diff options
author | OpenShift Merge Robot <openshift-merge-robot@users.noreply.github.com> | 2019-01-11 05:39:12 -0800 |
---|---|---|
committer | GitHub <noreply@github.com> | 2019-01-11 05:39:12 -0800 |
commit | b3eb23d671425775673f86bd02b9c89ef781f590 (patch) | |
tree | 5f06e4e289f16d9164d692590a3fe6541b5384cf /vendor/github.com/Microsoft/hcsshim | |
parent | 26f2b7debde313af4a5ae39727c66a3f8fd59be4 (diff) | |
parent | bd40dcfc2bc7c9014ea1f33482fb63aacbcdfe87 (diff) | |
download | podman-b3eb23d671425775673f86bd02b9c89ef781f590.tar.gz podman-b3eb23d671425775673f86bd02b9c89ef781f590.tar.bz2 podman-b3eb23d671425775673f86bd02b9c89ef781f590.zip |
Merge pull request #2102 from vrothberg/vendor-update
vendor: update everything
Diffstat (limited to 'vendor/github.com/Microsoft/hcsshim')
164 files changed, 7842 insertions, 3967 deletions
diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md index 30991a12e..15b39181a 100644 --- a/vendor/github.com/Microsoft/hcsshim/README.md +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -1,12 +1,41 @@ # hcsshim -This package supports launching Windows Server containers from Go. It is -primarily used in the [Docker Engine](https://github.com/docker/docker) project, -but it can be freely used by other projects as well. - -This project has adopted the [Microsoft Open Source Code of -Conduct](https://opensource.microsoft.com/codeofconduct/). For more information -see the [Code of Conduct -FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact -[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional -questions or comments. +[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master) + +This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS). + +It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well. + +## Contributing + +This project welcomes contributions and suggestions. Most contributions require you to agree to a +Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us +the rights to use your contribution. For details, visit https://cla.microsoft.com. + +When you submit a pull request, a CLA-bot will automatically determine whether you need to provide +a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions +provided by the bot. You will only need to do this once across all repos using our CLA. + +This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). +For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or +contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. + +## Dependencies + +This project requires Golang 1.9 or newer to build. + +For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements). + +## Reporting Security Issues + +Security issues and bugs should be reported privately, via email, to the Microsoft Security +Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should +receive a response within 24 hours. If for some reason you do not, please follow up via +email to ensure we received your original message. Further information, including the +[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in +the [Security TechCenter](https://technet.microsoft.com/en-us/security/default). + +For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet + +--------------- +Copyright (c) 2018 Microsoft Corp. All rights reserved. diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go deleted file mode 100644 index 6d824d7a7..000000000 --- a/vendor/github.com/Microsoft/hcsshim/activatelayer.go +++ /dev/null @@ -1,28 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// ActivateLayer will find the layer with the given id and mount it's filesystem. -// For a read/write layer, the mounted filesystem will appear as a volume on the -// host, while a read-only layer is generally expected to be a no-op. -// An activated layer must later be deactivated via DeactivateLayer. -func ActivateLayer(info DriverInfo, id string) error { - title := "hcsshim::ActivateLayer " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = activateLayer(&infop, id) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index b924d39f4..e142c3154 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,794 +1,192 @@ package hcsshim import ( - "encoding/json" "fmt" "os" - "sync" - "syscall" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/mergemaps" + "github.com/Microsoft/hcsshim/internal/schema1" ) -var ( - defaultTimeout = time.Minute * 4 -) - -const ( - pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}` - statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}` - processListQuery = `{ "PropertyTypes" : ["ProcessList"]}` - mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}` -) - -type container struct { - handleLock sync.RWMutex - handle hcsSystem - id string - callbackNumber uintptr -} - // ContainerProperties holds the properties for a container and the processes running in that container -type ContainerProperties struct { - ID string `json:"Id"` - Name string - SystemType string - Owner string - SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` - IsRuntimeTemplate bool `json:",omitempty"` - RuntimeImagePath string `json:",omitempty"` - Stopped bool `json:",omitempty"` - ExitType string `json:",omitempty"` - AreUpdatesPending bool `json:",omitempty"` - ObRoot string `json:",omitempty"` - Statistics Statistics `json:",omitempty"` - ProcessList []ProcessListItem `json:",omitempty"` - MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` -} +type ContainerProperties = schema1.ContainerProperties // MemoryStats holds the memory statistics for a container -type MemoryStats struct { - UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` -} +type MemoryStats = schema1.MemoryStats // ProcessorStats holds the processor statistics for a container -type ProcessorStats struct { - TotalRuntime100ns uint64 `json:",omitempty"` - RuntimeUser100ns uint64 `json:",omitempty"` - RuntimeKernel100ns uint64 `json:",omitempty"` -} +type ProcessorStats = schema1.ProcessorStats // StorageStats holds the storage statistics for a container -type StorageStats struct { - ReadCountNormalized uint64 `json:",omitempty"` - ReadSizeBytes uint64 `json:",omitempty"` - WriteCountNormalized uint64 `json:",omitempty"` - WriteSizeBytes uint64 `json:",omitempty"` -} +type StorageStats = schema1.StorageStats // NetworkStats holds the network statistics for a container -type NetworkStats struct { - BytesReceived uint64 `json:",omitempty"` - BytesSent uint64 `json:",omitempty"` - PacketsReceived uint64 `json:",omitempty"` - PacketsSent uint64 `json:",omitempty"` - DroppedPacketsIncoming uint64 `json:",omitempty"` - DroppedPacketsOutgoing uint64 `json:",omitempty"` - EndpointId string `json:",omitempty"` - InstanceId string `json:",omitempty"` -} +type NetworkStats = schema1.NetworkStats // Statistics is the structure returned by a statistics call on a container -type Statistics struct { - Timestamp time.Time `json:",omitempty"` - ContainerStartTime time.Time `json:",omitempty"` - Uptime100ns uint64 `json:",omitempty"` - Memory MemoryStats `json:",omitempty"` - Processor ProcessorStats `json:",omitempty"` - Storage StorageStats `json:",omitempty"` - Network []NetworkStats `json:",omitempty"` -} +type Statistics = schema1.Statistics // ProcessList is the structure of an item returned by a ProcessList call on a container -type ProcessListItem struct { - CreateTimestamp time.Time `json:",omitempty"` - ImageName string `json:",omitempty"` - KernelTime100ns uint64 `json:",omitempty"` - MemoryCommitBytes uint64 `json:",omitempty"` - MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` - MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` - ProcessId uint32 `json:",omitempty"` - UserTime100ns uint64 `json:",omitempty"` -} +type ProcessListItem = schema1.ProcessListItem // MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container -type MappedVirtualDiskController struct { - MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` -} +type MappedVirtualDiskController = schema1.MappedVirtualDiskController // Type of Request Support in ModifySystem -type RequestType string +type RequestType = schema1.RequestType // Type of Resource Support in ModifySystem -type ResourceType string +type ResourceType = schema1.ResourceType // RequestType const const ( - Add RequestType = "Add" - Remove RequestType = "Remove" - Network ResourceType = "Network" + Add = schema1.Add + Remove = schema1.Remove + Network = schema1.Network ) // ResourceModificationRequestResponse is the structure used to send request to the container to modify the system // Supported resource types are Network and Request Types are Add/Remove -type ResourceModificationRequestResponse struct { - Resource ResourceType `json:"ResourceType"` - Data interface{} `json:"Settings"` - Request RequestType `json:"RequestType,omitempty"` +type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse + +type container struct { + system *hcs.System } -// createContainerAdditionalJSON is read from the environment at initialisation +// createComputeSystemAdditionalJSON is read from the environment at initialisation // time. It allows an environment variable to define additional JSON which -// is merged in the CreateContainer call to HCS. -var createContainerAdditionalJSON string +// is merged in the CreateComputeSystem call to HCS. +var createContainerAdditionalJSON []byte func init() { - createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON") + createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")) } // CreateContainer creates a new container with the given configuration but does not start it. func CreateContainer(id string, c *ContainerConfig) (Container, error) { - return createContainerWithJSON(id, c, "") -} - -// CreateContainerWithJSON creates a new container with the given configuration but does not start it. -// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS. -func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { - return createContainerWithJSON(id, c, additionalJSON) -} - -func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { - operation := "CreateContainer" - title := "HCSShim::" + operation - - container := &container{ - id: id, - } - - configurationb, err := json.Marshal(c) + fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON) if err != nil { - return nil, err + return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - configuration := string(configurationb) - logrus.Debugf(title+" id=%s config=%s", id, configuration) - - // Merge any additional JSON. Priority is given to what is passed in explicitly, - // falling back to what's set in the environment. - if additionalJSON == "" && createContainerAdditionalJSON != "" { - additionalJSON = createContainerAdditionalJSON - } - if additionalJSON != "" { - configurationMap := map[string]interface{}{} - if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil { - return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err) - } - - additionalMap := map[string]interface{}{} - if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil { - return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err) - } - - mergedMap := mergeMaps(additionalMap, configurationMap) - mergedJSON, err := json.Marshal(mergedMap) - if err != nil { - return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err) - } - - configuration = string(mergedJSON) - logrus.Debugf(title+" id=%s merged config=%s", id, configuration) - } - - var ( - resultp *uint16 - identity syscall.Handle - ) - createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp) - - if createError == nil || IsPending(createError) { - if err := container.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) - } - } - - err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout) + system, err := hcs.CreateComputeSystem(id, fullConfig) if err != nil { - return nil, makeContainerError(container, operation, configuration, err) - } - - logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle) - return container, nil -} - -// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values -// in ToMap are overwritten. Values in fromMap are added to ToMap. -// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang -func mergeMaps(fromMap, ToMap interface{}) interface{} { - switch fromMap := fromMap.(type) { - case map[string]interface{}: - ToMap, ok := ToMap.(map[string]interface{}) - if !ok { - return fromMap - } - for keyToMap, valueToMap := range ToMap { - if valueFromMap, ok := fromMap[keyToMap]; ok { - fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap) - } else { - fromMap[keyToMap] = valueToMap - } - } - case nil: - // merge(nil, map[string]interface{...}) -> map[string]interface{...} - ToMap, ok := ToMap.(map[string]interface{}) - if ok { - return ToMap - } + return nil, err } - return fromMap + return &container{system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - operation := "OpenContainer" - title := "HCSShim::" + operation - logrus.Debugf(title+" id=%s", id) - - container := &container{ - id: id, - } - - var ( - handle hcsSystem - resultp *uint16 - ) - err := hcsOpenComputeSystem(id, &handle, &resultp) - err = processHcsResult(err, resultp) + system, err := hcs.OpenComputeSystem(id) if err != nil { - return nil, makeContainerError(container, operation, "", err) - } - - container.handle = handle - - if err := container.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, err } - - logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) - return container, nil + return &container{system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - operation := "GetContainers" - title := "HCSShim::" + operation - - queryb, err := json.Marshal(q) - if err != nil { - return nil, err - } - - query := string(queryb) - logrus.Debugf(title+" query=%s", query) - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, err - } - - if computeSystemsp == nil { - return nil, ErrUnexpectedValue - } - computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp) - computeSystems := []ContainerProperties{} - if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { - return nil, err - } - - logrus.Debugf(title + " succeeded") - return computeSystems, nil + return hcs.GetComputeSystems(q) } // Start synchronously starts the container. func (container *container) Start() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Start" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsStartComputeSystem(container.handle, "", &resultp) - err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Start(), container) } -// Shutdown requests a container shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. +// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Shutdown" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsShutdownComputeSystem(container.handle, "", &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Shutdown(), container) } -// Terminate requests a container terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. +// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Terminate" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsTerminateComputeSystem(container.handle, "", &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Terminate(), container) } -// Wait synchronously waits for the container to shutdown or terminate. +// Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - operation := "Wait" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Wait(), container) } -// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (container *container) WaitTimeout(timeout time.Duration) error { - operation := "WaitTimeout" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It +// returns false if timeout occurs. +func (container *container) WaitTimeout(t time.Duration) error { + return convertSystemError(container.system.WaitTimeout(t), container) } -func (container *container) properties(query string) (*ContainerProperties, error) { - var ( - resultp *uint16 - propertiesp *uint16 - ) - err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, err - } +// Pause pauses the execution of a container. +func (container *container) Pause() error { + return convertSystemError(container.system.Pause(), container) +} - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) - properties := &ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, err - } - return properties, nil +// Resume resumes the execution of a container. +func (container *container) Resume() error { + return convertSystemError(container.system.Resume(), container) } // HasPendingUpdates returns true if the container has updates pending to install func (container *container) HasPendingUpdates() (bool, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "HasPendingUpdates" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return false, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(pendingUpdatesQuery) - if err != nil { - return false, makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return properties.AreUpdatesPending, nil + return false, nil } -// Statistics returns statistics for the container +// Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Statistics" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(statisticsQuery) + properties, err := container.system.Properties(schema1.PropertyTypeStatistics) if err != nil { - return Statistics{}, makeContainerError(container, operation, "", err) + return Statistics{}, convertSystemError(err, container) } - logrus.Debugf(title+" succeeded id=%s", container.id) return properties.Statistics, nil } -// ProcessList returns an array of ProcessListItems for the container +// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "ProcessList" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(processListQuery) + properties, err := container.system.Properties(schema1.PropertyTypeProcessList) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - logrus.Debugf(title+" succeeded id=%s", container.id) return properties.ProcessList, nil } -// MappedVirtualDisks returns a map of the controllers and the disks mapped -// to a container. -// -// Example of JSON returned by the query. -//{ -// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm", -// "SystemType":"Container", -// "RuntimeOsType":"Linux", -// "RuntimeId":"00000000-0000-0000-0000-000000000000", -// "State":"Running", -// "MappedVirtualDiskControllers":{ -// "0":{ -// "MappedVirtualDisks":{ -// "2":{ -// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx", -// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch", -// "Lun":2, -// "CreateInUtilityVM":true -// }, -// "3":{ -// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx", -// "Lun":3, -// "CreateInUtilityVM":true, -// "AttachOnly":true -// } -// } -// } -// } -//} +// This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "MappedVirtualDiskList" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(mappedVirtualDiskQuery) + properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - logrus.Debugf(title+" succeeded id=%s", container.id) return properties.MappedVirtualDiskControllers, nil } -// Pause pauses the execution of the container. This feature is not enabled in TP5. -func (container *container) Pause() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Pause" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsPauseComputeSystem(container.handle, "", &resultp) - err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil -} - -// Resume resumes the execution of the container. This feature is not enabled in TP5. -func (container *container) Resume() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Resume" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsResumeComputeSystem(container.handle, "", &resultp) - err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil -} - // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "CreateProcess" - title := "HCSShim::Container::" + operation - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - // If we are not emulating a console, ignore any console size passed to us - if !c.EmulateConsole { - c.ConsoleSize[0] = 0 - c.ConsoleSize[1] = 0 - } - - configurationb, err := json.Marshal(c) + p, err := container.system.CreateProcess(c) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - - configuration := string(configurationb) - logrus.Debugf(title+" id=%s config=%s", container.id, configuration) - - err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, makeContainerError(container, operation, configuration, err) - } - - process := &process{ - handle: processHandle, - processID: int(processInfo.ProcessId), - container: container, - cachedPipes: &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, - }, - } - - if err := process.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID) - return process, nil + return &process{p}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "OpenProcess" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s, processid=%d", container.id, pid) - var ( - processHandle hcsProcess - resultp *uint16 - ) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp) - err = processHcsResult(err, resultp) + p, err := container.system.OpenProcess(pid) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - - process := &process{ - handle: processHandle, - processID: pid, - container: container, - } - - if err := process.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) - return process, nil + return &process{p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. func (container *container) Close() error { - container.handleLock.Lock() - defer container.handleLock.Unlock() - operation := "Close" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - // Don't double free this - if container.handle == 0 { - return nil - } - - if err := container.unregisterCallback(); err != nil { - return makeContainerError(container, operation, "", err) - } - - if err := hcsCloseComputeSystem(container.handle); err != nil { - return makeContainerError(container, operation, "", err) - } - - container.handle = 0 - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil -} - -func (container *container) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), - } - - callbackMapLock.Lock() - callbackNumber := nextCallback - nextCallback++ - callbackMap[callbackNumber] = context - callbackMapLock.Unlock() - - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) - if err != nil { - return err - } - context.handle = callbackHandle - container.callbackNumber = callbackNumber - - return nil -} - -func (container *container) unregisterCallback() error { - callbackNumber := container.callbackNumber - - callbackMapLock.RLock() - context := callbackMap[callbackNumber] - callbackMapLock.RUnlock() - - if context == nil { - return nil - } - - handle := context.handle - - if handle == 0 { - return nil - } - - // hcsUnregisterComputeSystemCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) - if err != nil { - return err - } - - closeChannels(context.channels) - - callbackMapLock.Lock() - callbackMap[callbackNumber] = nil - callbackMapLock.Unlock() - - handle = 0 - - return nil + return convertSystemError(container.system.Close(), container) } -// Modifies the System by sending a request to HCS +// Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Modify" - title := "HCSShim::Container::" + operation - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - requestJSON, err := json.Marshal(config) - if err != nil { - return err - } - - requestString := string(requestJSON) - logrus.Debugf(title+" id=%s request=%s", container.id, requestString) - - var resultp *uint16 - err = hcsModifyComputeSystem(container.handle, requestString, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeContainerError(container, operation, "", err) - } - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Modify(config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go deleted file mode 100644 index 035d9c394..000000000 --- a/vendor/github.com/Microsoft/hcsshim/createlayer.go +++ /dev/null @@ -1,27 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// CreateLayer creates a new, empty, read-only layer on the filesystem based on -// the parent layer provided. -func CreateLayer(info DriverInfo, id, parent string) error { - title := "hcsshim::CreateLayer " - logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = createLayer(&infop, id, parent) - if err != nil { - err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go deleted file mode 100644 index 7a6a8854c..000000000 --- a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go +++ /dev/null @@ -1,35 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// CreateSandboxLayer creates and populates new read-write layer for use by a container. -// This requires both the id of the direct parent layer, as well as the full list -// of paths to all parent layers up to the base (and including the direct parent -// whose id was provided). -func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { - title := "hcsshim::CreateSandboxLayer " - logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId) - - // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) - if err != nil { - return err - } - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = createSandboxLayer(&infop, layerId, parentId, layers) - if err != nil { - err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go deleted file mode 100644 index fd785030f..000000000 --- a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go +++ /dev/null @@ -1,26 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. -func DeactivateLayer(info DriverInfo, id string) error { - title := "hcsshim::DeactivateLayer " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = deactivateLayer(&infop, id) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go deleted file mode 100644 index b1e3b89fc..000000000 --- a/vendor/github.com/Microsoft/hcsshim/destroylayer.go +++ /dev/null @@ -1,27 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// DestroyLayer will remove the on-disk files representing the layer with the given -// id, including that layer's containing folder, if any. -func DestroyLayer(info DriverInfo, id string) error { - title := "hcsshim::DestroyLayer " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = destroyLayer(&infop, id) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go index d2f9cc8bd..63efa23c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -1,83 +1,91 @@ package hcsshim import ( - "errors" "fmt" "syscall" + + "github.com/Microsoft/hcsshim/internal/hns" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/hcserror" ) var ( - // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists - ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist + ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist // ErrElementNotFound is an error encountered when the object being referenced does not exist - ErrElementNotFound = syscall.Errno(0x490) + ErrElementNotFound = hcs.ErrElementNotFound // ErrElementNotFound is an error encountered when the object being referenced does not exist - ErrNotSupported = syscall.Errno(0x32) + ErrNotSupported = hcs.ErrNotSupported // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported // decimal -2147024883 / hex 0x8007000d - ErrInvalidData = syscall.Errno(0xd) + ErrInvalidData = hcs.ErrInvalidData // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed - ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + ErrHandleClose = hcs.ErrHandleClose // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method - ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + ErrAlreadyClosed = hcs.ErrAlreadyClosed // ErrInvalidNotificationType is an error encountered when an invalid notification type is used - ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + ErrInvalidNotificationType = hcs.ErrInvalidNotificationType // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation - ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + ErrInvalidProcessState = hcs.ErrInvalidProcessState // ErrTimeout is an error encountered when waiting on a notification times out - ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + ErrTimeout = hcs.ErrTimeout // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for // a different expected notification - ErrUnexpectedContainerExit = errors.New("unexpected container exit") + ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service // is lost while waiting for a notification - ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort // ErrUnexpectedValue is an error encountered when hcs returns an invalid value - ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + ErrUnexpectedValue = hcs.ErrUnexpectedValue // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container - ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously - ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation - ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState // ErrProcNotFound is an error encountered when the the process cannot be found - ErrProcNotFound = syscall.Errno(0x7f) + ErrProcNotFound = hcs.ErrProcNotFound // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. - ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management - ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message - ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage // ErrNotSupported is an error encountered when hcs doesn't support the request - ErrPlatformNotSupported = errors.New("unsupported platform request") + ErrPlatformNotSupported = hcs.ErrPlatformNotSupported ) +type EndpointNotFoundError = hns.EndpointNotFoundError +type NetworkNotFoundError = hns.NetworkNotFoundError + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { Process *process Operation string ExtraInfo string Err error + Events []hcs.ErrorEvent } // ContainerError is an error encountered in HCS during an operation on a Container object @@ -86,6 +94,7 @@ type ContainerError struct { Operation string ExtraInfo string Err error + Events []hcs.ErrorEvent } func (e *ContainerError) Error() string { @@ -97,7 +106,7 @@ func (e *ContainerError) Error() string { return "unexpected nil container for error: " + e.Err.Error() } - s := "container " + e.Container.id + s := "container " + e.Container.system.ID() if e.Operation != "" { s += " encountered an error during " + e.Operation @@ -107,11 +116,15 @@ func (e *ContainerError) Error() string { case nil: break case syscall.Errno: - s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) default: s += fmt.Sprintf(": %s", e.Err.Error()) } + for _, ev := range e.Events { + s += "\n" + ev.String() + } + if e.ExtraInfo != "" { s += " extra info: " + e.ExtraInfo } @@ -137,12 +150,7 @@ func (e *ProcessError) Error() string { return "Unexpected nil process for error: " + e.Err.Error() } - s := fmt.Sprintf("process %d", e.Process.processID) - - if e.Process.container != nil { - s += " in container " + e.Process.container.id - } - + s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID()) if e.Operation != "" { s += " encountered an error during " + e.Operation } @@ -151,11 +159,15 @@ func (e *ProcessError) Error() string { case nil: break case syscall.Errno: - s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) default: s += fmt.Sprintf(": %s", e.Err.Error()) } + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s } @@ -173,31 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsNotExist(err error) bool { - err = getInnerError(err) - return err == ErrComputeSystemDoesNotExist || - err == ErrElementNotFound || - err == ErrProcNotFound + if _, ok := err.