gcontext.WithTimeout(ctx, timeout)
+		defer cancel()
+	}
+
+	done := make(chan error, 1)
+	go func() {
+		done <- f()
+	}()
+	select {
+	case <-ctx.Done():
+		if ctx.Err() == gcontext.DeadlineExceeded {
+			log.G(ctx).WithField(logfields.Timeout, timeout).
+				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+		}
+		return ctx.Err()
+	case err := <-done:
+		return err
+	}
+}
+
+func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("query", query))
+
+	return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			computeSystemsp *uint16
+			resultp         *uint16
+		)
+		err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+		if computeSystemsp != nil {
+			computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(
+		trace.StringAttribute("id", id),
+		trace.StringAttribute("configuration", configuration))
+
+	return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error {
+		var resultp *uint16
+		err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsOpenComputeSystem(id, &computeSystem, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsCloseComputeSystem(computeSystem)
+	})
+}
+
+func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemStart, func() error {
+		var resultp *uint16
+		err := hcsStartComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsShutdownComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsTerminateComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemPause, func() error {
+		var resultp *uint16
+		err := hcsPauseComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		if hr != errVmcomputeOperationPending {
+			oc.SetSpanStatus(span, hr)
+		}
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SystemResume, func() error {
+		var resultp *uint16
+		err := hcsResumeComputeSystem(computeSystem, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
+
+	return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			propertiesp *uint16
+			resultp     *uint16
+		)
+		err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp)
+		if propertiesp != nil {
+			properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("configuration", configuration))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsModifyComputeSystem(computeSystem, configuration, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle)
+	})
+}
+
+func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsUnregisterComputeSystemCallback(callbackHandle)
+	})
+}
+
+func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCreateProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("processParameters", processParameters))
+
+	return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsOpenProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.Int64Attribute("pid", int64(pid)))
+
+	return process, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsOpenProcess(computeSystem, pid, &process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsCloseProcess")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsCloseProcess(process)
+	})
+}
+
+func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsTerminateProcess(process, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsSignalProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("options", options))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsSignalProcess(process, options, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsGetProcessInfo(process, &processInformation, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+
+	return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			processPropertiesp *uint16
+			resultp            *uint16
+		)
+		err := hcsGetProcessProperties(process, &processPropertiesp, &resultp)
+		if processPropertiesp != nil {
+			processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsModifyProcess")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("settings", settings))
+
+	return result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var resultp *uint16
+		err := hcsModifyProcess(process, settings, &resultp)
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties")
+	defer span.End()
+	defer func() {
+		if result != "" {
+			span.AddAttributes(trace.StringAttribute("result", result))
+		}
+		oc.SetSpanStatus(span, hr)
+	}()
+	span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
+
+	return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
+		var (
+			propertiesp *uint16
+			resultp     *uint16
+		)
+		err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp)
+		if propertiesp != nil {
+			properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
+		}
+		if resultp != nil {
+			result = interop.ConvertAndFreeCoTaskMemString(resultp)
+		}
+		return err
+	})
+}
+
+func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsRegisterProcessCallback(process, callback, context, &callbackHandle)
+	})
+}
+
+func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
+	ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback")
+	defer span.End()
+	defer func() { oc.SetSpanStatus(span, hr) }()
+
+	return execute(ctx, timeout.SyscallWatcher, func() error {
+		return hcsUnregisterProcessCallback(callbackHandle)
+	})
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go
index fcd5cdc87..0f2a69f6a 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go
@@ -1,6 +1,6 @@
 // Code generated mksyscall_windows.exe DO NOT EDIT
 
