vendor: update everything

* If possible, update each dependency to the latest available version.

* Use releases over commit IDs and avoid vendoring branches.

Signed-off-by: Valentin Rothberg <rothberg@redhat.com>

170 files changed, 8051 insertions, 4169 deletions

diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/tar.go b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go
index 53da908f1..d6566dbf0 100644
--- a/vendor/github.com/Microsoft/go-winio/backuptar/tar.go
+++ b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go
@@ -303,7 +303,7 @@ func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *win
 		if err != nil {
 			return "", 0, nil, err
 		}
-		fileInfo.FileAttributes = uintptr(attr)
+		fileInfo.FileAttributes = uint32(attr)
 	} else {
 		if hdr.Typeflag == tar.TypeDir {
 			fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY
diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go
index b37e930d6..4051c1b33 100644
--- a/vendor/github.com/Microsoft/go-winio/ea.go
+++ b/vendor/github.com/Microsoft/go-winio/ea.go
@@ -1,137 +1,137 @@
-package winio

-

-import (

-	"bytes"

-	"encoding/binary"

-	"errors"

-)

-

-type fileFullEaInformation struct {

-	NextEntryOffset uint32

-	Flags           uint8

-	NameLength      uint8

-	ValueLength     uint16

-}

-

-var (

-	fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})

-

-	errInvalidEaBuffer = errors.New("invalid extended attribute buffer")

-	errEaNameTooLarge  = errors.New("extended attribute name too large")

-	errEaValueTooLarge = errors.New("extended attribute value too large")

-)

-

-// ExtendedAttribute represents a single Windows EA.

-type ExtendedAttribute struct {

-	Name  string

-	Value []byte

-	Flags uint8

-}

-

-func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {

-	var info fileFullEaInformation

-	err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)

-	if err != nil {

-		err = errInvalidEaBuffer

-		return

-	}

-

-	nameOffset := fileFullEaInformationSize

-	nameLen := int(info.NameLength)

-	valueOffset := nameOffset + int(info.NameLength) + 1

-	valueLen := int(info.ValueLength)

-	nextOffset := int(info.NextEntryOffset)

-	if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {

-		err = errInvalidEaBuffer

-		return

-	}

-

-	ea.Name = string(b[nameOffset : nameOffset+nameLen])

-	ea.Value = b[valueOffset : valueOffset+valueLen]

-	ea.Flags = info.Flags

-	if info.NextEntryOffset != 0 {

-		nb = b[info.NextEntryOffset:]

-	}

-	return

-}

-

-// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION

-// buffer retrieved from BackupRead, ZwQueryEaFile, etc.

-func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {

-	for len(b) != 0 {

-		ea, nb, err := parseEa(b)

-		if err != nil {

-			return nil, err

-		}

-

-		eas = append(eas, ea)

-		b = nb

-	}

-	return

-}

-

-func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {

-	if int(uint8(len(ea.Name))) != len(ea.Name) {

-		return errEaNameTooLarge

-	}

-	if int(uint16(len(ea.Value))) != len(ea.Value) {

-		return errEaValueTooLarge

-	}

-	entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))

-	withPadding := (entrySize + 3) &^ 3

-	nextOffset := uint32(0)

-	if !last {

-		nextOffset = withPadding

-	}

-	info := fileFullEaInformation{

-		NextEntryOffset: nextOffset,

-		Flags:           ea.Flags,

-		NameLength:      uint8(len(ea.Name)),

-		ValueLength:     uint16(len(ea.Value)),

-	}

-

-	err := binary.Write(buf, binary.LittleEndian, &info)

-	if err != nil {

-		return err

-	}

-

-	_, err = buf.Write([]byte(ea.Name))

-	if err != nil {

-		return err

-	}

-

-	err = buf.WriteByte(0)

-	if err != nil {

-		return err

-	}

-

-	_, err = buf.Write(ea.Value)

-	if err != nil {

-		return err

-	}

-

-	_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])

-	if err != nil {

-		return err

-	}

-

-	return nil

-}

-

-// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION

-// buffer for use with BackupWrite, ZwSetEaFile, etc.

-func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {

-	var buf bytes.Buffer

-	for i := range eas {

-		last := false

-		if i == len(eas)-1 {

-			last = true

-		}

-

-		err := writeEa(&buf, &eas[i], last)

-		if err != nil {

-			return nil, err

-		}

-	}

-	return buf.Bytes(), nil

-}

+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"errors"
+)
+
+type fileFullEaInformation struct {
+	NextEntryOffset uint32
+	Flags           uint8
+	NameLength      uint8
+	ValueLength     uint16
+}
+
+var (
+	fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
+
+	errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
+	errEaNameTooLarge  = errors.New("extended attribute name too large")
+	errEaValueTooLarge = errors.New("extended attribute value too large")
+)
+
+// ExtendedAttribute represents a single Windows EA.
+type ExtendedAttribute struct {
+	Name  string
+	Value []byte
+	Flags uint8
+}
+
+func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
+	var info fileFullEaInformation
+	err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
+	if err != nil {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	nameOffset := fileFullEaInformationSize
+	nameLen := int(info.NameLength)
+	valueOffset := nameOffset + int(info.NameLength) + 1
+	valueLen := int(info.ValueLength)
+	nextOffset := int(info.NextEntryOffset)
+	if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	ea.Name = string(b[nameOffset : nameOffset+nameLen])
+	ea.Value = b[valueOffset : valueOffset+valueLen]
+	ea.Flags = info.Flags
+	if info.NextEntryOffset != 0 {
+		nb = b[info.NextEntryOffset:]
+	}
+	return
+}
+
+// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
+// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
+func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
+	for len(b) != 0 {
+		ea, nb, err := parseEa(b)
+		if err != nil {
+			return nil, err
+		}
+
+		eas = append(eas, ea)
+		b = nb
+	}
+	return
+}
+
+func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
+	if int(uint8(len(ea.Name))) != len(ea.Name) {
+		return errEaNameTooLarge
+	}
+	if int(uint16(len(ea.Value))) != len(ea.Value) {
+		return errEaValueTooLarge
+	}
+	entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
+	withPadding := (entrySize + 3) &^ 3
+	nextOffset := uint32(0)
+	if !last {
+		nextOffset = withPadding
+	}
+	info := fileFullEaInformation{
+		NextEntryOffset: nextOffset,
+		Flags:           ea.Flags,
+		NameLength:      uint8(len(ea.Name)),
+		ValueLength:     uint16(len(ea.Value)),
+	}
+
+	err := binary.Write(buf, binary.LittleEndian, &info)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte(ea.Name))
+	if err != nil {
+		return err
+	}
+
+	err = buf.WriteByte(0)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write(ea.Value)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
+// buffer for use with BackupWrite, ZwSetEaFile, etc.
+func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
+	var buf bytes.Buffer
+	for i := range eas {
+		last := false
+		if i == len(eas)-1 {
+			last = true
+		}
+
+		err := writeEa(&buf, &eas[i], last)
+		if err != nil {
+			return nil, err
+		}
+	}
+	return buf.Bytes(), nil
+}
diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go
index 57ac3696a..4334ff1cb 100644
--- a/vendor/github.com/Microsoft/go-winio/file.go
+++ b/vendor/github.com/Microsoft/go-winio/file.go
@@ -16,7 +16,6 @@ import (
 //sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
 //sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
 //sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
-//sys timeBeginPeriod(period uint32) (n int32) = winmm.timeBeginPeriod
 
 type atomicBool int32
 
@@ -153,8 +152,6 @@ func (f *win32File) prepareIo() (*ioOperation, error) {
 
 // ioCompletionProcessor processes completed async IOs forever
 func ioCompletionProcessor(h syscall.Handle) {
-	// Set the timer resolution to 1. This fixes a performance regression in golang 1.6.
-	timeBeginPeriod(1)
 	for {
 		var bytes uint32
 		var key uintptr
diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go
index b1d60abb8..ada2fbab6 100644
--- a/vendor/github.com/Microsoft/go-winio/fileinfo.go
+++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go
@@ -20,7 +20,8 @@ const (
 // FileBasicInfo contains file access time and file attributes information.
 type FileBasicInfo struct {
 	CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
-	FileAttributes                                          uintptr // includes padding
+	FileAttributes                                          uint32
+	pad                                                     uint32 // padding
 }
 
 // GetFileBasicInfo retrieves times and attributes for a file.
diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go
index 44340b816..d99eedb64 100644
--- a/vendor/github.com/Microsoft/go-winio/pipe.go
+++ b/vendor/github.com/Microsoft/go-winio/pipe.go
@@ -15,13 +15,13 @@ import (
 //sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
 //sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error)  [failretval==syscall.InvalidHandle] = CreateNamedPipeW
 //sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
-//sys waitNamedPipe(name string, timeout uint32) (err error) = WaitNamedPipeW
 //sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
 //sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
 //sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
 
 const (
 	cERROR_PIPE_BUSY      = syscall.Errno(231)
+	cERROR_NO_DATA        = syscall.Errno(232)
 	cERROR_PIPE_CONNECTED = syscall.Errno(535)
 	cERROR_SEM_TIMEOUT    = syscall.Errno(121)
 
@@ -120,6 +120,11 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
 		// zero-byte message, ensure that all future Read() calls
 		// also return EOF.
 		f.readEOF = true
+	} else if err == syscall.ERROR_MORE_DATA {
+		// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
+		// and the message still has more bytes. Treat this as a success, since
+		// this package presents all named pipes as byte streams.
+		err = nil
 	}
 	return n, err
 }
@@ -133,12 +138,14 @@ func (s pipeAddress) String() string {
 }
 
 // DialPipe connects to a named pipe by path, timing out if the connection
-// takes longer than the specified duration. If timeout is nil, then the timeout
-// is the default timeout established by the pipe server.
+// takes longer than the specified duration. If timeout is nil, then we use
+// a default timeout of 5 seconds.  (We do not use WaitNamedPipe.)
 func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
 	var absTimeout time.Time
 	if timeout != nil {
 		absTimeout = time.Now().Add(*timeout)
+	} else {
+		absTimeout = time.Now().Add(time.Second * 2)
 	}
 	var err error
 	var h syscall.Handle
@@ -147,22 +154,13 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
 		if err != cERROR_PIPE_BUSY {
 			break
 		}
-		now := time.Now()
-		var ms uint32
-		if absTimeout.IsZero() {
-			ms = cNMPWAIT_USE_DEFAULT_WAIT
-		} else if now.After(absTimeout) {
-			ms = cNMPWAIT_NOWAIT
-		} else {
-			ms = uint32(absTimeout.Sub(now).Nanoseconds() / 1000 / 1000)
-		}
-		err = waitNamedPipe(path, ms)
-		if err != nil {
-			if err == cERROR_SEM_TIMEOUT {
-				return nil, ErrTimeout
-			}
-			break
+		if time.Now().After(absTimeout) {
+			return nil, ErrTimeout
 		}
+
+		// Wait 10 msec and try again. This is a rather simplistic
+		// view, as we always try each 10 milliseconds.
+		time.Sleep(time.Millisecond * 10)
 	}
 	if err != nil {
 		return nil, &os.PathError{Op: "open", Path: path, Err: err}
@@ -174,16 +172,6 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
 		return nil, err
 	}
 
-	var state uint32
-	err = getNamedPipeHandleState(h, &state, nil, nil, nil, nil, 0)
-	if err != nil {
-		return nil, err
-	}
-
-	if state&cPIPE_READMODE_MESSAGE != 0 {
-		return nil, &os.PathError{Op: "open", Path: path, Err: errors.New("message readmode pipes not supported")}
-	}
-
 	f, err := makeWin32File(h)
 	if err != nil {
 		syscall.Close(h)
@@ -254,6 +242,36 @@ func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
 	return f, nil
 }
 
+func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
+	p, err := l.makeServerPipe()
+	if err != nil {
+		return nil, err
+	}
+
+	// Wait for the client to connect.
+	ch := make(chan error)
+	go func(p *win32File) {
+		ch <- connectPipe(p)
+	}(p)
+
+	select {
+	case err = <-ch:
+		if err != nil {
+			p.Close()
+			p = nil
+		}
+	case <-l.closeCh:
+		// Abort the connect request by closing the handle.
+		p.Close()
+		p = nil
+		err = <-ch
+		if err == nil || err == ErrFileClosed {
+			err = ErrPipeListenerClosed
+		}
+	}
+	return p, err
+}
+
 func (l *win32PipeListener) listenerRoutine() {
 	closed := false
 	for !closed {
@@ -261,31 +279,20 @@ func (l *win32PipeListener) listenerRoutine() {
 		case <-l.closeCh:
 			closed = true
 		case responseCh := <-l.acceptCh:
-			p, err := l.makeServerPipe()
-			if err == nil {
-				// Wait for the client to connect.
-				ch := make(chan error)
-				go func(p *win32File) {
-					ch <- connectPipe(p)
-				}(p)
-				select {
-				case err = <-ch:
-					if err != nil {
-						p.Close()
-						p = nil
-					}
-				case <-l.closeCh:
-					// Abort the connect request by closing the handle.
-					p.Close()
-					p = nil
-					err = <-ch
-					if err == nil || err == ErrFileClosed {
-						err = ErrPipeListenerClosed
-					}
-					closed = true
+			var (
+				p   *win32File
+				err error
+			)
+			for {
+				p, err = l.makeConnectedServerPipe()
+				// If the connection was immediately closed by the client, try
+				// again.
+				if err != cERROR_NO_DATA {
+					break
 				}
 			}
 			responseCh <- acceptResponse{p, err}
+			closed = err == ErrPipeListenerClosed
 		}
 	}
 	syscall.Close(l.firstHandle)
@@ -334,13 +341,23 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
 	if err != nil {
 		return nil, err
 	}
-	// Immediately open and then close a client handle so that the named pipe is
-	// created but not currently accepting connections.
+	// Create a client handle and connect it.  This results in the pipe
+	// instance always existing, so that clients see ERROR_PIPE_BUSY
+	// rather than ERROR_FILE_NOT_FOUND.  This ties the first instance
+	// up so that no other instances can be used.  This would have been
+	// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
+	// instead of CreateNamedPipe.  (Apparently created named pipes are
+	// considered to be in listening state regardless of whether any
+	// active calls to ConnectNamedPipe are outstanding.)
 	h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
 	if err != nil {
 		syscall.Close(h)
 		return nil, err
 	}
+	// Close the client handle. The server side of the instance will
+	// still be busy, leading to ERROR_PIPE_BUSY instead of
+	// ERROR_NOT_FOUND, as long as we don't close the server handle,
+	// or disconnect the client with DisconnectNamedPipe.
 	syscall.Close(h2)
 	l := &win32PipeListener{
 		firstHandle:        h,
diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
index 4f7a52eeb..3f527639a 100644
--- a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
+++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
@@ -38,14 +38,12 @@ func errnoErr(e syscall.Errno) error {
 
 var (
 	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
-	modwinmm    = windows.NewLazySystemDLL("winmm.dll")
 	modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
 
 	procCancelIoEx                                           = modkernel32.NewProc("CancelIoEx")
 	procCreateIoCompletionPort                               = modkernel32.NewProc("CreateIoCompletionPort")
 	procGetQueuedCompletionStatus                            = modkernel32.NewProc("GetQueuedCompletionStatus")
 	procSetFileCompletionNotificationModes                   = modkernel32.NewProc("SetFileCompletionNotificationModes")
-	proctimeBeginPeriod                                      = modwinmm.NewProc("timeBeginPeriod")
 	procConnectNamedPipe                                     = modkernel32.NewProc("ConnectNamedPipe")
 	procCreateNamedPipeW                                     = modkernel32.NewProc("CreateNamedPipeW")
 	procCreateFileW                                          = modkernel32.NewProc("CreateFileW")
@@ -122,12 +120,6 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro
 	return
 }
 
-func timeBeginPeriod(period uint32) (n int32) {
-	r0, _, _ := syscall.Syscall(proctimeBeginPeriod.Addr(), 1, uintptr(period), 0, 0)
-	n = int32(r0)
-	return
-}
-
 func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
 	r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
 	if r1 == 0 {
diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md
index 30991a12e..15b39181a 100644
--- a/vendor/github.com/Microsoft/hcsshim/README.md
+++ b/vendor/github.com/Microsoft/hcsshim/README.md
@@ -1,12 +1,41 @@
 # hcsshim
 
-This package supports launching Windows Server containers from Go. It is
-primarily used in the [Docker Engine](https://github.com/docker/docker) project,
-but it can be freely used by other projects as well.
-
-This project has adopted the [Microsoft Open Source Code of
-Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
-see the [Code of Conduct
-FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
-[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
-questions or comments.
+[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
+
+This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
+
+It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
+
+## Contributing
+
+This project welcomes contributions and suggestions.  Most contributions require you to agree to a
+Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
+the rights to use your contribution. For details, visit https://cla.microsoft.com.
+
+When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
+a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
+provided by the bot. You will only need to do this once across all repos using our CLA.
+
+This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
+For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
+contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
+
+## Dependencies
+
+This project requires Golang 1.9 or newer to build.
+
+For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
+
+## Reporting Security Issues
+
+Security issues and bugs should be reported privately, via email, to the Microsoft Security
+Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
+receive a response within 24 hours. If for some reason you do not, please follow up via
+email to ensure we received your original message. Further information, including the
+[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
+the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
+
+For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
+
+---------------
+Copyright (c) 2018 Microsoft Corp.  All rights reserved.
diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go
deleted file mode 100644
index 6d824d7a7..000000000
--- a/vendor/github.com/Microsoft/hcsshim/activatelayer.go
+++ /dev/null
@@ -1,28 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// ActivateLayer will find the layer with the given id and mount it's filesystem.
-// For a read/write layer, the mounted filesystem will appear as a volume on the
-// host, while a read-only layer is generally expected to be a no-op.
-// An activated layer must later be deactivated via DeactivateLayer.
-func ActivateLayer(info DriverInfo, id string) error {
-	title := "hcsshim::ActivateLayer "
-	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
-
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = activateLayer(&infop, id)
-	if err != nil {
-		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go
index b924d39f4..e142c3154 100644
--- a/vendor/github.com/Microsoft/hcsshim/container.go
+++ b/vendor/github.com/Microsoft/hcsshim/container.go
@@ -1,794 +1,192 @@
 package hcsshim
 
 import (
-	"encoding/json"
 	"fmt"
 	"os"
-	"sync"
-	"syscall"
 	"time"
 
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/mergemaps"
+	"github.com/Microsoft/hcsshim/internal/schema1"
 )
 
-var (
-	defaultTimeout = time.Minute * 4
-)
-
-const (
-	pendingUpdatesQuery    = `{ "PropertyTypes" : ["PendingUpdates"]}`
-	statisticsQuery        = `{ "PropertyTypes" : ["Statistics"]}`
-	processListQuery       = `{ "PropertyTypes" : ["ProcessList"]}`
-	mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
-)
-
-type container struct {
-	handleLock     sync.RWMutex
-	handle         hcsSystem
-	id             string
-	callbackNumber uintptr
-}
-
 // ContainerProperties holds the properties for a container and the processes running in that container
-type ContainerProperties struct {
-	ID                           string `json:"Id"`
-	Name                         string
-	SystemType                   string
-	Owner                        string
-	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
-	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
-	IsRuntimeTemplate            bool                                `json:",omitempty"`
-	RuntimeImagePath             string                              `json:",omitempty"`
-	Stopped                      bool                                `json:",omitempty"`
-	ExitType                     string                              `json:",omitempty"`
-	AreUpdatesPending            bool                                `json:",omitempty"`
-	ObRoot                       string                              `json:",omitempty"`
-	Statistics                   Statistics                          `json:",omitempty"`
-	ProcessList                  []ProcessListItem                   `json:",omitempty"`
-	MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
-}
+type ContainerProperties = schema1.ContainerProperties
 
 // MemoryStats holds the memory statistics for a container
-type MemoryStats struct {
-	UsageCommitBytes            uint64 `json:"MemoryUsageCommitBytes,omitempty"`
-	UsageCommitPeakBytes        uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
-	UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
-}
+type MemoryStats = schema1.MemoryStats
 
 // ProcessorStats holds the processor statistics for a container
-type ProcessorStats struct {
-	TotalRuntime100ns  uint64 `json:",omitempty"`
-	RuntimeUser100ns   uint64 `json:",omitempty"`
-	RuntimeKernel100ns uint64 `json:",omitempty"`
-}
+type ProcessorStats = schema1.ProcessorStats
 
 // StorageStats holds the storage statistics for a container
-type StorageStats struct {
-	ReadCountNormalized  uint64 `json:",omitempty"`
-	ReadSizeBytes        uint64 `json:",omitempty"`
-	WriteCountNormalized uint64 `json:",omitempty"`
-	WriteSizeBytes       uint64 `json:",omitempty"`
-}
+type StorageStats = schema1.StorageStats
 
 // NetworkStats holds the network statistics for a container
-type NetworkStats struct {
-	BytesReceived          uint64 `json:",omitempty"`
-	BytesSent              uint64 `json:",omitempty"`
-	PacketsReceived        uint64 `json:",omitempty"`
-	PacketsSent            uint64 `json:",omitempty"`
-	DroppedPacketsIncoming uint64 `json:",omitempty"`
-	DroppedPacketsOutgoing uint64 `json:",omitempty"`
-	EndpointId             string `json:",omitempty"`
-	InstanceId             string `json:",omitempty"`
-}
+type NetworkStats = schema1.NetworkStats
 
 // Statistics is the structure returned by a statistics call on a container
-type Statistics struct {
-	Timestamp          time.Time      `json:",omitempty"`
-	ContainerStartTime time.Time      `json:",omitempty"`
-	Uptime100ns        uint64         `json:",omitempty"`
-	Memory             MemoryStats    `json:",omitempty"`
-	Processor          ProcessorStats `json:",omitempty"`
-	Storage            StorageStats   `json:",omitempty"`
-	Network            []NetworkStats `json:",omitempty"`
-}
+type Statistics = schema1.Statistics
 
 // ProcessList is the structure of an item returned by a ProcessList call on a container
-type ProcessListItem struct {
-	CreateTimestamp              time.Time `json:",omitempty"`
-	ImageName                    string    `json:",omitempty"`
-	KernelTime100ns              uint64    `json:",omitempty"`
-	MemoryCommitBytes            uint64    `json:",omitempty"`
-	MemoryWorkingSetPrivateBytes uint64    `json:",omitempty"`
-	MemoryWorkingSetSharedBytes  uint64    `json:",omitempty"`
-	ProcessId                    uint32    `json:",omitempty"`
-	UserTime100ns                uint64    `json:",omitempty"`
-}
+type ProcessListItem = schema1.ProcessListItem
 
 // MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
-type MappedVirtualDiskController struct {
-	MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
-}
+type MappedVirtualDiskController = schema1.MappedVirtualDiskController
 
 // Type of Request Support in ModifySystem
-type RequestType string
+type RequestType = schema1.RequestType
 
 // Type of Resource Support in ModifySystem
-type ResourceType string
+type ResourceType = schema1.ResourceType
 
 // RequestType const
 const (
-	Add     RequestType  = "Add"
-	Remove  RequestType  = "Remove"
-	Network ResourceType = "Network"
+	Add     = schema1.Add
+	Remove  = schema1.Remove
+	Network = schema1.Network
 )
 
 // ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
 // Supported resource types are Network and Request Types are Add/Remove
-type ResourceModificationRequestResponse struct {
-	Resource ResourceType `json:"ResourceType"`
-	Data     interface{}  `json:"Settings"`
-	Request  RequestType  `json:"RequestType,omitempty"`
+type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
+
+type container struct {
+	system *hcs.System
 }
 
-// createContainerAdditionalJSON is read from the environment at initialisation
+// createComputeSystemAdditionalJSON is read from the environment at initialisation
 // time. It allows an environment variable to define additional JSON which
-// is merged in the CreateContainer call to HCS.
-var createContainerAdditionalJSON string
+// is merged in the CreateComputeSystem call to HCS.
+var createContainerAdditionalJSON []byte
 
 func init() {
-	createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")
+	createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
 }
 
 // CreateContainer creates a new container with the given configuration but does not start it.
 func CreateContainer(id string, c *ContainerConfig) (Container, error) {
-	return createContainerWithJSON(id, c, "")
-}
-
-// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
-// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
-func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
-	return createContainerWithJSON(id, c, additionalJSON)
-}
-
-func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
-	operation := "CreateContainer"
-	title := "HCSShim::" + operation
-
-	container := &container{
-		id: id,
-	}
-
-	configurationb, err := json.Marshal(c)
+	fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
 	if err != nil {
-		return nil, err
+		return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
 	}
 
-	configuration := string(configurationb)
-	logrus.Debugf(title+" id=%s config=%s", id, configuration)
-
-	// Merge any additional JSON. Priority is given to what is passed in explicitly,
-	// falling back to what's set in the environment.
-	if additionalJSON == "" && createContainerAdditionalJSON != "" {
-		additionalJSON = createContainerAdditionalJSON
-	}
-	if additionalJSON != "" {
-		configurationMap := map[string]interface{}{}
-		if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
-			return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
-		}
-
-		additionalMap := map[string]interface{}{}
-		if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
-			return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
-		}
-
-		mergedMap := mergeMaps(additionalMap, configurationMap)
-		mergedJSON, err := json.Marshal(mergedMap)
-		if err != nil {
-			return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
-		}
-
-		configuration = string(mergedJSON)
-		logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
-	}
-
-	var (
-		resultp  *uint16
-		identity syscall.Handle
-	)
-	createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
-
-	if createError == nil || IsPending(createError) {
-		if err := container.registerCallback(); err != nil {
-			return nil, makeContainerError(container, operation, "", err)
-		}
-	}
-
-	err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
+	system, err := hcs.CreateComputeSystem(id, fullConfig)
 	if err != nil {
-		return nil, makeContainerError(container, operation, configuration, err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
-	return container, nil
-}
-
-// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
-// in ToMap are overwritten. Values in fromMap are added to ToMap.
-// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
-func mergeMaps(fromMap, ToMap interface{}) interface{} {
-	switch fromMap := fromMap.(type) {
-	case map[string]interface{}:
-		ToMap, ok := ToMap.(map[string]interface{})
-		if !ok {
-			return fromMap
-		}
-		for keyToMap, valueToMap := range ToMap {
-			if valueFromMap, ok := fromMap[keyToMap]; ok {
-				fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
-			} else {
-				fromMap[keyToMap] = valueToMap
-			}
-		}
-	case nil:
-		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
-		ToMap, ok := ToMap.(map[string]interface{})
-		if ok {
-			return ToMap
-		}
+		return nil, err
 	}
-	return fromMap
+	return &container{system}, err
 }
 
 // OpenContainer opens an existing container by ID.
 func OpenContainer(id string) (Container, error) {
-	operation := "OpenContainer"
-	title := "HCSShim::" + operation
-	logrus.Debugf(title+" id=%s", id)
-
-	container := &container{
-		id: id,
-	}
-
-	var (
-		handle  hcsSystem
-		resultp *uint16
-	)
-	err := hcsOpenComputeSystem(id, &handle, &resultp)
-	err = processHcsResult(err, resultp)
+	system, err := hcs.OpenComputeSystem(id)
 	if err != nil {
-		return nil, makeContainerError(container, operation, "", err)
-	}
-
-	container.handle = handle
-
-	if err := container.registerCallback(); err != nil {
-		return nil, makeContainerError(container, operation, "", err)
+		return nil, err
 	}
-
-	logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
-	return container, nil
+	return &container{system}, err
 }
 
 // GetContainers gets a list of the containers on the system that match the query
 func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
-	operation := "GetContainers"
-	title := "HCSShim::" + operation
-
-	queryb, err := json.Marshal(q)
-	if err != nil {
-		return nil, err
-	}
-
-	query := string(queryb)
-	logrus.Debugf(title+" query=%s", query)
-
-	var (
-		resultp         *uint16
-		computeSystemsp *uint16
-	)
-	err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return nil, err
-	}
-
-	if computeSystemsp == nil {
-		return nil, ErrUnexpectedValue
-	}
-	computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
-	computeSystems := []ContainerProperties{}
-	if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
-		return nil, err
-	}
-
-	logrus.Debugf(title + " succeeded")
-	return computeSystems, nil
+	return hcs.GetComputeSystems(q)
 }
 
 // Start synchronously starts the container.
 func (container *container) Start() error {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Start"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	var resultp *uint16
-	err := hcsStartComputeSystem(container.handle, "", &resultp)
-	err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
+	return convertSystemError(container.system.Start(), container)
 }
 
-// Shutdown requests a container shutdown, if IsPending() on the error returned is true,
-// it may not actually be shut down until Wait() succeeds.
+// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
 func (container *container) Shutdown() error {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Shutdown"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	var resultp *uint16
-	err := hcsShutdownComputeSystem(container.handle, "", &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
+	return convertSystemError(container.system.Shutdown(), container)
 }
 
-// Terminate requests a container terminate, if IsPending() on the error returned is true,
-// it may not actually be shut down until Wait() succeeds.
+// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
 func (container *container) Terminate() error {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Terminate"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	var resultp *uint16
-	err := hcsTerminateComputeSystem(container.handle, "", &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
+	return convertSystemError(container.system.Terminate(), container)
 }
 
-// Wait synchronously waits for the container to shutdown or terminate.
+// Waits synchronously waits for the container to shutdown or terminate.
 func (container *container) Wait() error {
-	operation := "Wait"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
+	return convertSystemError(container.system.Wait(), container)
 }
 
-// WaitTimeout synchronously waits for the container to terminate or the duration to elapse.
-// If the timeout expires, IsTimeout(err) == true
-func (container *container) WaitTimeout(timeout time.Duration) error {
-	operation := "WaitTimeout"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
+// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+// returns false if timeout occurs.
+func (container *container) WaitTimeout(t time.Duration) error {
+	return convertSystemError(container.system.WaitTimeout(t), container)
 }
 
-func (container *container) properties(query string) (*ContainerProperties, error) {
-	var (
-		resultp     *uint16
-		propertiesp *uint16
-	)
-	err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return nil, err
-	}
+// Pause pauses the execution of a container.
+func (container *container) Pause() error {
+	return convertSystemError(container.system.Pause(), container)
+}
 
-	if propertiesp == nil {
-		return nil, ErrUnexpectedValue
-	}
-	propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
-	properties := &ContainerProperties{}
-	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
-		return nil, err
-	}
-	return properties, nil
+// Resume resumes the execution of a container.
+func (container *container) Resume() error {
+	return convertSystemError(container.system.Resume(), container)
 }
 
 // HasPendingUpdates returns true if the container has updates pending to install
 func (container *container) HasPendingUpdates() (bool, error) {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "HasPendingUpdates"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	properties, err := container.properties(pendingUpdatesQuery)
-	if err != nil {
-		return false, makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return properties.AreUpdatesPending, nil
+	return false, nil
 }
 
-// Statistics returns statistics for the container
+// Statistics returns statistics for the container. This is a legacy v1 call
 func (container *container) Statistics() (Statistics, error) {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Statistics"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	properties, err := container.properties(statisticsQuery)
+	properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
 	if err != nil {
-		return Statistics{}, makeContainerError(container, operation, "", err)
+		return Statistics{}, convertSystemError(err, container)
 	}
 
-	logrus.Debugf(title+" succeeded id=%s", container.id)
 	return properties.Statistics, nil
 }
 
-// ProcessList returns an array of ProcessListItems for the container
+// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
 func (container *container) ProcessList() ([]ProcessListItem, error) {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "ProcessList"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	properties, err := container.properties(processListQuery)
+	properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
 	if err != nil {
-		return nil, makeContainerError(container, operation, "", err)
+		return nil, convertSystemError(err, container)
 	}
 
-	logrus.Debugf(title+" succeeded id=%s", container.id)
 	return properties.ProcessList, nil
 }
 
-// MappedVirtualDisks returns a map of the controllers and the disks mapped
-// to a container.
-//
-// Example of JSON returned by the query.
-//{
-//   "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
-//   "SystemType":"Container",
-//   "RuntimeOsType":"Linux",
-//   "RuntimeId":"00000000-0000-0000-0000-000000000000",
-//   "State":"Running",
-//   "MappedVirtualDiskControllers":{
-//      "0":{
-//         "MappedVirtualDisks":{
-//            "2":{
-//               "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
-//               "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
-//               "Lun":2,
-//               "CreateInUtilityVM":true
-//            },
-//            "3":{
-//               "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
-//               "Lun":3,
-//               "CreateInUtilityVM":true,
-//               "AttachOnly":true
-//            }
-//         }
-//      }
-//   }
-//}
+// This is a legacy v1 call
 func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "MappedVirtualDiskList"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	properties, err := container.properties(mappedVirtualDiskQuery)
+	properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
 	if err != nil {
-		return nil, makeContainerError(container, operation, "", err)
+		return nil, convertSystemError(err, container)
 	}
 
-	logrus.Debugf(title+" succeeded id=%s", container.id)
 	return properties.MappedVirtualDiskControllers, nil
 }
 
