diff options
author | Daniel J Walsh <dwalsh@redhat.com> | 2018-03-26 18:26:55 -0400 |
---|---|---|
committer | Atomic Bot <atomic-devel@projectatomic.io> | 2018-03-27 18:09:12 +0000 |
commit | af64e10400f8533a0c48ecdf5ab9b7fbf329e14e (patch) | |
tree | 59160e3841b440dd35189c724bbb4375a7be173b /vendor/k8s.io/kubernetes/pkg/apis/core | |
parent | 26d7e3c7b85e28c4e42998c90fdcc14079f13eef (diff) | |
download | podman-af64e10400f8533a0c48ecdf5ab9b7fbf329e14e.tar.gz podman-af64e10400f8533a0c48ecdf5ab9b7fbf329e14e.tar.bz2 podman-af64e10400f8533a0c48ecdf5ab9b7fbf329e14e.zip |
Vendor in lots of kubernetes stuff to shrink image size
Signed-off-by: Daniel J Walsh <dwalsh@redhat.com>
Closes: #554
Approved by: mheon
Diffstat (limited to 'vendor/k8s.io/kubernetes/pkg/apis/core')
24 files changed, 24867 insertions, 0 deletions
diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/annotation_key_constants.go b/vendor/k8s.io/kubernetes/pkg/apis/core/annotation_key_constants.go new file mode 100644 index 000000000..131fdd990 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/annotation_key_constants.go @@ -0,0 +1,92 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// This file should be consistent with pkg/api/v1/annotation_key_constants.go. + +package core + +const ( + // ImagePolicyFailedOpenKey is added to pods created by failing open when the image policy + // webhook backend fails. + ImagePolicyFailedOpenKey string = "alpha.image-policy.k8s.io/failed-open" + + // PodPresetOptOutAnnotationKey represents the annotation key for a pod to exempt itself from pod preset manipulation + PodPresetOptOutAnnotationKey string = "podpreset.admission.kubernetes.io/exclude" + + // MirrorAnnotationKey represents the annotation key set by kubelets when creating mirror pods + MirrorPodAnnotationKey string = "kubernetes.io/config.mirror" + + // TolerationsAnnotationKey represents the key of tolerations data (json serialized) + // in the Annotations of a Pod. + TolerationsAnnotationKey string = "scheduler.alpha.kubernetes.io/tolerations" + + // TaintsAnnotationKey represents the key of taints data (json serialized) + // in the Annotations of a Node. + TaintsAnnotationKey string = "scheduler.alpha.kubernetes.io/taints" + + // SeccompPodAnnotationKey represents the key of a seccomp profile applied + // to all containers of a pod. + SeccompPodAnnotationKey string = "seccomp.security.alpha.kubernetes.io/pod" + + // SeccompContainerAnnotationKeyPrefix represents the key of a seccomp profile applied + // to one container of a pod. + SeccompContainerAnnotationKeyPrefix string = "container.seccomp.security.alpha.kubernetes.io/" + + // PreferAvoidPodsAnnotationKey represents the key of preferAvoidPods data (json serialized) + // in the Annotations of a Node. + PreferAvoidPodsAnnotationKey string = "scheduler.alpha.kubernetes.io/preferAvoidPods" + + // SysctlsPodAnnotationKey represents the key of sysctls which are set for the infrastructure + // container of a pod. The annotation value is a comma separated list of sysctl_name=value + // key-value pairs. Only a limited set of whitelisted and isolated sysctls is supported by + // the kubelet. Pods with other sysctls will fail to launch. + SysctlsPodAnnotationKey string = "security.alpha.kubernetes.io/sysctls" + + // UnsafeSysctlsPodAnnotationKey represents the key of sysctls which are set for the infrastructure + // container of a pod. The annotation value is a comma separated list of sysctl_name=value + // key-value pairs. Unsafe sysctls must be explicitly enabled for a kubelet. They are properly + // namespaced to a pod or a container, but their isolation is usually unclear or weak. Their use + // is at-your-own-risk. Pods that attempt to set an unsafe sysctl that is not enabled for a kubelet + // will fail to launch. + UnsafeSysctlsPodAnnotationKey string = "security.alpha.kubernetes.io/unsafe-sysctls" + + // ObjectTTLAnnotations represents a suggestion for kubelet for how long it can cache + // an object (e.g. secret, config map) before fetching it again from apiserver. + // This annotation can be attached to node. + ObjectTTLAnnotationKey string = "node.alpha.kubernetes.io/ttl" + + // BootstrapCheckpointAnnotationKey represents a Resource (Pod) that should be checkpointed by + // the kubelet prior to running + BootstrapCheckpointAnnotationKey string = "node.kubernetes.io/bootstrap-checkpoint" + + // annotation key prefix used to identify non-convertible json paths. + NonConvertibleAnnotationPrefix = "non-convertible.kubernetes.io" + + kubectlPrefix = "kubectl.kubernetes.io/" + + // LastAppliedConfigAnnotation is the annotation used to store the previous + // configuration of a resource for use in a three way diff by UpdateApplyAnnotation. + LastAppliedConfigAnnotation = kubectlPrefix + "last-applied-configuration" + + // AnnotationLoadBalancerSourceRangesKey is the key of the annotation on a service to set allowed ingress ranges on their LoadBalancers + // + // It should be a comma-separated list of CIDRs, e.g. `0.0.0.0/0` to + // allow full access (the default) or `18.0.0.0/8,56.0.0.0/8` to allow + // access only from the CIDRs currently allocated to MIT & the USPS. + // + // Not all cloud providers support this annotation, though AWS & GCE do. + AnnotationLoadBalancerSourceRangesKey = "service.beta.kubernetes.io/load-balancer-source-ranges" +) diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/doc.go b/vendor/k8s.io/kubernetes/pkg/apis/core/doc.go new file mode 100644 index 000000000..6017bfdab --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/doc.go @@ -0,0 +1,24 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// +k8s:deepcopy-gen=package + +// Package api contains the latest (or "internal") version of the +// Kubernetes API objects. This is the API objects as represented in memory. +// The contract presented to clients is located in the versioned packages, +// which are sub-directories. The first one is "v1". Those packages +// describe how a particular version is serialized to storage/network. +package core // import "k8s.io/kubernetes/pkg/apis/core" diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/field_constants.go b/vendor/k8s.io/kubernetes/pkg/apis/core/field_constants.go new file mode 100644 index 000000000..a26f80568 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/field_constants.go @@ -0,0 +1,38 @@ +/* +Copyright 2016 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package core + +// Field path constants that are specific to the internal API +// representation. +const ( + NodeUnschedulableField = "spec.unschedulable" + ObjectNameField = "metadata.name" + PodHostField = "spec.nodeName" + PodStatusField = "status.phase" + SecretTypeField = "type" + + EventReasonField = "action" + EventSourceField = "reportingComponent" + EventTypeField = "type" + EventInvolvedKindField = "involvedObject.kind" + EventInvolvedNamespaceField = "involvedObject.namespace" + EventInvolvedNameField = "involvedObject.name" + EventInvolvedUIDField = "involvedObject.uid" + EventInvolvedAPIVersionField = "involvedObject.apiVersion" + EventInvolvedResourceVersionField = "involvedObject.resourceVersion" + EventInvolvedFieldPathField = "involvedObject.fieldPath" +) diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/helper/helpers.go b/vendor/k8s.io/kubernetes/pkg/apis/core/helper/helpers.go new file mode 100644 index 000000000..96899f184 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/helper/helpers.go @@ -0,0 +1,597 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package helper + +import ( + "encoding/json" + "fmt" + "strings" + + "k8s.io/apimachinery/pkg/api/resource" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + "k8s.io/apimachinery/pkg/conversion" + "k8s.io/apimachinery/pkg/fields" + "k8s.io/apimachinery/pkg/labels" + "k8s.io/apimachinery/pkg/selection" + "k8s.io/apimachinery/pkg/util/sets" + "k8s.io/apimachinery/pkg/util/validation" + "k8s.io/kubernetes/pkg/apis/core" +) + +// IsHugePageResourceName returns true if the resource name has the huge page +// resource prefix. +func IsHugePageResourceName(name core.ResourceName) bool { + return strings.HasPrefix(string(name), core.ResourceHugePagesPrefix) +} + +// IsQuotaHugePageResourceName returns true if the resource name has the quota +// related huge page resource prefix. +func IsQuotaHugePageResourceName(name core.ResourceName) bool { + return strings.HasPrefix(string(name), core.ResourceHugePagesPrefix) || strings.HasPrefix(string(name), core.ResourceRequestsHugePagesPrefix) +} + +// HugePageResourceName returns a ResourceName with the canonical hugepage +// prefix prepended for the specified page size. The page size is converted +// to its canonical representation. +func HugePageResourceName(pageSize resource.Quantity) core.ResourceName { + return core.ResourceName(fmt.Sprintf("%s%s", core.ResourceHugePagesPrefix, pageSize.String())) +} + +// HugePageSizeFromResourceName returns the page size for the specified huge page +// resource name. If the specified input is not a valid huge page resource name +// an error is returned. +func HugePageSizeFromResourceName(name core.ResourceName) (resource.Quantity, error) { + if !IsHugePageResourceName(name) { + return resource.Quantity{}, fmt.Errorf("resource name: %s is not valid hugepage name", name) + } + pageSize := strings.TrimPrefix(string(name), core.ResourceHugePagesPrefix) + return resource.ParseQuantity(pageSize) +} + +// NonConvertibleFields iterates over the provided map and filters out all but +// any keys with the "non-convertible.kubernetes.io" prefix. +func NonConvertibleFields(annotations map[string]string) map[string]string { + nonConvertibleKeys := map[string]string{} + for key, value := range annotations { + if strings.HasPrefix(key, core.NonConvertibleAnnotationPrefix) { + nonConvertibleKeys[key] = value + } + } + return nonConvertibleKeys +} + +// Semantic can do semantic deep equality checks for core objects. +// Example: apiequality.Semantic.DeepEqual(aPod, aPodWithNonNilButEmptyMaps) == true +var Semantic = conversion.EqualitiesOrDie( + func(a, b resource.Quantity) bool { + // Ignore formatting, only care that numeric value stayed the same. + // TODO: if we decide it's important, it should be safe to start comparing the format. + // + // Uninitialized quantities are equivalent to 0 quantities. + return a.Cmp(b) == 0 + }, + func(a, b metav1.MicroTime) bool { + return a.UTC() == b.UTC() + }, + func(a, b metav1.Time) bool { + return a.UTC() == b.UTC() + }, + func(a, b labels.Selector) bool { + return a.String() == b.String() + }, + func(a, b fields.Selector) bool { + return a.String() == b.String() + }, +) + +var standardResourceQuotaScopes = sets.NewString( + string(core.ResourceQuotaScopeTerminating), + string(core.ResourceQuotaScopeNotTerminating), + string(core.ResourceQuotaScopeBestEffort), + string(core.ResourceQuotaScopeNotBestEffort), +) + +// IsStandardResourceQuotaScope returns true if the scope is a standard value +func IsStandardResourceQuotaScope(str string) bool { + return standardResourceQuotaScopes.Has(str) +} + +var podObjectCountQuotaResources = sets.NewString( + string(core.ResourcePods), +) + +var podComputeQuotaResources = sets.NewString( + string(core.ResourceCPU), + string(core.ResourceMemory), + string(core.ResourceLimitsCPU), + string(core.ResourceLimitsMemory), + string(core.ResourceRequestsCPU), + string(core.ResourceRequestsMemory), +) + +// IsResourceQuotaScopeValidForResource returns true if the resource applies to the specified scope +func IsResourceQuotaScopeValidForResource(scope core.ResourceQuotaScope, resource string) bool { + switch scope { + case core.ResourceQuotaScopeTerminating, core.ResourceQuotaScopeNotTerminating, core.ResourceQuotaScopeNotBestEffort: + return podObjectCountQuotaResources.Has(resource) || podComputeQuotaResources.Has(resource) + case core.ResourceQuotaScopeBestEffort: + return podObjectCountQuotaResources.Has(resource) + default: + return true + } +} + +var standardContainerResources = sets.NewString( + string(core.ResourceCPU), + string(core.ResourceMemory), + string(core.ResourceEphemeralStorage), +) + +// IsStandardContainerResourceName returns true if the container can make a resource request +// for the specified resource +func IsStandardContainerResourceName(str string) bool { + return standardContainerResources.Has(str) || IsHugePageResourceName(core.ResourceName(str)) +} + +// IsExtendedResourceName returns true if: +// 1. the resource name is not in the default namespace; +// 2. resource name does not have "requests." prefix, +// to avoid confusion with the convention in quota +// 3. it satisfies the rules in IsQualifiedName() after converted into quota resource name +func IsExtendedResourceName(name core.ResourceName) bool { + if IsDefaultNamespaceResource(name) || strings.HasPrefix(string(name), core.DefaultResourceRequestsPrefix) { + return false + } + // Ensure it satisfies the rules in IsQualifiedName() after converted into quota resource name + nameForQuota := fmt.Sprintf("%s%s", core.DefaultResourceRequestsPrefix, string(name)) + if errs := validation.IsQualifiedName(string(nameForQuota)); len(errs) != 0 { + return false + } + return true +} + +// IsDefaultNamespaceResource returns true if the resource name is in the +// *kubernetes.io/ namespace. Partially-qualified (unprefixed) names are +// implicitly in the kubernetes.io/ namespace. +func IsDefaultNamespaceResource(name core.ResourceName) bool { + return !strings.Contains(string(name), "/") || + strings.Contains(string(name), core.ResourceDefaultNamespacePrefix) +} + +var overcommitBlacklist = sets.NewString(string(core.ResourceNvidiaGPU)) + +// IsOvercommitAllowed returns true if the resource is in the default +// namespace and not blacklisted. +func IsOvercommitAllowed(name core.ResourceName) bool { + return IsDefaultNamespaceResource(name) && + !IsHugePageResourceName(name) && + !overcommitBlacklist.Has(string(name)) +} + +var standardLimitRangeTypes = sets.NewString( + string(core.LimitTypePod), + string(core.LimitTypeContainer), + string(core.LimitTypePersistentVolumeClaim), +) + +// IsStandardLimitRangeType returns true if the type is Pod or Container +func IsStandardLimitRangeType(str string) bool { + return standardLimitRangeTypes.Has(str) +} + +var standardQuotaResources = sets.NewString( + string(core.ResourceCPU), + string(core.ResourceMemory), + string(core.ResourceEphemeralStorage), + string(core.ResourceRequestsCPU), + string(core.ResourceRequestsMemory), + string(core.ResourceRequestsStorage), + string(core.ResourceRequestsEphemeralStorage), + string(core.ResourceLimitsCPU), + string(core.ResourceLimitsMemory), + string(core.ResourceLimitsEphemeralStorage), + string(core.ResourcePods), + string(core.ResourceQuotas), + string(core.ResourceServices), + string(core.ResourceReplicationControllers), + string(core.ResourceSecrets), + string(core.ResourcePersistentVolumeClaims), + string(core.ResourceConfigMaps), + string(core.ResourceServicesNodePorts), + string(core.ResourceServicesLoadBalancers), +) + +// IsStandardQuotaResourceName returns true if the resource is known to +// the quota tracking system +func IsStandardQuotaResourceName(str string) bool { + return standardQuotaResources.Has(str) || IsQuotaHugePageResourceName(core.ResourceName(str)) +} + +var standardResources = sets.NewString( + string(core.ResourceCPU), + string(core.ResourceMemory), + string(core.ResourceEphemeralStorage), + string(core.ResourceRequestsCPU), + string(core.ResourceRequestsMemory), + string(core.ResourceRequestsEphemeralStorage), + string(core.ResourceLimitsCPU), + string(core.ResourceLimitsMemory), + string(core.ResourceLimitsEphemeralStorage), + string(core.ResourcePods), + string(core.ResourceQuotas), + string(core.ResourceServices), + string(core.ResourceReplicationControllers), + string(core.ResourceSecrets), + string(core.ResourceConfigMaps), + string(core.ResourcePersistentVolumeClaims), + string(core.ResourceStorage), + string(core.ResourceRequestsStorage), + string(core.ResourceServicesNodePorts), + string(core.ResourceServicesLoadBalancers), +) + +// IsStandardResourceName returns true if the resource is known to the system +func IsStandardResourceName(str string) bool { + return standardResources.Has(str) || IsQuotaHugePageResourceName(core.ResourceName(str)) +} + +var integerResources = sets.NewString( + string(core.ResourcePods), + string(core.ResourceQuotas), + string(core.ResourceServices), + string(core.ResourceReplicationControllers), + string(core.ResourceSecrets), + string(core.ResourceConfigMaps), + string(core.ResourcePersistentVolumeClaims), + string(core.ResourceServicesNodePorts), + string(core.ResourceServicesLoadBalancers), +) + +// IsIntegerResourceName returns true if the resource is measured in integer values +func IsIntegerResourceName(str string) bool { + return integerResources.Has(str) || IsExtendedResourceName(core.ResourceName(str)) +} + +// this function aims to check if the service's ClusterIP is set or not +// the objective is not to perform validation here +func IsServiceIPSet(service *core.Service) bool { + return service.Spec.ClusterIP != core.ClusterIPNone && service.Spec.ClusterIP != "" +} + +var standardFinalizers = sets.NewString( + string(core.FinalizerKubernetes), + metav1.FinalizerOrphanDependents, + metav1.FinalizerDeleteDependents, +) + +func IsStandardFinalizerName(str string) bool { + return standardFinalizers.Has(str) +} + +// AddToNodeAddresses appends the NodeAddresses to the passed-by-pointer slice, +// only if they do not already exist +func AddToNodeAddresses(addresses *[]core.NodeAddress, addAddresses ...core.NodeAddress) { + for _, add := range addAddresses { + exists := false + for _, existing := range *addresses { + if existing.Address == add.Address && existing.Type == add.Type { + exists = true + break + } + } + if !exists { + *addresses = append(*addresses, add) + } + } +} + +// TODO: make method on LoadBalancerStatus? +func LoadBalancerStatusEqual(l, r *core.LoadBalancerStatus) bool { + return ingressSliceEqual(l.Ingress, r.Ingress) +} + +func ingressSliceEqual(lhs, rhs []core.LoadBalancerIngress) bool { + if len(lhs) != len(rhs) { + return false + } + for i := range lhs { + if !ingressEqual(&lhs[i], &rhs[i]) { + return false + } + } + return true +} + +func ingressEqual(lhs, rhs *core.LoadBalancerIngress) bool { + if lhs.IP != rhs.IP { + return false + } + if lhs.Hostname != rhs.Hostname { + return false + } + return true +} + +// TODO: make method on LoadBalancerStatus? +func LoadBalancerStatusDeepCopy(lb *core.LoadBalancerStatus) *core.LoadBalancerStatus { + c := &core.LoadBalancerStatus{} + c.Ingress = make([]core.LoadBalancerIngress, len(lb.Ingress)) + for i := range lb.Ingress { + c.Ingress[i] = lb.Ingress[i] + } + return c +} + +// GetAccessModesAsString returns a string representation of an array of access modes. +// modes, when present, are always in the same order: RWO,ROX,RWX. +func GetAccessModesAsString(modes []core.PersistentVolumeAccessMode) string { + modes = removeDuplicateAccessModes(modes) + modesStr := []string{} + if containsAccessMode(modes, core.ReadWriteOnce) { + modesStr = append(modesStr, "RWO") + } + if containsAccessMode(modes, core.ReadOnlyMany) { + modesStr = append(modesStr, "ROX") + } + if containsAccessMode(modes, core.ReadWriteMany) { + modesStr = append(modesStr, "RWX") + } + return strings.Join(modesStr, ",") +} + +// GetAccessModesAsString returns an array of AccessModes from a string created by GetAccessModesAsString +func GetAccessModesFromString(modes string) []core.PersistentVolumeAccessMode { + strmodes := strings.Split(modes, ",") + accessModes := []core.PersistentVolumeAccessMode{} + for _, s := range strmodes { + s = strings.Trim(s, " ") + switch { + case s == "RWO": + accessModes = append(accessModes, core.ReadWriteOnce) + case s == "ROX": + accessModes = append(accessModes, core.ReadOnlyMany) + case s == "RWX": + accessModes = append(accessModes, core.ReadWriteMany) + } + } + return accessModes +} + +// removeDuplicateAccessModes returns an array of access modes without any duplicates +func removeDuplicateAccessModes(modes []core.PersistentVolumeAccessMode) []core.PersistentVolumeAccessMode { + accessModes := []core.PersistentVolumeAccessMode{} + for _, m := range modes { + if !containsAccessMode(accessModes, m) { + accessModes = append(accessModes, m) + } + } + return accessModes +} + +func containsAccessMode(modes []core.PersistentVolumeAccessMode, mode core.PersistentVolumeAccessMode) bool { + for _, m := range modes { + if m == mode { + return true + } + } + return false +} + +// NodeSelectorRequirementsAsSelector converts the []NodeSelectorRequirement core type into a struct that implements +// labels.Selector. +func NodeSelectorRequirementsAsSelector(nsm []core.NodeSelectorRequirement) (labels.Selector, error) { + if len(nsm) == 0 { + return labels.Nothing(), nil + } + selector := labels.NewSelector() + for _, expr := range nsm { + var op selection.Operator + switch expr.Operator { + case core.NodeSelectorOpIn: + op = selection.In + case core.NodeSelectorOpNotIn: + op = selection.NotIn + case core.NodeSelectorOpExists: + op = selection.Exists + case core.NodeSelectorOpDoesNotExist: + op = selection.DoesNotExist + case core.NodeSelectorOpGt: + op = selection.GreaterThan + case core.NodeSelectorOpLt: + op = selection.LessThan + default: + return nil, fmt.Errorf("%q is not a valid node selector operator", expr.Operator) + } + r, err := labels.NewRequirement(expr.Key, op, expr.Values) + if err != nil { + return nil, err + } + selector = selector.Add(*r) + } + return selector, nil +} + +// GetTolerationsFromPodAnnotations gets the json serialized tolerations data from Pod.Annotations +// and converts it to the []Toleration type in core. +func GetTolerationsFromPodAnnotations(annotations map[string]string) ([]core.Toleration, error) { + var tolerations []core.Toleration + if len(annotations) > 0 && annotations[core.TolerationsAnnotationKey] != "" { + err := json.Unmarshal([]byte(annotations[core.TolerationsAnnotationKey]), &tolerations) + if err != nil { + return tolerations, err + } + } + return tolerations, nil +} + +// AddOrUpdateTolerationInPod tries to add a toleration to the pod's toleration list. +// Returns true if something was updated, false otherwise. +func AddOrUpdateTolerationInPod(pod *core.Pod, toleration *core.Toleration) bool { + podTolerations := pod.Spec.Tolerations + + var newTolerations []core.Toleration + updated := false + for i := range podTolerations { + if toleration.MatchToleration(&podTolerations[i]) { + if Semantic.DeepEqual(toleration, podTolerations[i]) { + return false + } + newTolerations = append(newTolerations, *toleration) + updated = true + continue + } + + newTolerations = append(newTolerations, podTolerations[i]) + } + + if !updated { + newTolerations = append(newTolerations, *toleration) + } + + pod.Spec.Tolerations = newTolerations + return true +} + +// GetTaintsFromNodeAnnotations gets the json serialized taints data from Pod.Annotations +// and converts it to the []Taint type in core. +func GetTaintsFromNodeAnnotations(annotations map[string]string) ([]core.Taint, error) { + var taints []core.Taint + if len(annotations) > 0 && annotations[core.TaintsAnnotationKey] != "" { + err := json.Unmarshal([]byte(annotations[core.TaintsAnnotationKey]), &taints) + if err != nil { + return []core.Taint{}, err + } + } + return taints, nil +} + +// SysctlsFromPodAnnotations parses the sysctl annotations into a slice of safe Sysctls +// and a slice of unsafe Sysctls. This is only a convenience wrapper around +// SysctlsFromPodAnnotation. +func SysctlsFromPodAnnotations(a map[string]string) ([]core.Sysctl, []core.Sysctl, error) { + safe, err := SysctlsFromPodAnnotation(a[core.SysctlsPodAnnotationKey]) + if err != nil { + return nil, nil, err + } + unsafe, err := SysctlsFromPodAnnotation(a[core.UnsafeSysctlsPodAnnotationKey]) + if err != nil { + return nil, nil, err + } + + return safe, unsafe, nil +} + +// SysctlsFromPodAnnotation parses an annotation value into a slice of Sysctls. +func SysctlsFromPodAnnotation(annotation string) ([]core.Sysctl, error) { + if len(annotation) == 0 { + return nil, nil + } + + kvs := strings.Split(annotation, ",") + sysctls := make([]core.Sysctl, len(kvs)) + for i, kv := range kvs { + cs := strings.Split(kv, "=") + if len(cs) != 2 || len(cs[0]) == 0 { + return nil, fmt.Errorf("sysctl %q not of the format sysctl_name=value", kv) + } + sysctls[i].Name = cs[0] + sysctls[i].Value = cs[1] + } + return sysctls, nil +} + +// PodAnnotationsFromSysctls creates an annotation value for a slice of Sysctls. +func PodAnnotationsFromSysctls(sysctls []core.Sysctl) string { + if len(sysctls) == 0 { + return "" + } + + kvs := make([]string, len(sysctls)) + for i := range sysctls { + kvs[i] = fmt.Sprintf("%s=%s", sysctls[i].Name, sysctls[i].Value) + } + return strings.Join(kvs, ",") +} + +// GetPersistentVolumeClass returns StorageClassName. +func GetPersistentVolumeClass(volume *core.PersistentVolume) string { + // Use beta annotation first + if class, found := volume.Annotations[core.BetaStorageClassAnnotation]; found { + return class + } + + return volume.Spec.StorageClassName +} + +// GetPersistentVolumeClaimClass returns StorageClassName. If no storage class was +// requested, it returns "". +func GetPersistentVolumeClaimClass(claim *core.PersistentVolumeClaim) string { + // Use beta annotation first + if class, found := claim.Annotations[core.BetaStorageClassAnnotation]; found { + return class + } + + if claim.Spec.StorageClassName != nil { + return *claim.Spec.StorageClassName + } + + return "" +} + +// PersistentVolumeClaimHasClass returns true if given claim has set StorageClassName field. +func PersistentVolumeClaimHasClass(claim *core.PersistentVolumeClaim) bool { + // Use beta annotation first + if _, found := claim.Annotations[core.BetaStorageClassAnnotation]; found { + return true + } + + if claim.Spec.StorageClassName != nil { + return true + } + + return false +} + +// GetStorageNodeAffinityFromAnnotation gets the json serialized data from PersistentVolume.Annotations +// and converts it to the NodeAffinity type in core. +// TODO: update when storage node affinity graduates to beta +func GetStorageNodeAffinityFromAnnotation(annotations map[string]string) (*core.NodeAffinity, error) { + if len(annotations) > 0 && annotations[core.AlphaStorageNodeAffinityAnnotation] != "" { + var affinity core.NodeAffinity + err := json.Unmarshal([]byte(annotations[core.AlphaStorageNodeAffinityAnnotation]), &affinity) + if err != nil { + return nil, err + } + return &affinity, nil + } + return nil, nil +} + +// Converts NodeAffinity type to Alpha annotation for use in PersistentVolumes +// TODO: update when storage node affinity graduates to beta +func StorageNodeAffinityToAlphaAnnotation(annotations map[string]string, affinity *core.NodeAffinity) error { + if affinity == nil { + return nil + } + + json, err := json.Marshal(*affinity) + if err != nil { + return err + } + annotations[core.AlphaStorageNodeAffinityAnnotation] = string(json) + return nil +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/install/install.go b/vendor/k8s.io/kubernetes/pkg/apis/core/install/install.go new file mode 100644 index 000000000..cae514ec7 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/install/install.go @@ -0,0 +1,67 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Package install installs the v1 monolithic api, making it available as an +// option to all of the API encoding/decoding machinery. +package install + +import ( + "k8s.io/apimachinery/pkg/apimachinery/announced" + "k8s.io/apimachinery/pkg/apimachinery/registered" + "k8s.io/apimachinery/pkg/runtime" + "k8s.io/apimachinery/pkg/util/sets" + "k8s.io/kubernetes/pkg/api/legacyscheme" + "k8s.io/kubernetes/pkg/apis/core" + "k8s.io/kubernetes/pkg/apis/core/v1" +) + +func init() { + Install(legacyscheme.GroupFactoryRegistry, legacyscheme.Registry, legacyscheme.Scheme) +} + +// Install registers the API group and adds types to a scheme +func Install(groupFactoryRegistry announced.APIGroupFactoryRegistry, registry *registered.APIRegistrationManager, scheme *runtime.Scheme) { + if err := announced.NewGroupMetaFactory( + &announced.GroupMetaFactoryArgs{ + GroupName: core.GroupName, + VersionPreferenceOrder: []string{v1.SchemeGroupVersion.Version}, + AddInternalObjectsToScheme: core.AddToScheme, + RootScopedKinds: sets.NewString( + "Node", + "Namespace", + "PersistentVolume", + "ComponentStatus", + ), + IgnoredKinds: sets.NewString( + "ListOptions", + "DeleteOptions", + "Status", + "PodLogOptions", + "PodExecOptions", + "PodAttachOptions", + "PodPortForwardOptions", + "PodProxyOptions", + "NodeProxyOptions", + "ServiceProxyOptions", + ), + }, + announced.VersionToSchemeFunc{ + v1.SchemeGroupVersion.Version: v1.AddToScheme, + }, + ).Announce(groupFactoryRegistry).RegisterAndEnable(registry, scheme); err != nil { + panic(err) + } +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/json.go b/vendor/k8s.io/kubernetes/pkg/apis/core/json.go new file mode 100644 index 000000000..937cd056c --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/json.go @@ -0,0 +1,28 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package core + +import "encoding/json" + +// This file implements json marshaling/unmarshaling interfaces on objects that are currently marshaled into annotations +// to prevent anyone from marshaling these internal structs. + +var _ = json.Marshaler(&AvoidPods{}) +var _ = json.Unmarshaler(&AvoidPods{}) + +func (AvoidPods) MarshalJSON() ([]byte, error) { panic("do not marshal internal struct") } +func (*AvoidPods) UnmarshalJSON([]byte) error { panic("do not unmarshal to internal struct") } diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/objectreference.go b/vendor/k8s.io/kubernetes/pkg/apis/core/objectreference.go new file mode 100644 index 000000000..55b27f30b --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/objectreference.go @@ -0,0 +1,34 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +//TODO: consider making these methods functions, because we don't want helper +//functions in the k8s.io/api repo. + +package core + +import ( + "k8s.io/apimachinery/pkg/runtime/schema" +) + +func (obj *ObjectReference) SetGroupVersionKind(gvk schema.GroupVersionKind) { + obj.APIVersion, obj.Kind = gvk.ToAPIVersionAndKind() +} + +func (obj *ObjectReference) GroupVersionKind() schema.GroupVersionKind { + return schema.FromAPIVersionAndKind(obj.APIVersion, obj.Kind) +} + +func (obj *ObjectReference) GetObjectKind() schema.ObjectKind { return obj } diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/pods/helpers.go b/vendor/k8s.io/kubernetes/pkg/apis/core/pods/helpers.go new file mode 100644 index 000000000..cf199cee7 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/pods/helpers.go @@ -0,0 +1,63 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package pods + +import ( + "fmt" + + "k8s.io/kubernetes/pkg/fieldpath" +) + +// ConvertDownwardAPIFieldLabel converts the specified downward API field label +// and its value in the pod of the specified version to the internal version, +// and returns the converted label and value. This function returns an error if +// the conversion fails. +func ConvertDownwardAPIFieldLabel(version, label, value string) (string, string, error) { + if version != "v1" { + return "", "", fmt.Errorf("unsupported pod version: %s", version) + } + + if path, _, ok := fieldpath.SplitMaybeSubscriptedPath(label); ok { + switch path { + case "metadata.annotations", "metadata.labels": + return label, value, nil + default: + return "", "", fmt.Errorf("field label does not support subscript: %s", label) + } + } + + switch label { + case "metadata.annotations", + "metadata.labels", + "metadata.name", + "metadata.namespace", + "metadata.uid", + "spec.nodeName", + "spec.restartPolicy", + "spec.serviceAccountName", + "spec.schedulerName", + "status.phase", + "status.hostIP", + "status.podIP": + return label, value, nil + // This is for backwards compatibility with old v1 clients which send spec.host + case "spec.host": + return "spec.nodeName", value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/register.go b/vendor/k8s.io/kubernetes/pkg/apis/core/register.go new file mode 100644 index 000000000..2784cbe15 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/register.go @@ -0,0 +1,99 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package core + +import ( + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + "k8s.io/apimachinery/pkg/runtime" + "k8s.io/apimachinery/pkg/runtime/schema" +) + +// GroupName is the group name use in this package +const GroupName = "" + +// SchemeGroupVersion is group version used to register these objects +var SchemeGroupVersion = schema.GroupVersion{Group: GroupName, Version: runtime.APIVersionInternal} + +// Kind takes an unqualified kind and returns a Group qualified GroupKind +func Kind(kind string) schema.GroupKind { + return SchemeGroupVersion.WithKind(kind).GroupKind() +} + +// Resource takes an unqualified resource and returns a Group qualified GroupResource +func Resource(resource string) schema.GroupResource { + return SchemeGroupVersion.WithResource(resource).GroupResource() +} + +var ( + SchemeBuilder = runtime.NewSchemeBuilder(addKnownTypes) + AddToScheme = SchemeBuilder.AddToScheme +) + +func addKnownTypes(scheme *runtime.Scheme) error { + if err := scheme.AddIgnoredConversionType(&metav1.TypeMeta{}, &metav1.TypeMeta{}); err != nil { + return err + } + scheme.AddKnownTypes(SchemeGroupVersion, + &Pod{}, + &PodList{}, + &PodStatusResult{}, + &PodTemplate{}, + &PodTemplateList{}, + &ReplicationControllerList{}, + &ReplicationController{}, + &ServiceList{}, + &Service{}, + &ServiceProxyOptions{}, + &NodeList{}, + &Node{}, + &NodeConfigSource{}, + &NodeProxyOptions{}, + &Endpoints{}, + &EndpointsList{}, + &Binding{}, + &Event{}, + &EventList{}, + &List{}, + &LimitRange{}, + &LimitRangeList{}, + &ResourceQuota{}, + &ResourceQuotaList{}, + &Namespace{}, + &NamespaceList{}, + &ServiceAccount{}, + &ServiceAccountList{}, + &Secret{}, + &SecretList{}, + &PersistentVolume{}, + &PersistentVolumeList{}, + &PersistentVolumeClaim{}, + &PersistentVolumeClaimList{}, + &PodAttachOptions{}, + &PodLogOptions{}, + &PodExecOptions{}, + &PodPortForwardOptions{}, + &PodProxyOptions{}, + &ComponentStatus{}, + &ComponentStatusList{}, + &SerializedReference{}, + &RangeAllocation{}, + &ConfigMap{}, + &ConfigMapList{}, + ) + + return nil +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/resource.go b/vendor/k8s.io/kubernetes/pkg/apis/core/resource.go new file mode 100644 index 000000000..1910cd921 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/resource.go @@ -0,0 +1,62 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package core + +import ( + "k8s.io/apimachinery/pkg/api/resource" +) + +func (self ResourceName) String() string { + return string(self) +} + +// Returns the CPU limit if specified. +func (self *ResourceList) Cpu() *resource.Quantity { + if val, ok := (*self)[ResourceCPU]; ok { + return &val + } + return &resource.Quantity{Format: resource.DecimalSI} +} + +// Returns the Memory limit if specified. +func (self *ResourceList) Memory() *resource.Quantity { + if val, ok := (*self)[ResourceMemory]; ok { + return &val + } + return &resource.Quantity{Format: resource.BinarySI} +} + +func (self *ResourceList) Pods() *resource.Quantity { + if val, ok := (*self)[ResourcePods]; ok { + return &val + } + return &resource.Quantity{} +} + +func (self *ResourceList) NvidiaGPU() *resource.Quantity { + if val, ok := (*self)[ResourceNvidiaGPU]; ok { + return &val + } + return &resource.Quantity{} +} + +func (self *ResourceList) StorageEphemeral() *resource.Quantity { + if val, ok := (*self)[ResourceEphemeralStorage]; ok { + return &val + } + return &resource.Quantity{} +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/taint.go b/vendor/k8s.io/kubernetes/pkg/apis/core/taint.go new file mode 100644 index 000000000..ae1feb74d --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/taint.go @@ -0,0 +1,36 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +//TODO: consider making these methods functions, because we don't want helper +//functions in the k8s.io/api repo. + +package core + +import "fmt" + +// MatchTaint checks if the taint matches taintToMatch. Taints are unique by key:effect, +// if the two taints have same key:effect, regard as they match. +func (t *Taint) MatchTaint(taintToMatch Taint) bool { + return t.Key == taintToMatch.Key && t.Effect == taintToMatch.Effect +} + +// taint.ToString() converts taint struct to string in format key=value:effect or key:effect. +func (t *Taint) ToString() string { + if len(t.Value) == 0 { + return fmt.Sprintf("%v:%v", t.Key, t.Effect) + } + return fmt.Sprintf("%v=%v:%v", t.Key, t.Value, t.Effect) +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/toleration.go b/vendor/k8s.io/kubernetes/pkg/apis/core/toleration.go new file mode 100644 index 000000000..1dfbc9f1b --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/toleration.go @@ -0,0 +1,30 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +//TODO: consider making these methods functions, because we don't want helper +//functions in the k8s.io/api repo. + +package core + +// MatchToleration checks if the toleration matches tolerationToMatch. Tolerations are unique by <key,effect,operator,value>, +// if the two tolerations have same <key,effect,operator,value> combination, regard as they match. +// TODO: uniqueness check for tolerations in api validations. +func (t *Toleration) MatchToleration(tolerationToMatch *Toleration) bool { + return t.Key == tolerationToMatch.Key && + t.Effect == tolerationToMatch.Effect && + t.Operator == tolerationToMatch.Operator && + t.Value == tolerationToMatch.Value +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/types.go b/vendor/k8s.io/kubernetes/pkg/apis/core/types.go new file mode 100644 index 000000000..a112791b1 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/types.go @@ -0,0 +1,4656 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package core + +import ( + "k8s.io/apimachinery/pkg/api/resource" + metainternalversion "k8s.io/apimachinery/pkg/apis/meta/internalversion" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + "k8s.io/apimachinery/pkg/fields" + "k8s.io/apimachinery/pkg/labels" + "k8s.io/apimachinery/pkg/types" + "k8s.io/apimachinery/pkg/util/intstr" +) + +// Common string formats +// --------------------- +// Many fields in this API have formatting requirements. The commonly used +// formats are defined here. +// +// C_IDENTIFIER: This is a string that conforms to the definition of an "identifier" +// in the C language. This is captured by the following regex: +// [A-Za-z_][A-Za-z0-9_]* +// This defines the format, but not the length restriction, which should be +// specified at the definition of any field of this type. +// +// DNS_LABEL: This is a string, no more than 63 characters long, that conforms +// to the definition of a "label" in RFCs 1035 and 1123. This is captured +// by the following regex: +// [a-z0-9]([-a-z0-9]*[a-z0-9])? +// +// DNS_SUBDOMAIN: This is a string, no more than 253 characters long, that conforms +// to the definition of a "subdomain" in RFCs 1035 and 1123. This is captured +// by the following regex: +// [a-z0-9]([-a-z0-9]*[a-z0-9])?(\.[a-z0-9]([-a-z0-9]*[a-z0-9])?)