-package hcs
+package vmcompute
 
 import (
 	"syscall"
@@ -56,13 +56,13 @@ var (
 	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
 	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
 	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
-
-	procHcsGetProcessInfo            = modvmcompute.NewProc("HcsGetProcessInfo")
-	procHcsGetProcessProperties      = modvmcompute.NewProc("HcsGetProcessProperties")
-	procHcsModifyProcess             = modvmcompute.NewProc("HcsModifyProcess")
-	procHcsGetServiceProperties      = modvmcompute.NewProc("HcsGetServiceProperties")
-	procHcsRegisterProcessCallback   = modvmcompute.NewProc("HcsRegisterProcessCallback")
-	procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+	procHcsSignalProcess                   = modvmcompute.NewProc("HcsSignalProcess")
+	procHcsGetProcessInfo                  = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties            = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess                   = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties            = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback         = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback       = modvmcompute.NewProc("HcsUnregisterProcessCallback")
 )
 
 func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
@@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result
 	return
 }
 
-func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(id)
 	if hr != nil {
@@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha
 	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
 }
 
-func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
 	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall
 	return
 }
 
-func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(id)
 	if hr != nil {
@@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16)
 	return _hcsOpenComputeSystem(_p0, computeSystem, result)
 }
 
-func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) {
 	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16
 	return
 }
 
-func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) {
 	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
 	return
 }
 
-func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin
 	return _hcsStartComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsStartComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u
 	return
 }
 
-func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **
 	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result
 	return
 }
 
-func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result *
 	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result
 	return
 }
 
-func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin
 	return _hcsPauseComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u
 	return
 }
 
-func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui
 	return _hcsResumeComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
 	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **
 	return
 }
 
-func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
 	if hr != nil {
@@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string
 	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
 }
 
-func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
 	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
 		return
 	}
@@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint
 	return
 }
 
-func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(configuration)
 	if hr != nil {
@@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul
 	return _hcsModifyComputeSystem(computeSystem, _p0, result)
 }
 
-func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) {
 	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
 		return
 	}
@@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res
 	return
 }
 
-func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
 	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
 		return
 	}
@@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr,
 	return
 }
 
-func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) {
 	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
 		return
 	}
@@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
 	return
 }
 
-func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(processParameters)
 	if hr != nil {
@@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process
 	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
 }
 
-func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
 	if hr = procHcsCreateProcess.Find(); hr != nil {
 		return
 	}
@@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce
 	return
 }
 
-func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) {
 	if hr = procHcsOpenProcess.Find(); hr != nil {
 		return
 	}
@@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re
 	return
 }
 
-func hcsCloseProcess(process hcsProcess) (hr error) {
+func hcsCloseProcess(process HcsProcess) (hr error) {
 	if hr = procHcsCloseProcess.Find(); hr != nil {
 		return
 	}
@@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) {
 	return
 }
 
-func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) {
 	if hr = procHcsTerminateProcess.Find(); hr != nil {
 		return
 	}
@@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
 	return
 }
 
-func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
+func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(options)
 	if hr != nil {
@@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e
 	return _hcsSignalProcess(process, _p0, result)
 }
 
-func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsTerminateProcess.Find(); hr != nil {
+func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsSignalProcess.Find(); hr != nil {
 		return
 	}
-	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
 	if int32(r0) < 0 {
 		if r0&0x1fff0000 == 0x00070000 {
 			r0 &= 0xffff
@@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr
 	return
 }
 
-func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) {
 	if hr = procHcsGetProcessInfo.Find(); hr != nil {
 		return
 	}
@@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma
 	return
 }
 
-func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) {
 	if hr = procHcsGetProcessProperties.Find(); hr != nil {
 		return
 	}
@@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res
 	return
 }
 
-func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) {
 	var _p0 *uint16
 	_p0, hr = syscall.UTF16PtrFromString(settings)
 	if hr != nil {
@@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr
 	return _hcsModifyProcess(process, _p0, result)
 }
 
-func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) {
 	if hr = procHcsModifyProcess.Find(); hr != nil {
 		return
 	}
@@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result
 	return
 }
 
-func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
 	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
 		return
 	}
@@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui
 	return
 }
 