(EndpointNotFoundError); ok { + return true + } + if _, ok := err.(NetworkNotFoundError); ok { + return true + } + return hcs.IsNotExist(getInnerError(err)) } // IsAlreadyClosed checks if an error is caused by the Container or Process having been // already closed by a call to the Close() method. func IsAlreadyClosed(err error) bool { - err = getInnerError(err) - return err == ErrAlreadyClosed + return hcs.IsAlreadyClosed(getInnerError(err)) } // IsPending returns a boolean indicating whether the error is that // the requested operation is being completed in the background. func IsPending(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationPending + return hcs.IsPending(getInnerError(err)) } // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { - err = getInnerError(err) - return err == ErrTimeout + return hcs.IsTimeout(getInnerError(err)) } // IsAlreadyStopped returns a boolean indicating whether the error is caused by @@ -206,10 +218,7 @@ func IsTimeout(err error) bool { // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsAlreadyStopped(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeAlreadyStopped || - err == ErrElementNotFound || - err == ErrProcNotFound + return hcs.IsAlreadyStopped(getInnerError(err)) } // IsNotSupported returns a boolean indicating whether the error is caused by @@ -218,12 +227,7 @@ func IsAlreadyStopped(err error) bool { // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // is thrown from the Platform func IsNotSupported(err error) bool { - err = getInnerError(err) - // If Platform doesn't recognize or support the request sent, below errors are seen - return err == ErrVmcomputeInvalidJSON || - err == ErrInvalidData || - err == ErrNotSupported || - err == ErrVmcomputeUnknownMessage + return hcs.IsNotSupported(getInnerError(err)) } func getInnerError(err error) error { @@ -237,3 +241,17 @@ func getInnerError(err error) error { } return err } + +func convertSystemError(err error, c *container) error { + if serr, ok := err.(*hcs.SystemError); ok { + return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events} + } + return err +} + +func convertProcessError(err error, p *process) error { + if perr, ok := err.(*hcs.ProcessError); ok { + return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events} + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go deleted file mode 100644 index 6946c6a84..000000000 --- a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go +++ /dev/null @@ -1,26 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// ExpandSandboxSize expands the size of a layer to at least size bytes. -func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { - title := "hcsshim::ExpandSandboxSize " - logrus.Debugf(title+"layerId=%s size=%d", layerId, size) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = expandSandboxSize(&infop, layerId, size) - if err != nil { - err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go deleted file mode 100644 index d7025f20b..000000000 --- a/vendor/github.com/Microsoft/hcsshim/exportlayer.go +++ /dev/null @@ -1,156 +0,0 @@ -package hcsshim - -import ( - "io" - "io/ioutil" - "os" - "syscall" - - "github.com/Microsoft/go-winio" - "github.com/sirupsen/logrus" -) - -// ExportLayer will create a folder at exportFolderPath and fill that folder with -// the transport format version of the layer identified by layerId. This transport -// format includes any metadata required for later importing the layer (using -// ImportLayer), and requires the full list of parent layer paths in order to -// perform the export. -func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { - title := "hcsshim::ExportLayer " - logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) - - // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) - if err != nil { - return err - } - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = exportLayer(&infop, layerId, exportFolderPath, layers) - if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath) - return nil -} - -type LayerReader interface { - Next() (string, int64, *winio.FileBasicInfo, error) - Read(b []byte) (int, error) - Close() error -} - -// FilterLayerReader provides an interface for extracting the contents of an on-disk layer. -type FilterLayerReader struct { - context uintptr -} - -// Next reads the next available file from a layer, ensuring that parent directories are always read -// before child files and directories. -// -// Next returns the file's relative path, size, and basic file metadata. Read() should be used to -// extract a Win32 backup stream with the remainder of the metadata and the data. -func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) { - var fileNamep *uint16 - fileInfo := &winio.FileBasicInfo{} - var deleted uint32 - var fileSize int64 - err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted) - if err != nil { - if err == syscall.ERROR_NO_MORE_FILES { - err = io.EOF - } else { - err = makeError(err, "ExportLayerNext", "") - } - return "", 0, nil, err - } - fileName := convertAndFreeCoTaskMemString(fileNamep) - if deleted != 0 { - fileInfo = nil - } - if fileName[0] == '\\' { - fileName = fileName[1:] - } - return fileName, fileSize, fileInfo, nil -} - -// Read reads from the current file's Win32 backup stream. -func (r *FilterLayerReader) Read(b []byte) (int, error) { - var bytesRead uint32 - err := exportLayerRead(r.context, b, &bytesRead) - if err != nil { - return 0, makeError(err, "ExportLayerRead", "") - } - if bytesRead == 0 { - return 0, io.EOF - } - return int(bytesRead), nil -} - -// Close frees resources associated with the layer reader. It will return an -// error if there was an error while reading the layer or of the layer was not -// completely read. -func (r *FilterLayerReader) Close() (err error) { - if r.context != 0 { - err = exportLayerEnd(r.context) - if err != nil { - err = makeError(err, "ExportLayerEnd", "") - } - r.context = 0 - } - return -} - -// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. -// The caller must have taken the SeBackupPrivilege privilege -// to call this and any methods on the resulting LayerReader. -func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { - if procExportLayerBegin.Find() != nil { - // The new layer reader is not available on this Windows build. Fall back to the - // legacy export code path. - path, err := ioutil.TempDir("", "hcs") - if err != nil { - return nil, err - } - err = ExportLayer(info, layerID, path, parentLayerPaths) - if err != nil { - os.RemoveAll(path) - return nil, err - } - return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil - } - - layers, err := layerPathsToDescriptors(parentLayerPaths) - if err != nil { - return nil, err - } - infop, err := convertDriverInfo(info) - if err != nil { - return nil, err - } - r := &FilterLayerReader{} - err = exportLayerBegin(&infop, layerID, layers, &r.context) - if err != nil { - return nil, makeError(err, "ExportLayerBegin", "") - } - return r, err -} - -type legacyLayerReaderWrapper struct { - *legacyLayerReader -} - -func (r *legacyLayerReaderWrapper) Close() error { - err := r.legacyLayerReader.Close() - os.RemoveAll(r.root) - return err -} diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go deleted file mode 100644 index 620aba123..000000000 --- a/vendor/github.com/Microsoft/hcsshim/guid.go +++ /dev/null @@ -1,19 +0,0 @@ -package hcsshim - -import ( - "crypto/sha1" - "fmt" -) - -type GUID [16]byte - -func NewGUID(source string) *GUID { - h := sha1.Sum([]byte(source)) - var g GUID - copy(g[0:], h[0:16]) - return &g -} - -func (g *GUID) ToString() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go index 236ba1fa3..ceb3ac85e 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcsshim.go +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -4,80 +4,20 @@ package hcsshim import ( - "fmt" "syscall" - "unsafe" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hcserror" ) -//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go +//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go -//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId -//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? -//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? -//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? -//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? -//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? -//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? -//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? -//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? -//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? -//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? -//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? -//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? -//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid? -//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? -//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? -//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? -//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? - -//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? -//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? -//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? -//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? - -//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? -//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? -//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? -//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? - -//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? - const ( // Specific user-visible exit codes WaitErrExecFailed = 32767 - ERROR_GEN_FAILURE = syscall.Errno(31) + ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) WSAEINVAL = syscall.Errno(10022) @@ -85,82 +25,4 @@ const ( TimeoutInfinite = 0xFFFFFFFF ) -type HcsError struct { - title string - rest string - Err error -} - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} - -func makeError(err error, title, rest string) error { - // Pass through DLL errors directly since they do not originate from HCS. - if _, ok := err.(*syscall.DLLError); ok { - return err - } - return &HcsError{title, rest, err} -} - -func makeErrorf(err error, title, format string, a ...interface{}) error { - return makeError(err, title, fmt.Sprintf(format, a...)) -} - -func win32FromError(err error) uint32 { - if herr, ok := err.(*HcsError); ok { - return win32FromError(herr.Err) - } - if code, ok := err.(syscall.Errno); ok { - return uint32(code) - } - return uint32(ERROR_GEN_FAILURE) -} - -func win32FromHresult(hr uintptr) uintptr { - if hr&0x1fff0000 == 0x00070000 { - return hr & 0xffff - } - return hr -} - -func (e *HcsError) Error() string { - s := e.title - if len(s) > 0 && s[len(s)-1] != ' ' { - s += " " - } - s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) - if e.rest != "" { - if e.rest[0] != ' ' { - s += " " - } - s += e.rest - } - return s -} - -func convertAndFreeCoTaskMemString(buffer *uint16) string { - str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:]) - coTaskMemFree(unsafe.Pointer(buffer)) - return str -} - -func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(convertAndFreeCoTaskMemString(buffer)) -} - -func processHcsResult(err error, resultp *uint16) error { - if resultp != nil { - result := convertAndFreeCoTaskMemString(resultp) - logrus.Debugf("Result: %s", result) - } - return err -} +type HcsError = hcserror.HcsError diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index 92afc0c24..eb013d2c4 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -1,318 +1,94 @@ -package hcsshim
-
-import (
- "encoding/json"
- "fmt"
- "net"
-
- "github.com/sirupsen/logrus"
-)
-
-// HNSEndpoint represents a network endpoint in HNS
-type HNSEndpoint struct {
- Id string `json:"ID,omitempty"`
- Name string `json:",omitempty"`
- VirtualNetwork string `json:",omitempty"`
- VirtualNetworkName string `json:",omitempty"`
- Policies []json.RawMessage `json:",omitempty"`
- MacAddress string `json:",omitempty"`
- IPAddress net.IP `json:",omitempty"`
- DNSSuffix string `json:",omitempty"`
- DNSServerList string `json:",omitempty"`
- GatewayAddress string `json:",omitempty"`
- EnableInternalDNS bool `json:",omitempty"`
- DisableICC bool `json:",omitempty"`
- PrefixLength uint8 `json:",omitempty"`
- IsRemoteEndpoint bool `json:",omitempty"`
-}
-
-//SystemType represents the type of the system on which actions are done
-type SystemType string
-
-// SystemType const
-const (
- ContainerType SystemType = "Container"
- VirtualMachineType SystemType = "VirtualMachine"
- HostType SystemType = "Host"
-)
-
-// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
-// Supported resource types are Network and Request Types are Add/Remove
-type EndpointAttachDetachRequest struct {
- ContainerID string `json:"ContainerId,omitempty"`
- SystemType SystemType `json:"SystemType"`
- CompartmentID uint16 `json:"CompartmentId,omitempty"`
- VirtualNICName string `json:"VirtualNicName,omitempty"`
-}
-
-// EndpointResquestResponse is object to get the endpoint request response
-type EndpointResquestResponse struct {
- Success bool
- Error string
-}
-
-// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
-func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
- endpoint := &HNSEndpoint{}
- err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
- if err != nil {
- return nil, err
- }
-
- return endpoint, nil
-}
-
-// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
-func HNSListEndpointRequest() ([]HNSEndpoint, error) {
- var endpoint []HNSEndpoint
- err := hnsCall("GET", "/endpoints/", "", &endpoint)
- if err != nil {
- return nil, err
- }
-
- return endpoint, nil
-}
-
-// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
-func HotAttachEndpoint(containerID string, endpointID string) error {
- return modifyNetworkEndpoint(containerID, endpointID, Add)
-}
-
-// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
-func HotDetachEndpoint(containerID string, endpointID string) error {
- return modifyNetworkEndpoint(containerID, endpointID, Remove)
-}
-
-// ModifyContainer corresponding to the container id, by sending a request
-func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
- container, err := OpenContainer(id)
- if err != nil {
- if IsNotExist(err) {
- return ErrComputeSystemDoesNotExist
- }
- return getInnerError(err)
- }
- defer container.Close()
- err = container.Modify(request)
- if err != nil {
- if IsNotSupported(err) {
- return ErrPlatformNotSupported
- }
- return getInnerError(err)
- }
-
- return nil
-}
-
-func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
- requestMessage := &ResourceModificationRequestResponse{
- Resource: Network,
- Request: request,
- Data: endpointID,
- }
- err := modifyContainer(containerID, requestMessage)
-
- if err != nil {
- return err
- }
-
- return nil
-}
-
-// GetHNSEndpointByID get the Endpoint by ID
-func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
- return HNSEndpointRequest("GET", endpointID, "")
-}
-
-// GetHNSEndpointByName gets the endpoint filtered by Name
-func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
- hnsResponse, err := HNSListEndpointRequest()
- if err != nil {
- return nil, err
- }
- for _, hnsEndpoint := range hnsResponse {
- if hnsEndpoint.Name == endpointName {
- return &hnsEndpoint, nil
- }
- }
- return nil, fmt.Errorf("Endpoint %v not found", endpointName)
-}
-
-// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
-func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
- operation := "Create"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
-
- jsonString, err := json.Marshal(endpoint)
- if err != nil {
- return nil, err
- }
- return HNSEndpointRequest("POST", "", string(jsonString))
-}
-
-// Delete Endpoint by sending EndpointRequest to HNS
-func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
- operation := "Delete"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
-
- return HNSEndpointRequest("DELETE", endpoint.Id, "")
-}
-
-// Update Endpoint
-func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
- operation := "Update"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
- jsonString, err := json.Marshal(endpoint)
- if err != nil {
- return nil, err
- }
- err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
-
- return endpoint, err
-}
-
-// ContainerHotAttach attaches an endpoint to a running container
-func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
- operation := "ContainerHotAttach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
-
- return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
-}
-
-// ContainerHotDetach detaches an endpoint from a running container
-func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
- operation := "ContainerHotDetach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
-
- return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
-}
-
-// ApplyACLPolicy applies Acl Policy on the Endpoint
-func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error {
- operation := "ApplyACLPolicy"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
-
- jsonString, err := json.Marshal(policy)
- if err != nil {
- return err
- }
- endpoint.Policies[0] = jsonString
- _, err = endpoint.Update()
- return err
-}
-
-// ContainerAttach attaches an endpoint to container
-func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
- operation := "ContainerAttach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
-
- requestMessage := &EndpointAttachDetachRequest{
- ContainerID: containerID,
- CompartmentID: compartmentID,
- SystemType: ContainerType,
- }
- response := &EndpointResquestResponse{}
- jsonString, err := json.Marshal(requestMessage)
- if err != nil {
- return err
- }
- return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
-}
-
-// ContainerDetach detaches an endpoint from container
-func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
- operation := "ContainerDetach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
-
- requestMessage := &EndpointAttachDetachRequest{
- ContainerID: containerID,
- SystemType: ContainerType,
- }
- response := &EndpointResquestResponse{}
-
- jsonString, err := json.Marshal(requestMessage)
- if err != nil {
- return err
- }
- return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
-}
-
-// HostAttach attaches a nic on the host
-func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
- operation := "HostAttach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
- requestMessage := &EndpointAttachDetachRequest{
- CompartmentID: compartmentID,
- SystemType: HostType,
- }
- response := &EndpointResquestResponse{}
-
- jsonString, err := json.Marshal(requestMessage)
- if err != nil {
- return err
- }
- return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
-
-}
-
-// HostDetach detaches a nic on the host
-func (endpoint *HNSEndpoint) HostDetach() error {
- operation := "HostDetach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
- requestMessage := &EndpointAttachDetachRequest{
- SystemType: HostType,
- }
- response := &EndpointResquestResponse{}
-
- jsonString, err := json.Marshal(requestMessage)
- if err != nil {
- return err
- }
- return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
-}
-
-// VirtualMachineNICAttach attaches a endpoint to a virtual machine
-func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
- operation := "VirtualMachineNicAttach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
- requestMessage := &EndpointAttachDetachRequest{
- VirtualNICName: virtualMachineNICName,
- SystemType: VirtualMachineType,
- }
- response := &EndpointResquestResponse{}
-
- jsonString, err := json.Marshal(requestMessage)
- if err != nil {
- return err
- }
- return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
-}
-
-// VirtualMachineNICDetach detaches a endpoint from a virtual machine
-func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
- operation := "VirtualMachineNicDetach"
- title := "HCSShim::HNSEndpoint::" + operation
- logrus.Debugf(title+" id=%s", endpoint.Id)
-
- requestMessage := &EndpointAttachDetachRequest{
- SystemType: VirtualMachineType,
- }
- response := &EndpointResquestResponse{}
-
- jsonString, err := json.Marshal(requestMessage)
- if err != nil {
- return err
- }
- return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
-}
+package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint = hns.HNSEndpoint + +// Namespace represents a Compartment. +type Namespace = hns.Namespace + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse = hns.EndpointResquestResponse + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + return hns.HNSEndpointRequest(method, path, request) +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + return hns.HNSListEndpointRequest() +} + +// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container +func HotAttachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Add) +} + +// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container +func HotDetachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Remove) +} + +// ModifyContainer corresponding to the container id, by sending a request +func modifyContainer(id string, request *ResourceModificationRequestResponse) error { + container, err := OpenContainer(id) + if err != nil { + if IsNotExist(err) { + return ErrComputeSystemDoesNotExist + } + return getInnerError(err) + } + defer container.Close() + err = container.Modify(request) + if err != nil { + if IsNotSupported(err) { + return ErrPlatformNotSupported + } + return getInnerError(err) + } + + return nil +} + +func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { + requestMessage := &ResourceModificationRequestResponse{ + Resource: Network, + Request: request, + Data: endpointID, + } + err := modifyContainer(containerID, requestMessage) + + if err != nil { + return err + } + + return nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return hns.GetHNSEndpointByID(endpointID) +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + return hns.GetHNSEndpointByName(endpointName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go new file mode 100644 index 000000000..2b5381904 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go @@ -0,0 +1,16 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSGlobals = hns.HNSGlobals +type HNSVersion = hns.HNSVersion + +var ( + HNSVersion1803 = hns.HNSVersion1803 +) + +func GetHNSGlobals() (*HNSGlobals, error) { + return hns.GetHNSGlobals() +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go index 3345bfa3f..f775fa1d0 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -1,142 +1,36 @@ -package hcsshim
-
-import (
- "encoding/json"
- "fmt"
- "net"
-
- "github.com/sirupsen/logrus"
-)
-
-// Subnet is assoicated with a network and represents a list
-// of subnets available to the network
-type Subnet struct {
- AddressPrefix string `json:",omitempty"`
- GatewayAddress string `json:",omitempty"`
- Policies []json.RawMessage `json:",omitempty"`
-}
-
-// MacPool is assoicated with a network and represents a list
-// of macaddresses available to the network
-type MacPool struct {
- StartMacAddress string `json:",omitempty"`
- EndMacAddress string `json:",omitempty"`
-}
-
-// HNSNetwork represents a network in HNS
-type HNSNetwork struct {
- Id string `json:"ID,omitempty"`
- Name string `json:",omitempty"`
- Type string `json:",omitempty"`
- NetworkAdapterName string `json:",omitempty"`
- SourceMac string `json:",omitempty"`
- Policies []json.RawMessage `json:",omitempty"`
- MacPools []MacPool `json:",omitempty"`
- Subnets []Subnet `json:",omitempty"`
- DNSSuffix string `json:",omitempty"`
- DNSServerList string `json:",omitempty"`
- DNSServerCompartment uint32 `json:",omitempty"`
- ManagementIP string `json:",omitempty"`
- AutomaticDNS bool `json:",omitempty"`
-}
-
-type hnsNetworkResponse struct {
- Success bool
- Error string
- Output HNSNetwork
-}
-
-type hnsResponse struct {
- Success bool
- Error string
- Output json.RawMessage
-}
-
-// HNSNetworkRequest makes a call into HNS to update/query a single network
-func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
- var network HNSNetwork
- err := hnsCall(method, "/networks/"+path, request, &network)
- if err != nil {
- return nil, err
- }
-
- return &network, nil
-}
-
-// HNSListNetworkRequest makes a HNS call to query the list of available networks
-func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
- var network []HNSNetwork
- err := hnsCall(method, "/networks/"+path, request, &network)
- if err != nil {
- return nil, err
- }
-
- return network, nil
-}
-
-// GetHNSNetworkByID
-func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
- return HNSNetworkRequest("GET", networkID, "")
-}
-
-// GetHNSNetworkName filtered by Name
-func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
- hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
- if err != nil {
- return nil, err
- }
- for _, hnsnetwork := range hsnnetworks {
- if hnsnetwork.Name == networkName {
- return &hnsnetwork, nil
- }
- }
- return nil, fmt.Errorf("Network %v not found", networkName)
-}
-
-// Create Network by sending NetworkRequest to HNS.
-func (network *HNSNetwork) Create() (*HNSNetwork, error) {
- operation := "Create"
- title := "HCSShim::HNSNetwork::" + operation
- logrus.Debugf(title+" id=%s", network.Id)
-
- jsonString, err := json.Marshal(network)
- if err != nil {
- return nil, err
- }
- return HNSNetworkRequest("POST", "", string(jsonString))
-}
-
-// Delete Network by sending NetworkRequest to HNS
-func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
- operation := "Delete"
- title := "HCSShim::HNSNetwork::" + operation
- logrus.Debugf(title+" id=%s", network.Id)
-
- return HNSNetworkRequest("DELETE", network.Id, "")
-}
-
-// Creates an endpoint on the Network.