-// Pause pauses the execution of the container. This feature is not enabled in TP5.
-func (container *container) Pause() error {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Pause"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	var resultp *uint16
-	err := hcsPauseComputeSystem(container.handle, "", &resultp)
-	err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
-}
-
-// Resume resumes the execution of the container. This feature is not enabled in TP5.
-func (container *container) Resume() error {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Resume"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	if container.handle == 0 {
-		return makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	var resultp *uint16
-	err := hcsResumeComputeSystem(container.handle, "", &resultp)
-	err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
-}
-
 // CreateProcess launches a new process within the container.
 func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "CreateProcess"
-	title := "HCSShim::Container::" + operation
-	var (
-		processInfo   hcsProcessInformation
-		processHandle hcsProcess
-		resultp       *uint16
-	)
-
-	if container.handle == 0 {
-		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	// If we are not emulating a console, ignore any console size passed to us
-	if !c.EmulateConsole {
-		c.ConsoleSize[0] = 0
-		c.ConsoleSize[1] = 0
-	}
-
-	configurationb, err := json.Marshal(c)
+	p, err := container.system.CreateProcess(c)
 	if err != nil {
-		return nil, makeContainerError(container, operation, "", err)
+		return nil, convertSystemError(err, container)
 	}
-
-	configuration := string(configurationb)
-	logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
-
-	err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return nil, makeContainerError(container, operation, configuration, err)
-	}
-
-	process := &process{
-		handle:    processHandle,
-		processID: int(processInfo.ProcessId),
-		container: container,
-		cachedPipes: &cachedPipes{
-			stdIn:  processInfo.StdInput,
-			stdOut: processInfo.StdOutput,
-			stdErr: processInfo.StdError,
-		},
-	}
-
-	if err := process.registerCallback(); err != nil {
-		return nil, makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
-	return process, nil
+	return &process{p}, nil
 }
 
 // OpenProcess gets an interface to an existing process within the container.
 func (container *container) OpenProcess(pid int) (Process, error) {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "OpenProcess"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
-	var (
-		processHandle hcsProcess
-		resultp       *uint16
-	)
-
-	if container.handle == 0 {
-		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
-	err = processHcsResult(err, resultp)
+	p, err := container.system.OpenProcess(pid)
 	if err != nil {
-		return nil, makeContainerError(container, operation, "", err)
+		return nil, convertSystemError(err, container)
 	}
-
-	process := &process{
-		handle:    processHandle,
-		processID: pid,
-		container: container,
-	}
-
-	if err := process.registerCallback(); err != nil {
-		return nil, makeContainerError(container, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
-	return process, nil
+	return &process{p}, nil
 }
 
 // Close cleans up any state associated with the container but does not terminate or wait for it.
 func (container *container) Close() error {
-	container.handleLock.Lock()
-	defer container.handleLock.Unlock()
-	operation := "Close"
-	title := "HCSShim::Container::" + operation
-	logrus.Debugf(title+" id=%s", container.id)
-
-	// Don't double free this
-	if container.handle == 0 {
-		return nil
-	}
-
-	if err := container.unregisterCallback(); err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	if err := hcsCloseComputeSystem(container.handle); err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-
-	container.handle = 0
-
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
-}
-
-func (container *container) registerCallback() error {
-	context := &notifcationWatcherContext{
-		channels: newChannels(),
-	}
-
-	callbackMapLock.Lock()
-	callbackNumber := nextCallback
-	nextCallback++
-	callbackMap[callbackNumber] = context
-	callbackMapLock.Unlock()
-
-	var callbackHandle hcsCallback
-	err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
-	if err != nil {
-		return err
-	}
-	context.handle = callbackHandle
-	container.callbackNumber = callbackNumber
-
-	return nil
-}
-
-func (container *container) unregisterCallback() error {
-	callbackNumber := container.callbackNumber
-
-	callbackMapLock.RLock()
-	context := callbackMap[callbackNumber]
-	callbackMapLock.RUnlock()
-
-	if context == nil {
-		return nil
-	}
-
-	handle := context.handle
-
-	if handle == 0 {
-		return nil
-	}
-
-	// hcsUnregisterComputeSystemCallback has its own syncronization
-	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
-	err := hcsUnregisterComputeSystemCallback(handle)
-	if err != nil {
-		return err
-	}
-
-	closeChannels(context.channels)
-
-	callbackMapLock.Lock()
-	callbackMap[callbackNumber] = nil
-	callbackMapLock.Unlock()
-
-	handle = 0
-
-	return nil
+	return convertSystemError(container.system.Close(), container)
 }
 
-// Modifies the System by sending a request to HCS
+// Modify the System
 func (container *container) Modify(config *ResourceModificationRequestResponse) error {
-	container.handleLock.RLock()
-	defer container.handleLock.RUnlock()
-	operation := "Modify"
-	title := "HCSShim::Container::" + operation
-
-	if container.handle == 0 {
-		return makeContainerError(container, operation, "", ErrAlreadyClosed)
-	}
-
-	requestJSON, err := json.Marshal(config)
-	if err != nil {
-		return err
-	}
-
-	requestString := string(requestJSON)
-	logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
-
-	var resultp *uint16
-	err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return makeContainerError(container, operation, "", err)
-	}
-	logrus.Debugf(title+" succeeded id=%s", container.id)
-	return nil
+	return convertSystemError(container.system.Modify(config), container)
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go
deleted file mode 100644
index 035d9c394..000000000
--- a/vendor/github.com/Microsoft/hcsshim/createlayer.go
+++ /dev/null
@@ -1,27 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// CreateLayer creates a new, empty, read-only layer on the filesystem based on
-// the parent layer provided.
-func CreateLayer(info DriverInfo, id, parent string) error {
-	title := "hcsshim::CreateLayer "
-	logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = createLayer(&infop, id, parent)
-	if err != nil {
-		err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go
deleted file mode 100644
index 7a6a8854c..000000000
--- a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go
+++ /dev/null
@@ -1,35 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// CreateSandboxLayer creates and populates new read-write layer for use by a container.
-// This requires both the id of the direct parent layer, as well as the full list
-// of paths to all parent layers up to the base (and including the direct parent
-// whose id was provided).
-func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
-	title := "hcsshim::CreateSandboxLayer "
-	logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
-
-	// Generate layer descriptors
-	layers, err := layerPathsToDescriptors(parentLayerPaths)
-	if err != nil {
-		return err
-	}
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = createSandboxLayer(&infop, layerId, parentId, layers)
-	if err != nil {
-		err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go
deleted file mode 100644
index fd785030f..000000000
--- a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go
+++ /dev/null
@@ -1,26 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
-func DeactivateLayer(info DriverInfo, id string) error {
-	title := "hcsshim::DeactivateLayer "
-	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = deactivateLayer(&infop, id)
-	if err != nil {
-		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go
deleted file mode 100644
index b1e3b89fc..000000000
--- a/vendor/github.com/Microsoft/hcsshim/destroylayer.go
+++ /dev/null
@@ -1,27 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// DestroyLayer will remove the on-disk files representing the layer with the given
-// id, including that layer's containing folder, if any.
-func DestroyLayer(info DriverInfo, id string) error {
-	title := "hcsshim::DestroyLayer "
-	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = destroyLayer(&infop, id)
-	if err != nil {
-		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go
index d2f9cc8bd..63efa23c7 100644
--- a/vendor/github.com/Microsoft/hcsshim/errors.go
+++ b/vendor/github.com/Microsoft/hcsshim/errors.go
@@ -1,83 +1,91 @@
 package hcsshim
 
 import (
-	"errors"
 	"fmt"
 	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hns"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
 )
 
 var (
-	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
-	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
+	ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
 
 	// ErrElementNotFound is an error encountered when the object being referenced does not exist
-	ErrElementNotFound = syscall.Errno(0x490)
+	ErrElementNotFound = hcs.ErrElementNotFound
 
 	// ErrElementNotFound is an error encountered when the object being referenced does not exist
-	ErrNotSupported = syscall.Errno(0x32)
+	ErrNotSupported = hcs.ErrNotSupported
 
 	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
 	// decimal -2147024883 / hex 0x8007000d
-	ErrInvalidData = syscall.Errno(0xd)
+	ErrInvalidData = hcs.ErrInvalidData
 
 	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
-	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+	ErrHandleClose = hcs.ErrHandleClose
 
 	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
-	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+	ErrAlreadyClosed = hcs.ErrAlreadyClosed
 
 	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
-	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+	ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
 
 	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
-	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+	ErrInvalidProcessState = hcs.ErrInvalidProcessState
 
 	// ErrTimeout is an error encountered when waiting on a notification times out
-	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+	ErrTimeout = hcs.ErrTimeout
 
 	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
 	// a different expected notification
-	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+	ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
 
 	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
 	// is lost while waiting for a notification
-	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+	ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
 
 	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
-	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+	ErrUnexpectedValue = hcs.ErrUnexpectedValue
 
 	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
-	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+	ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
 
 	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
-	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+	ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
 
 	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
-	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+	ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
 
 	// ErrProcNotFound is an error encountered when the the process cannot be found
-	ErrProcNotFound = syscall.Errno(0x7f)
+	ErrProcNotFound = hcs.ErrProcNotFound
 
 	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
 	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
-	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+	ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
 
 	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
-	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+	ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
 
 	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
-	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+	ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
 
 	// ErrNotSupported is an error encountered when hcs doesn't support the request
-	ErrPlatformNotSupported = errors.New("unsupported platform request")
+	ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
 )
 
+type EndpointNotFoundError = hns.EndpointNotFoundError
+type NetworkNotFoundError = hns.NetworkNotFoundError
+
 // ProcessError is an error encountered in HCS during an operation on a Process object
 type ProcessError struct {
 	Process   *process
 	Operation string
 	ExtraInfo string
 	Err       error
+	Events    []hcs.ErrorEvent
 }
 
 // ContainerError is an error encountered in HCS during an operation on a Container object
@@ -86,6 +94,7 @@ type ContainerError struct {
 	Operation string
 	ExtraInfo string
 	Err       error
+	Events    []hcs.ErrorEvent
 }
 
 func (e *ContainerError) Error() string {
@@ -97,7 +106,7 @@ func (e *ContainerError) Error() string {
 		return "unexpected nil container for error: " + e.Err.Error()
 	}
 
-	s := "container " + e.Container.id
+	s := "container " + e.Container.system.ID()
 
 	if e.Operation != "" {
 		s += " encountered an error during " + e.Operation
@@ -107,11 +116,15 @@ func (e *ContainerError) Error() string {
 	case nil:
 		break
 	case syscall.Errno:
-		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
 	default:
 		s += fmt.Sprintf(": %s", e.Err.Error())
 	}
 
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
 	if e.ExtraInfo != "" {
 		s += " extra info: " + e.ExtraInfo
 	}
@@ -137,12 +150,7 @@ func (e *ProcessError) Error() string {
 		return "Unexpected nil process for error: " + e.Err.Error()
 	}
 
-	s := fmt.Sprintf("process %d", e.Process.processID)
-
-	if e.Process.container != nil {
-		s += " in container " + e.Process.container.id
-	}
-
+	s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
 	if e.Operation != "" {
 		s += " encountered an error during " + e.Operation
 	}
@@ -151,11 +159,15 @@ func (e *ProcessError) Error() string {
 	case nil:
 		break
 	case syscall.Errno:
-		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
 	default:
 		s += fmt.Sprintf(": %s", e.Err.Error())
 	}
 
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
 	return s
 }
 
@@ -173,31 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err
 // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
 // will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
 func IsNotExist(err error) bool {
-	err = getInnerError(err)
-	return err == ErrComputeSystemDoesNotExist ||
-		err == ErrElementNotFound ||
-		err == ErrProcNotFound
+	if _, ok := err.(EndpointNotFoundError); ok {
+		return true
+	}
+	if _, ok := err.(NetworkNotFoundError); ok {
+		return true
+	}
+	return hcs.IsNotExist(getInnerError(err))
 }
 
 // IsAlreadyClosed checks if an error is caused by the Container or Process having been
 // already closed by a call to the Close() method.
 func IsAlreadyClosed(err error) bool {
-	err = getInnerError(err)
-	return err == ErrAlreadyClosed
+	return hcs.IsAlreadyClosed(getInnerError(err))
 }
 
 // IsPending returns a boolean indicating whether the error is that
 // the requested operation is being completed in the background.
 func IsPending(err error) bool {
-	err = getInnerError(err)
-	return err == ErrVmcomputeOperationPending
+	return hcs.IsPending(getInnerError(err))
 }
 
 // IsTimeout returns a boolean indicating whether the error is caused by
 // a timeout waiting for the operation to complete.
 func IsTimeout(err error) bool {
-	err = getInnerError(err)
-	return err == ErrTimeout
+	return hcs.IsTimeout(getInnerError(err))
 }
 
 // IsAlreadyStopped returns a boolean indicating whether the error is caused by
@@ -206,10 +218,7 @@ func IsTimeout(err error) bool {
 // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
 // will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
 func IsAlreadyStopped(err error) bool {
-	err = getInnerError(err)
-	return err == ErrVmcomputeAlreadyStopped ||
-		err == ErrElementNotFound ||
-		err == ErrProcNotFound
+	return hcs.IsAlreadyStopped(getInnerError(err))
 }
 
 // IsNotSupported returns a boolean indicating whether the error is caused by
@@ -218,12 +227,7 @@ func IsAlreadyStopped(err error) bool {
 // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
 // is thrown from the Platform
 func IsNotSupported(err error) bool {
-	err = getInnerError(err)
-	// If Platform doesn't recognize or support the request sent, below errors are seen
-	return err == ErrVmcomputeInvalidJSON ||
-		err == ErrInvalidData ||
-		err == ErrNotSupported ||
-		err == ErrVmcomputeUnknownMessage
+	return hcs.IsNotSupported(getInnerError(err))
 }
 
 func getInnerError(err error) error {
@@ -237,3 +241,17 @@ func getInnerError(err error) error {
 	}
 	return err
 }
+
+func convertSystemError(err error, c *container) error {
+	if serr, ok := err.(*hcs.SystemError); ok {
+		return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
+	}
+	return err
+}
+
+func convertProcessError(err error, p *process) error {
+	if perr, ok := err.(*hcs.ProcessError); ok {
+		return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
+	}
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go
deleted file mode 100644
index 6946c6a84..000000000
--- a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go
+++ /dev/null
@@ -1,26 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// ExpandSandboxSize expands the size of a layer to at least size bytes.
-func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
-	title := "hcsshim::ExpandSandboxSize "
-	logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = expandSandboxSize(&infop, layerId, size)
-	if err != nil {
-		err = makeErrorf(err, title, "layerId=%s  size=%d", layerId, size)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go
deleted file mode 100644
index d7025f20b..000000000
--- a/vendor/github.com/Microsoft/hcsshim/exportlayer.go
+++ /dev/null
@@ -1,156 +0,0 @@
-package hcsshim
-
-import (
-	"io"
-	"io/ioutil"
-	"os"
-	"syscall"
-
-	"github.com/Microsoft/go-winio"
-	"github.com/sirupsen/logrus"
-)
-
-// ExportLayer will create a folder at exportFolderPath and fill that folder with
-// the transport format version of the layer identified by layerId. This transport
-// format includes any metadata required for later importing the layer (using
-// ImportLayer), and requires the full list of parent layer paths in order to
-// perform the export.
-func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
-	title := "hcsshim::ExportLayer "
-	logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath)
-
-	// Generate layer descriptors
-	layers, err := layerPathsToDescriptors(parentLayerPaths)
-	if err != nil {
-		return err
-	}
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = exportLayer(&infop, layerId, exportFolderPath, layers)
-	if err != nil {
-		err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
-	return nil
-}
-
-type LayerReader interface {
-	Next() (string, int64, *winio.FileBasicInfo, error)
-	Read(b []byte) (int, error)
-	Close() error
-}
-
-// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
-type FilterLayerReader struct {
-	context uintptr
-}
-
-// Next reads the next available file from a layer, ensuring that parent directories are always read
-// before child files and directories.
-//
-// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
-// extract a Win32 backup stream with the remainder of the metadata and the data.
-func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
-	var fileNamep *uint16
-	fileInfo := &winio.FileBasicInfo{}
-	var deleted uint32
-	var fileSize int64
-	err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
-	if err != nil {
-		if err == syscall.ERROR_NO_MORE_FILES {
-			err = io.EOF
-		} else {
-			err = makeError(err, "ExportLayerNext", "")
-		}
-		return "", 0, nil, err
-	}
-	fileName := convertAndFreeCoTaskMemString(fileNamep)
-	if deleted != 0 {
-		fileInfo = nil
-	}
-	if fileName[0] == '\\' {
-		fileName = fileName[1:]
-	}
-	return fileName, fileSize, fileInfo, nil
-}
-
-// Read reads from the current file's Win32 backup stream.
-func (r *FilterLayerReader) Read(b []byte) (int, error) {
-	var bytesRead uint32
-	err := exportLayerRead(r.context, b, &bytesRead)
-	if err != nil {
-		return 0, makeError(err, "ExportLayerRead", "")
-	}
-	if bytesRead == 0 {
-		return 0, io.EOF
-	}
-	return int(bytesRead), nil
-}
-
-// Close frees resources associated with the layer reader. It will return an
-// error if there was an error while reading the layer or of the layer was not
-// completely read.
-func (r *FilterLayerReader) Close() (err error) {
-	if r.context != 0 {
-		err = exportLayerEnd(r.context)
-		if err != nil {
-			err = makeError(err, "ExportLayerEnd", "")
-		}
-		r.context = 0
-	}
-	return
-}
-
-// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
-// The caller must have taken the SeBackupPrivilege privilege
-// to call this and any methods on the resulting LayerReader.
-func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
-	if procExportLayerBegin.Find() != nil {
-		// The new layer reader is not available on this Windows build. Fall back to the
-		// legacy export code path.
-		path, err := ioutil.TempDir("", "hcs")
-		if err != nil {
-			return nil, err
-		}
-		err = ExportLayer(info, layerID, path, parentLayerPaths)
-		if err != nil {
-			os.RemoveAll(path)
-			return nil, err
-		}
-		return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil
-	}
-
-	layers, err := layerPathsToDescriptors(parentLayerPaths)
-	if err != nil {
-		return nil, err
-	}
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		return nil, err
-	}
-	r := &FilterLayerReader{}
-	err = exportLayerBegin(&infop, layerID, layers, &r.context)
-	if err != nil {
-		return nil, makeError(err, "ExportLayerBegin", "")
-	}
-	return r, err
-}
-
-type legacyLayerReaderWrapper struct {
-	*legacyLayerReader
-}
-
-func (r *legacyLayerReaderWrapper) Close() error {
-	err := r.legacyLayerReader.Close()
-	os.RemoveAll(r.root)
-	return err
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go
deleted file mode 100644
index 620aba123..000000000
--- a/vendor/github.com/Microsoft/hcsshim/guid.go
+++ /dev/null
@@ -1,19 +0,0 @@
-package hcsshim
-
-import (
-	"crypto/sha1"
-	"fmt"
-)
-
-type GUID [16]byte
-
-func NewGUID(source string) *GUID {
-	h := sha1.Sum([]byte(source))
-	var g GUID
-	copy(g[0:], h[0:16])
-	return &g
-}
-
-func (g *GUID) ToString() string {
-	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go
index 236ba1fa3..ceb3ac85e 100644
--- a/vendor/github.com/Microsoft/hcsshim/hcsshim.go
+++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go
@@ -4,80 +4,20 @@
 package hcsshim
 
 import (
-	"fmt"
 	"syscall"
-	"unsafe"
 
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
 )
 
-//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go
+//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
 
-//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
 //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
 
-//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
-//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
-//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
-//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
-//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
-//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
-//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
-//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
-//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
-//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
-//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
-//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
-//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
-//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
-//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
-//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
-//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
-
-//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
-//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
-//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
-//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
-
-//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
-//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
-//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
-//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
-
-//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
-//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
-//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
-//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
-//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
-//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
-//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
-//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
-//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
-//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
-//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
-//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
-//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
-
-//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
-//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
-//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
-//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
-//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
-//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
-//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
-//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
-//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
-//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
-
-//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
-
-//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
-
 const (
 	// Specific user-visible exit codes
 	WaitErrExecFailed = 32767
 
-	ERROR_GEN_FAILURE          = syscall.Errno(31)
+	ERROR_GEN_FAILURE          = hcserror.ERROR_GEN_FAILURE
 	ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
 	WSAEINVAL                  = syscall.Errno(10022)
 
@@ -85,82 +25,4 @@ const (
 	TimeoutInfinite = 0xFFFFFFFF
 )
 
-type HcsError struct {
-	title string
-	rest  string
-	Err   error
-}
-
-type hcsSystem syscall.Handle
-type hcsProcess syscall.Handle
-type hcsCallback syscall.Handle
-
-type hcsProcessInformation struct {
-	ProcessId uint32
-	Reserved  uint32
-	StdInput  syscall.Handle
-	StdOutput syscall.Handle
-	StdError  syscall.Handle
-}
-
-func makeError(err error, title, rest string) error {
-	// Pass through DLL errors directly since they do not originate from HCS.
-	if _, ok := err.(*syscall.DLLError); ok {
-		return err
-	}
-	return &HcsError{title, rest, err}
-}
-
-func makeErrorf(err error, title, format string, a ...interface{}) error {
-	return makeError(err, title, fmt.Sprintf(format, a...))
-}
-
-func win32FromError(err error) uint32 {
-	if herr, ok := err.(*HcsError); ok {
-		return win32FromError(herr.Err)
-	}
-	if code, ok := err.(syscall.Errno); ok {
-		return uint32(code)
-	}
-	return uint32(ERROR_GEN_FAILURE)
-}
-
-func win32FromHresult(hr uintptr) uintptr {
-	if hr&0x1fff0000 == 0x00070000 {
-		return hr & 0xffff
-	}
-	return hr
-}
-
-func (e *HcsError) Error() string {
-	s := e.title
-	if len(s) > 0 && s[len(s)-1] != ' ' {
-		s += " "
-	}
-	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
-	if e.rest != "" {
-		if e.rest[0] != ' ' {
-			s += " "
-		}
-		s += e.rest
-	}
-	return s
-}
-
-func convertAndFreeCoTaskMemString(buffer *uint16) string {
-	str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
-	coTaskMemFree(unsafe.Pointer(buffer))
-	return str
-}
-
-func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
-	return []byte(convertAndFreeCoTaskMemString(buffer))
-}
-
-func processHcsResult(err error, resultp *uint16) error {
-	if resultp != nil {
-		result := convertAndFreeCoTaskMemString(resultp)
-		logrus.Debugf("Result: %s", result)
-	}
-	return err
-}
+type HcsError = hcserror.HcsError
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
index 92afc0c24..eb013d2c4 100644
--- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
+++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
@@ -1,318 +1,94 @@
-package hcsshim

-

-import (

-	"encoding/json"

-	"fmt"

-	"net"

-

-	"github.com/sirupsen/logrus"

-)

-

-// HNSEndpoint represents a network endpoint in HNS

-type HNSEndpoint struct {

-	Id                 string            `json:"ID,omitempty"`

-	Name               string            `json:",omitempty"`

-	VirtualNetwork     string            `json:",omitempty"`

-	VirtualNetworkName string            `json:",omitempty"`

-	Policies           []json.RawMessage `json:",omitempty"`

-	MacAddress         string            `json:",omitempty"`

-	IPAddress          net.IP            `json:",omitempty"`

-	DNSSuffix          string            `json:",omitempty"`

-	DNSServerList      string            `json:",omitempty"`

-	GatewayAddress     string            `json:",omitempty"`

-	EnableInternalDNS  bool              `json:",omitempty"`

-	DisableICC         bool              `json:",omitempty"`

-	PrefixLength       uint8             `json:",omitempty"`

-	IsRemoteEndpoint   bool              `json:",omitempty"`

-}

-

-//SystemType represents the type of the system on which actions are done

-type SystemType string

-

-// SystemType const

-const (

-	ContainerType      SystemType = "Container"

-	VirtualMachineType SystemType = "VirtualMachine"

-	HostType           SystemType = "Host"

-)

-

-// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system

-// Supported resource types are Network and Request Types are Add/Remove

-type EndpointAttachDetachRequest struct {

-	ContainerID    string     `json:"ContainerId,omitempty"`

-	SystemType     SystemType `json:"SystemType"`

-	CompartmentID  uint16     `json:"CompartmentId,omitempty"`

-	VirtualNICName string     `json:"VirtualNicName,omitempty"`

-}

-

-// EndpointResquestResponse is object to get the endpoint request response

-type EndpointResquestResponse struct {

-	Success bool

-	Error   string

-}

-

-// HNSEndpointRequest makes a HNS call to modify/query a network endpoint

-func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {

-	endpoint := &HNSEndpoint{}

-	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)

-	if err != nil {

-		return nil, err

-	}

-

-	return endpoint, nil

-}

-

-// HNSListEndpointRequest makes a HNS call to query the list of available endpoints

-func HNSListEndpointRequest() ([]HNSEndpoint, error) {

-	var endpoint []HNSEndpoint

-	err := hnsCall("GET", "/endpoints/", "", &endpoint)

-	if err != nil {

-		return nil, err

-	}

-

-	return endpoint, nil

-}

-

-// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container

-func HotAttachEndpoint(containerID string, endpointID string) error {

-	return modifyNetworkEndpoint(containerID, endpointID, Add)

-}

-

-// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container

-func HotDetachEndpoint(containerID string, endpointID string) error {

-	return modifyNetworkEndpoint(containerID, endpointID, Remove)

-}

-

-// ModifyContainer corresponding to the container id, by sending a request

-func modifyContainer(id string, request *ResourceModificationRequestResponse) error {

-	container, err := OpenContainer(id)

-	if err != nil {

-		if IsNotExist(err) {

-			return ErrComputeSystemDoesNotExist

-		}

-		return getInnerError(err)

-	}

-	defer container.Close()

-	err = container.Modify(request)

-	if err != nil {

-		if IsNotSupported(err) {

-			return ErrPlatformNotSupported

-		}

-		return getInnerError(err)

-	}

-

-	return nil

-}

-

-func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {

-	requestMessage := &ResourceModificationRequestResponse{

-		Resource: Network,

-		Request:  request,

-		Data:     endpointID,

-	}

-	err := modifyContainer(containerID, requestMessage)

-

-	if err != nil {

-		return err

-	}

-

-	return nil

-}

-

-// GetHNSEndpointByID get the Endpoint by ID

-func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {

-	return HNSEndpointRequest("GET", endpointID, "")

-}

-

-// GetHNSEndpointByName gets the endpoint filtered by Name

-func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {

-	hnsResponse, err := HNSListEndpointRequest()

-	if err != nil {

-		return nil, err

-	}

-	for _, hnsEndpoint := range hnsResponse {

-		if hnsEndpoint.Name == endpointName {

-			return &hnsEndpoint, nil

-		}

-	}

-	return nil, fmt.Errorf("Endpoint %v not found", endpointName)

-}

-

-// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods

-func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {

-	operation := "Create"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-

-	jsonString, err := json.Marshal(endpoint)

-	if err != nil {

-		return nil, err

-	}

-	return HNSEndpointRequest("POST", "", string(jsonString))

-}

-

-// Delete Endpoint by sending EndpointRequest to HNS

-func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {

-	operation := "Delete"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-

-	return HNSEndpointRequest("DELETE", endpoint.Id, "")

-}

-

-// Update Endpoint

-func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {

-	operation := "Update"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-	jsonString, err := json.Marshal(endpoint)

-	if err != nil {

-		return nil, err

-	}

-	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)

-

-	return endpoint, err

-}

-

-// ContainerHotAttach attaches an endpoint to a running container

-func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {

-	operation := "ContainerHotAttach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)

-

-	return modifyNetworkEndpoint(containerID, endpoint.Id, Add)

-}

-

-// ContainerHotDetach detaches an endpoint from a running container

-func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {

-	operation := "ContainerHotDetach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)

-

-	return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)

-}

-

-// ApplyACLPolicy applies Acl Policy on the Endpoint

-func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error {

-	operation := "ApplyACLPolicy"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-

-	jsonString, err := json.Marshal(policy)

-	if err != nil {

-		return err

-	}

-	endpoint.Policies[0] = jsonString

-	_, err = endpoint.Update()

-	return err

-}

-

-// ContainerAttach attaches an endpoint to container

-func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {

-	operation := "ContainerAttach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-

-	requestMessage := &EndpointAttachDetachRequest{

-		ContainerID:   containerID,

-		CompartmentID: compartmentID,

-		SystemType:    ContainerType,

-	}

-	response := &EndpointResquestResponse{}

-	jsonString, err := json.Marshal(requestMessage)

-	if err != nil {

-		return err

-	}

-	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)

-}

-

-// ContainerDetach detaches an endpoint from container

-func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {

-	operation := "ContainerDetach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-

-	requestMessage := &EndpointAttachDetachRequest{

-		ContainerID: containerID,

-		SystemType:  ContainerType,

-	}

-	response := &EndpointResquestResponse{}

-

-	jsonString, err := json.Marshal(requestMessage)

-	if err != nil {

-		return err

-	}

-	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)

-}

-

-// HostAttach attaches a nic on the host

-func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {

-	operation := "HostAttach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-	requestMessage := &EndpointAttachDetachRequest{

-		CompartmentID: compartmentID,

-		SystemType:    HostType,

-	}

-	response := &EndpointResquestResponse{}

-

-	jsonString, err := json.Marshal(requestMessage)

-	if err != nil {

-		return err

-	}

-	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)

-

-}

-

-// HostDetach detaches a nic on the host

-func (endpoint *HNSEndpoint) HostDetach() error {

-	operation := "HostDetach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-	requestMessage := &EndpointAttachDetachRequest{

-		SystemType: HostType,

-	}

-	response := &EndpointResquestResponse{}

-

-	jsonString, err := json.Marshal(requestMessage)

-	if err != nil {

-		return err

-	}

-	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)

-}

-

-// VirtualMachineNICAttach attaches a endpoint to a virtual machine

-func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {

-	operation := "VirtualMachineNicAttach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-	requestMessage := &EndpointAttachDetachRequest{

-		VirtualNICName: virtualMachineNICName,

-		SystemType:     VirtualMachineType,

-	}

-	response := &EndpointResquestResponse{}

-

-	jsonString, err := json.Marshal(requestMessage)

-	if err != nil {

-		return err

-	}

-	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)

-}

-

-// VirtualMachineNICDetach detaches a endpoint  from a virtual machine

-func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {

-	operation := "VirtualMachineNicDetach"

-	title := "HCSShim::HNSEndpoint::" + operation

-	logrus.Debugf(title+" id=%s", endpoint.Id)

-

-	requestMessage := &EndpointAttachDetachRequest{

-		SystemType: VirtualMachineType,

-	}

-	response := &EndpointResquestResponse{}

-

-	jsonString, err := json.Marshal(requestMessage)

-	if err != nil {

-		return err

-	}

-	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)

-}

+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint = hns.HNSEndpoint
+
+// Namespace represents a Compartment.
+type Namespace = hns.Namespace
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse = hns.EndpointResquestResponse
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	return hns.HNSEndpointRequest(method, path, request)
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	return hns.HNSListEndpointRequest()
+}
+
+// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
+func HotAttachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Add)
+}
+
+// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
+func HotDetachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Remove)
+}
+
+// ModifyContainer corresponding to the container id, by sending a request
+func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
+	container, err := OpenContainer(id)
+	if err != nil {
+		if IsNotExist(err) {
+			return ErrComputeSystemDoesNotExist
+		}
+		return getInnerError(err)
+	}
+	defer container.Close()
+	err = container.Modify(request)
+	if err != nil {
+		if IsNotSupported(err) {
+			return ErrPlatformNotSupported
+		}
+		return getInnerError(err)
+	}
+
+	return nil
+}
+
+func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
+	requestMessage := &ResourceModificationRequestResponse{
+		Resource: Network,
+		Request:  request,
+		Data:     endpointID,
+	}
+	err := modifyContainer(containerID, requestMessage)
+
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByID(endpointID)
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByName(endpointName)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go
new file mode 100644
index 000000000..2b5381904
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go
@@ -0,0 +1,16 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSGlobals = hns.HNSGlobals
+type HNSVersion = hns.HNSVersion
+
+var (
+	HNSVersion1803 = hns.HNSVersion1803
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	return hns.GetHNSGlobals()
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
index 3345bfa3f..f775fa1d0 100644
--- a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
+++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
@@ -1,142 +1,36 @@
-package hcsshim

-

-import (

-	"encoding/json"

-	"fmt"

-	"net"

-

-	"github.com/sirupsen/logrus"

-)

-

-// Subnet is assoicated with a network and represents a list

-// of subnets available to the network

-type Subnet struct {

-	AddressPrefix  string            `json:",omitempty"`

-	GatewayAddress string            `json:",omitempty"`

-	Policies       []json.RawMessage `json:",omitempty"`

-}

-

-// MacPool is assoicated with a network and represents a list

-// of macaddresses available to the network

-type MacPool struct {

-	StartMacAddress string `json:",omitempty"`

-	EndMacAddress   string `json:",omitempty"`

-}

-

-// HNSNetwork represents a network in HNS

-type HNSNetwork struct {

-	Id                   string            `json:"ID,omitempty"`

-	Name                 string            `json:",omitempty"`

-	Type                 string            `json:",omitempty"`

-	NetworkAdapterName   string            `json:",omitempty"`

-	SourceMac            string            `json:",omitempty"`

-	Policies             []json.RawMessage `json:",omitempty"`

-	MacPools             []MacPool         `json:",omitempty"`

-	Subnets              []Subnet          `json:",omitempty"`

-	DNSSuffix            string            `json:",omitempty"`

-	DNSServerList        string            `json:",omitempty"`

-	DNSServerCompartment uint32            `json:",omitempty"`

-	ManagementIP         string            `json:",omitempty"`

-	AutomaticDNS         bool              `json:",omitempty"`

-}

-

-type hnsNetworkResponse struct {

-	Success bool

-	Error   string

-	Output  HNSNetwork

-}

-

-type hnsResponse struct {

-	Success bool

-	Error   string

-	Output  json.RawMessage

-}

-

-// HNSNetworkRequest makes a call into HNS to update/query a single network

-func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {

-	var network HNSNetwork

-	err := hnsCall(method, "/networks/"+path, request, &network)

-	if err != nil {

-		return nil, err

-	}

-

-	return &network, nil

-}

-

-// HNSListNetworkRequest makes a HNS call to query the list of available networks

-func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {

-	var network []HNSNetwork

-	err := hnsCall(method, "/networks/"+path, request, &network)

-	if err != nil {

-		return nil, err

-	}

-

-	return network, nil

-}

-

-// GetHNSNetworkByID

-func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {

-	return HNSNetworkRequest("GET", networkID, "")

-}

-

-// GetHNSNetworkName filtered by Name

-func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {

-	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")

-	if err != nil {

-		return nil, err

-	}

-	for _, hnsnetwork := range hsnnetworks {

-		if hnsnetwork.Name == networkName {

-			return &hnsnetwork, nil

-		}

-	}

-	return nil, fmt.Errorf("Network %v not found", networkName)

-}

-

-// Create Network by sending NetworkRequest to HNS.