-func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) {
 	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
 		return
 	}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go
index 651676fb2..b3b431e35 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go
@@ -1,7 +1,13 @@
 package wclayer
 
 import (
+	"os"
+	"path/filepath"
+	"syscall"
+	"unsafe"
+
 	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/osversion"
 	"github.com/sirupsen/logrus"
 )
 
@@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) {
 	if err != nil {
 		return hcserror.New(err, title+" - failed", "")
 	}
+
+	// Manually expand the volume now in order to work around bugs in 19H1 and
+	// prerelease versions of Vb. Remove once this is fixed in Windows.
+	if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 {
+		err = expandSandboxVolume(path)
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+type virtualStorageType struct {
+	DeviceID uint32
+	VendorID [16]byte
+}
+
+type openVersion2 struct {
+	GetInfoOnly    int32    // bool but 4-byte aligned
+	ReadOnly       int32    // bool but 4-byte aligned
+	ResiliencyGUID [16]byte // GUID
+}
+
+type openVirtualDiskParameters struct {
+	Version  uint32 // Must always be set to 2
+	Version2 openVersion2
+}
+
+func attachVhd(path string) (syscall.Handle, error) {
+	var (
+		defaultType virtualStorageType
+		handle      syscall.Handle
+	)
+	parameters := openVirtualDiskParameters{Version: 2}
+	err := openVirtualDisk(
+		&defaultType,
+		path,
+		0,
+		0,
+		&parameters,
+		&handle)
+	if err != nil {
+		return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err}
+	}
+	err = attachVirtualDisk(handle, 0, 0, 0, 0, 0)
+	if err != nil {
+		syscall.Close(handle)
+		return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err}
+	}
+	return handle, nil
+}
+
+func expandSandboxVolume(path string) error {
+	// Mount the sandbox VHD temporarily.
+	vhdPath := filepath.Join(path, "sandbox.vhdx")
+	vhd, err := attachVhd(vhdPath)
+	if err != nil {
+		return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err}
+	}
+	defer syscall.Close(vhd)
+
+	// Open the volume.
+	volumePath, err := GetLayerMountPath(path)
+	if err != nil {
+		return err
+	}
+	if volumePath[len(volumePath)-1] == '\\' {
+		volumePath = volumePath[:len(volumePath)-1]
+	}
+	volume, err := os.OpenFile(volumePath, os.O_RDWR, 0)
+	if err != nil {
+		return err
+	}
+	defer volume.Close()
+
+	// Get the volume's underlying partition size in NTFS clusters.
+	var (
+		partitionSize int64
+		bytes         uint32
+	)
+	const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C
+	err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil)
+	if err != nil {
+		return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err}
+	}
+	const (
+		clusterSize = 4096
+		sectorSize  = 512
+	)
+	targetClusters := partitionSize / clusterSize
+
+	// Get the volume's current size in NTFS clusters.
+	var volumeSize int64
+	err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil)
+	if err != nil {
+		return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err}
+	}
+	volumeClusters := volumeSize / clusterSize
+
+	// Only resize the volume if there is space to grow, otherwise this will
+	// fail with invalid parameter. NTFS reserves one cluster.
+	if volumeClusters+1 < targetClusters {
+		targetSectors := targetClusters * (clusterSize / sectorSize)
+		const _FSCTL_EXTEND_VOLUME = 0x000900F0
+		err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil)
+		if err != nil {
+			return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err}
+		}
+	}
 	return nil
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go
index 90df3bedc..443596fba 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go
@@ -3,7 +3,7 @@ package wclayer
 import (
 	"path/filepath"
 
-	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/go-winio/pkg/guid"
 )
 
 // LayerID returns the layer ID of a layer on disk.
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go
index 6d0ae8a07..06671309d 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go
@@ -6,7 +6,7 @@ package wclayer
 import (
 	"syscall"
 
-	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/go-winio/pkg/guid"
 	"github.com/sirupsen/logrus"
 )
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go
index 45a63cf65..a259c1b82 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go
@@ -1,7 +1,7 @@
 package wclayer
 
 import (
-	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/go-winio/pkg/guid"
 	"github.com/Microsoft/hcsshim/internal/hcserror"
 	"github.com/sirupsen/logrus"
 )
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go
index 78f2aacd8..dc40bf519 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go
@@ -1,6 +1,6 @@
 package wclayer
 
-import "github.com/Microsoft/hcsshim/internal/guid"
+import "github.com/Microsoft/go-winio/pkg/guid"
 
 //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go
 
@@ -24,4 +24,9 @@ import "github.com/Microsoft/hcsshim/internal/guid"
 
 //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess?
 