* +// or more simply: +// DNS_LABEL(\.DNS_LABEL)* +// +// IANA_SVC_NAME: This is a string, no more than 15 characters long, that +// conforms to the definition of IANA service name in RFC 6335. +// It must contains at least one letter [a-z] and it must contains only [a-z0-9-]. +// Hypens ('-') cannot be leading or trailing character of the string +// and cannot be adjacent to other hyphens. + +// ObjectMeta is metadata that all persisted resources must have, which includes all objects +// users must create. +// DEPRECATED: Use k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta instead - this type will be removed soon. +type ObjectMeta struct { + // Name is unique within a namespace. Name is required when creating resources, although + // some resources may allow a client to request the generation of an appropriate name + // automatically. Name is primarily intended for creation idempotence and configuration + // definition. + // +optional + Name string + + // GenerateName indicates that the name should be made unique by the server prior to persisting + // it. A non-empty value for the field indicates the name will be made unique (and the name + // returned to the client will be different than the name passed). The value of this field will + // be combined with a unique suffix on the server if the Name field has not been provided. + // The provided value must be valid within the rules for Name, and may be truncated by the length + // of the suffix required to make the value unique on the server. + // + // If this field is specified, and Name is not present, the server will NOT return a 409 if the + // generated name exists - instead, it will either return 201 Created or 500 with Reason + // ServerTimeout indicating a unique name could not be found in the time allotted, and the client + // should retry (optionally after the time indicated in the Retry-After header). + // +optional + GenerateName string + + // Namespace defines the space within which name must be unique. An empty namespace is + // equivalent to the "default" namespace, but "default" is the canonical representation. + // Not all objects are required to be scoped to a namespace - the value of this field for + // those objects will be empty. + // +optional + Namespace string + + // SelfLink is a URL representing this object. + // +optional + SelfLink string + + // UID is the unique in time and space value for this object. It is typically generated by + // the server on successful creation of a resource and is not allowed to change on PUT + // operations. + // +optional + UID types.UID + + // An opaque value that represents the version of this resource. May be used for optimistic + // concurrency, change detection, and the watch operation on a resource or set of resources. + // Clients must treat these values as opaque and values may only be valid for a particular + // resource or set of resources. Only servers will generate resource versions. + // +optional + ResourceVersion string + + // A sequence number representing a specific generation of the desired state. + // Populated by the system. Read-only. + // +optional + Generation int64 + + // CreationTimestamp is a timestamp representing the server time when this object was + // created. It is not guaranteed to be set in happens-before order across separate operations. + // Clients may not set this value. It is represented in RFC3339 form and is in UTC. + // +optional + CreationTimestamp metav1.Time + + // DeletionTimestamp is RFC 3339 date and time at which this resource will be deleted. This + // field is set by the server when a graceful deletion is requested by the user, and is not + // directly settable by a client. The resource is expected to be deleted (no longer visible + // from resource lists, and not reachable by name) after the time in this field. Once set, + // this value may not be unset or be set further into the future, although it may be shortened + // or the resource may be deleted prior to this time. For example, a user may request that + // a pod is deleted in 30 seconds. The Kubelet will react by sending a graceful termination + // signal to the containers in the pod. After that 30 seconds, the Kubelet will send a hard + // termination signal (SIGKILL) to the container and after cleanup, remove the pod from the + // API. In the presence of network partitions, this object may still exist after this + // timestamp, until an administrator or automated process can determine the resource is + // fully terminated. + // If not set, graceful deletion of the object has not been requested. + // + // Populated by the system when a graceful deletion is requested. + // Read-only. + // More info: https://git.k8s.io/community/contributors/devel/api-conventions.md#metadata + // +optional + DeletionTimestamp *metav1.Time + + // DeletionGracePeriodSeconds records the graceful deletion value set when graceful deletion + // was requested. Represents the most recent grace period, and may only be shortened once set. + // +optional + DeletionGracePeriodSeconds *int64 + + // Labels are key value pairs that may be used to scope and select individual resources. + // Label keys are of the form: + // label-key ::= prefixed-name | name + // prefixed-name ::= prefix '/' name + // prefix ::= DNS_SUBDOMAIN + // name ::= DNS_LABEL + // The prefix is optional. If the prefix is not specified, the key is assumed to be private + // to the user. Other system components that wish to use labels must specify a prefix. The + // "kubernetes.io/" prefix is reserved for use by kubernetes components. + // +optional + Labels map[string]string + + // Annotations are unstructured key value data stored with a resource that may be set by + // external tooling. They are not queryable and should be preserved when modifying + // objects. Annotation keys have the same formatting restrictions as Label keys. See the + // comments on Labels for details. + // +optional + Annotations map[string]string + + // List of objects depended by this object. If ALL objects in the list have + // been deleted, this object will be garbage collected. If this object is managed by a controller, + // then an entry in this list will point to this controller, with the controller field set to true. + // There cannot be more than one managing controller. + // +optional + OwnerReferences []metav1.OwnerReference + + // An initializer is a controller which enforces some system invariant at object creation time. + // This field is a list of initializers that have not yet acted on this object. If nil or empty, + // this object has been completely initialized. Otherwise, the object is considered uninitialized + // and is hidden (in list/watch and get calls) from clients that haven't explicitly asked to + // observe uninitialized objects. + // + // When an object is created, the system will populate this list with the current set of initializers. + // Only privileged users may set or modify this list. Once it is empty, it may not be modified further + // by any user. + Initializers *metav1.Initializers + + // Must be empty before the object is deleted from the registry. Each entry + // is an identifier for the responsible component that will remove the entry + // from the list. If the deletionTimestamp of the object is non-nil, entries + // in this list can only be removed. + // +optional + Finalizers []string + + // The name of the cluster which the object belongs to. + // This is used to distinguish resources with same name and namespace in different clusters. + // This field is not set anywhere right now and apiserver is going to ignore it if set in create or update request. + // +optional + ClusterName string +} + +const ( + // NamespaceDefault means the object is in the default namespace which is applied when not specified by clients + NamespaceDefault string = "default" + // NamespaceAll is the default argument to specify on a context when you want to list or filter resources across all namespaces + NamespaceAll string = "" + // NamespaceNone is the argument for a context when there is no namespace. + NamespaceNone string = "" + // NamespaceSystem is the system namespace where we place system components. + NamespaceSystem string = "kube-system" + // NamespacePublic is the namespace where we place public info (ConfigMaps) + NamespacePublic string = "kube-public" + // TerminationMessagePathDefault means the default path to capture the application termination message running in a container + TerminationMessagePathDefault string = "/dev/termination-log" +) + +// Volume represents a named volume in a pod that may be accessed by any containers in the pod. +type Volume struct { + // Required: This must be a DNS_LABEL. Each volume in a pod must have + // a unique name. + Name string + // The VolumeSource represents the location and type of a volume to mount. + // This is optional for now. If not specified, the Volume is implied to be an EmptyDir. + // This implied behavior is deprecated and will be removed in a future version. + // +optional + VolumeSource +} + +// VolumeSource represents the source location of a volume to mount. +// Only one of its members may be specified. +type VolumeSource struct { + // HostPath represents file or directory on the host machine that is + // directly exposed to the container. This is generally used for system + // agents or other privileged things that are allowed to see the host + // machine. Most containers will NOT need this. + // --- + // TODO(jonesdl) We need to restrict who can use host directory mounts and who can/can not + // mount host directories as read/write. + // +optional + HostPath *HostPathVolumeSource + // EmptyDir represents a temporary directory that shares a pod's lifetime. + // +optional + EmptyDir *EmptyDirVolumeSource + // GCEPersistentDisk represents a GCE Disk resource that is attached to a + // kubelet's host machine and then exposed to the pod. + // +optional + GCEPersistentDisk *GCEPersistentDiskVolumeSource + // AWSElasticBlockStore represents an AWS EBS disk that is attached to a + // kubelet's host machine and then exposed to the pod. + // +optional + AWSElasticBlockStore *AWSElasticBlockStoreVolumeSource + // GitRepo represents a git repository at a particular revision. + // +optional + GitRepo *GitRepoVolumeSource + // Secret represents a secret that should populate this volume. + // +optional + Secret *SecretVolumeSource + // NFS represents an NFS mount on the host that shares a pod's lifetime + // +optional + NFS *NFSVolumeSource + // ISCSIVolumeSource represents an ISCSI Disk resource that is attached to a + // kubelet's host machine and then exposed to the pod. + // +optional + ISCSI *ISCSIVolumeSource + // Glusterfs represents a Glusterfs mount on the host that shares a pod's lifetime + // +optional + Glusterfs *GlusterfsVolumeSource + // PersistentVolumeClaimVolumeSource represents a reference to a PersistentVolumeClaim in the same namespace + // +optional + PersistentVolumeClaim *PersistentVolumeClaimVolumeSource + // RBD represents a Rados Block Device mount on the host that shares a pod's lifetime + // +optional + RBD *RBDVolumeSource + + // Quobyte represents a Quobyte mount on the host that shares a pod's lifetime + // +optional + Quobyte *QuobyteVolumeSource + + // FlexVolume represents a generic volume resource that is + // provisioned/attached using an exec based plugin. + // +optional + FlexVolume *FlexVolumeSource + + // Cinder represents a cinder volume attached and mounted on kubelets host machine + // +optional + Cinder *CinderVolumeSource + + // CephFS represents a Cephfs mount on the host that shares a pod's lifetime + // +optional + CephFS *CephFSVolumeSource + + // Flocker represents a Flocker volume attached to a kubelet's host machine. This depends on the Flocker control service being running + // +optional + Flocker *FlockerVolumeSource + + // DownwardAPI represents metadata about the pod that should populate this volume + // +optional + DownwardAPI *DownwardAPIVolumeSource + // FC represents a Fibre Channel resource that is attached to a kubelet's host machine and then exposed to the pod. + // +optional + FC *FCVolumeSource + // AzureFile represents an Azure File Service mount on the host and bind mount to the pod. + // +optional + AzureFile *AzureFileVolumeSource + // ConfigMap represents a configMap that should populate this volume + // +optional + ConfigMap *ConfigMapVolumeSource + // VsphereVolume represents a vSphere volume attached and mounted on kubelets host machine + // +optional + VsphereVolume *VsphereVirtualDiskVolumeSource + // AzureDisk represents an Azure Data Disk mount on the host and bind mount to the pod. + // +optional + AzureDisk *AzureDiskVolumeSource + // PhotonPersistentDisk represents a Photon Controller persistent disk attached and mounted on kubelets host machine + PhotonPersistentDisk *PhotonPersistentDiskVolumeSource + // Items for all in one resources secrets, configmaps, and downward API + Projected *ProjectedVolumeSource + // PortworxVolume represents a portworx volume attached and mounted on kubelets host machine + // +optional + PortworxVolume *PortworxVolumeSource + // ScaleIO represents a ScaleIO persistent volume attached and mounted on Kubernetes nodes. + // +optional + ScaleIO *ScaleIOVolumeSource + // StorageOS represents a StorageOS volume that is attached to the kubelet's host machine and mounted into the pod + // +optional + StorageOS *StorageOSVolumeSource +} + +// Similar to VolumeSource but meant for the administrator who creates PVs. +// Exactly one of its members must be set. +type PersistentVolumeSource struct { + // GCEPersistentDisk represents a GCE Disk resource that is attached to a + // kubelet's host machine and then exposed to the pod. + // +optional + GCEPersistentDisk *GCEPersistentDiskVolumeSource + // AWSElasticBlockStore represents an AWS EBS disk that is attached to a + // kubelet's host machine and then exposed to the pod. + // +optional + AWSElasticBlockStore *AWSElasticBlockStoreVolumeSource + // HostPath represents a directory on the host. + // Provisioned by a developer or tester. + // This is useful for single-node development and testing only! + // On-host storage is not supported in any way and WILL NOT WORK in a multi-node cluster. + // +optional + HostPath *HostPathVolumeSource + // Glusterfs represents a Glusterfs volume that is attached to a host and exposed to the pod + // +optional + Glusterfs *GlusterfsVolumeSource + // NFS represents an NFS mount on the host that shares a pod's lifetime + // +optional + NFS *NFSVolumeSource + // RBD represents a Rados Block Device mount on the host that shares a pod's lifetime + // +optional + RBD *RBDPersistentVolumeSource + // Quobyte represents a Quobyte mount on the host that shares a pod's lifetime + // +optional + Quobyte *QuobyteVolumeSource + // ISCSIPersistentVolumeSource represents an ISCSI resource that is attached to a + // kubelet's host machine and then exposed to the pod. + // +optional + ISCSI *ISCSIPersistentVolumeSource + // FlexVolume represents a generic volume resource that is + // provisioned/attached using an exec based plugin. + // +optional + FlexVolume *FlexPersistentVolumeSource + // Cinder represents a cinder volume attached and mounted on kubelets host machine + // +optional + Cinder *CinderVolumeSource + // CephFS represents a Ceph FS mount on the host that shares a pod's lifetime + // +optional + CephFS *CephFSPersistentVolumeSource + // FC represents a Fibre Channel resource that is attached to a kubelet's host machine and then exposed to the pod. + // +optional + FC *FCVolumeSource + // Flocker represents a Flocker volume attached to a kubelet's host machine. This depends on the Flocker control service being running + // +optional + Flocker *FlockerVolumeSource + // AzureFile represents an Azure File Service mount on the host and bind mount to the pod. + // +optional + AzureFile *AzureFilePersistentVolumeSource + // VsphereVolume represents a vSphere volume attached and mounted on kubelets host machine + // +optional + VsphereVolume *VsphereVirtualDiskVolumeSource + // AzureDisk represents an Azure Data Disk mount on the host and bind mount to the pod. + // +optional + AzureDisk *AzureDiskVolumeSource + // PhotonPersistentDisk represents a Photon Controller persistent disk attached and mounted on kubelets host machine + PhotonPersistentDisk *PhotonPersistentDiskVolumeSource + // PortworxVolume represents a portworx volume attached and mounted on kubelets host machine + // +optional + PortworxVolume *PortworxVolumeSource + // ScaleIO represents a ScaleIO persistent volume attached and mounted on Kubernetes nodes. + // +optional + ScaleIO *ScaleIOPersistentVolumeSource + // Local represents directly-attached storage with node affinity + // +optional + Local *LocalVolumeSource + // StorageOS represents a StorageOS volume that is attached to the kubelet's host machine and mounted into the pod + // More info: https://releases.k8s.io/HEAD/examples/volumes/storageos/README.md + // +optional + StorageOS *StorageOSPersistentVolumeSource + // CSI (Container Storage Interface) represents storage that handled by an external CSI driver (Beta feature). + // +optional + CSI *CSIPersistentVolumeSource +} + +type PersistentVolumeClaimVolumeSource struct { + // ClaimName is the name of a PersistentVolumeClaim in the same namespace as the pod using this volume + ClaimName string + // Optional: Defaults to false (read/write). ReadOnly here + // will force the ReadOnly setting in VolumeMounts + // +optional + ReadOnly bool +} + +const ( + // BetaStorageClassAnnotation represents the beta/previous StorageClass annotation. + // It's deprecated and will be removed in a future release. (#51440) + BetaStorageClassAnnotation = "volume.beta.kubernetes.io/storage-class" + + // MountOptionAnnotation defines mount option annotation used in PVs + MountOptionAnnotation = "volume.beta.kubernetes.io/mount-options" + + // AlphaStorageNodeAffinityAnnotation defines node affinity policies for a PersistentVolume. + // Value is a string of the json representation of type NodeAffinity + AlphaStorageNodeAffinityAnnotation = "volume.alpha.kubernetes.io/node-affinity" +) + +// +genclient +// +genclient:nonNamespaced +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +type PersistentVolume struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + //Spec defines a persistent volume owned by the cluster + // +optional + Spec PersistentVolumeSpec + + // Status represents the current information about persistent volume. + // +optional + Status PersistentVolumeStatus +} + +type PersistentVolumeSpec struct { + // Resources represents the actual resources of the volume + Capacity ResourceList + // Source represents the location and type of a volume to mount. + PersistentVolumeSource + // AccessModes contains all ways the volume can be mounted + // +optional + AccessModes []PersistentVolumeAccessMode + // ClaimRef is part of a bi-directional binding between PersistentVolume and PersistentVolumeClaim. + // ClaimRef is expected to be non-nil when bound. + // claim.VolumeName is the authoritative bind between PV and PVC. + // When set to non-nil value, PVC.Spec.Selector of the referenced PVC is + // ignored, i.e. labels of this PV do not need to match PVC selector. + // +optional + ClaimRef *ObjectReference + // Optional: what happens to a persistent volume when released from its claim. + // +optional + PersistentVolumeReclaimPolicy PersistentVolumeReclaimPolicy + // Name of StorageClass to which this persistent volume belongs. Empty value + // means that this volume does not belong to any StorageClass. + // +optional + StorageClassName string + // A list of mount options, e.g. ["ro", "soft"]. Not validated - mount will + // simply fail if one is invalid. + // +optional + MountOptions []string + // volumeMode defines if a volume is intended to be used with a formatted filesystem + // or to remain in raw block state. Value of Filesystem is implied when not included in spec. + // This is an alpha feature and may change in the future. + // +optional + VolumeMode *PersistentVolumeMode + // NodeAffinity defines constraints that limit what nodes this volume can be accessed from. + // This field influences the scheduling of pods that use this volume. + // +optional + NodeAffinity *VolumeNodeAffinity +} + +// VolumeNodeAffinity defines constraints that limit what nodes this volume can be accessed from. +type VolumeNodeAffinity struct { + // Required specifies hard node constraints that must be met. + Required *NodeSelector +} + +// PersistentVolumeReclaimPolicy describes a policy for end-of-life maintenance of persistent volumes +type PersistentVolumeReclaimPolicy string + +const ( + // PersistentVolumeReclaimRecycle means the volume will be recycled back into the pool of unbound persistent volumes on release from its claim. + // The volume plugin must support Recycling. + // DEPRECATED: The PersistentVolumeReclaimRecycle called Recycle is being deprecated. See announcement here: https://groups.google.com/forum/#!topic/kubernetes-dev/uexugCza84I + PersistentVolumeReclaimRecycle PersistentVolumeReclaimPolicy = "Recycle" + // PersistentVolumeReclaimDelete means the volume will be deleted from Kubernetes on release from its claim. + // The volume plugin must support Deletion. + PersistentVolumeReclaimDelete PersistentVolumeReclaimPolicy = "Delete" + // PersistentVolumeReclaimRetain means the volume will be left in its current phase (Released) for manual reclamation by the administrator. + // The default policy is Retain. + PersistentVolumeReclaimRetain PersistentVolumeReclaimPolicy = "Retain" +) + +// PersistentVolumeMode describes how a volume is intended to be consumed, either Block or Filesystem. +type PersistentVolumeMode string + +const ( + // PersistentVolumeBlock means the volume will not be formatted with a filesystem and will remain a raw block device. + PersistentVolumeBlock PersistentVolumeMode = "Block" + // PersistentVolumeFilesystem means the volume will be or is formatted with a filesystem. + PersistentVolumeFilesystem PersistentVolumeMode = "Filesystem" +) + +type PersistentVolumeStatus struct { + // Phase indicates if a volume is available, bound to a claim, or released by a claim + // +optional + Phase PersistentVolumePhase + // A human-readable message indicating details about why the volume is in this state. + // +optional + Message string + // Reason is a brief CamelCase string that describes any failure and is meant for machine parsing and tidy display in the CLI + // +optional + Reason string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +type PersistentVolumeList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + Items []PersistentVolume +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PersistentVolumeClaim is a user's request for and claim to a persistent volume +type PersistentVolumeClaim struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the volume requested by a pod author + // +optional + Spec PersistentVolumeClaimSpec + + // Status represents the current information about a claim + // +optional + Status PersistentVolumeClaimStatus +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +type PersistentVolumeClaimList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + Items []PersistentVolumeClaim +} + +// PersistentVolumeClaimSpec describes the common attributes of storage devices +// and allows a Source for provider-specific attributes +type PersistentVolumeClaimSpec struct { + // Contains the types of access modes required + // +optional + AccessModes []PersistentVolumeAccessMode + // A label query over volumes to consider for binding. This selector is + // ignored when VolumeName is set + // +optional + Selector *metav1.LabelSelector + // Resources represents the minimum resources required + // +optional + Resources ResourceRequirements + // VolumeName is the binding reference to the PersistentVolume backing this + // claim. When set to non-empty value Selector is not evaluated + // +optional + VolumeName string + // Name of the StorageClass required by the claim. + // More info: https://kubernetes.io/docs/concepts/storage/persistent-volumes/#class-1 + // +optional + StorageClassName *string + // volumeMode defines what type of volume is required by the claim. + // Value of Filesystem is implied when not included in claim spec. + // This is an alpha feature and may change in the future. + // +optional + VolumeMode *PersistentVolumeMode +} + +type PersistentVolumeClaimConditionType string + +// These are valid conditions of Pvc +const ( + // An user trigger resize of pvc has been started + PersistentVolumeClaimResizing PersistentVolumeClaimConditionType = "Resizing" + // PersistentVolumeClaimFileSystemResizePending - controller resize is finished and a file system resize is pending on node + PersistentVolumeClaimFileSystemResizePending PersistentVolumeClaimConditionType = "FileSystemResizePending" +) + +type PersistentVolumeClaimCondition struct { + Type PersistentVolumeClaimConditionType + Status ConditionStatus + // +optional + LastProbeTime metav1.Time + // +optional + LastTransitionTime metav1.Time + // +optional + Reason string + // +optional + Message string +} + +type PersistentVolumeClaimStatus struct { + // Phase represents the current phase of PersistentVolumeClaim + // +optional + Phase PersistentVolumeClaimPhase + // AccessModes contains all ways the volume backing the PVC can be mounted + // +optional + AccessModes []PersistentVolumeAccessMode + // Represents the actual resources of the underlying volume + // +optional + Capacity ResourceList + // +optional + Conditions []PersistentVolumeClaimCondition +} + +type PersistentVolumeAccessMode string + +const ( + // can be mounted read/write mode to exactly 1 host + ReadWriteOnce PersistentVolumeAccessMode = "ReadWriteOnce" + // can be mounted in read-only mode to many hosts + ReadOnlyMany PersistentVolumeAccessMode = "ReadOnlyMany" + // can be mounted in read/write mode to many hosts + ReadWriteMany PersistentVolumeAccessMode = "ReadWriteMany" +) + +type PersistentVolumePhase string + +const ( + // used for PersistentVolumes that are not available + VolumePending PersistentVolumePhase = "Pending" + // used for PersistentVolumes that are not yet bound + // Available volumes are held by the binder and matched to PersistentVolumeClaims + VolumeAvailable PersistentVolumePhase = "Available" + // used for PersistentVolumes that are bound + VolumeBound PersistentVolumePhase = "Bound" + // used for PersistentVolumes where the bound PersistentVolumeClaim was deleted + // released volumes must be recycled before becoming available again + // this phase is used by the persistent volume claim binder to signal to another process to reclaim the resource + VolumeReleased PersistentVolumePhase = "Released" + // used for PersistentVolumes that failed to be correctly recycled or deleted after being released from a claim + VolumeFailed PersistentVolumePhase = "Failed" +) + +type PersistentVolumeClaimPhase string + +const ( + // used for PersistentVolumeClaims that are not yet bound + ClaimPending PersistentVolumeClaimPhase = "Pending" + // used for PersistentVolumeClaims that are bound + ClaimBound PersistentVolumeClaimPhase = "Bound" + // used for PersistentVolumeClaims that lost their underlying + // PersistentVolume. The claim was bound to a PersistentVolume and this + // volume does not exist any longer and all data on it was lost. + ClaimLost PersistentVolumeClaimPhase = "Lost" +) + +type HostPathType string + +const ( + // For backwards compatible, leave it empty if unset + HostPathUnset HostPathType = "" + // If nothing exists at the given path, an empty directory will be created there + // as needed with file mode 0755, having the same group and ownership with Kubelet. + HostPathDirectoryOrCreate HostPathType = "DirectoryOrCreate" + // A directory must exist at the given path + HostPathDirectory HostPathType = "Directory" + // If nothing exists at the given path, an empty file will be created there + // as needed with file mode 0644, having the same group and ownership with Kubelet. + HostPathFileOrCreate HostPathType = "FileOrCreate" + // A file must exist at the given path + HostPathFile HostPathType = "File" + // A UNIX socket must exist at the given path + HostPathSocket HostPathType = "Socket" + // A character device must exist at the given path + HostPathCharDev HostPathType = "CharDevice" + // A block device must exist at the given path + HostPathBlockDev HostPathType = "BlockDevice" +) + +// Represents a host path mapped into a pod. +// Host path volumes do not support ownership management or SELinux relabeling. +type HostPathVolumeSource struct { + // If the path is a symlink, it will follow the link to the real path. + Path string + // Defaults to "" + Type *HostPathType +} + +// Represents an empty directory for a pod. +// Empty directory volumes support ownership management and SELinux relabeling. +type EmptyDirVolumeSource struct { + // TODO: Longer term we want to represent the selection of underlying + // media more like a scheduling problem - user says what traits they + // need, we give them a backing store that satisfies that. For now + // this will cover the most common needs. + // Optional: what type of storage medium should back this directory. + // The default is "" which means to use the node's default medium. + // +optional + Medium StorageMedium + // Total amount of local storage required for this EmptyDir volume. + // The size limit is also applicable for memory medium. + // The maximum usage on memory medium EmptyDir would be the minimum value between + // the SizeLimit specified here and the sum of memory limits of all containers in a pod. + // The default is nil which means that the limit is undefined. + // More info: http://kubernetes.io/docs/user-guide/volumes#emptydir + // +optional + SizeLimit *resource.Quantity +} + +// StorageMedium defines ways that storage can be allocated to a volume. +type StorageMedium string + +const ( + StorageMediumDefault StorageMedium = "" // use whatever the default is for the node + StorageMediumMemory StorageMedium = "Memory" // use memory (tmpfs) + StorageMediumHugePages StorageMedium = "HugePages" // use hugepages +) + +// Protocol defines network protocols supported for things like container ports. +type Protocol string + +const ( + // ProtocolTCP is the TCP protocol. + ProtocolTCP Protocol = "TCP" + // ProtocolUDP is the UDP protocol. + ProtocolUDP Protocol = "UDP" +) + +// Represents a Persistent Disk resource in Google Compute Engine. +// +// A GCE PD must exist before mounting to a container. The disk must +// also be in the same GCE project and zone as the kubelet. A GCE PD +// can only be mounted as read/write once or read-only many times. GCE +// PDs support ownership management and SELinux relabeling. +type GCEPersistentDiskVolumeSource struct { + // Unique name of the PD resource. Used to identify the disk in GCE + PDName string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: Partition on the disk to mount. + // If omitted, kubelet will attempt to mount the device name. + // Ex. For /dev/sda1, this field is "1", for /dev/sda, this field is 0 or empty. + // +optional + Partition int32 + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents an ISCSI disk. +// ISCSI volumes can only be mounted as read/write once. +// ISCSI volumes support ownership management and SELinux relabeling. +type ISCSIVolumeSource struct { + // Required: iSCSI target portal + // the portal is either an IP or ip_addr:port if port is other than default (typically TCP ports 860 and 3260) + // +optional + TargetPortal string + // Required: target iSCSI Qualified Name + // +optional + IQN string + // Required: iSCSI target lun number + // +optional + Lun int32 + // Optional: Defaults to 'default' (tcp). iSCSI interface name that uses an iSCSI transport. + // +optional + ISCSIInterface string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // Optional: list of iSCSI target portal ips for high availability. + // the portal is either an IP or ip_addr:port if port is other than default (typically TCP ports 860 and 3260) + // +optional + Portals []string + // Optional: whether support iSCSI Discovery CHAP authentication + // +optional + DiscoveryCHAPAuth bool + // Optional: whether support iSCSI Session CHAP authentication + // +optional + SessionCHAPAuth bool + // Optional: CHAP secret for iSCSI target and initiator authentication. + // The secret is used if either DiscoveryCHAPAuth or SessionCHAPAuth is true + // +optional + SecretRef *LocalObjectReference + // Optional: Custom initiator name per volume. + // If initiatorName is specified with iscsiInterface simultaneously, new iSCSI interface + // <target portal>:<volume name> will be created for the connection. + // +optional + InitiatorName *string +} + +// ISCSIPersistentVolumeSource represents an ISCSI disk. +// ISCSI volumes can only be mounted as read/write once. +// ISCSI volumes support ownership management and SELinux relabeling. +type ISCSIPersistentVolumeSource struct { + // Required: iSCSI target portal + // the portal is either an IP or ip_addr:port if port is other than default (typically TCP ports 860 and 3260) + // +optional + TargetPortal string + // Required: target iSCSI Qualified Name + // +optional + IQN string + // Required: iSCSI target lun number + // +optional + Lun int32 + // Optional: Defaults to 'default' (tcp). iSCSI interface name that uses an iSCSI transport. + // +optional + ISCSIInterface string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // Optional: list of iSCSI target portal ips for high availability. + // the portal is either an IP or ip_addr:port if port is other than default (typically TCP ports 860 and 3260) + // +optional + Portals []string + // Optional: whether support iSCSI Discovery CHAP authentication + // +optional + DiscoveryCHAPAuth bool + // Optional: whether support iSCSI Session CHAP authentication + // +optional + SessionCHAPAuth bool + // Optional: CHAP secret for iSCSI target and initiator authentication. + // The secret is used if either DiscoveryCHAPAuth or SessionCHAPAuth is true + // +optional + SecretRef *SecretReference + // Optional: Custom initiator name per volume. + // If initiatorName is specified with iscsiInterface simultaneously, new iSCSI interface + // <target portal>:<volume name> will be created for the connection. + // +optional + InitiatorName *string +} + +// Represents a Fibre Channel volume. +// Fibre Channel volumes can only be mounted as read/write once. +// Fibre Channel volumes support ownership management and SELinux relabeling. +type FCVolumeSource struct { + // Optional: FC target worldwide names (WWNs) + // +optional + TargetWWNs []string + // Optional: FC target lun number + // +optional + Lun *int32 + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // Optional: FC volume World Wide Identifiers (WWIDs) + // Either WWIDs or TargetWWNs and Lun must be set, but not both simultaneously. + // +optional + WWIDs []string +} + +// FlexPersistentVolumeSource represents a generic persistent volume resource that is +// provisioned/attached using an exec based plugin. +type FlexPersistentVolumeSource struct { + // Driver is the name of the driver to use for this volume. + Driver string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". The default filesystem depends on FlexVolume script. + // +optional + FSType string + // Optional: SecretRef is reference to the secret object containing + // sensitive information to pass to the plugin scripts. This may be + // empty if no secret object is specified. If the secret object + // contains more than one secret, all secrets are passed to the plugin + // scripts. + // +optional + SecretRef *SecretReference + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // Optional: Extra driver options if any. + // +optional + Options map[string]string +} + +// FlexVolume represents a generic volume resource that is +// provisioned/attached using an exec based plugin. +type FlexVolumeSource struct { + // Driver is the name of the driver to use for this volume. + Driver string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". The default filesystem depends on FlexVolume script. + // +optional + FSType string + // Optional: SecretRef is reference to the secret object containing + // sensitive information to pass to the plugin scripts. This may be + // empty if no secret object is specified. If the secret object + // contains more than one secret, all secrets are passed to the plugin + // scripts. + // +optional + SecretRef *LocalObjectReference + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // Optional: Extra driver options if any. + // +optional + Options map[string]string +} + +// Represents a Persistent Disk resource in AWS. +// +// An AWS EBS disk must exist before mounting to a container. The disk +// must also be in the same AWS zone as the kubelet. An AWS EBS disk +// can only be mounted as read/write once. AWS EBS volumes support +// ownership management and SELinux relabeling. +type AWSElasticBlockStoreVolumeSource struct { + // Unique id of the persistent disk resource. Used to identify the disk in AWS + VolumeID string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: Partition on the disk to mount. + // If omitted, kubelet will attempt to mount the device name. + // Ex. For /dev/sda1, this field is "1", for /dev/sda, this field is 0 or empty. + // +optional + Partition int32 + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents a volume that is populated with the contents of a git repository. +// Git repo volumes do not support ownership management. +// Git repo volumes support SELinux relabeling. +type GitRepoVolumeSource struct { + // Repository URL + Repository string + // Commit hash, this is optional + // +optional + Revision string + // Clone target, this is optional + // Must not contain or start with '..'. If '.' is supplied, the volume directory will be the + // git repository. Otherwise, if specified, the volume will contain the git repository in + // the subdirectory with the given name. + // +optional + Directory string + // TODO: Consider credentials here. +} + +// Adapts a Secret into a volume. +// +// The contents of the target Secret's Data field will be presented in a volume +// as files using the keys in the Data field as the file names. +// Secret volumes support ownership management and SELinux relabeling. +type SecretVolumeSource struct { + // Name of the secret in the pod's namespace to use. + // +optional + SecretName string + // If unspecified, each key-value pair in the Data field of the referenced + // Secret will be projected into the volume as a file whose name is the + // key and content is the value. If specified, the listed keys will be + // projected into the specified paths, and unlisted keys will not be + // present. If a key is specified which is not present in the Secret, + // the volume setup will error unless it is marked optional. Paths must be + // relative and may not contain the '..' path or start with '..'. + // +optional + Items []KeyToPath + // Mode bits to use on created files by default. Must be a value between + // 0 and 0777. + // Directories within the path are not affected by this setting. + // This might be in conflict with other options that affect the file + // mode, like fsGroup, and the result can be other mode bits set. + // +optional + DefaultMode *int32 + // Specify whether the Secret or its key must be defined + // +optional + Optional *bool +} + +// Adapts a secret into a projected volume. +// +// The contents of the target Secret's Data field will be presented in a +// projected volume as files using the keys in the Data field as the file names. +// Note that this is identical to a secret volume source without the default +// mode. +type SecretProjection struct { + LocalObjectReference + // If unspecified, each key-value pair in the Data field of the referenced + // Secret will be projected into the volume as a file whose name is the + // key and content is the value. If specified, the listed keys will be + // projected into the specified paths, and unlisted keys will not be + // present. If a key is specified which is not present in the Secret, + // the volume setup will error unless it is marked optional. Paths must be + // relative and may not contain the '..' path or start with '..'. + // +optional + Items []KeyToPath + // Specify whether the Secret or its key must be defined + // +optional + Optional *bool +} + +// Represents an NFS mount that lasts the lifetime of a pod. +// NFS volumes do not support ownership management or SELinux relabeling. +type NFSVolumeSource struct { + // Server is the hostname or IP address of the NFS server + Server string + + // Path is the exported NFS share + Path string + + // Optional: Defaults to false (read/write). ReadOnly here will force + // the NFS export to be mounted with read-only permissions + // +optional + ReadOnly bool +} + +// Represents a Quobyte mount that lasts the lifetime of a pod. +// Quobyte volumes do not support ownership management or SELinux relabeling. +type QuobyteVolumeSource struct { + // Registry represents a single or multiple Quobyte Registry services + // specified as a string as host:port pair (multiple entries are separated with commas) + // which acts as the central registry for volumes + Registry string + + // Volume is a string that references an already created Quobyte volume by name. + Volume string + + // Defaults to false (read/write). ReadOnly here will force + // the Quobyte to be mounted with read-only permissions + // +optional + ReadOnly bool + + // User to map volume access to + // Defaults to the root user + // +optional + User string + + // Group to map volume access to + // Default is no group + // +optional + Group string +} + +// Represents a Glusterfs mount that lasts the lifetime of a pod. +// Glusterfs volumes do not support ownership management or SELinux relabeling. +type GlusterfsVolumeSource struct { + // Required: EndpointsName is the endpoint name that details Glusterfs topology + EndpointsName string + + // Required: Path is the Glusterfs volume path + Path string + + // Optional: Defaults to false (read/write). ReadOnly here will force + // the Glusterfs to be mounted with read-only permissions + // +optional + ReadOnly bool +} + +// Represents a Rados Block Device mount that lasts the lifetime of a pod. +// RBD volumes support ownership management and SELinux relabeling. +type RBDVolumeSource struct { + // Required: CephMonitors is a collection of Ceph monitors + CephMonitors []string + // Required: RBDImage is the rados image name + RBDImage string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: RadosPool is the rados pool name,default is rbd + // +optional + RBDPool string + // Optional: RBDUser is the rados user name, default is admin + // +optional + RadosUser string + // Optional: Keyring is the path to key ring for RBDUser, default is /etc/ceph/keyring + // +optional + Keyring string + // Optional: SecretRef is name of the authentication secret for RBDUser, default is nil. + // +optional + SecretRef *LocalObjectReference + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents a Rados Block Device mount that lasts the lifetime of a pod. +// RBD volumes support ownership management and SELinux relabeling. +type RBDPersistentVolumeSource struct { + // Required: CephMonitors is a collection of Ceph monitors + CephMonitors []string + // Required: RBDImage is the rados image name + RBDImage string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // TODO: how do we prevent errors in the filesystem from compromising the machine + // +optional + FSType string + // Optional: RadosPool is the rados pool name,default is rbd + // +optional + RBDPool string + // Optional: RBDUser is the rados user name, default is admin + // +optional + RadosUser string + // Optional: Keyring is the path to key ring for RBDUser, default is /etc/ceph/keyring + // +optional + Keyring string + // Optional: SecretRef is reference to the authentication secret for User, default is empty. + // +optional + SecretRef *SecretReference + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents a cinder volume resource in Openstack. A Cinder volume +// must exist before mounting to a container. The volume must also be +// in the same region as the kubelet. Cinder volumes support ownership +// management and SELinux relabeling. +type CinderVolumeSource struct { + // Unique id of the volume used to identify the cinder volume + VolumeID string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents a Ceph Filesystem mount that lasts the lifetime of a pod +// Cephfs volumes do not support ownership management or SELinux relabeling. +type CephFSVolumeSource struct { + // Required: Monitors is a collection of Ceph monitors + Monitors []string + // Optional: Used as the mounted root, rather than the full Ceph tree, default is / + // +optional + Path string + // Optional: User is the rados user name, default is admin + // +optional + User string + // Optional: SecretFile is the path to key ring for User, default is /etc/ceph/user.secret + // +optional + SecretFile string + // Optional: SecretRef is reference to the authentication secret for User, default is empty. + // +optional + SecretRef *LocalObjectReference + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// SecretReference represents a Secret Reference. It has enough information to retrieve secret +// in any namespace +type SecretReference struct { + // Name is unique within a namespace to reference a secret resource. + // +optional + Name string + // Namespace defines the space within which the secret name must be unique. + // +optional + Namespace string +} + +// Represents a Ceph Filesystem mount that lasts the lifetime of a pod +// Cephfs volumes do not support ownership management or SELinux relabeling. +type CephFSPersistentVolumeSource struct { + // Required: Monitors is a collection of Ceph monitors + Monitors []string + // Optional: Used as the mounted root, rather than the full Ceph tree, default is / + // +optional + Path string + // Optional: User is the rados user name, default is admin + // +optional + User string + // Optional: SecretFile is the path to key ring for User, default is /etc/ceph/user.secret + // +optional + SecretFile string + // Optional: SecretRef is reference to the authentication secret for User, default is empty. + // +optional + SecretRef *SecretReference + // Optional: Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents a Flocker volume mounted by the Flocker agent. +// One and only one of datasetName and datasetUUID should be set. +// Flocker volumes do not support ownership management or SELinux relabeling. +type FlockerVolumeSource struct { + // Name of the dataset stored as metadata -> name on the dataset for Flocker + // should be considered as deprecated + // +optional + DatasetName string + // UUID of the dataset. This is unique identifier of a Flocker dataset + // +optional + DatasetUUID string +} + +// Represents a volume containing downward API info. +// Downward API volumes support ownership management and SELinux relabeling. +type DownwardAPIVolumeSource struct { + // Items is a list of DownwardAPIVolume file + // +optional + Items []DownwardAPIVolumeFile + // Mode bits to use on created files by default. Must be a value between + // 0 and 0777. + // Directories within the path are not affected by this setting. + // This might be in conflict with other options that affect the file + // mode, like fsGroup, and the result can be other mode bits set. + // +optional + DefaultMode *int32 +} + +// Represents a single file containing information from the downward API +type DownwardAPIVolumeFile struct { + // Required: Path is the relative path name of the file to be created. Must not be absolute or contain the '..' path. Must be utf-8 encoded. The first item of the relative path must not start with '..' + Path string + // Required: Selects a field of the pod: only annotations, labels, name, namespace and uid are supported. + // +optional + FieldRef *ObjectFieldSelector + // Selects a resource of the container: only resources limits and requests + // (limits.cpu, limits.memory, requests.cpu and requests.memory) are currently supported. + // +optional + ResourceFieldRef *ResourceFieldSelector + // Optional: mode bits to use on this file, must be a value between 0 + // and 0777. If not specified, the volume defaultMode will be used. + // This might be in conflict with other options that affect the file + // mode, like fsGroup, and the result can be other mode bits set. + // +optional + Mode *int32 +} + +// Represents downward API info for projecting into a projected volume. +// Note that this is identical to a downwardAPI volume source without the default +// mode. +type DownwardAPIProjection struct { + // Items is a list of DownwardAPIVolume file + // +optional + Items []DownwardAPIVolumeFile +} + +// AzureFile represents an Azure File Service mount on the host and bind mount to the pod. +type AzureFileVolumeSource struct { + // the name of secret that contains Azure Storage Account Name and Key + SecretName string + // Share Name + ShareName string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// AzureFile represents an Azure File Service mount on the host and bind mount to the pod. +type AzureFilePersistentVolumeSource struct { + // the name of secret that contains Azure Storage Account Name and Key + SecretName string + // Share Name + ShareName string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // the namespace of the secret that contains Azure Storage Account Name and Key + // default is the same as the Pod + // +optional + SecretNamespace *string +} + +// Represents a vSphere volume resource. +type VsphereVirtualDiskVolumeSource struct { + // Path that identifies vSphere volume vmdk + VolumePath string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Storage Policy Based Management (SPBM) profile name. + // +optional + StoragePolicyName string + // Storage Policy Based Management (SPBM) profile ID associated with the StoragePolicyName. + // +optional + StoragePolicyID string +} + +// Represents a Photon Controller persistent disk resource. +type PhotonPersistentDiskVolumeSource struct { + // ID that identifies Photon Controller persistent disk + PdID string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + FSType string +} + +// PortworxVolumeSource represents a Portworx volume resource. +type PortworxVolumeSource struct { + // VolumeID uniquely identifies a Portworx volume + VolumeID string + // FSType represents the filesystem type to mount + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +type AzureDataDiskCachingMode string +type AzureDataDiskKind string + +const ( + AzureDataDiskCachingNone AzureDataDiskCachingMode = "None" + AzureDataDiskCachingReadOnly AzureDataDiskCachingMode = "ReadOnly" + AzureDataDiskCachingReadWrite AzureDataDiskCachingMode = "ReadWrite" + + AzureSharedBlobDisk AzureDataDiskKind = "Shared" + AzureDedicatedBlobDisk AzureDataDiskKind = "Dedicated" + AzureManagedDisk AzureDataDiskKind = "Managed" +) + +// AzureDisk represents an Azure Data Disk mount on the host and bind mount to the pod. +type AzureDiskVolumeSource struct { + // The Name of the data disk in the blob storage + DiskName string + // The URI of the data disk in the blob storage + DataDiskURI string + // Host Caching mode: None, Read Only, Read Write. + // +optional + CachingMode *AzureDataDiskCachingMode + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType *string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly *bool + // Expected values Shared: multiple blob disks per storage account Dedicated: single blob disk per storage account Managed: azure managed data disk (only in managed availability set). defaults to shared + Kind *AzureDataDiskKind +} + +// ScaleIOVolumeSource represents a persistent ScaleIO volume +type ScaleIOVolumeSource struct { + // The host address of the ScaleIO API Gateway. + Gateway string + // The name of the storage system as configured in ScaleIO. + System string + // SecretRef references to the secret for ScaleIO user and other + // sensitive information. If this is not provided, Login operation will fail. + SecretRef *LocalObjectReference + // Flag to enable/disable SSL communication with Gateway, default false + // +optional + SSLEnabled bool + // The name of the ScaleIO Protection Domain for the configured storage. + // +optional + ProtectionDomain string + // The ScaleIO Storage Pool associated with the protection domain. + // +optional + StoragePool string + // Indicates whether the storage for a volume should be ThickProvisioned or ThinProvisioned. + // +optional + StorageMode string + // The name of a volume already created in the ScaleIO system + // that is associated with this volume source. + VolumeName string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// ScaleIOPersistentVolumeSource represents a persistent ScaleIO volume that can be defined +// by a an admin via a storage class, for instance. +type ScaleIOPersistentVolumeSource struct { + // The host address of the ScaleIO API Gateway. + Gateway string + // The name of the storage system as configured in ScaleIO. + System string + // SecretRef references to the secret for ScaleIO user and other + // sensitive information. If this is not provided, Login operation will fail. + SecretRef *SecretReference + // Flag to enable/disable SSL communication with Gateway, default false + // +optional + SSLEnabled bool + // The name of the ScaleIO Protection Domain for the configured storage. + // +optional + ProtectionDomain string + // The ScaleIO Storage Pool associated with the protection domain. + // +optional + StoragePool string + // Indicates whether the storage for a volume should be ThickProvisioned or ThinProvisioned. + // +optional + StorageMode string + // The name of a volume created in the ScaleIO system + // that is associated with this volume source. + VolumeName string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool +} + +// Represents a StorageOS persistent volume resource. +type StorageOSVolumeSource struct { + // VolumeName is the human-readable name of the StorageOS volume. Volume + // names are only unique within a namespace. + VolumeName string + // VolumeNamespace specifies the scope of the volume within StorageOS. If no + // namespace is specified then the Pod's namespace will be used. This allows the + // Kubernetes name scoping to be mirrored within StorageOS for tighter integration. + // Set VolumeName to any name to override the default behaviour. + // Set to "default" if you are not using namespaces within StorageOS. + // Namespaces that do not pre-exist within StorageOS will be created. + // +optional + VolumeNamespace string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // SecretRef specifies the secret to use for obtaining the StorageOS API + // credentials. If not specified, default values will be attempted. + // +optional + SecretRef *LocalObjectReference +} + +// Represents a StorageOS persistent volume resource. +type StorageOSPersistentVolumeSource struct { + // VolumeName is the human-readable name of the StorageOS volume. Volume + // names are only unique within a namespace. + VolumeName string + // VolumeNamespace specifies the scope of the volume within StorageOS. If no + // namespace is specified then the Pod's namespace will be used. This allows the + // Kubernetes name scoping to be mirrored within StorageOS for tighter integration. + // Set VolumeName to any name to override the default behaviour. + // Set to "default" if you are not using namespaces within StorageOS. + // Namespaces that do not pre-exist within StorageOS will be created. + // +optional + VolumeNamespace string + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + // Defaults to false (read/write). ReadOnly here will force + // the ReadOnly setting in VolumeMounts. + // +optional + ReadOnly bool + // SecretRef specifies the secret to use for obtaining the StorageOS API + // credentials. If not specified, default values will be attempted. + // +optional + SecretRef *ObjectReference +} + +// Adapts a ConfigMap into a volume. +// +// The contents of the target ConfigMap's Data field will be presented in a +// volume as files using the keys in the Data field as the file names, unless +// the items element is populated with specific mappings of keys to paths. +// ConfigMap volumes support ownership management and SELinux relabeling. +type ConfigMapVolumeSource struct { + LocalObjectReference + // If unspecified, each key-value pair in the Data field of the referenced + // ConfigMap will be projected into the volume as a file whose name is the + // key and content is the value. If specified, the listed keys will be + // projected into the specified paths, and unlisted keys will not be + // present. If a key is specified which is not present in the ConfigMap, + // the volume setup will error unless it is marked optional. Paths must be + // relative and may not contain the '..' path or start with '..'