-func (network *HNSNetwork) Create() (*HNSNetwork, error) {

-	operation := "Create"

-	title := "HCSShim::HNSNetwork::" + operation

-	logrus.Debugf(title+" id=%s", network.Id)

-

-	jsonString, err := json.Marshal(network)

-	if err != nil {

-		return nil, err

-	}

-	return HNSNetworkRequest("POST", "", string(jsonString))

-}

-

-// Delete Network by sending NetworkRequest to HNS

-func (network *HNSNetwork) Delete() (*HNSNetwork, error) {

-	operation := "Delete"

-	title := "HCSShim::HNSNetwork::" + operation

-	logrus.Debugf(title+" id=%s", network.Id)

-

-	return HNSNetworkRequest("DELETE", network.Id, "")

-}

-

-// Creates an endpoint on the Network.

-func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {

-	return &HNSEndpoint{

-		VirtualNetwork: network.Id,

-		IPAddress:      ipAddress,

-		MacAddress:     string(macAddress),

-	}

-}

-

-func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {

-	operation := "CreateEndpoint"

-	title := "HCSShim::HNSNetwork::" + operation

-	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)

-

-	endpoint.VirtualNetwork = network.Id

-	return endpoint.Create()

-}

-

-func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {

-	operation := "CreateRemoteEndpoint"

-	title := "HCSShim::HNSNetwork::" + operation

-	logrus.Debugf(title+" id=%s", network.Id)

-	endpoint.IsRemoteEndpoint = true

-	return network.CreateEndpoint(endpoint)

-}

+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet = hns.Subnet
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool = hns.MacPool
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork = hns.HNSNetwork
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	return hns.HNSNetworkRequest(method, path, request)
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	return hns.HNSListNetworkRequest(method, path, request)
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByID(networkID)
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByName(networkName)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go
index ecfbf0eda..a3e03ff8f 100644
--- a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go
+++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go
@@ -1,95 +1,57 @@
-package hcsshim

-

-// Type of Request Support in ModifySystem

-type PolicyType string

-

-// RequestType const

-const (

-	Nat                  PolicyType = "NAT"

-	ACL                  PolicyType = "ACL"

-	PA                   PolicyType = "PA"

-	VLAN                 PolicyType = "VLAN"

-	VSID                 PolicyType = "VSID"

-	VNet                 PolicyType = "VNET"

-	L2Driver             PolicyType = "L2Driver"

-	Isolation            PolicyType = "Isolation"

-	QOS                  PolicyType = "QOS"

-	OutboundNat          PolicyType = "OutBoundNAT"

-	ExternalLoadBalancer PolicyType = "ELB"

-	Route                PolicyType = "ROUTE"

-)

-

-type NatPolicy struct {

-	Type         PolicyType `json:"Type"`

-	Protocol     string

-	InternalPort uint16

-	ExternalPort uint16

-}

-

-type QosPolicy struct {

-	Type                            PolicyType `json:"Type"`

-	MaximumOutgoingBandwidthInBytes uint64

-}

-

-type IsolationPolicy struct {

-	Type               PolicyType `json:"Type"`

-	VLAN               uint

-	VSID               uint

-	InDefaultIsolation bool

-}

-

-type VlanPolicy struct {

-	Type PolicyType `json:"Type"`

-	VLAN uint

-}

-

-type VsidPolicy struct {

-	Type PolicyType `json:"Type"`

-	VSID uint

-}

-

-type PaPolicy struct {

-	Type PolicyType `json:"Type"`

-	PA   string     `json:"PA"`

-}

-

-type OutboundNatPolicy struct {

-	Policy

-	VIP        string   `json:"VIP,omitempty"`

-	Exceptions []string `json:"ExceptionList,omitempty"`

-}

-

-type ActionType string

-type DirectionType string

-type RuleType string

-

-const (

-	Allow ActionType = "Allow"

-	Block ActionType = "Block"

-

-	In  DirectionType = "In"

-	Out DirectionType = "Out"

-

-	Host   RuleType = "Host"

-	Switch RuleType = "Switch"

-)

-

-type ACLPolicy struct {

-	Type          PolicyType `json:"Type"`

-	Protocol      uint16

-	InternalPort  uint16

-	Action        ActionType

-	Direction     DirectionType

-	LocalAddress  string

-	RemoteAddress string

-	LocalPort     uint16

-	RemotePort    uint16

-	RuleType      RuleType `json:"RuleType,omitempty"`

-

-	Priority    uint16

-	ServiceName string

-}

-

-type Policy struct {

-	Type PolicyType `json:"Type"`

-}

+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Type of Request Support in ModifySystem
+type PolicyType = hns.PolicyType
+
+// RequestType const
+const (
+	Nat                  = hns.Nat
+	ACL                  = hns.ACL
+	PA                   = hns.PA
+	VLAN                 = hns.VLAN
+	VSID                 = hns.VSID
+	VNet                 = hns.VNet
+	L2Driver             = hns.L2Driver
+	Isolation            = hns.Isolation
+	QOS                  = hns.QOS
+	OutboundNat          = hns.OutboundNat
+	ExternalLoadBalancer = hns.ExternalLoadBalancer
+	Route                = hns.Route
+)
+
+type NatPolicy = hns.NatPolicy
+
+type QosPolicy = hns.QosPolicy
+
+type IsolationPolicy = hns.IsolationPolicy
+
+type VlanPolicy = hns.VlanPolicy
+
+type VsidPolicy = hns.VsidPolicy
+
+type PaPolicy = hns.PaPolicy
+
+type OutboundNatPolicy = hns.OutboundNatPolicy
+
+type ActionType = hns.ActionType
+type DirectionType = hns.DirectionType
+type RuleType = hns.RuleType
+
+const (
+	Allow = hns.Allow
+	Block = hns.Block
+
+	In  = hns.In
+	Out = hns.Out
+
+	Host   = hns.Host
+	Switch = hns.Switch
+)
+
+type ACLPolicy = hns.ACLPolicy
+
+type Policy = hns.Policy
diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
index 15653b4f4..55aaa4a50 100644
--- a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
+++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
@@ -1,196 +1,47 @@
-package hcsshim

-

-import (

-	"encoding/json"

-

-	"github.com/sirupsen/logrus"

-)

-

-// RoutePolicy is a structure defining schema for Route based Policy

-type RoutePolicy struct {

-	Policy

-	DestinationPrefix string `json:"DestinationPrefix,omitempty"`

-	NextHop           string `json:"NextHop,omitempty"`

-	EncapEnabled      bool   `json:"NeedEncap,omitempty"`

-}

-

-// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy

-type ELBPolicy struct {

-	LBPolicy

-	SourceVIP string   `json:"SourceVIP,omitempty"`

-	VIPs      []string `json:"VIPs,omitempty"`

-	ILB       bool     `json:"ILB,omitempty"`

-}

-

-// LBPolicy is a structure defining schema for LoadBalancing based Policy

-type LBPolicy struct {

-	Policy

-	Protocol     uint16 `json:"Protocol,omitempty"`

-	InternalPort uint16

-	ExternalPort uint16

-}

-

-// PolicyList is a structure defining schema for Policy list request

-type PolicyList struct {

-	ID                 string            `json:"ID,omitempty"`

-	EndpointReferences []string          `json:"References,omitempty"`

-	Policies           []json.RawMessage `json:"Policies,omitempty"`

-}

-

-// HNSPolicyListRequest makes a call into HNS to update/query a single network

-func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {

-	var policy PolicyList

-	err := hnsCall(method, "/policylists/"+path, request, &policy)

-	if err != nil {

-		return nil, err

-	}

-

-	return &policy, nil

-}

-

-// HNSListPolicyListRequest gets all the policy list

-func HNSListPolicyListRequest() ([]PolicyList, error) {

-	var plist []PolicyList

-	err := hnsCall("GET", "/policylists/", "", &plist)

-	if err != nil {

-		return nil, err

-	}

-

-	return plist, nil

-}

-

-// PolicyListRequest makes a HNS call to modify/query a network policy list

-func PolicyListRequest(method, path, request string) (*PolicyList, error) {

-	policylist := &PolicyList{}

-	err := hnsCall(method, "/policylists/"+path, request, &policylist)

-	if err != nil {

-		return nil, err

-	}

-

-	return policylist, nil

-}

-

-// GetPolicyListByID get the policy list by ID

-func GetPolicyListByID(policyListID string) (*PolicyList, error) {

-	return PolicyListRequest("GET", policyListID, "")

-}

-

-// Create PolicyList by sending PolicyListRequest to HNS.

-func (policylist *PolicyList) Create() (*PolicyList, error) {

-	operation := "Create"

-	title := "HCSShim::PolicyList::" + operation

-	logrus.Debugf(title+" id=%s", policylist.ID)

-	jsonString, err := json.Marshal(policylist)

-	if err != nil {

-		return nil, err

-	}

-	return PolicyListRequest("POST", "", string(jsonString))

-}

-

-// Delete deletes PolicyList

-func (policylist *PolicyList) Delete() (*PolicyList, error) {

-	operation := "Delete"

-	title := "HCSShim::PolicyList::" + operation

-	logrus.Debugf(title+" id=%s", policylist.ID)

-

-	return PolicyListRequest("DELETE", policylist.ID, "")

-}

-

-// AddEndpoint add an endpoint to a Policy List

-func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {

-	operation := "AddEndpoint"

-	title := "HCSShim::PolicyList::" + operation

-	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)

-

-	_, err := policylist.Delete()

-	if err != nil {

-		return nil, err

-	}

-

-	// Add Endpoint to the Existing List

-	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)

-

-	return policylist.Create()

-}

-

-// RemoveEndpoint removes an endpoint from the Policy List

-func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {

-	operation := "RemoveEndpoint"

-	title := "HCSShim::PolicyList::" + operation

-	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)

-

-	_, err := policylist.Delete()

-	if err != nil {

-		return nil, err

-	}

-

-	elementToRemove := "/endpoints/" + endpoint.Id

-

-	var references []string

-

-	for _, endpointReference := range policylist.EndpointReferences {

-		if endpointReference == elementToRemove {

-			continue

-		}

-		references = append(references, endpointReference)

-	}

-	policylist.EndpointReferences = references

-	return policylist.Create()

-}

-

-// AddLoadBalancer policy list for the specified endpoints

-func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {

-	operation := "AddLoadBalancer"

-	title := "HCSShim::PolicyList::" + operation

-	logrus.Debugf(title+" Vip:%s", vip)

-

-	policylist := &PolicyList{}

-

-	elbPolicy := &ELBPolicy{

-		VIPs: []string{vip},

-		ILB:  isILB,

-	}

-	elbPolicy.Type = ExternalLoadBalancer

-	elbPolicy.Protocol = protocol

-	elbPolicy.InternalPort = internalPort

-	elbPolicy.ExternalPort = externalPort

-

-	for _, endpoint := range endpoints {

-		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)

-	}

-

-	jsonString, err := json.Marshal(elbPolicy)

-	if err != nil {

-		return nil, err

-	}

-	policylist.Policies = append(policylist.Policies, jsonString)

-	return policylist.Create()

-}

-

-// AddRoute adds route policy list for the specified endpoints

-func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {

-	operation := "AddRoute"

-	title := "HCSShim::PolicyList::" + operation

-	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)

-

-	policylist := &PolicyList{}

-

-	rPolicy := &RoutePolicy{

-		DestinationPrefix: destinationPrefix,

-		NextHop:           nextHop,

-		EncapEnabled:      encapEnabled,

-	}

-	rPolicy.Type = Route

-

-	for _, endpoint := range endpoints {

-		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)

-	}

-

-	jsonString, err := json.Marshal(rPolicy)

-	if err != nil {

-		return nil, err

-	}

-

-	policylist.Policies = append(policylist.Policies, jsonString)

-	return policylist.Create()

-}

+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy = hns.RoutePolicy
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy = hns.ELBPolicy
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy = hns.LBPolicy
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList = hns.PolicyList
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.HNSPolicyListRequest(method, path, request)
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	return hns.HNSListPolicyListRequest()
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.PolicyListRequest(method, path, request)
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return hns.GetPolicyListByID(policyListID)
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/hnssupport.go
new file mode 100644
index 000000000..69405244b
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnssupport.go
@@ -0,0 +1,13 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSSupportedFeatures = hns.HNSSupportedFeatures
+
+type HNSAclFeatures = hns.HNSAclFeatures
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	return hns.GetHNSSupportedFeatures()
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go
deleted file mode 100644
index 3aed14376..000000000
--- a/vendor/github.com/Microsoft/hcsshim/importlayer.go
+++ /dev/null
@@ -1,212 +0,0 @@
-package hcsshim
-
-import (
-	"errors"
-	"io/ioutil"
-	"os"
-	"path/filepath"
-
-	"github.com/Microsoft/go-winio"
-	"github.com/sirupsen/logrus"
-)
-
-// ImportLayer will take the contents of the folder at importFolderPath and import
-// that into a layer with the id layerId.  Note that in order to correctly populate
-// the layer and interperet the transport format, all parent layers must already
-// be present on the system at the paths provided in parentLayerPaths.
-func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
-	title := "hcsshim::ImportLayer "
-	logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath)
-
-	// Generate layer descriptors
-	layers, err := layerPathsToDescriptors(parentLayerPaths)
-	if err != nil {
-		return err
-	}
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = importLayer(&infop, layerID, importFolderPath, layers)
-	if err != nil {
-		err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
-	return nil
-}
-
-// LayerWriter is an interface that supports writing a new container image layer.
-type LayerWriter interface {
-	// Add adds a file to the layer with given metadata.
-	Add(name string, fileInfo *winio.FileBasicInfo) error
-	// AddLink adds a hard link to the layer. The target must already have been added.
-	AddLink(name string, target string) error
-	// Remove removes a file that was present in a parent layer from the layer.
-	Remove(name string) error
-	// Write writes data to the current file. The data must be in the format of a Win32
-	// backup stream.
-	Write(b []byte) (int, error)
-	// Close finishes the layer writing process and releases any resources.
-	Close() error
-}
-
-// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
-type FilterLayerWriter struct {
-	context uintptr
-}
-
-// Add adds a file or directory to the layer. The file's parent directory must have already been added.
-//
-// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
-// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
-// winio.BackupStreamWriter can be used to facilitate this.
-func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
-	if name[0] != '\\' {
-		name = `\` + name
-	}
-	err := importLayerNext(w.context, name, fileInfo)
-	if err != nil {
-		return makeError(err, "ImportLayerNext", "")
-	}
-	return nil
-}
-
-// AddLink adds a hard link to the layer. The target of the link must have already been added.
-func (w *FilterLayerWriter) AddLink(name string, target string) error {
-	return errors.New("hard links not yet supported")
-}
-
-// Remove removes a file from the layer. The file must have been present in the parent layer.
-//
-// name contains the file's relative path.
-func (w *FilterLayerWriter) Remove(name string) error {
-	if name[0] != '\\' {
-		name = `\` + name
-	}
-	err := importLayerNext(w.context, name, nil)
-	if err != nil {
-		return makeError(err, "ImportLayerNext", "")
-	}
-	return nil
-}
-
-// Write writes more backup stream data to the current file.
-func (w *FilterLayerWriter) Write(b []byte) (int, error) {
-	err := importLayerWrite(w.context, b)
-	if err != nil {
-		err = makeError(err, "ImportLayerWrite", "")
-		return 0, err
-	}
-	return len(b), err
-}
-
-// Close completes the layer write operation. The error must be checked to ensure that the
-// operation was successful.
-func (w *FilterLayerWriter) Close() (err error) {
-	if w.context != 0 {
-		err = importLayerEnd(w.context)
-		if err != nil {
-			err = makeError(err, "ImportLayerEnd", "")
-		}
-		w.context = 0
-	}
-	return
-}
-
-type legacyLayerWriterWrapper struct {
-	*legacyLayerWriter
-	info             DriverInfo
-	layerID          string
-	path             string
-	parentLayerPaths []string
-}
-
-func (r *legacyLayerWriterWrapper) Close() error {
-	defer os.RemoveAll(r.root)
-	err := r.legacyLayerWriter.Close()
-	if err != nil {
-		return err
-	}
-
-	// Use the original path here because ImportLayer does not support long paths for the source in TP5.
-	// But do use a long path for the destination to work around another bug with directories
-	// with MAX_PATH - 12 < length < MAX_PATH.
-	info := r.info
-	fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID))
-	if err != nil {
-		return err
-	}
-
-	info.HomeDir = ""
-	if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil {
-		return err
-	}
-	// Add any hard links that were collected.
-	for _, lnk := range r.PendingLinks {
-		if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) {
-			return err
-		}
-		if err = os.Link(lnk.Target, lnk.Path); err != nil {
-			return err
-		}
-	}
-	// Prepare the utility VM for use if one is present in the layer.
-	if r.HasUtilityVM {
-		err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM"))
-		if err != nil {
-			return err
-		}
-	}
-	return nil
-}
-
-// NewLayerWriter returns a new layer writer for creating a layer on disk.
-// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
-// to call this and any methods on the resulting LayerWriter.
-func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
-	if len(parentLayerPaths) == 0 {
-		// This is a base layer. It gets imported differently.
-		return &baseLayerWriter{
-			root: filepath.Join(info.HomeDir, layerID),
-		}, nil
-	}
-
-	if procImportLayerBegin.Find() != nil {
-		// The new layer reader is not available on this Windows build. Fall back to the
-		// legacy export code path.
-		path, err := ioutil.TempDir("", "hcs")
-		if err != nil {
-			return nil, err
-		}
-		return &legacyLayerWriterWrapper{
-			legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)),
-			info:              info,
-			layerID:           layerID,
-			path:              path,
-			parentLayerPaths:  parentLayerPaths,
-		}, nil
-	}
-	layers, err := layerPathsToDescriptors(parentLayerPaths)
-	if err != nil {
-		return nil, err
-	}
-
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		return nil, err
-	}
-
-	w := &FilterLayerWriter{}
-	err = importLayerBegin(&infop, layerID, layers, &w.context)
-	if err != nil {
-		return nil, makeError(err, "ImportLayerStart", "")
-	}
-	return w, nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go
index 9fc7852e4..5b91e0cc5 100644
--- a/vendor/github.com/Microsoft/hcsshim/interface.go
+++ b/vendor/github.com/Microsoft/hcsshim/interface.go
@@ -1,105 +1,32 @@
 package hcsshim
 
 import (
-	"encoding/json"
 	"io"
 	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema1"
 )
 
 // ProcessConfig is used as both the input of Container.CreateProcess
 // and to convert the parameters to JSON for passing onto the HCS
-type ProcessConfig struct {
-	ApplicationName   string            `json:",omitempty"`
-	CommandLine       string            `json:",omitempty"`
-	CommandArgs       []string          `json:",omitempty"` // Used by Linux Containers on Windows
-	User              string            `json:",omitempty"`
-	WorkingDirectory  string            `json:",omitempty"`
-	Environment       map[string]string `json:",omitempty"`
-	EmulateConsole    bool              `json:",omitempty"`
-	CreateStdInPipe   bool              `json:",omitempty"`
-	CreateStdOutPipe  bool              `json:",omitempty"`
-	CreateStdErrPipe  bool              `json:",omitempty"`
-	ConsoleSize       [2]uint           `json:",omitempty"`
-	CreateInUtilityVm bool              `json:",omitempty"` // Used by Linux Containers on Windows
-	OCISpecification  *json.RawMessage  `json:",omitempty"` // Used by Linux Containers on Windows
-}
-
-type Layer struct {
-	ID   string
-	Path string
-}
-
-type MappedDir struct {
-	HostPath         string
-	ContainerPath    string
-	ReadOnly         bool
-	BandwidthMaximum uint64
-	IOPSMaximum      uint64
-}
+type ProcessConfig = schema1.ProcessConfig
 
-type MappedPipe struct {
-	HostPath          string
-	ContainerPipeName string
-}
-
-type HvRuntime struct {
-	ImagePath           string `json:",omitempty"`
-	SkipTemplate        bool   `json:",omitempty"`
-	LinuxInitrdFile     string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
-	LinuxKernelFile     string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
-	LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
-	BootSource          string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
-	WritableBootSource  bool   `json:",omitempty"` // Linux Utility VM booting from VHD
-}
+type Layer = schema1.Layer
+type MappedDir = schema1.MappedDir
+type MappedPipe = schema1.MappedPipe
+type HvRuntime = schema1.HvRuntime
+type MappedVirtualDisk = schema1.MappedVirtualDisk
 
-type MappedVirtualDisk struct {
-	HostPath          string `json:",omitempty"` // Path to VHD on the host
-	ContainerPath     string // Platform-specific mount point path in the container
-	CreateInUtilityVM bool   `json:",omitempty"`
-	ReadOnly          bool   `json:",omitempty"`
-	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
-	AttachOnly        bool   `json:",omitempty:`
-}
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice = schema1.AssignedDevice
 
 // ContainerConfig is used as both the input of CreateContainer
 // and to convert the parameters to JSON for passing onto the HCS
-type ContainerConfig struct {
-	SystemType                  string              // HCS requires this to be hard-coded to "Container"
-	Name                        string              // Name of the container. We use the docker ID.
-	Owner                       string              `json:",omitempty"` // The management platform that created this container
-	VolumePath                  string              `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
-	IgnoreFlushesDuringBoot     bool                `json:",omitempty"` // Optimization hint for container startup in Windows
-	LayerFolderPath             string              `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format  %root%\windowsfilter\containerID
-	Layers                      []Layer             // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
-	Credentials                 string              `json:",omitempty"` // Credentials information
-	ProcessorCount              uint32              `json:",omitempty"` // Number of processors to assign to the container.
-	ProcessorWeight             uint64              `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
-	ProcessorMaximum            int64               `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
-	StorageIOPSMaximum          uint64              `json:",omitempty"` // Maximum Storage IOPS
-	StorageBandwidthMaximum     uint64              `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
-	StorageSandboxSize          uint64              `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
-	MemoryMaximumInMB           int64               `json:",omitempty"` // Maximum memory available to the container in Megabytes
-	HostName                    string              `json:",omitempty"` // Hostname
-	MappedDirectories           []MappedDir         `json:",omitempty"` // List of mapped directories (volumes/mounts)
-	MappedPipes                 []MappedPipe        `json:",omitempty"` // List of mapped Windows named pipes
-	HvPartition                 bool                // True if it a Hyper-V Container
-	NetworkSharedContainerName  string              `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
-	EndpointList                []string            `json:",omitempty"` // List of networking endpoints to be attached to container
-	HvRuntime                   *HvRuntime          `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
-	Servicing                   bool                `json:",omitempty"` // True if this container is for servicing
-	AllowUnqualifiedDNSQuery    bool                `json:",omitempty"` // True to allow unqualified DNS name resolution
-	DNSSearchList               string              `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
-	ContainerType               string              `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
-	TerminateOnLastHandleClosed bool                `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
-	MappedVirtualDisks          []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
-}
+type ContainerConfig = schema1.ContainerConfig
 
-type ComputeSystemQuery struct {
-	IDs    []string `json:"Ids,omitempty"`
-	Types  []string `json:",omitempty"`
-	Names  []string `json:",omitempty"`
-	Owners []string `json:",omitempty"`
-}
+type ComputeSystemQuery = schema1.ComputeSystemQuery
 
 // Container represents a created (but not necessarily running) container.
 type Container interface {
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
new file mode 100644
index 000000000..9f926c6be
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
@@ -0,0 +1,85 @@
+package guestrequest
+
+import "github.com/Microsoft/hcsshim/internal/schema2"
+
+// Arguably, many of these (at least CombinedLayers) should have been generated
+// by swagger.
+//
+// This will also change package name due to an inbound breaking change.
+
+// This class is used by a modify request to add or remove a combined layers
+// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
+// using the specified layers as the parent content. Ignores property ScratchPath
+// since the container path is already the scratch path. For linux, the GCS unions
+// the specified layers and ScratchPath together, placing the resulting union
+// filesystem at ContainerRootPath.
+type CombinedLayers struct {
+	ContainerRootPath string            `json:"ContainerRootPath,omitempty"`
+	Layers            []hcsschema.Layer `json:"Layers,omitempty"`
+	ScratchPath       string            `json:"ScratchPath,omitempty"`
+}
+
+// Defines the schema for hosted settings passed to GCS and/or OpenGCS
+
+// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
+type LCOWMappedVirtualDisk struct {
+	MountPath  string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
+	Lun        uint8  `json:"Lun,omitempty"`
+	Controller uint8  `json:"Controller,omitempty"`
+	ReadOnly   bool   `json:"ReadOnly,omitempty"`
+}
+
+type WCOWMappedVirtualDisk struct {
+	ContainerPath string `json:"ContainerPath,omitempty"`
+	Lun           int32  `json:"Lun,omitempty"`
+}
+
+type LCOWMappedDirectory struct {
+	MountPath string `json:"MountPath,omitempty"`
+	Port      int32  `json:"Port,omitempty"`
+	ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
+	ReadOnly  bool   `json:"ReadOnly,omitempty"`
+}
+
+// Read-only layers over VPMem
+type LCOWMappedVPMemDevice struct {
+	DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
+	MountPath    string `json:"MountPath,omitempty"` // /tmp/pN
+}
+
+type ResourceType string
+
+const (
+	// These are constants for v2 schema modify guest requests.
+	ResourceTypeMappedDirectory   ResourceType = "MappedDirectory"
+	ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
+	ResourceTypeNetwork           ResourceType = "Network"
+	ResourceTypeNetworkNamespace  ResourceType = "NetworkNamespace"
+	ResourceTypeCombinedLayers    ResourceType = "CombinedLayers"
+	ResourceTypeVPMemDevice       ResourceType = "VPMemDevice"
+)
+
+// GuestRequest is for modify commands passed to the guest.
+type GuestRequest struct {
+	RequestType  string       `json:"RequestType,omitempty"`
+	ResourceType ResourceType `json:"ResourceType,omitempty"`
+	Settings     interface{}  `json:"Settings,omitempty"`
+}
+
+type NetworkModifyRequest struct {
+	AdapterId   string      `json:"AdapterId,omitempty"`
+	RequestType string      `json:"RequestType,omitempty"`
+	Settings    interface{} `json:"Settings,omitempty"`
+}
+
+type RS4NetworkModifyRequest struct {
+	AdapterInstanceId string      `json:"AdapterInstanceId,omitempty"`
+	RequestType       string      `json:"RequestType,omitempty"`
+	Settings          interface{} `json:"Settings,omitempty"`
+}
+
+// SignalProcessOptions is the options passed to either WCOW or LCOW
+// to signal a given process.
+type SignalProcessOptions struct {
+	Signal int `json:,omitempty`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
new file mode 100644
index 000000000..e9e45c030
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
@@ -0,0 +1,69 @@
+package guid
+
+import (
+	"crypto/rand"
+	"encoding/json"
+	"fmt"
+	"io"
+	"strconv"
+	"strings"
+)
+
+var _ = (json.Marshaler)(&GUID{})
+var _ = (json.Unmarshaler)(&GUID{})
+
+type GUID [16]byte
+
+func New() GUID {
+	g := GUID{}
+	_, err := io.ReadFull(rand.Reader, g[:])
+	if err != nil {
+		panic(err)
+	}
+	return g
+}
+
+func (g GUID) String() string {
+	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
+}
+
+func FromString(s string) GUID {
+	if len(s) != 36 {
+		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
+	}
+	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
+		panic("invalid GUID format")
+	}
+	indexOrder := [16]int{
+		0, 2, 4, 6,
+		9, 11,
+		14, 16,
+		19, 21,
+		24, 26, 28, 30, 32, 34,
+	}
+	byteOrder := [16]int{
+		3, 2, 1, 0,
+		5, 4,
+		7, 6,
+		8, 9,
+		10, 11, 12, 13, 14, 15,
+	}
+	var g GUID
+	for i, x := range indexOrder {
+		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
+		if err != nil {
+			panic(err)
+		}
+		g[byteOrder[i]] = byte(b)
+	}
+	return g
+}
+
+func (g GUID) MarshalJSON() ([]byte, error) {
+	return json.Marshal(g.String())
+}
+
+func (g *GUID) UnmarshalJSON(data []byte) error {
+	*g = FromString(strings.Trim(string(data), "\""))
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
index e8c2b00c8..5119c2555 100644
--- a/vendor/github.com/Microsoft/hcsshim/callback.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
@@ -1,8 +1,11 @@
-package hcsshim
+package hcs
 
 import (
 	"sync"
 	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
 )
 
 var (
@@ -62,7 +65,7 @@ func closeChannels(channels notificationChannels) {
 func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
 	var result error
 	if int32(notificationStatus) < 0 {
-		result = syscall.Errno(win32FromHresult(notificationStatus))
+		result = interop.Win32FromHresult(notificationStatus)
 	}
 
 	callbackMapLock.RLock()
@@ -73,7 +76,13 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
 		return 0
 	}
 