+//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk
+//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk
+
+//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW
+
 type _guid = guid.GUID
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go
index d853ab259..67f917f07 100644
--- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go
@@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error {
 
 var (
 	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+	modvirtdisk  = windows.NewLazySystemDLL("virtdisk.dll")
+	modkernel32  = windows.NewLazySystemDLL("kernel32.dll")
 
 	procActivateLayer       = modvmcompute.NewProc("ActivateLayer")
 	procCopyLayer           = modvmcompute.NewProc("CopyLayer")
@@ -57,6 +59,9 @@ var (
 	procProcessBaseImage    = modvmcompute.NewProc("ProcessBaseImage")
 	procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage")
 	procGrantVmAccess       = modvmcompute.NewProc("GrantVmAccess")
+	procOpenVirtualDisk     = modvirtdisk.NewProc("OpenVirtualDisk")
+	procAttachVirtualDisk   = modvirtdisk.NewProc("AttachVirtualDisk")
+	procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW")
 )
 
 func activateLayer(info *driverInfo, id string) (hr error) {
@@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) {
 	}
 	return
 }
+
+func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(path)
+	if err != nil {
+		return
+	}
+	return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle)
+}
+
+func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) {
+	r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle)))
+	if r1 != 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) {
+	r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped))
+	if r1 != 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(directoryName)
+	if err != nil {
+		return
+	}
+	return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes)
+}
+
+func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go
index df0e63bbd..f60ba5501 100644
--- a/vendor/github.com/Microsoft/hcsshim/layer.go
+++ b/vendor/github.com/Microsoft/hcsshim/layer.go
@@ -4,7 +4,7 @@ import (
 	"crypto/sha1"
 	"path/filepath"
 
-	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/go-winio/pkg/guid"
 	"github.com/Microsoft/hcsshim/internal/wclayer"
 )
 
@@ -77,7 +77,7 @@ type GUID [16]byte
 
 func NameToGuid(name string) (id GUID, err error) {
 	g, err := wclayer.NameToGuid(name)
-	return GUID(g), err
+	return g.ToWindowsArray(), err
 }
 
 func NewGUID(source string) *GUID {
@@ -88,7 +88,7 @@ func NewGUID(source string) *GUID {
 }
 
 func (g *GUID) ToString() string {
-	return (guid.GUID)(*g).String()
+	return guid.FromWindowsArray(*g).String()
 }
 
 type LayerReader = wclayer.LayerReader
diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go
index 916950c02..477fe7078 100644
--- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go
+++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go
@@ -46,6 +46,12 @@ func Get() OSVersion {
 	return osv
 }
 
+// Build gets the build-number on Windows
+// The calling application must be manifested to get the correct version information.
+func Build() uint16 {
+	return Get().Build
+}
+
 func (osv OSVersion) ToString() string {
 	return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build)
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go
index 2d9567f6f..3488cc451 100644
--- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go
+++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go
@@ -1,10 +1,27 @@
 package osversion
 