-func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
- return &HNSEndpoint{
- VirtualNetwork: network.Id,
- IPAddress: ipAddress,
- MacAddress: string(macAddress),
- }
-}
-
-func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
- operation := "CreateEndpoint"
- title := "HCSShim::HNSNetwork::" + operation
- logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
-
- endpoint.VirtualNetwork = network.Id
- return endpoint.Create()
-}
-
-func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
- operation := "CreateRemoteEndpoint"
- title := "HCSShim::HNSNetwork::" + operation
- logrus.Debugf(title+" id=%s", network.Id)
- endpoint.IsRemoteEndpoint = true
- return network.CreateEndpoint(endpoint)
-}
+package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet = hns.Subnet + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool = hns.MacPool + +// HNSNetwork represents a network in HNS +type HNSNetwork = hns.HNSNetwork + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + return hns.HNSNetworkRequest(method, path, request) +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + return hns.HNSListNetworkRequest(method, path, request) +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return hns.GetHNSNetworkByID(networkID) +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + return hns.GetHNSNetworkByName(networkName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go index ecfbf0eda..a3e03ff8f 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -1,95 +1,57 @@ -package hcsshim
-
-// Type of Request Support in ModifySystem
-type PolicyType string
-
-// RequestType const
-const (
- Nat PolicyType = "NAT"
- ACL PolicyType = "ACL"
- PA PolicyType = "PA"
- VLAN PolicyType = "VLAN"
- VSID PolicyType = "VSID"
- VNet PolicyType = "VNET"
- L2Driver PolicyType = "L2Driver"
- Isolation PolicyType = "Isolation"
- QOS PolicyType = "QOS"
- OutboundNat PolicyType = "OutBoundNAT"
- ExternalLoadBalancer PolicyType = "ELB"
- Route PolicyType = "ROUTE"
-)
-
-type NatPolicy struct {
- Type PolicyType `json:"Type"`
- Protocol string
- InternalPort uint16
- ExternalPort uint16
-}
-
-type QosPolicy struct {
- Type PolicyType `json:"Type"`
- MaximumOutgoingBandwidthInBytes uint64
-}
-
-type IsolationPolicy struct {
- Type PolicyType `json:"Type"`
- VLAN uint
- VSID uint
- InDefaultIsolation bool
-}
-
-type VlanPolicy struct {
- Type PolicyType `json:"Type"`
- VLAN uint
-}
-
-type VsidPolicy struct {
- Type PolicyType `json:"Type"`
- VSID uint
-}
-
-type PaPolicy struct {
- Type PolicyType `json:"Type"`
- PA string `json:"PA"`
-}
-
-type OutboundNatPolicy struct {
- Policy
- VIP string `json:"VIP,omitempty"`
- Exceptions []string `json:"ExceptionList,omitempty"`
-}
-
-type ActionType string
-type DirectionType string
-type RuleType string
-
-const (
- Allow ActionType = "Allow"
- Block ActionType = "Block"
-
- In DirectionType = "In"
- Out DirectionType = "Out"
-
- Host RuleType = "Host"
- Switch RuleType = "Switch"
-)
-
-type ACLPolicy struct {
- Type PolicyType `json:"Type"`
- Protocol uint16
- InternalPort uint16
- Action ActionType
- Direction DirectionType
- LocalAddress string
- RemoteAddress string
- LocalPort uint16
- RemotePort uint16
- RuleType RuleType `json:"RuleType,omitempty"`
-
- Priority uint16
- ServiceName string
-}
-
-type Policy struct {
- Type PolicyType `json:"Type"`
-}
+package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// Type of Request Support in ModifySystem +type PolicyType = hns.PolicyType + +// RequestType const +const ( + Nat = hns.Nat + ACL = hns.ACL + PA = hns.PA + VLAN = hns.VLAN + VSID = hns.VSID + VNet = hns.VNet + L2Driver = hns.L2Driver + Isolation = hns.Isolation + QOS = hns.QOS + OutboundNat = hns.OutboundNat + ExternalLoadBalancer = hns.ExternalLoadBalancer + Route = hns.Route +) + +type NatPolicy = hns.NatPolicy + +type QosPolicy = hns.QosPolicy + +type IsolationPolicy = hns.IsolationPolicy + +type VlanPolicy = hns.VlanPolicy + +type VsidPolicy = hns.VsidPolicy + +type PaPolicy = hns.PaPolicy + +type OutboundNatPolicy = hns.OutboundNatPolicy + +type ActionType = hns.ActionType +type DirectionType = hns.DirectionType +type RuleType = hns.RuleType + +const ( + Allow = hns.Allow + Block = hns.Block + + In = hns.In + Out = hns.Out + + Host = hns.Host + Switch = hns.Switch +) + +type ACLPolicy = hns.ACLPolicy + +type Policy = hns.Policy diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go index 15653b4f4..55aaa4a50 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -1,196 +1,47 @@ -package hcsshim
-
-import (
- "encoding/json"
-
- "github.com/sirupsen/logrus"
-)
-
-// RoutePolicy is a structure defining schema for Route based Policy
-type RoutePolicy struct {
- Policy
- DestinationPrefix string `json:"DestinationPrefix,omitempty"`
- NextHop string `json:"NextHop,omitempty"`
- EncapEnabled bool `json:"NeedEncap,omitempty"`
-}
-
-// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
-type ELBPolicy struct {
- LBPolicy
- SourceVIP string `json:"SourceVIP,omitempty"`
- VIPs []string `json:"VIPs,omitempty"`
- ILB bool `json:"ILB,omitempty"`
-}
-
-// LBPolicy is a structure defining schema for LoadBalancing based Policy
-type LBPolicy struct {
- Policy
- Protocol uint16 `json:"Protocol,omitempty"`
- InternalPort uint16
- ExternalPort uint16
-}
-
-// PolicyList is a structure defining schema for Policy list request
-type PolicyList struct {
- ID string `json:"ID,omitempty"`
- EndpointReferences []string `json:"References,omitempty"`
- Policies []json.RawMessage `json:"Policies,omitempty"`
-}
-
-// HNSPolicyListRequest makes a call into HNS to update/query a single network
-func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
- var policy PolicyList
- err := hnsCall(method, "/policylists/"+path, request, &policy)
- if err != nil {
- return nil, err
- }
-
- return &policy, nil
-}
-
-// HNSListPolicyListRequest gets all the policy list
-func HNSListPolicyListRequest() ([]PolicyList, error) {
- var plist []PolicyList
- err := hnsCall("GET", "/policylists/", "", &plist)
- if err != nil {
- return nil, err
- }
-
- return plist, nil
-}
-
-// PolicyListRequest makes a HNS call to modify/query a network policy list
-func PolicyListRequest(method, path, request string) (*PolicyList, error) {
- policylist := &PolicyList{}
- err := hnsCall(method, "/policylists/"+path, request, &policylist)
- if err != nil {
- return nil, err
- }
-
- return policylist, nil
-}
-
-// GetPolicyListByID get the policy list by ID
-func GetPolicyListByID(policyListID string) (*PolicyList, error) {
- return PolicyListRequest("GET", policyListID, "")
-}
-
-// Create PolicyList by sending PolicyListRequest to HNS.
-func (policylist *PolicyList) Create() (*PolicyList, error) {
- operation := "Create"
- title := "HCSShim::PolicyList::" + operation
- logrus.Debugf(title+" id=%s", policylist.ID)
- jsonString, err := json.Marshal(policylist)
- if err != nil {
- return nil, err
- }
- return PolicyListRequest("POST", "", string(jsonString))
-}
-
-// Delete deletes PolicyList
-func (policylist *PolicyList) Delete() (*PolicyList, error) {
- operation := "Delete"
- title := "HCSShim::PolicyList::" + operation
- logrus.Debugf(title+" id=%s", policylist.ID)
-
- return PolicyListRequest("DELETE", policylist.ID, "")
-}
-
-// AddEndpoint add an endpoint to a Policy List
-func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
- operation := "AddEndpoint"
- title := "HCSShim::PolicyList::" + operation
- logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
-
- _, err := policylist.Delete()
- if err != nil {
- return nil, err
- }
-
- // Add Endpoint to the Existing List
- policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
-
- return policylist.Create()
-}
-
-// RemoveEndpoint removes an endpoint from the Policy List
-func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
- operation := "RemoveEndpoint"
- title := "HCSShim::PolicyList::" + operation
- logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
-
- _, err := policylist.Delete()
- if err != nil {
- return nil, err
- }
-
- elementToRemove := "/endpoints/" + endpoint.Id
-
- var references []string
-
- for _, endpointReference := range policylist.EndpointReferences {
- if endpointReference == elementToRemove {
- continue
- }
- references = append(references, endpointReference)
- }
- policylist.EndpointReferences = references
- return policylist.Create()
-}
-
-// AddLoadBalancer policy list for the specified endpoints
-func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
- operation := "AddLoadBalancer"
- title := "HCSShim::PolicyList::" + operation
- logrus.Debugf(title+" Vip:%s", vip)
-
- policylist := &PolicyList{}
-
- elbPolicy := &ELBPolicy{
- VIPs: []string{vip},
- ILB: isILB,
- }
- elbPolicy.Type = ExternalLoadBalancer
- elbPolicy.Protocol = protocol
- elbPolicy.InternalPort = internalPort
- elbPolicy.ExternalPort = externalPort
-
- for _, endpoint := range endpoints {
- policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
- }
-
- jsonString, err := json.Marshal(elbPolicy)
- if err != nil {
- return nil, err
- }
- policylist.Policies = append(policylist.Policies, jsonString)
- return policylist.Create()
-}
-
-// AddRoute adds route policy list for the specified endpoints
-func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
- operation := "AddRoute"
- title := "HCSShim::PolicyList::" + operation
- logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
-
- policylist := &PolicyList{}
-
- rPolicy := &RoutePolicy{
- DestinationPrefix: destinationPrefix,
- NextHop: nextHop,
- EncapEnabled: encapEnabled,
- }
- rPolicy.Type = Route
-
- for _, endpoint := range endpoints {
- policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
- }
-
- jsonString, err := json.Marshal(rPolicy)
- if err != nil {
- return nil, err
- }
-
- policylist.Policies = append(policylist.Policies, jsonString)
- return policylist.Create()
-}
+package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy = hns.RoutePolicy + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy = hns.ELBPolicy + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy = hns.LBPolicy + +// PolicyList is a structure defining schema for Policy list request +type PolicyList = hns.PolicyList + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + return hns.HNSPolicyListRequest(method, path, request) +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + return hns.HNSListPolicyListRequest() +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + return hns.PolicyListRequest(method, path, request) +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return hns.GetPolicyListByID(policyListID) +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/hnssupport.go new file mode 100644 index 000000000..69405244b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnssupport.go @@ -0,0 +1,13 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSSupportedFeatures = hns.HNSSupportedFeatures + +type HNSAclFeatures = hns.HNSAclFeatures + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + return hns.GetHNSSupportedFeatures() +} diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go deleted file mode 100644 index 3aed14376..000000000 --- a/vendor/github.com/Microsoft/hcsshim/importlayer.go +++ /dev/null @@ -1,212 +0,0 @@ -package hcsshim - -import ( - "errors" - "io/ioutil" - "os" - "path/filepath" - - "github.com/Microsoft/go-winio" - "github.com/sirupsen/logrus" -) - -// ImportLayer will take the contents of the folder at importFolderPath and import -// that into a layer with the id layerId. Note that in order to correctly populate -// the layer and interperet the transport format, all parent layers must already -// be present on the system at the paths provided in parentLayerPaths. -func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { - title := "hcsshim::ImportLayer " - logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) - - // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) - if err != nil { - return err - } - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = importLayer(&infop, layerID, importFolderPath, layers) - if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath) - return nil -} - -// LayerWriter is an interface that supports writing a new container image layer. -type LayerWriter interface { - // Add adds a file to the layer with given metadata. - Add(name string, fileInfo *winio.FileBasicInfo) error - // AddLink adds a hard link to the layer. The target must already have been added. - AddLink(name string, target string) error - // Remove removes a file that was present in a parent layer from the layer. - Remove(name string) error - // Write writes data to the current file. The data must be in the format of a Win32 - // backup stream. - Write(b []byte) (int, error) - // Close finishes the layer writing process and releases any resources. - Close() error -} - -// FilterLayerWriter provides an interface to write the contents of a layer to the file system. -type FilterLayerWriter struct { - context uintptr -} - -// Add adds a file or directory to the layer. The file's parent directory must have already been added. -// -// name contains the file's relative path. fileInfo contains file times and file attributes; the rest -// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method. -// winio.BackupStreamWriter can be used to facilitate this. -func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { - if name[0] != '\\' { - name = `\` + name - } - err := importLayerNext(w.context, name, fileInfo) - if err != nil { - return makeError(err, "ImportLayerNext", "") - } - return nil -} - -// AddLink adds a hard link to the layer. The target of the link must have already been added. -func (w *FilterLayerWriter) AddLink(name string, target string) error { - return errors.New("hard links not yet supported") -} - -// Remove removes a file from the layer. The file must have been present in the parent layer. -// -// name contains the file's relative path. -func (w *FilterLayerWriter) Remove(name string) error { - if name[0] != '\\' { - name = `\` + name - } - err := importLayerNext(w.context, name, nil) - if err != nil { - return makeError(err, "ImportLayerNext", "") - } - return nil -} - -// Write writes more backup stream data to the current file. -func (w *FilterLayerWriter) Write(b []byte) (int, error) { - err := importLayerWrite(w.context, b) - if err != nil { - err = makeError(err, "ImportLayerWrite", "") - return 0, err - } - return len(b), err -} - -// Close completes the layer write operation. The error must be checked to ensure that the -// operation was successful. -func (w *FilterLayerWriter) Close() (err error) { - if w.context != 0 { - err = importLayerEnd(w.context) - if err != nil { - err = makeError(err, "ImportLayerEnd", "") - } - w.context = 0 - } - return -} - -type legacyLayerWriterWrapper struct { - *legacyLayerWriter - info DriverInfo - layerID string - path string - parentLayerPaths []string -} - -func (r *legacyLayerWriterWrapper) Close() error { - defer os.RemoveAll(r.root) - err := r.legacyLayerWriter.Close() - if err != nil { - return err - } - - // Use the original path here because ImportLayer does not support long paths for the source in TP5. - // But do use a long path for the destination to work around another bug with directories - // with MAX_PATH - 12 < length < MAX_PATH. - info := r.info - fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID)) - if err != nil { - return err - } - - info.HomeDir = "" - if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil { - return err - } - // Add any hard links that were collected. - for _, lnk := range r.PendingLinks { - if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) { - return err - } - if err = os.Link(lnk.Target, lnk.Path); err != nil { - return err - } - } - // Prepare the utility VM for use if one is present in the layer. - if r.HasUtilityVM { - err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM")) - if err != nil { - return err - } - } - return nil -} - -// NewLayerWriter returns a new layer writer for creating a layer on disk. -// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges -// to call this and any methods on the resulting LayerWriter. -func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { - if len(parentLayerPaths) == 0 { - // This is a base layer. It gets imported differently. - return &baseLayerWriter{ - root: filepath.Join(info.HomeDir, layerID), - }, nil - } - - if procImportLayerBegin.Find() != nil { - // The new layer reader is not available on this Windows build. Fall back to the - // legacy export code path. - path, err := ioutil.TempDir("", "hcs") - if err != nil { - return nil, err - } - return &legacyLayerWriterWrapper{ - legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)), - info: info, - layerID: layerID, - path: path, - parentLayerPaths: parentLayerPaths, - }, nil - } - layers, err := layerPathsToDescriptors(parentLayerPaths) - if err != nil { - return nil, err - } - - infop, err := convertDriverInfo(info) - if err != nil { - return nil, err - } - - w := &FilterLayerWriter{} - err = importLayerBegin(&infop, layerID, layers, &w.context) - if err != nil { - return nil, makeError(err, "ImportLayerStart", "") - } - return w, nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go index 9fc7852e4..5b91e0cc5 100644 --- a/vendor/github.com/Microsoft/hcsshim/interface.go +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -1,105 +1,32 @@ package hcsshim import ( - "encoding/json" "io" "time" + + "github.com/Microsoft/hcsshim/internal/schema1" ) // ProcessConfig is used as both the input of Container.CreateProcess // and to convert the parameters to JSON for passing onto the HCS -type ProcessConfig struct { - ApplicationName string `json:",omitempty"` - CommandLine string `json:",omitempty"` - CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows - User string `json:",omitempty"` - WorkingDirectory string `json:",omitempty"` - Environment map[string]string `json:",omitempty"` - EmulateConsole bool `json:",omitempty"` - CreateStdInPipe bool `json:",omitempty"` - CreateStdOutPipe bool `json:",omitempty"` - CreateStdErrPipe bool `json:",omitempty"` - ConsoleSize [2]uint `json:",omitempty"` - CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows - OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows -} - -type Layer struct { - ID string - Path string -} - -type MappedDir struct { - HostPath string - ContainerPath string - ReadOnly bool - BandwidthMaximum uint64 - IOPSMaximum uint64 -} +type ProcessConfig = schema1.ProcessConfig -type MappedPipe struct { - HostPath string - ContainerPipeName string -} - -type HvRuntime struct { - ImagePath string `json:",omitempty"` - SkipTemplate bool `json:",omitempty"` - LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM - LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM - LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode - BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD - WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD -} +type Layer = schema1.Layer +type MappedDir = schema1.MappedDir +type MappedPipe = schema1.MappedPipe +type HvRuntime = schema1.HvRuntime +type MappedVirtualDisk = schema1.MappedVirtualDisk -type MappedVirtualDisk struct { - HostPath string `json:",omitempty"` // Path to VHD on the host - ContainerPath string // Platform-specific mount point path in the container - CreateInUtilityVM bool `json:",omitempty"` - ReadOnly bool `json:",omitempty"` - Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` -} +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice = schema1.AssignedDevice // ContainerConfig is used as both the input of CreateContainer // and to convert the parameters to JSON for passing onto the HCS -type ContainerConfig struct { - SystemType string // HCS requires this to be hard-coded to "Container" - Name string // Name of the container. We use the docker ID. - Owner string `json:",omitempty"` // The management platform that created this container - VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} - IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows - LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID - Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID - Credentials string `json:",omitempty"` // Credentials information - ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. - ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. - ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. - StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS - StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second - StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller - MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes - HostName string `json:",omitempty"` // Hostname - MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) - MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes - HvPartition bool // True if it a Hyper-V Container - NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. - EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container - HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM - Servicing bool `json:",omitempty"` // True if this container is for servicing - AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution - DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution - ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. - TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed - MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start -} +type ContainerConfig = schema1.ContainerConfig -type ComputeSystemQuery struct { - IDs []string `json:"Ids,omitempty"` - Types []string `json:",omitempty"` - Names []string `json:",omitempty"` - Owners []string `json:",omitempty"` -} +type ComputeSystemQuery = schema1.ComputeSystemQuery // Container represents a created (but not necessarily running) container. type Container interface { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go new file mode 100644 index 000000000..9f926c6be --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go @@ -0,0 +1,85 @@ +package guestrequest + +import "github.com/Microsoft/hcsshim/internal/schema2" + +// Arguably, many of these (at least CombinedLayers) should have been generated +// by swagger. +// +// This will also change package name due to an inbound breaking change. + +// This class is used by a modify request to add or remove a combined layers +// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath +// using the specified layers as the parent content. Ignores property ScratchPath +// since the container path is already the scratch path. For linux, the GCS unions +// the specified layers and ScratchPath together, placing the resulting union +// filesystem at ContainerRootPath. +type CombinedLayers struct { + ContainerRootPath string `json:"ContainerRootPath,omitempty"` + Layers []hcsschema.Layer `json:"Layers,omitempty"` + ScratchPath string `json:"ScratchPath,omitempty"` +} + +// Defines the schema for hosted settings passed to GCS and/or OpenGCS + +// SCSI. Scratch space for remote file-system commands, or R/W layer for containers +type LCOWMappedVirtualDisk struct { + MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM + Lun uint8 `json:"Lun,omitempty"` + Controller uint8 `json:"Controller,omitempty"` + ReadOnly bool `json:"ReadOnly,omitempty"` +} + +type WCOWMappedVirtualDisk struct { + ContainerPath string `json:"ContainerPath,omitempty"` + Lun int32 `json:"Lun,omitempty"` +} + +type LCOWMappedDirectory struct { + MountPath string `json:"MountPath,omitempty"` + Port int32 `json:"Port,omitempty"` + ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) + ReadOnly bool `json:"ReadOnly,omitempty"` +} + +// Read-only layers over VPMem +type LCOWMappedVPMemDevice struct { + DeviceNumber uint32 `json:"DeviceNumber,omitempty"` + MountPath string `json:"MountPath,omitempty"` // /tmp/pN +} + +type ResourceType string + +const ( + // These are constants for v2 schema modify guest requests. + ResourceTypeMappedDirectory ResourceType = "MappedDirectory" + ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" + ResourceTypeNetwork ResourceType = "Network" + ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" + ResourceTypeCombinedLayers ResourceType = "CombinedLayers" + ResourceTypeVPMemDevice ResourceType = "VPMemDevice" +) + +// GuestRequest is for modify commands passed to the guest. +type GuestRequest struct { + RequestType string `json:"RequestType,omitempty"` + ResourceType ResourceType `json:"ResourceType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type NetworkModifyRequest struct { + AdapterId string `json:"AdapterId,omitempty"` + RequestType string `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type RS4NetworkModifyRequest struct { + AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` + RequestType string `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +// SignalProcessOptions is the options passed to either WCOW or LCOW +// to signal a given process. +type SignalProcessOptions struct { + Signal int `json:,omitempty` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go new file mode 100644 index 000000000..e9e45c030 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go @@ -0,0 +1,69 @@ +package guid + +import ( + "crypto/rand" + "encoding/json" + "fmt" + "io" + "strconv" + "strings" +) + +var _ = (json.Marshaler)(&GUID{}) +var _ = (json.Unmarshaler)(&GUID{}) + +type GUID [16]byte + +func New() GUID { + g := GUID{} + _, err := io.ReadFull(rand.Reader, g[:]) + if err != nil { + panic(err) + } + return g +} + +func (g GUID) String() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} + +func FromString(s string) GUID { + if len(s) != 36 { + panic(fmt.Sprintf("invalid GUID length: %d", len(s))) + } + if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { + panic("invalid GUID format") + } + indexOrder := [16]int{ + 0, 2, 4, 6, + 9, 11, + 14, 16, + 19, 21, + 24, 26, 28, 30, 32, 34, + } + byteOrder := [16]int{ + 3, 2, 1, 0, + 5, 4, + 7, 6, + 8, 9, + 10, 11, 12, 13, 14, 15, + } + var g GUID + for i, x := range indexOrder { + b, err := strconv.ParseInt(s[x:x+2], 16, 16) + if err != nil { + panic(err) + } + g[byteOrder[i]] = byte(b) + } + return g +} + +func (g GUID) MarshalJSON() ([]byte, error) { + return json.Marshal(g.String()) +} + +func (g *GUID) UnmarshalJSON(data []byte) error { + *g = FromString(strings.Trim(string(data), "\"")) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index e8c2b00c8..5119c2555 100644 --- a/vendor/github.com/Microsoft/hcsshim/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,8 +1,11 @@ -package hcsshim +package hcs import ( "sync" "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" ) var ( @@ -62,7 +65,7 @@ func closeChannels(channels notificationChannels) { func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { var result error if int32(notificationStatus) < 0 { - result = syscall.Errno(win32FromHresult(notificationStatus)) + result = interop.Win32FromHresult(notificationStatus) } callbackMapLock.RLock() @@ -73,7 +76,13 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } - context.channels[notificationType] <- result + if channel, ok := context.channels[notificationType]; ok { + channel <- result + } else { + logrus.WithFields(logrus.Fields{ + "notification-type": notificationType, + }).Warn("Received a callback of an unsupported type") + } return 0 } diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go index 200333233..3669c34aa 100644 --- a/vendor/github.com/Microsoft/hcsshim/cgo.