. + // +optional + Items []KeyToPath + // Mode bits to use on created files by default. Must be a value between + // 0 and 0777. + // Directories within the path are not affected by this setting. + // This might be in conflict with other options that affect the file + // mode, like fsGroup, and the result can be other mode bits set. + // +optional + DefaultMode *int32 + // Specify whether the ConfigMap or it's keys must be defined + // +optional + Optional *bool +} + +// Adapts a ConfigMap into a projected volume. +// +// The contents of the target ConfigMap's Data field will be presented in a +// projected volume as files using the keys in the Data field as the file names, +// unless the items element is populated with specific mappings of keys to paths. +// Note that this is identical to a configmap volume source without the default +// mode. +type ConfigMapProjection struct { + LocalObjectReference + // If unspecified, each key-value pair in the Data field of the referenced + // ConfigMap will be projected into the volume as a file whose name is the + // key and content is the value. If specified, the listed keys will be + // projected into the specified paths, and unlisted keys will not be + // present. If a key is specified which is not present in the ConfigMap, + // the volume setup will error unless it is marked optional. Paths must be + // relative and may not contain the '..' path or start with '..'. + // +optional + Items []KeyToPath + // Specify whether the ConfigMap or it's keys must be defined + // +optional + Optional *bool +} + +// Represents a projected volume source +type ProjectedVolumeSource struct { + // list of volume projections + Sources []VolumeProjection + // Mode bits to use on created files by default. Must be a value between + // 0 and 0777. + // Directories within the path are not affected by this setting. + // This might be in conflict with other options that affect the file + // mode, like fsGroup, and the result can be other mode bits set. + // +optional + DefaultMode *int32 +} + +// Projection that may be projected along with other supported volume types +type VolumeProjection struct { + // all types below are the supported types for projection into the same volume + + // information about the secret data to project + Secret *SecretProjection + // information about the downwardAPI data to project + DownwardAPI *DownwardAPIProjection + // information about the configMap data to project + ConfigMap *ConfigMapProjection +} + +// Maps a string key to a path within a volume. +type KeyToPath struct { + // The key to project. + Key string + + // The relative path of the file to map the key to. + // May not be an absolute path. + // May not contain the path element '..'. + // May not start with the string '..'. + Path string + // Optional: mode bits to use on this file, should be a value between 0 + // and 0777. If not specified, the volume defaultMode will be used. + // This might be in conflict with other options that affect the file + // mode, like fsGroup, and the result can be other mode bits set. + // +optional + Mode *int32 +} + +// Local represents directly-attached storage with node affinity +type LocalVolumeSource struct { + // The full path to the volume on the node + // For alpha, this path must be a directory + // Once block as a source is supported, then this path can point to a block device + Path string +} + +// Represents storage that is managed by an external CSI volume driver (Beta feature) +type CSIPersistentVolumeSource struct { + // Driver is the name of the driver to use for this volume. + // Required. + Driver string + + // VolumeHandle is the unique volume name returned by the CSI volume + // plugin’s CreateVolume to refer to the volume on all subsequent calls. + // Required. + VolumeHandle string + + // Optional: The value to pass to ControllerPublishVolumeRequest. + // Defaults to false (read/write). + // +optional + ReadOnly bool + + // Filesystem type to mount. + // Must be a filesystem type supported by the host operating system. + // Ex. "ext4", "xfs", "ntfs". Implicitly inferred to be "ext4" if unspecified. + // +optional + FSType string + + // Attributes of the volume to publish. + // +optional + VolumeAttributes map[string]string + + // ControllerPublishSecretRef is a reference to the secret object containing + // sensitive information to pass to the CSI driver to complete the CSI + // ControllerPublishVolume and ControllerUnpublishVolume calls. + // This field is optional, and may be empty if no secret is required. If the + // secret object contains more than one secret, all secrets are passed. + // +optional + ControllerPublishSecretRef *SecretReference + + // NodeStageSecretRef is a reference to the secret object containing sensitive + // information to pass to the CSI driver to complete the CSI NodeStageVolume + // and NodeStageVolume and NodeUnstageVolume calls. + // This field is optional, and may be empty if no secret is required. If the + // secret object contains more than one secret, all secrets are passed. + // +optional + NodeStageSecretRef *SecretReference + + // NodePublishSecretRef is a reference to the secret object containing + // sensitive information to pass to the CSI driver to complete the CSI + // NodePublishVolume and NodeUnpublishVolume calls. + // This field is optional, and may be empty if no secret is required. If the + // secret object contains more than one secret, all secrets are passed. + // +optional + NodePublishSecretRef *SecretReference +} + +// ContainerPort represents a network port in a single container +type ContainerPort struct { + // Optional: If specified, this must be an IANA_SVC_NAME Each named port + // in a pod must have a unique name. + // +optional + Name string + // Optional: If specified, this must be a valid port number, 0 < x < 65536. + // If HostNetwork is specified, this must match ContainerPort. + // +optional + HostPort int32 + // Required: This must be a valid port number, 0 < x < 65536. + ContainerPort int32 + // Required: Supports "TCP" and "UDP". + // +optional + Protocol Protocol + // Optional: What host IP to bind the external port to. + // +optional + HostIP string +} + +// VolumeMount describes a mounting of a Volume within a container. +type VolumeMount struct { + // Required: This must match the Name of a Volume [above]. + Name string + // Optional: Defaults to false (read-write). + // +optional + ReadOnly bool + // Required. If the path is not an absolute path (e.g. some/path) it + // will be prepended with the appropriate root prefix for the operating + // system. On Linux this is '/', on Windows this is 'C:\'. + MountPath string + // Path within the volume from which the container's volume should be mounted. + // Defaults to "" (volume's root). + // +optional + SubPath string + // mountPropagation determines how mounts are propagated from the host + // to container and the other way around. + // When not set, MountPropagationHostToContainer is used. + // This field is alpha in 1.8 and can be reworked or removed in a future + // release. + // +optional + MountPropagation *MountPropagationMode +} + +// MountPropagationMode describes mount propagation. +type MountPropagationMode string + +const ( + // MountPropagationHostToContainer means that the volume in a container will + // receive new mounts from the host or other containers, but filesystems + // mounted inside the container won't be propagated to the host or other + // containers. + // Note that this mode is recursively applied to all mounts in the volume + // ("rslave" in Linux terminology). + MountPropagationHostToContainer MountPropagationMode = "HostToContainer" + // MountPropagationBidirectional means that the volume in a container will + // receive new mounts from the host or other containers, and its own mounts + // will be propagated from the container to the host or other containers. + // Note that this mode is recursively applied to all mounts in the volume + // ("rshared" in Linux terminology). + MountPropagationBidirectional MountPropagationMode = "Bidirectional" +) + +// VolumeDevice describes a mapping of a raw block device within a container. +type VolumeDevice struct { + // name must match the name of a persistentVolumeClaim in the pod + Name string + // devicePath is the path inside of the container that the device will be mapped to. + DevicePath string +} + +// EnvVar represents an environment variable present in a Container. +type EnvVar struct { + // Required: This must be a C_IDENTIFIER. + Name string + // Optional: no more than one of the following may be specified. + // Optional: Defaults to ""; variable references $(VAR_NAME) are expanded + // using the previous defined environment variables in the container and + // any service environment variables. If a variable cannot be resolved, + // the reference in the input string will be unchanged. The $(VAR_NAME) + // syntax can be escaped with a double $$, ie: $$(VAR_NAME). Escaped + // references will never be expanded, regardless of whether the variable + // exists or not. + // +optional + Value string + // Optional: Specifies a source the value of this var should come from. + // +optional + ValueFrom *EnvVarSource +} + +// EnvVarSource represents a source for the value of an EnvVar. +// Only one of its fields may be set. +type EnvVarSource struct { + // Selects a field of the pod: supports metadata.name, metadata.namespace, metadata.labels, metadata.annotations, + // metadata.uid, spec.nodeName, spec.serviceAccountName, status.hostIP, status.podIP. + // +optional + FieldRef *ObjectFieldSelector + // Selects a resource of the container: only resources limits and requests + // (limits.cpu, limits.memory, limits.ephemeral-storage, requests.cpu, requests.memory and requests.ephemeral-storage) are currently supported. + // +optional + ResourceFieldRef *ResourceFieldSelector + // Selects a key of a ConfigMap. + // +optional + ConfigMapKeyRef *ConfigMapKeySelector + // Selects a key of a secret in the pod's namespace. + // +optional + SecretKeyRef *SecretKeySelector +} + +// ObjectFieldSelector selects an APIVersioned field of an object. +type ObjectFieldSelector struct { + // Required: Version of the schema the FieldPath is written in terms of. + // If no value is specified, it will be defaulted to the APIVersion of the + // enclosing object. + APIVersion string + // Required: Path of the field to select in the specified API version + FieldPath string +} + +// ResourceFieldSelector represents container resources (cpu, memory) and their output format +type ResourceFieldSelector struct { + // Container name: required for volumes, optional for env vars + // +optional + ContainerName string + // Required: resource to select + Resource string + // Specifies the output format of the exposed resources, defaults to "1" + // +optional + Divisor resource.Quantity +} + +// Selects a key from a ConfigMap. +type ConfigMapKeySelector struct { + // The ConfigMap to select from. + LocalObjectReference + // The key to select. + Key string + // Specify whether the ConfigMap or it's key must be defined + // +optional + Optional *bool +} + +// SecretKeySelector selects a key of a Secret. +type SecretKeySelector struct { + // The name of the secret in the pod's namespace to select from. + LocalObjectReference + // The key of the secret to select from. Must be a valid secret key. + Key string + // Specify whether the Secret or it's key must be defined + // +optional + Optional *bool +} + +// EnvFromSource represents the source of a set of ConfigMaps +type EnvFromSource struct { + // An optional identifier to prepend to each key in the ConfigMap. + // +optional + Prefix string + // The ConfigMap to select from. + //+optional + ConfigMapRef *ConfigMapEnvSource + // The Secret to select from. + //+optional + SecretRef *SecretEnvSource +} + +// ConfigMapEnvSource selects a ConfigMap to populate the environment +// variables with. +// +// The contents of the target ConfigMap's Data field will represent the +// key-value pairs as environment variables. +type ConfigMapEnvSource struct { + // The ConfigMap to select from. + LocalObjectReference + // Specify whether the ConfigMap must be defined + // +optional + Optional *bool +} + +// SecretEnvSource selects a Secret to populate the environment +// variables with. +// +// The contents of the target Secret's Data field will represent the +// key-value pairs as environment variables. +type SecretEnvSource struct { + // The Secret to select from. + LocalObjectReference + // Specify whether the Secret must be defined + // +optional + Optional *bool +} + +// HTTPHeader describes a custom header to be used in HTTP probes +type HTTPHeader struct { + // The header field name + Name string + // The header field value + Value string +} + +// HTTPGetAction describes an action based on HTTP Get requests. +type HTTPGetAction struct { + // Optional: Path to access on the HTTP server. + // +optional + Path string + // Required: Name or number of the port to access on the container. + // +optional + Port intstr.IntOrString + // Optional: Host name to connect to, defaults to the pod IP. You + // probably want to set "Host" in httpHeaders instead. + // +optional + Host string + // Optional: Scheme to use for connecting to the host, defaults to HTTP. + // +optional + Scheme URIScheme + // Optional: Custom headers to set in the request. HTTP allows repeated headers. + // +optional + HTTPHeaders []HTTPHeader +} + +// URIScheme identifies the scheme used for connection to a host for Get actions +type URIScheme string + +const ( + // URISchemeHTTP means that the scheme used will be http:// + URISchemeHTTP URIScheme = "HTTP" + // URISchemeHTTPS means that the scheme used will be https:// + URISchemeHTTPS URIScheme = "HTTPS" +) + +// TCPSocketAction describes an action based on opening a socket +type TCPSocketAction struct { + // Required: Port to connect to. + // +optional + Port intstr.IntOrString + // Optional: Host name to connect to, defaults to the pod IP. + // +optional + Host string +} + +// ExecAction describes a "run in container" action. +type ExecAction struct { + // Command is the command line to execute inside the container, the working directory for the + // command is root ('/') in the container's filesystem. The command is simply exec'd, it is + // not run inside a shell, so traditional shell instructions ('|', etc) won't work. To use + // a shell, you need to explicitly call out to that shell. + // +optional + Command []string +} + +// Probe describes a health check to be performed against a container to determine whether it is +// alive or ready to receive traffic. +type Probe struct { + // The action taken to determine the health of a container + Handler + // Length of time before health checking is activated. In seconds. + // +optional + InitialDelaySeconds int32 + // Length of time before health checking times out. In seconds. + // +optional + TimeoutSeconds int32 + // How often (in seconds) to perform the probe. + // +optional + PeriodSeconds int32 + // Minimum consecutive successes for the probe to be considered successful after having failed. + // Must be 1 for liveness. + // +optional + SuccessThreshold int32 + // Minimum consecutive failures for the probe to be considered failed after having succeeded. + // +optional + FailureThreshold int32 +} + +// PullPolicy describes a policy for if/when to pull a container image +type PullPolicy string + +const ( + // PullAlways means that kubelet always attempts to pull the latest image. Container will fail If the pull fails. + PullAlways PullPolicy = "Always" + // PullNever means that kubelet never pulls an image, but only uses a local image. Container will fail if the image isn't present + PullNever PullPolicy = "Never" + // PullIfNotPresent means that kubelet pulls if the image isn't present on disk. Container will fail if the image isn't present and the pull fails. + PullIfNotPresent PullPolicy = "IfNotPresent" +) + +// TerminationMessagePolicy describes how termination messages are retrieved from a container. +type TerminationMessagePolicy string + +const ( + // TerminationMessageReadFile is the default behavior and will set the container status message to + // the contents of the container's terminationMessagePath when the container exits. + TerminationMessageReadFile TerminationMessagePolicy = "File" + // TerminationMessageFallbackToLogsOnError will read the most recent contents of the container logs + // for the container status message when the container exits with an error and the + // terminationMessagePath has no contents. + TerminationMessageFallbackToLogsOnError TerminationMessagePolicy = "FallbackToLogsOnError" +) + +// Capability represent POSIX capabilities type +type Capability string + +// Capabilities represent POSIX capabilities that can be added or removed to a running container. +type Capabilities struct { + // Added capabilities + // +optional + Add []Capability + // Removed capabilities + // +optional + Drop []Capability +} + +// ResourceRequirements describes the compute resource requirements. +type ResourceRequirements struct { + // Limits describes the maximum amount of compute resources allowed. + // +optional + Limits ResourceList + // Requests describes the minimum amount of compute resources required. + // If Request is omitted for a container, it defaults to Limits if that is explicitly specified, + // otherwise to an implementation-defined value + // +optional + Requests ResourceList +} + +// Container represents a single container that is expected to be run on the host. +type Container struct { + // Required: This must be a DNS_LABEL. Each container in a pod must + // have a unique name. + Name string + // Required. + Image string + // Optional: The docker image's entrypoint is used if this is not provided; cannot be updated. + // Variable references $(VAR_NAME) are expanded using the container's environment. If a variable + // cannot be resolved, the reference in the input string will be unchanged. The $(VAR_NAME) syntax + // can be escaped with a double $$, ie: $$(VAR_NAME). Escaped references will never be expanded, + // regardless of whether the variable exists or not. + // +optional + Command []string + // Optional: The docker image's cmd is used if this is not provided; cannot be updated. + // Variable references $(VAR_NAME) are expanded using the container's environment. If a variable + // cannot be resolved, the reference in the input string will be unchanged. The $(VAR_NAME) syntax + // can be escaped with a double $$, ie: $$(VAR_NAME). Escaped references will never be expanded, + // regardless of whether the variable exists or not. + // +optional + Args []string + // Optional: Defaults to Docker's default. + // +optional + WorkingDir string + // +optional + Ports []ContainerPort + // List of sources to populate environment variables in the container. + // The keys defined within a source must be a C_IDENTIFIER. All invalid keys + // will be reported as an event when the container is starting. When a key exists in multiple + // sources, the value associated with the last source will take precedence. + // Values defined by an Env with a duplicate key will take precedence. + // Cannot be updated. + // +optional + EnvFrom []EnvFromSource + // +optional + Env []EnvVar + // Compute resource requirements. + // +optional + Resources ResourceRequirements + // +optional + VolumeMounts []VolumeMount + // volumeDevices is the list of block devices to be used by the container. + // This is an alpha feature and may change in the future. + // +optional + VolumeDevices []VolumeDevice + // +optional + LivenessProbe *Probe + // +optional + ReadinessProbe *Probe + // +optional + Lifecycle *Lifecycle + // Required. + // +optional + TerminationMessagePath string + // +optional + TerminationMessagePolicy TerminationMessagePolicy + // Required: Policy for pulling images for this container + ImagePullPolicy PullPolicy + // Optional: SecurityContext defines the security options the container should be run with. + // If set, the fields of SecurityContext override the equivalent fields of PodSecurityContext. + // +optional + SecurityContext *SecurityContext + + // Variables for interactive containers, these have very specialized use-cases (e.g. debugging) + // and shouldn't be used for general purpose containers. + // +optional + Stdin bool + // +optional + StdinOnce bool + // +optional + TTY bool +} + +// Handler defines a specific action that should be taken +// TODO: pass structured data to these actions, and document that data here. +type Handler struct { + // One and only one of the following should be specified. + // Exec specifies the action to take. + // +optional + Exec *ExecAction + // HTTPGet specifies the http request to perform. + // +optional + HTTPGet *HTTPGetAction + // TCPSocket specifies an action involving a TCP port. + // TODO: implement a realistic TCP lifecycle hook + // +optional + TCPSocket *TCPSocketAction +} + +// Lifecycle describes actions that the management system should take in response to container lifecycle +// events. For the PostStart and PreStop lifecycle handlers, management of the container blocks +// until the action is complete, unless the container process fails, in which case the handler is aborted. +type Lifecycle struct { + // PostStart is called immediately after a container is created. If the handler fails, the container + // is terminated and restarted. + // +optional + PostStart *Handler + // PreStop is called immediately before a container is terminated. The reason for termination is + // passed to the handler. Regardless of the outcome of the handler, the container is eventually terminated. + // +optional + PreStop *Handler +} + +// The below types are used by kube_client and api_server. + +type ConditionStatus string + +// These are valid condition statuses. "ConditionTrue" means a resource is in the condition; +// "ConditionFalse" means a resource is not in the condition; "ConditionUnknown" means kubernetes +// can't decide if a resource is in the condition or not. In the future, we could add other +// intermediate conditions, e.g. ConditionDegraded. +const ( + ConditionTrue ConditionStatus = "True" + ConditionFalse ConditionStatus = "False" + ConditionUnknown ConditionStatus = "Unknown" +) + +type ContainerStateWaiting struct { + // A brief CamelCase string indicating details about why the container is in waiting state. + // +optional + Reason string + // A human-readable message indicating details about why the container is in waiting state. + // +optional + Message string +} + +type ContainerStateRunning struct { + // +optional + StartedAt metav1.Time +} + +type ContainerStateTerminated struct { + ExitCode int32 + // +optional + Signal int32 + // +optional + Reason string + // +optional + Message string + // +optional + StartedAt metav1.Time + // +optional + FinishedAt metav1.Time + // +optional + ContainerID string +} + +// ContainerState holds a possible state of container. +// Only one of its members may be specified. +// If none of them is specified, the default one is ContainerStateWaiting. +type ContainerState struct { + // +optional + Waiting *ContainerStateWaiting + // +optional + Running *ContainerStateRunning + // +optional + Terminated *ContainerStateTerminated +} + +type ContainerStatus struct { + // Each container in a pod must have a unique name. + Name string + // +optional + State ContainerState + // +optional + LastTerminationState ContainerState + // Ready specifies whether the container has passed its readiness check. + Ready bool + // Note that this is calculated from dead containers. But those containers are subject to + // garbage collection. This value will get capped at 5 by GC. + RestartCount int32 + Image string + ImageID string + // +optional + ContainerID string +} + +// PodPhase is a label for the condition of a pod at the current time. +type PodPhase string + +// These are the valid statuses of pods. +const ( + // PodPending means the pod has been accepted by the system, but one or more of the containers + // has not been started. This includes time before being bound to a node, as well as time spent + // pulling images onto the host. + PodPending PodPhase = "Pending" + // PodRunning means the pod has been bound to a node and all of the containers have been started. + // At least one container is still running or is in the process of being restarted. + PodRunning PodPhase = "Running" + // PodSucceeded means that all containers in the pod have voluntarily terminated + // with a container exit code of 0, and the system is not going to restart any of these containers. + PodSucceeded PodPhase = "Succeeded" + // PodFailed means that all containers in the pod have terminated, and at least one container has + // terminated in a failure (exited with a non-zero exit code or was stopped by the system). + PodFailed PodPhase = "Failed" + // PodUnknown means that for some reason the state of the pod could not be obtained, typically due + // to an error in communicating with the host of the pod. + PodUnknown PodPhase = "Unknown" +) + +type PodConditionType string + +// These are valid conditions of pod. +const ( + // PodScheduled represents status of the scheduling process for this pod. + PodScheduled PodConditionType = "PodScheduled" + // PodReady means the pod is able to service requests and should be added to the + // load balancing pools of all matching services. + PodReady PodConditionType = "Ready" + // PodInitialized means that all init containers in the pod have started successfully. + PodInitialized PodConditionType = "Initialized" + // PodReasonUnschedulable reason in PodScheduled PodCondition means that the scheduler + // can't schedule the pod right now, for example due to insufficient resources in the cluster. + PodReasonUnschedulable = "Unschedulable" +) + +type PodCondition struct { + Type PodConditionType + Status ConditionStatus + // +optional + LastProbeTime metav1.Time + // +optional + LastTransitionTime metav1.Time + // +optional + Reason string + // +optional + Message string +} + +// RestartPolicy describes how the container should be restarted. +// Only one of the following restart policies may be specified. +// If none of the following policies is specified, the default one +// is RestartPolicyAlways. +type RestartPolicy string + +const ( + RestartPolicyAlways RestartPolicy = "Always" + RestartPolicyOnFailure RestartPolicy = "OnFailure" + RestartPolicyNever RestartPolicy = "Never" +) + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodList is a list of Pods. +type PodList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Pod +} + +// DNSPolicy defines how a pod's DNS will be configured. +type DNSPolicy string + +const ( + // DNSClusterFirstWithHostNet indicates that the pod should use cluster DNS + // first, if it is available, then fall back on the default + // (as determined by kubelet) DNS settings. + DNSClusterFirstWithHostNet DNSPolicy = "ClusterFirstWithHostNet" + + // DNSClusterFirst indicates that the pod should use cluster DNS + // first unless hostNetwork is true, if it is available, then + // fall back on the default (as determined by kubelet) DNS settings. + DNSClusterFirst DNSPolicy = "ClusterFirst" + + // DNSDefault indicates that the pod should use the default (as + // determined by kubelet) DNS settings. + DNSDefault DNSPolicy = "Default" + + // DNSNone indicates that the pod should use empty DNS settings. DNS + // parameters such as nameservers and search paths should be defined via + // DNSConfig. + DNSNone DNSPolicy = "None" +) + +// A node selector represents the union of the results of one or more label queries +// over a set of nodes; that is, it represents the OR of the selectors represented +// by the node selector terms. +type NodeSelector struct { + //Required. A list of node selector terms. The terms are ORed. + NodeSelectorTerms []NodeSelectorTerm +} + +// A null or empty node selector term matches no objects. +type NodeSelectorTerm struct { + //Required. A list of node selector requirements. The requirements are ANDed. + MatchExpressions []NodeSelectorRequirement +} + +// A node selector requirement is a selector that contains values, a key, and an operator +// that relates the key and values. +type NodeSelectorRequirement struct { + // The label key that the selector applies to. + Key string + // Represents a key's relationship to a set of values. + // Valid operators are In, NotIn, Exists, DoesNotExist. Gt, and Lt. + Operator NodeSelectorOperator + // An array of string values. If the operator is In or NotIn, + // the values array must be non-empty. If the operator is Exists or DoesNotExist, + // the values array must be empty. If the operator is Gt or Lt, the values + // array must have a single element, which will be interpreted as an integer. + // This array is replaced during a strategic merge patch. + // +optional + Values []string +} + +// A node selector operator is the set of operators that can be used in +// a node selector requirement. +type NodeSelectorOperator string + +const ( + NodeSelectorOpIn NodeSelectorOperator = "In" + NodeSelectorOpNotIn NodeSelectorOperator = "NotIn" + NodeSelectorOpExists NodeSelectorOperator = "Exists" + NodeSelectorOpDoesNotExist NodeSelectorOperator = "DoesNotExist" + NodeSelectorOpGt NodeSelectorOperator = "Gt" + NodeSelectorOpLt NodeSelectorOperator = "Lt" +) + +// Affinity is a group of affinity scheduling rules. +type Affinity struct { + // Describes node affinity scheduling rules for the pod. + // +optional + NodeAffinity *NodeAffinity + // Describes pod affinity scheduling rules (e.g. co-locate this pod in the same node, zone, etc. as some other pod(s)). + // +optional + PodAffinity *PodAffinity + // Describes pod anti-affinity scheduling rules (e.g. avoid putting this pod in the same node, zone, etc. as some other pod(s)). + // +optional + PodAntiAffinity *PodAntiAffinity +} + +// Pod affinity is a group of inter pod affinity scheduling rules. +type PodAffinity struct { + // NOT YET IMPLEMENTED. TODO: Uncomment field once it is implemented. + // If the affinity requirements specified by this field are not met at + // scheduling time, the pod will not be scheduled onto the node. + // If the affinity requirements specified by this field cease to be met + // at some point during pod execution (e.g. due to a pod label update), the + // system will try to eventually evict the pod from its node. + // When there are multiple elements, the lists of nodes corresponding to each + // podAffinityTerm are intersected, i.e. all terms must be satisfied. + // +optional + // RequiredDuringSchedulingRequiredDuringExecution []PodAffinityTerm + + // If the affinity requirements specified by this field are not met at + // scheduling time, the pod will not be scheduled onto the node. + // If the affinity requirements specified by this field cease to be met + // at some point during pod execution (e.g. due to a pod label update), the + // system may or may not try to eventually evict the pod from its node. + // When there are multiple elements, the lists of nodes corresponding to each + // podAffinityTerm are intersected, i.e. all terms must be satisfied. + // +optional + RequiredDuringSchedulingIgnoredDuringExecution []PodAffinityTerm + // The scheduler will prefer to schedule pods to nodes that satisfy + // the affinity expressions specified by this field, but it may choose + // a node that violates one or more of the expressions. The node that is + // most preferred is the one with the greatest sum of weights, i.e. + // for each node that meets all of the scheduling requirements (resource + // request, requiredDuringScheduling affinity expressions, etc.), + // compute a sum by iterating through the elements of this field and adding + // "weight" to the sum if the node has pods which matches the corresponding podAffinityTerm; the + // node(s) with the highest sum are the most preferred. + // +optional + PreferredDuringSchedulingIgnoredDuringExecution []WeightedPodAffinityTerm +} + +// Pod anti affinity is a group of inter pod anti affinity scheduling rules. +type PodAntiAffinity struct { + // NOT YET IMPLEMENTED. TODO: Uncomment field once it is implemented. + // If the anti-affinity requirements specified by this field are not met at + // scheduling time, the pod will not be scheduled onto the node. + // If the anti-affinity requirements specified by this field cease to be met + // at some point during pod execution (e.g. due to a pod label update), the + // system will try to eventually evict the pod from its node. + // When there are multiple elements, the lists of nodes corresponding to each + // podAffinityTerm are intersected, i.e. all terms must be satisfied. + // +optional + // RequiredDuringSchedulingRequiredDuringExecution []PodAffinityTerm + + // If the anti-affinity requirements specified by this field are not met at + // scheduling time, the pod will not be scheduled onto the node. + // If the anti-affinity requirements specified by this field cease to be met + // at some point during pod execution (e.g. due to a pod label update), the + // system may or may not try to eventually evict the pod from its node. + // When there are multiple elements, the lists of nodes corresponding to each + // podAffinityTerm are intersected, i.e. all terms must be satisfied. + // +optional + RequiredDuringSchedulingIgnoredDuringExecution []PodAffinityTerm + // The scheduler will prefer to schedule pods to nodes that satisfy + // the anti-affinity expressions specified by this field, but it may choose + // a node that violates one or more of the expressions. The node that is + // most preferred is the one with the greatest sum of weights, i.e. + // for each node that meets all of the scheduling requirements (resource + // request, requiredDuringScheduling anti-affinity expressions, etc.), + // compute a sum by iterating through the elements of this field and adding + // "weight" to the sum if the node has pods which matches the corresponding podAffinityTerm; the + // node(s) with the highest sum are the most preferred. + // +optional + PreferredDuringSchedulingIgnoredDuringExecution []WeightedPodAffinityTerm +} + +// The weights of all of the matched WeightedPodAffinityTerm fields are added per-node to find the most preferred node(s) +type WeightedPodAffinityTerm struct { + // weight associated with matching the corresponding podAffinityTerm, + // in the range 1-100. + Weight int32 + // Required. A pod affinity term, associated with the corresponding weight. + PodAffinityTerm PodAffinityTerm +} + +// Defines a set of pods (namely those matching the labelSelector +// relative to the given namespace(s)) that this pod should be +// co-located (affinity) or not co-located (anti-affinity) with, +// where co-located is defined as running on a node whose value of +// the label with key <topologyKey> matches that of any node on which +// a pod of the set of pods is running. +type PodAffinityTerm struct { + // A label query over a set of resources, in this case pods. + // +optional + LabelSelector *metav1.LabelSelector + // namespaces specifies which namespaces the labelSelector applies to (matches against); + // null or empty list means "this pod's namespace" + // +optional + Namespaces []string + // This pod should be co-located (affinity) or not co-located (anti-affinity) with the pods matching + // the labelSelector in the specified namespaces, where co-located is defined as running on a node + // whose value of the label with key topologyKey matches that of any node on which any of the + // selected pods is running. + // Empty topologyKey is not allowed. + TopologyKey string +} + +// Node affinity is a group of node affinity scheduling rules. +type NodeAffinity struct { + // NOT YET IMPLEMENTED. TODO: Uncomment field once it is implemented. + // If the affinity requirements specified by this field are not met at + // scheduling time, the pod will not be scheduled onto the node. + // If the affinity requirements specified by this field cease to be met + // at some point during pod execution (e.g. due to an update), the system + // will try to eventually evict the pod from its node. + // +optional + // RequiredDuringSchedulingRequiredDuringExecution *NodeSelector + + // If the affinity requirements specified by this field are not met at + // scheduling time, the pod will not be scheduled onto the node. + // If the affinity requirements specified by this field cease to be met + // at some point during pod execution (e.g. due to an update), the system + // may or may not try to eventually evict the pod from its node. + // +optional + RequiredDuringSchedulingIgnoredDuringExecution *NodeSelector + // The scheduler will prefer to schedule pods to nodes that satisfy + // the affinity expressions specified by this field, but it may choose + // a node that violates one or more of the expressions. The node that is + // most preferred is the one with the greatest sum of weights, i.e. + // for each node that meets all of the scheduling requirements (resource + // request, requiredDuringScheduling affinity expressions, etc.), + // compute a sum by iterating through the elements of this field and adding + // "weight" to the sum if the node matches the corresponding matchExpressions; the + // node(s) with the highest sum are the most preferred. + // +optional + PreferredDuringSchedulingIgnoredDuringExecution []PreferredSchedulingTerm +} + +// An empty preferred scheduling term matches all objects with implicit weight 0 +// (i.e. it's a no-op). A null preferred scheduling term matches no objects (i.e. is also a no-op). +type PreferredSchedulingTerm struct { + // Weight associated with matching the corresponding nodeSelectorTerm, in the range 1-100. + Weight int32 + // A node selector term, associated with the corresponding weight. + Preference NodeSelectorTerm +} + +// The node this Taint is attached to has the "effect" on +// any pod that does not tolerate the Taint. +type Taint struct { + // Required. The taint key to be applied to a node. + Key string + // Required. The taint value corresponding to the taint key. + // +optional + Value string + // Required. The effect of the taint on pods + // that do not tolerate the taint. + // Valid effects are NoSchedule, PreferNoSchedule and NoExecute. + Effect TaintEffect + // TimeAdded represents the time at which the taint was added. + // It is only written for NoExecute taints. + // +optional + TimeAdded *metav1.Time +} + +type TaintEffect string + +const ( + // Do not allow new pods to schedule onto the node unless they tolerate the taint, + // but allow all pods submitted to Kubelet without going through the scheduler + // to start, and allow all already-running pods to continue running. + // Enforced by the scheduler. + TaintEffectNoSchedule TaintEffect = "NoSchedule" + // Like TaintEffectNoSchedule, but the scheduler tries not to schedule + // new pods onto the node, rather than prohibiting new pods from scheduling + // onto the node entirely. Enforced by the scheduler. + TaintEffectPreferNoSchedule TaintEffect = "PreferNoSchedule" + // NOT YET IMPLEMENTED. TODO: Uncomment field once it is implemented. + // Like TaintEffectNoSchedule, but additionally do not allow pods submitted to + // Kubelet without going through the scheduler to start. + // Enforced by Kubelet and the scheduler. + // TaintEffectNoScheduleNoAdmit TaintEffect = "NoScheduleNoAdmit" + + // Evict any already-running pods that do not tolerate the taint. + // Currently enforced by NodeController. + TaintEffectNoExecute TaintEffect = "NoExecute" +) + +// The pod this Toleration is attached to tolerates any taint that matches +// the triple <key,value,effect> using the matching operator <operator>. +type Toleration struct { + // Key is the taint key that the toleration applies to. Empty means match all taint keys. + // If the key is empty, operator must be Exists; this combination means to match all values and all keys. + // +optional + Key string + // Operator represents a key's relationship to the value. + // Valid operators are Exists and Equal. Defaults to Equal. + // Exists is equivalent to wildcard for value, so that a pod can + // tolerate all taints of a particular category. + // +optional + Operator TolerationOperator + // Value is the taint value the toleration matches to. + // If the operator is Exists, the value should be empty, otherwise just a regular string. + // +optional + Value string + // Effect indicates the taint effect to match. Empty means match all taint effects. + // When specified, allowed values are NoSchedule, PreferNoSchedule and NoExecute. + // +optional + Effect TaintEffect + // TolerationSeconds represents the period of time the toleration (which must be + // of effect NoExecute, otherwise this field is ignored) tolerates the taint. By default, + // it is not set, which means tolerate the taint forever (do not evict). Zero and + // negative values will be treated as 0 (evict immediately) by the system. + // +optional + TolerationSeconds *int64 +} + +// A toleration operator is the set of operators that can be used in a toleration. +type TolerationOperator string + +const ( + TolerationOpExists TolerationOperator = "Exists" + TolerationOpEqual TolerationOperator = "Equal" +) + +// PodSpec is a description of a pod +type PodSpec struct { + Volumes []Volume + // List of initialization containers belonging to the pod. + InitContainers []Container + // List of containers belonging to the pod. + Containers []Container + // +optional + RestartPolicy RestartPolicy + // Optional duration in seconds the pod needs to terminate gracefully. May be decreased in delete request. + // Value must be non-negative integer. The value zero indicates delete immediately. + // If this value is nil, the default grace period will be used instead. + // The grace period is the duration in seconds after the processes running in the pod are sent + // a termination signal and the time when the processes are forcibly halted with a kill signal. + // Set this value longer than the expected cleanup time for your process. + // +optional + TerminationGracePeriodSeconds *int64 + // Optional duration in seconds relative to the StartTime that the pod may be active on a node + // before the system actively tries to terminate the pod; value must be positive integer + // +optional + ActiveDeadlineSeconds *int64 + // Set DNS policy for the pod. + // Defaults to "ClusterFirst". + // Valid values are 'ClusterFirstWithHostNet', 'ClusterFirst', 'Default' or 'None'. + // DNS parameters given in DNSConfig will be merged with the policy selected with DNSPolicy. + // To have DNS options set along with hostNetwork, you have to specify DNS policy + // explicitly to 'ClusterFirstWithHostNet'. + // +optional + DNSPolicy DNSPolicy + // NodeSelector is a selector which must be true for the pod to fit on a node + // +optional + NodeSelector map[string]string + + // ServiceAccountName is the name of the ServiceAccount to use to run this pod + // The pod will be allowed to use secrets referenced by the ServiceAccount + ServiceAccountName string + // AutomountServiceAccountToken indicates whether a service account token should be automatically mounted. + // +optional + AutomountServiceAccountToken *bool + + // NodeName is a request to schedule this pod onto a specific node. If it is non-empty, + // the scheduler simply schedules this pod onto that node, assuming that it fits resource + // requirements. + // +optional + NodeName string + // SecurityContext holds pod-level security attributes and common container settings. + // Optional: Defaults to empty. See type description for default values of each field. + // +optional + SecurityContext *PodSecurityContext + // ImagePullSecrets is an optional list of references to secrets in the same namespace to use for pulling any of the images used by this PodSpec. + // If specified, these secrets will be passed to individual puller implementations for them to use. For example, + // in the case of docker, only DockerConfig type secrets are honored. + // +optional + ImagePullSecrets []LocalObjectReference + // Specifies the hostname of the Pod. + // If not specified, the pod's hostname will be set to a system-defined value. + // +optional + Hostname string + // If specified, the fully qualified Pod hostname will be "<hostname>.