 const (
-
-	// RS2 was a client-only release in case you're asking why it's not in the list.
+	// RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server
+	// 2016 (ltsc2016) and Windows 10 (Anniversary Update).
 	RS1 = 14393
+
+	// RS2 (version 1703, codename "Redstone 2") was a client-only update, and
+	// corresponds to Windows 10 (Creators Update).
+	RS2 = 15063
+
+	// RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server
+	// 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update).
 	RS3 = 16299
+
+	// RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server
+	// 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update).
 	RS4 = 17134
+
+	// RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server
+	// 2019 (ltsc2019), and Windows 10 (October 2018 Update).
 	RS5 = 17763
+
+	// V19H1 (version 1903) corresponds to Windows Sever 1903 (semi-annual
+	// channel).
+	V19H1 = 18362
 )
diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go
index ca8acbb7c..3362c6833 100644
--- a/vendor/github.com/Microsoft/hcsshim/process.go
+++ b/vendor/github.com/Microsoft/hcsshim/process.go
@@ -1,7 +1,9 @@
 package hcsshim
 
 import (
+	"context"
 	"io"
+	"sync"
 	"time"
 
 	"github.com/Microsoft/hcsshim/internal/hcs"
@@ -9,7 +11,10 @@ import (
 
 // ContainerError is an error encountered in HCS
 type process struct {
-	p *hcs.Process
+	p        *hcs.Process
+	waitOnce sync.Once
+	waitCh   chan struct{}
+	waitErr  error
 }
 
 // Pid returns the process ID of the process within the container.
@@ -19,7 +24,14 @@ func (process *process) Pid() int {
 
 // Kill signals the process to terminate but does not wait for it to finish terminating.
 func (process *process) Kill() error {
-	return convertProcessError(process.p.Kill(), process)
+	found, err := process.p.Kill(context.Background())
+	if err != nil {
+		return convertProcessError(err, process)
+	}
+	if !found {
+		return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"}
+	}
+	return nil
 }
 
 // Wait waits for the process to exit.
@@ -30,7 +42,21 @@ func (process *process) Wait() error {
 // WaitTimeout waits for the process to exit or the duration to elapse. It returns
 // false if timeout occurs.
 func (process *process) WaitTimeout(timeout time.Duration) error {
-	return convertProcessError(process.p.WaitTimeout(timeout), process)
+	process.waitOnce.Do(func() {
+		process.waitCh = make(chan struct{})
+		go func() {
+			process.waitErr = process.Wait()
+			close(process.waitCh)
+		}()
+	})
+	t := time.NewTimer(timeout)
+	defer t.Stop()
+	select {
+	case <-t.C:
+		return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"}
+	case <-process.waitCh:
+		return process.waitErr
+	}
 }
 
 // ExitCode returns the exit code of the process. The process must have
@@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) {
 
 // ResizeConsole resizes the console of the process.
 func (process *process) ResizeConsole(width, height uint16) error {
-	return convertProcessError(process.p.ResizeConsole(width, height), process)
+	return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process)
 }
 
 // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
 // these pipes does not close the underlying pipes; it should be possible to
 // call this multiple times to get multiple interfaces.
 func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
-	stdin, stdout, stderr, err := process.p.Stdio()
+	stdin, stdout, stderr, err := process.p.StdioLegacy()
 	if err != nil {
 		err = convertProcessError(err, process)
 	}
@@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e
 // CloseStdin closes the write side of the stdin pipe so that the process is
 // notified on the read side that there is no more data in stdin.
 func (process *process) CloseStdin() error {
-	return convertProcessError(process.p.CloseStdin(), process)
+	return convertProcessError(process.p.CloseStdin(context.Background()), process)
 }
 
 // Close cleans up any state associated with the process but does not kill
diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf
deleted file mode 100644
index 6e0ed1566..000000000
--- a/vendor/github.com/Microsoft/hcsshim/vendor.conf
+++ /dev/null
@@ -1,21 +0,0 @@
-github.com/blang/semver v3.1.0
-github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23
-github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3
-github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55
-github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f
-github.com/konsorten/go-windows-terminal-sequences v1.0.1
-github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c
-github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2
-github.com/Microsoft/opengcs v0.3.9
-github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353
-github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88
-github.com/pkg/errors v0.8.1
-github.com/sirupsen/logrus v1.3.0
-github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16
-github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c
-github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6
-github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b
-github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874
-golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908
-golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f
-golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb
\ No newline at end of file