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go @@ -1,4 +1,4 @@ -package hcsshim +package hcs import "C" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go new file mode 100644 index 000000000..6368b5717 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -0,0 +1,284 @@ +package hcs + +import ( + "encoding/json" + "errors" + "fmt" + "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/sirupsen/logrus" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") +) + +type ErrorEvent struct { + Message string `json:"Message,omitempty"` // Fully formated error message + StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form + Provider string `json:"Provider,omitempty"` + EventID uint16 `json:"EventId,omitempty"` + Flags uint32 `json:"Flags,omitempty"` + Source string `json:"Source,omitempty"` + //Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function) +} + +type hcsResult struct { + Error int32 + ErrorMessage string + ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"` +} + +func (ev *ErrorEvent) String() string { + evs := "[Event Detail: " + ev.Message + if ev.StackTrace != "" { + evs += " Stack Trace: " + ev.StackTrace + } + if ev.Provider != "" { + evs += " Provider: " + ev.Provider + } + if ev.EventID != 0 { + evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID) + } + if ev.Flags != 0 { + evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags) + } + if ev.Source != "" { + evs += " Source: " + ev.Source + } + evs += "]" + return evs +} + +func processHcsResult(resultp *uint16) []ErrorEvent { + if resultp != nil { + resultj := interop.ConvertAndFreeCoTaskMemString(resultp) + logrus.WithField(logfields.JSON, resultj). + Debug("HCS Result") + result := &hcsResult{} + if err := json.Unmarshal([]byte(resultj), result); err != nil { + logrus.WithFields(logrus.Fields{ + logfields.JSON: resultj, + logrus.ErrorKey: err, + }).Warning("Could not unmarshal HCS result") + return nil + } + return result.ErrorEvents + } + return nil +} + +type HcsError struct { + Op string + Err error + Events []ErrorEvent +} + +func (e *HcsError) Error() string { + s := e.Op + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + SystemID string + Pid int + Op string + Err error + Events []ErrorEvent +} + +// SystemError is an error encountered in HCS during an operation on a Container object +type SystemError struct { + ID string + Op string + Err error + Extra string + Events []ErrorEvent +} + +func (e *SystemError) Error() string { + s := e.Op + " " + e.ID + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + if e.Extra != "" { + s += "\n(extra info: " + e.Extra + ")" + } + return s +} + +func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*SystemError); ok { + return err + } + return &SystemError{ + ID: system.ID(), + Op: op, + Extra: extra, + Err: err, + Events: events, + } +} + +func (e *ProcessError) Error() string { + s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + return &ProcessError{ + Pid: process.Pid(), + SystemID: process.SystemID(), + Op: op, + Err: err, + Events: events, + } +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *HcsError: + err = pe.Err + case *SystemError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go new file mode 100644 index 000000000..b0d49cbcf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go @@ -0,0 +1,48 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcs + +import ( + "syscall" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go new file mode 100644 index 000000000..90d164e35 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go @@ -0,0 +1,15 @@ +package hcs + +import "github.com/sirupsen/logrus" + +func logOperationBegin(ctx logrus.Fields, msg string) { + logrus.WithFields(ctx).Debug(msg) +} + +func logOperationEnd(ctx logrus.Fields, msg string, err error) { + if err == nil { + logrus.WithFields(ctx).Debug(msg) + } else { + logrus.WithFields(ctx).WithError(err).Error(msg) + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go new file mode 100644 index 000000000..42598cf2f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -0,0 +1,465 @@ +package hcs + +import ( + "encoding/json" + "io" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/guestrequest" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type Process struct { + handleLock sync.RWMutex + handle hcsProcess + processID int + system *System + cachedPipes *cachedPipes + callbackNumber uintptr + + logctx logrus.Fields +} + +func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { + return &Process{ + handle: process, + processID: processID, + system: computeSystem, + logctx: logrus.Fields{ + logfields.HCSOperation: "", + logfields.ContainerID: computeSystem.ID(), + logfields.ProcessID: processID, + }, + } +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type ProcessStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *Process) Pid() int { + return process.processID +} + +// SystemID returns the ID of the process's compute system. +func (process *Process) SystemID() string { + return process.system.ID() +} + +func (process *Process) logOperationBegin(operation string) { + process.logctx[logfields.HCSOperation] = operation + logOperationBegin( + process.logctx, + "hcsshim::Process - Begin Operation") +} + +func (process *Process) logOperationEnd(err error) { + var result string + if err == nil { + result = "Success" + } else { + result = "Error" + } + + logOperationEnd( + process.logctx, + "hcsshim::Process - End Operation - "+result, + err) + process.logctx[logfields.HCSOperation] = "" +} + +// Signal signals the process with `options`. +func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcsshim::Process::Signal" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + optionsb, err := json.Marshal(options) + if err != nil { + return err + } + + optionsStr := string(optionsb) + + var resultp *uint16 + completed := false + go syscallWatcher(process.logctx, &completed) + err = hcsSignalProcess(process.handle, optionsStr, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + return nil +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *Process) Kill() (err error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcsshim::Process::Kill" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(process.logctx, &completed) + err = hcsTerminateProcess(process.handle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + return nil +} + +// Wait waits for the process to exit. +func (process *Process) Wait() (err error) { + operation := "hcsshim::Process::Wait" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, err, nil) + } + + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *Process) WaitTimeout(timeout time.Duration) (err error) { + operation := "hcssshim::Process::WaitTimeout" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, err, nil) + } + + return nil +} + +// ResizeConsole resizes the console of the process. +func (process *Process) ResizeConsole(width, height uint16) (err error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcsshim::Process::ResizeConsole" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + return nil +} + +func (process *Process) Properties() (_ *ProcessStatus, err error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcsshim::Process::Properties" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + if process.handle == 0 { + return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var ( + resultp *uint16 + propertiesp *uint16 + ) + completed := false + go syscallWatcher(process.logctx, &completed) + err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeProcessError(process, operation, err, events) + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) + + properties := &ProcessStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, makeProcessError(process, operation, err, nil) + } + + return properties, nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *Process) ExitCode() (_ int, err error) { + operation := "hcsshim::Process::ExitCode" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + properties, err := process.Properties() + if err != nil { + return 0, makeProcessError(process, operation, err, nil) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) + } + + if properties.LastWaitResult != 0 { + return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) + } + + return int(properties.ExitCode), nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcsshim::Process::Stdio" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) + events := processHcsResult(resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, nil) + } + + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *Process) CloseStdin() (err error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcsshim::Process::CloseStdin" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *Process) Close() (err error) { + process.handleLock.Lock() + defer process.handleLock.Unlock() + + operation := "hcsshim::Process::Close" + process.logOperationBegin(operation) + defer process.logOperationEnd(err) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if err = process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, err, nil) + } + + if err = hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, err, nil) + } + + process.handle = 0 + + return nil +} + +func (process *Process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *Process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go new file mode 100644 index 000000000..2629380fd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -0,0 +1,667 @@ +package hcs + +import ( + "encoding/json" + "os" + "strconv" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/schema1" + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/sirupsen/logrus" +) + +// currentContainerStarts is used to limit the number of concurrent container +// starts. +var currentContainerStarts containerStarts + +type containerStarts struct { + maxParallel int + inProgress int + sync.Mutex +} + +func init() { + mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START") + if len(mpsS) > 0 { + mpsI, err := strconv.Atoi(mpsS) + if err != nil || mpsI < 0 { + return + } + currentContainerStarts.maxParallel = mpsI + } +} + +type System struct { + handleLock sync.RWMutex + handle hcsSystem + id string + callbackNumber uintptr + + logctx logrus.Fields +} + +func newSystem(id string) *System { + return &System{ + id: id, + logctx: logrus.Fields{ + logfields.HCSOperation: "", + logfields.ContainerID: id, + }, + } +} + +func (computeSystem *System) logOperationBegin(operation string) { + computeSystem.logctx[logfields.HCSOperation] = operation + logOperationBegin( + computeSystem.logctx, + "hcsshim::ComputeSystem - Begin Operation") +} + +func (computeSystem *System) logOperationEnd(err error) { + var result string + if err == nil { + result = "Success" + } else { + result = "Error" + } + + logOperationEnd( + computeSystem.logctx, + "hcsshim::ComputeSystem - End Operation - "+result, + err) + computeSystem.logctx[logfields.HCSOperation] = "" +} + +// CreateComputeSystem creates a new compute system with the given configuration but does not start it. +func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { + operation := "hcsshim::CreateComputeSystem" + + computeSystem := newSystem(id) + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + hcsDocumentB, err := json.Marshal(hcsDocumentInterface) + if err != nil { + return nil, err + } + + hcsDocument := string(hcsDocumentB) + + logrus.WithFields(computeSystem.logctx). + WithField(logfields.JSON, hcsDocument). + Debug("HCS ComputeSystem Document") + + var ( + resultp *uint16 + identity syscall.Handle + ) + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) + completed = true + + if createError == nil || IsPending(createError) { + if err = computeSystem.registerCallback(); err != nil { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + computeSystem.Terminate() + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + } + + events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + if err != nil { + if err == ErrTimeout { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + computeSystem.Terminate() + } + return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) + } + + return computeSystem, nil +} + +// OpenComputeSystem opens an existing compute system by ID. +func OpenComputeSystem(id string) (_ *System, err error) { + operation := "hcsshim::OpenComputeSystem" + + computeSystem := newSystem(id) + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + var ( + handle hcsSystem + resultp *uint16 + ) + err = hcsOpenComputeSystem(id, &handle, &resultp) + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + + computeSystem.handle = handle + + if err = computeSystem.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + return computeSystem, nil +} + +// GetComputeSystems gets a list of the compute systems on the system that match the query +func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { + operation := "hcsshim::GetComputeSystems" + fields := logrus.Fields{ + logfields.HCSOperation: operation, + } + logOperationBegin( + fields, + "hcsshim::ComputeSystem - Begin Operation") + + defer func() { + var result string + if err == nil { + result = "Success" + } else { + result = "Error" + } + + logOperationEnd( + fields, + "hcsshim::ComputeSystem - End Operation - "+result, + err) + }() + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + query := string(queryb) + + logrus.WithFields(fields). + WithField(logfields.JSON, query). + Debug("HCS ComputeSystem Query") + + var ( + resultp *uint16 + computeSystemsp *uint16 + ) + completed := false + go syscallWatcher(fields, &completed) + err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, &HcsError{Op: operation, Err: err, Events: events} + } + + if computeSystemsp == nil { + return nil, ErrUnexpectedValue + } + computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) + computeSystems := []schema1.ContainerProperties{} + if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + return nil, err + } + + return computeSystems, nil +} + +// Start synchronously starts the computeSystem. +func (computeSystem *System) Start() (err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Start" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + } + + // This is a very simple backoff-retry loop to limit the number + // of parallel container starts if environment variable + // HCSSHIM_MAX_PARALLEL_START is set to a positive integer. + // It should generally only be used as a workaround to various + // platform issues that exist between RS1 and RS4 as of Aug 2018 + if currentContainerStarts.maxParallel > 0 { + for { + currentContainerStarts.Lock() + if currentContainerStarts.inProgress < currentContainerStarts.maxParallel { + currentContainerStarts.inProgress++ + currentContainerStarts.Unlock() + break + } + if currentContainerStarts.inProgress == currentContainerStarts.maxParallel { + currentContainerStarts.Unlock() + time.Sleep(100 * time.Millisecond) + } + } + // Make sure we decrement the count when we are done. + defer func() { + currentContainerStarts.Lock() + currentContainerStarts.inProgress-- + currentContainerStarts.Unlock() + }() + } + + var resultp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + if err != nil { + return makeSystemError(computeSystem, "Start", "", err, events) + } + + return nil +} + +// ID returns the compute system's identifier. +func (computeSystem *System) ID() string { + return computeSystem.id +} + +// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (computeSystem *System) Shutdown() (err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Shutdown" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Shutdown", "", err, events) + } + + return nil +} + +// Terminate requests a compute system terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (computeSystem *System) Terminate() (err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Terminate" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Terminate", "", err, events) + } + + return nil +} + +// Wait synchronously waits for the compute system to shutdown or terminate. +func (computeSystem *System) Wait() (err error) { + operation := "hcsshim::ComputeSystem::Wait" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeSystemError(computeSystem, "Wait", "", err, nil) + } + + return nil +} + +// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { + operation := "hcsshim::ComputeSystem::WaitTimeout" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + } + + return nil +} + +func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Properties" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + queryj, err := json.Marshal(schema1.PropertyQuery{types}) + if err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + } + + logrus.WithFields(computeSystem.logctx). + WithField(logfields.JSON, queryj). + Debug("HCS ComputeSystem Properties Query") + + var resultp, propertiesp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, events) + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + } + + return properties, nil +} + +// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Pause() (err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Pause" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + if err != nil { + return makeSystemError(computeSystem, "Pause", "", err, events) + } + + return nil +} + +// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Resume() (err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Resume" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + if err != nil { + return makeSystemError(computeSystem, "Resume", "", err, events) + } + + return nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::CreateProcess" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + } + + configuration := string(configurationb) + + logrus.WithFields(computeSystem.logctx). + WithField(logfields.JSON, configuration). + Debug("HCS ComputeSystem Process Document") + + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + } + + logrus.WithFields(computeSystem.logctx). + WithField(logfields.ProcessID, processInfo.ProcessId). + Debug("HCS ComputeSystem CreateProcess PID") + + process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) + process.cachedPipes = &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + } + + if err = process.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + } + + return process, nil +} + +// OpenProcess gets an interface to an existing process within the computeSystem. +func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + // Add PID for the context of this operation + computeSystem.logctx[logfields.ProcessID] = pid + defer delete(computeSystem.logctx, logfields.ProcessID) + + operation := "hcsshim::ComputeSystem::OpenProcess" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + var ( + processHandle hcsProcess + resultp *uint16 + ) + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + } + + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + } + + process := newProcess(processHandle, pid, computeSystem) + if err = process.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + } + + return process, nil +} + +// Close cleans up any state associated with the compute system but does not terminate or wait for it. +func (computeSystem *System) Close() (err error) { + computeSystem.handleLock.Lock() + defer computeSystem.handleLock.Unlock() + + operation := "hcsshim::ComputeSystem::Close" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + // Don't double free this + if computeSystem.handle == 0 { + return nil + } + + if err = computeSystem.unregisterCallback(); err != nil { + return makeSystemError(computeSystem, "Close", "", err, nil) + } + + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsCloseComputeSystem(computeSystem.handle) + completed = true + if err != nil { + return makeSystemError(computeSystem, "Close", "", err, nil) + } + + computeSystem.handle = 0 + + return nil +} + +func (computeSystem *System) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + computeSystem.callbackNumber = callbackNumber + + return nil +} + +func (computeSystem *System) unregisterCallback() error { + callbackNumber := computeSystem.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} + +// Modify the System by sending a request to HCS +func (computeSystem *System) Modify(config interface{}) (err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::ComputeSystem::Modify" + computeSystem.logOperationBegin(operation) + defer computeSystem.logOperationEnd(err) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + } + + requestJSON, err := json.Marshal(config) + if err != nil { + return err + } + + requestString := string(requestJSON) + + logrus.WithFields(computeSystem.logctx). + WithField(logfields.JSON, requestString). + Debug("HCS ComputeSystem Modify Document") + + var resultp *uint16 + completed := false + go syscallWatcher(computeSystem.logctx, &completed) + err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Modify", requestString, err, events) + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go index bd6e2d94a..a638677ed 100644 --- a/vendor/github.com/Microsoft/hcsshim/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -1,4 +1,4 @@ -package hcsshim +package hcs import ( "io" diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index b7be20ea0..91e212c57 100644 --- a/vendor/github.com/Microsoft/hcsshim/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,4 +1,4 @@ -package hcsshim +package hcs import ( "time" @@ -6,13 +6,13 @@ import ( "github.com/sirupsen/logrus" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { - err = processHcsResult(err, resultp) +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(resultp) if IsPending(err) { - return waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(callbackNumber, expectedNotification, timeout) } - return err + return events, err } func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go new file mode 100644 index 000000000..e09dd1334 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go @@ -0,0 +1,33 @@ +package hcs + +import ( + "time" + + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/sirupsen/logrus" +) + +// syscallWatcher is used as a very simple goroutine around calls into +// the platform. In some cases, we have seen HCS APIs not returning due to +// various bugs, and the goroutine making the syscall ends up not returning, +// prior to its async callback. By spinning up a syscallWatcher, it allows +// us to at least log a warning if a syscall doesn't complete in a reasonable +// amount of time. +// +// Usage is: +// +// completed := false +// go syscallWatcher(context, &completed) +// <syscall> +// completed = true +// +func syscallWatcher(context logrus.Fields, syscallCompleted *bool) { + time.Sleep(timeout.SyscallWatcher) + if *syscallCompleted { + return + } + logrus.WithFields(context). + WithField(logfields.Timeout, timeout.SyscallWatcher). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go new file mode 100644 index 000000000..877c69a14 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go @@ -0,0 +1,462 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package hcs + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") +) + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSignalProcess(process, _p0, result) +} + +func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go new file mode 100644 index 000000000..c8d362c66 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go @@ -0,0 +1,51 @@ +package hcserror + +import ( + "fmt" + "syscall" +) + +const ERROR_GEN_FAILURE = syscall.Errno(31) + +type HcsError struct { + title string + rest string + Err error +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func New(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func Errorf(err error, title, format string, a ...interface{}) error { + return New(err, title, fmt.Sprintf(format, a...)) +} + +func Win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return Win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go new file mode 100644 index 000000000..b2e475f53 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go @@ -0,0 +1,23 @@ +package hns + +import "fmt" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +type EndpointNotFoundError struct { + EndpointName string +} + +func (e EndpointNotFoundError) Error() string { + return fmt.Sprintf("Endpoint %s not found", e.EndpointName) +} + +type NetworkNotFoundError struct { + NetworkName string +} + +func (e NetworkNotFoundError) Error() string { + return fmt.Sprintf("Network %s not found", e.NetworkName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go new file mode 100644 index 000000000..ce636458c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -0,0 +1,260 @@ +package hns + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` + Namespace *Namespace `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, EndpointNotFoundError{EndpointName: endpointName} +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ApplyACLPolicy applies a set of ACL Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 2c1b979ae..969d1b263 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -1,9 +1,11 @@ -package hcsshim +package hns import ( "encoding/json" "fmt" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error { err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return makeError(err, "hnsCall ", "") + return hcserror.New(err, "hnsCall ", "") } - response := convertAndFreeCoTaskMemString(responseBuffer) + response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go new file mode 100644 index 000000000..a8d8cc56a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go @@ -0,0 +1,28 @@ +package hns + +type HNSGlobals struct { + Version HNSVersion `json:"Version"` +} + +type HNSVersion struct { + Major int `json:"Major"` + Minor int `json:"Minor"` +} + +var ( + HNSVersion1803 = HNSVersion{Major: 7, Minor: 2} +) + +func GetHNSGlobals() (*HNSGlobals, error) { + var version HNSVersion + err := hnsCall("GET", "/globals/version", "", &version) + if err != nil { + return nil, err + } + + globals := &HNSGlobals{ + Version: version, + } + + return globals, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go new file mode 100644 index 000000000..7e859de91 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -0,0 +1,141 @@ +package hns + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, NetworkNotFoundError{NetworkName: networkName} +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go new file mode 100644 index 000000000..2318a4fce --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -0,0 +1,98 @@ +package hns + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Id string `json:"Id,omitempty"` + Protocol uint16 + Protocols string `json:"Protocols,omitempty"` + InternalPort uint16 + Action ActionType + Direction DirectionType + LocalAddresses string + RemoteAddresses string + LocalPorts string `json:"LocalPorts,omitempty"` + LocalPort uint16 + RemotePorts string `json:"RemotePorts,omitempty"` + RemotePort uint16 + RuleType RuleType `json:"RuleType,omitempty"` + Priority uint16 + ServiceName string +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go new file mode 100644 index 000000000..31322a681 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go @@ -0,0 +1,201 @@ +package hns + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` + DSR bool `json:"IsDSR,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + SourceVIP: sourceVIP, + ILB: isILB, + } + + if len(vip) > 0 { + elbPolicy.VIPs = []string{vip} + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go new file mode 100644 index 000000000..d5efba7f2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go @@ -0,0 +1,49 @@ +package hns + +import ( + "github.com/sirupsen/logrus" +) + +type HNSSupportedFeatures struct { + Acl HNSAclFeatures `json:"ACL"` +} + +type HNSAclFeatures struct { + AclAddressLists bool `json:"AclAddressLists"` + AclNoHostRulePriority bool `json:"AclHostRulePriority"` + AclPortRanges bool `json:"AclPortRanges"` + AclRuleId bool `json:"AclRuleId"` +} + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + var hnsFeatures HNSSupportedFeatures + + globals, err := GetHNSGlobals() + if err != nil { + // Expected on pre-1803 builds, all features will be false/unsupported + logrus.Debugf("Unable to obtain HNS globals: %s", err) + return hnsFeatures + } + + hnsFeatures.Acl = HNSAclFeatures{ + AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803), + } + + return hnsFeatures +} + +func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool { + if currentVersion.Major < minVersionSupported.Major { + return false + } + if currentVersion.Major > minVersionSupported.Major { + return true + } + if currentVersion.Minor < minVersionSupported.Minor { + return false + } + return true +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go new file mode 100644 index 000000000..45e2281b0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -0,0 +1,110 @@ +package hns + +import ( + "encoding/json" + "fmt" + "os" + "path" + "strings" +) + +type namespaceRequest struct { + IsDefault bool `json:",omitempty"` +} + +type namespaceEndpointRequest struct { + ID string `json:"Id"` +} + +type NamespaceResource struct { + Type string + Data json.RawMessage +} + +type namespaceResourceRequest struct { + Type string + Data interface{} +} + +type Namespace struct { + ID string + IsDefault bool `json:",omitempty"` + ResourceList []NamespaceResource `json:",omitempty"` +} + +func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) { + var err error + hnspath := "/namespaces/" + if id != nil { + hnspath = path.Join(hnspath, *id) + } + if subpath != "" { + hnspath = path.Join(hnspath, subpath) + } + var reqJSON []byte + if request != nil { + if reqJSON, err = json.Marshal(request); err != nil { + return nil, err + } + } + var ns Namespace + err = hnsCall(method, hnspath, string(reqJSON), &ns) + if err != nil { + if strings.Contains(err.Error(), "Element not found.") { + return nil, os.ErrNotExist + } + return nil, fmt.Errorf("%s %s: %s", method, hnspath, err) + } + return &ns, err +} + +func CreateNamespace() (string, error) { + req := namespaceRequest{} + ns, err := issueNamespaceRequest(nil, "POST", "", &req) + if err != nil { + return "", err + } + return ns.ID, nil +} + +func RemoveNamespace(id string) error { + _, err := issueNamespaceRequest(&id, "DELETE", "", nil) + return err +} + +func GetNamespaceEndpoints(id string) ([]string, error) { + ns, err := issueNamespaceRequest(&id, "GET", "", nil) + if err != nil { + return nil, err + } + var endpoints []string + for _, rsrc := range ns.ResourceList { + if rsrc.Type == "Endpoint" { + var endpoint namespaceEndpointRequest + err = json.Unmarshal(rsrc.Data, &endpoint) + if err != nil { + return nil, fmt.Errorf("unmarshal endpoint: %s", err) + } + endpoints = append(endpoints, endpoint.ID) + } + } + return endpoints, nil +} + +func AddNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "addresource", &resource) + return err +} + +func RemoveNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go new file mode 100644 index 000000000..3a3232a06 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go @@ -0,0 +1,74 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package hns + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go new file mode 100644 index 000000000..f10c88d08 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -0,0 +1,27 @@ +package interop + +import ( + "syscall" + "unsafe" +) + +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree + +func ConvertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(ConvertAndFreeCoTaskMemString(buffer)) +} + +func Win32FromHresult(hr uintptr) syscall.Errno { + if hr&0x1fff0000 == 0x00070000 { + return syscall.Errno(hr & 0xffff) + } + return syscall.Errno(hr) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go new file mode 100644 index 000000000..2f5bf8f55 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go @@ -0,0 +1,48 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package interop + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modole32 = windows.NewLazySystemDLL("ole32.