<subdomain>.<pod namespace>.svc.<cluster domain>". + // If not specified, the pod will not have a domainname at all. + // +optional + Subdomain string + // If specified, the pod's scheduling constraints + // +optional + Affinity *Affinity + // If specified, the pod will be dispatched by specified scheduler. + // If not specified, the pod will be dispatched by default scheduler. + // +optional + SchedulerName string + // If specified, the pod's tolerations. + // +optional + Tolerations []Toleration + // HostAliases is an optional list of hosts and IPs that will be injected into the pod's hosts + // file if specified. This is only valid for non-hostNetwork pods. + // +optional + HostAliases []HostAlias + // If specified, indicates the pod's priority. "system-node-critical" and + // "system-cluster-critical" are two special keywords which indicate the + // highest priorities with the former being the highest priority. Any other + // name must be defined by creating a PriorityClass object with that name. + // If not specified, the pod priority will be default or zero if there is no + // default. + // +optional + PriorityClassName string + // The priority value. Various system components use this field to find the + // priority of the pod. When Priority Admission Controller is enabled, it + // prevents users from setting this field. The admission controller populates + // this field from PriorityClassName. + // The higher the value, the higher the priority. + // +optional + Priority *int32 + // Specifies the DNS parameters of a pod. + // Parameters specified here will be merged to the generated DNS + // configuration based on DNSPolicy. + // +optional + DNSConfig *PodDNSConfig +} + +// HostAlias holds the mapping between IP and hostnames that will be injected as an entry in the +// pod's hosts file. +type HostAlias struct { + IP string + Hostnames []string +} + +// Sysctl defines a kernel parameter to be set +type Sysctl struct { + // Name of a property to set + Name string + // Value of a property to set + Value string +} + +// PodSecurityContext holds pod-level security attributes and common container settings. +// Some fields are also present in container.securityContext. Field values of +// container.securityContext take precedence over field values of PodSecurityContext. +type PodSecurityContext struct { + // Use the host's network namespace. If this option is set, the ports that will be + // used must be specified. + // Optional: Default to false + // +k8s:conversion-gen=false + // +optional + HostNetwork bool + // Use the host's pid namespace. + // Optional: Default to false. + // +k8s:conversion-gen=false + // +optional + HostPID bool + // Use the host's ipc namespace. + // Optional: Default to false. + // +k8s:conversion-gen=false + // +optional + HostIPC bool + // Share a single process namespace between all of the containers in a pod. + // When this is set containers will be able to view and signal processes from other containers + // in the same pod, and the first process in each container will not be assigned PID 1. + // HostPID and ShareProcessNamespace cannot both be set. + // Optional: Default to false. + // This field is alpha-level and is honored only by servers that enable the PodShareProcessNamespace feature. + // +k8s:conversion-gen=false + // +optional + ShareProcessNamespace *bool + // The SELinux context to be applied to all containers. + // If unspecified, the container runtime will allocate a random SELinux context for each + // container. May also be set in SecurityContext. If set in + // both SecurityContext and PodSecurityContext, the value specified in SecurityContext + // takes precedence for that container. + // +optional + SELinuxOptions *SELinuxOptions + // The UID to run the entrypoint of the container process. + // Defaults to user specified in image metadata if unspecified. + // May also be set in SecurityContext. If set in both SecurityContext and + // PodSecurityContext, the value specified in SecurityContext takes precedence + // for that container. + // +optional + RunAsUser *int64 + // Indicates that the container must run as a non-root user. + // If true, the Kubelet will validate the image at runtime to ensure that it + // does not run as UID 0 (root) and fail to start the container if it does. + // If unset or false, no such validation will be performed. + // May also be set in SecurityContext. If set in both SecurityContext and + // PodSecurityContext, the value specified in SecurityContext takes precedence. + // +optional + RunAsNonRoot *bool + // A list of groups applied to the first process run in each container, in addition + // to the container's primary GID. If unspecified, no groups will be added to + // any container. + // +optional + SupplementalGroups []int64 + // A special supplemental group that applies to all containers in a pod. + // Some volume types allow the Kubelet to change the ownership of that volume + // to be owned by the pod: + // + // 1. The owning GID will be the FSGroup + // 2. The setgid bit is set (new files created in the volume will be owned by FSGroup) + // 3. The permission bits are OR'd with rw-rw---- + // + // If unset, the Kubelet will not modify the ownership and permissions of any volume. + // +optional + FSGroup *int64 +} + +// PodQOSClass defines the supported qos classes of Pods. +type PodQOSClass string + +const ( + // PodQOSGuaranteed is the Guaranteed qos class. + PodQOSGuaranteed PodQOSClass = "Guaranteed" + // PodQOSBurstable is the Burstable qos class. + PodQOSBurstable PodQOSClass = "Burstable" + // PodQOSBestEffort is the BestEffort qos class. + PodQOSBestEffort PodQOSClass = "BestEffort" +) + +// PodDNSConfig defines the DNS parameters of a pod in addition to +// those generated from DNSPolicy. +type PodDNSConfig struct { + // A list of DNS name server IP addresses. + // This will be appended to the base nameservers generated from DNSPolicy. + // Duplicated nameservers will be removed. + // +optional + Nameservers []string + // A list of DNS search domains for host-name lookup. + // This will be appended to the base search paths generated from DNSPolicy. + // Duplicated search paths will be removed. + // +optional + Searches []string + // A list of DNS resolver options. + // This will be merged with the base options generated from DNSPolicy. + // Duplicated entries will be removed. Resolution options given in Options + // will override those that appear in the base DNSPolicy. + // +optional + Options []PodDNSConfigOption +} + +// PodDNSConfigOption defines DNS resolver options of a pod. +type PodDNSConfigOption struct { + // Required. + Name string + // +optional + Value *string +} + +// PodStatus represents information about the status of a pod. Status may trail the actual +// state of a system. +type PodStatus struct { + // +optional + Phase PodPhase + // +optional + Conditions []PodCondition + // A human readable message indicating details about why the pod is in this state. + // +optional + Message string + // A brief CamelCase message indicating details about why the pod is in this state. e.g. 'Evicted' + // +optional + Reason string + // nominatedNodeName is set when this pod preempts other pods on the node, but it cannot be + // scheduled right away as preemption victims receive their graceful termination periods. + // This field does not guarantee that the pod will be scheduled on this node. Scheduler may decide + // to place the pod elsewhere if other nodes become available sooner. Scheduler may also decide to + // give the resources on this node to a higher priority pod that is created after preemption. + // +optional + NominatedNodeName string + + // +optional + HostIP string + // +optional + PodIP string + + // Date and time at which the object was acknowledged by the Kubelet. + // This is before the Kubelet pulled the container image(s) for the pod. + // +optional + StartTime *metav1.Time + // +optional + QOSClass PodQOSClass + + // The list has one entry per init container in the manifest. The most recent successful + // init container will have ready = true, the most recently started container will have + // startTime set. + // More info: https://kubernetes.io/docs/concepts/workloads/pods/pod-lifecycle/#pod-and-container-status + InitContainerStatuses []ContainerStatus + // The list has one entry per container in the manifest. Each entry is + // currently the output of `docker inspect`. This output format is *not* + // final and should not be relied upon. + // TODO: Make real decisions about what our info should look like. Re-enable fuzz test + // when we have done this. + // +optional + ContainerStatuses []ContainerStatus +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodStatusResult is a wrapper for PodStatus returned by kubelet that can be encode/decoded +type PodStatusResult struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + // Status represents the current information about a pod. This data may not be up + // to date. + // +optional + Status PodStatus +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Pod is a collection of containers, used as either input (create, update) or as output (list, get). +type Pod struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the behavior of a pod. + // +optional + Spec PodSpec + + // Status represents the current information about a pod. This data may not be up + // to date. + // +optional + Status PodStatus +} + +// PodTemplateSpec describes the data a pod should have when created from a template +type PodTemplateSpec struct { + // Metadata of the pods created from this template. + // +optional + metav1.ObjectMeta + + // Spec defines the behavior of a pod. + // +optional + Spec PodSpec +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodTemplate describes a template for creating copies of a predefined pod. +type PodTemplate struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Template defines the pods that will be created from this pod template + // +optional + Template PodTemplateSpec +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodTemplateList is a list of PodTemplates. +type PodTemplateList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []PodTemplate +} + +// ReplicationControllerSpec is the specification of a replication controller. +// As the internal representation of a replication controller, it may have either +// a TemplateRef or a Template set. +type ReplicationControllerSpec struct { + // Replicas is the number of desired replicas. + Replicas int32 + + // Minimum number of seconds for which a newly created pod should be ready + // without any of its container crashing, for it to be considered available. + // Defaults to 0 (pod will be considered available as soon as it is ready) + // +optional + MinReadySeconds int32 + + // Selector is a label query over pods that should match the Replicas count. + Selector map[string]string + + // TemplateRef is a reference to an object that describes the pod that will be created if + // insufficient replicas are detected. This reference is ignored if a Template is set. + // Must be set before converting to a versioned API object + // +optional + //TemplateRef *ObjectReference + + // Template is the object that describes the pod that will be created if + // insufficient replicas are detected. Internally, this takes precedence over a + // TemplateRef. + // +optional + Template *PodTemplateSpec +} + +// ReplicationControllerStatus represents the current status of a replication +// controller. +type ReplicationControllerStatus struct { + // Replicas is the number of actual replicas. + Replicas int32 + + // The number of pods that have labels matching the labels of the pod template of the replication controller. + // +optional + FullyLabeledReplicas int32 + + // The number of ready replicas for this replication controller. + // +optional + ReadyReplicas int32 + + // The number of available replicas (ready for at least minReadySeconds) for this replication controller. + // +optional + AvailableReplicas int32 + + // ObservedGeneration is the most recent generation observed by the controller. + // +optional + ObservedGeneration int64 + + // Represents the latest available observations of a replication controller's current state. + // +optional + Conditions []ReplicationControllerCondition +} + +type ReplicationControllerConditionType string + +// These are valid conditions of a replication controller. +const ( + // ReplicationControllerReplicaFailure is added in a replication controller when one of its pods + // fails to be created due to insufficient quota, limit ranges, pod security policy, node selectors, + // etc. or deleted due to kubelet being down or finalizers are failing. + ReplicationControllerReplicaFailure ReplicationControllerConditionType = "ReplicaFailure" +) + +// ReplicationControllerCondition describes the state of a replication controller at a certain point. +type ReplicationControllerCondition struct { + // Type of replication controller condition. + Type ReplicationControllerConditionType + // Status of the condition, one of True, False, Unknown. + Status ConditionStatus + // The last time the condition transitioned from one status to another. + // +optional + LastTransitionTime metav1.Time + // The reason for the condition's last transition. + // +optional + Reason string + // A human readable message indicating details about the transition. + // +optional + Message string +} + +// +genclient +// +genclient:method=GetScale,verb=get,subresource=scale,result=k8s.io/kubernetes/pkg/apis/autoscaling.Scale +// +genclient:method=UpdateScale,verb=update,subresource=scale,input=k8s.io/kubernetes/pkg/apis/autoscaling.Scale,result=k8s.io/kubernetes/pkg/apis/autoscaling.Scale +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ReplicationController represents the configuration of a replication controller. +type ReplicationController struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the desired behavior of this replication controller. + // +optional + Spec ReplicationControllerSpec + + // Status is the current status of this replication controller. This data may be + // out of date by some window of time. + // +optional + Status ReplicationControllerStatus +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ReplicationControllerList is a collection of replication controllers. +type ReplicationControllerList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []ReplicationController +} + +const ( + // ClusterIPNone - do not assign a cluster IP + // no proxying required and no environment variables should be created for pods + ClusterIPNone = "None" +) + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ServiceList holds a list of services. +type ServiceList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Service +} + +// Session Affinity Type string +type ServiceAffinity string + +const ( + // ServiceAffinityClientIP is the Client IP based. + ServiceAffinityClientIP ServiceAffinity = "ClientIP" + + // ServiceAffinityNone - no session affinity. + ServiceAffinityNone ServiceAffinity = "None" +) + +const ( + // DefaultClientIPServiceAffinitySeconds is the default timeout seconds + // of Client IP based session affinity - 3 hours. + DefaultClientIPServiceAffinitySeconds int32 = 10800 + // MaxClientIPServiceAffinitySeconds is the max timeout seconds + // of Client IP based session affinity - 1 day. + MaxClientIPServiceAffinitySeconds int32 = 86400 +) + +// SessionAffinityConfig represents the configurations of session affinity. +type SessionAffinityConfig struct { + // clientIP contains the configurations of Client IP based session affinity. + // +optional + ClientIP *ClientIPConfig +} + +// ClientIPConfig represents the configurations of Client IP based session affinity. +type ClientIPConfig struct { + // timeoutSeconds specifies the seconds of ClientIP type session sticky time. + // The value must be >0 && <=86400(for 1 day) if ServiceAffinity == "ClientIP". + // Default value is 10800(for 3 hours). + // +optional + TimeoutSeconds *int32 +} + +// Service Type string describes ingress methods for a service +type ServiceType string + +const ( + // ServiceTypeClusterIP means a service will only be accessible inside the + // cluster, via the ClusterIP. + ServiceTypeClusterIP ServiceType = "ClusterIP" + + // ServiceTypeNodePort means a service will be exposed on one port of + // every node, in addition to 'ClusterIP' type. + ServiceTypeNodePort ServiceType = "NodePort" + + // ServiceTypeLoadBalancer means a service will be exposed via an + // external load balancer (if the cloud provider supports it), in addition + // to 'NodePort' type. + ServiceTypeLoadBalancer ServiceType = "LoadBalancer" + + // ServiceTypeExternalName means a service consists of only a reference to + // an external name that kubedns or equivalent will return as a CNAME + // record, with no exposing or proxying of any pods involved. + ServiceTypeExternalName ServiceType = "ExternalName" +) + +// Service External Traffic Policy Type string +type ServiceExternalTrafficPolicyType string + +const ( + // ServiceExternalTrafficPolicyTypeLocal specifies node-local endpoints behavior. + ServiceExternalTrafficPolicyTypeLocal ServiceExternalTrafficPolicyType = "Local" + // ServiceExternalTrafficPolicyTypeCluster specifies cluster-wide (legacy) behavior. + ServiceExternalTrafficPolicyTypeCluster ServiceExternalTrafficPolicyType = "Cluster" +) + +// ServiceStatus represents the current status of a service +type ServiceStatus struct { + // LoadBalancer contains the current status of the load-balancer, + // if one is present. + // +optional + LoadBalancer LoadBalancerStatus +} + +// LoadBalancerStatus represents the status of a load-balancer +type LoadBalancerStatus struct { + // Ingress is a list containing ingress points for the load-balancer; + // traffic intended for the service should be sent to these ingress points. + // +optional + Ingress []LoadBalancerIngress +} + +// LoadBalancerIngress represents the status of a load-balancer ingress point: +// traffic intended for the service should be sent to an ingress point. +type LoadBalancerIngress struct { + // IP is set for load-balancer ingress points that are IP based + // (typically GCE or OpenStack load-balancers) + // +optional + IP string + + // Hostname is set for load-balancer ingress points that are DNS based + // (typically AWS load-balancers) + // +optional + Hostname string +} + +// ServiceSpec describes the attributes that a user creates on a service +type ServiceSpec struct { + // Type determines how the Service is exposed. Defaults to ClusterIP. Valid + // options are ExternalName, ClusterIP, NodePort, and LoadBalancer. + // "ExternalName" maps to the specified externalName. + // "ClusterIP" allocates a cluster-internal IP address for load-balancing to + // endpoints. Endpoints are determined by the selector or if that is not + // specified, by manual construction of an Endpoints object. If clusterIP is + // "None", no virtual IP is allocated and the endpoints are published as a + // set of endpoints rather than a stable IP. + // "NodePort" builds on ClusterIP and allocates a port on every node which + // routes to the clusterIP. + // "LoadBalancer" builds on NodePort and creates an + // external load-balancer (if supported in the current cloud) which routes + // to the clusterIP. + // More info: https://kubernetes.io/docs/concepts/services-networking/service/ + // +optional + Type ServiceType + + // Required: The list of ports that are exposed by this service. + Ports []ServicePort + + // Route service traffic to pods with label keys and values matching this + // selector. If empty or not present, the service is assumed to have an + // external process managing its endpoints, which Kubernetes will not + // modify. Only applies to types ClusterIP, NodePort, and LoadBalancer. + // Ignored if type is ExternalName. + // More info: https://kubernetes.io/docs/concepts/services-networking/service/ + Selector map[string]string + + // ClusterIP is the IP address of the service and is usually assigned + // randomly by the master. If an address is specified manually and is not in + // use by others, it will be allocated to the service; otherwise, creation + // of the service will fail. This field can not be changed through updates. + // Valid values are "None", empty string (""), or a valid IP address. "None" + // can be specified for headless services when proxying is not required. + // Only applies to types ClusterIP, NodePort, and LoadBalancer. Ignored if + // type is ExternalName. + // More info: https://kubernetes.io/docs/concepts/services-networking/service/#virtual-ips-and-service-proxies + // +optional + ClusterIP string + + // ExternalName is the external reference that kubedns or equivalent will + // return as a CNAME record for this service. No proxying will be involved. + // Must be a valid RFC-1123 hostname (https://tools.ietf.org/html/rfc1123) + // and requires Type to be ExternalName. + ExternalName string + + // ExternalIPs are used by external load balancers, or can be set by + // users to handle external traffic that arrives at a node. + // +optional + ExternalIPs []string + + // Only applies to Service Type: LoadBalancer + // LoadBalancer will get created with the IP specified in this field. + // This feature depends on whether the underlying cloud-provider supports specifying + // the loadBalancerIP when a load balancer is created. + // This field will be ignored if the cloud-provider does not support the feature. + // +optional + LoadBalancerIP string + + // Optional: Supports "ClientIP" and "None". Used to maintain session affinity. + // +optional + SessionAffinity ServiceAffinity + + // sessionAffinityConfig contains the configurations of session affinity. + // +optional + SessionAffinityConfig *SessionAffinityConfig + + // Optional: If specified and supported by the platform, this will restrict traffic through the cloud-provider + // load-balancer will be restricted to the specified client IPs. This field will be ignored if the + // cloud-provider does not support the feature." + // +optional + LoadBalancerSourceRanges []string + + // externalTrafficPolicy denotes if this Service desires to route external + // traffic to node-local or cluster-wide endpoints. "Local" preserves the + // client source IP and avoids a second hop for LoadBalancer and Nodeport + // type services, but risks potentially imbalanced traffic spreading. + // "Cluster" obscures the client source IP and may cause a second hop to + // another node, but should have good overall load-spreading. + // +optional + ExternalTrafficPolicy ServiceExternalTrafficPolicyType + + // healthCheckNodePort specifies the healthcheck nodePort for the service. + // If not specified, HealthCheckNodePort is created by the service api + // backend with the allocated nodePort. Will use user-specified nodePort value + // if specified by the client. Only effects when Type is set to LoadBalancer + // and ExternalTrafficPolicy is set to Local. + // +optional + HealthCheckNodePort int32 + + // publishNotReadyAddresses, when set to true, indicates that DNS implementations + // must publish the notReadyAddresses of subsets for the Endpoints associated with + // the Service. The default value is false. + // The primary use case for setting this field is to use a StatefulSet's Headless Service + // to propagate SRV records for its Pods without respect to their readiness for purpose + // of peer discovery. + // This field will replace the service.alpha.kubernetes.io/tolerate-unready-endpoints + // when that annotation is deprecated and all clients have been converted to use this + // field. + // +optional + PublishNotReadyAddresses bool +} + +type ServicePort struct { + // Optional if only one ServicePort is defined on this service: The + // name of this port within the service. This must be a DNS_LABEL. + // All ports within a ServiceSpec must have unique names. This maps to + // the 'Name' field in EndpointPort objects. + Name string + + // The IP protocol for this port. Supports "TCP" and "UDP". + Protocol Protocol + + // The port that will be exposed on the service. + Port int32 + + // Optional: The target port on pods selected by this service. If this + // is a string, it will be looked up as a named port in the target + // Pod's container ports. If this is not specified, the value + // of the 'port' field is used (an identity map). + // This field is ignored for services with clusterIP=None, and should be + // omitted or set equal to the 'port' field. + TargetPort intstr.IntOrString + + // The port on each node on which this service is exposed. + // Default is to auto-allocate a port if the ServiceType of this Service requires one. + NodePort int32 +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Service is a named abstraction of software service (for example, mysql) consisting of local port +// (for example 3306) that the proxy listens on, and the selector that determines which pods +// will answer requests sent through the proxy. +type Service struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the behavior of a service. + // +optional + Spec ServiceSpec + + // Status represents the current status of a service. + // +optional + Status ServiceStatus +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ServiceAccount binds together: +// * a name, understood by users, and perhaps by peripheral systems, for an identity +// * a principal that can be authenticated and authorized +// * a set of secrets +type ServiceAccount struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Secrets is the list of secrets allowed to be used by pods running using this ServiceAccount + Secrets []ObjectReference + + // ImagePullSecrets is a list of references to secrets in the same namespace to use for pulling any images + // in pods that reference this ServiceAccount. ImagePullSecrets are distinct from Secrets because Secrets + // can be mounted in the pod, but ImagePullSecrets are only accessed by the kubelet. + // +optional + ImagePullSecrets []LocalObjectReference + + // AutomountServiceAccountToken indicates whether pods running as this service account should have an API token automatically mounted. + // Can be overridden at the pod level. + // +optional + AutomountServiceAccountToken *bool +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ServiceAccountList is a list of ServiceAccount objects +type ServiceAccountList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []ServiceAccount +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Endpoints is a collection of endpoints that implement the actual service. Example: +// Name: "mysvc", +// Subsets: [ +// { +// Addresses: [{"ip": "10.10.1.1"}, {"ip": "10.10.2.2"}], +// Ports: [{"name": "a", "port": 8675}, {"name": "b", "port": 309}] +// }, +// { +// Addresses: [{"ip": "10.10.3.3"}], +// Ports: [{"name": "a", "port": 93}, {"name": "b", "port": 76}] +// }, +// ] +type Endpoints struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // The set of all endpoints is the union of all subsets. + Subsets []EndpointSubset +} + +// EndpointSubset is a group of addresses with a common set of ports. The +// expanded set of endpoints is the Cartesian product of Addresses x Ports. +// For example, given: +// { +// Addresses: [{"ip": "10.10.1.1"}, {"ip": "10.10.2.2"}], +// Ports: [{"name": "a", "port": 8675}, {"name": "b", "port": 309}] +// } +// The resulting set of endpoints can be viewed as: +// a: [ 10.10.1.1:8675, 10.10.2.2:8675 ], +// b: [ 10.10.1.1:309, 10.10.2.2:309 ] +type EndpointSubset struct { + Addresses []EndpointAddress + NotReadyAddresses []EndpointAddress + Ports []EndpointPort +} + +// EndpointAddress is a tuple that describes single IP address. +type EndpointAddress struct { + // The IP of this endpoint. + // IPv6 is also accepted but not fully supported on all platforms. Also, certain + // kubernetes components, like kube-proxy, are not IPv6 ready. + // TODO: This should allow hostname or IP, see #4447. + IP string + // Optional: Hostname of this endpoint + // Meant to be used by DNS servers etc. + // +optional + Hostname string + // Optional: Node hosting this endpoint. This can be used to determine endpoints local to a node. + // +optional + NodeName *string + // Optional: The kubernetes object related to the entry point. + TargetRef *ObjectReference +} + +// EndpointPort is a tuple that describes a single port. +type EndpointPort struct { + // The name of this port (corresponds to ServicePort.Name). Optional + // if only one port is defined. Must be a DNS_LABEL. + Name string + + // The port number. + Port int32 + + // The IP protocol for this port. + Protocol Protocol +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// EndpointsList is a list of endpoints. +type EndpointsList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Endpoints +} + +// NodeSpec describes the attributes that a node is created with. +type NodeSpec struct { + // PodCIDR represents the pod IP range assigned to the node + // Note: assigning IP ranges to nodes might need to be revisited when we support migratable IPs. + // +optional + PodCIDR string + + // External ID of the node assigned by some machine database (e.g. a cloud provider) + // +optional + ExternalID string + + // ID of the node assigned by the cloud provider + // Note: format is "<ProviderName>://<ProviderSpecificNodeID>" + // +optional + ProviderID string + + // Unschedulable controls node schedulability of new pods. By default node is schedulable. + // +optional + Unschedulable bool + + // If specified, the node's taints. + // +optional + Taints []Taint + + // If specified, the source to get node configuration from + // The DynamicKubeletConfig feature gate must be enabled for the Kubelet to use this field + // +optional + ConfigSource *NodeConfigSource +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// NodeConfigSource specifies a source of node configuration. Exactly one subfield must be non-nil. +type NodeConfigSource struct { + metav1.TypeMeta + ConfigMapRef *ObjectReference +} + +// DaemonEndpoint contains information about a single Daemon endpoint. +type DaemonEndpoint struct { + /* + The port tag was not properly in quotes in earlier releases, so it must be + uppercase for backwards compatibility (since it was falling back to var name of + 'Port'). + */ + + // Port number of the given endpoint. + Port int32 +} + +// NodeDaemonEndpoints lists ports opened by daemons running on the Node. +type NodeDaemonEndpoints struct { + // Endpoint on which Kubelet is listening. + // +optional + KubeletEndpoint DaemonEndpoint +} + +// NodeSystemInfo is a set of ids/uuids to uniquely identify the node. +type NodeSystemInfo struct { + // MachineID reported by the node. For unique machine identification + // in the cluster this field is preferred. Learn more from man(5) + // machine-id: http://man7.org/linux/man-pages/man5/machine-id.5.html + MachineID string + // SystemUUID reported by the node. For unique machine identification + // MachineID is preferred. This field is specific to Red Hat hosts + // https://access.redhat.com/documentation/en-US/Red_Hat_Subscription_Management/1/html/RHSM/getting-system-uuid.html + SystemUUID string + // Boot ID reported by the node. + BootID string + // Kernel Version reported by the node. + KernelVersion string + // OS Image reported by the node. + OSImage string + // ContainerRuntime Version reported by the node. + ContainerRuntimeVersion string + // Kubelet Version reported by the node. + KubeletVersion string + // KubeProxy Version reported by the node. + KubeProxyVersion string + // The Operating System reported by the node + OperatingSystem string + // The Architecture reported by the node + Architecture string +} + +// NodeStatus is information about the current status of a node. +type NodeStatus struct { + // Capacity represents the total resources of a node. + // +optional + Capacity ResourceList + // Allocatable represents the resources of a node that are available for scheduling. + // +optional + Allocatable ResourceList + // NodePhase is the current lifecycle phase of the node. + // +optional + Phase NodePhase + // Conditions is an array of current node conditions. + // +optional + Conditions []NodeCondition + // Queried from cloud provider, if available. + // +optional + Addresses []NodeAddress + // Endpoints of daemons running on the Node. + // +optional + DaemonEndpoints NodeDaemonEndpoints + // Set of ids/uuids to uniquely identify the node. + // +optional + NodeInfo NodeSystemInfo + // List of container images on this node + // +optional + Images []ContainerImage + // List of attachable volumes in use (mounted) by the node. + // +optional + VolumesInUse []UniqueVolumeName + // List of volumes that are attached to the node. + // +optional + VolumesAttached []AttachedVolume +} + +type UniqueVolumeName string + +// AttachedVolume describes a volume attached to a node +type AttachedVolume struct { + // Name of the attached volume + Name UniqueVolumeName + + // DevicePath represents the device path where the volume should be available + DevicePath string +} + +// AvoidPods describes pods that should avoid this node. This is the value for a +// Node annotation with key scheduler.alpha.kubernetes.io/preferAvoidPods and +// will eventually become a field of NodeStatus. +type AvoidPods struct { + // Bounded-sized list of signatures of pods that should avoid this node, sorted + // in timestamp order from oldest to newest. Size of the slice is unspecified. + // +optional + PreferAvoidPods []PreferAvoidPodsEntry +} + +// Describes a class of pods that should avoid this node. +type PreferAvoidPodsEntry struct { + // The class of pods. + PodSignature PodSignature + // Time at which this entry was added to the list. + // +optional + EvictionTime metav1.Time + // (brief) reason why this entry was added to the list. + // +optional + Reason string + // Human readable message indicating why this entry was added to the list. + // +optional + Message string +} + +// Describes the class of pods that should avoid this node. +// Exactly one field should be set. +type PodSignature struct { + // Reference to controller whose pods should avoid this node. + // +optional + PodController *metav1.OwnerReference +} + +// Describe a container image +type ContainerImage struct { + // Names by which this image is known. + Names []string + // The size of the image in bytes. + // +optional + SizeBytes int64 +} + +type NodePhase string + +// These are the valid phases of node. +const ( + // NodePending means the node has been created/added by the system, but not configured. + NodePending NodePhase = "Pending" + // NodeRunning means the node has been configured and has Kubernetes components running. + NodeRunning NodePhase = "Running" + // NodeTerminated means the node has been removed from the cluster. + NodeTerminated NodePhase = "Terminated" +) + +type NodeConditionType string + +// These are valid conditions of node. Currently, we don't have enough information to decide +// node condition. In the future, we will add more. The proposed set of conditions are: +// NodeReady, NodeReachable +const ( + // NodeReady means kubelet is healthy and ready to accept pods. + NodeReady NodeConditionType = "Ready" + // NodeOutOfDisk means the kubelet will not accept new pods due to insufficient free disk + // space on the node. + NodeOutOfDisk NodeConditionType = "OutOfDisk" + // NodeMemoryPressure means the kubelet is under pressure due to insufficient available memory. + NodeMemoryPressure NodeConditionType = "MemoryPressure" + // NodeDiskPressure means the kubelet is under pressure due to insufficient available disk. + NodeDiskPressure NodeConditionType = "DiskPressure" + // NodeNetworkUnavailable means that network for the node is not correctly configured. + NodeNetworkUnavailable NodeConditionType = "NetworkUnavailable" + // NodeKubeletConfigOk indicates whether the kubelet is correctly configured + NodeKubeletConfigOk NodeConditionType = "KubeletConfigOk" +) + +type NodeCondition struct { + Type NodeConditionType + Status ConditionStatus + // +optional + LastHeartbeatTime metav1.Time + // +optional + LastTransitionTime metav1.Time + // +optional + Reason string + // +optional + Message string +} + +type NodeAddressType string + +const ( + NodeHostName NodeAddressType = "Hostname" + NodeExternalIP NodeAddressType = "ExternalIP" + NodeInternalIP NodeAddressType = "InternalIP" + NodeExternalDNS NodeAddressType = "ExternalDNS" + NodeInternalDNS NodeAddressType = "InternalDNS" +) + +type NodeAddress struct { + Type NodeAddressType + Address string +} + +// NodeResources is an object for conveying resource information about a node. +// see http://releases.k8s.io/HEAD/docs/design/resources.md for more details. +type NodeResources struct { + // Capacity represents the available resources of a node + // +optional + Capacity ResourceList +} + +// ResourceName is the name identifying various resources in a ResourceList. +type ResourceName string + +// Resource names must be not more than 63 characters, consisting of upper- or lower-case alphanumeric characters, +// with the -, _, and . characters allowed anywhere, except the first or last character. +// The default convention, matching that for annotations, is to use lower-case names, with dashes, rather than +// camel case, separating compound words. +// Fully-qualified resource typenames are constructed from a DNS-style subdomain, followed by a slash `/` and a name. +const ( + // CPU, in cores. (500m = .5 cores) + ResourceCPU ResourceName = "cpu" + // Memory, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + ResourceMemory ResourceName = "memory" + // Volume size, in bytes (e,g. 5Gi = 5GiB = 5 * 1024 * 1024 * 1024) + ResourceStorage ResourceName = "storage" + // Local ephemeral storage, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + // The resource name for ResourceEphemeralStorage is alpha and it can change across releases. + ResourceEphemeralStorage ResourceName = "ephemeral-storage" + // NVIDIA GPU, in devices. Alpha, might change: although fractional and allowing values >1, only one whole device per node is assigned. + ResourceNvidiaGPU ResourceName = "alpha.kubernetes.io/nvidia-gpu" +) + +const ( + // Default namespace prefix. + ResourceDefaultNamespacePrefix = "kubernetes.io/" + // Name prefix for huge page resources (alpha). + ResourceHugePagesPrefix = "hugepages-" +) + +// ResourceList is a set of (resource name, quantity) pairs. +type ResourceList map[ResourceName]resource.Quantity + +// +genclient +// +genclient:nonNamespaced +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Node is a worker node in Kubernetes +// The name of the node according to etcd is in ObjectMeta.Name. +type Node struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the behavior of a node. + // +optional + Spec NodeSpec + + // Status describes the current status of a Node + // +optional + Status NodeStatus +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// NodeList is a list of nodes. +type NodeList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Node +} + +// NamespaceSpec describes the attributes on a Namespace +type NamespaceSpec struct { + // Finalizers is an opaque list of values that must be empty to permanently remove object from storage + Finalizers []FinalizerName +} + +// FinalizerName is the name identifying a finalizer during namespace lifecycle. +type FinalizerName string + +// These are internal finalizer values to Kubernetes, must be qualified name unless defined here or +// in metav1. +const ( + FinalizerKubernetes FinalizerName = "kubernetes" +) + +// NamespaceStatus is information about the current status of a Namespace. +type NamespaceStatus struct { + // Phase is the current