-	context.channels[notificationType] <- result
+	if channel, ok := context.channels[notificationType]; ok {
+		channel <- result
+	} else {
+		logrus.WithFields(logrus.Fields{
+			"notification-type": notificationType,
+		}).Warn("Received a callback of an unsupported type")
+	}
 
 	return 0
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
index 200333233..3669c34aa 100644
--- a/vendor/github.com/Microsoft/hcsshim/cgo.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
@@ -1,4 +1,4 @@
-package hcsshim
+package hcs
 
 import "C"
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
new file mode 100644
index 000000000..6368b5717
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
@@ -0,0 +1,284 @@
+package hcs
+
+import (
+	"encoding/json"
+	"errors"
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
+	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = syscall.Errno(0x490)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = syscall.Errno(0x32)
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = syscall.Errno(0xd)
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = syscall.Errno(0x7f)
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = errors.New("unsupported platform request")
+)
+
+type ErrorEvent struct {
+	Message    string `json:"Message,omitempty"`    // Fully formated error message
+	StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
+	Provider   string `json:"Provider,omitempty"`
+	EventID    uint16 `json:"EventId,omitempty"`
+	Flags      uint32 `json:"Flags,omitempty"`
+	Source     string `json:"Source,omitempty"`
+	//Data       []EventData `json:"Data,omitempty"`  // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
+}
+
+type hcsResult struct {
+	Error        int32
+	ErrorMessage string
+	ErrorEvents  []ErrorEvent `json:"ErrorEvents,omitempty"`
+}
+
+func (ev *ErrorEvent) String() string {
+	evs := "[Event Detail: " + ev.Message
+	if ev.StackTrace != "" {
+		evs += " Stack Trace: " + ev.StackTrace
+	}
+	if ev.Provider != "" {
+		evs += " Provider: " + ev.Provider
+	}
+	if ev.EventID != 0 {
+		evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
+	}
+	if ev.Flags != 0 {
+		evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
+	}
+	if ev.Source != "" {
+		evs += " Source: " + ev.Source
+	}
+	evs += "]"
+	return evs
+}
+
+func processHcsResult(resultp *uint16) []ErrorEvent {
+	if resultp != nil {
+		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
+		logrus.WithField(logfields.JSON, resultj).
+			Debug("HCS Result")
+		result := &hcsResult{}
+		if err := json.Unmarshal([]byte(resultj), result); err != nil {
+			logrus.WithFields(logrus.Fields{
+				logfields.JSON:  resultj,
+				logrus.ErrorKey: err,
+			}).Warning("Could not unmarshal HCS result")
+			return nil
+		}
+		return result.ErrorEvents
+	}
+	return nil
+}
+
+type HcsError struct {
+	Op     string
+	Err    error
+	Events []ErrorEvent
+}
+
+func (e *HcsError) Error() string {
+	s := e.Op + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	SystemID string
+	Pid      int
+	Op       string
+	Err      error
+	Events   []ErrorEvent
+}
+
+// SystemError is an error encountered in HCS during an operation on a Container object
+type SystemError struct {
+	ID     string
+	Op     string
+	Err    error
+	Extra  string
+	Events []ErrorEvent
+}
+
+func (e *SystemError) Error() string {
+	s := e.Op + " " + e.ID + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	if e.Extra != "" {
+		s += "\n(extra info: " + e.Extra + ")"
+	}
+	return s
+}
+
+func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*SystemError); ok {
+		return err
+	}
+	return &SystemError{
+		ID:     system.ID(),
+		Op:     op,
+		Extra:  extra,
+		Err:    err,
+		Events: events,
+	}
+}
+
+func (e *ProcessError) Error() string {
+	s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	return &ProcessError{
+		Pid:      process.Pid(),
+		SystemID: process.SystemID(),
+		Op:       op,
+		Err:      err,
+		Events:   events,
+	}
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	err = getInnerError(err)
+	return err == ErrComputeSystemDoesNotExist ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	err = getInnerError(err)
+	return err == ErrAlreadyClosed
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationPending
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	err = getInnerError(err)
+	return err == ErrTimeout
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeAlreadyStopped ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	err = getInnerError(err)
+	// If Platform doesn't recognize or support the request sent, below errors are seen
+	return err == ErrVmcomputeInvalidJSON ||
+		err == ErrInvalidData ||
+		err == ErrNotSupported ||
+		err == ErrVmcomputeUnknownMessage
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *HcsError:
+		err = pe.Err
+	case *SystemError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
new file mode 100644
index 000000000..b0d49cbcf
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
@@ -0,0 +1,48 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcs
+
+import (
+	"syscall"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+type hcsSystem syscall.Handle
+type hcsProcess syscall.Handle
+type hcsCallback syscall.Handle
+
+type hcsProcessInformation struct {
+	ProcessId uint32
+	Reserved  uint32
+	StdInput  syscall.Handle
+	StdOutput syscall.Handle
+	StdError  syscall.Handle
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
new file mode 100644
index 000000000..90d164e35
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
@@ -0,0 +1,15 @@
+package hcs
+
+import "github.com/sirupsen/logrus"
+
+func logOperationBegin(ctx logrus.Fields, msg string) {
+	logrus.WithFields(ctx).Debug(msg)
+}
+
+func logOperationEnd(ctx logrus.Fields, msg string, err error) {
+	if err == nil {
+		logrus.WithFields(ctx).Debug(msg)
+	} else {
+		logrus.WithFields(ctx).WithError(err).Error(msg)
+	}
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
new file mode 100644
index 000000000..42598cf2f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
@@ -0,0 +1,465 @@
+package hcs
+
+import (
+	"encoding/json"
+	"io"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/guestrequest"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+// ContainerError is an error encountered in HCS
+type Process struct {
+	handleLock     sync.RWMutex
+	handle         hcsProcess
+	processID      int
+	system         *System
+	cachedPipes    *cachedPipes
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
+	return &Process{
+		handle:    process,
+		processID: processID,
+		system:    computeSystem,
+		logctx: logrus.Fields{
+			logfields.HCSOperation: "",
+			logfields.ContainerID:  computeSystem.ID(),
+			logfields.ProcessID:    processID,
+		},
+	}
+}
+
+type cachedPipes struct {
+	stdIn  syscall.Handle
+	stdOut syscall.Handle
+	stdErr syscall.Handle
+}
+
+type processModifyRequest struct {
+	Operation   string
+	ConsoleSize *consoleSize `json:",omitempty"`
+	CloseHandle *closeHandle `json:",omitempty"`
+}
+
+type consoleSize struct {
+	Height uint16
+	Width  uint16
+}
+
+type closeHandle struct {
+	Handle string
+}
+
+type ProcessStatus struct {
+	ProcessID      uint32
+	Exited         bool
+	ExitCode       uint32
+	LastWaitResult int32
+}
+
+const (
+	stdIn  string = "StdIn"
+	stdOut string = "StdOut"
+	stdErr string = "StdErr"
+)
+
+const (
+	modifyConsoleSize string = "ConsoleSize"
+	modifyCloseHandle string = "CloseHandle"
+)
+
+// Pid returns the process ID of the process within the container.
+func (process *Process) Pid() int {
+	return process.processID
+}
+
+// SystemID returns the ID of the process's compute system.
+func (process *Process) SystemID() string {
+	return process.system.ID()
+}
+
+func (process *Process) logOperationBegin(operation string) {
+	process.logctx[logfields.HCSOperation] = operation
+	logOperationBegin(
+		process.logctx,
+		"hcsshim::Process - Begin Operation")
+}
+
+func (process *Process) logOperationEnd(err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		process.logctx,
+		"hcsshim::Process - End Operation - "+result,
+		err)
+	process.logctx[logfields.HCSOperation] = ""
+}
+
+// Signal signals the process with `options`.
+func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Signal"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	optionsb, err := json.Marshal(options)
+	if err != nil {
+		return err
+	}
+
+	optionsStr := string(optionsb)
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(process.logctx, &completed)
+	err = hcsSignalProcess(process.handle, optionsStr, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Kill signals the process to terminate but does not wait for it to finish terminating.
+func (process *Process) Kill() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Kill"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(process.logctx, &completed)
+	err = hcsTerminateProcess(process.handle, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Wait waits for the process to exit.
+func (process *Process) Wait() (err error) {
+	operation := "hcsshim::Process::Wait"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+// false if timeout occurs.
+func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcssshim::Process::WaitTimeout"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// ResizeConsole resizes the console of the process.
+func (process *Process) ResizeConsole(width, height uint16) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::ResizeConsole"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyConsoleSize,
+		ConsoleSize: &consoleSize{
+			Height: height,
+			Width:  width,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+func (process *Process) Properties() (_ *ProcessStatus, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Properties"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	if process.handle == 0 {
+		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	completed := false
+	go syscallWatcher(process.logctx, &completed)
+	err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeProcessError(process, operation, err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+
+	properties := &ProcessStatus{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return properties, nil
+}
+
+// ExitCode returns the exit code of the process. The process must have
+// already terminated.
+func (process *Process) ExitCode() (_ int, err error) {
+	operation := "hcsshim::Process::ExitCode"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	properties, err := process.Properties()
+	if err != nil {
+		return 0, makeProcessError(process, operation, err, nil)
+	}
+
+	if properties.Exited == false {
+		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
+	}
+
+	if properties.LastWaitResult != 0 {
+		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
+	}
+
+	return int(properties.ExitCode), nil
+}
+
+// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; it should be possible to
+// call this multiple times to get multiple interfaces.
+func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Stdio"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	if process.handle == 0 {
+		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var stdIn, stdOut, stdErr syscall.Handle
+
+	if process.cachedPipes == nil {
+		var (
+			processInfo hcsProcessInformation
+			resultp     *uint16
+		)
+		err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
+		events := processHcsResult(resultp)
+		if err != nil {
+			return nil, nil, nil, makeProcessError(process, operation, err, events)
+		}
+
+		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
+	} else {
+		// Use cached pipes
+		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
+
+		// Invalidate the cache
+		process.cachedPipes = nil
+	}
+
+	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return pipes[0], pipes[1], pipes[2], nil
+}
+
+// CloseStdin closes the write side of the stdin pipe so that the process is
+// notified on the read side that there is no more data in stdin.
+func (process *Process) CloseStdin() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::CloseStdin"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyCloseHandle,
+		CloseHandle: &closeHandle{
+			Handle: stdIn,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Close cleans up any state associated with the process but does not kill
+// or wait on it.
+func (process *Process) Close() (err error) {
+	process.handleLock.Lock()
+	defer process.handleLock.Unlock()
+
+	operation := "hcsshim::Process::Close"
+	process.logOperationBegin(operation)
+	defer process.logOperationEnd(err)
+
+	// Don't double free this
+	if process.handle == 0 {
+		return nil
+	}
+
+	if err = process.unregisterCallback(); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	if err = hcsCloseProcess(process.handle); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	process.handle = 0
+
+	return nil
+}
+
+func (process *Process) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	process.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (process *Process) unregisterCallback() error {
+	callbackNumber := process.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterProcessCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterProcessCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
new file mode 100644
index 000000000..2629380fd
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
@@ -0,0 +1,667 @@
+package hcs
+
+import (
+	"encoding/json"
+	"os"
+	"strconv"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// currentContainerStarts is used to limit the number of concurrent container
+// starts.
+var currentContainerStarts containerStarts
+
+type containerStarts struct {
+	maxParallel int
+	inProgress  int
+	sync.Mutex
+}
+
+func init() {
+	mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
+	if len(mpsS) > 0 {
+		mpsI, err := strconv.Atoi(mpsS)
+		if err != nil || mpsI < 0 {
+			return
+		}
+		currentContainerStarts.maxParallel = mpsI
+	}
+}
+
+type System struct {
+	handleLock     sync.RWMutex
+	handle         hcsSystem
+	id             string
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newSystem(id string) *System {
+	return &System{
+		id: id,
+		logctx: logrus.Fields{
+			logfields.HCSOperation: "",
+			logfields.ContainerID:  id,
+		},
+	}
+}
+
+func (computeSystem *System) logOperationBegin(operation string) {
+	computeSystem.logctx[logfields.HCSOperation] = operation
+	logOperationBegin(
+		computeSystem.logctx,
+		"hcsshim::ComputeSystem - Begin Operation")
+}
+
+func (computeSystem *System) logOperationEnd(err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		computeSystem.logctx,
+		"hcsshim::ComputeSystem - End Operation - "+result,
+		err)
+	computeSystem.logctx[logfields.HCSOperation] = ""
+}
+
+// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
+func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
+	operation := "hcsshim::CreateComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
+	if err != nil {
+		return nil, err
+	}
+
+	hcsDocument := string(hcsDocumentB)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, hcsDocument).
+		Debug("HCS ComputeSystem Document")
+
+	var (
+		resultp  *uint16
+		identity syscall.Handle
+	)
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
+	completed = true
+
+	if createError == nil || IsPending(createError) {
+		if err = computeSystem.registerCallback(); err != nil {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+			return nil, makeSystemError(computeSystem, operation, "", err, nil)
+		}
+	}
+
+	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	if err != nil {
+		if err == ErrTimeout {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+		}
+		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
+	}
+
+	return computeSystem, nil
+}
+
+// OpenComputeSystem opens an existing compute system by ID.
+func OpenComputeSystem(id string) (_ *System, err error) {
+	operation := "hcsshim::OpenComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	var (
+		handle  hcsSystem
+		resultp *uint16
+	)
+	err = hcsOpenComputeSystem(id, &handle, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+
+	computeSystem.handle = handle
+
+	if err = computeSystem.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	return computeSystem, nil
+}
+
+// GetComputeSystems gets a list of the compute systems on the system that match the query
+func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
+	operation := "hcsshim::GetComputeSystems"
+	fields := logrus.Fields{
+		logfields.HCSOperation: operation,
+	}
+	logOperationBegin(
+		fields,
+		"hcsshim::ComputeSystem - Begin Operation")
+
+	defer func() {
+		var result string
+		if err == nil {
+			result = "Success"
+		} else {
+			result = "Error"
+		}
+
+		logOperationEnd(
+			fields,
+			"hcsshim::ComputeSystem - End Operation - "+result,
+			err)
+	}()
+
+	queryb, err := json.Marshal(q)
+	if err != nil {
+		return nil, err
+	}
+
+	query := string(queryb)
+
+	logrus.WithFields(fields).
+		WithField(logfields.JSON, query).
+		Debug("HCS ComputeSystem Query")
+
+	var (
+		resultp         *uint16
+		computeSystemsp *uint16
+	)
+	completed := false
+	go syscallWatcher(fields, &completed)
+	err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, &HcsError{Op: operation, Err: err, Events: events}
+	}
+
+	if computeSystemsp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
+	computeSystems := []schema1.ContainerProperties{}
+	if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+		return nil, err
+	}
+
+	return computeSystems, nil
+}
+
+// Start synchronously starts the computeSystem.
+func (computeSystem *System) Start() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Start"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+	}
+
+	// This is a very simple backoff-retry loop to limit the number
+	// of parallel container starts if environment variable
+	// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
+	// It should generally only be used as a workaround to various
+	// platform issues that exist between RS1 and RS4 as of Aug 2018
+	if currentContainerStarts.maxParallel > 0 {
+		for {
+			currentContainerStarts.Lock()
+			if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
+				currentContainerStarts.inProgress++
+				currentContainerStarts.Unlock()
+				break
+			}
+			if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
+				currentContainerStarts.Unlock()
+				time.Sleep(100 * time.Millisecond)
+			}
+		}
+		// Make sure we decrement the count when we are done.
+		defer func() {
+			currentContainerStarts.Lock()
+			currentContainerStarts.inProgress--
+			currentContainerStarts.Unlock()
+		}()
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
+	if err != nil {
+		return makeSystemError(computeSystem, "Start", "", err, events)
+	}
+
+	return nil
+}
+
+// ID returns the compute system's identifier.
+func (computeSystem *System) ID() string {
+	return computeSystem.id
+}
+
+// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Shutdown() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Shutdown"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Shutdown", "", err, events)
+	}
+
+	return nil
+}
+
+// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Terminate() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Terminate"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Terminate", "", err, events)
+	}
+
+	return nil
+}
+
+// Wait synchronously waits for the compute system to shutdown or terminate.
+func (computeSystem *System) Wait() (err error) {
+	operation := "hcsshim::ComputeSystem::Wait"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil {
+		return makeSystemError(computeSystem, "Wait", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
+// If the timeout expires, IsTimeout(err) == true
+func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitTimeout"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
+	if err != nil {
+		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
+	}
+
+	return nil
+}
+
+func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Properties"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, queryj).
+		Debug("HCS ComputeSystem Properties Query")
+
+	var resultp, propertiesp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+	properties := &schema1.ContainerProperties{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	return properties, nil
+}
+
+// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Pause() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Pause"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
+	if err != nil {
+		return makeSystemError(computeSystem, "Pause", "", err, events)
+	}
+
+	return nil
+}
+
+// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Resume() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Resume"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
+	if err != nil {
+		return makeSystemError(computeSystem, "Resume", "", err, events)
+	}
+
+	return nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::CreateProcess"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	var (
+		processInfo   hcsProcessInformation
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	configuration := string(configurationb)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, configuration).
+		Debug("HCS ComputeSystem Process Document")
+
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.ProcessID, processInfo.ProcessId).
+		Debug("HCS ComputeSystem CreateProcess PID")
+
+	process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
+	process.cachedPipes = &cachedPipes{
+		stdIn:  processInfo.StdInput,
+		stdOut: processInfo.StdOutput,
+		stdErr: processInfo.StdError,
+	}
+
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// OpenProcess gets an interface to an existing process within the computeSystem.
+func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	// Add PID for the context of this operation
+	computeSystem.logctx[logfields.ProcessID] = pid
+	defer delete(computeSystem.logctx, logfields.ProcessID)
+
+	operation := "hcsshim::ComputeSystem::OpenProcess"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	var (
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+	}
+
+	process := newProcess(processHandle, pid, computeSystem)
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// Close cleans up any state associated with the compute system but does not terminate or wait for it.
+func (computeSystem *System) Close() (err error) {
+	computeSystem.handleLock.Lock()
+	defer computeSystem.handleLock.Unlock()
+
+	operation := "hcsshim::ComputeSystem::Close"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	// Don't double free this
+	if computeSystem.handle == 0 {
+		return nil
+	}
+
+	if err = computeSystem.unregisterCallback(); err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsCloseComputeSystem(computeSystem.handle)
+	completed = true
+	if err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	computeSystem.handle = 0
+
+	return nil
+}
+
+func (computeSystem *System) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	computeSystem.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (computeSystem *System) unregisterCallback() error {
+	callbackNumber := computeSystem.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterComputeSystemCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterComputeSystemCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
+
+// Modify the System by sending a request to HCS
+func (computeSystem *System) Modify(config interface{}) (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Modify"
+	computeSystem.logOperationBegin(operation)
+	defer computeSystem.logOperationEnd(err)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+	}
+
+	requestJSON, err := json.Marshal(config)
+	if err != nil {
+		return err
+	}
+
+	requestString := string(requestJSON)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, requestString).
+		Debug("HCS ComputeSystem Modify Document")
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(computeSystem.logctx, &completed)
+	err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+	}
+
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
index bd6e2d94a..a638677ed 100644
--- a/vendor/github.com/Microsoft/hcsshim/utils.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
@@ -1,4 +1,4 @@
-package hcsshim
+package hcs
 
 import (
 	"io"
diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
index b7be20ea0..91e212c57 100644
--- a/vendor/github.com/Microsoft/hcsshim/waithelper.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
@@ -1,4 +1,4 @@
-package hcsshim
+package hcs
 
 import (
 	"time"
@@ -6,13 +6,13 @@ import (
 	"github.com/sirupsen/logrus"
 )
 
-func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
-	err = processHcsResult(err, resultp)
+func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+	events := processHcsResult(resultp)
 	if IsPending(err) {
-		return waitForNotification(callbackNumber, expectedNotification, timeout)
+		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
 	}
 
-	return err
+	return events, err
 }
 
 func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
new file mode 100644
index 000000000..e09dd1334
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
@@ -0,0 +1,33 @@
+package hcs
+
+import (
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// syscallWatcher is used as a very simple goroutine around calls into
+// the platform. In some cases, we have seen HCS APIs not returning due to
+// various bugs, and the goroutine making the syscall ends up not returning,
+// prior to its async callback. By spinning up a syscallWatcher, it allows
+// us to at least log a warning if a syscall doesn't complete in a reasonable
+// amount of time.
+//
+// Usage is:
+//
+// completed := false
+// go syscallWatcher(context, &completed)
+// <syscall>
+// completed = true
+//
+func syscallWatcher(context logrus.Fields, syscallCompleted *bool) {
+	time.Sleep(timeout.SyscallWatcher)
+	if *syscallCompleted {
+		return
+	}
+	logrus.WithFields(context).
+		WithField(logfields.Timeout, timeout.SyscallWatcher).
+		Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
new file mode 100644
index 000000000..877c69a14
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
@@ -0,0 +1,462 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hcs
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+
+	procHcsGetProcessInfo            = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties      = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess             = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties      = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback   = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+)
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCloseProcess(process hcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsSignalProcess(process, _p0, result)
+}
+
+func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
new file mode 100644
index 000000000..c8d362c66
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
@@ -0,0 +1,51 @@
+package hcserror
+
+import (
+	"fmt"
+	"syscall"
+)
+
+const ERROR_GEN_FAILURE = syscall.Errno(31)
+
+type HcsError struct {
+	title string
+	rest  string
+	Err   error
+}
+
+func (e *HcsError) Error() string {
+	s := e.title
+	if len(s) > 0 && s[len(s)-1] != ' ' {
+		s += " "
+	}
+	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
+	if e.rest != "" {
+		if e.rest[0] != ' ' {
+			s += " "
+		}
+		s += e.rest
+	}
+	return s
+}
+
+func New(err error, title, rest string) error {
+	// Pass through DLL errors directly since they do not originate from HCS.
+	if _, ok := err.(*syscall.DLLError); ok {
+		return err
+	}
+	return &HcsError{title, rest, err}
+}
+
+func Errorf(err error, title, format string, a ...interface{}) error {
+	return New(err, title, fmt.Sprintf(format, a...))
+}
+
+func Win32FromError(err error) uint32 {
+	if herr, ok := err.(*HcsError); ok {
+		return Win32FromError(herr.Err)
+	}
+	if code, ok := err.(syscall.Errno); ok {
+		return uint32(code)
+	}
+	return uint32(ERROR_GEN_FAILURE)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go
new file mode 100644
index 000000000..b2e475f53
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go
@@ -0,0 +1,23 @@
+package hns
+
+import "fmt"
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
+
+//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
+
+type EndpointNotFoundError struct {
+	EndpointName string
+}
+
+func (e EndpointNotFoundError) Error() string {
+	return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
+}
+
+type NetworkNotFoundError struct {
+	NetworkName string
+}
+
+func (e NetworkNotFoundError) Error() string {
+	return fmt.Sprintf("Network %s not found", e.NetworkName)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
new file mode 100644
index 000000000..ce636458c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
@@ -0,0 +1,260 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint struct {
+	Id                 string            `json:"ID,omitempty"`
+	Name               string            `json:",omitempty"`
+	VirtualNetwork     string            `json:",omitempty"`
+	VirtualNetworkName string            `json:",omitempty"`
+	Policies           []json.RawMessage `json:",omitempty"`
+	MacAddress         string            `json:",omitempty"`
+	IPAddress          net.IP            `json:",omitempty"`
+	DNSSuffix          string            `json:",omitempty"`
+	DNSServerList      string            `json:",omitempty"`
+	GatewayAddress     string            `json:",omitempty"`
+	EnableInternalDNS  bool              `json:",omitempty"`
+	DisableICC         bool              `json:",omitempty"`
+	PrefixLength       uint8             `json:",omitempty"`
+	IsRemoteEndpoint   bool              `json:",omitempty"`
+	Namespace          *Namespace        `json:",omitempty"`
+}
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest struct {
+	ContainerID    string     `json:"ContainerId,omitempty"`
+	SystemType     SystemType `json:"SystemType"`
+	CompartmentID  uint16     `json:"CompartmentId,omitempty"`
+	VirtualNICName string     `json:"VirtualNicName,omitempty"`
+}
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse struct {
+	Success bool
+	Error   string
+}
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	endpoint := &HNSEndpoint{}
+	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	var endpoint []HNSEndpoint
+	err := hnsCall("GET", "/endpoints/", "", &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return HNSEndpointRequest("GET", endpointID, "")
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	hnsResponse, err := HNSListEndpointRequest()
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsEndpoint := range hnsResponse {
+		if hnsEndpoint.Name == endpointName {
+			return &hnsEndpoint, nil
+		}
+	}
+	return nil, EndpointNotFoundError{EndpointName: endpointName}
+}
+
+// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
+func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
+	operation := "Create"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	return HNSEndpointRequest("POST", "", string(jsonString))
+}
+
+// Delete Endpoint by sending EndpointRequest to HNS
+func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	return HNSEndpointRequest("DELETE", endpoint.Id, "")
+}
+
+// Update Endpoint
+func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
+	operation := "Update"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
+
+	return endpoint, err
+}
+
+// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
+func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
+	operation := "ApplyACLPolicy"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	for _, policy := range policies {
+		if policy == nil {
+			continue
+		}
+		jsonString, err := json.Marshal(policy)
+		if err != nil {
+			return err
+		}
+		endpoint.Policies = append(endpoint.Policies, jsonString)
+	}
+
+	_, err := endpoint.Update()
+	return err
+}
+
+// ContainerAttach attaches an endpoint to container
+func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
+	operation := "ContainerAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID:   containerID,
+		CompartmentID: compartmentID,
+		SystemType:    ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// ContainerDetach detaches an endpoint from container
+func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
+	operation := "ContainerDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID: containerID,
+		SystemType:  ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// HostAttach attaches a nic on the host
+func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
+	operation := "HostAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		CompartmentID: compartmentID,
+		SystemType:    HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+
+}
+
+// HostDetach detaches a nic on the host
+func (endpoint *HNSEndpoint) HostDetach() error {
+	operation := "HostDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// VirtualMachineNICAttach attaches a endpoint to a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
+	operation := "VirtualMachineNicAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		VirtualNICName: virtualMachineNICName,
+		SystemType:     VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// VirtualMachineNICDetach detaches a endpoint  from a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
+	operation := "VirtualMachineNicDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
index 2c1b979ae..969d1b263 100644
--- a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
@@ -1,9 +1,11 @@
-package hcsshim
+package hns
 
 import (
 	"encoding/json"
 	"fmt"
 
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
 	"github.com/sirupsen/logrus"
 )
 
@@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error {
 
 	err := _hnsCall(method, path, request, &responseBuffer)
 	if err != nil {
-		return makeError(err, "hnsCall ", "")
+		return hcserror.New(err, "hnsCall ", "")
 	}
-	response := convertAndFreeCoTaskMemString(responseBuffer)
+	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
 