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go new file mode 100644 index 000000000..a1527d706 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go @@ -0,0 +1,37 @@ +package logfields + +const ( + // Identifiers + + ContainerID = "cid" + UVMID = "uvm-id" + ProcessID = "pid" + + // Common Misc + + // Timeout represents an operation timeout. + Timeout = "timeout" + JSON = "json" + + // Keys/values + + Field = "field" + OCIAnnotation = "oci-annotation" + Value = "value" + + // Golang type's + + ExpectedType = "expected-type" + Bool = "bool" + Uint32 = "uint32" + Uint64 = "uint64" + + // HCS + + HCSOperation = "hcs-op" + HCSOperationResult = "hcs-op-result" + + // runhcs + + VMShimOperation = "vmshim-op" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go new file mode 100644 index 000000000..e5b8b85e0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go @@ -0,0 +1,24 @@ +package longpath + +import ( + "path/filepath" + "strings" +) + +// LongAbs makes a path absolute and returns it in NT long path form. +func LongAbs(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go new file mode 100644 index 000000000..7e95efb30 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go @@ -0,0 +1,52 @@ +package mergemaps + +import "encoding/json" + +// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func Merge(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = Merge(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// MergeJSON merges the contents of a JSON string into an object representation, +// returning a new object suitable for translating to JSON. +func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) { + if len(additionalJSON) == 0 { + return object, nil + } + objectJSON, err := json.Marshal(object) + if err != nil { + return nil, err + } + var objectMap, newMap map[string]interface{} + err = json.Unmarshal(objectJSON, &objectMap) + if err != nil { + return nil, err + } + err = json.Unmarshal(additionalJSON, &newMap) + if err != nil { + return nil, err + } + return Merge(newMap, objectMap), nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go new file mode 100644 index 000000000..0c0b1159f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -0,0 +1,431 @@ +package safefile + +import ( + "errors" + "io" + "os" + "path/filepath" + "strings" + "syscall" + "unicode/utf16" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/longpath" + + winio "github.com/Microsoft/go-winio" +) + +//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go + +//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile +//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile +//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb +//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc +//sys localFree(ptr uintptr) = kernel32.LocalFree + +type ioStatusBlock struct { + Status, Information uintptr +} + +type objectAttributes struct { + Length uintptr + RootDirectory uintptr + ObjectName uintptr + Attributes uintptr + SecurityDescriptor uintptr + SecurityQoS uintptr +} + +type unicodeString struct { + Length uint16 + MaximumLength uint16 + Buffer uintptr +} + +type fileLinkInformation struct { + ReplaceIfExists bool + RootDirectory uintptr + FileNameLength uint32 + FileName [1]uint16 +} + +type fileDispositionInformationEx struct { + Flags uintptr +} + +const ( + _FileLinkInformation = 11 + _FileDispositionInformationEx = 64 + + FILE_READ_ATTRIBUTES = 0x0080 + FILE_WRITE_ATTRIBUTES = 0x0100 + DELETE = 0x10000 + + FILE_OPEN = 1 + FILE_CREATE = 2 + + FILE_DIRECTORY_FILE = 0x00000001 + FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 + FILE_DELETE_ON_CLOSE = 0x00001000 + FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 + FILE_OPEN_REPARSE_POINT = 0x00200000 + + FILE_DISPOSITION_DELETE = 0x00000001 + + _OBJ_DONT_REPARSE = 0x1000 + + _STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B +) + +func OpenRoot(path string) (*os.File, error) { + longpath, err := longpath.LongAbs(path) + if err != nil { + return nil, err + } + return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING) +} + +func ntRelativePath(path string) ([]uint16, error) { + path = filepath.Clean(path) + if strings.Contains(":", path) { + // Since alternate data streams must follow the file they + // are attached to, finding one here (out of order) is invalid. + return nil, errors.New("path contains invalid character `:`") + } + fspath := filepath.FromSlash(path) + if len(fspath) > 0 && fspath[0] == '\\' { + return nil, errors.New("expected relative path") + } + + path16 := utf16.Encode(([]rune)(fspath)) + if len(path16) > 32767 { + return nil, syscall.ENAMETOOLONG + } + + return path16, nil +} + +// openRelativeInternal opens a relative path from the given root, failing if +// any of the intermediate path components are reparse points. +func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { + var ( + h uintptr + iosb ioStatusBlock + oa objectAttributes + ) + + path16, err := ntRelativePath(path) + if err != nil { + return nil, err + } + + if root == nil || root.Fd() == 0 { + return nil, errors.New("missing root directory") + } + + upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2) + defer localFree(upathBuffer) + + upath := (*unicodeString)(unsafe.Pointer(upathBuffer)) + upath.Length = uint16(len(path16) * 2) + upath.MaximumLength = upath.Length + upath.Buffer = upathBuffer + unsafe.Sizeof(*upath) + copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16) + + oa.Length = unsafe.Sizeof(oa) + oa.ObjectName = upathBuffer + oa.RootDirectory = uintptr(root.Fd()) + oa.Attributes = _OBJ_DONT_REPARSE + status := ntCreateFile( + &h, + accessMask|syscall.SYNCHRONIZE, + &oa, + &iosb, + nil, + 0, + shareFlags, + createDisposition, + FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags, + nil, + 0, + ) + if status != 0 { + return nil, rtlNtStatusToDosError(status) + } + + fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path)) + if err != nil { + syscall.Close(syscall.Handle(h)) + return nil, err + } + + return os.NewFile(h, fullPath), nil +} + +// OpenRelative opens a relative path from the given root, failing if +// any of the intermediate path components are reparse points. +func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { + f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags) + if err != nil { + err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err} + } + return f, err +} + +// LinkRelative creates a hard link from oldname to newname (relative to oldroot +// and newroot), failing if any of the intermediate path components are reparse +// points. +func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { + // Open the old file. + oldf, err := openRelativeInternal( + oldname, + oldroot, + syscall.FILE_WRITE_ATTRIBUTES, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + 0, + ) + if err != nil { + return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err} + } + defer oldf.Close() + + // Open the parent of the new file. + var parent *os.File + parentPath := filepath.Dir(newname) + if parentPath != "." { + parent, err = openRelativeInternal( + parentPath, + newroot, + syscall.GENERIC_READ, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + FILE_DIRECTORY_FILE) + if err != nil { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} + } + defer parent.Close() + + fi, err := winio.GetFileBasicInfo(parent) + if err != nil { + return err + } + if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)} + } + + } else { + parent = newroot + } + + // Issue an NT call to create the link. This will be safe because NT will + // not open any more directories to create the link, so it cannot walk any + // more reparse points. + newbase := filepath.Base(newname) + newbase16, err := ntRelativePath(newbase) + if err != nil { + return err + } + + size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2 + linkinfoBuffer := localAlloc(0, size) + defer localFree(linkinfoBuffer) + linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer)) + linkinfo.RootDirectory = parent.Fd() + linkinfo.FileNameLength = uint32(len(newbase16) * 2) + copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16) + + var iosb ioStatusBlock + status := ntSetInformationFile( + oldf.Fd(), + &iosb, + linkinfoBuffer, + uint32(size), + _FileLinkInformation, + ) + if status != 0 { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)} + } + + return nil +} + +// deleteOnClose marks a file to be deleted when the handle is closed. +func deleteOnClose(f *os.File) error { + disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE} + var iosb ioStatusBlock + status := ntSetInformationFile( + f.Fd(), + &iosb, + uintptr(unsafe.Pointer(&disposition)), + uint32(unsafe.Sizeof(disposition)), + _FileDispositionInformationEx, + ) + if status != 0 { + return rtlNtStatusToDosError(status) + } + return nil +} + +// clearReadOnly clears the readonly attribute on a file. +func clearReadOnly(f *os.File) error { + bi, err := winio.GetFileBasicInfo(f) + if err != nil { + return err + } + if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 { + return nil + } + sbi := winio.FileBasicInfo{ + FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY, + } + if sbi.FileAttributes == 0 { + sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL + } + return winio.SetFileBasicInfo(f, &sbi) +} + +// RemoveRelative removes a file or directory relative to a root, failing if any +// intermediate path components are reparse points. +func RemoveRelative(path string, root *os.File) error { + f, err := openRelativeInternal( + path, + root, + FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + FILE_OPEN_REPARSE_POINT) + if err == nil { + defer f.Close() + err = deleteOnClose(f) + if err == syscall.ERROR_ACCESS_DENIED { + // Maybe the file is marked readonly. Clear the bit and retry. + clearReadOnly(f) + err = deleteOnClose(f) + } + } + if err != nil { + return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err} + } + return nil +} + +// RemoveAllRelative removes a directory tree relative to a root, failing if any +// intermediate path components are reparse points. +func RemoveAllRelative(path string, root *os.File) error { + fi, err := LstatRelative(path, root) + if err != nil { + if os.IsNotExist(err) { + return nil + } + return err + } + fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 { + // If this is a reparse point, it can't have children. Simple remove will do. + err := RemoveRelative(path, root) + if err == nil || os.IsNotExist(err) { + return nil + } + return err + } + + // It is necessary to use os.Open as Readdirnames does not work with + // OpenRelative. This is safe because the above lstatrelative fails + // if the target is outside the root, and we know this is not a + // symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check. + fd, err := os.Open(filepath.Join(root.Name(), path)) + if err != nil { + if os.IsNotExist(err) { + // Race. It was deleted between the Lstat and Open. + // Return nil per RemoveAll's docs. + return nil + } + return err + } + + // Remove contents & return first error. + for { + names, err1 := fd.Readdirnames(100) + for _, name := range names { + err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root) + if err == nil { + err = err1 + } + } + if err1 == io.EOF { + break + } + // If Readdirnames returned an error, use it. + if err == nil { + err = err1 + } + if len(names) == 0 { + break + } + } + fd.Close() + + // Remove directory. + err1 := RemoveRelative(path, root) + if err1 == nil || os.IsNotExist(err1) { + return nil + } + if err == nil { + err = err1 + } + return err +} + +// MkdirRelative creates a directory relative to a root, failing if any +// intermediate path components are reparse points. +func MkdirRelative(path string, root *os.File) error { + f, err := openRelativeInternal( + path, + root, + 0, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_CREATE, + FILE_DIRECTORY_FILE) + if err == nil { + f.Close() + } else { + err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err} + } + return err +} + +// LstatRelative performs a stat operation on a file relative to a root, failing +// if any intermediate path components are reparse points. +func LstatRelative(path string, root *os.File) (os.FileInfo, error) { + f, err := openRelativeInternal( + path, + root, + FILE_READ_ATTRIBUTES, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + FILE_OPEN_REPARSE_POINT) + if err != nil { + return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} + } + defer f.Close() + return f.Stat() +} + +// EnsureNotReparsePointRelative validates that a given file (relative to a +// root) and all intermediate path components are not a reparse points. +func EnsureNotReparsePointRelative(path string, root *os.File) error { + // Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT. + f, err := OpenRelative( + path, + root, + 0, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + 0) + if err != nil { + return err + } + f.Close() + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go new file mode 100644 index 000000000..709b9d347 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go @@ -0,0 +1,79 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package safefile + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + + procNtCreateFile = modntdll.NewProc("NtCreateFile") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLocalFree = modkernel32.NewProc("LocalFree") +) + +func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { + r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) + status = uint32(r0) + return +} + +func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + +func rtlNtStatusToDosError(status uint32) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} + +func localAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func localFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go new file mode 100644 index 000000000..995433ace --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -0,0 +1,245 @@ +package schema1 + +import ( + "encoding/json" + "time" + + "github.com/Microsoft/hcsshim/internal/schema2" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 + CreateInUtilityVM bool + // LinuxMetadata - Support added in 1803/RS4+. + LinuxMetadata bool `json:",omitempty"` +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty:` +} + +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice struct { + // InterfaceClassGUID of the device to assign to container. + InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start + AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5 +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +type PropertyType string + +const ( + PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2 + PropertyTypeProcessList = "ProcessList" // V1 and V2 + PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call + PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5 +) + +type PropertyQuery struct { + PropertyTypes []PropertyType `json:",omitempty"` +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + State string + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` + GuestConnectionInfo GuestConnectionInfo `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM +type GuestDefinedCapabilities struct { + NamespaceAddRequestSupported bool `json:",omitempty"` + SignalProcessSupported bool `json:",omitempty"` +} + +// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM +type GuestConnectionInfo struct { + SupportedSchemaVersions []hcsschema.Version `json:",omitempty"` + ProtocolVersion uint32 `json:",omitempty"` + GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go new file mode 100644 index 000000000..09456cbc2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -0,0 +1,31 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Attachment struct { + + Type_ string `json:"Type,omitempty"` + + Path string `json:"Path,omitempty"` + + IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"` + + CachingMode string `json:"CachingMode,omitempty"` + + NoWriteHardening bool `json:"NoWriteHardening,omitempty"` + + DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"` + + IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"` + + CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go new file mode 100644 index 000000000..ecbbed4c2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Battery struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go new file mode 100644 index 000000000..243779eab --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CacheQueryStatsResponse struct { + + L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` + + L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` + + L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go new file mode 100644 index 000000000..ca75277a3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Chipset struct { + Uefi *Uefi `json:"Uefi,omitempty"` + + IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"` + + BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"` + + ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"` + + ChassisAssetTag string `json:"ChassisAssetTag,omitempty"` + + UseUtc bool `json:"UseUtc,omitempty"` + + // LinuxKernelDirect - Added in v2.2 Builds >=181117 + LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go new file mode 100644 index 000000000..88f01707a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CloseHandle struct { + + Handle string `json:"Handle,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go new file mode 100644 index 000000000..c665be3d5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. +type ComPort struct { + + NamedPipe string `json:"NamedPipe,omitempty"` + + OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go new file mode 100644 index 000000000..85785d285 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ComputeSystem struct { + + Owner string `json:"Owner,omitempty"` + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + + Container *Container `json:"Container,omitempty"` + + VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"` + + ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go new file mode 100644 index 000000000..1a47db7d9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -0,0 +1,72 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "net/http" +) + +// contextKeys are used to identify the type of value in the context. +// Since these are string, it is possible to get a short description of the +// context key for logging and debugging using key.String(). + +type contextKey string + +func (c contextKey) String() string { + return "auth " + string(c) +} + +var ( + // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. + ContextOAuth2 = contextKey("token") + + // ContextBasicAuth takes BasicAuth as authentication for the request. + ContextBasicAuth = contextKey("basic") + + // ContextAccessToken takes a string oauth2 access token as authentication for the request. + ContextAccessToken = contextKey("accesstoken") + + // ContextAPIKey takes an APIKey as authentication for the request + ContextAPIKey = contextKey("apikey") +) + +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +type BasicAuth struct { + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` +} + +// APIKey provides API key based authentication to a request passed via context using ContextAPIKey +type APIKey struct { + Key string + Prefix string +} + +type Configuration struct { + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client +} + +func NewConfiguration() *Configuration { + cfg := &Configuration{ + BasePath: "https://localhost", + DefaultHeader: make(map[string]string), + UserAgent: "Swagger-Codegen/2.1.0/go", + } + return cfg +} + +func (c *Configuration) AddDefaultHeader(key string, value string) { + c.DefaultHeader[key] = value +}
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go new file mode 100644 index 000000000..adbe07fe5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ConsoleSize struct { + + Height int32 `json:"Height,omitempty"` + + Width int32 `json:"Width,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go new file mode 100644 index 000000000..17dce28bc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -0,0 +1,35 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Container struct { + + GuestOs *GuestOs `json:"GuestOs,omitempty"` + + Storage *Storage `json:"Storage,omitempty"` + + MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"` + + MappedPipes []MappedPipe `json:"MappedPipes,omitempty"` + + Memory *Memory `json:"Memory,omitempty"` + + Processor *Processor `json:"Processor,omitempty"` + + Networking *Networking `json:"Networking,omitempty"` + + HvSocket *HvSocket `json:"HvSocket,omitempty"` + + ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + AssignedDevices []Device `json:"AssignedDevices,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go new file mode 100644 index 000000000..0f8f64437 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardState struct { + + // Authentication cookie for calls to a Container Credential Guard instance. + Cookie string `json:"Cookie,omitempty"` + + // Name of the RPC endpoint of the Container Credential Guard instance. + RpcEndpoint string `json:"RpcEndpoint,omitempty"` + + // Transport used for the configured Container Credential Guard instance. + Transport string `json:"Transport,omitempty"` + + // Credential spec used for the configured Container Credential Guard instance. + CredentialSpec string `json:"CredentialSpec,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go new file mode 100644 index 000000000..754797e21 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// memory usage as viewed from within the container +type ContainerMemoryInformation struct { + + TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` + + TotalUsage int32 `json:"TotalUsage,omitempty"` + + CommittedBytes int32 `json:"CommittedBytes,omitempty"` + + SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"` + + CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"` + + PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go new file mode 100644 index 000000000..ca319bbbc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Device struct { + + // The interface class guid of the device to assign to container. + InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go new file mode 100644 index 000000000..b2191c571 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -0,0 +1,43 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Devices struct { + + ComPorts map[string]ComPort `json:"ComPorts,omitempty"` + + Scsi map[string]Scsi `json:"Scsi,omitempty"` + + VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"` + + NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"` + + VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"` + + Keyboard *Keyboard `json:"Keyboard,omitempty"` + + Mouse *Mouse `json:"Mouse,omitempty"` + + HvSocket *HvSocket2 `json:"HvSocket,omitempty"` + + EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"` + + GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"` + + VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"` + + Plan9 *Plan9 `json:"Plan9,omitempty"` + + Battery *Battery `json:"Battery,omitempty"` + + FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"` + + SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go new file mode 100644 index 000000000..4fe592f71 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type EnhancedModeVideo struct { + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go new file mode 100644 index 000000000..51011afe4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type FlexibleIoDevice struct { + + EmulatorId string `json:"EmulatorId,omitempty"` + + HostingModel string `json:"HostingModel,omitempty"` + + Configuration []string `json:"Configuration,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go new file mode 100644 index 000000000..7db29495b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestConnection struct { + + // Use Vsock rather than Hyper-V sockets to communicate with the guest service. + UseVsock bool `json:"UseVsock,omitempty"` + + // Don't disconnect the guest connection when pausing the virtual machine. + UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go new file mode 100644 index 000000000..8a369bab7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Information about the guest. +type GuestConnectionInfo struct { + + // Each schema version x.y stands for the range of versions a.b where a==x and b<=y. This list comes from the SupportedSchemaVersions field in GcsCapabilities. + SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"` + + ProtocolVersion int32 `json:"ProtocolVersion,omitempty"` + + GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go new file mode 100644 index 000000000..c5fa76735 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestCrashReporting struct { + + WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go new file mode 100644 index 000000000..c708fc7c3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestOs struct { + + HostName string `json:"HostName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go new file mode 100644 index 000000000..ef1eec886 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestState struct { + + // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. + GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` + + // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. + RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` + + // If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store. + ForceTransientState bool `json:"ForceTransientState,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go new file mode 100644 index 000000000..0797584c5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HostedSystem struct { + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + Container *Container `json:"Container,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go new file mode 100644 index 000000000..ef9ffb8dd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocket struct { + + Config *HvSocketSystemConfig `json:"Config,omitempty"` + + EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go new file mode 100644 index 000000000..a19ba15c1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// HvSocket configuration for a VM +type HvSocket2 struct { + + HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go new file mode 100644 index 000000000..a848e91e6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocketServiceConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to this specific service. If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to this specific service. If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"` + + // If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors + AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go new file mode 100644 index 000000000..69f4f9d39 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// This is the HCS Schema version of the HvSocket configuration. The VMWP version is located in Config.Devices.IC in V1. +type HvSocketSystemConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to an unlisted service for this specific container/VM (not wildcard binds). + DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to an unlisted service in the VM/container. + DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"` + + ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go new file mode 100644 index 000000000..3d3fa3b1c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Keyboard struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go new file mode 100644 index 000000000..b63b8ef12 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Layer struct { + + Id string `json:"Id,omitempty"` + + Path string `json:"Path,omitempty"` + + PathType string `json:"PathType,omitempty"` + + // Unspecified defaults to Enabled + Cache string `json:"Cache,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go new file mode 100644 index 000000000..0ab6c280f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.2 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type LinuxKernelDirect struct { + KernelFilePath string `json:"KernelFilePath,omitempty"` + + InitRdPath string `json:"InitRdPath,omitempty"` + + KernelCmdLine string `json:"KernelCmdLine,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go new file mode 100644 index 000000000..a823a6d3b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedDirectory struct { + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` + + ContainerPath string `json:"ContainerPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go new file mode 100644 index 000000000..2d1d2604a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedPipe struct { + + ContainerPipeName string `json:"ContainerPipeName,omitempty"` + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go new file mode 100644 index 000000000..e1d135a3a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory struct { + + SizeInMB int32 `json:"SizeInMB,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go new file mode 100644 index 000000000..27d0b8c48 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory2 struct { + SizeInMB int32 `json:"SizeInMB,omitempty"` + + AllowOvercommit bool `json:"AllowOvercommit,omitempty"` + + EnableHotHint bool `json:"EnableHotHint,omitempty"` + + EnableColdHint bool `json:"EnableColdHint,omitempty"` + + EnableEpf bool `json:"EnableEpf,omitempty"` + + // EnableDeferredCommit is private in the schema. If regenerated need to add back. + EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go new file mode 100644 index 000000000..bdd87dffd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MemoryInformationForVm struct { + + VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + + VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` + + VirtualNodes []VirtualNodeInfo `json:"VirtualNodes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go new file mode 100644 index 000000000..6214970f6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Memory runtime statistics +type MemoryStats struct { + + MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + + MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` + + MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go new file mode 100644 index 000000000..d29455a3e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ModifySettingRequest struct { + ResourcePath string `json:"ResourcePath,omitempty"` + + RequestType string `json:"RequestType,omitempty"` + + Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated + + GuestRequest interface{} `json:"GuestRequest,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go new file mode 100644 index 000000000..ccf8b938f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Mouse struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go new file mode 100644 index 000000000..c586f66c2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type NetworkAdapter struct { + + EndpointId string `json:"EndpointId,omitempty"` + + MacAddress string `json:"MacAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go new file mode 100644 index 000000000..12c47827c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -0,0 +1,24 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Networking struct { + + AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` + + DnsSearchList string `json:"DnsSearchList,omitempty"` + + NetworkSharedContainerName string `json:"NetworkSharedContainerName,omitempty"` + + // Guid in windows; string in linux + Namespace string `json:"Namespace,omitempty"` + + NetworkAdapters []string `json:"NetworkAdapters,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go new file mode 100644 index 000000000..1cd70d179 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Notification data that is indicated to components running in the Virtual Machine. +type PauseNotification struct { + + Reason string `json:"Reason,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go new file mode 100644 index 000000000..780a5cae2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Options for HcsPauseComputeSystem +type PauseOptions struct { + + SuspensionLevel string `json:"SuspensionLevel,omitempty"` + + HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go new file mode 100644 index 000000000..705c677e1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9 struct { + + Shares []Plan9Share `json:"Shares,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go new file mode 100644 index 000000000..b2bc58b83 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9Share struct { + + Name string `json:"Name,omitempty"` + + // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. + AccessName string `json:"AccessName,omitempty"` + + Path string `json:"Path,omitempty"` + + Port int32 `json:"Port,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go new file mode 100644 index 000000000..63e0b7f8f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -0,0 +1,34 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Information about a process running in a container +type ProcessDetails struct { + + ProcessId int32 `json:"ProcessId,omitempty"` + + ImageName string `json:"ImageName,omitempty"` + + CreateTimestamp time.Time `json:"CreateTimestamp,omitempty"` + + UserTime100ns int32 `json:"UserTime100ns,omitempty"` + + KernelTime100ns int32 `json:"KernelTime100ns,omitempty"` + + MemoryCommitBytes int32 `json:"MemoryCommitBytes,omitempty"` + + MemoryWorkingSetPrivateBytes int32 `json:"MemoryWorkingSetPrivateBytes,omitempty"` + + MemoryWorkingSetSharedBytes int32 `json:"MemoryWorkingSetSharedBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go new file mode 100644 index 000000000..29bc2e3d0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Passed to HcsRpc_ModifyProcess +type ProcessModifyRequest struct { + + Operation string `json:"Operation,omitempty"` + + ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` + + CloseHandle *CloseHandle `json:"CloseHandle,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go new file mode 100644 index 000000000..470c55734 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -0,0 +1,47 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ProcessParameters struct { + + ApplicationName string `json:"ApplicationName,omitempty"` + + CommandLine string `json:"CommandLine,omitempty"` + + // optional alternative to CommandLine, currently only supported by Linux GCS + CommandArgs []string `json:"CommandArgs,omitempty"` + + User string `json:"User,omitempty"` + + WorkingDirectory string `json:"WorkingDirectory,omitempty"` + + Environment map[string]string `json:"Environment,omitempty"` + + // if set, will run as low-privilege process + RestrictedToken bool `json:"RestrictedToken,omitempty"` + + // if set, ignore StdErrPipe + EmulateConsole bool `json:"EmulateConsole,omitempty"` + + CreateStdInPipe bool `json:"CreateStdInPipe,omitempty"` + + CreateStdOutPipe bool `json:"CreateStdOutPipe,omitempty"` + + CreateStdErrPipe bool `json:"CreateStdErrPipe,omitempty"` + + // height then width + ConsoleSize []int32 `json:"ConsoleSize,omitempty"` + + // if set, find an existing session for the user and create the process in it + UseExistingLogin bool `json:"UseExistingLogin,omitempty"` + + // if set, use the legacy console instead of conhost + UseLegacyConsole bool `json:"UseLegacyConsole,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go new file mode 100644 index 000000000..20793d150 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Status of a process running in a container +type ProcessStatus struct { + + ProcessId int32 `json:"ProcessId,omitempty"` + + Exited bool `json:"Exited,omitempty"` + + ExitCode int32 `json:"ExitCode,omitempty"` + + LastWaitResult int32 `json:"LastWaitResult,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go new file mode 100644 index 000000000..7a60b0245 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor struct { + + Count int32 `json:"Count,omitempty"` + + Maximum int32 `json:"Maximum,omitempty"` + + Weight int32 `json:"Weight,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go new file mode 100644 index 000000000..40d3e7356 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor2 struct { + + Count int32 `json:"Count,omitempty"` + + Limit int32 `json:"Limit,omitempty"` + + Weight int32 `json:"Weight,omitempty"` + + ExposeVirtualizationExtensions bool `json:"ExposeVirtualizationExtensions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go new file mode 100644 index 000000000..9d3b77e57 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// CPU runtime statistics +type ProcessorStats struct { + + TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + + RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` + + RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go new file mode 100644 index 000000000..6db2a48f6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -0,0 +1,47 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Properties struct { + + Id string `json:"Id,omitempty"` + + SystemType string `json:"SystemType,omitempty"` + + RuntimeOsType string `json:"RuntimeOsType,omitempty"` + + Name string `json:"Name,omitempty"` + + Owner string `json:"Owner,omitempty"` + + RuntimeId string `json:"RuntimeId,omitempty"` + + RuntimeTemplateId string `json:"RuntimeTemplateId,omitempty"` + + State string `json:"State,omitempty"` + + Stopped bool `json:"Stopped,omitempty"` + + ExitType string `json:"ExitType,omitempty"` + + Memory *MemoryInformationForVm `json:"Memory,omitempty"` + + Statistics *Statistics `json:"Statistics,omitempty"` + + ProcessList []ProcessDetails `json:"ProcessList,omitempty"` + + TerminateOnLastHandleClosed bool `json:"TerminateOnLastHandleClosed,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` + + GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go new file mode 100644 index 000000000..22b92ffdf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// By default the basic properties will be returned. This query provides a way to request specific properties. +type PropertyQuery struct { + + PropertyTypes []string `json:"PropertyTypes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go new file mode 100644 index 000000000..97e453128 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RdpConnectionOptions struct { + + AccessSids []string `json:"AccessSids,omitempty"` + + NamedPipe string `json:"NamedPipe,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go new file mode 100644 index 000000000..fa574ccc8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryChanges struct { + + AddValues []RegistryValue `json:"AddValues,omitempty"` + + DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go new file mode 100644 index 000000000..fab03bc60 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryKey struct { + + Hive string `json:"Hive,omitempty"` + + Name string `json:"Name,omitempty"` + + Volatile bool `json:"Volatile,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go new file mode 100644 index 000000000..1589f4841 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -0,0 +1,31 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryValue struct { + + Key *RegistryKey `json:"Key,omitempty"` + + Name string `json:"Name,omitempty"` + + Type_ string `json:"Type,omitempty"` + + // One and only one value type must be set. + StringValue string `json:"StringValue,omitempty"` + + BinaryValue string `json:"BinaryValue,omitempty"` + + DWordValue int32 `json:"DWordValue,omitempty"` + + QWordValue int32 `json:"QWordValue,omitempty"` + + // Only used if RegistryValueType is CustomType The data is in BinaryValue + CustomType int32 `json:"CustomType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go new file mode 100644 index 000000000..778ff5873 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RestoreState struct { + + // The path to the save state file to restore the system from. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` + + // The ID of the template system to clone this new system off of. An empty string indicates the system should not be cloned from a template. + TemplateSystemId string `json:"TemplateSystemId,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go new file mode 100644 index 000000000..e55fa1d98 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SaveOptions struct { + + // The type of save operation to be performed. + SaveType string `json:"SaveType,omitempty"` + + // The path to the file that will container the saved state. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go new file mode 100644 index 000000000..bf253a470 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Scsi struct { + + // Map of attachments, where the key is the integer LUN number on the controller. + Attachments map[string]Attachment `json:"Attachments,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go new file mode 100644 index 000000000..bd573f6cd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryConfiguration struct { + + Regions []SharedMemoryRegion `json:"Regions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go new file mode 100644 index 000000000..a57b2cba7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegion struct { + + SectionName string `json:"SectionName,omitempty"` + + StartOffset int32 `json:"StartOffset,omitempty"` + + Length int32 `json:"Length,omitempty"` + + AllowGuestWrite bool `json:"AllowGuestWrite,omitempty"` + + HiddenFromGuest bool `json:"HiddenFromGuest,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go new file mode 100644 index 000000000..d9a50cc7d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegionInfo struct { + + SectionName string `json:"SectionName,omitempty"` + + GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go new file mode 100644 index 000000000..599c06e8a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Silo job information +type SiloProperties struct { + + Enabled bool `json:"Enabled,omitempty"` + + JobName string `json:"JobName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go new file mode 100644 index 000000000..5cb3ed93b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -0,0 +1,30 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Runtime statistics for a container +type Statistics struct { + + Timestamp time.Time `json:"Timestamp,omitempty"` + + ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` + + Uptime100ns int32 `json:"Uptime100ns,omitempty"` + + Processor *ProcessorStats `json:"Processor,omitempty"` + + Memory *MemoryStats `json:"Memory,omitempty"` + + Storage *StorageStats `json:"Storage,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go new file mode 100644 index 000000000..2627af913 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Storage struct { + + // List of layers that describe the parent hierarchy for a container's storage. These layers combined together, presented as a disposable and/or committable working storage, are used by the container to record all changes done to the parent layers. + Layers []Layer `json:"Layers,omitempty"` + + // Path that points to the scratch space of a container, where parent layers are combined together to present a new disposable and/or committable layer with the changes done during its runtime. + Path string `json:"Path,omitempty"` + + QoS *StorageQoS `json:"QoS,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go new file mode 100644 index 000000000..8c5255df1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type StorageQoS struct { + + IopsMaximum int32 `json:"IopsMaximum,omitempty"` + + BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go new file mode 100644 index 000000000..198ea57d7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Storage runtime statistics +type StorageStats struct { + + ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + + ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + + WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` + + WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go new file mode 100644 index 000000000..af2e3c823 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Topology struct { + + Memory *Memory2 `json:"Memory,omitempty"` + + Processor *Processor2 `json:"Processor,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go new file mode 100644 index 000000000..ba91178f9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Uefi struct { + + EnableDebugger bool `json:"EnableDebugger,omitempty"` + + SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` + + BootThis *UefiBootEntry `json:"BootThis,omitempty"` + + Console string `json:"Console,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go new file mode 100644 index 000000000..6620fb2bc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type UefiBootEntry struct { + + DeviceType string `json:"DeviceType,omitempty"` + + DevicePath string `json:"DevicePath,omitempty"` + + DiskNumber int32 `json:"DiskNumber,omitempty"` + + OptionalData string `json:"OptionalData,omitempty"` + + VmbFsRootPath string `json:"VmbFsRootPath,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go new file mode 100644 index 000000000..62c0e4d12 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Version struct { + + Major int32 `json:"Major,omitempty"` + + Minor int32 `json:"Minor,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go new file mode 100644 index 000000000..0958e5606 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VideoMonitor struct { + + HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` + + VerticalResolution int32 `json:"VerticalResolution,omitempty"` + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go new file mode 100644 index 000000000..11f39eea7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go @@ -0,0 +1,29 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualMachine struct { + + Chipset *Chipset `json:"Chipset,omitempty"` + + ComputeTopology *Topology `json:"ComputeTopology,omitempty"` + + Devices *Devices `json:"Devices,omitempty"` + + GuestState *GuestState `json:"GuestState,omitempty"` + + RestoreState *RestoreState `json:"RestoreState,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + StorageQoS *StorageQoS `json:"StorageQoS,omitempty"` + + GuestConnection *GuestConnection `json:"GuestConnection,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go new file mode 100644 index 000000000..48402d8ec --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualNodeInfo struct { + + VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` + + PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` + + VirtualProcessorCount int32 `json:"VirtualProcessorCount,omitempty"` + + MemoryUsageInPages int32 `json:"MemoryUsageInPages,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go new file mode 100644 index 000000000..f5b7f3e38 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemController struct { + Devices map[string]VirtualPMemDevice `json:"Devices,omitempty"` + + MaximumCount uint32 `json:"MaximumCount,omitempty"` + + MaximumSizeBytes uint64 `json:"MaximumSizeBytes,omitempty"` + + Backing string `json:"Backing,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go new file mode 100644 index 000000000..47714444a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemDevice struct { + + HostPath string `json:"HostPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + ImageFormat string `json:"ImageFormat,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go new file mode 100644 index 000000000..76131b3a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmb struct { + + Shares []VirtualSmbShare `json:"Shares,omitempty"` + + DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go new file mode 100644 index 000000000..b50098a42 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShare struct { + + Name string `json:"Name,omitempty"` + + Path string `json:"Path,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` + + Options *VirtualSmbShareOptions `json:"Options,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go new file mode 100644 index 000000000..c1894279d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -0,0 +1,63 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShareOptions struct { + + ReadOnly bool `json:"ReadOnly,omitempty"` + + // convert exclusive access to shared read access + ShareRead bool `json:"ShareRead,omitempty"` + + // all opens will use cached I/O + CacheIo bool `json:"CacheIo,omitempty"` + + // disable oplock support + NoOplocks bool `json:"NoOplocks,omitempty"` + + // Acquire the backup privilege when attempting to open + TakeBackupPrivilege bool `json:"TakeBackupPrivilege,omitempty"` + + // Use the identity of the share root when opening + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + // disable Direct Mapping + NoDirectmap bool `json:"NoDirectmap,omitempty"` + + // disable Byterange locks + NoLocks bool `json:"NoLocks,omitempty"` + + // disable Directory CHange Notifications + NoDirnotify bool `json:"NoDirnotify,omitempty"` + + // share is use for VM shared memory + VmSharedMemory bool `json:"VmSharedMemory,omitempty"` + + // allow access only to the files specified in AllowedFiles + RestrictFileAccess bool `json:"RestrictFileAccess,omitempty"` + + // disable all oplocks except Level II + ForceLevelIIOplocks bool `json:"ForceLevelIIOplocks,omitempty"` + + // Allow the host to reparse this base layer + ReparseBaseLayer bool `json:"ReparseBaseLayer,omitempty"` + + // Enable pseudo-oplocks + PseudoOplocks bool `json:"PseudoOplocks,omitempty"` + + // All opens will use non-cached IO + NonCacheIo bool `json:"NonCacheIo,omitempty"` + + // Enable pseudo directory change notifications + PseudoDirnotify bool `json:"PseudoDirnotify,omitempty"` + + // Block directory enumeration, renames, and deletes. + SingleFileMapping bool `json:"SingleFileMapping,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go new file mode 100644 index 000000000..39f628667 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VmMemory struct { + + AvailableMemory int32 `json:"AvailableMemory,omitempty"` + + AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` + + ReservedMemory int32 `json:"ReservedMemory,omitempty"` + + AssignedMemory int32 `json:"AssignedMemory,omitempty"` + + SlpActive bool `json:"SlpActive,omitempty"` + + BalancingEnabled bool `json:"BalancingEnabled,omitempty"` + + DmOperationInProgress bool `json:"DmOperationInProgress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go new file mode 100644 index 000000000..cf632bbc8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type WindowsCrashReporting struct { + + DumpFileName string `json:"DumpFileName,omitempty"` + + MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go new file mode 100644 index 000000000..ff3b6572e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go @@ -0,0 +1,70 @@ +package timeout + +import ( + "os" + "strconv" + "time" +) + +var ( + // defaultTimeout is the timeout for most operations that is not overridden. + defaultTimeout = 4 * time.Minute + + // defaultTimeoutTestdRetry is the retry loop timeout for testd to respond + // for a disk to come online in LCOW. + defaultTimeoutTestdRetry = 5 * time.Second +) + +// External variables for HCSShim consumers to use. +var ( + // SystemCreate is the timeout for creating a compute system + SystemCreate time.Duration = defaultTimeout + + // SystemStart is the timeout for starting a compute system + SystemStart time.Duration = defaultTimeout + + // SystemPause is the timeout for pausing a compute system + SystemPause time.Duration = defaultTimeout + + // SystemResume is the timeout for resuming a compute system + SystemResume time.Duration = defaultTimeout + + // SyscallWatcher is the timeout before warning of a potential stuck platform syscall. + SyscallWatcher time.Duration = defaultTimeout + + // Tar2VHD is the timeout for the tar2vhd operation to complete + Tar2VHD time.Duration = defaultTimeout + + // ExternalCommandToStart is the timeout for external commands to start + ExternalCommandToStart = defaultTimeout + + // ExternalCommandToComplete is the timeout for external commands to complete. + // Generally this means copying data from their stdio pipes. + ExternalCommandToComplete = defaultTimeout + + // TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW + TestDRetryLoop = defaultTimeoutTestdRetry +) + +func init() { + SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate) + SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart) + SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause) + SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume) + SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher) + Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD) + ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart) + ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete) + TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop) +} + +func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration { + envTimeout := os.Getenv(env) + if len(envTimeout) > 0 { + e, err := strconv.Atoi(envTimeout) + if err == nil && e > 0 { + return time.Second * time.Duration(e) + } + } + return defaultValue +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go new file mode 100644 index 000000000..3a0d4bc58 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(path string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"path %s", path) + + err := activateLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go index 9babd4e18..5784241df 100644 --- a/vendor/github.com/Microsoft/hcsshim/baselayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import ( "errors" @@ -7,10 +7,12 @@ import ( "syscall" "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/safefile" ) type baseLayerWriter struct { - root string + root *os.File f *os.File bw *winio.BackupFileWriter err error @@ -26,10 +28,10 @@ type dirInfo struct { // reapplyDirectoryTimes reapplies directory modification, creation, etc. times // after processing of the directory tree has completed. The times are expected // to be ordered such that parent directories come before child directories. -func reapplyDirectoryTimes(dis []dirInfo) error { +func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { for i := range dis { di := &dis[len(dis)-i-1] // reverse order: process child directories first - f, err := winio.OpenForBackup(di.path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING) + f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE) if err != nil { return err } @@ -75,12 +77,6 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e w.hasUtilityVM = true } - path := filepath.Join(w.root, name) - path, err = makeLongAbsPath(path) - if err != nil { - return err - } - var f *os.File defer func() { if f != nil { @@ -88,27 +84,23 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e } }() - createmode := uint32(syscall.CREATE_NEW) + extraFlags := uint32(0) if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { - err := os.Mkdir(path, 0) - if err != nil && !os.IsExist(err) { - return err - } - createmode = syscall.OPEN_EXISTING + extraFlags |= safefile.FILE_DIRECTORY_FILE if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { - w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo}) + w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) } } mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) - f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode) + f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags) if err != nil { - return makeError(err, "Failed to OpenForBackup", path) + return hcserror.New(err, "Failed to safefile.OpenRelative", name) } err = winio.SetFileBasicInfo(f, fileInfo) if err != nil { - return makeError(err, "Failed to SetFileBasicInfo", path) + return hcserror.New(err, "Failed to SetFileBasicInfo", name) } w.f = f @@ -129,17 +121,7 @@ func (w *baseLayerWriter) AddLink(name string, target string) (err error) { return err } - linkpath, err := makeLongAbsPath(filepath.Join(w.root, name)) - if err != nil { - return err - } - - linktarget, err := makeLongAbsPath(filepath.Join(w.root, target)) - if err != nil { - return err - } - - return os.Link(linktarget, linkpath) + return safefile.LinkRelative(target, w.root, name, w.root) } func (w *baseLayerWriter) Remove(name string) error { @@ -155,6 +137,10 @@ func (w *baseLayerWriter) Write(b []byte) (int, error) { } func (w *baseLayerWriter) Close() error { + defer func() { + w.root.Close() + w.root = nil + }() err := w.closeCurrentFile() if err != nil { return err @@ -162,18 +148,22 @@ func (w *baseLayerWriter) Close() error { if w.err == nil { // Restore the file times of all the directories, since they may have // been modified by creating child directories. - err = reapplyDirectoryTimes(w.dirInfo) + err = reapplyDirectoryTimes(w.root, w.dirInfo) if err != nil { return err } - err = ProcessBaseLayer(w.root) + err = ProcessBaseLayer(w.root.Name()) if err != nil { return err } if w.hasUtilityVM { - err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM")) + err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root) + if err != nil { + return err + } + err = ProcessUtilityVMImage(filepath.Join(w.root.Name(), "UtilityVM")) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go new file mode 100644 index 000000000..d15817730 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(path, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"ID %s parent %s", path, parent) + + err := createLayer(&stdDriverInfo, path, parent) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s parent=%s", path, parent) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s parent=%s", path, parent) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go new file mode 100644 index 000000000..bf2fece19 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -0,0 +1,31 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// CreateScratchLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateScratchLayer(path string, parentLayerPaths []string) error { + title := "hcsshim::CreateScratchLayer " + logrus.Debugf(title+"path %s", path) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = createSandboxLayer(&stdDriverInfo, path, 0, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go new file mode 100644 index 000000000..b998f8a19 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(path string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"path %s", path) + + err := deactivateLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go new file mode 100644 index 000000000..dc14cecc4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// DestroyLayer will remove the on-disk files representing the layer with the given +// path, including that layer's containing folder, if any. +func DestroyLayer(path string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"path %s", path) + + err := destroyLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go new file mode 100644 index 000000000..7832bb452 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ExpandScratchSize expands the size of a layer to at least size bytes. +func ExpandScratchSize(path string, size uint64) error { + title := "hcsshim::ExpandScratchSize " + logrus.Debugf(title+"path=%s size=%d", path, size) + + err := expandSandboxSize(&stdDriverInfo, path, size) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s size=%d", path, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s size=%d", path, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go new file mode 100644 index 000000000..d43e941ee --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -0,0 +1,68 @@ +package wclayer + +import ( + "io/ioutil" + "os" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ExportLayer " + logrus.Debugf(title+"path %s folder %s", path, exportFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath) + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) { + exportPath, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(path, exportPath, parentLayerPaths) + if err != nil { + os.RemoveAll(exportPath) + return nil, err + } + return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil +} + +type legacyLayerReaderWrapper struct { + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() error { + err := r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go index 89f8079d0..8c37549a0 100644 --- a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -1,34 +1,28 @@ -package hcsshim +package wclayer import ( "syscall" + "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) -// GetLayerMountPath will look for a mounted layer with the given id and return +// GetLayerMountPath will look for a mounted layer with the given path and return // the path at which that layer can be accessed. This path may be a volume path // if the layer is a mounted read-write layer, otherwise it is expected to be the // folder path at which the layer is stored. -func GetLayerMountPath(info DriverInfo, id string) (string, error) { +func GetLayerMountPath(path string) (string, error) { title := "hcsshim::GetLayerMountPath " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return "", err - } + logrus.Debugf(title+"path %s", path) var mountPathLength uintptr mountPathLength = 0 // Call the procedure itself. logrus.Debugf("Calling proc (1)") - err = getLayerMountPath(&infop, id, &mountPathLength, nil) + err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil) if err != nil { - err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) + err = hcserror.Errorf(err, title, "(first call) path=%s", path) logrus.Error(err) return "", err } @@ -42,14 +36,14 @@ func GetLayerMountPath(info DriverInfo, id string) (string, error) { // Call the procedure again logrus.Debugf("Calling proc (2)") - err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) + err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0]) if err != nil { - err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) + err = hcserror.Errorf(err, title, "(second call) path=%s", path) logrus.Error(err) return "", err } - path := syscall.UTF16ToString(mountPathp[0:]) - logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) - return path, nil + mountPath := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath) + return mountPath, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go index 05d3d9532..10899c68a 100644 --- a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -1,6 +1,10 @@ -package hcsshim +package wclayer -import "github.com/sirupsen/logrus" +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) // GetSharedBaseImages will enumerate the images stored in the common central // image store and return descriptive info about those images for the purpose @@ -12,11 +16,11 @@ func GetSharedBaseImages() (imageData string, err error) { var buffer *uint16 err = getBaseImages(&buffer) if err != nil { - err = makeError(err, title, "") + err = hcserror.New(err, title, "") logrus.Error(err) return } - imageData = convertAndFreeCoTaskMemString(buffer) + imageData = interop.ConvertAndFreeCoTaskMemString(buffer) logrus.Debugf(title+" - succeeded output=%s", imageData) return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go new file mode 100644 index 000000000..d86e67827 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// GrantVmAccess adds access to a file for a given VM +func GrantVmAccess(vmid string, filepath string) error { + title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath) + logrus.Debugf(title) + + err := grantVmAccess(vmid, filepath) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", filepath) + logrus.Error(err) + return err + } + + logrus.Debugf(title + " - succeeded") + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go new file mode 100644 index 000000000..486d55470 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -0,0 +1,127 @@ +package wclayer + +import ( + "io/ioutil" + "os" + "path/filepath" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/sirupsen/logrus" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ImportLayer " + logrus.Debugf(title+"path %s folder %s", path, importFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = importLayer(&stdDriverInfo, path, importFolderPath, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath) + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +type legacyLayerWriterWrapper struct { + *legacyLayerWriter + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() error { + defer os.RemoveAll(r.root.Name()) + defer r.legacyLayerWriter.CloseRoots() + err := r.legacyLayerWriter.Close() + if err != nil { + return err + } + + if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { + return err + } + for _, name := range r.Tombstones { + if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) { + return err + } + } + // Add any hard links that were collected. + for _, lnk := range r.PendingLinks { + if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) { + return err + } + if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil { + return err + } + } + // Prepare the utility VM for use if one is present in the layer. + if r.HasUtilityVM { + err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot) + if err != nil { + return err + } + err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM")) + if err != nil { + return err + } + } + return nil +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) { + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + f, err := safefile.OpenRoot(path) + if err != nil { + return nil, err + } + return &baseLayerWriter{ + root: f, + }, nil + } + + importPath, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path) + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + legacyLayerWriter: w, + path: importPath, + parentLayerPaths: parentLayerPaths, + }, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go new file mode 100644 index 000000000..71287ff8a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(path string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"path %s", path) + + // Call the procedure itself. + var exists uint32 + err := layerExists(&stdDriverInfo, path, &exists) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go new file mode 100644 index 000000000..90df3bedc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -0,0 +1,13 @@ +package wclayer + +import ( + "path/filepath" + + "github.com/Microsoft/hcsshim/internal/guid" +) + +// LayerID returns the layer ID of a layer on disk. +func LayerID(path string) (guid.GUID, error) { + _, file := filepath.Split(path) + return NameToGuid(file) +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index c0e550377..a1b8b9882 100644 --- a/vendor/github.com/Microsoft/hcsshim/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -1,12 +1,12 @@ -package hcsshim +package wclayer // This file contains utility functions to support storage (graph) related // functionality. import ( - "path/filepath" "syscall" + "github.com/Microsoft/hcsshim/internal/guid" "github.com/sirupsen/logrus" ) @@ -22,28 +22,16 @@ struct DriverInfo { LPCWSTR HomeDir; }; */ -type DriverInfo struct { - Flavour int - HomeDir string -} type driverInfo struct { Flavour int HomeDirp *uint16 } -func convertDriverInfo(info DriverInfo) (driverInfo, error) { - homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) - if err != nil { - logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) - return driverInfo{}, err - } - - return driverInfo{ - Flavour: info.Flavour, - HomeDirp: homedirp, - }, nil -} +var ( + utf16EmptyString uint16 + stdDriverInfo = driverInfo{1, &utf16EmptyString} +) /* To pass into syscall, we need a struct matching the following: typedef struct _WC_LAYER_DESCRIPTOR { @@ -75,7 +63,7 @@ typedef struct _WC_LAYER_DESCRIPTOR { } WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; */ type WC_LAYER_DESCRIPTOR struct { - LayerId GUID + LayerId guid.GUID Flags uint32 Pathp *uint16 } @@ -85,10 +73,7 @@ func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, var layers []WC_LAYER_DESCRIPTOR for i := 0; i < len(parentLayerPaths); i++ { - // Create a layer descriptor, using the folder name - // as the source for a GUID LayerId - _, folderName := filepath.Split(parentLayerPaths[i]) - g, err := NameToGuid(folderName) + g, err := LayerID(parentLayerPaths[i]) if err != nil { logrus.Debugf("Failed to convert name to guid %s", err) return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go index c7f6073ac..b8ea5d263 100644 --- a/vendor/github.com/Microsoft/hcsshim/legacy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import ( "bufio" @@ -6,12 +6,15 @@ import ( "errors" "fmt" "io" + "io/ioutil" "os" "path/filepath" "strings" "syscall" "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/safefile" ) var errorIterationCanceled = errors.New("") @@ -34,23 +37,6 @@ func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) } -func makeLongAbsPath(path string) (string, error) { - if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { - return path, nil - } - if !filepath.IsAbs(path) { - absPath, err := filepath.Abs(path) - if err != nil { - return "", err - } - path = absPath - } - if strings.HasPrefix(path, `\\`) { - return `\\?\UNC\` + path[2:], nil - } - return `\\?\` + path, nil -} - func hasPathPrefix(p, prefix string) bool { return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' } @@ -106,7 +92,7 @@ func readTombstones(path string) (map[string]([]string), error) { } func (r *legacyLayerReader) walkUntilCancelled() error { - root, err := makeLongAbsPath(r.root) + root, err := longpath.LongAbs(r.root) if err != nil { return err } @@ -121,6 +107,16 @@ func (r *legacyLayerReader) walkUntilCancelled() error { if err != nil { return err } + + // Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048. + // Handle failure from what may be a golang bug in the conversion of + // UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat + // which is called by filepath.Walk will fail when a filename contains + // unicode characters. Skip the recycle bin regardless which is goodness. + if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() { + return filepath.SkipDir + } + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { return nil } @@ -273,7 +269,7 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil if err != nil { return } - fileInfo.FileAttributes = uintptr(attr) + fileInfo.FileAttributes = attr beginning := int64(4) // Find the accurate file size. @@ -326,59 +322,81 @@ func (r *legacyLayerReader) Close() error { type pendingLink struct { Path, Target string + TargetRoot *os.File +} + +type pendingDir struct { + Path string + Root *os.File } type legacyLayerWriter struct { - root string - parentRoots []string - destRoot string - currentFile *os.File - backupWriter *winio.BackupFileWriter - tombstones []string - pathFixed bool - HasUtilityVM bool - uvmDi []dirInfo - addedFiles map[string]bool - PendingLinks []pendingLink + root *os.File + destRoot *os.File + parentRoots []*os.File + currentFile *os.File + bufWriter *bufio.Writer + currentFileName string + currentFileRoot *os.File + backupWriter *winio.BackupFileWriter + Tombstones []string + HasUtilityVM bool + uvmDi []dirInfo + addedFiles map[string]bool + PendingLinks []pendingLink + pendingDirs []pendingDir + currentIsDir bool } // newLegacyLayerWriter returns a LayerWriter that can write the contaler layer // transport format to disk. -func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) *legacyLayerWriter { - return &legacyLayerWriter{ - root: root, - parentRoots: parentRoots, - destRoot: destRoot, - addedFiles: make(map[string]bool), +func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) { + w = &legacyLayerWriter{ + addedFiles: make(map[string]bool), } -} - -func (w *legacyLayerWriter) init() error { - if !w.pathFixed { - path, err := makeLongAbsPath(w.root) + defer func() { if err != nil { - return err - } - for i, p := range w.parentRoots { - w.parentRoots[i], err = makeLongAbsPath(p) - if err != nil { - return err - } + w.CloseRoots() + w = nil } - destPath, err := makeLongAbsPath(w.destRoot) + }() + w.root, err = safefile.OpenRoot(root) + if err != nil { + return + } + w.destRoot, err = safefile.OpenRoot(destRoot) + if err != nil { + return + } + for _, r := range parentRoots { + f, err := safefile.OpenRoot(r) if err != nil { - return err + return w, err } - w.root = path - w.destRoot = destPath - w.pathFixed = true + w.parentRoots = append(w.parentRoots, f) } - return nil + w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536) + return +} + +func (w *legacyLayerWriter) CloseRoots() { + if w.root != nil { + w.root.Close() + w.root = nil + } + if w.destRoot != nil { + w.destRoot.Close() + w.destRoot = nil + } + for i := range w.parentRoots { + w.parentRoots[i].Close() + } + w.parentRoots = nil } func (w *legacyLayerWriter) initUtilityVM() error { if !w.HasUtilityVM { - err := os.Mkdir(filepath.Join(w.destRoot, utilityVMPath), 0) + err := safefile.MkdirRelative(utilityVMPath, w.destRoot) if err != nil { return err } @@ -386,7 +404,7 @@ func (w *legacyLayerWriter) initUtilityVM() error { // clone the utility VM from the parent layer into this layer. Use hard // links to avoid unnecessary copying, since most of the files are // immutable. - err = cloneTree(filepath.Join(w.parentRoots[0], utilityVMFilesPath), filepath.Join(w.destRoot, utilityVMFilesPath), mutatedUtilityVMFiles) + err = cloneTree(w.parentRoots[0], w.destRoot, utilityVMFilesPath, mutatedUtilityVMFiles) if err != nil { return fmt.Errorf("cloning the parent utility VM image failed: %s", err) } @@ -395,7 +413,45 @@ func (w *legacyLayerWriter) initUtilityVM() error { return nil } -func (w *legacyLayerWriter) reset() { +func (w *legacyLayerWriter) reset() error { + err := w.bufWriter.Flush() + if err != nil { + return err + } + w.bufWriter.Reset(ioutil.Discard) + if w.currentIsDir { + r := w.currentFile + br := winio.NewBackupStreamReader(r) + // Seek to the beginning of the backup stream, skipping the fileattrs + if _, err := r.Seek(4, io.SeekStart); err != nil { + return err + } + + for { + bhdr, err := br.Next() + if err == io.EOF { + // end of backupstream data + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupReparseData: + // The current file is a `.$wcidirs$` metadata file that + // describes a directory reparse point. Delete the placeholder + // directory to prevent future files being added into the + // destination of the reparse point during the ImportLayer call + if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil { + return err + } + w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot}) + default: + // ignore all other stream types, as we only care about directory reparse points + } + } + w.currentIsDir = false + } if w.backupWriter != nil { w.backupWriter.Close() w.backupWriter = nil @@ -403,21 +459,21 @@ func (w *legacyLayerWriter) reset() { if w.currentFile != nil { w.currentFile.Close() w.currentFile = nil + w.currentFileName = "" + w.currentFileRoot = nil } + return nil } // copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata -func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { - createDisposition := uint32(syscall.CREATE_NEW) - if isDir { - err = os.Mkdir(destPath, 0) - if err != nil { - return nil, err - } - createDisposition = syscall.OPEN_EXISTING - } - - src, err := openFileOrDir(srcPath, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.OPEN_EXISTING) +func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { + src, err := safefile.OpenRelative( + subPath, + srcRoot, + syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + safefile.FILE_OPEN, + safefile.FILE_OPEN_REPARSE_POINT) if err != nil { return nil, err } @@ -430,7 +486,17 @@ func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio return nil, err } - dest, err := openFileOrDir(destPath, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + extraFlags := uint32(0) + if isDir { + extraFlags |= safefile.FILE_DIRECTORY_FILE + } + dest, err := safefile.OpenRelative( + subPath, + destRoot, + syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + safefile.FILE_CREATE, + extraFlags) if err != nil { return nil, err } @@ -459,55 +525,57 @@ func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio // cloneTree clones a directory tree using hard links. It skips hard links for // the file names in the provided map and just copies those files. -func cloneTree(srcPath, destPath string, mutatedFiles map[string]bool) error { +func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error { var di []dirInfo - err := filepath.Walk(srcPath, func(srcFilePath string, info os.FileInfo, err error) error { + err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot) + if err != nil { + return err + } + err = filepath.Walk(filepath.Join(srcRoot.Name(), subPath), func(srcFilePath string, info os.FileInfo, err error) error { if err != nil { return err } - relPath, err := filepath.Rel(srcPath, srcFilePath) + relPath, err := filepath.Rel(srcRoot.Name(), srcFilePath) if err != nil { return err } - destFilePath := filepath.Join(destPath, relPath) + fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes // Directories, reparse points, and files that will be mutated during // utility VM import must be copied. All other files can be hard linked. - isReparsePoint := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 - if info.IsDir() || isReparsePoint || mutatedFiles[relPath] { - fi, err := copyFileWithMetadata(srcFilePath, destFilePath, info.IsDir()) + isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 + // In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink. + // See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc + // Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly + isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 + + if isDir || isReparsePoint || mutatedFiles[relPath] { + fi, err := copyFileWithMetadata(srcRoot, destRoot, relPath, isDir) if err != nil { return err } - if info.IsDir() && !isReparsePoint { - di = append(di, dirInfo{path: destFilePath, fileInfo: *fi}) + if isDir && !isReparsePoint { + di = append(di, dirInfo{path: relPath, fileInfo: *fi}) } } else { - err = os.Link(srcFilePath, destFilePath) + err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot) if err != nil { return err } } - // Don't recurse on reparse points. - if info.IsDir() && isReparsePoint { - return filepath.SkipDir - } - return nil }) if err != nil { return err } - return reapplyDirectoryTimes(di) + return reapplyDirectoryTimes(destRoot, di) } func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { - w.reset() - err := w.init() - if err != nil { + if err := w.reset(); err != nil { return err } @@ -515,6 +583,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro return w.initUtilityVM() } + name = filepath.Clean(name) if hasPathPrefix(name, utilityVMPath) { if !w.HasUtilityVM { return errors.New("missing UtilityVM directory") @@ -522,10 +591,9 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { return errors.New("invalid UtilityVM layer") } - path := filepath.Join(w.destRoot, name) - createDisposition := uint32(syscall.OPEN_EXISTING) + createDisposition := uint32(safefile.FILE_OPEN) if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { - st, err := os.Lstat(path) + st, err := safefile.LstatRelative(name, w.destRoot) if err != nil && !os.IsNotExist(err) { return err } @@ -533,37 +601,44 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro // Delete the existing file/directory if it is not the same type as this directory. existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { - if err = os.RemoveAll(path); err != nil { + if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil { return err } st = nil } } if st == nil { - if err = os.Mkdir(path, 0); err != nil { + if err = safefile.MkdirRelative(name, w.destRoot); err != nil { return err } } if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { - w.uvmDi = append(w.uvmDi, dirInfo{path: path, fileInfo: *fileInfo}) + w.uvmDi = append(w.uvmDi, dirInfo{path: name, fileInfo: *fileInfo}) } } else { // Overwrite any existing hard link. - err = os.Remove(path) + err := safefile.RemoveRelative(name, w.destRoot) if err != nil && !os.IsNotExist(err) { return err } - createDisposition = syscall.CREATE_NEW + createDisposition = safefile.FILE_CREATE } - f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + f, err := safefile.OpenRelative( + name, + w.destRoot, + syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + createDisposition, + safefile.FILE_OPEN_REPARSE_POINT, + ) if err != nil { return err } defer func() { if f != nil { f.Close() - os.Remove(path) + safefile.RemoveRelative(name, w.destRoot) } }() @@ -573,29 +648,33 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro } w.backupWriter = winio.NewBackupFileWriter(f, true) + w.bufWriter.Reset(w.backupWriter) w.currentFile = f + w.currentFileName = name + w.currentFileRoot = w.destRoot w.addedFiles[name] = true f = nil return nil } - path := filepath.Join(w.root, name) + fname := name if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { - err := os.Mkdir(path, 0) + err := safefile.MkdirRelative(name, w.root) if err != nil { return err } - path += ".$wcidirs$" + fname += ".$wcidirs$" + w.currentIsDir = true } - f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.CREATE_NEW) + f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0) if err != nil { return err } defer func() { if f != nil { f.Close() - os.Remove(path) + safefile.RemoveRelative(fname, w.root) } }() @@ -608,28 +687,32 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro if hasPathPrefix(name, hivesPath) { w.backupWriter = winio.NewBackupFileWriter(f, false) + w.bufWriter.Reset(w.backupWriter) } else { + w.bufWriter.Reset(f) // The file attributes are written before the stream. - err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes)) if err != nil { + w.bufWriter.Reset(ioutil.Discard) return err } } w.currentFile = f + w.currentFileName = name + w.currentFileRoot = w.root w.addedFiles[name] = true f = nil return nil } func (w *legacyLayerWriter) AddLink(name string, target string) error { - w.reset() - err := w.init() - if err != nil { + if err := w.reset(); err != nil { return err } - var roots []string + target = filepath.Clean(target) + var roots []*os.File if hasPathPrefix(target, filesPath) { // Look for cross-layer hard link targets in the parent layers, since // nothing is in the destination path yet. @@ -638,7 +721,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error { // Since the utility VM is fully cloned into the destination path // already, look for cross-layer hard link targets directly in the // destination path. - roots = []string{w.destRoot} + roots = []*os.File{w.destRoot} } if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) { @@ -647,12 +730,12 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error { // Find to try the target of the link in a previously added file. If that // fails, search in parent layers. - var selectedRoot string + var selectedRoot *os.File if _, ok := w.addedFiles[target]; ok { selectedRoot = w.destRoot } else { for _, r := range roots { - if _, err = os.Lstat(filepath.Join(r, target)); err != nil { + if _, err := safefile.LstatRelative(target, r); err != nil { if !os.IsNotExist(err) { return err } @@ -661,22 +744,25 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error { break } } - if selectedRoot == "" { + if selectedRoot == nil { return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target) } } + // The link can't be written until after the ImportLayer call. w.PendingLinks = append(w.PendingLinks, pendingLink{ - Path: filepath.Join(w.destRoot, name), - Target: filepath.Join(selectedRoot, target), + Path: name, + Target: target, + TargetRoot: selectedRoot, }) w.addedFiles[name] = true return nil } func (w *legacyLayerWriter) Remove(name string) error { + name = filepath.Clean(name) if hasPathPrefix(name, filesPath) { - w.tombstones = append(w.tombstones, name[len(filesPath)+1:]) + w.Tombstones = append(w.Tombstones, name) } else if hasPathPrefix(name, utilityVMFilesPath) { err := w.initUtilityVM() if err != nil { @@ -685,11 +771,10 @@ func (w *legacyLayerWriter) Remove(name string) error { // Make sure the path exists; os.RemoveAll will not fail if the file is // already gone, and this needs to be a fatal error for diagnostics // purposes. - path := filepath.Join(w.destRoot, name) - if _, err := os.Lstat(path); err != nil { + if _, err := safefile.LstatRelative(name, w.destRoot); err != nil { return err } - err = os.RemoveAll(path) + err = safefile.RemoveAllRelative(name, w.destRoot) if err != nil { return err } @@ -701,38 +786,27 @@ func (w *legacyLayerWriter) Remove(name string) error { } func (w *legacyLayerWriter) Write(b []byte) (int, error) { - if w.backupWriter == nil { - if w.currentFile == nil { - return 0, errors.New("closed") - } - return w.currentFile.Write(b) + if w.backupWriter == nil && w.currentFile == nil { + return 0, errors.New("closed") } - return w.backupWriter.Write(b) + return w.bufWriter.Write(b) } func (w *legacyLayerWriter) Close() error { - w.reset() - err := w.init() - if err != nil { + if err := w.reset(); err != nil { return err } - tf, err := os.Create(filepath.Join(w.root, "tombstones.txt")) - if err != nil { - return err - } - defer tf.Close() - _, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n")) - if err != nil { + if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) { return err } - for _, t := range w.tombstones { - _, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n")) + for _, pd := range w.pendingDirs { + err := safefile.MkdirRelative(pd.Path, pd.Root) if err != nil { return err } } if w.HasUtilityVM { - err = reapplyDirectoryTimes(w.uvmDi) + err := reapplyDirectoryTimes(w.destRoot, w.uvmDi) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go new file mode 100644 index 000000000..741994ba4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id guid.GUID, err error) { + title := "hcsshim::NameToGuid " + + err = nameToGuid(name, &id) + if err != nil { + err = hcserror.Errorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + logrus.Debugf(title+"name:%s guid:%s", name, id.String()) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go index 5c5b61841..bd4005dc4 100644 --- a/vendor/github.com/Microsoft/hcsshim/preparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -1,21 +1,22 @@ -package hcsshim +package wclayer import ( "sync" + "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) var prepareLayerLock sync.Mutex -// PrepareLayer finds a mounted read-write layer matching layerId and enables the +// PrepareLayer finds a mounted read-write layer matching path and enables the // the filesystem filter for use on that layer. This requires the paths to all // parent layers, and is necessary in order to view or interact with the layer // as an actual filesystem (reading and writing files, creating directories, etc). // Disabling the filter must be done via UnprepareLayer. -func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { +func PrepareLayer(path string, parentLayerPaths []string) error { title := "hcsshim::PrepareLayer " - logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + logrus.Debugf(title+"path %s", path) // Generate layer descriptors layers, err := layerPathsToDescriptors(parentLayerPaths) @@ -23,24 +24,17 @@ func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) er return err } - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - // This lock is a temporary workaround for a Windows bug. Only allowing one // call to prepareLayer at a time vastly reduces the chance of a timeout. prepareLayerLock.Lock() defer prepareLayerLock.Unlock() - err = prepareLayer(&infop, layerId, layers) + err = prepareLayer(&stdDriverInfo, path, layers) if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + err = hcserror.Errorf(err, title, "path=%s", path) logrus.Error(err) return err } - logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) + logrus.Debugf(title+"succeeded path=%s", path) return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go index fadb1b92c..884207c3e 100644 --- a/vendor/github.com/Microsoft/hcsshim/processimage.