lifecycle phase of the namespace. + // +optional + Phase NamespacePhase +} + +type NamespacePhase string + +// These are the valid phases of a namespace. +const ( + // NamespaceActive means the namespace is available for use in the system + NamespaceActive NamespacePhase = "Active" + // NamespaceTerminating means the namespace is undergoing graceful termination + NamespaceTerminating NamespacePhase = "Terminating" +) + +// +genclient +// +genclient:nonNamespaced +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// A namespace provides a scope for Names. +// Use of multiple namespaces is optional +type Namespace struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the behavior of the Namespace. + // +optional + Spec NamespaceSpec + + // Status describes the current status of a Namespace + // +optional + Status NamespaceStatus +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// NamespaceList is a list of Namespaces. +type NamespaceList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Namespace +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Binding ties one object to another; for example, a pod is bound to a node by a scheduler. +// Deprecated in 1.7, please use the bindings subresource of pods instead. +type Binding struct { + metav1.TypeMeta + // ObjectMeta describes the object that is being bound. + // +optional + metav1.ObjectMeta + + // Target is the object to bind to. + Target ObjectReference +} + +// Preconditions must be fulfilled before an operation (update, delete, etc.) is carried out. +type Preconditions struct { + // Specifies the target UID. + // +optional + UID *types.UID +} + +// DeletionPropagation decides whether and how garbage collection will be performed. +type DeletionPropagation string + +const ( + // Orphans the dependents. + DeletePropagationOrphan DeletionPropagation = "Orphan" + // Deletes the object from the key-value store, the garbage collector will delete the dependents in the background. + DeletePropagationBackground DeletionPropagation = "Background" + // The object exists in the key-value store until the garbage collector deletes all the dependents whose ownerReference.blockOwnerDeletion=true from the key-value store. + // API sever will put the "DeletingDependents" finalizer on the object, and sets its deletionTimestamp. + // This policy is cascading, i.e., the dependents will be deleted with Foreground. + DeletePropagationForeground DeletionPropagation = "Foreground" +) + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// DeleteOptions may be provided when deleting an API object +// DEPRECATED: This type has been moved to meta/v1 and will be removed soon. +type DeleteOptions struct { + metav1.TypeMeta + + // Optional duration in seconds before the object should be deleted. Value must be non-negative integer. + // The value zero indicates delete immediately. If this value is nil, the default grace period for the + // specified type will be used. + // +optional + GracePeriodSeconds *int64 + + // Must be fulfilled before a deletion is carried out. If not possible, a 409 Conflict status will be + // returned. + // +optional + Preconditions *Preconditions + + // Deprecated: please use the PropagationPolicy, this field will be deprecated in 1.7. + // Should the dependent objects be orphaned. If true/false, the "orphan" + // finalizer will be added to/removed from the object's finalizers list. + // Either this field or PropagationPolicy may be set, but not both. + // +optional + OrphanDependents *bool + + // Whether and how garbage collection will be performed. + // Either this field or OrphanDependents may be set, but not both. + // The default policy is decided by the existing finalizer set in the + // metadata.finalizers and the resource-specific default policy. + // Acceptable values are: 'Orphan' - orphan the dependents; 'Background' - + // allow the garbage collector to delete the dependents in the background; + // 'Foreground' - a cascading policy that deletes all dependents in the + // foreground. + // +optional + PropagationPolicy *DeletionPropagation +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ListOptions is the query options to a standard REST list call, and has future support for +// watch calls. +// DEPRECATED: This type has been moved to meta/v1 and will be removed soon. +type ListOptions struct { + metav1.TypeMeta + + // A selector based on labels + LabelSelector labels.Selector + // A selector based on fields + FieldSelector fields.Selector + + // If true, partially initialized resources are included in the response. + IncludeUninitialized bool + + // If true, watch for changes to this list + Watch bool + // When specified with a watch call, shows changes that occur after that particular version of a resource. + // Defaults to changes from the beginning of history. + // When specified for list: + // - if unset, then the result is returned from remote storage based on quorum-read flag; + // - if it's 0, then we simply return what we currently have in cache, no guarantee; + // - if set to non zero, then the result is at least as fresh as given rv. + ResourceVersion string + // Timeout for the list/watch call. + TimeoutSeconds *int64 +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodLogOptions is the query options for a Pod's logs REST call +type PodLogOptions struct { + metav1.TypeMeta + + // Container for which to return logs + Container string + // If true, follow the logs for the pod + Follow bool + // If true, return previous terminated container logs + Previous bool + // A relative time in seconds before the current time from which to show logs. If this value + // precedes the time a pod was started, only logs since the pod start will be returned. + // If this value is in the future, no logs will be returned. + // Only one of sinceSeconds or sinceTime may be specified. + SinceSeconds *int64 + // An RFC3339 timestamp from which to show logs. If this value + // precedes the time a pod was started, only logs since the pod start will be returned. + // If this value is in the future, no logs will be returned. + // Only one of sinceSeconds or sinceTime may be specified. + SinceTime *metav1.Time + // If true, add an RFC3339 or RFC3339Nano timestamp at the beginning of every line + // of log output. + Timestamps bool + // If set, the number of lines from the end of the logs to show. If not specified, + // logs are shown from the creation of the container or sinceSeconds or sinceTime + TailLines *int64 + // If set, the number of bytes to read from the server before terminating the + // log output. This may not display a complete final line of logging, and may return + // slightly more or slightly less than the specified limit. + LimitBytes *int64 +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodAttachOptions is the query options to a Pod's remote attach call +// TODO: merge w/ PodExecOptions below for stdin, stdout, etc +type PodAttachOptions struct { + metav1.TypeMeta + + // Stdin if true indicates that stdin is to be redirected for the attach call + // +optional + Stdin bool + + // Stdout if true indicates that stdout is to be redirected for the attach call + // +optional + Stdout bool + + // Stderr if true indicates that stderr is to be redirected for the attach call + // +optional + Stderr bool + + // TTY if true indicates that a tty will be allocated for the attach call + // +optional + TTY bool + + // Container to attach to. + // +optional + Container string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodExecOptions is the query options to a Pod's remote exec call +type PodExecOptions struct { + metav1.TypeMeta + + // Stdin if true indicates that stdin is to be redirected for the exec call + Stdin bool + + // Stdout if true indicates that stdout is to be redirected for the exec call + Stdout bool + + // Stderr if true indicates that stderr is to be redirected for the exec call + Stderr bool + + // TTY if true indicates that a tty will be allocated for the exec call + TTY bool + + // Container in which to execute the command. + Container string + + // Command is the remote command to execute; argv array; not executed within a shell. + Command []string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodPortForwardOptions is the query options to a Pod's port forward call +type PodPortForwardOptions struct { + metav1.TypeMeta + + // The list of ports to forward + // +optional + Ports []int32 +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// PodProxyOptions is the query options to a Pod's proxy call +type PodProxyOptions struct { + metav1.TypeMeta + + // Path is the URL path to use for the current proxy request + Path string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// NodeProxyOptions is the query options to a Node's proxy call +type NodeProxyOptions struct { + metav1.TypeMeta + + // Path is the URL path to use for the current proxy request + Path string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ServiceProxyOptions is the query options to a Service's proxy call. +type ServiceProxyOptions struct { + metav1.TypeMeta + + // Path is the part of URLs that include service endpoints, suffixes, + // and parameters to use for the current proxy request to service. + // For example, the whole request URL is + // http://localhost/api/v1/namespaces/kube-system/services/elasticsearch-logging/_search?q=user:kimchy. + // Path is _search?q=user:kimchy. + Path string +} + +// ObjectReference contains enough information to let you inspect or modify the referred object. +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object +type ObjectReference struct { + // +optional + Kind string + // +optional + Namespace string + // +optional + Name string + // +optional + UID types.UID + // +optional + APIVersion string + // +optional + ResourceVersion string + + // Optional. If referring to a piece of an object instead of an entire object, this string + // should contain information to identify the sub-object. For example, if the object + // reference is to a container within a pod, this would take on a value like: + // "spec.containers{name}" (where "name" refers to the name of the container that triggered + // the event) or if no container name is specified "spec.containers[2]" (container with + // index 2 in this pod). This syntax is chosen only to have some well-defined way of + // referencing a part of an object. + // TODO: this design is not final and this field is subject to change in the future. + // +optional + FieldPath string +} + +// LocalObjectReference contains enough information to let you locate the referenced object inside the same namespace. +type LocalObjectReference struct { + //TODO: Add other useful fields. apiVersion, kind, uid? + Name string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +type SerializedReference struct { + metav1.TypeMeta + // +optional + Reference ObjectReference +} + +type EventSource struct { + // Component from which the event is generated. + // +optional + Component string + // Node name on which the event is generated. + // +optional + Host string +} + +// Valid values for event types (new types could be added in future) +const ( + // Information only and will not cause any problems + EventTypeNormal string = "Normal" + // These events are to warn that something might go wrong + EventTypeWarning string = "Warning" +) + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Event is a report of an event somewhere in the cluster. +// TODO: Decide whether to store these separately or with the object they apply to. +type Event struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Required. The object that this event is about. Mapped to events.Event.regarding + // +optional + InvolvedObject ObjectReference + + // Optional; this should be a short, machine understandable string that gives the reason + // for this event being generated. For example, if the event is reporting that a container + // can't start, the Reason might be "ImageNotFound". + // TODO: provide exact specification for format. + // +optional + Reason string + + // Optional. A human-readable description of the status of this operation. + // TODO: decide on maximum length. Mapped to events.Event.note + // +optional + Message string + + // Optional. The component reporting this event. Should be a short machine understandable string. + // +optional + Source EventSource + + // The time at which the event was first recorded. (Time of server receipt is in TypeMeta.) + // +optional + FirstTimestamp metav1.Time + + // The time at which the most recent occurrence of this event was recorded. + // +optional + LastTimestamp metav1.Time + + // The number of times this event has occurred. + // +optional + Count int32 + + // Type of this event (Normal, Warning), new types could be added in the future. + // +optional + Type string + + // Time when this Event was first observed. + // +optional + EventTime metav1.MicroTime + + // Data about the Event series this event represents or nil if it's a singleton Event. + // +optional + Series *EventSeries + + // What action was taken/failed regarding to the Regarding object. + // +optional + Action string + + // Optional secondary object for more complex actions. + // +optional + Related *ObjectReference + + // Name of the controller that emitted this Event, e.g. `kubernetes.io/kubelet`. + // +optional + ReportingController string + + // ID of the controller instance, e.g. `kubelet-xyzf`. + // +optional + ReportingInstance string +} + +type EventSeries struct { + // Number of occurrences in this series up to the last heartbeat time + Count int32 + // Time of the last occurrence observed + LastObservedTime metav1.MicroTime + // State of this Series: Ongoing or Finished + State EventSeriesState +} + +type EventSeriesState string + +const ( + EventSeriesStateOngoing EventSeriesState = "Ongoing" + EventSeriesStateFinished EventSeriesState = "Finished" + EventSeriesStateUnknown EventSeriesState = "Unknown" +) + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// EventList is a list of events. +type EventList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Event +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// List holds a list of objects, which may not be known by the server. +type List metainternalversion.List + +// A type of object that is limited +type LimitType string + +const ( + // Limit that applies to all pods in a namespace + LimitTypePod LimitType = "Pod" + // Limit that applies to all containers in a namespace + LimitTypeContainer LimitType = "Container" + // Limit that applies to all persistent volume claims in a namespace + LimitTypePersistentVolumeClaim LimitType = "PersistentVolumeClaim" +) + +// LimitRangeItem defines a min/max usage limit for any resource that matches on kind +type LimitRangeItem struct { + // Type of resource that this limit applies to + // +optional + Type LimitType + // Max usage constraints on this kind by resource name + // +optional + Max ResourceList + // Min usage constraints on this kind by resource name + // +optional + Min ResourceList + // Default resource requirement limit value by resource name. + // +optional + Default ResourceList + // DefaultRequest resource requirement request value by resource name. + // +optional + DefaultRequest ResourceList + // MaxLimitRequestRatio represents the max burst value for the named resource + // +optional + MaxLimitRequestRatio ResourceList +} + +// LimitRangeSpec defines a min/max usage limit for resources that match on kind +type LimitRangeSpec struct { + // Limits is the list of LimitRangeItem objects that are enforced + Limits []LimitRangeItem +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// LimitRange sets resource usage limits for each kind of resource in a Namespace +type LimitRange struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the limits enforced + // +optional + Spec LimitRangeSpec +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// LimitRangeList is a list of LimitRange items. +type LimitRangeList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + // Items is a list of LimitRange objects + Items []LimitRange +} + +// The following identify resource constants for Kubernetes object types +const ( + // Pods, number + ResourcePods ResourceName = "pods" + // Services, number + ResourceServices ResourceName = "services" + // ReplicationControllers, number + ResourceReplicationControllers ResourceName = "replicationcontrollers" + // ResourceQuotas, number + ResourceQuotas ResourceName = "resourcequotas" + // ResourceSecrets, number + ResourceSecrets ResourceName = "secrets" + // ResourceConfigMaps, number + ResourceConfigMaps ResourceName = "configmaps" + // ResourcePersistentVolumeClaims, number + ResourcePersistentVolumeClaims ResourceName = "persistentvolumeclaims" + // ResourceServicesNodePorts, number + ResourceServicesNodePorts ResourceName = "services.nodeports" + // ResourceServicesLoadBalancers, number + ResourceServicesLoadBalancers ResourceName = "services.loadbalancers" + // CPU request, in cores. (500m = .5 cores) + ResourceRequestsCPU ResourceName = "requests.cpu" + // Memory request, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + ResourceRequestsMemory ResourceName = "requests.memory" + // Storage request, in bytes + ResourceRequestsStorage ResourceName = "requests.storage" + // Local ephemeral storage request, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + ResourceRequestsEphemeralStorage ResourceName = "requests.ephemeral-storage" + // CPU limit, in cores. (500m = .5 cores) + ResourceLimitsCPU ResourceName = "limits.cpu" + // Memory limit, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + ResourceLimitsMemory ResourceName = "limits.memory" + // Local ephemeral storage limit, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + ResourceLimitsEphemeralStorage ResourceName = "limits.ephemeral-storage" +) + +// The following identify resource prefix for Kubernetes object types +const ( + // HugePages request, in bytes. (500Gi = 500GiB = 500 * 1024 * 1024 * 1024) + // As burst is not supported for HugePages, we would only quota its request, and ignore the limit. + ResourceRequestsHugePagesPrefix = "requests.hugepages-" + // Default resource requests prefix + DefaultResourceRequestsPrefix = "requests." +) + +// A ResourceQuotaScope defines a filter that must match each object tracked by a quota +type ResourceQuotaScope string + +const ( + // Match all pod objects where spec.activeDeadlineSeconds + ResourceQuotaScopeTerminating ResourceQuotaScope = "Terminating" + // Match all pod objects where !spec.activeDeadlineSeconds + ResourceQuotaScopeNotTerminating ResourceQuotaScope = "NotTerminating" + // Match all pod objects that have best effort quality of service + ResourceQuotaScopeBestEffort ResourceQuotaScope = "BestEffort" + // Match all pod objects that do not have best effort quality of service + ResourceQuotaScopeNotBestEffort ResourceQuotaScope = "NotBestEffort" +) + +// ResourceQuotaSpec defines the desired hard limits to enforce for Quota +type ResourceQuotaSpec struct { + // Hard is the set of desired hard limits for each named resource + // +optional + Hard ResourceList + // A collection of filters that must match each object tracked by a quota. + // If not specified, the quota matches all objects. + // +optional + Scopes []ResourceQuotaScope +} + +// ResourceQuotaStatus defines the enforced hard limits and observed use +type ResourceQuotaStatus struct { + // Hard is the set of enforced hard limits for each named resource + // +optional + Hard ResourceList + // Used is the current observed total usage of the resource in the namespace + // +optional + Used ResourceList +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ResourceQuota sets aggregate quota restrictions enforced per namespace +type ResourceQuota struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Spec defines the desired quota + // +optional + Spec ResourceQuotaSpec + + // Status defines the actual enforced quota and its current usage + // +optional + Status ResourceQuotaStatus +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ResourceQuotaList is a list of ResourceQuota items +type ResourceQuotaList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + // Items is a list of ResourceQuota objects + Items []ResourceQuota +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// Secret holds secret data of a certain type. The total bytes of the values in +// the Data field must be less than MaxSecretSize bytes. +type Secret struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Data contains the secret data. Each key must consist of alphanumeric + // characters, '-', '_' or '.'. The serialized form of the secret data is a + // base64 encoded string, representing the arbitrary (possibly non-string) + // data value here. + // +optional + Data map[string][]byte + + // Used to facilitate programmatic handling of secret data. + // +optional + Type SecretType +} + +const MaxSecretSize = 1 * 1024 * 1024 + +type SecretType string + +const ( + // SecretTypeOpaque is the default; arbitrary user-defined data + SecretTypeOpaque SecretType = "Opaque" + + // SecretTypeServiceAccountToken contains a token that identifies a service account to the API + // + // Required fields: + // - Secret.Annotations["kubernetes.io/service-account.name"] - the name of the ServiceAccount the token identifies + // - Secret.Annotations["kubernetes.io/service-account.uid"] - the UID of the ServiceAccount the token identifies + // - Secret.Data["token"] - a token that identifies the service account to the API + SecretTypeServiceAccountToken SecretType = "kubernetes.io/service-account-token" + + // ServiceAccountNameKey is the key of the required annotation for SecretTypeServiceAccountToken secrets + ServiceAccountNameKey = "kubernetes.io/service-account.name" + // ServiceAccountUIDKey is the key of the required annotation for SecretTypeServiceAccountToken secrets + ServiceAccountUIDKey = "kubernetes.io/service-account.uid" + // ServiceAccountTokenKey is the key of the required data for SecretTypeServiceAccountToken secrets + ServiceAccountTokenKey = "token" + // ServiceAccountKubeconfigKey is the key of the optional kubeconfig data for SecretTypeServiceAccountToken secrets + ServiceAccountKubeconfigKey = "kubernetes.kubeconfig" + // ServiceAccountRootCAKey is the key of the optional root certificate authority for SecretTypeServiceAccountToken secrets + ServiceAccountRootCAKey = "ca.crt" + // ServiceAccountNamespaceKey is the key of the optional namespace to use as the default for namespaced API calls + ServiceAccountNamespaceKey = "namespace" + + // SecretTypeDockercfg contains a dockercfg file that follows the same format rules as ~/.dockercfg + // + // Required fields: + // - Secret.Data[".dockercfg"] - a serialized ~/.dockercfg file + SecretTypeDockercfg SecretType = "kubernetes.io/dockercfg" + + // DockerConfigKey is the key of the required data for SecretTypeDockercfg secrets + DockerConfigKey = ".dockercfg" + + // SecretTypeDockerConfigJson contains a dockercfg file that follows the same format rules as ~/.docker/config.json + // + // Required fields: + // - Secret.Data[".dockerconfigjson"] - a serialized ~/.docker/config.json file + SecretTypeDockerConfigJson SecretType = "kubernetes.io/dockerconfigjson" + + // DockerConfigJsonKey is the key of the required data for SecretTypeDockerConfigJson secrets + DockerConfigJsonKey = ".dockerconfigjson" + + // SecretTypeBasicAuth contains data needed for basic authentication. + // + // Required at least one of fields: + // - Secret.Data["username"] - username used for authentication + // - Secret.Data["password"] - password or token needed for authentication + SecretTypeBasicAuth SecretType = "kubernetes.io/basic-auth" + + // BasicAuthUsernameKey is the key of the username for SecretTypeBasicAuth secrets + BasicAuthUsernameKey = "username" + // BasicAuthPasswordKey is the key of the password or token for SecretTypeBasicAuth secrets + BasicAuthPasswordKey = "password" + + // SecretTypeSSHAuth contains data needed for SSH authentication. + // + // Required field: + // - Secret.Data["ssh-privatekey"] - private SSH key needed for authentication + SecretTypeSSHAuth SecretType = "kubernetes.io/ssh-auth" + + // SSHAuthPrivateKey is the key of the required SSH private key for SecretTypeSSHAuth secrets + SSHAuthPrivateKey = "ssh-privatekey" + + // SecretTypeTLS contains information about a TLS client or server secret. It + // is primarily used with TLS termination of the Ingress resource, but may be + // used in other types. + // + // Required fields: + // - Secret.Data["tls.key"] - TLS private key. + // Secret.Data["tls.crt"] - TLS certificate. + // TODO: Consider supporting different formats, specifying CA/destinationCA. + SecretTypeTLS SecretType = "kubernetes.io/tls" + + // TLSCertKey is the key for tls certificates in a TLS secret. + TLSCertKey = "tls.crt" + // TLSPrivateKeyKey is the key for the private key field in a TLS secret. + TLSPrivateKeyKey = "tls.key" + // SecretTypeBootstrapToken is used during the automated bootstrap process (first + // implemented by kubeadm). It stores tokens that are used to sign well known + // ConfigMaps. They are used for authn. + SecretTypeBootstrapToken SecretType = "bootstrap.kubernetes.io/token" +) + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +type SecretList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []Secret +} + +// +genclient +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ConfigMap holds configuration data for components or applications to consume. +type ConfigMap struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // Data contains the configuration data. + // Each key must consist of alphanumeric characters, '-', '_' or '.'. + // Values with non-UTF-8 byte sequences must use the BinaryData field. + // The keys stored in Data must not overlap with the keys in + // the BinaryData field, this is enforced during validation process. + // +optional + Data map[string]string + + // BinaryData contains the binary data. + // Each key must consist of alphanumeric characters, '-', '_' or '.'. + // BinaryData can contain byte sequences that are not in the UTF-8 range. + // The keys stored in BinaryData must not overlap with the ones in + // the Data field, this is enforced during validation process. + // Using this field will require 1.10+ apiserver and + // kubelet. + // +optional + BinaryData map[string][]byte +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ConfigMapList is a resource containing a list of ConfigMap objects. +type ConfigMapList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + // Items is the list of ConfigMaps. + Items []ConfigMap +} + +// These constants are for remote command execution and port forwarding and are +// used by both the client side and server side components. +// +// This is probably not the ideal place for them, but it didn't seem worth it +// to create pkg/exec and pkg/portforward just to contain a single file with +// constants in it. Suggestions for more appropriate alternatives are +// definitely welcome! +const ( + // Enable stdin for remote command execution + ExecStdinParam = "input" + // Enable stdout for remote command execution + ExecStdoutParam = "output" + // Enable stderr for remote command execution + ExecStderrParam = "error" + // Enable TTY for remote command execution + ExecTTYParam = "tty" + // Command to run for remote command execution + ExecCommandParam = "command" + + // Name of header that specifies stream type + StreamType = "streamType" + // Value for streamType header for stdin stream + StreamTypeStdin = "stdin" + // Value for streamType header for stdout stream + StreamTypeStdout = "stdout" + // Value for streamType header for stderr stream + StreamTypeStderr = "stderr" + // Value for streamType header for data stream + StreamTypeData = "data" + // Value for streamType header for error stream + StreamTypeError = "error" + // Value for streamType header for terminal resize stream + StreamTypeResize = "resize" + + // Name of header that specifies the port being forwarded + PortHeader = "port" + // Name of header that specifies a request ID used to associate the error + // and data streams for a single forwarded connection + PortForwardRequestIDHeader = "requestID" +) + +// Type and constants for component health validation. +type ComponentConditionType string + +// These are the valid conditions for the component. +const ( + ComponentHealthy ComponentConditionType = "Healthy" +) + +type ComponentCondition struct { + Type ComponentConditionType + Status ConditionStatus + // +optional + Message string + // +optional + Error string +} + +// +genclient +// +genclient:nonNamespaced +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// ComponentStatus (and ComponentStatusList) holds the cluster validation info. +type ComponentStatus struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + + // +optional + Conditions []ComponentCondition +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +type ComponentStatusList struct { + metav1.TypeMeta + // +optional + metav1.ListMeta + + Items []ComponentStatus +} + +// SecurityContext holds security configuration that will be applied to a container. +// Some fields are present in both SecurityContext and PodSecurityContext. When both +// are set, the values in SecurityContext take precedence. +type SecurityContext struct { + // The capabilities to add/drop when running containers. + // Defaults to the default set of capabilities granted by the container runtime. + // +optional + Capabilities *Capabilities + // Run container in privileged mode. + // Processes in privileged containers are essentially equivalent to root on the host. + // Defaults to false. + // +optional + Privileged *bool + // The SELinux context to be applied to the container. + // If unspecified, the container runtime will allocate a random SELinux context for each + // container. May also be set in PodSecurityContext. If set in both SecurityContext and + // PodSecurityContext, the value specified in SecurityContext takes precedence. + // +optional + SELinuxOptions *SELinuxOptions + // The UID to run the entrypoint of the container process. + // Defaults to user specified in image metadata if unspecified. + // May also be set in PodSecurityContext. If set in both SecurityContext and + // PodSecurityContext, the value specified in SecurityContext takes precedence. + // +optional + RunAsUser *int64 + // Indicates that the container must run as a non-root user. + // If true, the Kubelet will validate the image at runtime to ensure that it + // does not run as UID 0 (root) and fail to start the container if it does. + // If unset or false, no such validation will be performed. + // May also be set in PodSecurityContext. If set in both SecurityContext and + // PodSecurityContext, the value specified in SecurityContext takes precedence. + // +optional + RunAsNonRoot *bool + // The read-only root filesystem allows you to restrict the locations that an application can write + // files to, ensuring the persistent data can only be written to mounts. + // +optional + ReadOnlyRootFilesystem *bool + // AllowPrivilegeEscalation controls whether a process can gain more + // privileges than its parent process. This bool directly controls if + // the no_new_privs flag will be set on the container process. + // +optional + AllowPrivilegeEscalation *bool +} + +// SELinuxOptions are the labels to be applied to the container. +type SELinuxOptions struct { + // SELinux user label + // +optional + User string + // SELinux role label + // +optional + Role string + // SELinux type label + // +optional + Type string + // SELinux level label. + // +optional + Level string +} + +// +k8s:deepcopy-gen:interfaces=k8s.io/apimachinery/pkg/runtime.Object + +// RangeAllocation is an opaque API object (not exposed to end users) that can be persisted to record +// the global allocation state of the cluster. The schema of Range and Data generic, in that Range +// should be a string representation of the inputs to a range (for instance, for IP allocation it +// might be a CIDR) and Data is an opaque blob understood by an allocator which is typically a +// binary range. Consumers should use annotations to record additional information (schema version, +// data encoding hints). A range allocation should *ALWAYS* be recreatable at any time by observation +// of the cluster, thus the object is less strongly typed than most. +type RangeAllocation struct { + metav1.TypeMeta + // +optional + metav1.ObjectMeta + // A string representing a unique label for a range of resources, such as a CIDR "10.0.0.0/8" or + // port range "10000-30000". Range is not strongly schema'd here. The Range is expected to define + // a start and end unless there is an implicit end. + Range string + // A byte array representing the serialized state of a range allocation. Additional clarifiers on + // the type or format of data should be represented with annotations. For IP allocations, this is + // represented as a bit array starting at the base IP of the CIDR in Range, with each bit representing + // a single allocated address (the fifth bit on CIDR 10.0.0.0/8 is 10.0.0.4). + Data []byte +} + +const ( + // "default-scheduler" is the name of default scheduler. + DefaultSchedulerName = "default-scheduler" + + // RequiredDuringScheduling affinity is not symmetric, but there is an implicit PreferredDuringScheduling affinity rule + // corresponding to every RequiredDuringScheduling affinity rule. + // When the --hard-pod-affinity-weight scheduler flag is not specified, + // DefaultHardPodAffinityWeight defines the weight of the implicit PreferredDuringScheduling affinity rule. + DefaultHardPodAffinitySymmetricWeight int32 = 1 +) diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/conversion.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/conversion.go new file mode 100644 index 000000000..d888ebca4 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/conversion.go @@ -0,0 +1,619 @@ +/* +Copyright 2015 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1 + +import ( + "fmt" + "reflect" + + "k8s.io/api/core/v1" + + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + "k8s.io/apimachinery/pkg/conversion" + "k8s.io/apimachinery/pkg/runtime" + "k8s.io/apimachinery/pkg/util/validation/field" + "k8s.io/kubernetes/pkg/apis/core" + "k8s.io/kubernetes/pkg/apis/extensions" +) + +// This is a "fast-path" that avoids reflection for common types. It focuses on the objects that are +// converted the most in the cluster. +// TODO: generate one of these for every external API group - this is to prove the impact +func addFastPathConversionFuncs(scheme *runtime.Scheme) error { + scheme.AddGenericConversionFunc(func(objA, objB interface{}, s conversion.Scope) (bool, error) { + switch a := objA.(type) { + case *v1.Pod: + switch b := objB.(type) { + case *core.Pod: + return true, Convert_v1_Pod_To_core_Pod(a, b, s) + } + case *core.Pod: + switch b := objB.(type) { + case *v1.Pod: + return true, Convert_core_Pod_To_v1_Pod(a, b, s) + } + + case *v1.Event: + switch b := objB.(type) { + case *core.Event: + return true, Convert_v1_Event_To_core_Event(a, b, s) + } + case *core.Event: + switch b := objB.(type) { + case *v1.Event: + return true, Convert_core_Event_To_v1_Event(a, b, s) + } + + case *v1.ReplicationController: + switch b := objB.(type) { + case *core.ReplicationController: + return true, Convert_v1_ReplicationController_To_core_ReplicationController(a, b, s) + } + case *core.ReplicationController: + switch b := objB.(type) { + case *v1.ReplicationController: + return true, Convert_core_ReplicationController_To_v1_ReplicationController(a, b, s) + } + + case *v1.Node: + switch b := objB.(type) { + case *core.Node: + return true, Convert_v1_Node_To_core_Node(a, b, s) + } + case *core.Node: + switch b := objB.(type) { + case *v1.Node: + return true, Convert_core_Node_To_v1_Node(a, b, s) + } + + case *v1.Namespace: + switch b := objB.(type) { + case *core.Namespace: + return true, Convert_v1_Namespace_To_core_Namespace(a, b, s) + } + case *core.Namespace: + switch b := objB.(type) { + case *v1.Namespace: + return true, Convert_core_Namespace_To_v1_Namespace(a, b, s) + } + + case *v1.Service: + switch b := objB.(type) { + case *core.Service: + return true, Convert_v1_Service_To_core_Service(a, b, s) + } + case *core.Service: + switch b := objB.(type) { + case *v1.Service: + return true, Convert_core_Service_To_v1_Service(a, b, s) + } + + case *v1.Endpoints: + switch b := objB.(type) { + case *core.Endpoints: + return true, Convert_v1_Endpoints_To_core_Endpoints(a, b, s) + } + case *core.Endpoints: + switch b := objB.(type) { + case *v1.Endpoints: + return true, Convert_core_Endpoints_To_v1_Endpoints(a, b, s) + } + + case *metav1.WatchEvent: + switch b := objB.(type) { + case *metav1.InternalEvent: + return true, metav1.Convert_versioned_Event_to_versioned_InternalEvent(a, b, s) + } + case *metav1.InternalEvent: + switch b := objB.(type) { + case *metav1.WatchEvent: + return true, metav1.Convert_versioned_InternalEvent_to_versioned_Event(a, b, s) + } + } + return false, nil + }) + return nil +} + +func addConversionFuncs(scheme *runtime.Scheme) error { + // Add non-generated conversion functions + err := scheme.AddConversionFuncs( + Convert_core_Pod_To_v1_Pod, + Convert_core_PodSpec_To_v1_PodSpec, + Convert_core_ReplicationControllerSpec_To_v1_ReplicationControllerSpec, + Convert_core_ServiceSpec_To_v1_ServiceSpec, + Convert_v1_Pod_To_core_Pod, + Convert_v1_PodSpec_To_core_PodSpec, + Convert_v1_ReplicationControllerSpec_To_core_ReplicationControllerSpec, + Convert_v1_Secret_To_core_Secret, + Convert_v1_ServiceSpec_To_core_ServiceSpec, + Convert_v1_ResourceList_To_core_ResourceList, + Convert_v1_ReplicationController_to_extensions_ReplicaSet, + Convert_v1_ReplicationControllerSpec_to_extensions_ReplicaSetSpec, + Convert_v1_ReplicationControllerStatus_to_extensions_ReplicaSetStatus, + Convert_extensions_ReplicaSet_to_v1_ReplicationController, + Convert_extensions_ReplicaSetSpec_to_v1_ReplicationControllerSpec, + Convert_extensions_ReplicaSetStatus_to_v1_ReplicationControllerStatus, + ) + if err != nil { + return err + } + + // Add field conversion funcs. + err = scheme.AddFieldLabelConversionFunc("v1", "Pod", + func(label, value string) (string, string, error) { + switch label { + case "metadata.name", + "metadata.namespace", + "spec.nodeName", + "spec.restartPolicy", + "spec.schedulerName", + "status.phase", + "status.podIP", + "status.nominatedNodeName": + return label, value, nil + // This is for backwards compatibility with old v1 clients which send spec.host + case "spec.host": + return "spec.nodeName", value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } + }, + ) + if err != nil { + return err + } + err = scheme.AddFieldLabelConversionFunc("v1", "Node", + func(label, value string) (string, string, error) { + switch label { + case "metadata.name": + return label, value, nil + case "spec.unschedulable": + return label, value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } + }, + ) + if err != nil { + return err + } + err = scheme.AddFieldLabelConversionFunc("v1", "ReplicationController", + func(label, value string) (string, string, error) { + switch label { + case "metadata.name", + "metadata.namespace", + "status.replicas": + return label, value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } + }) + if err != nil { + return err + } + if err := AddFieldLabelConversionsForEvent(scheme); err != nil { + return err + } + if err := AddFieldLabelConversionsForNamespace(scheme); err != nil { + return err + } + if err := AddFieldLabelConversionsForSecret(scheme); err != nil { + return err + } + return nil +} + +func Convert_v1_ReplicationController_to_extensions_ReplicaSet(in *v1.ReplicationController, out *extensions.ReplicaSet, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_ReplicationControllerSpec_to_extensions_ReplicaSetSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_ReplicationControllerStatus_to_extensions_ReplicaSetStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +func Convert_v1_ReplicationControllerSpec_to_extensions_ReplicaSetSpec(in *v1.ReplicationControllerSpec, out *extensions.ReplicaSetSpec, s conversion.Scope) error { + out.Replicas = *in.Replicas + out.MinReadySeconds = in.MinReadySeconds + if in.Selector != nil { + out.Selector = new(metav1.LabelSelector) + metav1.Convert_map_to_unversioned_LabelSelector(&in.Selector, out.Selector, s) + } + if in.Template != nil { + if err := Convert_v1_PodTemplateSpec_To_core_PodTemplateSpec(in.Template, &out.Template, s); err != nil { + return err + } + } + return nil +} + +func Convert_v1_ReplicationControllerStatus_to_extensions_ReplicaSetStatus(in *v1.ReplicationControllerStatus, out *extensions.ReplicaSetStatus, s conversion.Scope) error { + out.Replicas = in.Replicas + out.FullyLabeledReplicas = in.FullyLabeledReplicas + out.ReadyReplicas = in.ReadyReplicas + out.AvailableReplicas = in.AvailableReplicas + out.ObservedGeneration = in.ObservedGeneration + for _, cond := range in.Conditions { + out.Conditions = append(out.Conditions, extensions.ReplicaSetCondition{ + Type: extensions.ReplicaSetConditionType(cond.Type), + Status: core.ConditionStatus(cond.Status), + LastTransitionTime: cond.LastTransitionTime, + Reason: cond.Reason, + Message: cond.Message, + }) + } + return nil +} + +func Convert_extensions_ReplicaSet_to_v1_ReplicationController(in *extensions.ReplicaSet, out *v1.ReplicationController, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_extensions_ReplicaSetSpec_to_v1_ReplicationControllerSpec(&in.Spec, &out.Spec, s); err != nil { + fieldErr, ok := err.