 	hnsresponse := &hnsResponse{}
 	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go
new file mode 100644
index 000000000..a8d8cc56a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go
@@ -0,0 +1,28 @@
+package hns
+
+type HNSGlobals struct {
+	Version HNSVersion `json:"Version"`
+}
+
+type HNSVersion struct {
+	Major int `json:"Major"`
+	Minor int `json:"Minor"`
+}
+
+var (
+	HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	var version HNSVersion
+	err := hnsCall("GET", "/globals/version", "", &version)
+	if err != nil {
+		return nil, err
+	}
+
+	globals := &HNSGlobals{
+		Version: version,
+	}
+
+	return globals, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
new file mode 100644
index 000000000..7e859de91
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
@@ -0,0 +1,141 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet struct {
+	AddressPrefix  string            `json:",omitempty"`
+	GatewayAddress string            `json:",omitempty"`
+	Policies       []json.RawMessage `json:",omitempty"`
+}
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool struct {
+	StartMacAddress string `json:",omitempty"`
+	EndMacAddress   string `json:",omitempty"`
+}
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork struct {
+	Id                   string            `json:"ID,omitempty"`
+	Name                 string            `json:",omitempty"`
+	Type                 string            `json:",omitempty"`
+	NetworkAdapterName   string            `json:",omitempty"`
+	SourceMac            string            `json:",omitempty"`
+	Policies             []json.RawMessage `json:",omitempty"`
+	MacPools             []MacPool         `json:",omitempty"`
+	Subnets              []Subnet          `json:",omitempty"`
+	DNSSuffix            string            `json:",omitempty"`
+	DNSServerList        string            `json:",omitempty"`
+	DNSServerCompartment uint32            `json:",omitempty"`
+	ManagementIP         string            `json:",omitempty"`
+	AutomaticDNS         bool              `json:",omitempty"`
+}
+
+type hnsNetworkResponse struct {
+	Success bool
+	Error   string
+	Output  HNSNetwork
+}
+
+type hnsResponse struct {
+	Success bool
+	Error   string
+	Output  json.RawMessage
+}
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	var network HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return &network, nil
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	var network []HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return network, nil
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return HNSNetworkRequest("GET", networkID, "")
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsnetwork := range hsnnetworks {
+		if hnsnetwork.Name == networkName {
+			return &hnsnetwork, nil
+		}
+	}
+	return nil, NetworkNotFoundError{NetworkName: networkName}
+}
+
+// Create Network by sending NetworkRequest to HNS.
+func (network *HNSNetwork) Create() (*HNSNetwork, error) {
+	operation := "Create"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	jsonString, err := json.Marshal(network)
+	if err != nil {
+		return nil, err
+	}
+	return HNSNetworkRequest("POST", "", string(jsonString))
+}
+
+// Delete Network by sending NetworkRequest to HNS
+func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	return HNSNetworkRequest("DELETE", network.Id, "")
+}
+
+// Creates an endpoint on the Network.
+func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
+	return &HNSEndpoint{
+		VirtualNetwork: network.Id,
+		IPAddress:      ipAddress,
+		MacAddress:     string(macAddress),
+	}
+}
+
+func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
+
+	endpoint.VirtualNetwork = network.Id
+	return endpoint.Create()
+}
+
+func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateRemoteEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+	endpoint.IsRemoteEndpoint = true
+	return network.CreateEndpoint(endpoint)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
new file mode 100644
index 000000000..2318a4fce
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go
@@ -0,0 +1,98 @@
+package hns
+
+// Type of Request Support in ModifySystem
+type PolicyType string
+
+// RequestType const
+const (
+	Nat                  PolicyType = "NAT"
+	ACL                  PolicyType = "ACL"
+	PA                   PolicyType = "PA"
+	VLAN                 PolicyType = "VLAN"
+	VSID                 PolicyType = "VSID"
+	VNet                 PolicyType = "VNET"
+	L2Driver             PolicyType = "L2Driver"
+	Isolation            PolicyType = "Isolation"
+	QOS                  PolicyType = "QOS"
+	OutboundNat          PolicyType = "OutBoundNAT"
+	ExternalLoadBalancer PolicyType = "ELB"
+	Route                PolicyType = "ROUTE"
+)
+
+type NatPolicy struct {
+	Type         PolicyType `json:"Type"`
+	Protocol     string
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+type QosPolicy struct {
+	Type                            PolicyType `json:"Type"`
+	MaximumOutgoingBandwidthInBytes uint64
+}
+
+type IsolationPolicy struct {
+	Type               PolicyType `json:"Type"`
+	VLAN               uint
+	VSID               uint
+	InDefaultIsolation bool
+}
+
+type VlanPolicy struct {
+	Type PolicyType `json:"Type"`
+	VLAN uint
+}
+
+type VsidPolicy struct {
+	Type PolicyType `json:"Type"`
+	VSID uint
+}
+
+type PaPolicy struct {
+	Type PolicyType `json:"Type"`
+	PA   string     `json:"PA"`
+}
+
+type OutboundNatPolicy struct {
+	Policy
+	VIP        string   `json:"VIP,omitempty"`
+	Exceptions []string `json:"ExceptionList,omitempty"`
+}
+
+type ActionType string
+type DirectionType string
+type RuleType string
+
+const (
+	Allow ActionType = "Allow"
+	Block ActionType = "Block"
+
+	In  DirectionType = "In"
+	Out DirectionType = "Out"
+
+	Host   RuleType = "Host"
+	Switch RuleType = "Switch"
+)
+
+type ACLPolicy struct {
+	Type            PolicyType `json:"Type"`
+	Id              string     `json:"Id,omitempty"`
+	Protocol        uint16
+	Protocols       string `json:"Protocols,omitempty"`
+	InternalPort    uint16
+	Action          ActionType
+	Direction       DirectionType
+	LocalAddresses  string
+	RemoteAddresses string
+	LocalPorts      string `json:"LocalPorts,omitempty"`
+	LocalPort       uint16
+	RemotePorts     string `json:"RemotePorts,omitempty"`
+	RemotePort      uint16
+	RuleType        RuleType `json:"RuleType,omitempty"`
+	Priority        uint16
+	ServiceName     string
+}
+
+type Policy struct {
+	Type PolicyType `json:"Type"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
new file mode 100644
index 000000000..31322a681
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
@@ -0,0 +1,201 @@
+package hns
+
+import (
+	"encoding/json"
+
+	"github.com/sirupsen/logrus"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy struct {
+	Policy
+	DestinationPrefix string `json:"DestinationPrefix,omitempty"`
+	NextHop           string `json:"NextHop,omitempty"`
+	EncapEnabled      bool   `json:"NeedEncap,omitempty"`
+}
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy struct {
+	LBPolicy
+	SourceVIP string   `json:"SourceVIP,omitempty"`
+	VIPs      []string `json:"VIPs,omitempty"`
+	ILB       bool     `json:"ILB,omitempty"`
+	DSR       bool     `json:"IsDSR,omitempty"`
+}
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy struct {
+	Policy
+	Protocol     uint16 `json:"Protocol,omitempty"`
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList struct {
+	ID                 string            `json:"ID,omitempty"`
+	EndpointReferences []string          `json:"References,omitempty"`
+	Policies           []json.RawMessage `json:"Policies,omitempty"`
+}
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	var policy PolicyList
+	err := hnsCall(method, "/policylists/"+path, request, &policy)
+	if err != nil {
+		return nil, err
+	}
+
+	return &policy, nil
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	var plist []PolicyList
+	err := hnsCall("GET", "/policylists/", "", &plist)
+	if err != nil {
+		return nil, err
+	}
+
+	return plist, nil
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	policylist := &PolicyList{}
+	err := hnsCall(method, "/policylists/"+path, request, &policylist)
+	if err != nil {
+		return nil, err
+	}
+
+	return policylist, nil
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return PolicyListRequest("GET", policyListID, "")
+}
+
+// Create PolicyList by sending PolicyListRequest to HNS.
+func (policylist *PolicyList) Create() (*PolicyList, error) {
+	operation := "Create"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+	jsonString, err := json.Marshal(policylist)
+	if err != nil {
+		return nil, err
+	}
+	return PolicyListRequest("POST", "", string(jsonString))
+}
+
+// Delete deletes PolicyList
+func (policylist *PolicyList) Delete() (*PolicyList, error) {
+	operation := "Delete"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+
+	return PolicyListRequest("DELETE", policylist.ID, "")
+}
+
+// AddEndpoint add an endpoint to a Policy List
+func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "AddEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	// Add Endpoint to the Existing List
+	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+
+	return policylist.Create()
+}
+
+// RemoveEndpoint removes an endpoint from the Policy List
+func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "RemoveEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	elementToRemove := "/endpoints/" + endpoint.Id
+
+	var references []string
+
+	for _, endpointReference := range policylist.EndpointReferences {
+		if endpointReference == elementToRemove {
+			continue
+		}
+		references = append(references, endpointReference)
+	}
+	policylist.EndpointReferences = references
+	return policylist.Create()
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	operation := "AddLoadBalancer"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+
+	policylist := &PolicyList{}
+
+	elbPolicy := &ELBPolicy{
+		SourceVIP: sourceVIP,
+		ILB:       isILB,
+	}
+
+	if len(vip) > 0 {
+		elbPolicy.VIPs = []string{vip}
+	}
+	elbPolicy.Type = ExternalLoadBalancer
+	elbPolicy.Protocol = protocol
+	elbPolicy.InternalPort = internalPort
+	elbPolicy.ExternalPort = externalPort
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(elbPolicy)
+	if err != nil {
+		return nil, err
+	}
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	operation := "AddRoute"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
+
+	policylist := &PolicyList{}
+
+	rPolicy := &RoutePolicy{
+		DestinationPrefix: destinationPrefix,
+		NextHop:           nextHop,
+		EncapEnabled:      encapEnabled,
+	}
+	rPolicy.Type = Route
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(rPolicy)
+	if err != nil {
+		return nil, err
+	}
+
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go
new file mode 100644
index 000000000..d5efba7f2
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go
@@ -0,0 +1,49 @@
+package hns
+
+import (
+	"github.com/sirupsen/logrus"
+)
+
+type HNSSupportedFeatures struct {
+	Acl HNSAclFeatures `json:"ACL"`
+}
+
+type HNSAclFeatures struct {
+	AclAddressLists       bool `json:"AclAddressLists"`
+	AclNoHostRulePriority bool `json:"AclHostRulePriority"`
+	AclPortRanges         bool `json:"AclPortRanges"`
+	AclRuleId             bool `json:"AclRuleId"`
+}
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	var hnsFeatures HNSSupportedFeatures
+
+	globals, err := GetHNSGlobals()
+	if err != nil {
+		// Expected on pre-1803 builds, all features will be false/unsupported
+		logrus.Debugf("Unable to obtain HNS globals: %s", err)
+		return hnsFeatures
+	}
+
+	hnsFeatures.Acl = HNSAclFeatures{
+		AclAddressLists:       isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclPortRanges:         isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclRuleId:             isHNSFeatureSupported(globals.Version, HNSVersion1803),
+	}
+
+	return hnsFeatures
+}
+
+func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
+	if currentVersion.Major < minVersionSupported.Major {
+		return false
+	}
+	if currentVersion.Major > minVersionSupported.Major {
+		return true
+	}
+	if currentVersion.Minor < minVersionSupported.Minor {
+		return false
+	}
+	return true
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go
new file mode 100644
index 000000000..45e2281b0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go
@@ -0,0 +1,110 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"path"
+	"strings"
+)
+
+type namespaceRequest struct {
+	IsDefault bool `json:",omitempty"`
+}
+
+type namespaceEndpointRequest struct {
+	ID string `json:"Id"`
+}
+
+type NamespaceResource struct {
+	Type string
+	Data json.RawMessage
+}
+
+type namespaceResourceRequest struct {
+	Type string
+	Data interface{}
+}
+
+type Namespace struct {
+	ID           string
+	IsDefault    bool                `json:",omitempty"`
+	ResourceList []NamespaceResource `json:",omitempty"`
+}
+
+func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
+	var err error
+	hnspath := "/namespaces/"
+	if id != nil {
+		hnspath = path.Join(hnspath, *id)
+	}
+	if subpath != "" {
+		hnspath = path.Join(hnspath, subpath)
+	}
+	var reqJSON []byte
+	if request != nil {
+		if reqJSON, err = json.Marshal(request); err != nil {
+			return nil, err
+		}
+	}
+	var ns Namespace
+	err = hnsCall(method, hnspath, string(reqJSON), &ns)
+	if err != nil {
+		if strings.Contains(err.Error(), "Element not found.") {
+			return nil, os.ErrNotExist
+		}
+		return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
+	}
+	return &ns, err
+}
+
+func CreateNamespace() (string, error) {
+	req := namespaceRequest{}
+	ns, err := issueNamespaceRequest(nil, "POST", "", &req)
+	if err != nil {
+		return "", err
+	}
+	return ns.ID, nil
+}
+
+func RemoveNamespace(id string) error {
+	_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
+	return err
+}
+
+func GetNamespaceEndpoints(id string) ([]string, error) {
+	ns, err := issueNamespaceRequest(&id, "GET", "", nil)
+	if err != nil {
+		return nil, err
+	}
+	var endpoints []string
+	for _, rsrc := range ns.ResourceList {
+		if rsrc.Type == "Endpoint" {
+			var endpoint namespaceEndpointRequest
+			err = json.Unmarshal(rsrc.Data, &endpoint)
+			if err != nil {
+				return nil, fmt.Errorf("unmarshal endpoint: %s", err)
+			}
+			endpoints = append(endpoints, endpoint.ID)
+		}
+	}
+	return endpoints, nil
+}
+
+func AddNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
+	return err
+}
+
+func RemoveNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
new file mode 100644
index 000000000..3a3232a06
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
@@ -0,0 +1,74 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hns
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHNSCall = modvmcompute.NewProc("HNSCall")
+)
+
+func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(method)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	var _p2 *uint16
+	_p2, hr = syscall.UTF16PtrFromString(object)
+	if hr != nil {
+		return
+	}
+	return __hnsCall(_p0, _p1, _p2, response)
+}
+
+func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
+	if hr = procHNSCall.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
new file mode 100644
index 000000000..f10c88d08
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go
@@ -0,0 +1,27 @@
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
+
+//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
+
+func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
+	str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
+	coTaskMemFree(unsafe.Pointer(buffer))
+	return str
+}
+
+func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
+	return []byte(ConvertAndFreeCoTaskMemString(buffer))
+}
+
+func Win32FromHresult(hr uintptr) syscall.Errno {
+	if hr&0x1fff0000 == 0x00070000 {
+		return syscall.Errno(hr & 0xffff)
+	}
+	return syscall.Errno(hr)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
new file mode 100644
index 000000000..2f5bf8f55
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
@@ -0,0 +1,48 @@
+// Code generated by 'go generate'; DO NOT EDIT.
+
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modole32 = windows.NewLazySystemDLL("ole32.dll")
+
+	procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
+)
+
+func coTaskMemFree(buffer unsafe.Pointer) {
+	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go
new file mode 100644
index 000000000..a1527d706
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go
@@ -0,0 +1,37 @@
+package logfields
+
+const (
+	// Identifiers
+
+	ContainerID = "cid"
+	UVMID       = "uvm-id"
+	ProcessID   = "pid"
+
+	// Common Misc
+
+	// Timeout represents an operation timeout.
+	Timeout = "timeout"
+	JSON    = "json"
+
+	// Keys/values
+
+	Field         = "field"
+	OCIAnnotation = "oci-annotation"
+	Value         = "value"
+
+	// Golang type's
+
+	ExpectedType = "expected-type"
+	Bool         = "bool"
+	Uint32       = "uint32"
+	Uint64       = "uint64"
+
+	// HCS
+
+	HCSOperation       = "hcs-op"
+	HCSOperationResult = "hcs-op-result"
+
+	// runhcs
+
+	VMShimOperation = "vmshim-op"
+)
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go
new file mode 100644
index 000000000..e5b8b85e0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go
@@ -0,0 +1,24 @@
+package longpath
+
+import (
+	"path/filepath"
+	"strings"
+)
+
+// LongAbs makes a path absolute and returns it in NT long path form.
+func LongAbs(path string) (string, error) {
+	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
+		return path, nil
+	}
+	if !filepath.IsAbs(path) {
+		absPath, err := filepath.Abs(path)
+		if err != nil {
+			return "", err
+		}
+		path = absPath
+	}
+	if strings.HasPrefix(path, `\\`) {
+		return `\\?\UNC\` + path[2:], nil
+	}
+	return `\\?\` + path, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go
new file mode 100644
index 000000000..7e95efb30
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go
@@ -0,0 +1,52 @@
+package mergemaps
+
+import "encoding/json"
+
+// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
+// in ToMap are overwritten. Values in fromMap are added to ToMap.
+// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
+func Merge(fromMap, ToMap interface{}) interface{} {
+	switch fromMap := fromMap.(type) {
+	case map[string]interface{}:
+		ToMap, ok := ToMap.(map[string]interface{})
+		if !ok {
+			return fromMap
+		}
+		for keyToMap, valueToMap := range ToMap {
+			if valueFromMap, ok := fromMap[keyToMap]; ok {
+				fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
+			} else {
+				fromMap[keyToMap] = valueToMap
+			}
+		}
+	case nil:
+		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
+		ToMap, ok := ToMap.(map[string]interface{})
+		if ok {
+			return ToMap
+		}
+	}
+	return fromMap
+}
+
+// MergeJSON merges the contents of a JSON string into an object representation,
+// returning a new object suitable for translating to JSON.
+func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
+	if len(additionalJSON) == 0 {
+		return object, nil
+	}
+	objectJSON, err := json.Marshal(object)
+	if err != nil {
+		return nil, err
+	}
+	var objectMap, newMap map[string]interface{}
+	err = json.Unmarshal(objectJSON, &objectMap)
+	if err != nil {
+		return nil, err
+	}
+	err = json.Unmarshal(additionalJSON, &newMap)
+	if err != nil {
+		return nil, err
+	}
+	return Merge(newMap, objectMap), nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
new file mode 100644
index 000000000..0c0b1159f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
@@ -0,0 +1,431 @@
+package safefile
+
+import (
+	"errors"
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+	"syscall"
+	"unicode/utf16"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/longpath"
+
+	winio "github.com/Microsoft/go-winio"
+)
+
+//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
+
+//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
+//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
+//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
+//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
+//sys localFree(ptr uintptr) = kernel32.LocalFree
+
+type ioStatusBlock struct {
+	Status, Information uintptr
+}
+
+type objectAttributes struct {
+	Length             uintptr
+	RootDirectory      uintptr
+	ObjectName         uintptr
+	Attributes         uintptr
+	SecurityDescriptor uintptr
+	SecurityQoS        uintptr
+}
+
+type unicodeString struct {
+	Length        uint16
+	MaximumLength uint16
+	Buffer        uintptr
+}
+
+type fileLinkInformation struct {
+	ReplaceIfExists bool
+	RootDirectory   uintptr
+	FileNameLength  uint32
+	FileName        [1]uint16
+}
+
+type fileDispositionInformationEx struct {
+	Flags uintptr
+}
+
+const (
+	_FileLinkInformation          = 11
+	_FileDispositionInformationEx = 64
+
+	FILE_READ_ATTRIBUTES  = 0x0080
+	FILE_WRITE_ATTRIBUTES = 0x0100
+	DELETE                = 0x10000
+
+	FILE_OPEN   = 1
+	FILE_CREATE = 2
+
+	FILE_DIRECTORY_FILE          = 0x00000001
+	FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
+	FILE_DELETE_ON_CLOSE         = 0x00001000
+	FILE_OPEN_FOR_BACKUP_INTENT  = 0x00004000
+	FILE_OPEN_REPARSE_POINT      = 0x00200000
+
+	FILE_DISPOSITION_DELETE = 0x00000001
+
+	_OBJ_DONT_REPARSE = 0x1000
+
+	_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
+)
+
+func OpenRoot(path string) (*os.File, error) {
+	longpath, err := longpath.LongAbs(path)
+	if err != nil {
+		return nil, err
+	}
+	return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
+}
+
+func ntRelativePath(path string) ([]uint16, error) {
+	path = filepath.Clean(path)
+	if strings.Contains(":", path) {
+		// Since alternate data streams must follow the file they
+		// are attached to, finding one here (out of order) is invalid.
+		return nil, errors.New("path contains invalid character `:`")
+	}
+	fspath := filepath.FromSlash(path)
+	if len(fspath) > 0 && fspath[0] == '\\' {
+		return nil, errors.New("expected relative path")
+	}
+
+	path16 := utf16.Encode(([]rune)(fspath))
+	if len(path16) > 32767 {
+		return nil, syscall.ENAMETOOLONG
+	}
+
+	return path16, nil
+}
+
+// openRelativeInternal opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	var (
+		h    uintptr
+		iosb ioStatusBlock
+		oa   objectAttributes
+	)
+
+	path16, err := ntRelativePath(path)
+	if err != nil {
+		return nil, err
+	}
+
+	if root == nil || root.Fd() == 0 {
+		return nil, errors.New("missing root directory")
+	}
+
+	upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
+	defer localFree(upathBuffer)
+
+	upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
+	upath.Length = uint16(len(path16) * 2)
+	upath.MaximumLength = upath.Length
+	upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
+	copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
+
+	oa.Length = unsafe.Sizeof(oa)
+	oa.ObjectName = upathBuffer
+	oa.RootDirectory = uintptr(root.Fd())
+	oa.Attributes = _OBJ_DONT_REPARSE
+	status := ntCreateFile(
+		&h,
+		accessMask|syscall.SYNCHRONIZE,
+		&oa,
+		&iosb,
+		nil,
+		0,
+		shareFlags,
+		createDisposition,
+		FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
+		nil,
+		0,
+	)
+	if status != 0 {
+		return nil, rtlNtStatusToDosError(status)
+	}
+
+	fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
+	if err != nil {
+		syscall.Close(syscall.Handle(h))
+		return nil, err
+	}
+
+	return os.NewFile(h, fullPath), nil
+}
+
+// OpenRelative opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return f, err
+}
+
+// LinkRelative creates a hard link from oldname to newname (relative to oldroot
+// and newroot), failing if any of the intermediate path components are reparse
+// points.
+func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
+	// Open the old file.
+	oldf, err := openRelativeInternal(
+		oldname,
+		oldroot,
+		syscall.FILE_WRITE_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0,
+	)
+	if err != nil {
+		return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
+	}
+	defer oldf.Close()
+
+	// Open the parent of the new file.
+	var parent *os.File
+	parentPath := filepath.Dir(newname)
+	if parentPath != "." {
+		parent, err = openRelativeInternal(
+			parentPath,
+			newroot,
+			syscall.GENERIC_READ,
+			syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+			FILE_OPEN,
+			FILE_DIRECTORY_FILE)
+		if err != nil {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
+		}
+		defer parent.Close()
+
+		fi, err := winio.GetFileBasicInfo(parent)
+		if err != nil {
+			return err
+		}
+		if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
+		}
+
+	} else {
+		parent = newroot
+	}
+
+	// Issue an NT call to create the link. This will be safe because NT will
+	// not open any more directories to create the link, so it cannot walk any
+	// more reparse points.
+	newbase := filepath.Base(newname)
+	newbase16, err := ntRelativePath(newbase)
+	if err != nil {
+		return err
+	}
+
+	size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
+	linkinfoBuffer := localAlloc(0, size)
+	defer localFree(linkinfoBuffer)
+	linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
+	linkinfo.RootDirectory = parent.Fd()
+	linkinfo.FileNameLength = uint32(len(newbase16) * 2)
+	copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
+
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		oldf.Fd(),
+		&iosb,
+		linkinfoBuffer,
+		uint32(size),
+		_FileLinkInformation,
+	)
+	if status != 0 {
+		return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
+	}
+
+	return nil
+}
+
+// deleteOnClose marks a file to be deleted when the handle is closed.
+func deleteOnClose(f *os.File) error {
+	disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		f.Fd(),
+		&iosb,
+		uintptr(unsafe.Pointer(&disposition)),
+		uint32(unsafe.Sizeof(disposition)),
+		_FileDispositionInformationEx,
+	)
+	if status != 0 {
+		return rtlNtStatusToDosError(status)
+	}
+	return nil
+}
+
+// clearReadOnly clears the readonly attribute on a file.
+func clearReadOnly(f *os.File) error {
+	bi, err := winio.GetFileBasicInfo(f)
+	if err != nil {
+		return err
+	}
+	if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
+		return nil
+	}
+	sbi := winio.FileBasicInfo{
+		FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
+	}
+	if sbi.FileAttributes == 0 {
+		sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
+	}
+	return winio.SetFileBasicInfo(f, &sbi)
+}
+
+// RemoveRelative removes a file or directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err == nil {
+		defer f.Close()
+		err = deleteOnClose(f)
+		if err == syscall.ERROR_ACCESS_DENIED {
+			// Maybe the file is marked readonly. Clear the bit and retry.
+			clearReadOnly(f)
+			err = deleteOnClose(f)
+		}
+	}
+	if err != nil {
+		return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return nil
+}
+
+// RemoveAllRelative removes a directory tree relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveAllRelative(path string, root *os.File) error {
+	fi, err := LstatRelative(path, root)
+	if err != nil {
+		if os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+	fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+	if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
+		// If this is a reparse point, it can't have children. Simple remove will do.
+		err := RemoveRelative(path, root)
+		if err == nil || os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+
+	// It is necessary to use os.Open as Readdirnames does not work with
+	// OpenRelative. This is safe because the above lstatrelative fails
+	// if the target is outside the root, and we know this is not a
+	// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
+	fd, err := os.Open(filepath.Join(root.Name(), path))
+	if err != nil {
+		if os.IsNotExist(err) {
+			// Race. It was deleted between the Lstat and Open.
+			// Return nil per RemoveAll's docs.
+			return nil
+		}
+		return err
+	}
+
+	// Remove contents & return first error.
+	for {
+		names, err1 := fd.Readdirnames(100)
+		for _, name := range names {
+			err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
+			if err == nil {
+				err = err1
+			}
+		}
+		if err1 == io.EOF {
+			break
+		}
+		// If Readdirnames returned an error, use it.
+		if err == nil {
+			err = err1
+		}
+		if len(names) == 0 {
+			break
+		}
+	}
+	fd.Close()
+
+	// Remove directory.
+	err1 := RemoveRelative(path, root)
+	if err1 == nil || os.IsNotExist(err1) {
+		return nil
+	}
+	if err == nil {
+		err = err1
+	}
+	return err
+}
+
+// MkdirRelative creates a directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func MkdirRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_CREATE,
+		FILE_DIRECTORY_FILE)
+	if err == nil {
+		f.Close()
+	} else {
+		err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return err
+}
+
+// LstatRelative performs a stat operation on a file relative to a root, failing
+// if any intermediate path components are reparse points.
+func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err != nil {
+		return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	defer f.Close()
+	return f.Stat()
+}
+
+// EnsureNotReparsePointRelative validates that a given file (relative to a
+// root) and all intermediate path components are not a reparse points.
+func EnsureNotReparsePointRelative(path string, root *os.File) error {
+	// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
+	f, err := OpenRelative(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0)
+	if err != nil {
+		return err
+	}
+	f.Close()
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
new file mode 100644
index 000000000..709b9d347
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
@@ -0,0 +1,79 @@
+// Code generated by 'go generate'; DO NOT EDIT.
+
+package safefile
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modntdll    = windows.NewLazySystemDLL("ntdll.dll")
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+
+	procNtCreateFile               = modntdll.NewProc("NtCreateFile")
+	procNtSetInformationFile       = modntdll.NewProc("NtSetInformationFile")
+	procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
+	procLocalAlloc                 = modkernel32.NewProc("LocalAlloc")
+	procLocalFree                  = modkernel32.NewProc("LocalFree")
+)
+
+func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
+	status = uint32(r0)
+	return
+}
+
+func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
+	status = uint32(r0)
+	return
+}
+
+func rtlNtStatusToDosError(status uint32) (winerr error) {
+	r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
+	if r0 != 0 {
+		winerr = syscall.Errno(r0)
+	}
+	return
+}
+
+func localAlloc(flags uint32, size int) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func localFree(ptr uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
new file mode 100644
index 000000000..995433ace
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go
@@ -0,0 +1,245 @@
+package schema1
+
+import (
+	"encoding/json"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig struct {
+	ApplicationName   string            `json:",omitempty"`
+	CommandLine       string            `json:",omitempty"`
+	CommandArgs       []string          `json:",omitempty"` // Used by Linux Containers on Windows
+	User              string            `json:",omitempty"`
+	WorkingDirectory  string            `json:",omitempty"`
+	Environment       map[string]string `json:",omitempty"`
+	EmulateConsole    bool              `json:",omitempty"`
+	CreateStdInPipe   bool              `json:",omitempty"`
+	CreateStdOutPipe  bool              `json:",omitempty"`
+	CreateStdErrPipe  bool              `json:",omitempty"`
+	ConsoleSize       [2]uint           `json:",omitempty"`
+	CreateInUtilityVm bool              `json:",omitempty"` // Used by Linux Containers on Windows
+	OCISpecification  *json.RawMessage  `json:",omitempty"` // Used by Linux Containers on Windows
+}
+
+type Layer struct {
+	ID   string
+	Path string
+}
+
+type MappedDir struct {
+	HostPath          string
+	ContainerPath     string
+	ReadOnly          bool
+	BandwidthMaximum  uint64
+	IOPSMaximum       uint64
+	CreateInUtilityVM bool
+	// LinuxMetadata - Support added in 1803/RS4+.
+	LinuxMetadata bool `json:",omitempty"`
+}
+
+type MappedPipe struct {
+	HostPath          string
+	ContainerPipeName string
+}
+
+type HvRuntime struct {
+	ImagePath           string `json:",omitempty"`
+	SkipTemplate        bool   `json:",omitempty"`
+	LinuxInitrdFile     string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
+	LinuxKernelFile     string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
+	LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
+	BootSource          string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
+	WritableBootSource  bool   `json:",omitempty"` // Linux Utility VM booting from VHD
+}
+
+type MappedVirtualDisk struct {
+	HostPath          string `json:",omitempty"` // Path to VHD on the host
+	ContainerPath     string // Platform-specific mount point path in the container
+	CreateInUtilityVM bool   `json:",omitempty"`
+	ReadOnly          bool   `json:",omitempty"`
+	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
+	AttachOnly        bool   `json:",omitempty:`
+}
+
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice struct {
+	//  InterfaceClassGUID of the device to assign to container.
+	InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
+}
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig struct {
+	SystemType                  string              // HCS requires this to be hard-coded to "Container"
+	Name                        string              // Name of the container. We use the docker ID.
+	Owner                       string              `json:",omitempty"` // The management platform that created this container
+	VolumePath                  string              `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
+	IgnoreFlushesDuringBoot     bool                `json:",omitempty"` // Optimization hint for container startup in Windows
+	LayerFolderPath             string              `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format  %root%\windowsfilter\containerID
+	Layers                      []Layer             // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
+	Credentials                 string              `json:",omitempty"` // Credentials information
+	ProcessorCount              uint32              `json:",omitempty"` // Number of processors to assign to the container.
+	ProcessorWeight             uint64              `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
+	ProcessorMaximum            int64               `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
+	StorageIOPSMaximum          uint64              `json:",omitempty"` // Maximum Storage IOPS
+	StorageBandwidthMaximum     uint64              `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
+	StorageSandboxSize          uint64              `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
+	MemoryMaximumInMB           int64               `json:",omitempty"` // Maximum memory available to the container in Megabytes
+	HostName                    string              `json:",omitempty"` // Hostname
+	MappedDirectories           []MappedDir         `json:",omitempty"` // List of mapped directories (volumes/mounts)
+	MappedPipes                 []MappedPipe        `json:",omitempty"` // List of mapped Windows named pipes
+	HvPartition                 bool                // True if it a Hyper-V Container
+	NetworkSharedContainerName  string              `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
+	EndpointList                []string            `json:",omitempty"` // List of networking endpoints to be attached to container
+	HvRuntime                   *HvRuntime          `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
+	Servicing                   bool                `json:",omitempty"` // True if this container is for servicing
+	AllowUnqualifiedDNSQuery    bool                `json:",omitempty"` // True to allow unqualified DNS name resolution
+	DNSSearchList               string              `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
+	ContainerType               string              `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
+	TerminateOnLastHandleClosed bool                `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
+	MappedVirtualDisks          []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
+	AssignedDevices             []AssignedDevice    `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
+}
+
+type ComputeSystemQuery struct {
+	IDs    []string `json:"Ids,omitempty"`
+	Types  []string `json:",omitempty"`
+	Names  []string `json:",omitempty"`
+	Owners []string `json:",omitempty"`
+}
+
+type PropertyType string
+
+const (
+	PropertyTypeStatistics        PropertyType = "Statistics"        // V1 and V2
+	PropertyTypeProcessList                    = "ProcessList"       // V1 and V2
+	PropertyTypeMappedVirtualDisk              = "MappedVirtualDisk" // Not supported in V2 schema call
+	PropertyTypeGuestConnection                = "GuestConnection"   // V1 and V2. Nil return from HCS before RS5
+)
+
+type PropertyQuery struct {
+	PropertyTypes []PropertyType `json:",omitempty"`
+}
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties struct {
+	ID                           string `json:"Id"`
+	State                        string
+	Name                         string
+	SystemType                   string
+	Owner                        string
+	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
+	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	IsRuntimeTemplate            bool                                `json:",omitempty"`
+	RuntimeImagePath             string                              `json:",omitempty"`
+	Stopped                      bool                                `json:",omitempty"`
+	ExitType                     string                              `json:",omitempty"`
+	AreUpdatesPending            bool                                `json:",omitempty"`
+	ObRoot                       string                              `json:",omitempty"`
+	Statistics                   Statistics                          `json:",omitempty"`
+	ProcessList                  []ProcessListItem                   `json:",omitempty"`
+	MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
+	GuestConnectionInfo          GuestConnectionInfo                 `json:",omitempty"`
+}
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats struct {
+	UsageCommitBytes            uint64 `json:"MemoryUsageCommitBytes,omitempty"`
+	UsageCommitPeakBytes        uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+	UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats struct {
+	TotalRuntime100ns  uint64 `json:",omitempty"`
+	RuntimeUser100ns   uint64 `json:",omitempty"`
+	RuntimeKernel100ns uint64 `json:",omitempty"`
+}
+
+// StorageStats holds the storage statistics for a container
+type StorageStats struct {
+	ReadCountNormalized  uint64 `json:",omitempty"`
+	ReadSizeBytes        uint64 `json:",omitempty"`
+	WriteCountNormalized uint64 `json:",omitempty"`
+	WriteSizeBytes       uint64 `json:",omitempty"`
+}
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats struct {
+	BytesReceived          uint64 `json:",omitempty"`
+	BytesSent              uint64 `json:",omitempty"`
+	PacketsReceived        uint64 `json:",omitempty"`
+	PacketsSent            uint64 `json:",omitempty"`
+	DroppedPacketsIncoming uint64 `json:",omitempty"`
+	DroppedPacketsOutgoing uint64 `json:",omitempty"`
+	EndpointId             string `json:",omitempty"`
+	InstanceId             string `json:",omitempty"`
+}
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics struct {
+	Timestamp          time.Time      `json:",omitempty"`
+	ContainerStartTime time.Time      `json:",omitempty"`
+	Uptime100ns        uint64         `json:",omitempty"`
+	Memory             MemoryStats    `json:",omitempty"`
+	Processor          ProcessorStats `json:",omitempty"`
+	Storage            StorageStats   `json:",omitempty"`
+	Network            []NetworkStats `json:",omitempty"`
+}
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem struct {
+	CreateTimestamp              time.Time `json:",omitempty"`
+	ImageName                    string    `json:",omitempty"`
+	KernelTime100ns              uint64    `json:",omitempty"`
+	MemoryCommitBytes            uint64    `json:",omitempty"`
+	MemoryWorkingSetPrivateBytes uint64    `json:",omitempty"`
+	MemoryWorkingSetSharedBytes  uint64    `json:",omitempty"`
+	ProcessId                    uint32    `json:",omitempty"`
+	UserTime100ns                uint64    `json:",omitempty"`
+}
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController struct {
+	MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
+}
+
+// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
+type GuestDefinedCapabilities struct {
+	NamespaceAddRequestSupported bool `json:",omitempty"`
+	SignalProcessSupported       bool `json:",omitempty"`
+}
+
+// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
+type GuestConnectionInfo struct {
+	SupportedSchemaVersions  []hcsschema.Version      `json:",omitempty"`
+	ProtocolVersion          uint32                   `json:",omitempty"`
+	GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
+}
+
+// Type of Request Support in ModifySystem
+type RequestType string
+
+// Type of Resource Support in ModifySystem
+type ResourceType string
+
+// RequestType const
+const (
+	Add     RequestType  = "Add"
+	Remove  RequestType  = "Remove"
+	Network ResourceType = "Network"
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse struct {
+	Resource ResourceType `json:"ResourceType"`
+	Data     interface{}  `json:"Settings"`
+	Request  RequestType  `json:"RequestType,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
new file mode 100644
index 000000000..09456cbc2
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
@@ -0,0 +1,31 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Attachment struct {
+
+	Type_ string `json:"Type,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
+
+	CachingMode string `json:"CachingMode,omitempty"`
+
+	NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
+
+	DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
+
+	IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
+
+	CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go
new file mode 100644
index 000000000..ecbbed4c2
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go
@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Battery struct {
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
new file mode 100644
index 000000000..243779eab
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type CacheQueryStatsResponse struct {
+
+	L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
+
+	L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
+
+	L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go
new file mode 100644
index 000000000..ca75277a3
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go
@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Chipset struct {
+	Uefi *Uefi `json:"Uefi,omitempty"`
+
+	IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"`
+
+	BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"`
+
+	ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"`
+
+	ChassisAssetTag string `json:"ChassisAssetTag,omitempty"`
+
+	UseUtc bool `json:"UseUtc,omitempty"`
+
+	// LinuxKernelDirect - Added in v2.2 Builds >=181117
+	LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
new file mode 100644
index 000000000..88f01707a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type CloseHandle struct {
+
+	Handle string `json:"Handle,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go
new file mode 100644
index 000000000..c665be3d5
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go
@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
+type ComPort struct {
+
+	NamedPipe string `json:"NamedPipe,omitempty"`
+
+	OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
new file mode 100644
index 000000000..85785d285
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ComputeSystem struct {
+
+	Owner string `json:"Owner,omitempty"`
+
+	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
+
+	HostingSystemId string `json:"HostingSystemId,omitempty"`
+
+	HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
+
+	Container *Container `json:"Container,omitempty"`
+
+	VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"`
+
+	ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
new file mode 100644
index 000000000..1a47db7d9
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
@@ -0,0 +1,72 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"net/http"
+)
+
+// contextKeys are used to identify the type of value in the context.
+// Since these are string, it is possible to get a short description of the
+// context key for logging and debugging using key.String().
+
+type contextKey string
+
+func (c contextKey) String() string {
+	return "auth " + string(c)
+}
+
+var (
+	// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
+	ContextOAuth2    	= contextKey("token")
+
+	// ContextBasicAuth takes BasicAuth as authentication for the request.
+	ContextBasicAuth 	= contextKey("basic")
+
+	// ContextAccessToken takes a string oauth2 access token as authentication for the request.
+	ContextAccessToken 	= contextKey("accesstoken")
+
+	// ContextAPIKey takes an APIKey as authentication for the request
+ 	ContextAPIKey 		= contextKey("apikey")
+)
+
+// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth 
+type BasicAuth struct {
+	UserName      string            `json:"userName,omitempty"`
+	Password      string            `json:"password,omitempty"`	
+}
+
+// APIKey provides API key based authentication to a request passed via context using ContextAPIKey
+type APIKey struct {
+	Key 	string
+	Prefix	string
+}
+
+type Configuration struct {
+	BasePath      string            	`json:"basePath,omitempty"`
+	Host          string            	`json:"host,omitempty"`
+	Scheme        string            	`json:"scheme,omitempty"`
+	DefaultHeader map[string]string 	`json:"defaultHeader,omitempty"`
+	UserAgent     string            	`json:"userAgent,omitempty"`
+	HTTPClient 	  *http.Client
+}
+
+func NewConfiguration() *Configuration {
+	cfg := &Configuration{
+		BasePath:      "https://localhost",
+		DefaultHeader: make(map[string]string),
+		UserAgent:     "Swagger-Codegen/2.1.0/go",
+	}
+	return cfg
+}
+
+func (c *Configuration) AddDefaultHeader(key string, value string) {
+	c.DefaultHeader[key] = value
+}
\ No newline at end of file
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
new file mode 100644
index 000000000..adbe07fe5
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ConsoleSize struct {
+
+	Height int32 `json:"Height,omitempty"`
+
+	Width int32 `json:"Width,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go
new file mode 100644
index 000000000..17dce28bc
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go
@@ -0,0 +1,35 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Container struct {
+
+	GuestOs *GuestOs `json:"GuestOs,omitempty"`
+
+	Storage *Storage `json:"Storage,omitempty"`
+
+	MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"`
+
+	MappedPipes []MappedPipe `json:"MappedPipes,omitempty"`
+
+	Memory *Memory `json:"Memory,omitempty"`
+
+	Processor *Processor `json:"Processor,omitempty"`
+
+	Networking *Networking `json:"Networking,omitempty"`
+
+	HvSocket *HvSocket `json:"HvSocket,omitempty"`
+
+	ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"`
+
+	RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
+
+	AssignedDevices []Device `json:"AssignedDevices,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go
new file mode 100644
index 000000000..0f8f64437
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go
@@ -0,0 +1,25 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ContainerCredentialGuardState struct {
+
+	//  Authentication cookie for calls to a Container Credential Guard instance.
+	Cookie string `json:"Cookie,omitempty"`
+
+	//  Name of the RPC endpoint of the Container Credential Guard instance.
+	RpcEndpoint string `json:"RpcEndpoint,omitempty"`
+
+	//  Transport used for the configured Container Credential Guard instance.
+	Transport string `json:"Transport,omitempty"`
+
+	//  Credential spec used for the configured Container Credential Guard instance.
+	CredentialSpec string `json:"CredentialSpec,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
new file mode 100644
index 000000000..754797e21
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
@@ -0,0 +1,26 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  memory usage as viewed from within the container
+type ContainerMemoryInformation struct {
+
+	TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
+
+	TotalUsage int32 `json:"TotalUsage,omitempty"`
+
+	CommittedBytes int32 `json:"CommittedBytes,omitempty"`
+
+	SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"`
+
+	CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"`
+
+	PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go
new file mode 100644
index 000000000..ca319bbbc
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go
@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Device struct {
+
+	//  The interface class guid of the device to assign to container.
+	InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go
new file mode 100644
index 000000000..b2191c571
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go
@@ -0,0 +1,43 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Devices struct {
+
+	ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
+
+	Scsi map[string]Scsi `json:"Scsi,omitempty"`
+
+	VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"`
+
+	NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"`
+
+	VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"`
+
+	Keyboard *Keyboard `json:"Keyboard,omitempty"`
+
+	Mouse *Mouse `json:"Mouse,omitempty"`
+
+	HvSocket *HvSocket2 `json:"HvSocket,omitempty"`
+
+	EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"`
+
+	GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"`
+
+	VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"`
+
+	Plan9 *Plan9 `json:"Plan9,omitempty"`
+
+	Battery *Battery `json:"Battery,omitempty"`
+
+	FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"`
+
+	SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
new file mode 100644
index 000000000..4fe592f71
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type EnhancedModeVideo struct {
+
+	ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
new file mode 100644
index 000000000..51011afe4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type FlexibleIoDevice struct {
+
+	EmulatorId string `json:"EmulatorId,omitempty"`
+
+	HostingModel string `json:"HostingModel,omitempty"`
+
+	Configuration []string `json:"Configuration,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go
new file mode 100644
index 000000000..7db29495b
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestConnection struct {
+
+	//  Use Vsock rather than Hyper-V sockets to communicate with the guest service.
+	UseVsock bool `json:"UseVsock,omitempty"`
+
+	//  Don't disconnect the guest connection when pausing the virtual machine.
+	UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go
new file mode 100644
index 000000000..8a369bab7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Information about the guest.
+type GuestConnectionInfo struct {
+
+	//  Each schema version x.y stands for the range of versions a.b where a==x  and b<=y. This list comes from the SupportedSchemaVersions field in  GcsCapabilities.
+	SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"`
+
+	ProtocolVersion int32 `json:"ProtocolVersion,omitempty"`
+
+	GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
new file mode 100644
index 000000000..c5fa76735
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestCrashReporting struct {
+
+	WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go
new file mode 100644
index 000000000..c708fc7c3
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestOs struct {
+
+	HostName string `json:"HostName,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go
new file mode 100644
index 000000000..ef1eec886
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go
@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestState struct {
+
+	//  The path to an existing file uses for persistent guest state storage.  An empty string indicates the system should initialize new transient, in-memory guest state.
+	GuestStateFilePath string `json:"GuestStateFilePath,omitempty"`
+
+	//  The path to an existing file for persistent runtime state storage.  An empty string indicates the system should initialize new transient, in-memory runtime state.
+	RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"`
+
+	//  If true, the guest state and runtime state files will be used as templates  to populate transient, in-memory state instead of using the files as persistent backing store.
+	ForceTransientState bool `json:"ForceTransientState,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
new file mode 100644
index 000000000..0797584c5
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HostedSystem struct {
+
+	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
+
+	Container *Container `json:"Container,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go
new file mode 100644
index 000000000..ef9ffb8dd
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HvSocket struct {
+
+	Config *HvSocketSystemConfig `json:"Config,omitempty"`
+
+	EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
new file mode 100644
index 000000000..a19ba15c1
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go
@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  HvSocket configuration for a VM
+type HvSocket2 struct {
+
+	HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go
new file mode 100644
index 000000000..a848e91e6
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go
@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HvSocketServiceConfig struct {
+
+	//  SDDL string that HvSocket will check before allowing a host process to bind  to this specific service.  If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in  HvSocketSystemWpConfig in V1.
+	BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"`
+
+	//  SDDL string that HvSocket will check before allowing a host process to connect  to this specific service.  If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in  HvSocketSystemWpConfig in V1.
+	ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"`
+
+	//  If true, HvSocket will process wildcard binds for this service/system combination.  Wildcard binds are secured in the registry at  SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors
+	AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go
new file mode 100644
index 000000000..69f4f9d39
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go
@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  This is the HCS Schema version of the HvSocket configuration. The VMWP version is  located in Config.Devices.IC in V1.
+type HvSocketSystemConfig struct {
+
+	//  SDDL string that HvSocket will check before allowing a host process to bind  to an unlisted service for this specific container/VM (not wildcard binds).
+	DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"`
+
+	//  SDDL string that HvSocket will check before allowing a host process to connect  to an unlisted service in the VM/container.
+	DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"`
+
+	ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go
new file mode 100644
index 000000000..3d3fa3b1c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go
@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Keyboard struct {
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go
new file mode 100644
index 000000000..b63b8ef12
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go
@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Layer struct {
+
+	Id string `json:"Id,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	PathType string `json:"PathType,omitempty"`
+
+	//  Unspecified defaults to Enabled
+	Cache string `json:"Cache,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go
new file mode 100644
index 000000000..0ab6c280f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go
@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.2
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type LinuxKernelDirect struct {
+	KernelFilePath string `json:"KernelFilePath,omitempty"`
+
+	InitRdPath string `json:"InitRdPath,omitempty"`
+
+	KernelCmdLine string `json:"KernelCmdLine,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go
new file mode 100644
index 000000000..a823a6d3b
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type MappedDirectory struct {
+
+	HostPath string `json:"HostPath,omitempty"`
+
+	HostPathType string `json:"HostPathType,omitempty"`
+
+	ContainerPath string `json:"ContainerPath,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go
new file mode 100644
index 000000000..2d1d2604a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type MappedPipe struct {
+
+	ContainerPipeName string `json:"ContainerPipeName,omitempty"`
+
+	HostPath string `json:"HostPath,omitempty"`
+
+	HostPathType string `json:"HostPathType,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go
new file mode 100644
index 000000000..e1d135a3a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Memory struct {
+
+	SizeInMB int32 `json:"SizeInMB,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go
new file mode 100644
index 000000000..27d0b8c48
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go
@@ -0,0 +1,25 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Memory2 struct {
+	SizeInMB int32 `json:"SizeInMB,omitempty"`
+
+	AllowOvercommit bool `json:"AllowOvercommit,omitempty"`
+
+	EnableHotHint bool `json:"EnableHotHint,omitempty"`
+
+	EnableColdHint bool `json:"EnableColdHint,omitempty"`
+
+	EnableEpf bool `json:"EnableEpf,omitempty"`
+
+	// EnableDeferredCommit is private in the schema. If regenerated need to add back.
+	EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go
new file mode 100644
index 000000000..bdd87dffd
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type MemoryInformationForVm struct {
+
+	VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"`
+
+	VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"`
+
+	VirtualNodes []VirtualNodeInfo `json:"VirtualNodes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go
new file mode 100644
index 000000000..6214970f6
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go
@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Memory runtime statistics
+type MemoryStats struct {
+
+	MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"`
+
+	MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+
+	MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go
new file mode 100644
index 000000000..d29455a3e
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go
@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ModifySettingRequest struct {
+	ResourcePath string `json:"ResourcePath,omitempty"`
+
+	RequestType string `json:"RequestType,omitempty"`
+
+	Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated
+
+	GuestRequest interface{} `json:"GuestRequest,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go
new file mode 100644
index 000000000..ccf8b938f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go
@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Mouse struct {
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go
new file mode 100644
index 000000000..c586f66c2
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type NetworkAdapter struct {
+
+	EndpointId string `json:"EndpointId,omitempty"`
+
+	MacAddress string `json:"MacAddress,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go
new file mode 100644
index 000000000..12c47827c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go
@@ -0,0 +1,24 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Networking struct {
+
+	AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"`
+
+	DnsSearchList string `json:"DnsSearchList,omitempty"`
+
+	NetworkSharedContainerName string `json:"NetworkSharedContainerName,omitempty"`
+
+	//  Guid in windows; string in linux
+	Namespace string `json:"Namespace,omitempty"`
+
+	NetworkAdapters []string `json:"NetworkAdapters,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go
new file mode 100644
index 000000000..1cd70d179
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go
@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Notification data that is indicated to components running in the Virtual Machine.
+type PauseNotification struct {
+
+	Reason string `json:"Reason,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go
new file mode 100644
index 000000000..780a5cae2
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go
@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Options for HcsPauseComputeSystem
+type PauseOptions struct {
+
+	SuspensionLevel string `json:"SuspensionLevel,omitempty"`
+
+	HostedNotification *PauseNotification `json:"HostedNotification,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go
new file mode 100644
index 000000000..705c677e1
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Plan9 struct {
+
+	Shares []Plan9Share `json:"Shares,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go
new file mode 100644
index 000000000..b2bc58b83
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go
@@ -0,0 +1,26 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Plan9Share struct {
+
+	Name string `json:"Name,omitempty"`
+
+	//  The name by which the guest operation system can access this share, via  the aname parameter in the Plan9 protocol.
+	AccessName string `json:"AccessName,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	Port int32 `json:"Port,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+
+	UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go
new file mode 100644
index 000000000..63e0b7f8f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go
@@ -0,0 +1,34 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"time"
+)
+
+//  Information about a process running in a container
+type ProcessDetails struct {
+
+	ProcessId int32 `json:"ProcessId,omitempty"`
+
+	ImageName string `json:"ImageName,omitempty"`
+
+	CreateTimestamp time.Time `json:"CreateTimestamp,omitempty"`
+
+	UserTime100ns int32 `json:"UserTime100ns,omitempty"`
+
+	KernelTime100ns int32 `json:"KernelTime100ns,omitempty"`
+
+	MemoryCommitBytes int32 `json:"MemoryCommitBytes,omitempty"`
+
+	MemoryWorkingSetPrivateBytes int32 `json:"MemoryWorkingSetPrivateBytes,omitempty"`
+
+	MemoryWorkingSetSharedBytes int32 `json:"MemoryWorkingSetSharedBytes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go
new file mode 100644
index 000000000..29bc2e3d0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go
@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Passed to HcsRpc_ModifyProcess
+type ProcessModifyRequest struct {
+
+	Operation string `json:"Operation,omitempty"`
+
+	ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"`
+
+	CloseHandle *CloseHandle `json:"CloseHandle,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go
new file mode 100644
index 000000000..470c55734
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go
@@ -0,0 +1,47 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ProcessParameters struct {
+
+	ApplicationName string `json:"ApplicationName,omitempty"`
+
+	CommandLine string `json:"CommandLine,omitempty"`
+
+	//  optional alternative to CommandLine, currently only supported by Linux GCS
+	CommandArgs []string `json:"CommandArgs,omitempty"`
+
+	User string `json:"User,omitempty"`
+
+	WorkingDirectory string `json:"WorkingDirectory,omitempty"`
+
+	Environment map[string]string `json:"Environment,omitempty"`
+
+	//  if set, will run as low-privilege process
+	RestrictedToken bool `json:"RestrictedToken,omitempty"`
+
+	//  if set, ignore StdErrPipe
+	EmulateConsole bool `json:"EmulateConsole,omitempty"`
+
+	CreateStdInPipe bool `json:"CreateStdInPipe,omitempty"`
+
+	CreateStdOutPipe bool `json:"CreateStdOutPipe,omitempty"`
+
+	CreateStdErrPipe bool `json:"CreateStdErrPipe,omitempty"`
+
+	//  height then width
+	ConsoleSize []int32 `json:"ConsoleSize,omitempty"`
+
+	//  if set, find an existing session for the user and create the process in it
+	UseExistingLogin bool `json:"UseExistingLogin,omitempty"`
+
+	//  if set, use the legacy console instead of conhost
+	UseLegacyConsole bool `json:"UseLegacyConsole,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go
new file mode 100644
index 000000000..20793d150
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go
@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Status of a process running in a container
+type ProcessStatus struct {
+
+	ProcessId int32 `json:"ProcessId,omitempty"`
+
+	Exited bool `json:"Exited,omitempty"`
+
+	ExitCode int32 `json:"ExitCode,omitempty"`
+
+	LastWaitResult int32 `json:"LastWaitResult,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go
new file mode 100644
index 000000000..7a60b0245
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Processor struct {
+
+	Count int32 `json:"Count,omitempty"`
+
+	Maximum int32 `json:"Maximum,omitempty"`
+
+	Weight int32 `json:"Weight,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go
new file mode 100644
index 000000000..40d3e7356
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Processor2 struct {
+
+	Count int32 `json:"Count,omitempty"`
+
+	Limit int32 `json:"Limit,omitempty"`
+
+	Weight int32 `json:"Weight,omitempty"`
+
+	ExposeVirtualizationExtensions bool `json:"ExposeVirtualizationExtensions,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go
new file mode 100644
index 000000000..9d3b77e57
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go
@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  CPU runtime statistics
+type ProcessorStats struct {
+
+	TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"`
+
+	RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"`
+
+	RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go
new file mode 100644
index 000000000..6db2a48f6
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go
@@ -0,0 +1,47 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Properties struct {
+
+	Id string `json:"Id,omitempty"`
+
+	SystemType string `json:"SystemType,omitempty"`
+
+	RuntimeOsType string `json:"RuntimeOsType,omitempty"`
+
+	Name string `json:"Name,omitempty"`
+
+	Owner string `json:"Owner,omitempty"`
+
+	RuntimeId string `json:"RuntimeId,omitempty"`
+
+	RuntimeTemplateId string `json:"RuntimeTemplateId,omitempty"`
+
+	State string `json:"State,omitempty"`
+
+	Stopped bool `json:"Stopped,omitempty"`
+
+	ExitType string `json:"ExitType,omitempty"`
+
+	Memory *MemoryInformationForVm `json:"Memory,omitempty"`
+
+	Statistics *Statistics `json:"Statistics,omitempty"`
+
+	ProcessList []ProcessDetails `json:"ProcessList,omitempty"`
+
+	TerminateOnLastHandleClosed bool `json:"TerminateOnLastHandleClosed,omitempty"`
+
+	HostingSystemId string `json:"HostingSystemId,omitempty"`
+
+	SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"`
+
+	GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go
new file mode 100644
index 000000000..22b92ffdf
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go
@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//   By default the basic properties will be returned. This query provides a way to  request specific properties. 
+type PropertyQuery struct {
+
+	PropertyTypes []string `json:"PropertyTypes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go
new file mode 100644
index 000000000..97e453128
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RdpConnectionOptions struct {
+
+	AccessSids []string `json:"AccessSids,omitempty"`
+
+	NamedPipe string `json:"NamedPipe,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go
new file mode 100644
index 000000000..fa574ccc8
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RegistryChanges struct {
+
+	AddValues []RegistryValue `json:"AddValues,omitempty"`
+
+	DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go
new file mode 100644
index 000000000..fab03bc60
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RegistryKey struct {
+
+	Hive string `json:"Hive,omitempty"`
+
+	Name string `json:"Name,omitempty"`
+
+	Volatile bool `json:"Volatile,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go
new file mode 100644
index 000000000..1589f4841
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go
@@ -0,0 +1,31 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RegistryValue struct {
+
+	Key *RegistryKey `json:"Key,omitempty"`
+
+	Name string `json:"Name,omitempty"`
+
+	Type_ string `json:"Type,omitempty"`
+
+	//  One and only one value type must be set.
+	StringValue string `json:"StringValue,omitempty"`
+
+	BinaryValue string `json:"BinaryValue,omitempty"`
+
+	DWordValue int32 `json:"DWordValue,omitempty"`
+
+	QWordValue int32 `json:"QWordValue,omitempty"`
+
+	//  Only used if RegistryValueType is CustomType  The data is in BinaryValue
+	CustomType int32 `json:"CustomType,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go
new file mode 100644
index 000000000..778ff5873
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RestoreState struct {
+
+	//  The path to the save state file to restore the system from.
+	SaveStateFilePath string `json:"SaveStateFilePath,omitempty"`
+
+	//  The ID of the template system to clone this new system off of. An empty  string indicates the system should not be cloned from a template.
+	TemplateSystemId string `json:"TemplateSystemId,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go
new file mode 100644
index 000000000..e55fa1d98
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SaveOptions struct {
+
+	//  The type of save operation to be performed.
+	SaveType string `json:"SaveType,omitempty"`
+
+	//  The path to the file that will container the saved state.
+	SaveStateFilePath string `json:"SaveStateFilePath,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go
new file mode 100644
index 000000000..bf253a470
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go
@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Scsi struct {
+
+	//  Map of attachments, where the key is the integer LUN number on the controller.
+	Attachments map[string]Attachment `json:"Attachments,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go
new file mode 100644
index 000000000..bd573f6cd
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go
@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SharedMemoryConfiguration struct {
+
+	Regions []SharedMemoryRegion `json:"Regions,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go
new file mode 100644
index 000000000..a57b2cba7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go
@@ -0,0 +1,23 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SharedMemoryRegion struct {
+
+	SectionName string `json:"SectionName,omitempty"`
+
+	StartOffset int32 `json:"StartOffset,omitempty"`
+
+	Length int32 `json:"Length,omitempty"`
+
+	AllowGuestWrite bool `json:"AllowGuestWrite,omitempty"`
+
+	HiddenFromGuest bool `json:"HiddenFromGuest,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go
new file mode 100644
index 000000000..d9a50cc7d
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SharedMemoryRegionInfo struct {
+
+	SectionName string `json:"SectionName,omitempty"`
+
+	GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go
new file mode 100644
index 000000000..599c06e8a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go
@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Silo job information
+type SiloProperties struct {
+
+	Enabled bool `json:"Enabled,omitempty"`
+
+	JobName string `json:"JobName,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go
new file mode 100644
index 000000000..5cb3ed93b
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go
@@ -0,0 +1,30 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"time"
+)
+
+//  Runtime statistics for a container
+type Statistics struct {
+
+	Timestamp time.Time `json:"Timestamp,omitempty"`
+
+	ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"`
+
+	Uptime100ns int32 `json:"Uptime100ns,omitempty"`
+
+	Processor *ProcessorStats `json:"Processor,omitempty"`
+
+	Memory *MemoryStats `json:"Memory,omitempty"`
+
+	Storage *StorageStats `json:"Storage,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go
new file mode 100644
index 000000000..2627af913
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Storage struct {
+
+	//  List of layers that describe the parent hierarchy for a container's  storage. These layers combined together, presented as a disposable  and/or committable working storage, are used by the container to  record all changes done to the parent layers.
+	Layers []Layer `json:"Layers,omitempty"`
+
+	//  Path that points to the scratch space of a container, where parent  layers are combined together to present a new disposable and/or committable  layer with the changes done during its runtime.
+	Path string `json:"Path,omitempty"`
+
+	QoS *StorageQoS `json:"QoS,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go
new file mode 100644
index 000000000..8c5255df1
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type StorageQoS struct {
+
+	IopsMaximum int32 `json:"IopsMaximum,omitempty"`
+
+	BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go
new file mode 100644
index 000000000..198ea57d7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go
@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Storage runtime statistics
+type StorageStats struct {
+
+	ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"`
+
+	ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"`
+
+	WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"`
+
+	WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go
new file mode 100644
index 000000000..af2e3c823
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Topology struct {
+
+	Memory *Memory2 `json:"Memory,omitempty"`
+
+	Processor *Processor2 `json:"Processor,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go
new file mode 100644
index 000000000..ba91178f9
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Uefi struct {
+
+	EnableDebugger bool `json:"EnableDebugger,omitempty"`
+
+	SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"`
+
+	BootThis *UefiBootEntry `json:"BootThis,omitempty"`
+
+	Console string `json:"Console,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go
new file mode 100644
index 000000000..6620fb2bc
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go
@@ -0,0 +1,23 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type UefiBootEntry struct {
+
+	DeviceType string `json:"DeviceType,omitempty"`
+
+	DevicePath string `json:"DevicePath,omitempty"`
+
+	DiskNumber int32 `json:"DiskNumber,omitempty"`
+
+	OptionalData string `json:"OptionalData,omitempty"`
+
+	VmbFsRootPath string `json:"VmbFsRootPath,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go
new file mode 100644
index 000000000..62c0e4d12
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Version struct {
+
+	Major int32 `json:"Major,omitempty"`
+
+	Minor int32 `json:"Minor,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go
new file mode 100644
index 000000000..0958e5606
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VideoMonitor struct {
+
+	HorizontalResolution int32 `json:"HorizontalResolution,omitempty"`
+
+	VerticalResolution int32 `json:"VerticalResolution,omitempty"`
+
+	ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go
new file mode 100644
index 000000000..11f39eea7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go
@@ -0,0 +1,29 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualMachine struct {
+
+	Chipset *Chipset `json:"Chipset,omitempty"`
+
+	ComputeTopology *Topology `json:"ComputeTopology,omitempty"`
+
+	Devices *Devices `json:"Devices,omitempty"`
+
+	GuestState *GuestState `json:"GuestState,omitempty"`
+
+	RestoreState *RestoreState `json:"RestoreState,omitempty"`
+
+	RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
+
+	StorageQoS *StorageQoS `json:"StorageQoS,omitempty"`
+
+	GuestConnection *GuestConnection `json:"GuestConnection,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go
new file mode 100644
index 000000000..48402d8ec
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualNodeInfo struct {
+
+	VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"`
+
+	PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"`
+
+	VirtualProcessorCount int32 `json:"VirtualProcessorCount,omitempty"`
+
+	MemoryUsageInPages int32 `json:"MemoryUsageInPages,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go
new file mode 100644
index 000000000..f5b7f3e38
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go
@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualPMemController struct {
+	Devices map[string]VirtualPMemDevice `json:"Devices,omitempty"`
+
+	MaximumCount uint32 `json:"MaximumCount,omitempty"`
+
+	MaximumSizeBytes uint64 `json:"MaximumSizeBytes,omitempty"`
+
+	Backing string `json:"Backing,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go
new file mode 100644
index 000000000..47714444a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go
@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualPMemDevice struct {
+
+	HostPath string `json:"HostPath,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+
+	ImageFormat string `json:"ImageFormat,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go
new file mode 100644
index 000000000..76131b3a7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualSmb struct {
+
+	Shares []VirtualSmbShare `json:"Shares,omitempty"`
+
+	DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go
new file mode 100644
index 000000000..b50098a42
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go
@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualSmbShare struct {
+
+	Name string `json:"Name,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	AllowedFiles []string `json:"AllowedFiles,omitempty"`
+
+	Options *VirtualSmbShareOptions `json:"Options,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go
new file mode 100644
index 000000000..c1894279d
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go
@@ -0,0 +1,63 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VirtualSmbShareOptions struct {
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+
+	//  convert exclusive access to shared read access
+	ShareRead bool `json:"ShareRead,omitempty"`
+
+	//  all opens will use cached I/O
+	CacheIo bool `json:"CacheIo,omitempty"`
+
+	//  disable oplock support
+	NoOplocks bool `json:"NoOplocks,omitempty"`
+
+	//  Acquire the backup privilege when attempting to open
+	TakeBackupPrivilege bool `json:"TakeBackupPrivilege,omitempty"`
+
+	//  Use the identity of the share root when opening
+	UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"`
+
+	//  disable Direct Mapping
+	NoDirectmap bool `json:"NoDirectmap,omitempty"`
+
+	//  disable Byterange locks
+	NoLocks bool `json:"NoLocks,omitempty"`
+
+	//  disable Directory CHange Notifications
+	NoDirnotify bool `json:"NoDirnotify,omitempty"`
+
+	//  share is use for VM shared memory
+	VmSharedMemory bool `json:"VmSharedMemory,omitempty"`
+
+	//  allow access only to the files specified in AllowedFiles
+	RestrictFileAccess bool `json:"RestrictFileAccess,omitempty"`
+
+	//  disable all oplocks except Level II
+	ForceLevelIIOplocks bool `json:"ForceLevelIIOplocks,omitempty"`
+
+	//  Allow the host to reparse this base layer
+	ReparseBaseLayer bool `json:"ReparseBaseLayer,omitempty"`
+
+	//  Enable pseudo-oplocks
+	PseudoOplocks bool `json:"PseudoOplocks,omitempty"`
+
+	//  All opens will use non-cached IO
+	NonCacheIo bool `json:"NonCacheIo,omitempty"`
+
+	//  Enable pseudo directory change notifications
+	PseudoDirnotify bool `json:"PseudoDirnotify,omitempty"`
+
+	//  Block directory enumeration, renames, and deletes.
+	SingleFileMapping bool `json:"SingleFileMapping,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go
new file mode 100644
index 000000000..39f628667
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go
@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type VmMemory struct {
+
+	AvailableMemory int32 `json:"AvailableMemory,omitempty"`
+
+	AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"`
+
+	ReservedMemory int32 `json:"ReservedMemory,omitempty"`
+
+	AssignedMemory int32 `json:"AssignedMemory,omitempty"`
+
+	SlpActive bool `json:"SlpActive,omitempty"`
+
+	BalancingEnabled bool `json:"BalancingEnabled,omitempty"`
+
+	DmOperationInProgress bool `json:"DmOperationInProgress,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go
new file mode 100644
index 000000000..cf632bbc8
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go
@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type WindowsCrashReporting struct {
+
+	DumpFileName string `json:"DumpFileName,omitempty"`
+
+	MaxDumpSize int64 `json:"MaxDumpSize,omitempty"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go
new file mode 100644
index 000000000..ff3b6572e
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go
@@ -0,0 +1,70 @@
+package timeout
+
+import (
+	"os"
+	"strconv"
+	"time"
+)
+
+var (
+	// defaultTimeout is the timeout for most operations that is not overridden.
+	defaultTimeout = 4 * time.Minute
+
+	// defaultTimeoutTestdRetry is the retry loop timeout for testd to respond
+	// for a disk to come online in LCOW.
+	defaultTimeoutTestdRetry = 5 * time.Second
+)
+
+// External variables for HCSShim consumers to use.
+var (
+	// SystemCreate is the timeout for creating a compute system
+	SystemCreate time.Duration = defaultTimeout
+
+	// SystemStart is the timeout for starting a compute system
+	SystemStart time.Duration = defaultTimeout
+
+	// SystemPause is the timeout for pausing a compute system
+	SystemPause time.Duration = defaultTimeout
+
+	// SystemResume is the timeout for resuming a compute system
+	SystemResume time.Duration = defaultTimeout
+
+	// SyscallWatcher is the timeout before warning of a potential stuck platform syscall.
+	SyscallWatcher time.Duration = defaultTimeout
+
+	// Tar2VHD is the timeout for the tar2vhd operation to complete
+	Tar2VHD time.Duration = defaultTimeout
+
+	// ExternalCommandToStart is the timeout for external commands to start
+	ExternalCommandToStart = defaultTimeout
+
+	// ExternalCommandToComplete is the timeout for external commands to complete.
+	// Generally this means copying data from their stdio pipes.
+	ExternalCommandToComplete = defaultTimeout
+
+	// TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW
+	TestDRetryLoop = defaultTimeoutTestdRetry
+)
+
+func init() {
+	SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate)
+	SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart)
+	SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause)
+	SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume)
+	SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher)
+	Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD)
+	ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart)
+	ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete)
+	TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop)
+}
+
+func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration {
+	envTimeout := os.Getenv(env)
+	if len(envTimeout) > 0 {
+		e, err := strconv.Atoi(envTimeout)
+		if err == nil && e > 0 {
+			return time.Second * time.Duration(e)
+		}
+	}
+	return defaultValue
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go
new file mode 100644
index 000000000..3a0d4bc58
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go
@@ -0,0 +1,25 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// ActivateLayer will find the layer with the given id and mount it's filesystem.
+// For a read/write layer, the mounted filesystem will appear as a volume on the
+// host, while a read-only layer is generally expected to be a no-op.
+// An activated layer must later be deactivated via DeactivateLayer.
+func ActivateLayer(path string) error {
+	title := "hcsshim::ActivateLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := activateLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+" - succeeded path=%s", path)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go
index 9babd4e18..5784241df 100644
--- a/vendor/github.com/Microsoft/hcsshim/baselayer.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go
@@ -1,4 +1,4 @@
-package hcsshim
+package wclayer
 