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import "os" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go new file mode 100644 index 000000000..5f1b4f4f4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(path string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"path %s", path) + + err := unprepareLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go new file mode 100644 index 000000000..78f2aacd8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -0,0 +1,27 @@ +package wclayer + +import "github.com/Microsoft/hcsshim/internal/guid" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? + +type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go new file mode 100644 index 000000000..2105703dc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -0,0 +1,457 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package wclayer + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") +) + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, parent, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func nameToGuid(name string, guid *_guid) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *_guid) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func grantVmAccess(vmid string, filepath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(vmid) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(filepath) + if hr != nil { + return + } + return _grantVmAccess(_p0, _p1) +} + +func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { + if hr = procGrantVmAccess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go new file mode 100644 index 000000000..df0e63bbd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -0,0 +1,106 @@ +package hcsshim + +import ( + "crypto/sha1" + "path/filepath" + + "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/hcsshim/internal/wclayer" +) + +func layerPath(info *DriverInfo, id string) string { + return filepath.Join(info.HomeDir, id) +} + +func ActivateLayer(info DriverInfo, id string) error { + return wclayer.ActivateLayer(layerPath(&info, id)) +} +func CreateLayer(info DriverInfo, id, parent string) error { + return wclayer.CreateLayer(layerPath(&info, id), parent) +} + +// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility. +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) +} +func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) +} +func DeactivateLayer(info DriverInfo, id string) error { + return wclayer.DeactivateLayer(layerPath(&info, id)) +} +func DestroyLayer(info DriverInfo, id string) error { + return wclayer.DestroyLayer(layerPath(&info, id)) +} + +// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) +} +func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) +} +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths) +} +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + return wclayer.GetLayerMountPath(layerPath(&info, id)) +} +func GetSharedBaseImages() (imageData string, err error) { + return wclayer.GetSharedBaseImages() +} +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths) +} +func LayerExists(info DriverInfo, id string) (bool, error) { + return wclayer.LayerExists(layerPath(&info, id)) +} +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths) +} +func ProcessBaseLayer(path string) error { + return wclayer.ProcessBaseLayer(path) +} +func ProcessUtilityVMImage(path string) error { + return wclayer.ProcessUtilityVMImage(path) +} +func UnprepareLayer(info DriverInfo, layerId string) error { + return wclayer.UnprepareLayer(layerPath(&info, layerId)) +} + +type DriverInfo struct { + Flavour int + HomeDir string +} + +type GUID [16]byte + +func NameToGuid(name string) (id GUID, err error) { + g, err := wclayer.NameToGuid(name) + return GUID(g), err +} + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return (guid.GUID)(*g).String() +} + +type LayerReader = wclayer.LayerReader + +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths) +} + +type LayerWriter = wclayer.LayerWriter + +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths) +} + +type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go deleted file mode 100644 index fe46f404c..000000000 --- a/vendor/github.com/Microsoft/hcsshim/layerexists.go +++ /dev/null @@ -1,30 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// LayerExists will return true if a layer with the given id exists and is known -// to the system. -func LayerExists(info DriverInfo, id string) (bool, error) { - title := "hcsshim::LayerExists " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return false, err - } - - // Call the procedure itself. - var exists uint32 - - err = layerExists(&infop, id, &exists) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return false, err - } - - logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists) - return exists != 0, nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go deleted file mode 100644 index b7c6d020c..000000000 --- a/vendor/github.com/Microsoft/hcsshim/nametoguid.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// NameToGuid converts the given string into a GUID using the algorithm in the -// Host Compute Service, ensuring GUIDs generated with the same string are common -// across all clients. -func NameToGuid(name string) (id GUID, err error) { - title := "hcsshim::NameToGuid " - logrus.Debugf(title+"Name %s", name) - - err = nameToGuid(name, &id) - if err != nil { - err = makeErrorf(err, title, "name=%s", name) - logrus.Error(err) - return - } - - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index faee2cfee..ca8acbb7c 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,384 +1,72 @@ package hcsshim import ( - "encoding/json" "io" - "sync" - "syscall" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hcs" ) // ContainerError is an error encountered in HCS type process struct { - handleLock sync.RWMutex - handle hcsProcess - processID int - container *container - cachedPipes *cachedPipes - callbackNumber uintptr + p *hcs.Process } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - -type processModifyRequest struct { - Operation string - ConsoleSize *consoleSize `json:",omitempty"` - CloseHandle *closeHandle `json:",omitempty"` -} - -type consoleSize struct { - Height uint16 - Width uint16 -} - -type closeHandle struct { - Handle string -} - -type processStatus struct { - ProcessID uint32 - Exited bool - ExitCode uint32 - LastWaitResult int32 -} - -const ( - stdIn string = "StdIn" - stdOut string = "StdOut" - stdErr string = "StdErr" -) - -const ( - modifyConsoleSize string = "ConsoleSize" - modifyCloseHandle string = "CloseHandle" -) - // Pid returns the process ID of the process within the container. func (process *process) Pid() int { - return process.processID + return process.p.Pid() } // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "Kill" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsTerminateProcess(process.handle, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.Kill(), process) } // Wait waits for the process to exit. func (process *process) Wait() error { - operation := "Wait" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.Wait(), process) } // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - operation := "WaitTimeout" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.WaitTimeout(timeout), process) } // ExitCode returns the exit code of the process. The process must have // already terminated. func (process *process) ExitCode() (int, error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "ExitCode" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return 0, makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - properties, err := process.properties() + code, err := process.p.ExitCode() if err != nil { - return 0, makeProcessError(process, operation, "", err) - } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, "", ErrInvalidProcessState) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult)) + err = convertProcessError(err, process) } - - logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode) - return int(properties.ExitCode), nil + return code, err } // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "ResizeConsole" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - modifyRequest := processModifyRequest{ - Operation: modifyConsoleSize, - ConsoleSize: &consoleSize{ - Height: height, - Width: width, - }, - } - - modifyRequestb, err := json.Marshal(modifyRequest) - if err != nil { - return err - } - - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil -} - -func (process *process) properties() (*processStatus, error) { - operation := "properties" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - var ( - resultp *uint16 - propertiesp *uint16 - ) - err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, err - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) - - properties := &processStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, err - } - - logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) - return properties, nil + return convertProcessError(process.p.ResizeConsole(width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "Stdio" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, "", err) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil - } - - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + stdin, stdout, stderr, err := process.p.Stdio() if err != nil { - return nil, nil, nil, makeProcessError(process, operation, "", err) + err = convertProcessError(err, process) } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return pipes[0], pipes[1], pipes[2], nil + return stdin, stdout, stderr, err } // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "CloseStdin" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - modifyRequest := processModifyRequest{ - Operation: modifyCloseHandle, - CloseHandle: &closeHandle{ - Handle: stdIn, - }, - } - - modifyRequestb, err := json.Marshal(modifyRequest) - if err != nil { - return err - } - - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.CloseStdin(), process) } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *process) Close() error { - process.handleLock.Lock() - defer process.handleLock.Unlock() - operation := "Close" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - // Don't double free this - if process.handle == 0 { - return nil - } - - if err := process.unregisterCallback(); err != nil { - return makeProcessError(process, operation, "", err) - } - - if err := hcsCloseProcess(process.handle); err != nil { - return makeProcessError(process, operation, "", err) - } - - process.handle = 0 - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil -} - -func (process *process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), - } - - callbackMapLock.Lock() - callbackNumber := nextCallback - nextCallback++ - callbackMap[callbackNumber] = context - callbackMapLock.Unlock() - - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) - if err != nil { - return err - } - context.handle = callbackHandle - process.callbackNumber = callbackNumber - - return nil -} - -func (process *process) unregisterCallback() error { - callbackNumber := process.callbackNumber - - callbackMapLock.RLock() - context := callbackMap[callbackNumber] - callbackMapLock.RUnlock() - - if context == nil { - return nil - } - - handle := context.handle - - if handle == 0 { - return nil - } - - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) - if err != nil { - return err - } - - closeChannels(context.channels) - - callbackMapLock.Lock() - callbackMap[callbackNumber] = nil - callbackMapLock.Unlock() - - handle = 0 - - return nil + return convertProcessError(process.p.Close(), process) } diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go deleted file mode 100644 index e8a3b507b..000000000 --- a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go +++ /dev/null @@ -1,27 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// UnprepareLayer disables the filesystem filter for the read-write layer with -// the given id. -func UnprepareLayer(info DriverInfo, layerId string) error { - title := "hcsshim::UnprepareLayer " - logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = unprepareLayer(&infop, layerId) - if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go deleted file mode 100644 index ae10c23d4..000000000 --- a/vendor/github.com/Microsoft/hcsshim/version.go +++ /dev/null @@ -1,7 +0,0 @@ -package hcsshim - -// IsTP4 returns whether the currently running Windows build is at least TP4. -func IsTP4() bool { - // HNSCall was not present in TP4 - return procHNSCall.Find() != nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go deleted file mode 100644 index 5d1a851ae..000000000 --- a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go +++ /dev/null @@ -1,1042 +0,0 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT - -package hcsshim - -import ( - "syscall" - "unsafe" - - "github.com/Microsoft/go-winio" - "golang.org/x/sys/windows" -) - -var _ unsafe.Pointer - -// Do the interface allocations only once for common -// Errno values. -const ( - errnoERROR_IO_PENDING = 997 -) - -var ( - errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) -) - -// errnoErr returns common boxed Errno values, to prevent -// allocations at runtime. -func errnoErr(e syscall.Errno) error { - switch e { - case 0: - return nil - case errnoERROR_IO_PENDING: - return errERROR_IO_PENDING - } - // TODO: add more here, after collecting data on the common - // error values see on Windows. (perhaps when running - // all.bat?) - return e -} - -var ( - modole32 = windows.NewLazySystemDLL("ole32.dll") - modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") - modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - - procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") - procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") - procActivateLayer = modvmcompute.NewProc("ActivateLayer") - procCopyLayer = modvmcompute.NewProc("CopyLayer") - procCreateLayer = modvmcompute.NewProc("CreateLayer") - procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") - procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") - procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") - procDestroyLayer = modvmcompute.NewProc("DestroyLayer") - procExportLayer = modvmcompute.NewProc("ExportLayer") - procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") - procGetBaseImages = modvmcompute.NewProc("GetBaseImages") - procImportLayer = modvmcompute.NewProc("ImportLayer") - procLayerExists = modvmcompute.NewProc("LayerExists") - procNameToGuid = modvmcompute.NewProc("NameToGuid") - procPrepareLayer = modvmcompute.NewProc("PrepareLayer") - procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") - procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") - procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") - procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") - procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") - procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") - procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") - procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") - procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") - procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") - procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") - procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") - procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") - procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") - procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") - procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") - procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") - procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") - procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") - procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") - procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") - procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") - procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") - procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") - procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") - procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") - procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") - procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") - procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") - procHNSCall = modvmcompute.NewProc("HNSCall") -) - -func coTaskMemFree(buffer unsafe.Pointer) { - syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) - return -} - -func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { - r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func activateLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _activateLayer(info, _p0) -} - -func _activateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procActivateLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(srcId) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(dstId) - if hr != nil { - return - } - return _copyLayer(info, _p0, _p1, descriptors) -} - -func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procCopyLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func createLayer(info *driverInfo, id string, parent string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(parent) - if hr != nil { - return - } - return _createLayer(info, _p0, _p1) -} - -func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { - if hr = procCreateLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(parent) - if hr != nil { - return - } - return _createSandboxLayer(info, _p0, _p1, descriptors) -} - -func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procCreateSandboxLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _expandSandboxSize(info, _p0, size) -} - -func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { - if hr = procExpandSandboxSize.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func deactivateLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _deactivateLayer(info, _p0) -} - -func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDeactivateLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func destroyLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _destroyLayer(info, _p0) -} - -func _destroyLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDestroyLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _exportLayer(info, _p0, _p1, descriptors) -} - -func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procExportLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _getLayerMountPath(info, _p0, length, buffer) -} - -func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { - if hr = procGetLayerMountPath.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func getBaseImages(buffer **uint16) (hr error) { - if hr = procGetBaseImages.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _importLayer(info, _p0, _p1, descriptors) -} - -func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procImportLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _layerExists(info, _p0, exists) -} - -func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { - if hr = procLayerExists.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func nameToGuid(name string, guid *GUID) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(name) - if hr != nil { - return - } - return _nameToGuid(_p0, guid) -} - -func _nameToGuid(name *uint16, guid *GUID) (hr error) { - if hr = procNameToGuid.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _prepareLayer(info, _p0, descriptors) -} - -func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procPrepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func unprepareLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _unprepareLayer(info, _p0) -} - -func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procUnprepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func processBaseImage(path string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _processBaseImage(_p0) -} - -func _processBaseImage(path *uint16) (hr error) { - if hr = procProcessBaseImage.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func processUtilityImage(path string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _processUtilityImage(_p0) -} - -func _processUtilityImage(path *uint16) (hr error) { - if hr = procProcessUtilityImage.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _importLayerBegin(info, _p0, descriptors, context) -} - -func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procImportLayerBegin.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(fileName) - if hr != nil { - return - } - return _importLayerNext(context, _p0, fileInfo) -} - -func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { - if hr = procImportLayerNext.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerWrite(context uintptr, buffer []byte) (hr error) { - var _p0 *byte - if len(buffer) > 0 { - _p0 = &buffer[0] - } - if hr = procImportLayerWrite.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerEnd(context uintptr) (hr error) { - if hr = procImportLayerEnd.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _exportLayerBegin(info, _p0, descriptors, context) -} - -func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procExportLayerBegin.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { - if hr = procExportLayerNext.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { - var _p0 *byte - if len(buffer) > 0 { - _p0 = &buffer[0] - } - if hr = procExportLayerRead.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerEnd(context uintptr) (hr error) { - if hr = procExportLayerEnd.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) - if hr != nil { - return - } - return _hcsEnumerateComputeSystems(_p0, computeSystems, result) -} - -func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { - if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(configuration) - if hr != nil { - return - } - return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) -} - -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { - if hr = procHcsCreateComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _hcsOpenComputeSystem(_p0, computeSystem, result) -} - -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { - if hr = procHcsOpenComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { - if hr = procHcsCloseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsStartComputeSystem(computeSystem, _p0, result) -} - -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsStartComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsShutdownComputeSystem(computeSystem, _p0, result) -} - -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsShutdownComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsTerminateComputeSystem(computeSystem, _p0, result) -} - -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsPauseComputeSystem(computeSystem, _p0, result) -} - -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsPauseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsResumeComputeSystem(computeSystem, _p0, result) -} - -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsResumeComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) - if hr != nil { - return - } - return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) -} - -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(configuration) - if hr != nil { - return - } - return _hcsModifyComputeSystem(computeSystem, _p0, result) -} - -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { - if hr = procHcsModifyComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { - if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { - if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(processParameters) - if hr != nil { - return - } - return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) -} - -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { - if hr = procHcsCreateProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { - if hr = procHcsOpenProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCloseProcess(process hcsProcess) (hr error) { - if hr = procHcsCloseProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { - if hr = procHcsGetProcessInfo.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { - if hr = procHcsGetProcessProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcsModifyProcess(process, _p0, result) -} - -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) - if hr != nil { - return - } - return _hcsGetServiceProperties(_p0, properties, result) -} - -func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetServiceProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { - if hr = procHcsRegisterProcessCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { - if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcsModifyServiceSettings(_p0, result) -} - -func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyServiceSettings.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func _hnsCall(method string, path string, object string, response **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(method) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - var _p2 *uint16 - _p2, hr = syscall.UTF16PtrFromString(object) - if hr != nil { - return - } - return __hnsCall(_p0, _p1, _p2, response) -} - -func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - if hr = procHNSCall.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go new file mode 100644 index 000000000..d2dff9cb0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go @@ -0,0 +1,52 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") +) + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} |