(*field.Error) + if !ok { + return err + } + if out.Annotations == nil { + out.Annotations = make(map[string]string) + } + out.Annotations[v1.NonConvertibleAnnotationPrefix+"/"+fieldErr.Field] = reflect.ValueOf(fieldErr.BadValue).String() + } + if err := Convert_extensions_ReplicaSetStatus_to_v1_ReplicationControllerStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +func Convert_extensions_ReplicaSetSpec_to_v1_ReplicationControllerSpec(in *extensions.ReplicaSetSpec, out *v1.ReplicationControllerSpec, s conversion.Scope) error { + out.Replicas = new(int32) + *out.Replicas = in.Replicas + out.MinReadySeconds = in.MinReadySeconds + var invalidErr error + if in.Selector != nil { + invalidErr = metav1.Convert_unversioned_LabelSelector_to_map(in.Selector, &out.Selector, s) + } + out.Template = new(v1.PodTemplateSpec) + if err := Convert_core_PodTemplateSpec_To_v1_PodTemplateSpec(&in.Template, out.Template, s); err != nil { + return err + } + return invalidErr +} + +func Convert_extensions_ReplicaSetStatus_to_v1_ReplicationControllerStatus(in *extensions.ReplicaSetStatus, out *v1.ReplicationControllerStatus, s conversion.Scope) error { + out.Replicas = in.Replicas + out.FullyLabeledReplicas = in.FullyLabeledReplicas + out.ReadyReplicas = in.ReadyReplicas + out.AvailableReplicas = in.AvailableReplicas + out.ObservedGeneration = in.ObservedGeneration + for _, cond := range in.Conditions { + out.Conditions = append(out.Conditions, v1.ReplicationControllerCondition{ + Type: v1.ReplicationControllerConditionType(cond.Type), + Status: v1.ConditionStatus(cond.Status), + LastTransitionTime: cond.LastTransitionTime, + Reason: cond.Reason, + Message: cond.Message, + }) + } + return nil +} + +func Convert_core_ReplicationControllerSpec_To_v1_ReplicationControllerSpec(in *core.ReplicationControllerSpec, out *v1.ReplicationControllerSpec, s conversion.Scope) error { + out.Replicas = &in.Replicas + out.MinReadySeconds = in.MinReadySeconds + out.Selector = in.Selector + if in.Template != nil { + out.Template = new(v1.PodTemplateSpec) + if err := Convert_core_PodTemplateSpec_To_v1_PodTemplateSpec(in.Template, out.Template, s); err != nil { + return err + } + } else { + out.Template = nil + } + return nil +} + +func Convert_v1_ReplicationControllerSpec_To_core_ReplicationControllerSpec(in *v1.ReplicationControllerSpec, out *core.ReplicationControllerSpec, s conversion.Scope) error { + if in.Replicas != nil { + out.Replicas = *in.Replicas + } + out.MinReadySeconds = in.MinReadySeconds + out.Selector = in.Selector + if in.Template != nil { + out.Template = new(core.PodTemplateSpec) + if err := Convert_v1_PodTemplateSpec_To_core_PodTemplateSpec(in.Template, out.Template, s); err != nil { + return err + } + } else { + out.Template = nil + } + return nil +} + +func Convert_core_PodTemplateSpec_To_v1_PodTemplateSpec(in *core.PodTemplateSpec, out *v1.PodTemplateSpec, s conversion.Scope) error { + if err := autoConvert_core_PodTemplateSpec_To_v1_PodTemplateSpec(in, out, s); err != nil { + return err + } + + // drop init container annotations so they don't take effect on legacy kubelets. + // remove this once the oldest supported kubelet no longer honors the annotations over the field. + out.Annotations = dropInitContainerAnnotations(out.Annotations) + + return nil +} + +func Convert_v1_PodTemplateSpec_To_core_PodTemplateSpec(in *v1.PodTemplateSpec, out *core.PodTemplateSpec, s conversion.Scope) error { + if err := autoConvert_v1_PodTemplateSpec_To_core_PodTemplateSpec(in, out, s); err != nil { + return err + } + + // drop init container annotations so they don't show up as differences when receiving requests from old clients + out.Annotations = dropInitContainerAnnotations(out.Annotations) + + return nil +} + +// The following two v1.PodSpec conversions are done here to support v1.ServiceAccount +// as an alias for ServiceAccountName. +func Convert_core_PodSpec_To_v1_PodSpec(in *core.PodSpec, out *v1.PodSpec, s conversion.Scope) error { + if err := autoConvert_core_PodSpec_To_v1_PodSpec(in, out, s); err != nil { + return err + } + + // DeprecatedServiceAccount is an alias for ServiceAccountName. + out.DeprecatedServiceAccount = in.ServiceAccountName + + if in.SecurityContext != nil { + // the host namespace fields have to be handled here for backward compatibility + // with v1.0.0 + out.HostPID = in.SecurityContext.HostPID + out.HostNetwork = in.SecurityContext.HostNetwork + out.HostIPC = in.SecurityContext.HostIPC + out.ShareProcessNamespace = in.SecurityContext.ShareProcessNamespace + } + + return nil +} + +func Convert_v1_PodSpec_To_core_PodSpec(in *v1.PodSpec, out *core.PodSpec, s conversion.Scope) error { + if err := autoConvert_v1_PodSpec_To_core_PodSpec(in, out, s); err != nil { + return err + } + + // We support DeprecatedServiceAccount as an alias for ServiceAccountName. + // If both are specified, ServiceAccountName (the new field) wins. + if in.ServiceAccountName == "" { + out.ServiceAccountName = in.DeprecatedServiceAccount + } + + // the host namespace fields have to be handled specially for backward compatibility + // with v1.0.0 + if out.SecurityContext == nil { + out.SecurityContext = new(core.PodSecurityContext) + } + out.SecurityContext.HostNetwork = in.HostNetwork + out.SecurityContext.HostPID = in.HostPID + out.SecurityContext.HostIPC = in.HostIPC + out.SecurityContext.ShareProcessNamespace = in.ShareProcessNamespace + + return nil +} + +func Convert_v1_Pod_To_core_Pod(in *v1.Pod, out *core.Pod, s conversion.Scope) error { + if err := autoConvert_v1_Pod_To_core_Pod(in, out, s); err != nil { + return err + } + + // drop init container annotations so they don't show up as differences when receiving requests from old clients + out.Annotations = dropInitContainerAnnotations(out.Annotations) + + return nil +} + +func Convert_core_Pod_To_v1_Pod(in *core.Pod, out *v1.Pod, s conversion.Scope) error { + if err := autoConvert_core_Pod_To_v1_Pod(in, out, s); err != nil { + return err + } + + // drop init container annotations so they don't take effect on legacy kubelets. + // remove this once the oldest supported kubelet no longer honors the annotations over the field. + out.Annotations = dropInitContainerAnnotations(out.Annotations) + + return nil +} + +func Convert_v1_Secret_To_core_Secret(in *v1.Secret, out *core.Secret, s conversion.Scope) error { + if err := autoConvert_v1_Secret_To_core_Secret(in, out, s); err != nil { + return err + } + + // StringData overwrites Data + if len(in.StringData) > 0 { + if out.Data == nil { + out.Data = map[string][]byte{} + } + for k, v := range in.StringData { + out.Data[k] = []byte(v) + } + } + + return nil +} +func Convert_core_SecurityContext_To_v1_SecurityContext(in *core.SecurityContext, out *v1.SecurityContext, s conversion.Scope) error { + if in.Capabilities != nil { + out.Capabilities = new(v1.Capabilities) + if err := Convert_core_Capabilities_To_v1_Capabilities(in.Capabilities, out.Capabilities, s); err != nil { + return err + } + } else { + out.Capabilities = nil + } + out.Privileged = in.Privileged + if in.SELinuxOptions != nil { + out.SELinuxOptions = new(v1.SELinuxOptions) + if err := Convert_core_SELinuxOptions_To_v1_SELinuxOptions(in.SELinuxOptions, out.SELinuxOptions, s); err != nil { + return err + } + } else { + out.SELinuxOptions = nil + } + out.RunAsUser = in.RunAsUser + out.RunAsNonRoot = in.RunAsNonRoot + out.ReadOnlyRootFilesystem = in.ReadOnlyRootFilesystem + out.AllowPrivilegeEscalation = in.AllowPrivilegeEscalation + return nil +} + +func Convert_core_PodSecurityContext_To_v1_PodSecurityContext(in *core.PodSecurityContext, out *v1.PodSecurityContext, s conversion.Scope) error { + out.SupplementalGroups = in.SupplementalGroups + if in.SELinuxOptions != nil { + out.SELinuxOptions = new(v1.SELinuxOptions) + if err := Convert_core_SELinuxOptions_To_v1_SELinuxOptions(in.SELinuxOptions, out.SELinuxOptions, s); err != nil { + return err + } + } else { + out.SELinuxOptions = nil + } + out.RunAsUser = in.RunAsUser + out.RunAsNonRoot = in.RunAsNonRoot + out.FSGroup = in.FSGroup + return nil +} + +func Convert_v1_PodSecurityContext_To_core_PodSecurityContext(in *v1.PodSecurityContext, out *core.PodSecurityContext, s conversion.Scope) error { + out.SupplementalGroups = in.SupplementalGroups + if in.SELinuxOptions != nil { + out.SELinuxOptions = new(core.SELinuxOptions) + if err := Convert_v1_SELinuxOptions_To_core_SELinuxOptions(in.SELinuxOptions, out.SELinuxOptions, s); err != nil { + return err + } + } else { + out.SELinuxOptions = nil + } + out.RunAsUser = in.RunAsUser + out.RunAsNonRoot = in.RunAsNonRoot + out.FSGroup = in.FSGroup + return nil +} + +// +k8s:conversion-fn=copy-only +func Convert_v1_ResourceList_To_core_ResourceList(in *v1.ResourceList, out *core.ResourceList, s conversion.Scope) error { + if *in == nil { + return nil + } + if *out == nil { + *out = make(core.ResourceList, len(*in)) + } + for key, val := range *in { + // Moved to defaults + // TODO(#18538): We round up resource values to milli scale to maintain API compatibility. + // In the future, we should instead reject values that need rounding. + // const milliScale = -3 + // val.RoundUp(milliScale) + + (*out)[core.ResourceName(key)] = val + } + return nil +} + +func AddFieldLabelConversionsForEvent(scheme *runtime.Scheme) error { + return scheme.AddFieldLabelConversionFunc("v1", "Event", + func(label, value string) (string, string, error) { + switch label { + case "involvedObject.kind", + "involvedObject.namespace", + "involvedObject.name", + "involvedObject.uid", + "involvedObject.apiVersion", + "involvedObject.resourceVersion", + "involvedObject.fieldPath", + "reason", + "source", + "type", + "metadata.namespace", + "metadata.name": + return label, value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } + }) +} + +func AddFieldLabelConversionsForNamespace(scheme *runtime.Scheme) error { + return scheme.AddFieldLabelConversionFunc("v1", "Namespace", + func(label, value string) (string, string, error) { + switch label { + case "status.phase", + "metadata.name": + return label, value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } + }) +} + +func AddFieldLabelConversionsForSecret(scheme *runtime.Scheme) error { + return scheme.AddFieldLabelConversionFunc("v1", "Secret", + func(label, value string) (string, string, error) { + switch label { + case "type", + "metadata.namespace", + "metadata.name": + return label, value, nil + default: + return "", "", fmt.Errorf("field label not supported: %s", label) + } + }) +} + +var initContainerAnnotations = map[string]bool{ + "pod.beta.kubernetes.io/init-containers": true, + "pod.alpha.kubernetes.io/init-containers": true, + "pod.beta.kubernetes.io/init-container-statuses": true, + "pod.alpha.kubernetes.io/init-container-statuses": true, +} + +// dropInitContainerAnnotations returns a copy of the annotations with init container annotations removed, +// or the original annotations if no init container annotations were present. +// +// this can be removed once no clients prior to 1.8 are supported, and no kubelets prior to 1.8 can be run +// (we don't support kubelets older than 2 versions skewed from the apiserver, but we don't prevent them, either) +func dropInitContainerAnnotations(oldAnnotations map[string]string) map[string]string { + if len(oldAnnotations) == 0 { + return oldAnnotations + } + + found := false + for k := range initContainerAnnotations { + if _, ok := oldAnnotations[k]; ok { + found = true + break + } + } + if !found { + return oldAnnotations + } + + newAnnotations := make(map[string]string, len(oldAnnotations)) + for k, v := range oldAnnotations { + if !initContainerAnnotations[k] { + newAnnotations[k] = v + } + } + return newAnnotations +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/defaults.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/defaults.go new file mode 100644 index 000000000..c2aeafc3d --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/defaults.go @@ -0,0 +1,413 @@ +/* +Copyright 2015 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1 + +import ( + "k8s.io/api/core/v1" + "k8s.io/apimachinery/pkg/runtime" + "k8s.io/apimachinery/pkg/util/intstr" + utilfeature "k8s.io/apiserver/pkg/util/feature" + "k8s.io/kubernetes/pkg/features" + "k8s.io/kubernetes/pkg/util/parsers" + utilpointer "k8s.io/kubernetes/pkg/util/pointer" +) + +func addDefaultingFuncs(scheme *runtime.Scheme) error { + return RegisterDefaults(scheme) +} + +func SetDefaults_ResourceList(obj *v1.ResourceList) { + for key, val := range *obj { + // TODO(#18538): We round up resource values to milli scale to maintain API compatibility. + // In the future, we should instead reject values that need rounding. + const milliScale = -3 + val.RoundUp(milliScale) + + (*obj)[v1.ResourceName(key)] = val + } +} + +func SetDefaults_ReplicationController(obj *v1.ReplicationController) { + var labels map[string]string + if obj.Spec.Template != nil { + labels = obj.Spec.Template.Labels + } + // TODO: support templates defined elsewhere when we support them in the API + if labels != nil { + if len(obj.Spec.Selector) == 0 { + obj.Spec.Selector = labels + } + if len(obj.Labels) == 0 { + obj.Labels = labels + } + } + if obj.Spec.Replicas == nil { + obj.Spec.Replicas = new(int32) + *obj.Spec.Replicas = 1 + } +} +func SetDefaults_Volume(obj *v1.Volume) { + if utilpointer.AllPtrFieldsNil(&obj.VolumeSource) { + obj.VolumeSource = v1.VolumeSource{ + EmptyDir: &v1.EmptyDirVolumeSource{}, + } + } +} +func SetDefaults_ContainerPort(obj *v1.ContainerPort) { + if obj.Protocol == "" { + obj.Protocol = v1.ProtocolTCP + } +} +func SetDefaults_Container(obj *v1.Container) { + if obj.ImagePullPolicy == "" { + // Ignore error and assume it has been validated elsewhere + _, tag, _, _ := parsers.ParseImageName(obj.Image) + + // Check image tag + if tag == "latest" { + obj.ImagePullPolicy = v1.PullAlways + } else { + obj.ImagePullPolicy = v1.PullIfNotPresent + } + } + if obj.TerminationMessagePath == "" { + obj.TerminationMessagePath = v1.TerminationMessagePathDefault + } + if obj.TerminationMessagePolicy == "" { + obj.TerminationMessagePolicy = v1.TerminationMessageReadFile + } +} +func SetDefaults_Service(obj *v1.Service) { + if obj.Spec.SessionAffinity == "" { + obj.Spec.SessionAffinity = v1.ServiceAffinityNone + } + if obj.Spec.SessionAffinity == v1.ServiceAffinityNone { + obj.Spec.SessionAffinityConfig = nil + } + if obj.Spec.SessionAffinity == v1.ServiceAffinityClientIP { + if obj.Spec.SessionAffinityConfig == nil || obj.Spec.SessionAffinityConfig.ClientIP == nil || obj.Spec.SessionAffinityConfig.ClientIP.TimeoutSeconds == nil { + timeoutSeconds := v1.DefaultClientIPServiceAffinitySeconds + obj.Spec.SessionAffinityConfig = &v1.SessionAffinityConfig{ + ClientIP: &v1.ClientIPConfig{ + TimeoutSeconds: &timeoutSeconds, + }, + } + } + } + if obj.Spec.Type == "" { + obj.Spec.Type = v1.ServiceTypeClusterIP + } + for i := range obj.Spec.Ports { + sp := &obj.Spec.Ports[i] + if sp.Protocol == "" { + sp.Protocol = v1.ProtocolTCP + } + if sp.TargetPort == intstr.FromInt(0) || sp.TargetPort == intstr.FromString("") { + sp.TargetPort = intstr.FromInt(int(sp.Port)) + } + } + // Defaults ExternalTrafficPolicy field for NodePort / LoadBalancer service + // to Global for consistency. + if (obj.Spec.Type == v1.ServiceTypeNodePort || + obj.Spec.Type == v1.ServiceTypeLoadBalancer) && + obj.Spec.ExternalTrafficPolicy == "" { + obj.Spec.ExternalTrafficPolicy = v1.ServiceExternalTrafficPolicyTypeCluster + } +} +func SetDefaults_Pod(obj *v1.Pod) { + // If limits are specified, but requests are not, default requests to limits + // This is done here rather than a more specific defaulting pass on v1.ResourceRequirements + // because we only want this defaulting semantic to take place on a v1.Pod and not a v1.PodTemplate + for i := range obj.Spec.Containers { + // set requests to limits if requests are not specified, but limits are + if obj.Spec.Containers[i].Resources.Limits != nil { + if obj.Spec.Containers[i].Resources.Requests == nil { + obj.Spec.Containers[i].Resources.Requests = make(v1.ResourceList) + } + for key, value := range obj.Spec.Containers[i].Resources.Limits { + if _, exists := obj.Spec.Containers[i].Resources.Requests[key]; !exists { + obj.Spec.Containers[i].Resources.Requests[key] = *(value.Copy()) + } + } + } + } + for i := range obj.Spec.InitContainers { + if obj.Spec.InitContainers[i].Resources.Limits != nil { + if obj.Spec.InitContainers[i].Resources.Requests == nil { + obj.Spec.InitContainers[i].Resources.Requests = make(v1.ResourceList) + } + for key, value := range obj.Spec.InitContainers[i].Resources.Limits { + if _, exists := obj.Spec.InitContainers[i].Resources.Requests[key]; !exists { + obj.Spec.InitContainers[i].Resources.Requests[key] = *(value.Copy()) + } + } + } + } +} +func SetDefaults_PodSpec(obj *v1.PodSpec) { + if obj.DNSPolicy == "" { + obj.DNSPolicy = v1.DNSClusterFirst + } + if obj.RestartPolicy == "" { + obj.RestartPolicy = v1.RestartPolicyAlways + } + if obj.HostNetwork { + defaultHostNetworkPorts(&obj.Containers) + defaultHostNetworkPorts(&obj.InitContainers) + } + if obj.SecurityContext == nil { + obj.SecurityContext = &v1.PodSecurityContext{} + } + if obj.TerminationGracePeriodSeconds == nil { + period := int64(v1.DefaultTerminationGracePeriodSeconds) + obj.TerminationGracePeriodSeconds = &period + } + if obj.SchedulerName == "" { + obj.SchedulerName = v1.DefaultSchedulerName + } +} +func SetDefaults_Probe(obj *v1.Probe) { + if obj.TimeoutSeconds == 0 { + obj.TimeoutSeconds = 1 + } + if obj.PeriodSeconds == 0 { + obj.PeriodSeconds = 10 + } + if obj.SuccessThreshold == 0 { + obj.SuccessThreshold = 1 + } + if obj.FailureThreshold == 0 { + obj.FailureThreshold = 3 + } +} +func SetDefaults_SecretVolumeSource(obj *v1.SecretVolumeSource) { + if obj.DefaultMode == nil { + perm := int32(v1.SecretVolumeSourceDefaultMode) + obj.DefaultMode = &perm + } +} +func SetDefaults_ConfigMapVolumeSource(obj *v1.ConfigMapVolumeSource) { + if obj.DefaultMode == nil { + perm := int32(v1.ConfigMapVolumeSourceDefaultMode) + obj.DefaultMode = &perm + } +} +func SetDefaults_DownwardAPIVolumeSource(obj *v1.DownwardAPIVolumeSource) { + if obj.DefaultMode == nil { + perm := int32(v1.DownwardAPIVolumeSourceDefaultMode) + obj.DefaultMode = &perm + } +} +func SetDefaults_Secret(obj *v1.Secret) { + if obj.Type == "" { + obj.Type = v1.SecretTypeOpaque + } +} +func SetDefaults_ProjectedVolumeSource(obj *v1.ProjectedVolumeSource) { + if obj.DefaultMode == nil { + perm := int32(v1.ProjectedVolumeSourceDefaultMode) + obj.DefaultMode = &perm + } +} +func SetDefaults_PersistentVolume(obj *v1.PersistentVolume) { + if obj.Status.Phase == "" { + obj.Status.Phase = v1.VolumePending + } + if obj.Spec.PersistentVolumeReclaimPolicy == "" { + obj.Spec.PersistentVolumeReclaimPolicy = v1.PersistentVolumeReclaimRetain + } + if obj.Spec.VolumeMode == nil && utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + obj.Spec.VolumeMode = new(v1.PersistentVolumeMode) + *obj.Spec.VolumeMode = v1.PersistentVolumeFilesystem + } +} +func SetDefaults_PersistentVolumeClaim(obj *v1.PersistentVolumeClaim) { + if obj.Status.Phase == "" { + obj.Status.Phase = v1.ClaimPending + } + if obj.Spec.VolumeMode == nil && utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + obj.Spec.VolumeMode = new(v1.PersistentVolumeMode) + *obj.Spec.VolumeMode = v1.PersistentVolumeFilesystem + } +} +func SetDefaults_ISCSIVolumeSource(obj *v1.ISCSIVolumeSource) { + if obj.ISCSIInterface == "" { + obj.ISCSIInterface = "default" + } +} +func SetDefaults_ISCSIPersistentVolumeSource(obj *v1.ISCSIPersistentVolumeSource) { + if obj.ISCSIInterface == "" { + obj.ISCSIInterface = "default" + } +} +func SetDefaults_AzureDiskVolumeSource(obj *v1.AzureDiskVolumeSource) { + if obj.CachingMode == nil { + obj.CachingMode = new(v1.AzureDataDiskCachingMode) + *obj.CachingMode = v1.AzureDataDiskCachingReadWrite + } + if obj.Kind == nil { + obj.Kind = new(v1.AzureDataDiskKind) + *obj.Kind = v1.AzureSharedBlobDisk + } + if obj.FSType == nil { + obj.FSType = new(string) + *obj.FSType = "ext4" + } + if obj.ReadOnly == nil { + obj.ReadOnly = new(bool) + *obj.ReadOnly = false + } +} +func SetDefaults_Endpoints(obj *v1.Endpoints) { + for i := range obj.Subsets { + ss := &obj.Subsets[i] + for i := range ss.Ports { + ep := &ss.Ports[i] + if ep.Protocol == "" { + ep.Protocol = v1.ProtocolTCP + } + } + } +} +func SetDefaults_HTTPGetAction(obj *v1.HTTPGetAction) { + if obj.Path == "" { + obj.Path = "/" + } + if obj.Scheme == "" { + obj.Scheme = v1.URISchemeHTTP + } +} +func SetDefaults_NamespaceStatus(obj *v1.NamespaceStatus) { + if obj.Phase == "" { + obj.Phase = v1.NamespaceActive + } +} +func SetDefaults_Node(obj *v1.Node) { + if obj.Spec.ExternalID == "" { + obj.Spec.ExternalID = obj.Name + } +} +func SetDefaults_NodeStatus(obj *v1.NodeStatus) { + if obj.Allocatable == nil && obj.Capacity != nil { + obj.Allocatable = make(v1.ResourceList, len(obj.Capacity)) + for key, value := range obj.Capacity { + obj.Allocatable[key] = *(value.Copy()) + } + obj.Allocatable = obj.Capacity + } +} +func SetDefaults_ObjectFieldSelector(obj *v1.ObjectFieldSelector) { + if obj.APIVersion == "" { + obj.APIVersion = "v1" + } +} +func SetDefaults_LimitRangeItem(obj *v1.LimitRangeItem) { + // for container limits, we apply default values + if obj.Type == v1.LimitTypeContainer { + + if obj.Default == nil { + obj.Default = make(v1.ResourceList) + } + if obj.DefaultRequest == nil { + obj.DefaultRequest = make(v1.ResourceList) + } + + // If a default limit is unspecified, but the max is specified, default the limit to the max + for key, value := range obj.Max { + if _, exists := obj.Default[key]; !exists { + obj.Default[key] = *(value.Copy()) + } + } + // If a default limit is specified, but the default request is not, default request to limit + for key, value := range obj.Default { + if _, exists := obj.DefaultRequest[key]; !exists { + obj.DefaultRequest[key] = *(value.Copy()) + } + } + // If a default request is not specified, but the min is provided, default request to the min + for key, value := range obj.Min { + if _, exists := obj.DefaultRequest[key]; !exists { + obj.DefaultRequest[key] = *(value.Copy()) + } + } + } +} +func SetDefaults_ConfigMap(obj *v1.ConfigMap) { + if obj.Data == nil { + obj.Data = make(map[string]string) + } +} + +// With host networking default all container ports to host ports. +func defaultHostNetworkPorts(containers *[]v1.Container) { + for i := range *containers { + for j := range (*containers)[i].Ports { + if (*containers)[i].Ports[j].HostPort == 0 { + (*containers)[i].Ports[j].HostPort = (*containers)[i].Ports[j].ContainerPort + } + } + } +} + +func SetDefaults_RBDVolumeSource(obj *v1.RBDVolumeSource) { + if obj.RBDPool == "" { + obj.RBDPool = "rbd" + } + if obj.RadosUser == "" { + obj.RadosUser = "admin" + } + if obj.Keyring == "" { + obj.Keyring = "/etc/ceph/keyring" + } +} + +func SetDefaults_RBDPersistentVolumeSource(obj *v1.RBDPersistentVolumeSource) { + if obj.RBDPool == "" { + obj.RBDPool = "rbd" + } + if obj.RadosUser == "" { + obj.RadosUser = "admin" + } + if obj.Keyring == "" { + obj.Keyring = "/etc/ceph/keyring" + } +} + +func SetDefaults_ScaleIOVolumeSource(obj *v1.ScaleIOVolumeSource) { + if obj.StorageMode == "" { + obj.StorageMode = "ThinProvisioned" + } + if obj.FSType == "" { + obj.FSType = "xfs" + } +} + +func SetDefaults_ScaleIOPersistentVolumeSource(obj *v1.ScaleIOPersistentVolumeSource) { + if obj.StorageMode == "" { + obj.StorageMode = "ThinProvisioned" + } + if obj.FSType == "" { + obj.FSType = "xfs" + } +} + +func SetDefaults_HostPathVolumeSource(obj *v1.HostPathVolumeSource) { + typeVol := v1.HostPathUnset + if obj.Type == nil { + obj.Type = &typeVol + } +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/doc.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/doc.go new file mode 100644 index 000000000..454e30183 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/doc.go @@ -0,0 +1,23 @@ +/* +Copyright 2015 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// +k8s:conversion-gen=k8s.io/kubernetes/pkg/apis/core +// +k8s:conversion-gen-external-types=k8s.io/api/core/v1 +// +k8s:defaulter-gen=TypeMeta +// +k8s:defaulter-gen-input=../../../../vendor/k8s.io/api/core/v1 + +// Package v1 is the v1 version of the API. +package v1 // import "k8s.io/kubernetes/pkg/apis/core/v1" diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/helper/helpers.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/helper/helpers.go new file mode 100644 index 000000000..bb6d9385f --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/helper/helpers.go @@ -0,0 +1,450 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package helper + +import ( + "encoding/json" + "fmt" + "strings" + + "k8s.io/api/core/v1" + "k8s.io/apimachinery/pkg/api/resource" + "k8s.io/apimachinery/pkg/labels" + "k8s.io/apimachinery/pkg/selection" + "k8s.io/apimachinery/pkg/util/sets" + "k8s.io/apimachinery/pkg/util/validation" + "k8s.io/kubernetes/pkg/apis/core/helper" +) + +// IsExtendedResourceName returns true if: +// 1. the resource name is not in the default namespace; +// 2. resource name does not have "requests." prefix, +// to avoid confusion with the convention in quota +// 3. it satisfies the rules in IsQualifiedName() after converted into quota resource name +func IsExtendedResourceName(name v1.ResourceName) bool { + if IsDefaultNamespaceResource(name) || strings.HasPrefix(string(name), v1.DefaultResourceRequestsPrefix) { + return false + } + // Ensure it satisfies the rules in IsQualifiedName() after converted into quota resource name + nameForQuota := fmt.Sprintf("%s%s", v1.DefaultResourceRequestsPrefix, string(name)) + if errs := validation.IsQualifiedName(string(nameForQuota)); len(errs) != 0 { + return false + } + return true +} + +// IsDefaultNamespaceResource returns true if the resource name is in the +// *kubernetes.io/ namespace. Partially-qualified (unprefixed) names are +// implicitly in the kubernetes.io/ namespace. +func IsDefaultNamespaceResource(name v1.ResourceName) bool { + return !strings.Contains(string(name), "/") || + strings.Contains(string(name), v1.ResourceDefaultNamespacePrefix) + +} + +// IsHugePageResourceName returns true if the resource name has the huge page +// resource prefix. +func IsHugePageResourceName(name v1.ResourceName) bool { + return strings.HasPrefix(string(name), v1.ResourceHugePagesPrefix) +} + +// HugePageResourceName returns a ResourceName with the canonical hugepage +// prefix prepended for the specified page size. The page size is converted +// to its canonical representation. +func HugePageResourceName(pageSize resource.Quantity) v1.ResourceName { + return v1.ResourceName(fmt.Sprintf("%s%s", v1.ResourceHugePagesPrefix, pageSize.String())) +} + +// HugePageSizeFromResourceName returns the page size for the specified huge page +// resource name. If the specified input is not a valid huge page resource name +// an error is returned. +func HugePageSizeFromResourceName(name v1.ResourceName) (resource.Quantity, error) { + if !IsHugePageResourceName(name) { + return resource.Quantity{}, fmt.Errorf("resource name: %s is not valid hugepage name", name) + } + pageSize := strings.TrimPrefix(string(name), v1.ResourceHugePagesPrefix) + return resource.ParseQuantity(pageSize) +} + +var overcommitBlacklist = sets.NewString(string(v1.ResourceNvidiaGPU)) + +// IsOvercommitAllowed returns true if the resource is in the default +// namespace and not blacklisted and is not hugepages. +func IsOvercommitAllowed(name v1.ResourceName) bool { + return IsDefaultNamespaceResource(name) && + !IsHugePageResourceName(name) && + !overcommitBlacklist.Has(string(name)) +} + +// Extended and Hugepages resources +func IsScalarResourceName(name v1.ResourceName) bool { + return IsExtendedResourceName(name) || IsHugePageResourceName(name) +} + +// this function aims to check if the service's ClusterIP is set or not +// the objective is not to perform validation here +func IsServiceIPSet(service *v1.Service) bool { + return service.Spec.ClusterIP != v1.ClusterIPNone && service.Spec.ClusterIP != "" +} + +// AddToNodeAddresses appends the NodeAddresses to the passed-by-pointer slice, +// only if they do not already exist +func AddToNodeAddresses(addresses *[]v1.NodeAddress, addAddresses ...v1.NodeAddress) { + for _, add := range addAddresses { + exists := false + for _, existing := range *addresses { + if existing.Address == add.Address && existing.Type == add.Type { + exists = true + break + } + } + if !exists { + *addresses = append(*addresses, add) + } + } +} + +// TODO: make method on LoadBalancerStatus? +func LoadBalancerStatusEqual(l, r *v1.LoadBalancerStatus) bool { + return ingressSliceEqual(l.Ingress, r.Ingress) +} + +func ingressSliceEqual(lhs, rhs []v1.LoadBalancerIngress) bool { + if len(lhs) != len(rhs) { + return false + } + for i := range lhs { + if !ingressEqual(&lhs[i], &rhs[i]) { + return false + } + } + return true +} + +func ingressEqual(lhs, rhs *v1.LoadBalancerIngress) bool { + if lhs.IP != rhs.IP { + return false + } + if lhs.Hostname != rhs.Hostname { + return false + } + return true +} + +// TODO: make method on LoadBalancerStatus? +func LoadBalancerStatusDeepCopy(lb *v1.LoadBalancerStatus) *v1.LoadBalancerStatus { + c := &v1.LoadBalancerStatus{} + c.Ingress = make([]v1.LoadBalancerIngress, len(lb.Ingress)) + for i := range lb.Ingress { + c.Ingress[i] = lb.Ingress[i] + } + return c +} + +// GetAccessModesAsString returns a string representation of an array of access modes. +// modes, when present, are always in the same order: RWO,ROX,RWX. +func GetAccessModesAsString(modes []v1.PersistentVolumeAccessMode) string { + modes = removeDuplicateAccessModes(modes) + modesStr := []string{} + if containsAccessMode(modes, v1.ReadWriteOnce) { + modesStr = append(modesStr, "RWO") + } + if containsAccessMode(modes, v1.ReadOnlyMany) { + modesStr = append(modesStr, "ROX") + } + if containsAccessMode(modes, v1.ReadWriteMany) { + modesStr = append(modesStr, "RWX") + } + return strings.Join(modesStr, ",") +} + +// GetAccessModesAsString returns an array of AccessModes from a string created by GetAccessModesAsString +func GetAccessModesFromString(modes string) []v1.PersistentVolumeAccessMode { + strmodes := strings.Split(modes, ",") + accessModes := []v1.PersistentVolumeAccessMode{} + for _, s := range strmodes { + s = strings.Trim(s, " ") + switch { + case s == "RWO": + accessModes = append(accessModes, v1.ReadWriteOnce) + case s == "ROX": + accessModes = append(accessModes, v1.ReadOnlyMany) + case s == "RWX": + accessModes = append(accessModes, v1.ReadWriteMany) + } + } + return accessModes +} + +// removeDuplicateAccessModes returns an array of access modes without any duplicates +func removeDuplicateAccessModes(modes []v1.PersistentVolumeAccessMode) []v1.PersistentVolumeAccessMode { + accessModes := []v1.PersistentVolumeAccessMode{} + for _, m := range modes { + if !containsAccessMode(accessModes, m) { + accessModes = append(accessModes, m) + } + } + return accessModes +} + +func containsAccessMode(modes []v1.PersistentVolumeAccessMode, mode v1.PersistentVolumeAccessMode) bool { + for _, m := range modes { + if m == mode { + return true + } + } + return false +} + +// NodeSelectorRequirementsAsSelector converts the []NodeSelectorRequirement api type into a struct that implements +// labels.Selector. +func NodeSelectorRequirementsAsSelector(nsm []v1.NodeSelectorRequirement) (labels.Selector, error) { + if len(nsm) == 0 { + return labels.Nothing(), nil + } + selector := labels.NewSelector() + for _, expr := range nsm { + var op selection.Operator + switch expr.Operator { + case v1.NodeSelectorOpIn: + op = selection.In + case v1.NodeSelectorOpNotIn: + op = selection.NotIn + case v1.NodeSelectorOpExists: + op = selection.Exists + case v1.NodeSelectorOpDoesNotExist: + op = selection.DoesNotExist + case v1.NodeSelectorOpGt: + op = selection.GreaterThan + case v1.NodeSelectorOpLt: + op = selection.LessThan + default: + return nil, fmt.Errorf("%q is not a valid node selector operator", expr.Operator) + } + r, err := labels.NewRequirement(expr.Key, op, expr.Values) + if err != nil { + return nil, err + } + selector = selector.Add(*r) + } + return selector, nil +} + +// AddOrUpdateTolerationInPodSpec tries to add a toleration to the toleration list in PodSpec. +// Returns true if something was updated, false otherwise. +func AddOrUpdateTolerationInPodSpec(spec *v1.PodSpec, toleration *v1.Toleration) bool { + podTolerations := spec.Tolerations + + var newTolerations []v1.Toleration + updated := false + for i := range podTolerations { + if toleration.MatchToleration(&podTolerations[i]) { + if helper.Semantic.DeepEqual(toleration, podTolerations[i]) { + return false + } + newTolerations = append(newTolerations, *toleration) + updated = true + continue + } + + newTolerations = append(newTolerations, podTolerations[i]) + } + + if !updated { + newTolerations = append(newTolerations, *toleration) + } + + spec.Tolerations = newTolerations + return true +} + +// AddOrUpdateTolerationInPod tries to add a toleration to the pod's toleration list. +// Returns true if something was updated, false otherwise. +func AddOrUpdateTolerationInPod(pod *v1.Pod, toleration *v1.Toleration) bool { + return AddOrUpdateTolerationInPodSpec(&pod.Spec, toleration) +} + +// TolerationsTolerateTaint checks if taint is tolerated by any of the tolerations. +func TolerationsTolerateTaint(tolerations []v1.Toleration, taint *v1.Taint) bool { + for i := range tolerations { + if tolerations[i].ToleratesTaint(taint) { + return true + } + } + return false +} + +type taintsFilterFunc func(*v1.Taint) bool + +// TolerationsTolerateTaintsWithFilter checks if given tolerations tolerates +// all the taints that apply to the filter in given taint list. +func TolerationsTolerateTaintsWithFilter(tolerations []v1.Toleration, taints []v1.Taint, applyFilter taintsFilterFunc) bool { + if len(taints) == 0 { + return true + } + + for i := range taints { + if applyFilter != nil && !applyFilter(&taints[i]) { + continue + } + + if !TolerationsTolerateTaint(tolerations, &taints[i]) { + return false + } + } + + return true +} + +// Returns true and list of Tolerations matching all Taints if all are tolerated, or false otherwise. +func GetMatchingTolerations(taints []v1.Taint, tolerations []v1.Toleration) (bool, []v1.Toleration) { + if len(taints) == 0 { + return true, []v1.Toleration{} + } + if len(tolerations) == 0 && len(taints) > 0 { + return false, []v1.Toleration{} + } + result := []v1.Toleration{} + for i := range taints { + tolerated := false + for j := range tolerations { + if tolerations[j].ToleratesTaint(&taints[i]) { + result = append(result, tolerations[j]) + tolerated = true + break + } + } + if !tolerated { + return false, []v1.Toleration{} + } + } + return true, result +} + +func GetAvoidPodsFromNodeAnnotations(annotations map[string]string) (v1.AvoidPods, error) { + var avoidPods v1.AvoidPods + if len(annotations) > 0 && annotations[v1.PreferAvoidPodsAnnotationKey] != "" { + err := json.Unmarshal([]byte(annotations[v1.PreferAvoidPodsAnnotationKey]), &avoidPods) + if err != nil { + return avoidPods, err + } + } + return avoidPods, nil +} + +// SysctlsFromPodAnnotations parses the sysctl annotations into a slice of safe Sysctls +// and a slice of unsafe Sysctls. This is only a convenience wrapper around +// SysctlsFromPodAnnotation. +func SysctlsFromPodAnnotations(a map[string]string) ([]v1.Sysctl, []v1.Sysctl, error) { + safe, err := SysctlsFromPodAnnotation(a[v1.SysctlsPodAnnotationKey]) + if err != nil { + return nil, nil, err + } + unsafe, err := SysctlsFromPodAnnotation(a[v1.UnsafeSysctlsPodAnnotationKey]) + if err != nil { + return nil, nil, err + } + + return safe, unsafe, nil +} + +// SysctlsFromPodAnnotation parses an annotation value into a slice of Sysctls. +func SysctlsFromPodAnnotation(annotation string) ([]v1.Sysctl, error) { + if len(annotation) == 0 { + return nil, nil + } + + kvs := strings.Split(annotation, ",") + sysctls := make([]v1.Sysctl, len(kvs)) + for i, kv := range kvs { + cs := strings.Split(kv, "=") + if len(cs) != 2 || len(cs[0]) == 0 { + return nil, fmt.Errorf("sysctl %q not of the format sysctl_name=value", kv) + } + sysctls[i].Name = cs[0] + sysctls[i].Value = cs[1] + } + return sysctls, nil +} + +// PodAnnotationsFromSysctls creates an annotation value for a slice of Sysctls. +func PodAnnotationsFromSysctls(sysctls []v1.Sysctl) string { + if len(sysctls) == 0 { + return "" + } + + kvs := make([]string, len(sysctls)) + for i := range sysctls { + kvs[i] = fmt.Sprintf("%s=%s", sysctls[i].Name, sysctls[i].Value) + } + return strings.Join(kvs, ",") +} + +// GetPersistentVolumeClass returns StorageClassName. +func GetPersistentVolumeClass(volume *v1.PersistentVolume) string { + // Use beta annotation first + if class, found := volume.Annotations[v1.BetaStorageClassAnnotation]; found { + return class + } + + return volume.Spec.StorageClassName +} + +// GetPersistentVolumeClaimClass returns StorageClassName. If no storage class was +// requested, it returns "". +func GetPersistentVolumeClaimClass(claim *v1.PersistentVolumeClaim) string { + // Use beta annotation first + if class, found := claim.Annotations[v1.BetaStorageClassAnnotation]; found { + return class + } + + if claim.Spec.StorageClassName != nil { + return *claim.Spec.StorageClassName + } + + return "" +} + +// GetStorageNodeAffinityFromAnnotation gets the json serialized data from PersistentVolume.Annotations +// and converts it to the NodeAffinity type in api. +// TODO: update when storage node affinity graduates to beta +func GetStorageNodeAffinityFromAnnotation(annotations map[string]string) (*v1.NodeAffinity, error) { + if len(annotations) > 0 && annotations[v1.AlphaStorageNodeAffinityAnnotation] != "" { + var affinity v1.NodeAffinity + err := json.Unmarshal([]byte(annotations[v1.AlphaStorageNodeAffinityAnnotation]), &affinity) + if err != nil { + return nil, err + } + return &affinity, nil + } + return nil, nil +} + +// Converts NodeAffinity type to Alpha annotation for use in PersistentVolumes +// TODO: update when storage node affinity graduates to beta +func StorageNodeAffinityToAlphaAnnotation(annotations map[string]string, affinity *v1.NodeAffinity) error { + if affinity == nil { + return nil + } + + json, err := json.Marshal(*affinity) + if err != nil { + return err + } + annotations[v1.AlphaStorageNodeAffinityAnnotation] = string(json) + return nil +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/register.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/register.go new file mode 100644 index 000000000..79611beab --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/register.go @@ -0,0 +1,46 @@ +/* +Copyright 2017 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1 + +import ( + "k8s.io/api/core/v1" + "k8s.io/apimachinery/pkg/runtime/schema" +) + +var ( + localSchemeBuilder = &v1.SchemeBuilder + AddToScheme = localSchemeBuilder.AddToScheme +) + +func init() { + // We only register manually written functions here. The registration of the + // generated functions takes place in the generated files. The separation + // makes the code compile even when the generated files are missing. + localSchemeBuilder.Register(addDefaultingFuncs, addConversionFuncs, addFastPathConversionFuncs) +} + +// TODO: remove these global varialbes +// GroupName is the group name use in this package +const GroupName = "" + +// SchemeGroupVersion is group version used to register these objects +var SchemeGroupVersion = schema.GroupVersion{Group: GroupName, Version: "v1"} + +// Resource takes an unqualified resource and returns a Group qualified GroupResource +func Resource(resource string) schema.GroupResource { + return SchemeGroupVersion.WithResource(resource).GroupResource() +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/zz_generated.conversion.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/zz_generated.conversion.go new file mode 100644 index 000000000..17773f26e --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/zz_generated.conversion.go @@ -0,0 +1,5686 @@ +// +build !ignore_autogenerated + +/* +Copyright 2018 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by conversion-gen. DO NOT EDIT. + +package v1 + +import ( + unsafe "unsafe" + + v1 "k8s.io/api/core/v1" + resource "k8s.io/apimachinery/pkg/api/resource" + meta_v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + conversion "k8s.io/apimachinery/pkg/conversion" + runtime "k8s.io/apimachinery/pkg/runtime" + types "k8s.io/apimachinery/pkg/types" + core "k8s.io/kubernetes/pkg/apis/core" +) + +func init() { + localSchemeBuilder.Register(RegisterConversions) +} + +// RegisterConversions adds conversion functions to the given scheme. +// Public to allow building arbitrary schemes. +func RegisterConversions(scheme *runtime.Scheme) error { + return scheme.AddGeneratedConversionFuncs( + Convert_v1_AWSElasticBlockStoreVolumeSource_To_core_AWSElasticBlockStoreVolumeSource, + Convert_core_AWSElasticBlockStoreVolumeSource_To_v1_AWSElasticBlockStoreVolumeSource, + Convert_v1_Affinity_To_core_Affinity, + Convert_core_Affinity_To_v1_Affinity, + Convert_v1_AttachedVolume_To_core_AttachedVolume, + Convert_core_AttachedVolume_To_v1_AttachedVolume, + Convert_v1_AvoidPods_To_core_AvoidPods, + Convert_core_AvoidPods_To_v1_AvoidPods, + Convert_v1_AzureDiskVolumeSource_To_core_AzureDiskVolumeSource, + Convert_core_AzureDiskVolumeSource_To_v1_AzureDiskVolumeSource, + Convert_v1_AzureFilePersistentVolumeSource_To_core_AzureFilePersistentVolumeSource, + Convert_core_AzureFilePersistentVolumeSource_To_v1_AzureFilePersistentVolumeSource, + Convert_v1_AzureFileVolumeSource_To_core_AzureFileVolumeSource, + Convert_core_AzureFileVolumeSource_To_v1_AzureFileVolumeSource, + Convert_v1_Binding_To_core_Binding, + Convert_core_Binding_To_v1_Binding, + Convert_v1_CSIPersistentVolumeSource_To_core_CSIPersistentVolumeSource, + Convert_core_CSIPersistentVolumeSource_To_v1_CSIPersistentVolumeSource, + Convert_v1_Capabilities_To_core_Capabilities, + Convert_core_Capabilities_To_v1_Capabilities, + Convert_v1_CephFSPersistentVolumeSource_To_core_CephFSPersistentVolumeSource, + Convert_core_CephFSPersistentVolumeSource_To_v1_CephFSPersistentVolumeSource, + Convert_v1_CephFSVolumeSource_To_core_CephFSVolumeSource, + Convert_core_CephFSVolumeSource_To_v1_CephFSVolumeSource, + Convert_v1_CinderVolumeSource_To_core_CinderVolumeSource, + Convert_core_CinderVolumeSource_To_v1_CinderVolumeSource, + Convert_v1_ClientIPConfig_To_core_ClientIPConfig, + Convert_core_ClientIPConfig_To_v1_ClientIPConfig, + Convert_v1_ComponentCondition_To_core_ComponentCondition, + Convert_core_ComponentCondition_To_v1_ComponentCondition, + Convert_v1_ComponentStatus_To_core_ComponentStatus, + Convert_core_ComponentStatus_To_v1_ComponentStatus, + Convert_v1_ComponentStatusList_To_core_ComponentStatusList, + Convert_core_ComponentStatusList_To_v1_ComponentStatusList, + Convert_v1_ConfigMap_To_core_ConfigMap, + Convert_core_ConfigMap_To_v1_ConfigMap, + Convert_v1_ConfigMapEnvSource_To_core_ConfigMapEnvSource, + Convert_core_ConfigMapEnvSource_To_v1_ConfigMapEnvSource, + Convert_v1_ConfigMapKeySelector_To_core_ConfigMapKeySelector, + Convert_core_ConfigMapKeySelector_To_v1_ConfigMapKeySelector, + Convert_v1_ConfigMapList_To_core_ConfigMapList, + Convert_core_ConfigMapList_To_v1_ConfigMapList, + Convert_v1_ConfigMapProjection_To_core_ConfigMapProjection, + Convert_core_ConfigMapProjection_To_v1_ConfigMapProjection, + Convert_v1_ConfigMapVolumeSource_To_core_ConfigMapVolumeSource, + Convert_core_ConfigMapVolumeSource_To_v1_ConfigMapVolumeSource, + Convert_v1_Container_To_core_Container, + Convert_core_Container_To_v1_Container, + Convert_v1_ContainerImage_To_core_ContainerImage, + Convert_core_ContainerImage_To_v1_ContainerImage, + Convert_v1_ContainerPort_To_core_ContainerPort, + Convert_core_ContainerPort_To_v1_ContainerPort, + Convert_v1_ContainerState_To_core_ContainerState, + Convert_core_ContainerState_To_v1_ContainerState, + Convert_v1_ContainerStateRunning_To_core_ContainerStateRunning, + Convert_core_ContainerStateRunning_To_v1_ContainerStateRunning, + Convert_v1_ContainerStateTerminated_To_core_ContainerStateTerminated, + Convert_core_ContainerStateTerminated_To_v1_ContainerStateTerminated, + Convert_v1_ContainerStateWaiting_To_core_ContainerStateWaiting, + Convert_core_ContainerStateWaiting_To_v1_ContainerStateWaiting, + Convert_v1_ContainerStatus_To_core_ContainerStatus, + Convert_core_ContainerStatus_To_v1_ContainerStatus, + Convert_v1_DaemonEndpoint_To_core_DaemonEndpoint, + Convert_core_DaemonEndpoint_To_v1_DaemonEndpoint, + Convert_v1_DeleteOptions_To_core_DeleteOptions, + Convert_core_DeleteOptions_To_v1_DeleteOptions, + Convert_v1_DownwardAPIProjection_To_core_DownwardAPIProjection, + Convert_core_DownwardAPIProjection_To_v1_DownwardAPIProjection, + Convert_v1_DownwardAPIVolumeFile_To_core_DownwardAPIVolumeFile, + Convert_core_DownwardAPIVolumeFile_To_v1_DownwardAPIVolumeFile, + Convert_v1_DownwardAPIVolumeSource_To_core_DownwardAPIVolumeSource, + Convert_core_DownwardAPIVolumeSource_To_v1_DownwardAPIVolumeSource, + Convert_v1_EmptyDirVolumeSource_To_core_EmptyDirVolumeSource, + Convert_core_EmptyDirVolumeSource_To_v1_EmptyDirVolumeSource, + Convert_v1_EndpointAddress_To_core_EndpointAddress, + Convert_core_EndpointAddress_To_v1_EndpointAddress, + Convert_v1_EndpointPort_To_core_EndpointPort, + Convert_core_EndpointPort_To_v1_EndpointPort, + Convert_v1_EndpointSubset_To_core_EndpointSubset, + Convert_core_EndpointSubset_To_v1_EndpointSubset, + Convert_v1_Endpoints_To_core_Endpoints, + Convert_core_Endpoints_To_v1_Endpoints, + Convert_v1_EndpointsList_To_core_EndpointsList, + Convert_core_EndpointsList_To_v1_EndpointsList, + Convert_v1_EnvFromSource_To_core_EnvFromSource, + Convert_core_EnvFromSource_To_v1_EnvFromSource, + Convert_v1_EnvVar_To_core_EnvVar, + Convert_core_EnvVar_To_v1_EnvVar, + Convert_v1_EnvVarSource_To_core_EnvVarSource, + Convert_core_EnvVarSource_To_v1_EnvVarSource, + Convert_v1_Event_To_core_Event, + Convert_core_Event_To_v1_Event, + Convert_v1_EventList_To_core_EventList, + Convert_core_EventList_To_v1_EventList, + Convert_v1_EventSeries_To_core_EventSeries, + Convert_core_EventSeries_To_v1_EventSeries, + Convert_v1_EventSource_To_core_EventSource, + Convert_core_EventSource_To_v1_EventSource, + Convert_v1_ExecAction_To_core_ExecAction, + Convert_core_ExecAction_To_v1_ExecAction, + Convert_v1_FCVolumeSource_To_core_FCVolumeSource, + Convert_core_FCVolumeSource_To_v1_FCVolumeSource, + Convert_v1_FlexPersistentVolumeSource_To_core_FlexPersistentVolumeSource, + Convert_core_FlexPersistentVolumeSource_To_v1_FlexPersistentVolumeSource, + Convert_v1_FlexVolumeSource_To_core_FlexVolumeSource, + Convert_core_FlexVolumeSource_To_v1_FlexVolumeSource, + Convert_v1_FlockerVolumeSource_To_core_FlockerVolumeSource, + Convert_core_FlockerVolumeSource_To_v1_FlockerVolumeSource, + Convert_v1_GCEPersistentDiskVolumeSource_To_core_GCEPersistentDiskVolumeSource, + Convert_core_GCEPersistentDiskVolumeSource_To_v1_GCEPersistentDiskVolumeSource, + Convert_v1_GitRepoVolumeSource_To_core_GitRepoVolumeSource, + Convert_core_GitRepoVolumeSource_To_v1_GitRepoVolumeSource, + Convert_v1_GlusterfsVolumeSource_To_core_GlusterfsVolumeSource, + Convert_core_GlusterfsVolumeSource_To_v1_GlusterfsVolumeSource, + Convert_v1_HTTPGetAction_To_core_HTTPGetAction, + Convert_core_HTTPGetAction_To_v1_HTTPGetAction, + Convert_v1_HTTPHeader_To_core_HTTPHeader, + Convert_core_HTTPHeader_To_v1_HTTPHeader, + Convert_v1_Handler_To_core_Handler, + Convert_core_Handler_To_v1_Handler, + Convert_v1_HostAlias_To_core_HostAlias, + Convert_core_HostAlias_To_v1_HostAlias, + Convert_v1_HostPathVolumeSource_To_core_HostPathVolumeSource, + Convert_core_HostPathVolumeSource_To_v1_HostPathVolumeSource, + Convert_v1_ISCSIPersistentVolumeSource_To_core_ISCSIPersistentVolumeSource, + Convert_core_ISCSIPersistentVolumeSource_To_v1_ISCSIPersistentVolumeSource, + Convert_v1_ISCSIVolumeSource_To_core_ISCSIVolumeSource, + Convert_core_ISCSIVolumeSource_To_v1_ISCSIVolumeSource, + Convert_v1_KeyToPath_To_core_KeyToPath, + Convert_core_KeyToPath_To_v1_KeyToPath, + Convert_v1_Lifecycle_To_core_Lifecycle, + Convert_core_Lifecycle_To_v1_Lifecycle, + Convert_v1_LimitRange_To_core_LimitRange, + Convert_core_LimitRange_To_v1_LimitRange, + Convert_v1_LimitRangeItem_To_core_LimitRangeItem, + Convert_core_LimitRangeItem_To_v1_LimitRangeItem, + Convert_v1_LimitRangeList_To_core_LimitRangeList, + Convert_core_LimitRangeList_To_v1_LimitRangeList, + Convert_v1_LimitRangeSpec_To_core_LimitRangeSpec, + Convert_core_LimitRangeSpec_To_v1_LimitRangeSpec, + Convert_v1_List_To_core_List, + Convert_core