 import (
 	"errors"
@@ -7,10 +7,12 @@ import (
 	"syscall"
 
 	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/safefile"
 )
 
 type baseLayerWriter struct {
-	root         string
+	root         *os.File
 	f            *os.File
 	bw           *winio.BackupFileWriter
 	err          error
@@ -26,10 +28,10 @@ type dirInfo struct {
 // reapplyDirectoryTimes reapplies directory modification, creation, etc. times
 // after processing of the directory tree has completed. The times are expected
 // to be ordered such that parent directories come before child directories.
-func reapplyDirectoryTimes(dis []dirInfo) error {
+func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error {
 	for i := range dis {
 		di := &dis[len(dis)-i-1] // reverse order: process child directories first
-		f, err := winio.OpenForBackup(di.path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING)
+		f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE)
 		if err != nil {
 			return err
 		}
@@ -75,12 +77,6 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e
 		w.hasUtilityVM = true
 	}
 
-	path := filepath.Join(w.root, name)
-	path, err = makeLongAbsPath(path)
-	if err != nil {
-		return err
-	}
-
 	var f *os.File
 	defer func() {
 		if f != nil {
@@ -88,27 +84,23 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e
 		}
 	}()
 
-	createmode := uint32(syscall.CREATE_NEW)
+	extraFlags := uint32(0)
 	if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 {
-		err := os.Mkdir(path, 0)
-		if err != nil && !os.IsExist(err) {
-			return err
-		}
-		createmode = syscall.OPEN_EXISTING
+		extraFlags |= safefile.FILE_DIRECTORY_FILE
 		if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
-			w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo})
+			w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo})
 		}
 	}
 
 	mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY)
-	f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode)
+	f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags)
 	if err != nil {
-		return makeError(err, "Failed to OpenForBackup", path)
+		return hcserror.New(err, "Failed to safefile.OpenRelative", name)
 	}
 
 	err = winio.SetFileBasicInfo(f, fileInfo)
 	if err != nil {
-		return makeError(err, "Failed to SetFileBasicInfo", path)
+		return hcserror.New(err, "Failed to SetFileBasicInfo", name)
 	}
 
 	w.f = f
@@ -129,17 +121,7 @@ func (w *baseLayerWriter) AddLink(name string, target string) (err error) {
 		return err
 	}
 
-	linkpath, err := makeLongAbsPath(filepath.Join(w.root, name))
-	if err != nil {
-		return err
-	}
-
-	linktarget, err := makeLongAbsPath(filepath.Join(w.root, target))
-	if err != nil {
-		return err
-	}
-
-	return os.Link(linktarget, linkpath)
+	return safefile.LinkRelative(target, w.root, name, w.root)
 }
 
 func (w *baseLayerWriter) Remove(name string) error {
@@ -155,6 +137,10 @@ func (w *baseLayerWriter) Write(b []byte) (int, error) {
 }
 
 func (w *baseLayerWriter) Close() error {
+	defer func() {
+		w.root.Close()
+		w.root = nil
+	}()
 	err := w.closeCurrentFile()
 	if err != nil {
 		return err
@@ -162,18 +148,22 @@ func (w *baseLayerWriter) Close() error {
 	if w.err == nil {
 		// Restore the file times of all the directories, since they may have
 		// been modified by creating child directories.
-		err = reapplyDirectoryTimes(w.dirInfo)
+		err = reapplyDirectoryTimes(w.root, w.dirInfo)
 		if err != nil {
 			return err
 		}
 
-		err = ProcessBaseLayer(w.root)
+		err = ProcessBaseLayer(w.root.Name())
 		if err != nil {
 			return err
 		}
 
 		if w.hasUtilityVM {
-			err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM"))
+			err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root)
+			if err != nil {
+				return err
+			}
+			err = ProcessUtilityVMImage(filepath.Join(w.root.Name(), "UtilityVM"))
 			if err != nil {
 				return err
 			}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go
new file mode 100644
index 000000000..d15817730
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go
@@ -0,0 +1,23 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// CreateLayer creates a new, empty, read-only layer on the filesystem based on
+// the parent layer provided.
+func CreateLayer(path, parent string) error {
+	title := "hcsshim::CreateLayer "
+	logrus.Debugf(title+"ID %s parent %s", path, parent)
+
+	err := createLayer(&stdDriverInfo, path, parent)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s parent=%s", path, parent)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded path=%s parent=%s", path, parent)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go
new file mode 100644
index 000000000..bf2fece19
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go
@@ -0,0 +1,31 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// CreateScratchLayer creates and populates new read-write layer for use by a container.
+// This requires both the id of the direct parent layer, as well as the full list
+// of paths to all parent layers up to the base (and including the direct parent
+// whose id was provided).
+func CreateScratchLayer(path string, parentLayerPaths []string) error {
+	title := "hcsshim::CreateScratchLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	err = createSandboxLayer(&stdDriverInfo, path, 0, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded path=%s", path)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go
new file mode 100644
index 000000000..b998f8a19
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go
@@ -0,0 +1,22 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
+func DeactivateLayer(path string) error {
+	title := "hcsshim::DeactivateLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := deactivateLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s", path)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go
new file mode 100644
index 000000000..dc14cecc4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go
@@ -0,0 +1,23 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// DestroyLayer will remove the on-disk files representing the layer with the given
+// path, including that layer's containing folder, if any.
+func DestroyLayer(path string) error {
+	title := "hcsshim::DestroyLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := destroyLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s", path)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go
new file mode 100644
index 000000000..7832bb452
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go
@@ -0,0 +1,22 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// ExpandScratchSize expands the size of a layer to at least size bytes.
+func ExpandScratchSize(path string, size uint64) error {
+	title := "hcsshim::ExpandScratchSize "
+	logrus.Debugf(title+"path=%s size=%d", path, size)
+
+	err := expandSandboxSize(&stdDriverInfo, path, size)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s size=%d", path, size)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded path=%s size=%d", path, size)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go
new file mode 100644
index 000000000..d43e941ee
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go
@@ -0,0 +1,68 @@
+package wclayer
+
+import (
+	"io/ioutil"
+	"os"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// ExportLayer will create a folder at exportFolderPath and fill that folder with
+// the transport format version of the layer identified by layerId. This transport
+// format includes any metadata required for later importing the layer (using
+// ImportLayer), and requires the full list of parent layer paths in order to
+// perform the export.
+func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error {
+	title := "hcsshim::ExportLayer "
+	logrus.Debugf(title+"path %s folder %s", path, exportFolderPath)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath)
+	return nil
+}
+
+type LayerReader interface {
+	Next() (string, int64, *winio.FileBasicInfo, error)
+	Read(b []byte) (int, error)
+	Close() error
+}
+
+// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
+// The caller must have taken the SeBackupPrivilege privilege
+// to call this and any methods on the resulting LayerReader.
+func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) {
+	exportPath, err := ioutil.TempDir("", "hcs")
+	if err != nil {
+		return nil, err
+	}
+	err = ExportLayer(path, exportPath, parentLayerPaths)
+	if err != nil {
+		os.RemoveAll(exportPath)
+		return nil, err
+	}
+	return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil
+}
+
+type legacyLayerReaderWrapper struct {
+	*legacyLayerReader
+}
+
+func (r *legacyLayerReaderWrapper) Close() error {
+	err := r.legacyLayerReader.Close()
+	os.RemoveAll(r.root)
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go
index 89f8079d0..8c37549a0 100644
--- a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go
@@ -1,34 +1,28 @@
-package hcsshim
+package wclayer
 
 import (
 	"syscall"
 
+	"github.com/Microsoft/hcsshim/internal/hcserror"
 	"github.com/sirupsen/logrus"
 )
 
-// GetLayerMountPath will look for a mounted layer with the given id and return
+// GetLayerMountPath will look for a mounted layer with the given path and return
 // the path at which that layer can be accessed.  This path may be a volume path
 // if the layer is a mounted read-write layer, otherwise it is expected to be the
 // folder path at which the layer is stored.
-func GetLayerMountPath(info DriverInfo, id string) (string, error) {
+func GetLayerMountPath(path string) (string, error) {
 	title := "hcsshim::GetLayerMountPath "
-	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return "", err
-	}
+	logrus.Debugf(title+"path %s", path)
 
 	var mountPathLength uintptr
 	mountPathLength = 0
 
 	// Call the procedure itself.
 	logrus.Debugf("Calling proc (1)")
-	err = getLayerMountPath(&infop, id, &mountPathLength, nil)
+	err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil)
 	if err != nil {
-		err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour)
+		err = hcserror.Errorf(err, title, "(first call) path=%s", path)
 		logrus.Error(err)
 		return "", err
 	}
@@ -42,14 +36,14 @@ func GetLayerMountPath(info DriverInfo, id string) (string, error) {
 
 	// Call the procedure again
 	logrus.Debugf("Calling proc (2)")
-	err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0])
+	err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0])
 	if err != nil {
-		err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour)
+		err = hcserror.Errorf(err, title, "(second call) path=%s", path)
 		logrus.Error(err)
 		return "", err
 	}
 
-	path := syscall.UTF16ToString(mountPathp[0:])
-	logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path)
-	return path, nil
+	mountPath := syscall.UTF16ToString(mountPathp[0:])
+	logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath)
+	return mountPath, nil
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go
index 05d3d9532..10899c68a 100644
--- a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go
@@ -1,6 +1,10 @@
-package hcsshim
+package wclayer
 
-import "github.com/sirupsen/logrus"
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
 
 // GetSharedBaseImages will enumerate the images stored in the common central
 // image store and return descriptive info about those images for the purpose
@@ -12,11 +16,11 @@ func GetSharedBaseImages() (imageData string, err error) {
 	var buffer *uint16
 	err = getBaseImages(&buffer)
 	if err != nil {
-		err = makeError(err, title, "")
+		err = hcserror.New(err, title, "")
 		logrus.Error(err)
 		return
 	}
-	imageData = convertAndFreeCoTaskMemString(buffer)
+	imageData = interop.ConvertAndFreeCoTaskMemString(buffer)
 	logrus.Debugf(title+" - succeeded output=%s", imageData)
 	return
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go
new file mode 100644
index 000000000..d86e67827
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go
@@ -0,0 +1,24 @@
+package wclayer
+
+import (
+	"fmt"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// GrantVmAccess adds access to a file for a given VM
+func GrantVmAccess(vmid string, filepath string) error {
+	title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath)
+	logrus.Debugf(title)
+
+	err := grantVmAccess(vmid, filepath)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", filepath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title + " - succeeded")
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go
new file mode 100644
index 000000000..486d55470
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go
@@ -0,0 +1,127 @@
+package wclayer
+
+import (
+	"io/ioutil"
+	"os"
+	"path/filepath"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/safefile"
+	"github.com/sirupsen/logrus"
+)
+
+// ImportLayer will take the contents of the folder at importFolderPath and import
+// that into a layer with the id layerId.  Note that in order to correctly populate
+// the layer and interperet the transport format, all parent layers must already
+// be present on the system at the paths provided in parentLayerPaths.
+func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error {
+	title := "hcsshim::ImportLayer "
+	logrus.Debugf(title+"path %s folder %s", path, importFolderPath)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	err = importLayer(&stdDriverInfo, path, importFolderPath, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath)
+	return nil
+}
+
+// LayerWriter is an interface that supports writing a new container image layer.
+type LayerWriter interface {
+	// Add adds a file to the layer with given metadata.
+	Add(name string, fileInfo *winio.FileBasicInfo) error
+	// AddLink adds a hard link to the layer. The target must already have been added.
+	AddLink(name string, target string) error
+	// Remove removes a file that was present in a parent layer from the layer.
+	Remove(name string) error
+	// Write writes data to the current file. The data must be in the format of a Win32
+	// backup stream.
+	Write(b []byte) (int, error)
+	// Close finishes the layer writing process and releases any resources.
+	Close() error
+}
+
+type legacyLayerWriterWrapper struct {
+	*legacyLayerWriter
+	path             string
+	parentLayerPaths []string
+}
+
+func (r *legacyLayerWriterWrapper) Close() error {
+	defer os.RemoveAll(r.root.Name())
+	defer r.legacyLayerWriter.CloseRoots()
+	err := r.legacyLayerWriter.Close()
+	if err != nil {
+		return err
+	}
+
+	if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
+		return err
+	}
+	for _, name := range r.Tombstones {
+		if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
+			return err
+		}
+	}
+	// Add any hard links that were collected.
+	for _, lnk := range r.PendingLinks {
+		if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
+			return err
+		}
+		if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
+			return err
+		}
+	}
+	// Prepare the utility VM for use if one is present in the layer.
+	if r.HasUtilityVM {
+		err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot)
+		if err != nil {
+			return err
+		}
+		err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM"))
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+// NewLayerWriter returns a new layer writer for creating a layer on disk.
+// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
+// to call this and any methods on the resulting LayerWriter.
+func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) {
+	if len(parentLayerPaths) == 0 {
+		// This is a base layer. It gets imported differently.
+		f, err := safefile.OpenRoot(path)
+		if err != nil {
+			return nil, err
+		}
+		return &baseLayerWriter{
+			root: f,
+		}, nil
+	}
+
+	importPath, err := ioutil.TempDir("", "hcs")
+	if err != nil {
+		return nil, err
+	}
+	w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path)
+	if err != nil {
+		return nil, err
+	}
+	return &legacyLayerWriterWrapper{
+		legacyLayerWriter: w,
+		path:              importPath,
+		parentLayerPaths:  parentLayerPaths,
+	}, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go
new file mode 100644
index 000000000..71287ff8a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go
@@ -0,0 +1,25 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// LayerExists will return true if a layer with the given id exists and is known
+// to the system.
+func LayerExists(path string) (bool, error) {
+	title := "hcsshim::LayerExists "
+	logrus.Debugf(title+"path %s", path)
+
+	// Call the procedure itself.
+	var exists uint32
+	err := layerExists(&stdDriverInfo, path, &exists)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return false, err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists)
+	return exists != 0, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go
new file mode 100644
index 000000000..90df3bedc
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go
@@ -0,0 +1,13 @@
+package wclayer
+
+import (
+	"path/filepath"
+
+	"github.com/Microsoft/hcsshim/internal/guid"
+)
+
+// LayerID returns the layer ID of a layer on disk.
+func LayerID(path string) (guid.GUID, error) {
+	_, file := filepath.Split(path)
+	return NameToGuid(file)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go
index c0e550377..a1b8b9882 100644
--- a/vendor/github.com/Microsoft/hcsshim/layerutils.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go
@@ -1,12 +1,12 @@
-package hcsshim
+package wclayer
 
 // This file contains utility functions to support storage (graph) related
 // functionality.
 
 import (
-	"path/filepath"
 	"syscall"
 
+	"github.com/Microsoft/hcsshim/internal/guid"
 	"github.com/sirupsen/logrus"
 )
 
@@ -22,28 +22,16 @@ struct DriverInfo {
     LPCWSTR HomeDir;
 };
 */
-type DriverInfo struct {
-	Flavour int
-	HomeDir string
-}
 
 type driverInfo struct {
 	Flavour  int
 	HomeDirp *uint16
 }
 
-func convertDriverInfo(info DriverInfo) (driverInfo, error) {
-	homedirp, err := syscall.UTF16PtrFromString(info.HomeDir)
-	if err != nil {
-		logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error())
-		return driverInfo{}, err
-	}
-
-	return driverInfo{
-		Flavour:  info.Flavour,
-		HomeDirp: homedirp,
-	}, nil
-}
+var (
+	utf16EmptyString uint16
+	stdDriverInfo    = driverInfo{1, &utf16EmptyString}
+)
 
 /* To pass into syscall, we need a struct matching the following:
 typedef struct _WC_LAYER_DESCRIPTOR {
@@ -75,7 +63,7 @@ typedef struct _WC_LAYER_DESCRIPTOR {
 } WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR;
 */
 type WC_LAYER_DESCRIPTOR struct {
-	LayerId GUID
+	LayerId guid.GUID
 	Flags   uint32
 	Pathp   *uint16
 }
@@ -85,10 +73,7 @@ func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR,
 	var layers []WC_LAYER_DESCRIPTOR
 
 	for i := 0; i < len(parentLayerPaths); i++ {
-		// Create a layer descriptor, using the folder name
-		// as the source for a GUID LayerId
-		_, folderName := filepath.Split(parentLayerPaths[i])
-		g, err := NameToGuid(folderName)
+		g, err := LayerID(parentLayerPaths[i])
 		if err != nil {
 			logrus.Debugf("Failed to convert name to guid %s", err)
 			return nil, err
diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go
index c7f6073ac..b8ea5d263 100644
--- a/vendor/github.com/Microsoft/hcsshim/legacy.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go
@@ -1,4 +1,4 @@
-package hcsshim
+package wclayer
 
 import (
 	"bufio"
@@ -6,12 +6,15 @@ import (
 	"errors"
 	"fmt"
 	"io"
+	"io/ioutil"
 	"os"
 	"path/filepath"
 	"strings"
 	"syscall"
 
 	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/longpath"
+	"github.com/Microsoft/hcsshim/internal/safefile"
 )
 
 var errorIterationCanceled = errors.New("")
@@ -34,23 +37,6 @@ func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os
 	return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition)
 }
 
-func makeLongAbsPath(path string) (string, error) {
-	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
-		return path, nil
-	}
-	if !filepath.IsAbs(path) {
-		absPath, err := filepath.Abs(path)
-		if err != nil {
-			return "", err
-		}
-		path = absPath
-	}
-	if strings.HasPrefix(path, `\\`) {
-		return `\\?\UNC\` + path[2:], nil
-	}
-	return `\\?\` + path, nil
-}
-
 func hasPathPrefix(p, prefix string) bool {
 	return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\'
 }
@@ -106,7 +92,7 @@ func readTombstones(path string) (map[string]([]string), error) {
 }
 
 func (r *legacyLayerReader) walkUntilCancelled() error {
-	root, err := makeLongAbsPath(r.root)
+	root, err := longpath.LongAbs(r.root)
 	if err != nil {
 		return err
 	}
@@ -121,6 +107,16 @@ func (r *legacyLayerReader) walkUntilCancelled() error {
 		if err != nil {
 			return err
 		}
+
+		// Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048.
+		// Handle failure from what may be a golang bug in the conversion of
+		// UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat
+		// which is called by filepath.Walk will fail when a filename contains
+		// unicode characters. Skip the recycle bin regardless which is goodness.
+		if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() {
+			return filepath.SkipDir
+		}
+
 		if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") {
 			return nil
 		}
@@ -273,7 +269,7 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil
 		if err != nil {
 			return
 		}
-		fileInfo.FileAttributes = uintptr(attr)
+		fileInfo.FileAttributes = attr
 		beginning := int64(4)
 
 		// Find the accurate file size.
@@ -326,59 +322,81 @@ func (r *legacyLayerReader) Close() error {
 
 type pendingLink struct {
 	Path, Target string
+	TargetRoot   *os.File
+}
+
+type pendingDir struct {
+	Path string
+	Root *os.File
 }
 
 type legacyLayerWriter struct {
-	root         string
-	parentRoots  []string
-	destRoot     string
-	currentFile  *os.File
-	backupWriter *winio.BackupFileWriter
-	tombstones   []string
-	pathFixed    bool
-	HasUtilityVM bool
-	uvmDi        []dirInfo
-	addedFiles   map[string]bool
-	PendingLinks []pendingLink
+	root            *os.File
+	destRoot        *os.File
+	parentRoots     []*os.File
+	currentFile     *os.File
+	bufWriter       *bufio.Writer
+	currentFileName string
+	currentFileRoot *os.File
+	backupWriter    *winio.BackupFileWriter
+	Tombstones      []string
+	HasUtilityVM    bool
+	uvmDi           []dirInfo
+	addedFiles      map[string]bool
+	PendingLinks    []pendingLink
+	pendingDirs     []pendingDir
+	currentIsDir    bool
 }
 
 // newLegacyLayerWriter returns a LayerWriter that can write the contaler layer
 // transport format to disk.
-func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) *legacyLayerWriter {
-	return &legacyLayerWriter{
-		root:        root,
-		parentRoots: parentRoots,
-		destRoot:    destRoot,
-		addedFiles:  make(map[string]bool),
+func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) {
+	w = &legacyLayerWriter{
+		addedFiles: make(map[string]bool),
 	}
-}
-
-func (w *legacyLayerWriter) init() error {
-	if !w.pathFixed {
-		path, err := makeLongAbsPath(w.root)
+	defer func() {
 		if err != nil {
-			return err
-		}
-		for i, p := range w.parentRoots {
-			w.parentRoots[i], err = makeLongAbsPath(p)
-			if err != nil {
-				return err
-			}
+			w.CloseRoots()
+			w = nil
 		}
-		destPath, err := makeLongAbsPath(w.destRoot)
+	}()
+	w.root, err = safefile.OpenRoot(root)
+	if err != nil {
+		return
+	}
+	w.destRoot, err = safefile.OpenRoot(destRoot)
+	if err != nil {
+		return
+	}
+	for _, r := range parentRoots {
+		f, err := safefile.OpenRoot(r)
 		if err != nil {
-			return err
+			return w, err
 		}
-		w.root = path
-		w.destRoot = destPath
-		w.pathFixed = true
+		w.parentRoots = append(w.parentRoots, f)
 	}
-	return nil
+	w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536)
+	return
+}
+
+func (w *legacyLayerWriter) CloseRoots() {
+	if w.root != nil {
+		w.root.Close()
+		w.root = nil
+	}
+	if w.destRoot != nil {
+		w.destRoot.Close()
+		w.destRoot = nil
+	}
+	for i := range w.parentRoots {
+		w.parentRoots[i].Close()
+	}
+	w.parentRoots = nil
 }
 
 func (w *legacyLayerWriter) initUtilityVM() error {
 	if !w.HasUtilityVM {
-		err := os.Mkdir(filepath.Join(w.destRoot, utilityVMPath), 0)
+		err := safefile.MkdirRelative(utilityVMPath, w.destRoot)
 		if err != nil {
 			return err
 		}
@@ -386,7 +404,7 @@ func (w *legacyLayerWriter) initUtilityVM() error {
 		// clone the utility VM from the parent layer into this layer. Use hard
 		// links to avoid unnecessary copying, since most of the files are
 		// immutable.
-		err = cloneTree(filepath.Join(w.parentRoots[0], utilityVMFilesPath), filepath.Join(w.destRoot, utilityVMFilesPath), mutatedUtilityVMFiles)
+		err = cloneTree(w.parentRoots[0], w.destRoot, utilityVMFilesPath, mutatedUtilityVMFiles)
 		if err != nil {
 			return fmt.Errorf("cloning the parent utility VM image failed: %s", err)
 		}
@@ -395,7 +413,45 @@ func (w *legacyLayerWriter) initUtilityVM() error {
 	return nil
 }
 
-func (w *legacyLayerWriter) reset() {
+func (w *legacyLayerWriter) reset() error {
+	err := w.bufWriter.Flush()
+	if err != nil {
+		return err
+	}
+	w.bufWriter.Reset(ioutil.Discard)
+	if w.currentIsDir {
+		r := w.currentFile
+		br := winio.NewBackupStreamReader(r)
+		// Seek to the beginning of the backup stream, skipping the fileattrs
+		if _, err := r.Seek(4, io.SeekStart); err != nil {
+			return err
+		}
+
+		for {
+			bhdr, err := br.Next()
+			if err == io.EOF {
+				// end of backupstream data
+				break
+			}
+			if err != nil {
+				return err
+			}
+			switch bhdr.Id {
+			case winio.BackupReparseData:
+				// The current file is a `.$wcidirs$` metadata file that
+				// describes a directory reparse point. Delete the placeholder
+				// directory to prevent future files being added into the
+				// destination of the reparse point during the ImportLayer call
+				if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil {
+					return err
+				}
+				w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot})
+			default:
+				// ignore all other stream types, as we only care about directory reparse points
+			}
+		}
+		w.currentIsDir = false
+	}
 	if w.backupWriter != nil {
 		w.backupWriter.Close()
 		w.backupWriter = nil
@@ -403,21 +459,21 @@ func (w *legacyLayerWriter) reset() {
 	if w.currentFile != nil {
 		w.currentFile.Close()
 		w.currentFile = nil
+		w.currentFileName = ""
+		w.currentFileRoot = nil
 	}
+	return nil
 }
 
 // copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata
-func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
-	createDisposition := uint32(syscall.CREATE_NEW)
-	if isDir {
-		err = os.Mkdir(destPath, 0)
-		if err != nil {
-			return nil, err
-		}
-		createDisposition = syscall.OPEN_EXISTING
-	}
-
-	src, err := openFileOrDir(srcPath, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.OPEN_EXISTING)
+func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
+	src, err := safefile.OpenRelative(
+		subPath,
+		srcRoot,
+		syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY,
+		syscall.FILE_SHARE_READ,
+		safefile.FILE_OPEN,
+		safefile.FILE_OPEN_REPARSE_POINT)
 	if err != nil {
 		return nil, err
 	}
@@ -430,7 +486,17 @@ func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio
 		return nil, err
 	}
 
-	dest, err := openFileOrDir(destPath, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition)
+	extraFlags := uint32(0)
+	if isDir {
+		extraFlags |= safefile.FILE_DIRECTORY_FILE
+	}
+	dest, err := safefile.OpenRelative(
+		subPath,
+		destRoot,
+		syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
+		syscall.FILE_SHARE_READ,
+		safefile.FILE_CREATE,
+		extraFlags)
 	if err != nil {
 		return nil, err
 	}
@@ -459,55 +525,57 @@ func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio
 
 // cloneTree clones a directory tree using hard links. It skips hard links for
 // the file names in the provided map and just copies those files.
-func cloneTree(srcPath, destPath string, mutatedFiles map[string]bool) error {
+func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error {
 	var di []dirInfo
-	err := filepath.Walk(srcPath, func(srcFilePath string, info os.FileInfo, err error) error {
+	err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot)
+	if err != nil {
+		return err
+	}
+	err = filepath.Walk(filepath.Join(srcRoot.Name(), subPath), func(srcFilePath string, info os.FileInfo, err error) error {
 		if err != nil {
 			return err
 		}
 
-		relPath, err := filepath.Rel(srcPath, srcFilePath)
+		relPath, err := filepath.Rel(srcRoot.Name(), srcFilePath)
 		if err != nil {
 			return err
 		}
-		destFilePath := filepath.Join(destPath, relPath)
 
+		fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes
 		// Directories, reparse points, and files that will be mutated during
 		// utility VM import must be copied. All other files can be hard linked.
-		isReparsePoint := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0
-		if info.IsDir() || isReparsePoint || mutatedFiles[relPath] {
-			fi, err := copyFileWithMetadata(srcFilePath, destFilePath, info.IsDir())
+		isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0
+		// In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink.
+		// See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc
+		// Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly
+		isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0
+
+		if isDir || isReparsePoint || mutatedFiles[relPath] {
+			fi, err := copyFileWithMetadata(srcRoot, destRoot, relPath, isDir)
 			if err != nil {
 				return err
 			}
-			if info.IsDir() && !isReparsePoint {
-				di = append(di, dirInfo{path: destFilePath, fileInfo: *fi})
+			if isDir && !isReparsePoint {
+				di = append(di, dirInfo{path: relPath, fileInfo: *fi})
 			}
 		} else {
-			err = os.Link(srcFilePath, destFilePath)
+			err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot)
 			if err != nil {
 				return err
 			}
 		}
 
-		// Don't recurse on reparse points.
-		if info.IsDir() && isReparsePoint {
-			return filepath.SkipDir
-		}
-
 		return nil
 	})
 	if err != nil {
 		return err
 	}
 
-	return reapplyDirectoryTimes(di)
+	return reapplyDirectoryTimes(destRoot, di)
 }
 
 func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
-	w.reset()
-	err := w.init()
-	if err != nil {
+	if err := w.reset(); err != nil {
 		return err
 	}
 
@@ -515,6 +583,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
 		return w.initUtilityVM()
 	}
 
+	name = filepath.Clean(name)
 	if hasPathPrefix(name, utilityVMPath) {
 		if !w.HasUtilityVM {
 			return errors.New("missing UtilityVM directory")
@@ -522,10 +591,9 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
 		if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath {
 			return errors.New("invalid UtilityVM layer")
 		}
-		path := filepath.Join(w.destRoot, name)
-		createDisposition := uint32(syscall.OPEN_EXISTING)
+		createDisposition := uint32(safefile.FILE_OPEN)
 		if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
-			st, err := os.Lstat(path)
+			st, err := safefile.LstatRelative(name, w.destRoot)
 			if err != nil && !os.IsNotExist(err) {
 				return err
 			}
@@ -533,37 +601,44 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
 				// Delete the existing file/directory if it is not the same type as this directory.
 				existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes
 				if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
-					if err = os.RemoveAll(path); err != nil {
+					if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil {
 						return err
 					}
 					st = nil
 				}
 			}
 			if st == nil {
-				if err = os.Mkdir(path, 0); err != nil {
+				if err = safefile.MkdirRelative(name, w.destRoot); err != nil {
 					return err
 				}
 			}
 			if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
-				w.uvmDi = append(w.uvmDi, dirInfo{path: path, fileInfo: *fileInfo})
+				w.uvmDi = append(w.uvmDi, dirInfo{path: name, fileInfo: *fileInfo})
 			}
 		} else {
 			// Overwrite any existing hard link.
-			err = os.Remove(path)
+			err := safefile.RemoveRelative(name, w.destRoot)
 			if err != nil && !os.IsNotExist(err) {
 				return err
 			}
-			createDisposition = syscall.CREATE_NEW
+			createDisposition = safefile.FILE_CREATE
 		}
 
-		f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition)
+		f, err := safefile.OpenRelative(
+			name,
+			w.destRoot,
+			syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
+			syscall.FILE_SHARE_READ,
+			createDisposition,
+			safefile.FILE_OPEN_REPARSE_POINT,
+		)
 		if err != nil {
 			return err
 		}
 		defer func() {
 			if f != nil {
 				f.Close()
-				os.Remove(path)
+				safefile.RemoveRelative(name, w.destRoot)
 			}
 		}()
 
@@ -573,29 +648,33 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
 		}
 
 		w.backupWriter = winio.NewBackupFileWriter(f, true)
+		w.bufWriter.Reset(w.backupWriter)
 		w.currentFile = f
+		w.currentFileName = name
+		w.currentFileRoot = w.destRoot
 		w.addedFiles[name] = true
 		f = nil
 		return nil
 	}
 
-	path := filepath.Join(w.root, name)
+	fname := name
 	if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
-		err := os.Mkdir(path, 0)
+		err := safefile.MkdirRelative(name, w.root)
 		if err != nil {
 			return err
 		}
-		path += ".$wcidirs$"
+		fname += ".$wcidirs$"
+		w.currentIsDir = true
 	}
 
-	f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.CREATE_NEW)
+	f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0)
 	if err != nil {
 		return err
 	}
 	defer func() {
 		if f != nil {
 			f.Close()
-			os.Remove(path)
+			safefile.RemoveRelative(fname, w.root)
 		}
 	}()
 
@@ -608,28 +687,32 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
 
 	if hasPathPrefix(name, hivesPath) {
 		w.backupWriter = winio.NewBackupFileWriter(f, false)
+		w.bufWriter.Reset(w.backupWriter)
 	} else {
+		w.bufWriter.Reset(f)
 		// The file attributes are written before the stream.
-		err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes))
+		err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes))
 		if err != nil {
+			w.bufWriter.Reset(ioutil.Discard)
 			return err
 		}
 	}
 
 	w.currentFile = f
+	w.currentFileName = name
+	w.currentFileRoot = w.root
 	w.addedFiles[name] = true
 	f = nil
 	return nil
 }
 
 func (w *legacyLayerWriter) AddLink(name string, target string) error {
-	w.reset()
-	err := w.init()
-	if err != nil {
+	if err := w.reset(); err != nil {
 		return err
 	}
 
-	var roots []string
+	target = filepath.Clean(target)
+	var roots []*os.File
 	if hasPathPrefix(target, filesPath) {
 		// Look for cross-layer hard link targets in the parent layers, since
 		// nothing is in the destination path yet.
@@ -638,7 +721,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error {
 		// Since the utility VM is fully cloned into the destination path
 		// already, look for cross-layer hard link targets directly in the
 		// destination path.
-		roots = []string{w.destRoot}
+		roots = []*os.File{w.destRoot}
 	}
 
 	if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) {
@@ -647,12 +730,12 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error {
 
 	// Find to try the target of the link in a previously added file. If that
 	// fails, search in parent layers.
-	var selectedRoot string
+	var selectedRoot *os.File
 	if _, ok := w.addedFiles[target]; ok {
 		selectedRoot = w.destRoot
 	} else {
 		for _, r := range roots {
-			if _, err = os.Lstat(filepath.Join(r, target)); err != nil {
+			if _, err := safefile.LstatRelative(target, r); err != nil {
 				if !os.IsNotExist(err) {
 					return err
 				}
@@ -661,22 +744,25 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error {
 				break
 			}
 		}
-		if selectedRoot == "" {
+		if selectedRoot == nil {
 			return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target)
 		}
 	}
+
 	// The link can't be written until after the ImportLayer call.
 	w.PendingLinks = append(w.PendingLinks, pendingLink{
-		Path:   filepath.Join(w.destRoot, name),
-		Target: filepath.Join(selectedRoot, target),
+		Path:       name,
+		Target:     target,
+		TargetRoot: selectedRoot,
 	})
 	w.addedFiles[name] = true
 	return nil
 }
 
 func (w *legacyLayerWriter) Remove(name string) error {
+	name = filepath.Clean(name)
 	if hasPathPrefix(name, filesPath) {
-		w.tombstones = append(w.tombstones, name[len(filesPath)+1:])
+		w.Tombstones = append(w.Tombstones, name)
 	} else if hasPathPrefix(name, utilityVMFilesPath) {
 		err := w.initUtilityVM()
 		if err != nil {
@@ -685,11 +771,10 @@ func (w *legacyLayerWriter) Remove(name string) error {
 		// Make sure the path exists; os.RemoveAll will not fail if the file is
 		// already gone, and this needs to be a fatal error for diagnostics
 		// purposes.
-		path := filepath.Join(w.destRoot, name)
-		if _, err := os.Lstat(path); err != nil {
+		if _, err := safefile.LstatRelative(name, w.destRoot); err != nil {
 			return err
 		}
-		err = os.RemoveAll(path)
+		err = safefile.RemoveAllRelative(name, w.destRoot)
 		if err != nil {
 			return err
 		}
@@ -701,38 +786,27 @@ func (w *legacyLayerWriter) Remove(name string) error {
 }
 
 func (w *legacyLayerWriter) Write(b []byte) (int, error) {
-	if w.backupWriter == nil {
-		if w.currentFile == nil {
-			return 0, errors.New("closed")
-		}
-		return w.currentFile.Write(b)
+	if w.backupWriter == nil && w.currentFile == nil {
+		return 0, errors.New("closed")
 	}
-	return w.backupWriter.Write(b)
+	return w.bufWriter.Write(b)
 }
 
 func (w *legacyLayerWriter) Close() error {
-	w.reset()
-	err := w.init()
-	if err != nil {
+	if err := w.reset(); err != nil {
 		return err
 	}
-	tf, err := os.Create(filepath.Join(w.root, "tombstones.txt"))
-	if err != nil {
-		return err
-	}
-	defer tf.Close()
-	_, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n"))
-	if err != nil {
+	if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) {
 		return err
 	}
-	for _, t := range w.tombstones {
-		_, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n"))
+	for _, pd := range w.pendingDirs {
+		err := safefile.MkdirRelative(pd.Path, pd.Root)
 		if err != nil {
 			return err
 		}
 	}
 	if w.HasUtilityVM {
-		err = reapplyDirectoryTimes(w.uvmDi)
+		err := reapplyDirectoryTimes(w.destRoot, w.uvmDi)
 		if err != nil {
 			return err
 		}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go
new file mode 100644
index 000000000..741994ba4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go
@@ -0,0 +1,24 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// NameToGuid converts the given string into a GUID using the algorithm in the
+// Host Compute Service, ensuring GUIDs generated with the same string are common
+// across all clients.
+func NameToGuid(name string) (id guid.GUID, err error) {
+	title := "hcsshim::NameToGuid "
+
+	err = nameToGuid(name, &id)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "name=%s", name)
+		logrus.Error(err)
+		return
+	}
+
+	logrus.Debugf(title+"name:%s guid:%s", name, id.String())
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go
index 5c5b61841..bd4005dc4 100644
--- a/vendor/github.com/Microsoft/hcsshim/preparelayer.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go
@@ -1,21 +1,22 @@
-package hcsshim
+package wclayer
 
 import (
 	"sync"
 
+	"github.com/Microsoft/hcsshim/internal/hcserror"
 	"github.com/sirupsen/logrus"
 )
 
 var prepareLayerLock sync.Mutex
 
-// PrepareLayer finds a mounted read-write layer matching layerId and enables the
+// PrepareLayer finds a mounted read-write layer matching path and enables the
 // the filesystem filter for use on that layer.  This requires the paths to all
 // parent layers, and is necessary in order to view or interact with the layer
 // as an actual filesystem (reading and writing files, creating directories, etc).
 // Disabling the filter must be done via UnprepareLayer.
-func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
+func PrepareLayer(path string, parentLayerPaths []string) error {
 	title := "hcsshim::PrepareLayer "
-	logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
+	logrus.Debugf(title+"path %s", path)
 
 	// Generate layer descriptors
 	layers, err := layerPathsToDescriptors(parentLayerPaths)
@@ -23,24 +24,17 @@ func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) er
 		return err
 	}
 
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
 	// This lock is a temporary workaround for a Windows bug. Only allowing one
 	// call to prepareLayer at a time vastly reduces the chance of a timeout.
 	prepareLayerLock.Lock()
 	defer prepareLayerLock.Unlock()
-	err = prepareLayer(&infop, layerId, layers)
+	err = prepareLayer(&stdDriverInfo, path, layers)
 	if err != nil {
-		err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
+		err = hcserror.Errorf(err, title, "path=%s", path)
 		logrus.Error(err)
 		return err
 	}
 
-	logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId)
+	logrus.Debugf(title+"succeeded path=%s", path)
 	return nil
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go
index fadb1b92c..884207c3e 100644
--- a/vendor/github.com/Microsoft/hcsshim/processimage.go
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go
@@ -1,4 +1,4 @@
-package hcsshim
+package wclayer
 
 import "os"
 
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go
new file mode 100644
index 000000000..5f1b4f4f4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go
@@ -0,0 +1,23 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// UnprepareLayer disables the filesystem filter for the read-write layer with
+// the given id.
+func UnprepareLayer(path string) error {
+	title := "hcsshim::UnprepareLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := unprepareLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s", path)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go
new file mode 100644
index 000000000..78f2aacd8
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go
@@ -0,0 +1,27 @@
+package wclayer
+
+import "github.com/Microsoft/hcsshim/internal/guid"
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go
+
+//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
+//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
+//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
+//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
+//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
+//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
+//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
+//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
+//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
+//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
+//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
+//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
+//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid?
+//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
+//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
+//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
+//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
+
+//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess?
+
+type _guid = guid.GUID
diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go
new file mode 100644
index 000000000..2105703dc
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go
@@ -0,0 +1,457 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package wclayer
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procActivateLayer       = modvmcompute.NewProc("ActivateLayer")
+	procCopyLayer           = modvmcompute.NewProc("CopyLayer")
+	procCreateLayer         = modvmcompute.NewProc("CreateLayer")
+	procCreateSandboxLayer  = modvmcompute.NewProc("CreateSandboxLayer")
+	procExpandSandboxSize   = modvmcompute.NewProc("ExpandSandboxSize")
+	procDeactivateLayer     = modvmcompute.NewProc("DeactivateLayer")
+	procDestroyLayer        = modvmcompute.NewProc("DestroyLayer")
+	procExportLayer         = modvmcompute.NewProc("ExportLayer")
+	procGetLayerMountPath   = modvmcompute.NewProc("GetLayerMountPath")
+	procGetBaseImages       = modvmcompute.NewProc("GetBaseImages")
+	procImportLayer         = modvmcompute.NewProc("ImportLayer")
+	procLayerExists         = modvmcompute.NewProc("LayerExists")
+	procNameToGuid          = modvmcompute.NewProc("NameToGuid")
+	procPrepareLayer        = modvmcompute.NewProc("PrepareLayer")
+	procUnprepareLayer      = modvmcompute.NewProc("UnprepareLayer")
+	procProcessBaseImage    = modvmcompute.NewProc("ProcessBaseImage")
+	procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage")
+	procGrantVmAccess       = modvmcompute.NewProc("GrantVmAccess")
+)
+
+func activateLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _activateLayer(info, _p0)
+}
+
+func _activateLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procActivateLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(srcId)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(dstId)
+	if hr != nil {
+		return
+	}
+	return _copyLayer(info, _p0, _p1, descriptors)
+}
+
+func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procCopyLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func createLayer(info *driverInfo, id string, parent string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(parent)
+	if hr != nil {
+		return
+	}
+	return _createLayer(info, _p0, _p1)
+}
+
+func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) {
+	if hr = procCreateLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _createSandboxLayer(info, _p0, parent, descriptors)
+}
+
+func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p1 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p1 = &descriptors[0]
+	}
+	if hr = procCreateSandboxLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _expandSandboxSize(info, _p0, size)
+}
+
+func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) {
+	if hr = procExpandSandboxSize.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func deactivateLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _deactivateLayer(info, _p0)
+}
+
+func _deactivateLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procDeactivateLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func destroyLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _destroyLayer(info, _p0)
+}
+
+func _destroyLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procDestroyLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _exportLayer(info, _p0, _p1, descriptors)
+}
+
+func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procExportLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _getLayerMountPath(info, _p0, length, buffer)
+}
+
+func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) {
+	if hr = procGetLayerMountPath.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func getBaseImages(buffer **uint16) (hr error) {
+	if hr = procGetBaseImages.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _importLayer(info, _p0, _p1, descriptors)
+}
+
+func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procImportLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func layerExists(info *driverInfo, id string, exists *uint32) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _layerExists(info, _p0, exists)
+}
+
+func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) {
+	if hr = procLayerExists.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func nameToGuid(name string, guid *_guid) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(name)
+	if hr != nil {
+		return
+	}
+	return _nameToGuid(_p0, guid)
+}
+
+func _nameToGuid(name *uint16, guid *_guid) (hr error) {
+	if hr = procNameToGuid.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _prepareLayer(info, _p0, descriptors)
+}
+
+func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p1 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p1 = &descriptors[0]
+	}
+	if hr = procPrepareLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func unprepareLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _unprepareLayer(info, _p0)
+}
+
+func _unprepareLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procUnprepareLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func processBaseImage(path string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _processBaseImage(_p0)
+}
+
+func _processBaseImage(path *uint16) (hr error) {
+	if hr = procProcessBaseImage.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func processUtilityImage(path string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _processUtilityImage(_p0)
+}
+
+func _processUtilityImage(path *uint16) (hr error) {
+	if hr = procProcessUtilityImage.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func grantVmAccess(vmid string, filepath string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(vmid)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(filepath)
+	if hr != nil {
+		return
+	}
+	return _grantVmAccess(_p0, _p1)
+}
+
+func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) {
+	if hr = procGrantVmAccess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go
new file mode 100644
index 000000000..df0e63bbd
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/layer.go
@@ -0,0 +1,106 @@
+package hcsshim
+
+import (
+	"crypto/sha1"
+	"path/filepath"
+
+	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/hcsshim/internal/wclayer"
+)
+
+func layerPath(info *DriverInfo, id string) string {
+	return filepath.Join(info.HomeDir, id)
+}
+
+func ActivateLayer(info DriverInfo, id string) error {
+	return wclayer.ActivateLayer(layerPath(&info, id))
+}
+func CreateLayer(info DriverInfo, id, parent string) error {
+	return wclayer.CreateLayer(layerPath(&info, id), parent)
+}
+
+// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility.
+func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
+	return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
+}
+func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
+	return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
+}
+func DeactivateLayer(info DriverInfo, id string) error {
+	return wclayer.DeactivateLayer(layerPath(&info, id))
+}
+func DestroyLayer(info DriverInfo, id string) error {
+	return wclayer.DestroyLayer(layerPath(&info, id))
+}
+
+// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility.
+func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
+	return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
+}
+func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error {
+	return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
+}
+func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
+	return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths)
+}
+func GetLayerMountPath(info DriverInfo, id string) (string, error) {
+	return wclayer.GetLayerMountPath(layerPath(&info, id))
+}
+func GetSharedBaseImages() (imageData string, err error) {
+	return wclayer.GetSharedBaseImages()
+}
+func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
+	return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths)
+}
+func LayerExists(info DriverInfo, id string) (bool, error) {
+	return wclayer.LayerExists(layerPath(&info, id))
+}
+func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
+	return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths)
+}
+func ProcessBaseLayer(path string) error {
+	return wclayer.ProcessBaseLayer(path)
+}
+func ProcessUtilityVMImage(path string) error {
+	return wclayer.ProcessUtilityVMImage(path)
+}
+func UnprepareLayer(info DriverInfo, layerId string) error {
+	return wclayer.UnprepareLayer(layerPath(&info, layerId))
+}
+
+type DriverInfo struct {
+	Flavour int
+	HomeDir string
+}
+
+type GUID [16]byte
+
+func NameToGuid(name string) (id GUID, err error) {
+	g, err := wclayer.NameToGuid(name)
+	return GUID(g), err
+}
+
+func NewGUID(source string) *GUID {
+	h := sha1.Sum([]byte(source))
+	var g GUID
+	copy(g[0:], h[0:16])
+	return &g
+}
+
+func (g *GUID) ToString() string {
+	return (guid.GUID)(*g).String()
+}
+
+type LayerReader = wclayer.LayerReader
+
+func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
+	return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths)
+}
+
+type LayerWriter = wclayer.LayerWriter
+
+func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
+	return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths)
+}
+
+type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR
diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go
deleted file mode 100644
index fe46f404c..000000000
--- a/vendor/github.com/Microsoft/hcsshim/layerexists.go
+++ /dev/null
@@ -1,30 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// LayerExists will return true if a layer with the given id exists and is known
-// to the system.
-func LayerExists(info DriverInfo, id string) (bool, error) {
-	title := "hcsshim::LayerExists "
-	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return false, err
-	}
-
-	// Call the procedure itself.
-	var exists uint32
-
-	err = layerExists(&infop, id, &exists)
-	if err != nil {
-		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
-		logrus.Error(err)
-		return false, err
-	}
-
-	logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists)
-	return exists != 0, nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go
deleted file mode 100644
index b7c6d020c..000000000
--- a/vendor/github.com/Microsoft/hcsshim/nametoguid.go
+++ /dev/null
@@ -1,20 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// NameToGuid converts the given string into a GUID using the algorithm in the
-// Host Compute Service, ensuring GUIDs generated with the same string are common
-// across all clients.
-func NameToGuid(name string) (id GUID, err error) {
-	title := "hcsshim::NameToGuid "
-	logrus.Debugf(title+"Name %s", name)
-
-	err = nameToGuid(name, &id)
-	if err != nil {
-		err = makeErrorf(err, title, "name=%s", name)
-		logrus.Error(err)
-		return
-	}
-
-	return
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go
index faee2cfee..ca8acbb7c 100644
--- a/vendor/github.com/Microsoft/hcsshim/process.go
+++ b/vendor/github.com/Microsoft/hcsshim/process.go
@@ -1,384 +1,72 @@
 package hcsshim
 
 import (
-	"encoding/json"
 	"io"
-	"sync"
-	"syscall"
 	"time"
 
-	"github.com/sirupsen/logrus"
+	"github.com/Microsoft/hcsshim/internal/hcs"
 )
 
 // ContainerError is an error encountered in HCS
 type process struct {
-	handleLock     sync.RWMutex
-	handle         hcsProcess
-	processID      int
-	container      *container
-	cachedPipes    *cachedPipes
-	callbackNumber uintptr
+	p *hcs.Process
 }
 
-type cachedPipes struct {
-	stdIn  syscall.Handle
-	stdOut syscall.Handle
-	stdErr syscall.Handle
-}
-
-type processModifyRequest struct {
-	Operation   string
-	ConsoleSize *consoleSize `json:",omitempty"`
-	CloseHandle *closeHandle `json:",omitempty"`
-}
-
-type consoleSize struct {
-	Height uint16
-	Width  uint16
-}
-
-type closeHandle struct {
-	Handle string
-}
-
-type processStatus struct {
-	ProcessID      uint32
-	Exited         bool
-	ExitCode       uint32
-	LastWaitResult int32
-}
-
-const (
-	stdIn  string = "StdIn"
-	stdOut string = "StdOut"
-	stdErr string = "StdErr"
-)
-
-const (
-	modifyConsoleSize string = "ConsoleSize"
-	modifyCloseHandle string = "CloseHandle"
-)
-
 // Pid returns the process ID of the process within the container.
 func (process *process) Pid() int {
-	return process.processID
+	return process.p.Pid()
 }
 
 // Kill signals the process to terminate but does not wait for it to finish terminating.
 func (process *process) Kill() error {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-	operation := "Kill"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	if process.handle == 0 {
-		return makeProcessError(process, operation, "", ErrAlreadyClosed)
-	}
-
-	var resultp *uint16
-	err := hcsTerminateProcess(process.handle, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return nil
+	return convertProcessError(process.p.Kill(), process)
 }
 
 // Wait waits for the process to exit.
 func (process *process) Wait() error {
-	operation := "Wait"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
-	if err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return nil
+	return convertProcessError(process.p.Wait(), process)
 }
 
 // WaitTimeout waits for the process to exit or the duration to elapse. It returns
 // false if timeout occurs.
 func (process *process) WaitTimeout(timeout time.Duration) error {
-	operation := "WaitTimeout"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
-	if err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return nil
+	return convertProcessError(process.p.WaitTimeout(timeout), process)
 }
 
 // ExitCode returns the exit code of the process. The process must have
 // already terminated.
 func (process *process) ExitCode() (int, error) {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-	operation := "ExitCode"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	if process.handle == 0 {
-		return 0, makeProcessError(process, operation, "", ErrAlreadyClosed)
-	}
-
-	properties, err := process.properties()
+	code, err := process.p.ExitCode()
 	if err != nil {
-		return 0, makeProcessError(process, operation, "", err)
-	}
-
-	if properties.Exited == false {
-		return 0, makeProcessError(process, operation, "", ErrInvalidProcessState)
-	}
-
-	if properties.LastWaitResult != 0 {
-		return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult))
+		err = convertProcessError(err, process)
 	}
-
-	logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode)
-	return int(properties.ExitCode), nil
+	return code, err
 }
 
 // ResizeConsole resizes the console of the process.
 func (process *process) ResizeConsole(width, height uint16) error {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-	operation := "ResizeConsole"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	if process.handle == 0 {
-		return makeProcessError(process, operation, "", ErrAlreadyClosed)
-	}
-
-	modifyRequest := processModifyRequest{
-		Operation: modifyConsoleSize,
-		ConsoleSize: &consoleSize{
-			Height: height,
-			Width:  width,
-		},
-	}
-
-	modifyRequestb, err := json.Marshal(modifyRequest)
-	if err != nil {
-		return err
-	}
-
-	modifyRequestStr := string(modifyRequestb)
-
-	var resultp *uint16
-	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return nil
-}
-
-func (process *process) properties() (*processStatus, error) {
-	operation := "properties"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	var (
-		resultp     *uint16
-		propertiesp *uint16
-	)
-	err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return nil, err
-	}
-
-	if propertiesp == nil {
-		return nil, ErrUnexpectedValue
-	}
-	propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
-
-	properties := &processStatus{}
-	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
-		return nil, err
-	}
-
-	logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
-	return properties, nil
+	return convertProcessError(process.p.ResizeConsole(width, height), process)
 }
 
 // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
 // these pipes does not close the underlying pipes; it should be possible to
 // call this multiple times to get multiple interfaces.
 func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-	operation := "Stdio"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	if process.handle == 0 {
-		return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed)
-	}
-
-	var stdIn, stdOut, stdErr syscall.Handle
-
-	if process.cachedPipes == nil {
-		var (
-			processInfo hcsProcessInformation
-			resultp     *uint16
-		)
-		err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
-		err = processHcsResult(err, resultp)
-		if err != nil {
-			return nil, nil, nil, makeProcessError(process, operation, "", err)
-		}
-
-		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
-	} else {
-		// Use cached pipes
-		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
-
-		// Invalidate the cache
-		process.cachedPipes = nil
-	}
-
-	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	stdin, stdout, stderr, err := process.p.Stdio()
 	if err != nil {
-		return nil, nil, nil, makeProcessError(process, operation, "", err)
+		err = convertProcessError(err, process)
 	}
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return pipes[0], pipes[1], pipes[2], nil
+	return stdin, stdout, stderr, err
 }
 
 // CloseStdin closes the write side of the stdin pipe so that the process is
 // notified on the read side that there is no more data in stdin.
 func (process *process) CloseStdin() error {
-	process.handleLock.RLock()
-	defer process.handleLock.RUnlock()
-	operation := "CloseStdin"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	if process.handle == 0 {
-		return makeProcessError(process, operation, "", ErrAlreadyClosed)
-	}
-
-	modifyRequest := processModifyRequest{
-		Operation: modifyCloseHandle,
-		CloseHandle: &closeHandle{
-			Handle: stdIn,
-		},
-	}
-
-	modifyRequestb, err := json.Marshal(modifyRequest)
-	if err != nil {
-		return err
-	}
-
-	modifyRequestStr := string(modifyRequestb)
-
-	var resultp *uint16
-	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
-	err = processHcsResult(err, resultp)
-	if err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return nil
+	return convertProcessError(process.p.CloseStdin(), process)
 }
 
 // Close cleans up any state associated with the process but does not kill
 // or wait on it.
 func (process *process) Close() error {
-	process.handleLock.Lock()
-	defer process.handleLock.Unlock()
-	operation := "Close"
-	title := "HCSShim::Process::" + operation
-	logrus.Debugf(title+" processid=%d", process.processID)
-
-	// Don't double free this
-	if process.handle == 0 {
-		return nil
-	}
-
-	if err := process.unregisterCallback(); err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	if err := hcsCloseProcess(process.handle); err != nil {
-		return makeProcessError(process, operation, "", err)
-	}
-
-	process.handle = 0
-
-	logrus.Debugf(title+" succeeded processid=%d", process.processID)
-	return nil
-}
-
-func (process *process) registerCallback() error {
-	context := &notifcationWatcherContext{
-		channels: newChannels(),
-	}
-
-	callbackMapLock.Lock()
-	callbackNumber := nextCallback
-	nextCallback++
-	callbackMap[callbackNumber] = context
-	callbackMapLock.Unlock()
-
-	var callbackHandle hcsCallback
-	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
-	if err != nil {
-		return err
-	}
-	context.handle = callbackHandle
-	process.callbackNumber = callbackNumber
-
-	return nil
-}
-
-func (process *process) unregisterCallback() error {
-	callbackNumber := process.callbackNumber
-
-	callbackMapLock.RLock()
-	context := callbackMap[callbackNumber]
-	callbackMapLock.RUnlock()
-
-	if context == nil {
-		return nil
-	}
-
-	handle := context.handle
-
-	if handle == 0 {
-		return nil
-	}
-
-	// hcsUnregisterProcessCallback has its own syncronization
-	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
-	err := hcsUnregisterProcessCallback(handle)
-	if err != nil {
-		return err
-	}
-
-	closeChannels(context.channels)
-
-	callbackMapLock.Lock()
-	callbackMap[callbackNumber] = nil
-	callbackMapLock.Unlock()
-
-	handle = 0
-
-	return nil
+	return convertProcessError(process.p.Close(), process)
 }
diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go
deleted file mode 100644
index e8a3b507b..000000000
--- a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go
+++ /dev/null
@@ -1,27 +0,0 @@
-package hcsshim
-
-import "github.com/sirupsen/logrus"
-
-// UnprepareLayer disables the filesystem filter for the read-write layer with
-// the given id.
-func UnprepareLayer(info DriverInfo, layerId string) error {
-	title := "hcsshim::UnprepareLayer "
-	logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
-
-	// Convert info to API calling convention
-	infop, err := convertDriverInfo(info)
-	if err != nil {
-		logrus.Error(err)
-		return err
-	}
-
-	err = unprepareLayer(&infop, layerId)
-	if err != nil {
-		err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
-		logrus.Error(err)
-		return err
-	}
-
-	logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId)
-	return nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go
deleted file mode 100644
index ae10c23d4..000000000
--- a/vendor/github.com/Microsoft/hcsshim/version.go
+++ /dev/null
@@ -1,7 +0,0 @@
-package hcsshim
-
-// IsTP4 returns whether the currently running Windows build is at least TP4.
-func IsTP4() bool {
-	// HNSCall was not present in TP4
-	return procHNSCall.Find() != nil
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go
deleted file mode 100644
index 5d1a851ae..000000000
--- a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go
+++ /dev/null
@@ -1,1042 +0,0 @@
-// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
-
-package hcsshim
-
-import (
-	"syscall"
-	"unsafe"
-
-	"github.com/Microsoft/go-winio"
-	"golang.org/x/sys/windows"
-)
-
-var _ unsafe.Pointer
-
-// Do the interface allocations only once for common
-// Errno values.
-const (
-	errnoERROR_IO_PENDING = 997
-)
-
-var (
-	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
-)
-
-// errnoErr returns common boxed Errno values, to prevent
-// allocations at runtime.
-func errnoErr(e syscall.Errno) error {
-	switch e {
-	case 0:
-		return nil
-	case errnoERROR_IO_PENDING:
-		return errERROR_IO_PENDING
-	}
-	// TODO: add more here, after collecting data on the common
-	// error values see on Windows. (perhaps when running
-	// all.bat?)
-	return e
-}
-
-var (
-	modole32     = windows.NewLazySystemDLL("ole32.dll")
-	modiphlpapi  = windows.NewLazySystemDLL("iphlpapi.dll")
-	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
-
-	procCoTaskMemFree                      = modole32.NewProc("CoTaskMemFree")
-	procSetCurrentThreadCompartmentId      = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
-	procActivateLayer                      = modvmcompute.NewProc("ActivateLayer")
-	procCopyLayer                          = modvmcompute.NewProc("CopyLayer")
-	procCreateLayer                        = modvmcompute.NewProc("CreateLayer")
-	procCreateSandboxLayer                 = modvmcompute.NewProc("CreateSandboxLayer")
-	procExpandSandboxSize                  = modvmcompute.NewProc("ExpandSandboxSize")
-	procDeactivateLayer                    = modvmcompute.NewProc("DeactivateLayer")
-	procDestroyLayer                       = modvmcompute.NewProc("DestroyLayer")
-	procExportLayer                        = modvmcompute.NewProc("ExportLayer")
-	procGetLayerMountPath                  = modvmcompute.NewProc("GetLayerMountPath")
-	procGetBaseImages                      = modvmcompute.NewProc("GetBaseImages")
-	procImportLayer                        = modvmcompute.NewProc("ImportLayer")
-	procLayerExists                        = modvmcompute.NewProc("LayerExists")
-	procNameToGuid                         = modvmcompute.NewProc("NameToGuid")
-	procPrepareLayer                       = modvmcompute.NewProc("PrepareLayer")
-	procUnprepareLayer                     = modvmcompute.NewProc("UnprepareLayer")
-	procProcessBaseImage                   = modvmcompute.NewProc("ProcessBaseImage")
-	procProcessUtilityImage                = modvmcompute.NewProc("ProcessUtilityImage")
-	procImportLayerBegin                   = modvmcompute.NewProc("ImportLayerBegin")
-	procImportLayerNext                    = modvmcompute.NewProc("ImportLayerNext")
-	procImportLayerWrite                   = modvmcompute.NewProc("ImportLayerWrite")
-	procImportLayerEnd                     = modvmcompute.NewProc("ImportLayerEnd")
-	procExportLayerBegin                   = modvmcompute.NewProc("ExportLayerBegin")
-	procExportLayerNext                    = modvmcompute.NewProc("ExportLayerNext")
-	procExportLayerRead                    = modvmcompute.NewProc("ExportLayerRead")
-	procExportLayerEnd                     = modvmcompute.NewProc("ExportLayerEnd")
-	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
-	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
-	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
-	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
-	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
-	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
-	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
-	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
-	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
-	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
-	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
-	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
-	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
-	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
-	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
-	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
-	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
-	procHcsGetProcessInfo                  = modvmcompute.NewProc("HcsGetProcessInfo")
-	procHcsGetProcessProperties            = modvmcompute.NewProc("HcsGetProcessProperties")
-	procHcsModifyProcess                   = modvmcompute.NewProc("HcsModifyProcess")
-	procHcsGetServiceProperties            = modvmcompute.NewProc("HcsGetServiceProperties")
-	procHcsRegisterProcessCallback         = modvmcompute.NewProc("HcsRegisterProcessCallback")
-	procHcsUnregisterProcessCallback       = modvmcompute.NewProc("HcsUnregisterProcessCallback")
-	procHcsModifyServiceSettings           = modvmcompute.NewProc("HcsModifyServiceSettings")
-	procHNSCall                            = modvmcompute.NewProc("HNSCall")
-)
-
-func coTaskMemFree(buffer unsafe.Pointer) {
-	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
-	return
-}
-
-func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
-	r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func activateLayer(info *driverInfo, id string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _activateLayer(info, _p0)
-}
-
-func _activateLayer(info *driverInfo, id *uint16) (hr error) {
-	if hr = procActivateLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(srcId)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(dstId)
-	if hr != nil {
-		return
-	}
-	return _copyLayer(info, _p0, _p1, descriptors)
-}
-
-func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p2 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p2 = &descriptors[0]
-	}
-	if hr = procCopyLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func createLayer(info *driverInfo, id string, parent string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(parent)
-	if hr != nil {
-		return
-	}
-	return _createLayer(info, _p0, _p1)
-}
-
-func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) {
-	if hr = procCreateLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(parent)
-	if hr != nil {
-		return
-	}
-	return _createSandboxLayer(info, _p0, _p1, descriptors)
-}
-
-func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p2 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p2 = &descriptors[0]
-	}
-	if hr = procCreateSandboxLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _expandSandboxSize(info, _p0, size)
-}
-
-func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) {
-	if hr = procExpandSandboxSize.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func deactivateLayer(info *driverInfo, id string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _deactivateLayer(info, _p0)
-}
-
-func _deactivateLayer(info *driverInfo, id *uint16) (hr error) {
-	if hr = procDeactivateLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func destroyLayer(info *driverInfo, id string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _destroyLayer(info, _p0)
-}
-
-func _destroyLayer(info *driverInfo, id *uint16) (hr error) {
-	if hr = procDestroyLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(path)
-	if hr != nil {
-		return
-	}
-	return _exportLayer(info, _p0, _p1, descriptors)
-}
-
-func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p2 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p2 = &descriptors[0]
-	}
-	if hr = procExportLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _getLayerMountPath(info, _p0, length, buffer)
-}
-
-func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) {
-	if hr = procGetLayerMountPath.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func getBaseImages(buffer **uint16) (hr error) {
-	if hr = procGetBaseImages.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(path)
-	if hr != nil {
-		return
-	}
-	return _importLayer(info, _p0, _p1, descriptors)
-}
-
-func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p2 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p2 = &descriptors[0]
-	}
-	if hr = procImportLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func layerExists(info *driverInfo, id string, exists *uint32) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _layerExists(info, _p0, exists)
-}
-
-func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) {
-	if hr = procLayerExists.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func nameToGuid(name string, guid *GUID) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(name)
-	if hr != nil {
-		return
-	}
-	return _nameToGuid(_p0, guid)
-}
-
-func _nameToGuid(name *uint16, guid *GUID) (hr error) {
-	if hr = procNameToGuid.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _prepareLayer(info, _p0, descriptors)
-}
-
-func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
-	var _p1 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p1 = &descriptors[0]
-	}
-	if hr = procPrepareLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func unprepareLayer(info *driverInfo, id string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _unprepareLayer(info, _p0)
-}
-
-func _unprepareLayer(info *driverInfo, id *uint16) (hr error) {
-	if hr = procUnprepareLayer.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func processBaseImage(path string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(path)
-	if hr != nil {
-		return
-	}
-	return _processBaseImage(_p0)
-}
-
-func _processBaseImage(path *uint16) (hr error) {
-	if hr = procProcessBaseImage.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func processUtilityImage(path string) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(path)
-	if hr != nil {
-		return
-	}
-	return _processUtilityImage(_p0)
-}
-
-func _processUtilityImage(path *uint16) (hr error) {
-	if hr = procProcessUtilityImage.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _importLayerBegin(info, _p0, descriptors, context)
-}
-
-func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
-	var _p1 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p1 = &descriptors[0]
-	}
-	if hr = procImportLayerBegin.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(fileName)
-	if hr != nil {
-		return
-	}
-	return _importLayerNext(context, _p0, fileInfo)
-}
-
-func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) {
-	if hr = procImportLayerNext.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func importLayerWrite(context uintptr, buffer []byte) (hr error) {
-	var _p0 *byte
-	if len(buffer) > 0 {
-		_p0 = &buffer[0]
-	}
-	if hr = procImportLayerWrite.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func importLayerEnd(context uintptr) (hr error) {
-	if hr = procImportLayerEnd.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _exportLayerBegin(info, _p0, descriptors, context)
-}
-
-func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
-	var _p1 *WC_LAYER_DESCRIPTOR
-	if len(descriptors) > 0 {
-		_p1 = &descriptors[0]
-	}
-	if hr = procExportLayerBegin.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) {
-	if hr = procExportLayerNext.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) {
-	var _p0 *byte
-	if len(buffer) > 0 {
-		_p0 = &buffer[0]
-	}
-	if hr = procExportLayerRead.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func exportLayerEnd(context uintptr) (hr error) {
-	if hr = procExportLayerEnd.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(query)
-	if hr != nil {
-		return
-	}
-	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
-}
-
-func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
-	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(configuration)
-	if hr != nil {
-		return
-	}
-	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
-}
-
-func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
-	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(id)
-	if hr != nil {
-		return
-	}
-	return _hcsOpenComputeSystem(_p0, computeSystem, result)
-}
-
-func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
-	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
-	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(options)
-	if hr != nil {
-		return
-	}
-	return _hcsStartComputeSystem(computeSystem, _p0, result)
-}
-
-func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsStartComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(options)
-	if hr != nil {
-		return
-	}
-	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
-}
-
-func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(options)
-	if hr != nil {
-		return
-	}
-	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
-}
-
-func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(options)
-	if hr != nil {
-		return
-	}
-	return _hcsPauseComputeSystem(computeSystem, _p0, result)
-}
-
-func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(options)
-	if hr != nil {
-		return
-	}
-	return _hcsResumeComputeSystem(computeSystem, _p0, result)
-}
-
-func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
-	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
-	if hr != nil {
-		return
-	}
-	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
-}
-
-func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
-	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(configuration)
-	if hr != nil {
-		return
-	}
-	return _hcsModifyComputeSystem(computeSystem, _p0, result)
-}
-
-func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
-	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
-	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
-	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(processParameters)
-	if hr != nil {
-		return
-	}
-	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
-}
-
-func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
-	if hr = procHcsCreateProcess.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
-	if hr = procHcsOpenProcess.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsCloseProcess(process hcsProcess) (hr error) {
-	if hr = procHcsCloseProcess.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
-	if hr = procHcsTerminateProcess.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
-	if hr = procHcsGetProcessInfo.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
-	if hr = procHcsGetProcessProperties.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(settings)
-	if hr != nil {
-		return
-	}
-	return _hcsModifyProcess(process, _p0, result)
-}
-
-func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
-	if hr = procHcsModifyProcess.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
-	if hr != nil {
-		return
-	}
-	return _hcsGetServiceProperties(_p0, properties, result)
-}
-
-func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
-	if hr = procHcsGetServiceProperties.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
-	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
-	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func hcsModifyServiceSettings(settings string, result **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(settings)
-	if hr != nil {
-		return
-	}
-	return _hcsModifyServiceSettings(_p0, result)
-}
-
-func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) {
-	if hr = procHcsModifyServiceSettings.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
-
-func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
-	var _p0 *uint16
-	_p0, hr = syscall.UTF16PtrFromString(method)
-	if hr != nil {
-		return
-	}
-	var _p1 *uint16
-	_p1, hr = syscall.UTF16PtrFromString(path)
-	if hr != nil {
-		return
-	}
-	var _p2 *uint16
-	_p2, hr = syscall.UTF16PtrFromString(object)
-	if hr != nil {
-		return
-	}
-	return __hnsCall(_p0, _p1, _p2, response)
-}
-
-func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
-	if hr = procHNSCall.Find(); hr != nil {
-		return
-	}
-	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
-	if int32(r0) < 0 {
-		hr = syscall.Errno(win32FromHresult(r0))
-	}
-	return
-}
diff --git a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go
new file mode 100644
index 000000000..d2dff9cb0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go
@@ -0,0 +1,52 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hcsshim
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll")
+
+	procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
+)
+
+func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
+	r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}