_List_To_v1_List, + Convert_v1_ListOptions_To_core_ListOptions, + Convert_core_ListOptions_To_v1_ListOptions, + Convert_v1_LoadBalancerIngress_To_core_LoadBalancerIngress, + Convert_core_LoadBalancerIngress_To_v1_LoadBalancerIngress, + Convert_v1_LoadBalancerStatus_To_core_LoadBalancerStatus, + Convert_core_LoadBalancerStatus_To_v1_LoadBalancerStatus, + Convert_v1_LocalObjectReference_To_core_LocalObjectReference, + Convert_core_LocalObjectReference_To_v1_LocalObjectReference, + Convert_v1_LocalVolumeSource_To_core_LocalVolumeSource, + Convert_core_LocalVolumeSource_To_v1_LocalVolumeSource, + Convert_v1_NFSVolumeSource_To_core_NFSVolumeSource, + Convert_core_NFSVolumeSource_To_v1_NFSVolumeSource, + Convert_v1_Namespace_To_core_Namespace, + Convert_core_Namespace_To_v1_Namespace, + Convert_v1_NamespaceList_To_core_NamespaceList, + Convert_core_NamespaceList_To_v1_NamespaceList, + Convert_v1_NamespaceSpec_To_core_NamespaceSpec, + Convert_core_NamespaceSpec_To_v1_NamespaceSpec, + Convert_v1_NamespaceStatus_To_core_NamespaceStatus, + Convert_core_NamespaceStatus_To_v1_NamespaceStatus, + Convert_v1_Node_To_core_Node, + Convert_core_Node_To_v1_Node, + Convert_v1_NodeAddress_To_core_NodeAddress, + Convert_core_NodeAddress_To_v1_NodeAddress, + Convert_v1_NodeAffinity_To_core_NodeAffinity, + Convert_core_NodeAffinity_To_v1_NodeAffinity, + Convert_v1_NodeCondition_To_core_NodeCondition, + Convert_core_NodeCondition_To_v1_NodeCondition, + Convert_v1_NodeConfigSource_To_core_NodeConfigSource, + Convert_core_NodeConfigSource_To_v1_NodeConfigSource, + Convert_v1_NodeDaemonEndpoints_To_core_NodeDaemonEndpoints, + Convert_core_NodeDaemonEndpoints_To_v1_NodeDaemonEndpoints, + Convert_v1_NodeList_To_core_NodeList, + Convert_core_NodeList_To_v1_NodeList, + Convert_v1_NodeProxyOptions_To_core_NodeProxyOptions, + Convert_core_NodeProxyOptions_To_v1_NodeProxyOptions, + Convert_v1_NodeResources_To_core_NodeResources, + Convert_core_NodeResources_To_v1_NodeResources, + Convert_v1_NodeSelector_To_core_NodeSelector, + Convert_core_NodeSelector_To_v1_NodeSelector, + Convert_v1_NodeSelectorRequirement_To_core_NodeSelectorRequirement, + Convert_core_NodeSelectorRequirement_To_v1_NodeSelectorRequirement, + Convert_v1_NodeSelectorTerm_To_core_NodeSelectorTerm, + Convert_core_NodeSelectorTerm_To_v1_NodeSelectorTerm, + Convert_v1_NodeSpec_To_core_NodeSpec, + Convert_core_NodeSpec_To_v1_NodeSpec, + Convert_v1_NodeStatus_To_core_NodeStatus, + Convert_core_NodeStatus_To_v1_NodeStatus, + Convert_v1_NodeSystemInfo_To_core_NodeSystemInfo, + Convert_core_NodeSystemInfo_To_v1_NodeSystemInfo, + Convert_v1_ObjectFieldSelector_To_core_ObjectFieldSelector, + Convert_core_ObjectFieldSelector_To_v1_ObjectFieldSelector, + Convert_v1_ObjectMeta_To_core_ObjectMeta, + Convert_core_ObjectMeta_To_v1_ObjectMeta, + Convert_v1_ObjectReference_To_core_ObjectReference, + Convert_core_ObjectReference_To_v1_ObjectReference, + Convert_v1_PersistentVolume_To_core_PersistentVolume, + Convert_core_PersistentVolume_To_v1_PersistentVolume, + Convert_v1_PersistentVolumeClaim_To_core_PersistentVolumeClaim, + Convert_core_PersistentVolumeClaim_To_v1_PersistentVolumeClaim, + Convert_v1_PersistentVolumeClaimCondition_To_core_PersistentVolumeClaimCondition, + Convert_core_PersistentVolumeClaimCondition_To_v1_PersistentVolumeClaimCondition, + Convert_v1_PersistentVolumeClaimList_To_core_PersistentVolumeClaimList, + Convert_core_PersistentVolumeClaimList_To_v1_PersistentVolumeClaimList, + Convert_v1_PersistentVolumeClaimSpec_To_core_PersistentVolumeClaimSpec, + Convert_core_PersistentVolumeClaimSpec_To_v1_PersistentVolumeClaimSpec, + Convert_v1_PersistentVolumeClaimStatus_To_core_PersistentVolumeClaimStatus, + Convert_core_PersistentVolumeClaimStatus_To_v1_PersistentVolumeClaimStatus, + Convert_v1_PersistentVolumeClaimVolumeSource_To_core_PersistentVolumeClaimVolumeSource, + Convert_core_PersistentVolumeClaimVolumeSource_To_v1_PersistentVolumeClaimVolumeSource, + Convert_v1_PersistentVolumeList_To_core_PersistentVolumeList, + Convert_core_PersistentVolumeList_To_v1_PersistentVolumeList, + Convert_v1_PersistentVolumeSource_To_core_PersistentVolumeSource, + Convert_core_PersistentVolumeSource_To_v1_PersistentVolumeSource, + Convert_v1_PersistentVolumeSpec_To_core_PersistentVolumeSpec, + Convert_core_PersistentVolumeSpec_To_v1_PersistentVolumeSpec, + Convert_v1_PersistentVolumeStatus_To_core_PersistentVolumeStatus, + Convert_core_PersistentVolumeStatus_To_v1_PersistentVolumeStatus, + Convert_v1_PhotonPersistentDiskVolumeSource_To_core_PhotonPersistentDiskVolumeSource, + Convert_core_PhotonPersistentDiskVolumeSource_To_v1_PhotonPersistentDiskVolumeSource, + Convert_v1_Pod_To_core_Pod, + Convert_core_Pod_To_v1_Pod, + Convert_v1_PodAffinity_To_core_PodAffinity, + Convert_core_PodAffinity_To_v1_PodAffinity, + Convert_v1_PodAffinityTerm_To_core_PodAffinityTerm, + Convert_core_PodAffinityTerm_To_v1_PodAffinityTerm, + Convert_v1_PodAntiAffinity_To_core_PodAntiAffinity, + Convert_core_PodAntiAffinity_To_v1_PodAntiAffinity, + Convert_v1_PodAttachOptions_To_core_PodAttachOptions, + Convert_core_PodAttachOptions_To_v1_PodAttachOptions, + Convert_v1_PodCondition_To_core_PodCondition, + Convert_core_PodCondition_To_v1_PodCondition, + Convert_v1_PodDNSConfig_To_core_PodDNSConfig, + Convert_core_PodDNSConfig_To_v1_PodDNSConfig, + Convert_v1_PodDNSConfigOption_To_core_PodDNSConfigOption, + Convert_core_PodDNSConfigOption_To_v1_PodDNSConfigOption, + Convert_v1_PodExecOptions_To_core_PodExecOptions, + Convert_core_PodExecOptions_To_v1_PodExecOptions, + Convert_v1_PodList_To_core_PodList, + Convert_core_PodList_To_v1_PodList, + Convert_v1_PodLogOptions_To_core_PodLogOptions, + Convert_core_PodLogOptions_To_v1_PodLogOptions, + Convert_v1_PodPortForwardOptions_To_core_PodPortForwardOptions, + Convert_core_PodPortForwardOptions_To_v1_PodPortForwardOptions, + Convert_v1_PodProxyOptions_To_core_PodProxyOptions, + Convert_core_PodProxyOptions_To_v1_PodProxyOptions, + Convert_v1_PodSecurityContext_To_core_PodSecurityContext, + Convert_core_PodSecurityContext_To_v1_PodSecurityContext, + Convert_v1_PodSignature_To_core_PodSignature, + Convert_core_PodSignature_To_v1_PodSignature, + Convert_v1_PodSpec_To_core_PodSpec, + Convert_core_PodSpec_To_v1_PodSpec, + Convert_v1_PodStatus_To_core_PodStatus, + Convert_core_PodStatus_To_v1_PodStatus, + Convert_v1_PodStatusResult_To_core_PodStatusResult, + Convert_core_PodStatusResult_To_v1_PodStatusResult, + Convert_v1_PodTemplate_To_core_PodTemplate, + Convert_core_PodTemplate_To_v1_PodTemplate, + Convert_v1_PodTemplateList_To_core_PodTemplateList, + Convert_core_PodTemplateList_To_v1_PodTemplateList, + Convert_v1_PodTemplateSpec_To_core_PodTemplateSpec, + Convert_core_PodTemplateSpec_To_v1_PodTemplateSpec, + Convert_v1_PortworxVolumeSource_To_core_PortworxVolumeSource, + Convert_core_PortworxVolumeSource_To_v1_PortworxVolumeSource, + Convert_v1_Preconditions_To_core_Preconditions, + Convert_core_Preconditions_To_v1_Preconditions, + Convert_v1_PreferAvoidPodsEntry_To_core_PreferAvoidPodsEntry, + Convert_core_PreferAvoidPodsEntry_To_v1_PreferAvoidPodsEntry, + Convert_v1_PreferredSchedulingTerm_To_core_PreferredSchedulingTerm, + Convert_core_PreferredSchedulingTerm_To_v1_PreferredSchedulingTerm, + Convert_v1_Probe_To_core_Probe, + Convert_core_Probe_To_v1_Probe, + Convert_v1_ProjectedVolumeSource_To_core_ProjectedVolumeSource, + Convert_core_ProjectedVolumeSource_To_v1_ProjectedVolumeSource, + Convert_v1_QuobyteVolumeSource_To_core_QuobyteVolumeSource, + Convert_core_QuobyteVolumeSource_To_v1_QuobyteVolumeSource, + Convert_v1_RBDPersistentVolumeSource_To_core_RBDPersistentVolumeSource, + Convert_core_RBDPersistentVolumeSource_To_v1_RBDPersistentVolumeSource, + Convert_v1_RBDVolumeSource_To_core_RBDVolumeSource, + Convert_core_RBDVolumeSource_To_v1_RBDVolumeSource, + Convert_v1_RangeAllocation_To_core_RangeAllocation, + Convert_core_RangeAllocation_To_v1_RangeAllocation, + Convert_v1_ReplicationController_To_core_ReplicationController, + Convert_core_ReplicationController_To_v1_ReplicationController, + Convert_v1_ReplicationControllerCondition_To_core_ReplicationControllerCondition, + Convert_core_ReplicationControllerCondition_To_v1_ReplicationControllerCondition, + Convert_v1_ReplicationControllerList_To_core_ReplicationControllerList, + Convert_core_ReplicationControllerList_To_v1_ReplicationControllerList, + Convert_v1_ReplicationControllerSpec_To_core_ReplicationControllerSpec, + Convert_core_ReplicationControllerSpec_To_v1_ReplicationControllerSpec, + Convert_v1_ReplicationControllerStatus_To_core_ReplicationControllerStatus, + Convert_core_ReplicationControllerStatus_To_v1_ReplicationControllerStatus, + Convert_v1_ResourceFieldSelector_To_core_ResourceFieldSelector, + Convert_core_ResourceFieldSelector_To_v1_ResourceFieldSelector, + Convert_v1_ResourceQuota_To_core_ResourceQuota, + Convert_core_ResourceQuota_To_v1_ResourceQuota, + Convert_v1_ResourceQuotaList_To_core_ResourceQuotaList, + Convert_core_ResourceQuotaList_To_v1_ResourceQuotaList, + Convert_v1_ResourceQuotaSpec_To_core_ResourceQuotaSpec, + Convert_core_ResourceQuotaSpec_To_v1_ResourceQuotaSpec, + Convert_v1_ResourceQuotaStatus_To_core_ResourceQuotaStatus, + Convert_core_ResourceQuotaStatus_To_v1_ResourceQuotaStatus, + Convert_v1_ResourceRequirements_To_core_ResourceRequirements, + Convert_core_ResourceRequirements_To_v1_ResourceRequirements, + Convert_v1_SELinuxOptions_To_core_SELinuxOptions, + Convert_core_SELinuxOptions_To_v1_SELinuxOptions, + Convert_v1_ScaleIOPersistentVolumeSource_To_core_ScaleIOPersistentVolumeSource, + Convert_core_ScaleIOPersistentVolumeSource_To_v1_ScaleIOPersistentVolumeSource, + Convert_v1_ScaleIOVolumeSource_To_core_ScaleIOVolumeSource, + Convert_core_ScaleIOVolumeSource_To_v1_ScaleIOVolumeSource, + Convert_v1_Secret_To_core_Secret, + Convert_core_Secret_To_v1_Secret, + Convert_v1_SecretEnvSource_To_core_SecretEnvSource, + Convert_core_SecretEnvSource_To_v1_SecretEnvSource, + Convert_v1_SecretKeySelector_To_core_SecretKeySelector, + Convert_core_SecretKeySelector_To_v1_SecretKeySelector, + Convert_v1_SecretList_To_core_SecretList, + Convert_core_SecretList_To_v1_SecretList, + Convert_v1_SecretProjection_To_core_SecretProjection, + Convert_core_SecretProjection_To_v1_SecretProjection, + Convert_v1_SecretReference_To_core_SecretReference, + Convert_core_SecretReference_To_v1_SecretReference, + Convert_v1_SecretVolumeSource_To_core_SecretVolumeSource, + Convert_core_SecretVolumeSource_To_v1_SecretVolumeSource, + Convert_v1_SecurityContext_To_core_SecurityContext, + Convert_core_SecurityContext_To_v1_SecurityContext, + Convert_v1_SerializedReference_To_core_SerializedReference, + Convert_core_SerializedReference_To_v1_SerializedReference, + Convert_v1_Service_To_core_Service, + Convert_core_Service_To_v1_Service, + Convert_v1_ServiceAccount_To_core_ServiceAccount, + Convert_core_ServiceAccount_To_v1_ServiceAccount, + Convert_v1_ServiceAccountList_To_core_ServiceAccountList, + Convert_core_ServiceAccountList_To_v1_ServiceAccountList, + Convert_v1_ServiceList_To_core_ServiceList, + Convert_core_ServiceList_To_v1_ServiceList, + Convert_v1_ServicePort_To_core_ServicePort, + Convert_core_ServicePort_To_v1_ServicePort, + Convert_v1_ServiceProxyOptions_To_core_ServiceProxyOptions, + Convert_core_ServiceProxyOptions_To_v1_ServiceProxyOptions, + Convert_v1_ServiceSpec_To_core_ServiceSpec, + Convert_core_ServiceSpec_To_v1_ServiceSpec, + Convert_v1_ServiceStatus_To_core_ServiceStatus, + Convert_core_ServiceStatus_To_v1_ServiceStatus, + Convert_v1_SessionAffinityConfig_To_core_SessionAffinityConfig, + Convert_core_SessionAffinityConfig_To_v1_SessionAffinityConfig, + Convert_v1_StorageOSPersistentVolumeSource_To_core_StorageOSPersistentVolumeSource, + Convert_core_StorageOSPersistentVolumeSource_To_v1_StorageOSPersistentVolumeSource, + Convert_v1_StorageOSVolumeSource_To_core_StorageOSVolumeSource, + Convert_core_StorageOSVolumeSource_To_v1_StorageOSVolumeSource, + Convert_v1_Sysctl_To_core_Sysctl, + Convert_core_Sysctl_To_v1_Sysctl, + Convert_v1_TCPSocketAction_To_core_TCPSocketAction, + Convert_core_TCPSocketAction_To_v1_TCPSocketAction, + Convert_v1_Taint_To_core_Taint, + Convert_core_Taint_To_v1_Taint, + Convert_v1_Toleration_To_core_Toleration, + Convert_core_Toleration_To_v1_Toleration, + Convert_v1_Volume_To_core_Volume, + Convert_core_Volume_To_v1_Volume, + Convert_v1_VolumeDevice_To_core_VolumeDevice, + Convert_core_VolumeDevice_To_v1_VolumeDevice, + Convert_v1_VolumeMount_To_core_VolumeMount, + Convert_core_VolumeMount_To_v1_VolumeMount, + Convert_v1_VolumeNodeAffinity_To_core_VolumeNodeAffinity, + Convert_core_VolumeNodeAffinity_To_v1_VolumeNodeAffinity, + Convert_v1_VolumeProjection_To_core_VolumeProjection, + Convert_core_VolumeProjection_To_v1_VolumeProjection, + Convert_v1_VolumeSource_To_core_VolumeSource, + Convert_core_VolumeSource_To_v1_VolumeSource, + Convert_v1_VsphereVirtualDiskVolumeSource_To_core_VsphereVirtualDiskVolumeSource, + Convert_core_VsphereVirtualDiskVolumeSource_To_v1_VsphereVirtualDiskVolumeSource, + Convert_v1_WeightedPodAffinityTerm_To_core_WeightedPodAffinityTerm, + Convert_core_WeightedPodAffinityTerm_To_v1_WeightedPodAffinityTerm, + ) +} + +func autoConvert_v1_AWSElasticBlockStoreVolumeSource_To_core_AWSElasticBlockStoreVolumeSource(in *v1.AWSElasticBlockStoreVolumeSource, out *core.AWSElasticBlockStoreVolumeSource, s conversion.Scope) error { + out.VolumeID = in.VolumeID + out.FSType = in.FSType + out.Partition = in.Partition + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_AWSElasticBlockStoreVolumeSource_To_core_AWSElasticBlockStoreVolumeSource is an autogenerated conversion function. +func Convert_v1_AWSElasticBlockStoreVolumeSource_To_core_AWSElasticBlockStoreVolumeSource(in *v1.AWSElasticBlockStoreVolumeSource, out *core.AWSElasticBlockStoreVolumeSource, s conversion.Scope) error { + return autoConvert_v1_AWSElasticBlockStoreVolumeSource_To_core_AWSElasticBlockStoreVolumeSource(in, out, s) +} + +func autoConvert_core_AWSElasticBlockStoreVolumeSource_To_v1_AWSElasticBlockStoreVolumeSource(in *core.AWSElasticBlockStoreVolumeSource, out *v1.AWSElasticBlockStoreVolumeSource, s conversion.Scope) error { + out.VolumeID = in.VolumeID + out.FSType = in.FSType + out.Partition = in.Partition + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_AWSElasticBlockStoreVolumeSource_To_v1_AWSElasticBlockStoreVolumeSource is an autogenerated conversion function. +func Convert_core_AWSElasticBlockStoreVolumeSource_To_v1_AWSElasticBlockStoreVolumeSource(in *core.AWSElasticBlockStoreVolumeSource, out *v1.AWSElasticBlockStoreVolumeSource, s conversion.Scope) error { + return autoConvert_core_AWSElasticBlockStoreVolumeSource_To_v1_AWSElasticBlockStoreVolumeSource(in, out, s) +} + +func autoConvert_v1_Affinity_To_core_Affinity(in *v1.Affinity, out *core.Affinity, s conversion.Scope) error { + out.NodeAffinity = (*core.NodeAffinity)(unsafe.Pointer(in.NodeAffinity)) + out.PodAffinity = (*core.PodAffinity)(unsafe.Pointer(in.PodAffinity)) + out.PodAntiAffinity = (*core.PodAntiAffinity)(unsafe.Pointer(in.PodAntiAffinity)) + return nil +} + +// Convert_v1_Affinity_To_core_Affinity is an autogenerated conversion function. +func Convert_v1_Affinity_To_core_Affinity(in *v1.Affinity, out *core.Affinity, s conversion.Scope) error { + return autoConvert_v1_Affinity_To_core_Affinity(in, out, s) +} + +func autoConvert_core_Affinity_To_v1_Affinity(in *core.Affinity, out *v1.Affinity, s conversion.Scope) error { + out.NodeAffinity = (*v1.NodeAffinity)(unsafe.Pointer(in.NodeAffinity)) + out.PodAffinity = (*v1.PodAffinity)(unsafe.Pointer(in.PodAffinity)) + out.PodAntiAffinity = (*v1.PodAntiAffinity)(unsafe.Pointer(in.PodAntiAffinity)) + return nil +} + +// Convert_core_Affinity_To_v1_Affinity is an autogenerated conversion function. +func Convert_core_Affinity_To_v1_Affinity(in *core.Affinity, out *v1.Affinity, s conversion.Scope) error { + return autoConvert_core_Affinity_To_v1_Affinity(in, out, s) +} + +func autoConvert_v1_AttachedVolume_To_core_AttachedVolume(in *v1.AttachedVolume, out *core.AttachedVolume, s conversion.Scope) error { + out.Name = core.UniqueVolumeName(in.Name) + out.DevicePath = in.DevicePath + return nil +} + +// Convert_v1_AttachedVolume_To_core_AttachedVolume is an autogenerated conversion function. +func Convert_v1_AttachedVolume_To_core_AttachedVolume(in *v1.AttachedVolume, out *core.AttachedVolume, s conversion.Scope) error { + return autoConvert_v1_AttachedVolume_To_core_AttachedVolume(in, out, s) +} + +func autoConvert_core_AttachedVolume_To_v1_AttachedVolume(in *core.AttachedVolume, out *v1.AttachedVolume, s conversion.Scope) error { + out.Name = v1.UniqueVolumeName(in.Name) + out.DevicePath = in.DevicePath + return nil +} + +// Convert_core_AttachedVolume_To_v1_AttachedVolume is an autogenerated conversion function. +func Convert_core_AttachedVolume_To_v1_AttachedVolume(in *core.AttachedVolume, out *v1.AttachedVolume, s conversion.Scope) error { + return autoConvert_core_AttachedVolume_To_v1_AttachedVolume(in, out, s) +} + +func autoConvert_v1_AvoidPods_To_core_AvoidPods(in *v1.AvoidPods, out *core.AvoidPods, s conversion.Scope) error { + out.PreferAvoidPods = *(*[]core.PreferAvoidPodsEntry)(unsafe.Pointer(&in.PreferAvoidPods)) + return nil +} + +// Convert_v1_AvoidPods_To_core_AvoidPods is an autogenerated conversion function. +func Convert_v1_AvoidPods_To_core_AvoidPods(in *v1.AvoidPods, out *core.AvoidPods, s conversion.Scope) error { + return autoConvert_v1_AvoidPods_To_core_AvoidPods(in, out, s) +} + +func autoConvert_core_AvoidPods_To_v1_AvoidPods(in *core.AvoidPods, out *v1.AvoidPods, s conversion.Scope) error { + out.PreferAvoidPods = *(*[]v1.PreferAvoidPodsEntry)(unsafe.Pointer(&in.PreferAvoidPods)) + return nil +} + +// Convert_core_AvoidPods_To_v1_AvoidPods is an autogenerated conversion function. +func Convert_core_AvoidPods_To_v1_AvoidPods(in *core.AvoidPods, out *v1.AvoidPods, s conversion.Scope) error { + return autoConvert_core_AvoidPods_To_v1_AvoidPods(in, out, s) +} + +func autoConvert_v1_AzureDiskVolumeSource_To_core_AzureDiskVolumeSource(in *v1.AzureDiskVolumeSource, out *core.AzureDiskVolumeSource, s conversion.Scope) error { + out.DiskName = in.DiskName + out.DataDiskURI = in.DataDiskURI + out.CachingMode = (*core.AzureDataDiskCachingMode)(unsafe.Pointer(in.CachingMode)) + out.FSType = (*string)(unsafe.Pointer(in.FSType)) + out.ReadOnly = (*bool)(unsafe.Pointer(in.ReadOnly)) + out.Kind = (*core.AzureDataDiskKind)(unsafe.Pointer(in.Kind)) + return nil +} + +// Convert_v1_AzureDiskVolumeSource_To_core_AzureDiskVolumeSource is an autogenerated conversion function. +func Convert_v1_AzureDiskVolumeSource_To_core_AzureDiskVolumeSource(in *v1.AzureDiskVolumeSource, out *core.AzureDiskVolumeSource, s conversion.Scope) error { + return autoConvert_v1_AzureDiskVolumeSource_To_core_AzureDiskVolumeSource(in, out, s) +} + +func autoConvert_core_AzureDiskVolumeSource_To_v1_AzureDiskVolumeSource(in *core.AzureDiskVolumeSource, out *v1.AzureDiskVolumeSource, s conversion.Scope) error { + out.DiskName = in.DiskName + out.DataDiskURI = in.DataDiskURI + out.CachingMode = (*v1.AzureDataDiskCachingMode)(unsafe.Pointer(in.CachingMode)) + out.FSType = (*string)(unsafe.Pointer(in.FSType)) + out.ReadOnly = (*bool)(unsafe.Pointer(in.ReadOnly)) + out.Kind = (*v1.AzureDataDiskKind)(unsafe.Pointer(in.Kind)) + return nil +} + +// Convert_core_AzureDiskVolumeSource_To_v1_AzureDiskVolumeSource is an autogenerated conversion function. +func Convert_core_AzureDiskVolumeSource_To_v1_AzureDiskVolumeSource(in *core.AzureDiskVolumeSource, out *v1.AzureDiskVolumeSource, s conversion.Scope) error { + return autoConvert_core_AzureDiskVolumeSource_To_v1_AzureDiskVolumeSource(in, out, s) +} + +func autoConvert_v1_AzureFilePersistentVolumeSource_To_core_AzureFilePersistentVolumeSource(in *v1.AzureFilePersistentVolumeSource, out *core.AzureFilePersistentVolumeSource, s conversion.Scope) error { + out.SecretName = in.SecretName + out.ShareName = in.ShareName + out.ReadOnly = in.ReadOnly + out.SecretNamespace = (*string)(unsafe.Pointer(in.SecretNamespace)) + return nil +} + +// Convert_v1_AzureFilePersistentVolumeSource_To_core_AzureFilePersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_AzureFilePersistentVolumeSource_To_core_AzureFilePersistentVolumeSource(in *v1.AzureFilePersistentVolumeSource, out *core.AzureFilePersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_AzureFilePersistentVolumeSource_To_core_AzureFilePersistentVolumeSource(in, out, s) +} + +func autoConvert_core_AzureFilePersistentVolumeSource_To_v1_AzureFilePersistentVolumeSource(in *core.AzureFilePersistentVolumeSource, out *v1.AzureFilePersistentVolumeSource, s conversion.Scope) error { + out.SecretName = in.SecretName + out.ShareName = in.ShareName + out.ReadOnly = in.ReadOnly + out.SecretNamespace = (*string)(unsafe.Pointer(in.SecretNamespace)) + return nil +} + +// Convert_core_AzureFilePersistentVolumeSource_To_v1_AzureFilePersistentVolumeSource is an autogenerated conversion function. +func Convert_core_AzureFilePersistentVolumeSource_To_v1_AzureFilePersistentVolumeSource(in *core.AzureFilePersistentVolumeSource, out *v1.AzureFilePersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_AzureFilePersistentVolumeSource_To_v1_AzureFilePersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_AzureFileVolumeSource_To_core_AzureFileVolumeSource(in *v1.AzureFileVolumeSource, out *core.AzureFileVolumeSource, s conversion.Scope) error { + out.SecretName = in.SecretName + out.ShareName = in.ShareName + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_AzureFileVolumeSource_To_core_AzureFileVolumeSource is an autogenerated conversion function. +func Convert_v1_AzureFileVolumeSource_To_core_AzureFileVolumeSource(in *v1.AzureFileVolumeSource, out *core.AzureFileVolumeSource, s conversion.Scope) error { + return autoConvert_v1_AzureFileVolumeSource_To_core_AzureFileVolumeSource(in, out, s) +} + +func autoConvert_core_AzureFileVolumeSource_To_v1_AzureFileVolumeSource(in *core.AzureFileVolumeSource, out *v1.AzureFileVolumeSource, s conversion.Scope) error { + out.SecretName = in.SecretName + out.ShareName = in.ShareName + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_AzureFileVolumeSource_To_v1_AzureFileVolumeSource is an autogenerated conversion function. +func Convert_core_AzureFileVolumeSource_To_v1_AzureFileVolumeSource(in *core.AzureFileVolumeSource, out *v1.AzureFileVolumeSource, s conversion.Scope) error { + return autoConvert_core_AzureFileVolumeSource_To_v1_AzureFileVolumeSource(in, out, s) +} + +func autoConvert_v1_Binding_To_core_Binding(in *v1.Binding, out *core.Binding, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_ObjectReference_To_core_ObjectReference(&in.Target, &out.Target, s); err != nil { + return err + } + return nil +} + +// Convert_v1_Binding_To_core_Binding is an autogenerated conversion function. +func Convert_v1_Binding_To_core_Binding(in *v1.Binding, out *core.Binding, s conversion.Scope) error { + return autoConvert_v1_Binding_To_core_Binding(in, out, s) +} + +func autoConvert_core_Binding_To_v1_Binding(in *core.Binding, out *v1.Binding, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_ObjectReference_To_v1_ObjectReference(&in.Target, &out.Target, s); err != nil { + return err + } + return nil +} + +// Convert_core_Binding_To_v1_Binding is an autogenerated conversion function. +func Convert_core_Binding_To_v1_Binding(in *core.Binding, out *v1.Binding, s conversion.Scope) error { + return autoConvert_core_Binding_To_v1_Binding(in, out, s) +} + +func autoConvert_v1_CSIPersistentVolumeSource_To_core_CSIPersistentVolumeSource(in *v1.CSIPersistentVolumeSource, out *core.CSIPersistentVolumeSource, s conversion.Scope) error { + out.Driver = in.Driver + out.VolumeHandle = in.VolumeHandle + out.ReadOnly = in.ReadOnly + out.FSType = in.FSType + out.VolumeAttributes = *(*map[string]string)(unsafe.Pointer(&in.VolumeAttributes)) + out.ControllerPublishSecretRef = (*core.SecretReference)(unsafe.Pointer(in.ControllerPublishSecretRef)) + out.NodeStageSecretRef = (*core.SecretReference)(unsafe.Pointer(in.NodeStageSecretRef)) + out.NodePublishSecretRef = (*core.SecretReference)(unsafe.Pointer(in.NodePublishSecretRef)) + return nil +} + +// Convert_v1_CSIPersistentVolumeSource_To_core_CSIPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_CSIPersistentVolumeSource_To_core_CSIPersistentVolumeSource(in *v1.CSIPersistentVolumeSource, out *core.CSIPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_CSIPersistentVolumeSource_To_core_CSIPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_CSIPersistentVolumeSource_To_v1_CSIPersistentVolumeSource(in *core.CSIPersistentVolumeSource, out *v1.CSIPersistentVolumeSource, s conversion.Scope) error { + out.Driver = in.Driver + out.VolumeHandle = in.VolumeHandle + out.ReadOnly = in.ReadOnly + out.FSType = in.FSType + out.VolumeAttributes = *(*map[string]string)(unsafe.Pointer(&in.VolumeAttributes)) + out.ControllerPublishSecretRef = (*v1.SecretReference)(unsafe.Pointer(in.ControllerPublishSecretRef)) + out.NodeStageSecretRef = (*v1.SecretReference)(unsafe.Pointer(in.NodeStageSecretRef)) + out.NodePublishSecretRef = (*v1.SecretReference)(unsafe.Pointer(in.NodePublishSecretRef)) + return nil +} + +// Convert_core_CSIPersistentVolumeSource_To_v1_CSIPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_CSIPersistentVolumeSource_To_v1_CSIPersistentVolumeSource(in *core.CSIPersistentVolumeSource, out *v1.CSIPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_CSIPersistentVolumeSource_To_v1_CSIPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_Capabilities_To_core_Capabilities(in *v1.Capabilities, out *core.Capabilities, s conversion.Scope) error { + out.Add = *(*[]core.Capability)(unsafe.Pointer(&in.Add)) + out.Drop = *(*[]core.Capability)(unsafe.Pointer(&in.Drop)) + return nil +} + +// Convert_v1_Capabilities_To_core_Capabilities is an autogenerated conversion function. +func Convert_v1_Capabilities_To_core_Capabilities(in *v1.Capabilities, out *core.Capabilities, s conversion.Scope) error { + return autoConvert_v1_Capabilities_To_core_Capabilities(in, out, s) +} + +func autoConvert_core_Capabilities_To_v1_Capabilities(in *core.Capabilities, out *v1.Capabilities, s conversion.Scope) error { + out.Add = *(*[]v1.Capability)(unsafe.Pointer(&in.Add)) + out.Drop = *(*[]v1.Capability)(unsafe.Pointer(&in.Drop)) + return nil +} + +// Convert_core_Capabilities_To_v1_Capabilities is an autogenerated conversion function. +func Convert_core_Capabilities_To_v1_Capabilities(in *core.Capabilities, out *v1.Capabilities, s conversion.Scope) error { + return autoConvert_core_Capabilities_To_v1_Capabilities(in, out, s) +} + +func autoConvert_v1_CephFSPersistentVolumeSource_To_core_CephFSPersistentVolumeSource(in *v1.CephFSPersistentVolumeSource, out *core.CephFSPersistentVolumeSource, s conversion.Scope) error { + out.Monitors = *(*[]string)(unsafe.Pointer(&in.Monitors)) + out.Path = in.Path + out.User = in.User + out.SecretFile = in.SecretFile + out.SecretRef = (*core.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_CephFSPersistentVolumeSource_To_core_CephFSPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_CephFSPersistentVolumeSource_To_core_CephFSPersistentVolumeSource(in *v1.CephFSPersistentVolumeSource, out *core.CephFSPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_CephFSPersistentVolumeSource_To_core_CephFSPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_CephFSPersistentVolumeSource_To_v1_CephFSPersistentVolumeSource(in *core.CephFSPersistentVolumeSource, out *v1.CephFSPersistentVolumeSource, s conversion.Scope) error { + out.Monitors = *(*[]string)(unsafe.Pointer(&in.Monitors)) + out.Path = in.Path + out.User = in.User + out.SecretFile = in.SecretFile + out.SecretRef = (*v1.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_CephFSPersistentVolumeSource_To_v1_CephFSPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_CephFSPersistentVolumeSource_To_v1_CephFSPersistentVolumeSource(in *core.CephFSPersistentVolumeSource, out *v1.CephFSPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_CephFSPersistentVolumeSource_To_v1_CephFSPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_CephFSVolumeSource_To_core_CephFSVolumeSource(in *v1.CephFSVolumeSource, out *core.CephFSVolumeSource, s conversion.Scope) error { + out.Monitors = *(*[]string)(unsafe.Pointer(&in.Monitors)) + out.Path = in.Path + out.User = in.User + out.SecretFile = in.SecretFile + out.SecretRef = (*core.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_CephFSVolumeSource_To_core_CephFSVolumeSource is an autogenerated conversion function. +func Convert_v1_CephFSVolumeSource_To_core_CephFSVolumeSource(in *v1.CephFSVolumeSource, out *core.CephFSVolumeSource, s conversion.Scope) error { + return autoConvert_v1_CephFSVolumeSource_To_core_CephFSVolumeSource(in, out, s) +} + +func autoConvert_core_CephFSVolumeSource_To_v1_CephFSVolumeSource(in *core.CephFSVolumeSource, out *v1.CephFSVolumeSource, s conversion.Scope) error { + out.Monitors = *(*[]string)(unsafe.Pointer(&in.Monitors)) + out.Path = in.Path + out.User = in.User + out.SecretFile = in.SecretFile + out.SecretRef = (*v1.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_CephFSVolumeSource_To_v1_CephFSVolumeSource is an autogenerated conversion function. +func Convert_core_CephFSVolumeSource_To_v1_CephFSVolumeSource(in *core.CephFSVolumeSource, out *v1.CephFSVolumeSource, s conversion.Scope) error { + return autoConvert_core_CephFSVolumeSource_To_v1_CephFSVolumeSource(in, out, s) +} + +func autoConvert_v1_CinderVolumeSource_To_core_CinderVolumeSource(in *v1.CinderVolumeSource, out *core.CinderVolumeSource, s conversion.Scope) error { + out.VolumeID = in.VolumeID + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_CinderVolumeSource_To_core_CinderVolumeSource is an autogenerated conversion function. +func Convert_v1_CinderVolumeSource_To_core_CinderVolumeSource(in *v1.CinderVolumeSource, out *core.CinderVolumeSource, s conversion.Scope) error { + return autoConvert_v1_CinderVolumeSource_To_core_CinderVolumeSource(in, out, s) +} + +func autoConvert_core_CinderVolumeSource_To_v1_CinderVolumeSource(in *core.CinderVolumeSource, out *v1.CinderVolumeSource, s conversion.Scope) error { + out.VolumeID = in.VolumeID + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_CinderVolumeSource_To_v1_CinderVolumeSource is an autogenerated conversion function. +func Convert_core_CinderVolumeSource_To_v1_CinderVolumeSource(in *core.CinderVolumeSource, out *v1.CinderVolumeSource, s conversion.Scope) error { + return autoConvert_core_CinderVolumeSource_To_v1_CinderVolumeSource(in, out, s) +} + +func autoConvert_v1_ClientIPConfig_To_core_ClientIPConfig(in *v1.ClientIPConfig, out *core.ClientIPConfig, s conversion.Scope) error { + out.TimeoutSeconds = (*int32)(unsafe.Pointer(in.TimeoutSeconds)) + return nil +} + +// Convert_v1_ClientIPConfig_To_core_ClientIPConfig is an autogenerated conversion function. +func Convert_v1_ClientIPConfig_To_core_ClientIPConfig(in *v1.ClientIPConfig, out *core.ClientIPConfig, s conversion.Scope) error { + return autoConvert_v1_ClientIPConfig_To_core_ClientIPConfig(in, out, s) +} + +func autoConvert_core_ClientIPConfig_To_v1_ClientIPConfig(in *core.ClientIPConfig, out *v1.ClientIPConfig, s conversion.Scope) error { + out.TimeoutSeconds = (*int32)(unsafe.Pointer(in.TimeoutSeconds)) + return nil +} + +// Convert_core_ClientIPConfig_To_v1_ClientIPConfig is an autogenerated conversion function. +func Convert_core_ClientIPConfig_To_v1_ClientIPConfig(in *core.ClientIPConfig, out *v1.ClientIPConfig, s conversion.Scope) error { + return autoConvert_core_ClientIPConfig_To_v1_ClientIPConfig(in, out, s) +} + +func autoConvert_v1_ComponentCondition_To_core_ComponentCondition(in *v1.ComponentCondition, out *core.ComponentCondition, s conversion.Scope) error { + out.Type = core.ComponentConditionType(in.Type) + out.Status = core.ConditionStatus(in.Status) + out.Message = in.Message + out.Error = in.Error + return nil +} + +// Convert_v1_ComponentCondition_To_core_ComponentCondition is an autogenerated conversion function. +func Convert_v1_ComponentCondition_To_core_ComponentCondition(in *v1.ComponentCondition, out *core.ComponentCondition, s conversion.Scope) error { + return autoConvert_v1_ComponentCondition_To_core_ComponentCondition(in, out, s) +} + +func autoConvert_core_ComponentCondition_To_v1_ComponentCondition(in *core.ComponentCondition, out *v1.ComponentCondition, s conversion.Scope) error { + out.Type = v1.ComponentConditionType(in.Type) + out.Status = v1.ConditionStatus(in.Status) + out.Message = in.Message + out.Error = in.Error + return nil +} + +// Convert_core_ComponentCondition_To_v1_ComponentCondition is an autogenerated conversion function. +func Convert_core_ComponentCondition_To_v1_ComponentCondition(in *core.ComponentCondition, out *v1.ComponentCondition, s conversion.Scope) error { + return autoConvert_core_ComponentCondition_To_v1_ComponentCondition(in, out, s) +} + +func autoConvert_v1_ComponentStatus_To_core_ComponentStatus(in *v1.ComponentStatus, out *core.ComponentStatus, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Conditions = *(*[]core.ComponentCondition)(unsafe.Pointer(&in.Conditions)) + return nil +} + +// Convert_v1_ComponentStatus_To_core_ComponentStatus is an autogenerated conversion function. +func Convert_v1_ComponentStatus_To_core_ComponentStatus(in *v1.ComponentStatus, out *core.ComponentStatus, s conversion.Scope) error { + return autoConvert_v1_ComponentStatus_To_core_ComponentStatus(in, out, s) +} + +func autoConvert_core_ComponentStatus_To_v1_ComponentStatus(in *core.ComponentStatus, out *v1.ComponentStatus, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Conditions = *(*[]v1.ComponentCondition)(unsafe.Pointer(&in.Conditions)) + return nil +} + +// Convert_core_ComponentStatus_To_v1_ComponentStatus is an autogenerated conversion function. +func Convert_core_ComponentStatus_To_v1_ComponentStatus(in *core.ComponentStatus, out *v1.ComponentStatus, s conversion.Scope) error { + return autoConvert_core_ComponentStatus_To_v1_ComponentStatus(in, out, s) +} + +func autoConvert_v1_ComponentStatusList_To_core_ComponentStatusList(in *v1.ComponentStatusList, out *core.ComponentStatusList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.ComponentStatus)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_ComponentStatusList_To_core_ComponentStatusList is an autogenerated conversion function. +func Convert_v1_ComponentStatusList_To_core_ComponentStatusList(in *v1.ComponentStatusList, out *core.ComponentStatusList, s conversion.Scope) error { + return autoConvert_v1_ComponentStatusList_To_core_ComponentStatusList(in, out, s) +} + +func autoConvert_core_ComponentStatusList_To_v1_ComponentStatusList(in *core.ComponentStatusList, out *v1.ComponentStatusList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.ComponentStatus)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_ComponentStatusList_To_v1_ComponentStatusList is an autogenerated conversion function. +func Convert_core_ComponentStatusList_To_v1_ComponentStatusList(in *core.ComponentStatusList, out *v1.ComponentStatusList, s conversion.Scope) error { + return autoConvert_core_ComponentStatusList_To_v1_ComponentStatusList(in, out, s) +} + +func autoConvert_v1_ConfigMap_To_core_ConfigMap(in *v1.ConfigMap, out *core.ConfigMap, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Data = *(*map[string]string)(unsafe.Pointer(&in.Data)) + out.BinaryData = *(*map[string][]byte)(unsafe.Pointer(&in.BinaryData)) + return nil +} + +// Convert_v1_ConfigMap_To_core_ConfigMap is an autogenerated conversion function. +func Convert_v1_ConfigMap_To_core_ConfigMap(in *v1.ConfigMap, out *core.ConfigMap, s conversion.Scope) error { + return autoConvert_v1_ConfigMap_To_core_ConfigMap(in, out, s) +} + +func autoConvert_core_ConfigMap_To_v1_ConfigMap(in *core.ConfigMap, out *v1.ConfigMap, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Data = *(*map[string]string)(unsafe.Pointer(&in.Data)) + out.BinaryData = *(*map[string][]byte)(unsafe.Pointer(&in.BinaryData)) + return nil +} + +// Convert_core_ConfigMap_To_v1_ConfigMap is an autogenerated conversion function. +func Convert_core_ConfigMap_To_v1_ConfigMap(in *core.ConfigMap, out *v1.ConfigMap, s conversion.Scope) error { + return autoConvert_core_ConfigMap_To_v1_ConfigMap(in, out, s) +} + +func autoConvert_v1_ConfigMapEnvSource_To_core_ConfigMapEnvSource(in *v1.ConfigMapEnvSource, out *core.ConfigMapEnvSource, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_ConfigMapEnvSource_To_core_ConfigMapEnvSource is an autogenerated conversion function. +func Convert_v1_ConfigMapEnvSource_To_core_ConfigMapEnvSource(in *v1.ConfigMapEnvSource, out *core.ConfigMapEnvSource, s conversion.Scope) error { + return autoConvert_v1_ConfigMapEnvSource_To_core_ConfigMapEnvSource(in, out, s) +} + +func autoConvert_core_ConfigMapEnvSource_To_v1_ConfigMapEnvSource(in *core.ConfigMapEnvSource, out *v1.ConfigMapEnvSource, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_ConfigMapEnvSource_To_v1_ConfigMapEnvSource is an autogenerated conversion function. +func Convert_core_ConfigMapEnvSource_To_v1_ConfigMapEnvSource(in *core.ConfigMapEnvSource, out *v1.ConfigMapEnvSource, s conversion.Scope) error { + return autoConvert_core_ConfigMapEnvSource_To_v1_ConfigMapEnvSource(in, out, s) +} + +func autoConvert_v1_ConfigMapKeySelector_To_core_ConfigMapKeySelector(in *v1.ConfigMapKeySelector, out *core.ConfigMapKeySelector, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Key = in.Key + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_ConfigMapKeySelector_To_core_ConfigMapKeySelector is an autogenerated conversion function. +func Convert_v1_ConfigMapKeySelector_To_core_ConfigMapKeySelector(in *v1.ConfigMapKeySelector, out *core.ConfigMapKeySelector, s conversion.Scope) error { + return autoConvert_v1_ConfigMapKeySelector_To_core_ConfigMapKeySelector(in, out, s) +} + +func autoConvert_core_ConfigMapKeySelector_To_v1_ConfigMapKeySelector(in *core.ConfigMapKeySelector, out *v1.ConfigMapKeySelector, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Key = in.Key + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_ConfigMapKeySelector_To_v1_ConfigMapKeySelector is an autogenerated conversion function. +func Convert_core_ConfigMapKeySelector_To_v1_ConfigMapKeySelector(in *core.ConfigMapKeySelector, out *v1.ConfigMapKeySelector, s conversion.Scope) error { + return autoConvert_core_ConfigMapKeySelector_To_v1_ConfigMapKeySelector(in, out, s) +} + +func autoConvert_v1_ConfigMapList_To_core_ConfigMapList(in *v1.ConfigMapList, out *core.ConfigMapList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.ConfigMap)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_ConfigMapList_To_core_ConfigMapList is an autogenerated conversion function. +func Convert_v1_ConfigMapList_To_core_ConfigMapList(in *v1.ConfigMapList, out *core.ConfigMapList, s conversion.Scope) error { + return autoConvert_v1_ConfigMapList_To_core_ConfigMapList(in, out, s) +} + +func autoConvert_core_ConfigMapList_To_v1_ConfigMapList(in *core.ConfigMapList, out *v1.ConfigMapList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.ConfigMap)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_ConfigMapList_To_v1_ConfigMapList is an autogenerated conversion function. +func Convert_core_ConfigMapList_To_v1_ConfigMapList(in *core.ConfigMapList, out *v1.ConfigMapList, s conversion.Scope) error { + return autoConvert_core_ConfigMapList_To_v1_ConfigMapList(in, out, s) +} + +func autoConvert_v1_ConfigMapProjection_To_core_ConfigMapProjection(in *v1.ConfigMapProjection, out *core.ConfigMapProjection, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Items = *(*[]core.KeyToPath)(unsafe.Pointer(&in.Items)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_ConfigMapProjection_To_core_ConfigMapProjection is an autogenerated conversion function. +func Convert_v1_ConfigMapProjection_To_core_ConfigMapProjection(in *v1.ConfigMapProjection, out *core.ConfigMapProjection, s conversion.Scope) error { + return autoConvert_v1_ConfigMapProjection_To_core_ConfigMapProjection(in, out, s) +} + +func autoConvert_core_ConfigMapProjection_To_v1_ConfigMapProjection(in *core.ConfigMapProjection, out *v1.ConfigMapProjection, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Items = *(*[]v1.KeyToPath)(unsafe.Pointer(&in.Items)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_ConfigMapProjection_To_v1_ConfigMapProjection is an autogenerated conversion function. +func Convert_core_ConfigMapProjection_To_v1_ConfigMapProjection(in *core.ConfigMapProjection, out *v1.ConfigMapProjection, s conversion.Scope) error { + return autoConvert_core_ConfigMapProjection_To_v1_ConfigMapProjection(in, out, s) +} + +func autoConvert_v1_ConfigMapVolumeSource_To_core_ConfigMapVolumeSource(in *v1.ConfigMapVolumeSource, out *core.ConfigMapVolumeSource, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Items = *(*[]core.KeyToPath)(unsafe.Pointer(&in.Items)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_ConfigMapVolumeSource_To_core_ConfigMapVolumeSource is an autogenerated conversion function. +func Convert_v1_ConfigMapVolumeSource_To_core_ConfigMapVolumeSource(in *v1.ConfigMapVolumeSource, out *core.ConfigMapVolumeSource, s conversion.Scope) error { + return autoConvert_v1_ConfigMapVolumeSource_To_core_ConfigMapVolumeSource(in, out, s) +} + +func autoConvert_core_ConfigMapVolumeSource_To_v1_ConfigMapVolumeSource(in *core.ConfigMapVolumeSource, out *v1.ConfigMapVolumeSource, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Items = *(*[]v1.KeyToPath)(unsafe.Pointer(&in.Items)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_ConfigMapVolumeSource_To_v1_ConfigMapVolumeSource is an autogenerated conversion function. +func Convert_core_ConfigMapVolumeSource_To_v1_ConfigMapVolumeSource(in *core.ConfigMapVolumeSource, out *v1.ConfigMapVolumeSource, s conversion.Scope) error { + return autoConvert_core_ConfigMapVolumeSource_To_v1_ConfigMapVolumeSource(in, out, s) +} + +func autoConvert_v1_Container_To_core_Container(in *v1.Container, out *core.Container, s conversion.Scope) error { + out.Name = in.Name + out.Image = in.Image + out.Command = *(*[]string)(unsafe.Pointer(&in.Command)) + out.Args = *(*[]string)(unsafe.Pointer(&in.Args)) + out.WorkingDir = in.WorkingDir + out.Ports = *(*[]core.ContainerPort)(unsafe.Pointer(&in.Ports)) + out.EnvFrom = *(*[]core.EnvFromSource)(unsafe.Pointer(&in.EnvFrom)) + out.Env = *(*[]core.EnvVar)(unsafe.Pointer(&in.Env)) + if err := Convert_v1_ResourceRequirements_To_core_ResourceRequirements(&in.Resources, &out.Resources, s); err != nil { + return err + } + out.VolumeMounts = *(*[]core.VolumeMount)(unsafe.Pointer(&in.VolumeMounts)) + out.VolumeDevices = *(*[]core.VolumeDevice)(unsafe.Pointer(&in.VolumeDevices)) + out.LivenessProbe = (*core.Probe)(unsafe.Pointer(in.LivenessProbe)) + out.ReadinessProbe = (*core.Probe)(unsafe.Pointer(in.ReadinessProbe)) + out.Lifecycle = (*core.Lifecycle)(unsafe.Pointer(in.Lifecycle)) + out.TerminationMessagePath = in.TerminationMessagePath + out.TerminationMessagePolicy = core.TerminationMessagePolicy(in.TerminationMessagePolicy) + out.ImagePullPolicy = core.PullPolicy(in.ImagePullPolicy) + if in.SecurityContext != nil { + in, out := &in.SecurityContext, &out.SecurityContext + *out = new(core.SecurityContext) + if err := Convert_v1_SecurityContext_To_core_SecurityContext(*in, *out, s); err != nil { + return err + } + } else { + out.SecurityContext = nil + } + out.Stdin = in.Stdin + out.StdinOnce = in.StdinOnce + out.TTY = in.TTY + return nil +} + +// Convert_v1_Container_To_core_Container is an autogenerated conversion function. +func Convert_v1_Container_To_core_Container(in *v1.Container, out *core.Container, s conversion.Scope) error { + return autoConvert_v1_Container_To_core_Container(in, out, s) +} + +func autoConvert_core_Container_To_v1_Container(in *core.Container, out *v1.Container, s conversion.Scope) error { + out.Name = in.Name + out.Image = in.Image + out.Command = *(*[]string)(unsafe.Pointer(&in.Command)) + out.Args = *(*[]string)(unsafe.Pointer(&in.Args)) + out.WorkingDir = in.WorkingDir + out.Ports = *(*[]v1.ContainerPort)(unsafe.Pointer(&in.Ports)) + out.EnvFrom = *(*[]v1.EnvFromSource)(unsafe.Pointer(&in.EnvFrom)) + out.Env = *(*[]v1.EnvVar)(unsafe.Pointer(&in.Env)) + if err := Convert_core_ResourceRequirements_To_v1_ResourceRequirements(&in.Resources, &out.Resources, s); err != nil { + return err + } + out.VolumeMounts = *(*[]v1.VolumeMount)(unsafe.Pointer(&in.VolumeMounts)) + out.VolumeDevices = *(*[]v1.VolumeDevice)(unsafe.Pointer(&in.VolumeDevices)) + out.LivenessProbe = (*v1.Probe)(unsafe.Pointer(in.LivenessProbe)) + out.ReadinessProbe = (*v1.Probe)(unsafe.Pointer(in.ReadinessProbe)) + out.Lifecycle = (*v1.Lifecycle)(unsafe.Pointer(in.Lifecycle)) + out.TerminationMessagePath = in.TerminationMessagePath + out.TerminationMessagePolicy = v1.TerminationMessagePolicy(in.TerminationMessagePolicy) + out.ImagePullPolicy = v1.PullPolicy(in.ImagePullPolicy) + if in.SecurityContext != nil { + in, out := &in.SecurityContext, &out.SecurityContext + *out = new(v1.SecurityContext) + if err := Convert_core_SecurityContext_To_v1_SecurityContext(*in, *out, s); err != nil { + return err + } + } else { + out.SecurityContext = nil + } + out.Stdin = in.Stdin + out.StdinOnce = in.StdinOnce + out.TTY = in.TTY + return nil +} + +// Convert_core_Container_To_v1_Container is an autogenerated conversion function. +func Convert_core_Container_To_v1_Container(in *core.Container, out *v1.Container, s conversion.Scope) error { + return autoConvert_core_Container_To_v1_Container(in, out, s) +} + +func autoConvert_v1_ContainerImage_To_core_ContainerImage(in *v1.ContainerImage, out *core.ContainerImage, s conversion.Scope) error { + out.Names = *(*[]string)(unsafe.Pointer(&in.Names)) + out.SizeBytes = in.SizeBytes + return nil +} + +// Convert_v1_ContainerImage_To_core_ContainerImage is an autogenerated conversion function. +func Convert_v1_ContainerImage_To_core_ContainerImage(in *v1.ContainerImage, out *core.ContainerImage, s conversion.Scope) error { + return autoConvert_v1_ContainerImage_To_core_ContainerImage(in, out, s) +} + +func autoConvert_core_ContainerImage_To_v1_ContainerImage(in *core.ContainerImage, out *v1.ContainerImage, s conversion.Scope) error { + out.Names = *(*[]string)(unsafe.Pointer(&in.Names)) + out.SizeBytes = in.SizeBytes + return nil +} + +// Convert_core_ContainerImage_To_v1_ContainerImage is an autogenerated conversion function. +func Convert_core_ContainerImage_To_v1_ContainerImage(in *core.ContainerImage, out *v1.ContainerImage, s conversion.Scope) error { + return autoConvert_core_ContainerImage_To_v1_ContainerImage(in, out, s) +} + +func autoConvert_v1_ContainerPort_To_core_ContainerPort(in *v1.ContainerPort, out *core.ContainerPort, s conversion.Scope) error { + out.Name = in.Name + out.HostPort = in.HostPort + out.ContainerPort = in.ContainerPort + out.Protocol = core.Protocol(in.Protocol) + out.HostIP = in.HostIP + return nil +} + +// Convert_v1_ContainerPort_To_core_ContainerPort is an autogenerated conversion function. +func Convert_v1_ContainerPort_To_core_ContainerPort(in *v1.ContainerPort, out *core.ContainerPort, s conversion.Scope) error { + return autoConvert_v1_ContainerPort_To_core_ContainerPort(in, out, s) +} + +func autoConvert_core_ContainerPort_To_v1_ContainerPort(in *core.ContainerPort, out *v1.ContainerPort, s conversion.Scope) error { + out.Name = in.Name + out.HostPort = in.HostPort + out.ContainerPort = in.ContainerPort + out.Protocol = v1.Protocol(in.Protocol) + out.HostIP = in.HostIP + return nil +} + +// Convert_core_ContainerPort_To_v1_ContainerPort is an autogenerated conversion function. +func Convert_core_ContainerPort_To_v1_ContainerPort(in *core.ContainerPort, out *v1.ContainerPort, s conversion.Scope) error { + return autoConvert_core_ContainerPort_To_v1_ContainerPort(in, out, s) +} + +func autoConvert_v1_ContainerState_To_core_ContainerState(in *v1.ContainerState, out *core.ContainerState, s conversion.Scope) error { + out.Waiting = (*core.ContainerStateWaiting)(unsafe.Pointer(in.Waiting)) + out.Running = (*core.ContainerStateRunning)(unsafe.Pointer(in.Running)) + out.Terminated = (*core.ContainerStateTerminated)(unsafe.Pointer(in.Terminated)) + return nil +} + +// Convert_v1_ContainerState_To_core_ContainerState is an autogenerated conversion function. +func Convert_v1_ContainerState_To_core_ContainerState(in *v1.ContainerState, out *core.ContainerState, s conversion.Scope) error { + return autoConvert_v1_ContainerState_To_core_ContainerState(in, out, s) +} + +func autoConvert_core_ContainerState_To_v1_ContainerState(in *core.ContainerState, out *v1.ContainerState, s conversion.Scope) error { + out.Waiting = (*v1.ContainerStateWaiting)(unsafe.Pointer(in.Waiting)) + out.Running = (*v1.ContainerStateRunning)(unsafe.Pointer(in.Running)) + out.Terminated = (*v1.ContainerStateTerminated)(unsafe.Pointer(in.Terminated)) + return nil +} + +// Convert_core_ContainerState_To_v1_ContainerState is an autogenerated conversion function. +func Convert_core_ContainerState_To_v1_ContainerState(in *core.ContainerState, out *v1.ContainerState, s conversion.Scope) error { + return autoConvert_core_ContainerState_To_v1_ContainerState(in, out, s) +} + +func autoConvert_v1_ContainerStateRunning_To_core_ContainerStateRunning(in *v1.ContainerStateRunning, out *core.ContainerStateRunning, s conversion.Scope) error { + out.StartedAt = in.StartedAt + return nil +} + +// Convert_v1_ContainerStateRunning_To_core_ContainerStateRunning is an autogenerated conversion function. +func Convert_v1_ContainerStateRunning_To_core_ContainerStateRunning(in *v1.ContainerStateRunning, out *core.ContainerStateRunning, s conversion.Scope) error { + return autoConvert_v1_ContainerStateRunning_To_core_ContainerStateRunning(in, out, s) +} + +func autoConvert_core_ContainerStateRunning_To_v1_ContainerStateRunning(in *core.ContainerStateRunning, out *v1.ContainerStateRunning, s conversion.Scope) error { + out.StartedAt = in.StartedAt + return nil +} + +// Convert_core_ContainerStateRunning_To_v1_ContainerStateRunning is an autogenerated conversion function. +func Convert_core_ContainerStateRunning_To_v1_ContainerStateRunning(in *core.ContainerStateRunning, out *v1.ContainerStateRunning, s conversion.Scope) error { + return autoConvert_core_ContainerStateRunning_To_v1_ContainerStateRunning(in, out, s) +} + +func autoConvert_v1_ContainerStateTerminated_To_core_ContainerStateTerminated(in *v1.ContainerStateTerminated, out *core.ContainerStateTerminated, s conversion.Scope) error { + out.ExitCode = in.ExitCode + out.Signal = in.Signal + out.Reason = in.Reason + out.Message = in.Message + out.StartedAt = in.StartedAt + out.FinishedAt = in.FinishedAt + out.ContainerID = in.ContainerID + return nil +} + +// Convert_v1_ContainerStateTerminated_To_core_ContainerStateTerminated is an autogenerated conversion function. +func Convert_v1_ContainerStateTerminated_To_core_ContainerStateTerminated(in *v1.ContainerStateTerminated, out *core.ContainerStateTerminated, s conversion.Scope) error { + return autoConvert_v1_ContainerStateTerminated_To_core_ContainerStateTerminated(in, out, s) +} + +func autoConvert_core_ContainerStateTerminated_To_v1_ContainerStateTerminated(in *core.ContainerStateTerminated, out *v1.ContainerStateTerminated, s conversion.Scope) error { + out.ExitCode = in.ExitCode + out.Signal = in.Signal + out.Reason = in.Reason + out.Message = in.Message + out.StartedAt = in.StartedAt + out.FinishedAt = in.FinishedAt + out.ContainerID = in.ContainerID + return nil +} + +// Convert_core_ContainerStateTerminated_To_v1_ContainerStateTerminated is an autogenerated conversion function. +func Convert_core_ContainerStateTerminated_To_v1_ContainerStateTerminated(in *core.ContainerStateTerminated, out *v1.ContainerStateTerminated, s conversion.Scope) error { + return autoConvert_core_ContainerStateTerminated_To_v1_ContainerStateTerminated(in, out, s) +} + +func autoConvert_v1_ContainerStateWaiting_To_core_ContainerStateWaiting(in *v1.ContainerStateWaiting, out *core.ContainerStateWaiting, s conversion.Scope) error { + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_v1_ContainerStateWaiting_To_core_ContainerStateWaiting is an autogenerated conversion function. +func Convert_v1_ContainerStateWaiting_To_core_ContainerStateWaiting(in *v1.ContainerStateWaiting, out *core.ContainerStateWaiting, s conversion.Scope) error { + return autoConvert_v1_ContainerStateWaiting_To_core_ContainerStateWaiting(in, out, s) +} + +func autoConvert_core_ContainerStateWaiting_To_v1_ContainerStateWaiting(in *core.ContainerStateWaiting, out *v1.ContainerStateWaiting, s conversion.Scope) error { + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_core_ContainerStateWaiting_To_v1_ContainerStateWaiting is an autogenerated conversion function. +func Convert_core_ContainerStateWaiting_To_v1_ContainerStateWaiting(in *core.ContainerStateWaiting, out *v1.ContainerStateWaiting, s conversion.Scope) error { + return autoConvert_core_ContainerStateWaiting_To_v1_ContainerStateWaiting(in, out, s) +} + +func autoConvert_v1_ContainerStatus_To_core_ContainerStatus(in *v1.ContainerStatus, out *core.ContainerStatus, s conversion.Scope) error { + out.Name = in.Name + if err := Convert_v1_ContainerState_To_core_ContainerState(&in.State, &out.State, s); err != nil { + return err + } + if err := Convert_v1_ContainerState_To_core_ContainerState(&in.LastTerminationState, &out.LastTerminationState, s); err != nil { + return err + } + out.Ready = in.Ready + out.RestartCount = in.RestartCount + out.Image = in.Image + out.ImageID = in.ImageID + out.ContainerID = in.ContainerID + return nil +} + +// Convert_v1_ContainerStatus_To_core_ContainerStatus is an autogenerated conversion function. +func Convert_v1_ContainerStatus_To_core_ContainerStatus(in *v1.ContainerStatus, out *core.ContainerStatus, s conversion.Scope) error { + return autoConvert_v1_ContainerStatus_To_core_ContainerStatus(in, out, s) +} + +func autoConvert_core_ContainerStatus_To_v1_ContainerStatus(in *core.ContainerStatus, out *v1.ContainerStatus, s conversion.Scope) error { + out.Name = in.Name + if err := Convert_core_ContainerState_To_v1_ContainerState(&in.State, &out.State, s); err != nil { + return err + } + if err := Convert_core_ContainerState_To_v1_ContainerState(&in.LastTerminationState, &out.LastTerminationState, s); err != nil { + return err + } + out.Ready = in.Ready + out.RestartCount = in.RestartCount + out.Image = in.Image + out.ImageID = in.ImageID + out.ContainerID = in.ContainerID + return nil +} + +// Convert_core_ContainerStatus_To_v1_ContainerStatus is an autogenerated conversion function. +func Convert_core_ContainerStatus_To_v1_ContainerStatus(in *core.ContainerStatus, out *v1.ContainerStatus, s conversion.Scope) error { + return autoConvert_core_ContainerStatus_To_v1_ContainerStatus(in, out, s) +} + +func autoConvert_v1_DaemonEndpoint_To_core_DaemonEndpoint(in *v1.DaemonEndpoint, out *core.DaemonEndpoint, s conversion.Scope) error { + out.Port = in.Port + return nil +} + +// Convert_v1_DaemonEndpoint_To_core_DaemonEndpoint is an autogenerated conversion function. +func Convert_v1_DaemonEndpoint_To_core_DaemonEndpoint(in *v1.DaemonEndpoint, out *core.DaemonEndpoint, s conversion.Scope) error { + return autoConvert_v1_DaemonEndpoint_To_core_DaemonEndpoint(in, out, s) +} + +func autoConvert_core_DaemonEndpoint_To_v1_DaemonEndpoint(in *core.DaemonEndpoint, out *v1.DaemonEndpoint, s conversion.Scope) error { + out.Port = in.Port + return nil +} + +// Convert_core_DaemonEndpoint_To_v1_DaemonEndpoint is an autogenerated conversion function. +func Convert_core_DaemonEndpoint_To_v1_DaemonEndpoint(in *core.DaemonEndpoint, out *v1.DaemonEndpoint, s conversion.Scope) error { + return autoConvert_core_DaemonEndpoint_To_v1_DaemonEndpoint(in, out, s) +} + +func autoConvert_v1_DeleteOptions_To_core_DeleteOptions(in *v1.DeleteOptions, out *core.DeleteOptions, s conversion.Scope) error { + out.GracePeriodSeconds = (*int64)(unsafe.Pointer(in.GracePeriodSeconds)) + out.Preconditions = (*core.Preconditions)(unsafe.Pointer(in.Preconditions)) + out.OrphanDependents = (*bool)(unsafe.Pointer(in.OrphanDependents)) + out.PropagationPolicy = (*core.DeletionPropagation)(unsafe.Pointer(in.PropagationPolicy)) + return nil +} + +// Convert_v1_DeleteOptions_To_core_DeleteOptions is an autogenerated conversion function. +func Convert_v1_DeleteOptions_To_core_DeleteOptions(in *v1.DeleteOptions, out *core.DeleteOptions, s conversion.Scope) error { + return autoConvert_v1_DeleteOptions_To_core_DeleteOptions(in, out, s) +} + +func autoConvert_core_DeleteOptions_To_v1_DeleteOptions(in *core.DeleteOptions, out *v1.DeleteOptions, s conversion.Scope) error { + out.GracePeriodSeconds = (*int64)(unsafe.Pointer(in.GracePeriodSeconds)) + out.Preconditions = (*v1.Preconditions)(unsafe.Pointer(in.Preconditions)) + out.OrphanDependents = (*bool)(unsafe.Pointer(in.OrphanDependents)) + out.PropagationPolicy = (*v1.DeletionPropagation)(unsafe.Pointer(in.PropagationPolicy)) + return nil +} + +// Convert_core_DeleteOptions_To_v1_DeleteOptions is an autogenerated conversion function. +func Convert_core_DeleteOptions_To_v1_DeleteOptions(in *core.DeleteOptions, out *v1.DeleteOptions, s conversion.Scope) error { + return autoConvert_core_DeleteOptions_To_v1_DeleteOptions(in, out, s) +} + +func autoConvert_v1_DownwardAPIProjection_To_core_DownwardAPIProjection(in *v1.DownwardAPIProjection, out *core.DownwardAPIProjection, s conversion.Scope) error { + out.Items = *(*[]core.DownwardAPIVolumeFile)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_DownwardAPIProjection_To_core_DownwardAPIProjection is an autogenerated conversion function. +func Convert_v1_DownwardAPIProjection_To_core_DownwardAPIProjection(in *v1.DownwardAPIProjection, out *core.DownwardAPIProjection, s conversion.Scope) error { + return autoConvert_v1_DownwardAPIProjection_To_core_DownwardAPIProjection(in, out, s) +} + +func autoConvert_core_DownwardAPIProjection_To_v1_DownwardAPIProjection(in *core.DownwardAPIProjection, out *v1.DownwardAPIProjection, s conversion.Scope) error { + out.Items = *(*[]v1.DownwardAPIVolumeFile)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_DownwardAPIProjection_To_v1_DownwardAPIProjection is an autogenerated conversion function. +func Convert_core_DownwardAPIProjection_To_v1_DownwardAPIProjection(in *core.DownwardAPIProjection, out *v1.DownwardAPIProjection, s conversion.Scope) error { + return autoConvert_core_DownwardAPIProjection_To_v1_DownwardAPIProjection(in, out, s) +} + +func autoConvert_v1_DownwardAPIVolumeFile_To_core_DownwardAPIVolumeFile(in *v1.DownwardAPIVolumeFile, out *core.DownwardAPIVolumeFile, s conversion.Scope) error { + out.Path = in.Path + out.FieldRef = (*core.ObjectFieldSelector)(unsafe.Pointer(in.FieldRef)) + out.ResourceFieldRef = (*core.ResourceFieldSelector)(unsafe.Pointer(in.ResourceFieldRef)) + out.Mode = (*int32)(unsafe.Pointer(in.Mode)) + return nil +} + +// Convert_v1_DownwardAPIVolumeFile_To_core_DownwardAPIVolumeFile is an autogenerated conversion function. +func Convert_v1_DownwardAPIVolumeFile_To_core_DownwardAPIVolumeFile(in *v1.DownwardAPIVolumeFile, out *core.DownwardAPIVolumeFile, s conversion.Scope) error { + return autoConvert_v1_DownwardAPIVolumeFile_To_core_DownwardAPIVolumeFile(in, out, s) +} + +func autoConvert_core_DownwardAPIVolumeFile_To_v1_DownwardAPIVolumeFile(in *core.DownwardAPIVolumeFile, out *v1.DownwardAPIVolumeFile, s conversion.Scope) error { + out.Path = in.Path + out.FieldRef = (*v1.ObjectFieldSelector)(unsafe.Pointer(in.FieldRef)) + out.ResourceFieldRef = (*v1.ResourceFieldSelector)(unsafe.Pointer(in.ResourceFieldRef)) + out.Mode = (*int32)(unsafe.Pointer(in.Mode)) + return nil +} + +// Convert_core_DownwardAPIVolumeFile_To_v1_DownwardAPIVolumeFile is an autogenerated conversion function. +func Convert_core_DownwardAPIVolumeFile_To_v1_DownwardAPIVolumeFile(in *core.DownwardAPIVolumeFile, out *v1.DownwardAPIVolumeFile, s conversion.Scope) error { + return autoConvert_core_DownwardAPIVolumeFile_To_v1_DownwardAPIVolumeFile(in, out, s) +} + +func autoConvert_v1_DownwardAPIVolumeSource_To_core_DownwardAPIVolumeSource(in *v1.DownwardAPIVolumeSource, out *core.DownwardAPIVolumeSource, s conversion.Scope) error { + out.Items = *(*[]core.DownwardAPIVolumeFile)(unsafe.Pointer(&in.Items)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + return nil +} + +// Convert_v1_DownwardAPIVolumeSource_To_core_DownwardAPIVolumeSource is an autogenerated conversion function. +func Convert_v1_DownwardAPIVolumeSource_To_core_DownwardAPIVolumeSource(in *v1.DownwardAPIVolumeSource, out *core.DownwardAPIVolumeSource, s conversion.Scope) error { + return autoConvert_v1_DownwardAPIVolumeSource_To_core_DownwardAPIVolumeSource(in, out, s) +} + +func autoConvert_core_DownwardAPIVolumeSource_To_v1_DownwardAPIVolumeSource(in *core.DownwardAPIVolumeSource, out *v1.DownwardAPIVolumeSource, s conversion.Scope) error { + out.Items = *(*[]v1.DownwardAPIVolumeFile)(unsafe.Pointer(&in.Items)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + return nil +} + +// Convert_core_DownwardAPIVolumeSource_To_v1_DownwardAPIVolumeSource is an autogenerated conversion function. +func Convert_core_DownwardAPIVolumeSource_To_v1_DownwardAPIVolumeSource(in *core.DownwardAPIVolumeSource, out *v1.DownwardAPIVolumeSource, s conversion.Scope) error { + return autoConvert_core_DownwardAPIVolumeSource_To_v1_DownwardAPIVolumeSource(in, out, s) +} + +func autoConvert_v1_EmptyDirVolumeSource_To_core_EmptyDirVolumeSource(in *v1.EmptyDirVolumeSource, out *core.EmptyDirVolumeSource, s conversion.Scope) error { + out.Medium = core.StorageMedium(in.Medium) + out.SizeLimit = (*resource.Quantity)(unsafe.Pointer(in.SizeLimit)) + return nil +} + +// Convert_v1_EmptyDirVolumeSource_To_core_EmptyDirVolumeSource is an autogenerated conversion function. +func Convert_v1_EmptyDirVolumeSource_To_core_EmptyDirVolumeSource(in *v1.EmptyDirVolumeSource, out *core.EmptyDirVolumeSource, s conversion.Scope) error { + return autoConvert_v1_EmptyDirVolumeSource_To_core_EmptyDirVolumeSource(in, out, s) +} + +func autoConvert_core_EmptyDirVolumeSource_To_v1_EmptyDirVolumeSource(in *core.EmptyDirVolumeSource, out *v1.EmptyDirVolumeSource, s conversion.Scope) error { + out.Medium = v1.StorageMedium(in.Medium) + out.SizeLimit = (*resource.Quantity)(unsafe.Pointer(in.SizeLimit)) + return nil +} + +// Convert_core_EmptyDirVolumeSource_To_v1_EmptyDirVolumeSource is an autogenerated conversion function. +func Convert_core_EmptyDirVolumeSource_To_v1_EmptyDirVolumeSource(in *core.EmptyDirVolumeSource, out *v1.EmptyDirVolumeSource, s conversion.Scope) error { + return autoConvert_core_EmptyDirVolumeSource_To_v1_EmptyDirVolumeSource(in, out, s) +} + +func autoConvert_v1_EndpointAddress_To_core_EndpointAddress(in *v1.EndpointAddress, out *core.EndpointAddress, s conversion.Scope) error { + out.IP = in.IP + out.Hostname = in.Hostname + out.NodeName = (*string)(unsafe.Pointer(in.NodeName)) + out.TargetRef = (*core.ObjectReference)(unsafe.Pointer(in.TargetRef)) + return nil +} + +// Convert_v1_EndpointAddress_To_core_EndpointAddress is an autogenerated conversion function. +func Convert_v1_EndpointAddress_To_core_EndpointAddress(in *v1.EndpointAddress, out *core.EndpointAddress, s conversion.Scope) error { + return autoConvert_v1_EndpointAddress_To_core_EndpointAddress(in, out, s) +} + +func autoConvert_core_EndpointAddress_To_v1_EndpointAddress(in *core.EndpointAddress, out *v1.EndpointAddress, s conversion.Scope) error { + out.IP = in.IP + out.Hostname = in.Hostname + out.NodeName = (*string)(unsafe.Pointer(in.NodeName)) + out.TargetRef = (*v1.ObjectReference)(unsafe.Pointer(in.TargetRef)) + return nil +} + +// Convert_core_EndpointAddress_To_v1_EndpointAddress is an autogenerated conversion function. +func Convert_core_EndpointAddress_To_v1_EndpointAddress(in *core.EndpointAddress, out *v1.EndpointAddress, s conversion.Scope) error { + return autoConvert_core_EndpointAddress_To_v1_EndpointAddress(in, out, s) +} + +func autoConvert_v1_EndpointPort_To_core_EndpointPort(in *v1.EndpointPort, out *core.EndpointPort, s conversion.Scope) error { + out.Name = in.Name + out.Port = in.Port + out.Protocol = core.Protocol(in.Protocol) + return nil +} + +// Convert_v1_EndpointPort_To_core_EndpointPort is an autogenerated conversion function. +func Convert_v1_EndpointPort_To_core_EndpointPort(in *v1.EndpointPort, out *core.EndpointPort, s conversion.Scope) error { + return autoConvert_v1_EndpointPort_To_core_EndpointPort(in, out, s) +} + +func autoConvert_core_EndpointPort_To_v1_EndpointPort(in *core.EndpointPort, out *v1.EndpointPort, s conversion.Scope) error { + out.Name = in.Name + out.Port = in.Port + out.Protocol = v1.Protocol(in.Protocol) + return nil +} + +// Convert_core_EndpointPort_To_v1_EndpointPort is an autogenerated conversion function. +func Convert_core_EndpointPort_To_v1_EndpointPort(in *core.EndpointPort, out *v1.EndpointPort, s conversion.Scope) error { + return autoConvert_core_EndpointPort_To_v1_EndpointPort(in, out, s) +} + +func autoConvert_v1_EndpointSubset_To_core_EndpointSubset(in *v1.EndpointSubset, out *core.EndpointSubset, s conversion.Scope) error { + out.Addresses = *(*[]core.EndpointAddress)(unsafe.Pointer(&in.Addresses)) + out.NotReadyAddresses = *(*[]core.EndpointAddress)(unsafe.Pointer(&in.NotReadyAddresses)) + out.Ports = *(*[]core.EndpointPort)(unsafe.Pointer(&in.Ports)) + return nil +} + +// Convert_v1_EndpointSubset_To_core_EndpointSubset is an autogenerated conversion function. +func Convert_v1_EndpointSubset_To_core_EndpointSubset(in *v1.EndpointSubset, out *core.EndpointSubset, s conversion.Scope) error { + return autoConvert_v1_EndpointSubset_To_core_EndpointSubset(in, out, s) +} + +func autoConvert_core_EndpointSubset_To_v1_EndpointSubset(in *core.EndpointSubset, out *v1.EndpointSubset, s conversion.Scope) error { + out.Addresses = *(*[]v1.EndpointAddress)(unsafe.Pointer(&in.Addresses)) + out.NotReadyAddresses = *(*[]v1.EndpointAddress)(unsafe.Pointer(&in.NotReadyAddresses)) + out.Ports = *(*[]v1.EndpointPort)(unsafe.Pointer(&in.Ports)) + return nil +} + +// Convert_core_EndpointSubset_To_v1_EndpointSubset is an autogenerated conversion function. +func Convert_core_EndpointSubset_To_v1_EndpointSubset(in *core.EndpointSubset, out *v1.EndpointSubset, s conversion.Scope) error { + return autoConvert_core_EndpointSubset_To_v1_EndpointSubset(in, out, s) +} + +func autoConvert_v1_Endpoints_To_core_Endpoints(in *v1.Endpoints, out *core.Endpoints, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Subsets = *(*[]core.EndpointSubset)(unsafe.Pointer(&in.Subsets)) + return nil +} + +// Convert_v1_Endpoints_To_core_Endpoints is an autogenerated conversion function. +func Convert_v1_Endpoints_To_core_Endpoints(in *v1.Endpoints, out *core.Endpoints, s conversion.Scope) error { + return autoConvert_v1_Endpoints_To_core_Endpoints(in, out, s) +} + +func autoConvert_core_Endpoints_To_v1_Endpoints(in *core.Endpoints, out *v1.Endpoints, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Subsets = *(*[]v1.EndpointSubset)(unsafe.Pointer(&in.Subsets)) + return nil +} + +// Convert_core_Endpoints_To_v1_Endpoints is an autogenerated conversion function. +func Convert_core_Endpoints_To_v1_Endpoints(in *core.Endpoints, out *v1.Endpoints, s conversion.Scope) error { + return autoConvert_core_Endpoints_To_v1_Endpoints(in, out, s) +} + +func autoConvert_v1_EndpointsList_To_core_EndpointsList(in *v1.EndpointsList, out *core.EndpointsList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.Endpoints)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_EndpointsList_To_core_EndpointsList is an autogenerated conversion function. +func Convert_v1_EndpointsList_To_core_EndpointsList(in *v1.EndpointsList, out *core.EndpointsList, s conversion.Scope) error { + return autoConvert_v1_EndpointsList_To_core_EndpointsList(in, out, s) +} + +func autoConvert_core_EndpointsList_To_v1_EndpointsList(in *core.EndpointsList, out *v1.EndpointsList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.Endpoints)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_EndpointsList_To_v1_EndpointsList is an autogenerated conversion function. +func Convert_core_EndpointsList_To_v1_EndpointsList(in *core.EndpointsList, out *v1.EndpointsList, s conversion.Scope) error { + return autoConvert_core_EndpointsList_To_v1_EndpointsList(in, out, s) +} + +func autoConvert_v1_EnvFromSource_To_core_EnvFromSource(in *v1.EnvFromSource, out *core.EnvFromSource, s conversion.Scope) error { + out.Prefix = in.Prefix + out.ConfigMapRef = (*core.ConfigMapEnvSource)(unsafe.Pointer(in.ConfigMapRef)) + out.SecretRef = (*core.SecretEnvSource)(unsafe.Pointer(in.SecretRef)) + return nil +} + +// Convert_v1_EnvFromSource_To_core_EnvFromSource is an autogenerated conversion function. +func Convert_v1_EnvFromSource_To_core_EnvFromSource(in *v1.EnvFromSource, out *core.EnvFromSource, s conversion.Scope) error { + return autoConvert_v1_EnvFromSource_To_core_EnvFromSource(in, out, s) +} + +func autoConvert_core_EnvFromSource_To_v1_EnvFromSource(in *core.EnvFromSource, out *v1.EnvFromSource, s conversion.Scope) error { + out.Prefix = in.Prefix + out.ConfigMapRef = (*v1.ConfigMapEnvSource)(unsafe.Pointer(in.ConfigMapRef)) + out.SecretRef = (*v1.SecretEnvSource)(unsafe.Pointer(in.SecretRef)) + return nil +} + +// Convert_core_EnvFromSource_To_v1_EnvFromSource is an autogenerated conversion function. +func Convert_core_EnvFromSource_To_v1_EnvFromSource(in *core.EnvFromSource, out *v1.EnvFromSource, s conversion.Scope) error { + return autoConvert_core_EnvFromSource_To_v1_EnvFromSource(in, out, s) +} + +func autoConvert_v1_EnvVar_To_core_EnvVar(in *v1.EnvVar, out *core.EnvVar, s conversion.Scope) error { + out.Name = in.Name + out.Value = in.Value + out.ValueFrom = (*core.EnvVarSource)(unsafe.Pointer(in.ValueFrom)) + return nil +} + +// Convert_v1_EnvVar_To_core_EnvVar is an autogenerated conversion function. +func Convert_v1_EnvVar_To_core_EnvVar(in *v1.EnvVar, out *core.EnvVar, s conversion.Scope) error { + return autoConvert_v1_EnvVar_To_core_EnvVar(in, out, s) +} + +func autoConvert_core_EnvVar_To_v1_EnvVar(in *core.EnvVar, out *v1.EnvVar, s conversion.Scope) error { + out.Name = in.Name + out.Value = in.Value + out.ValueFrom = (*v1.EnvVarSource)(unsafe.Pointer(in.ValueFrom)) + return nil +} + +// Convert_core_EnvVar_To_v1_EnvVar is an autogenerated conversion function. +func Convert_core_EnvVar_To_v1_EnvVar(in *core.EnvVar, out *v1.EnvVar, s conversion.Scope) error { + return autoConvert_core_EnvVar_To_v1_EnvVar(in, out, s) +} + +func autoConvert_v1_EnvVarSource_To_core_EnvVarSource(in *v1.EnvVarSource, out *core.EnvVarSource, s conversion.Scope) error { + out.FieldRef = (*core.ObjectFieldSelector)(unsafe.Pointer(in.FieldRef)) + out.ResourceFieldRef = (*core.ResourceFieldSelector)(unsafe.Pointer(in.ResourceFieldRef)) + out.ConfigMapKeyRef = (*core.ConfigMapKeySelector)(unsafe.Pointer(in.ConfigMapKeyRef)) + out.SecretKeyRef = (*core.SecretKeySelector)(unsafe.Pointer(in.SecretKeyRef)) + return nil +} + +// Convert_v1_EnvVarSource_To_core_EnvVarSource is an autogenerated conversion function. +func Convert_v1_EnvVarSource_To_core_EnvVarSource(in *v1.EnvVarSource, out *core.EnvVarSource, s conversion.Scope) error { + return autoConvert_v1_EnvVarSource_To_core_EnvVarSource(in, out, s) +} + +func autoConvert_core_EnvVarSource_To_v1_EnvVarSource(in *core.EnvVarSource, out *v1.EnvVarSource, s conversion.Scope) error { + out.FieldRef = (*v1.ObjectFieldSelector)(unsafe.Pointer(in.FieldRef)) + out.ResourceFieldRef = (*v1.ResourceFieldSelector)(unsafe.Pointer(in.ResourceFieldRef)) + out.ConfigMapKeyRef = (*v1.ConfigMapKeySelector)(unsafe.Pointer(in.ConfigMapKeyRef)) + out.SecretKeyRef = (*v1.SecretKeySelector)(unsafe.Pointer(in.SecretKeyRef)) + return nil +} + +// Convert_core_EnvVarSource_To_v1_EnvVarSource is an autogenerated conversion function. +func Convert_core_EnvVarSource_To_v1_EnvVarSource(in *core.EnvVarSource, out *v1.EnvVarSource, s conversion.Scope) error { + return autoConvert_core_EnvVarSource_To_v1_EnvVarSource(in, out, s) +} + +func autoConvert_v1_Event_To_core_Event(in *v1.Event, out *core.Event, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_ObjectReference_To_core_ObjectReference(&in.InvolvedObject, &out.InvolvedObject, s); err != nil { + return err + } + out.Reason = in.Reason + out.Message = in.Message + if err := Convert_v1_EventSource_To_core_EventSource(&in.Source, &out.Source, s); err != nil { + return err + } + out.FirstTimestamp = in.FirstTimestamp + out.LastTimestamp = in.LastTimestamp + out.Count = in.Count + out.Type = in.Type + out.EventTime = in.EventTime + out.Series = (*core.EventSeries)(unsafe.Pointer(in.Series)) + out.Action = in.Action + out.Related = (*core.ObjectReference)(unsafe.Pointer(in.Related)) + out.ReportingController = in.ReportingController + out.ReportingInstance = in.ReportingInstance + return nil +} + +// Convert_v1_Event_To_core_Event is an autogenerated conversion function. +func Convert_v1_Event_To_core_Event(in *v1.Event, out *core.Event, s conversion.Scope) error { + return autoConvert_v1_Event_To_core_Event(in, out, s) +} + +func autoConvert_core_Event_To_v1_Event(in *core.Event, out *v1.Event, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_ObjectReference_To_v1_ObjectReference(&in.InvolvedObject, &out.InvolvedObject, s); err != nil { + return err + } + out.Reason = in.Reason + out.Message = in.Message + if err := Convert_core_EventSource_To_v1_EventSource(&in.Source, &out.Source, s); err != nil { + return err + } + out.FirstTimestamp = in.FirstTimestamp + out.LastTimestamp = in.LastTimestamp + out.Count = in.Count + out.Type = in.Type + out.EventTime = in.EventTime + out.Series = (*v1.EventSeries)(unsafe.Pointer(in.Series)) + out.Action = in.Action + out.Related = (*v1.ObjectReference)(unsafe.Pointer(in.Related)) + out.ReportingController = in.ReportingController + out.ReportingInstance = in.ReportingInstance + return nil +} + +// Convert_core_Event_To_v1_Event is an autogenerated conversion function. +func Convert_core_Event_To_v1_Event(in *core.Event, out *v1.Event, s conversion.Scope) error { + return autoConvert_core_Event_To_v1_Event(in, out, s) +} + +func autoConvert_v1_EventList_To_core_EventList(in *v1.EventList, out *core.EventList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.Event)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_EventList_To_core_EventList is an autogenerated conversion function. +func Convert_v1_EventList_To_core_EventList(in *v1.EventList, out *core.EventList, s conversion.Scope) error { + return autoConvert_v1_EventList_To_core_EventList(in, out, s) +} + +func autoConvert_core_EventList_To_v1_EventList(in *core.EventList, out *v1.EventList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.Event)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_EventList_To_v1_EventList is an autogenerated conversion function. +func Convert_core_EventList_To_v1_EventList(in *core.EventList, out *v1.EventList, s conversion.Scope) error { + return autoConvert_core_EventList_To_v1_EventList(in, out, s) +} + +func autoConvert_v1_EventSeries_To_core_EventSeries(in *v1.EventSeries, out *core.EventSeries, s conversion.Scope) error { + out.Count = in.Count + out.LastObservedTime = in.LastObservedTime + out.State = core.EventSeriesState(in.State) + return nil +} + +// Convert_v1_EventSeries_To_core_EventSeries is an autogenerated conversion function. +func Convert_v1_EventSeries_To_core_EventSeries(in *v1.EventSeries, out *core.EventSeries, s conversion.Scope) error { + return autoConvert_v1_EventSeries_To_core_EventSeries(in, out, s) +} + +func autoConvert_core_EventSeries_To_v1_EventSeries(in *core.EventSeries, out *v1.EventSeries, s conversion.Scope) error { + out.Count = in.Count + out.LastObservedTime = in.LastObservedTime + out.State = v1.EventSeriesState(in.State) + return nil +} + +// Convert_core_EventSeries_To_v1_EventSeries is an autogenerated conversion function. +func Convert_core_EventSeries_To_v1_EventSeries(in *core.EventSeries, out *v1.EventSeries, s conversion.Scope) error { + return autoConvert_core_EventSeries_To_v1_EventSeries(in, out, s) +} + +func autoConvert_v1_EventSource_To_core_EventSource(in *v1.EventSource, out *core.EventSource, s conversion.Scope) error { + out.Component = in.Component + out.Host = in.Host + return nil +} + +// Convert_v1_EventSource_To_core_EventSource is an autogenerated conversion function. +func Convert_v1_EventSource_To_core_EventSource(in *v1.EventSource, out *core.EventSource, s conversion.Scope) error { + return autoConvert_v1_EventSource_To_core_EventSource(in, out, s) +} + +func autoConvert_core_EventSource_To_v1_EventSource(in *core.EventSource, out *v1.EventSource, s conversion.Scope) error { + out.Component = in.Component + out.Host = in.Host + return nil +} + +// Convert_core_EventSource_To_v1_EventSource is an autogenerated conversion function. +func Convert_core_EventSource_To_v1_EventSource(in *core.EventSource, out *v1.EventSource, s conversion.Scope) error { + return autoConvert_core_EventSource_To_v1_EventSource(in, out, s) +} + +func autoConvert_v1_ExecAction_To_core_ExecAction(in *v1.ExecAction, out *core.ExecAction, s conversion.Scope) error { + out.Command = *(*[]string)(unsafe.Pointer(&in.Command)) + return nil +} + +// Convert_v1_ExecAction_To_core_ExecAction is an autogenerated conversion function. +func Convert_v1_ExecAction_To_core_ExecAction(in *v1.ExecAction, out *core.ExecAction, s conversion.Scope) error { + return autoConvert_v1_ExecAction_To_core_ExecAction(in, out, s) +} + +func autoConvert_core_ExecAction_To_v1_ExecAction(in *core.ExecAction, out *v1.ExecAction, s conversion.Scope) error { + out.Command = *(*[]string)(unsafe.Pointer(&in.Command)) + return nil +} + +// Convert_core_ExecAction_To_v1_ExecAction is an autogenerated conversion function. +func Convert_core_ExecAction_To_v1_ExecAction(in *core.ExecAction, out *v1.ExecAction, s conversion.Scope) error { + return autoConvert_core_ExecAction_To_v1_ExecAction(in, out, s) +} + +func autoConvert_v1_FCVolumeSource_To_core_FCVolumeSource(in *v1.FCVolumeSource, out *core.FCVolumeSource, s conversion.Scope) error { + out.TargetWWNs = *(*[]string)(unsafe.Pointer(&in.TargetWWNs)) + out.Lun = (*int32)(unsafe.Pointer(in.Lun)) + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.WWIDs = *(*[]string)(unsafe.Pointer(&in.WWIDs)) + return nil +} + +// Convert_v1_FCVolumeSource_To_core_FCVolumeSource is an autogenerated conversion function. +func Convert_v1_FCVolumeSource_To_core_FCVolumeSource(in *v1.FCVolumeSource, out *core.FCVolumeSource, s conversion.Scope) error { + return autoConvert_v1_FCVolumeSource_To_core_FCVolumeSource(in, out, s) +} + +func autoConvert_core_FCVolumeSource_To_v1_FCVolumeSource(in *core.FCVolumeSource, out *v1.FCVolumeSource, s conversion.Scope) error { + out.TargetWWNs = *(*[]string)(unsafe.Pointer(&in.TargetWWNs)) + out.Lun = (*int32)(unsafe.Pointer(in.Lun)) + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.WWIDs = *(*[]string)(unsafe.Pointer(&in.WWIDs)) + return nil +} + +// Convert_core_FCVolumeSource_To_v1_FCVolumeSource is an autogenerated conversion function. +func Convert_core_FCVolumeSource_To_v1_FCVolumeSource(in *core.FCVolumeSource, out *v1.FCVolumeSource, s conversion.Scope) error { + return autoConvert_core_FCVolumeSource_To_v1_FCVolumeSource(in, out, s) +} + +func autoConvert_v1_FlexPersistentVolumeSource_To_core_FlexPersistentVolumeSource(in *v1.FlexPersistentVolumeSource, out *core.FlexPersistentVolumeSource, s conversion.Scope) error { + out.Driver = in.Driver + out.FSType = in.FSType + out.SecretRef = (*core.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + out.Options = *(*map[string]string)(unsafe.Pointer(&in.Options)) + return nil +} + +// Convert_v1_FlexPersistentVolumeSource_To_core_FlexPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_FlexPersistentVolumeSource_To_core_FlexPersistentVolumeSource(in *v1.FlexPersistentVolumeSource, out *core.FlexPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_FlexPersistentVolumeSource_To_core_FlexPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_FlexPersistentVolumeSource_To_v1_FlexPersistentVolumeSource(in *core.FlexPersistentVolumeSource, out *v1.FlexPersistentVolumeSource, s conversion.Scope) error { + out.Driver = in.Driver + out.FSType = in.FSType + out.SecretRef = (*v1.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + out.Options = *(*map[string]string)(unsafe.Pointer(&in.Options)) + return nil +} + +// Convert_core_FlexPersistentVolumeSource_To_v1_FlexPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_FlexPersistentVolumeSource_To_v1_FlexPersistentVolumeSource(in *core.FlexPersistentVolumeSource, out *v1.FlexPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_FlexPersistentVolumeSource_To_v1_FlexPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_FlexVolumeSource_To_core_FlexVolumeSource(in *v1.FlexVolumeSource, out *core.FlexVolumeSource, s conversion.Scope) error { + out.Driver = in.Driver + out.FSType = in.FSType + out.SecretRef = (*core.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + out.Options = *(*map[string]string)(unsafe.Pointer(&in.Options)) + return nil +} + +// Convert_v1_FlexVolumeSource_To_core_FlexVolumeSource is an autogenerated conversion function. +func Convert_v1_FlexVolumeSource_To_core_FlexVolumeSource(in *v1.FlexVolumeSource, out *core.FlexVolumeSource, s conversion.Scope) error { + return autoConvert_v1_FlexVolumeSource_To_core_FlexVolumeSource(in, out, s) +} + +func autoConvert_core_FlexVolumeSource_To_v1_FlexVolumeSource(in *core.FlexVolumeSource, out *v1.FlexVolumeSource, s conversion.Scope) error { + out.Driver = in.Driver + out.FSType = in.FSType + out.SecretRef = (*v1.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + out.Options = *(*map[string]string)(unsafe.Pointer(&in.Options)) + return nil +} + +// Convert_core_FlexVolumeSource_To_v1_FlexVolumeSource is an autogenerated conversion function. +func Convert_core_FlexVolumeSource_To_v1_FlexVolumeSource(in *core.FlexVolumeSource, out *v1.FlexVolumeSource, s conversion.Scope) error { + return autoConvert_core_FlexVolumeSource_To_v1_FlexVolumeSource(in, out, s) +} + +func autoConvert_v1_FlockerVolumeSource_To_core_FlockerVolumeSource(in *v1.FlockerVolumeSource, out *core.FlockerVolumeSource, s conversion.Scope) error { + out.DatasetName = in.DatasetName + out.DatasetUUID = in.DatasetUUID + return nil +} + +// Convert_v1_FlockerVolumeSource_To_core_FlockerVolumeSource is an autogenerated conversion function. +func Convert_v1_FlockerVolumeSource_To_core_FlockerVolumeSource(in *v1.FlockerVolumeSource, out *core.FlockerVolumeSource, s conversion.Scope) error { + return autoConvert_v1_FlockerVolumeSource_To_core_FlockerVolumeSource(in, out, s) +} + +func autoConvert_core_FlockerVolumeSource_To_v1_FlockerVolumeSource(in *core.FlockerVolumeSource, out *v1.FlockerVolumeSource, s conversion.Scope) error { + out.DatasetName = in.DatasetName + out.DatasetUUID = in.DatasetUUID + return nil +} + +// Convert_core_FlockerVolumeSource_To_v1_FlockerVolumeSource is an autogenerated conversion function. +func Convert_core_FlockerVolumeSource_To_v1_FlockerVolumeSource(in *core.FlockerVolumeSource, out *v1.FlockerVolumeSource, s conversion.Scope) error { + return autoConvert_core_FlockerVolumeSource_To_v1_FlockerVolumeSource(in, out, s) +} + +func autoConvert_v1_GCEPersistentDiskVolumeSource_To_core_GCEPersistentDiskVolumeSource(in *v1.GCEPersistentDiskVolumeSource, out *core.GCEPersistentDiskVolumeSource, s conversion.Scope) error { + out.PDName = in.PDName + out.FSType = in.FSType + out.Partition = in.Partition + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_GCEPersistentDiskVolumeSource_To_core_GCEPersistentDiskVolumeSource is an autogenerated conversion function. +func Convert_v1_GCEPersistentDiskVolumeSource_To_core_GCEPersistentDiskVolumeSource(in *v1.GCEPersistentDiskVolumeSource, out *core.GCEPersistentDiskVolumeSource, s conversion.Scope) error { + return autoConvert_v1_GCEPersistentDiskVolumeSource_To_core_GCEPersistentDiskVolumeSource(in, out, s) +} + +func autoConvert_core_GCEPersistentDiskVolumeSource_To_v1_GCEPersistentDiskVolumeSource(in *core.GCEPersistentDiskVolumeSource, out *v1.GCEPersistentDiskVolumeSource, s conversion.Scope) error { + out.PDName = in.PDName + out.FSType = in.FSType + out.Partition = in.Partition + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_GCEPersistentDiskVolumeSource_To_v1_GCEPersistentDiskVolumeSource is an autogenerated conversion function. +func Convert_core_GCEPersistentDiskVolumeSource_To_v1_GCEPersistentDiskVolumeSource(in *core.GCEPersistentDiskVolumeSource, out *v1.GCEPersistentDiskVolumeSource, s conversion.Scope) error { + return autoConvert_core_GCEPersistentDiskVolumeSource_To_v1_GCEPersistentDiskVolumeSource(in, out, s) +} + +func autoConvert_v1_GitRepoVolumeSource_To_core_GitRepoVolumeSource(in *v1.GitRepoVolumeSource, out *core.GitRepoVolumeSource, s conversion.Scope) error { + out.Repository = in.Repository + out.Revision = in.Revision + out.Directory = in.Directory + return nil +} + +// Convert_v1_GitRepoVolumeSource_To_core_GitRepoVolumeSource is an autogenerated conversion function. +func Convert_v1_GitRepoVolumeSource_To_core_GitRepoVolumeSource(in *v1.GitRepoVolumeSource, out *core.GitRepoVolumeSource, s conversion.Scope) error { + return autoConvert_v1_GitRepoVolumeSource_To_core_GitRepoVolumeSource(in, out, s) +} + +func autoConvert_core_GitRepoVolumeSource_To_v1_GitRepoVolumeSource(in *core.GitRepoVolumeSource, out *v1.GitRepoVolumeSource, s conversion.Scope) error { + out.Repository = in.Repository + out.Revision = in.Revision + out.Directory = in.Directory + return nil +} + +// Convert_core_GitRepoVolumeSource_To_v1_GitRepoVolumeSource is an autogenerated conversion function. +func Convert_core_GitRepoVolumeSource_To_v1_GitRepoVolumeSource(in *core.GitRepoVolumeSource, out *v1.GitRepoVolumeSource, s conversion.Scope) error { + return autoConvert_core_GitRepoVolumeSource_To_v1_GitRepoVolumeSource(in, out, s) +} + +func autoConvert_v1_GlusterfsVolumeSource_To_core_GlusterfsVolumeSource(in *v1.GlusterfsVolumeSource, out *core.GlusterfsVolumeSource, s conversion.Scope) error { + out.EndpointsName = in.EndpointsName + out.Path = in.Path + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_GlusterfsVolumeSource_To_core_GlusterfsVolumeSource is an autogenerated conversion function. +func Convert_v1_GlusterfsVolumeSource_To_core_GlusterfsVolumeSource(in *v1.GlusterfsVolumeSource, out *core.GlusterfsVolumeSource, s conversion.Scope) error { + return autoConvert_v1_GlusterfsVolumeSource_To_core_GlusterfsVolumeSource(in, out, s) +} + +func autoConvert_core_GlusterfsVolumeSource_To_v1_GlusterfsVolumeSource(in *core.GlusterfsVolumeSource, out *v1.GlusterfsVolumeSource, s conversion.Scope) error { + out.EndpointsName = in.EndpointsName + out.Path = in.Path + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_GlusterfsVolumeSource_To_v1_GlusterfsVolumeSource is an autogenerated conversion function. +func Convert_core_GlusterfsVolumeSource_To_v1_GlusterfsVolumeSource(in *core.GlusterfsVolumeSource, out *v1.GlusterfsVolumeSource, s conversion.Scope) error { + return autoConvert_core_GlusterfsVolumeSource_To_v1_GlusterfsVolumeSource(in, out, s) +} + +func autoConvert_v1_HTTPGetAction_To_core_HTTPGetAction(in *v1.HTTPGetAction, out *core.HTTPGetAction, s conversion.Scope) error { + out.Path = in.Path + out.Port = in.Port + out.Host = in.Host + out.Scheme = core.URIScheme(in.Scheme) + out.HTTPHeaders = *(*[]core.HTTPHeader)(unsafe.Pointer(&in.HTTPHeaders)) + return nil +} + +// Convert_v1_HTTPGetAction_To_core_HTTPGetAction is an autogenerated conversion function. +func Convert_v1_HTTPGetAction_To_core_HTTPGetAction(in *v1.HTTPGetAction, out *core.HTTPGetAction, s conversion.Scope) error { + return autoConvert_v1_HTTPGetAction_To_core_HTTPGetAction(in, out, s) +} + +func autoConvert_core_HTTPGetAction_To_v1_HTTPGetAction(in *core.HTTPGetAction, out *v1.HTTPGetAction, s conversion.Scope) error { + out.Path = in.Path + out.Port = in.Port + out.Host = in.Host + out.Scheme = v1.URIScheme(in.Scheme) + out.HTTPHeaders = *(*[]v1.HTTPHeader)(unsafe.Pointer(&in.HTTPHeaders)) + return nil +} + +// Convert_core_HTTPGetAction_To_v1_HTTPGetAction is an autogenerated conversion function. +func Convert_core_HTTPGetAction_To_v1_HTTPGetAction(in *core.HTTPGetAction, out *v1.HTTPGetAction, s conversion.Scope) error { + return autoConvert_core_HTTPGetAction_To_v1_HTTPGetAction(in, out, s) +} + +func autoConvert_v1_HTTPHeader_To_core_HTTPHeader(in *v1.HTTPHeader, out *core.HTTPHeader, s conversion.Scope) error { + out.Name = in.Name + out.Value = in.Value + return nil +} + +// Convert_v1_HTTPHeader_To_core_HTTPHeader is an autogenerated conversion function. +func Convert_v1_HTTPHeader_To_core_HTTPHeader(in *v1.HTTPHeader, out *core.HTTPHeader, s conversion.Scope) error { + return autoConvert_v1_HTTPHeader_To_core_HTTPHeader(in, out, s) +} + +func autoConvert_core_HTTPHeader_To_v1_HTTPHeader(in *core.HTTPHeader, out *v1.HTTPHeader, s conversion.Scope) error { + out.Name = in.Name + out.Value = in.Value + return nil +} + +// Convert_core_HTTPHeader_To_v1_HTTPHeader is an autogenerated conversion function. +func Convert_core_HTTPHeader_To_v1_HTTPHeader(in *core.HTTPHeader, out *v1.HTTPHeader, s conversion.Scope) error { + return autoConvert_core_HTTPHeader_To_v1_HTTPHeader(in, out, s) +} + +func autoConvert_v1_Handler_To_core_Handler(in *v1.Handler, out *core.Handler, s conversion.Scope) error { + out.Exec = (*core.ExecAction)(unsafe.Pointer(in.Exec)) + out.HTTPGet = (*core.HTTPGetAction)(unsafe.Pointer(in.HTTPGet)) + out.TCPSocket = (*core.TCPSocketAction)(unsafe.Pointer(in.TCPSocket)) + return nil +} + +// Convert_v1_Handler_To_core_Handler is an autogenerated conversion function. +func Convert_v1_Handler_To_core_Handler(in *v1.Handler, out *core.Handler, s conversion.Scope) error { + return autoConvert_v1_Handler_To_core_Handler(in, out, s) +} + +func autoConvert_core_Handler_To_v1_Handler(in *core.Handler, out *v1.Handler, s conversion.Scope) error { + out.Exec = (*v1.ExecAction)(unsafe.Pointer(in.Exec)) + out.HTTPGet = (*v1.HTTPGetAction)(unsafe.Pointer(in.HTTPGet)) + out.TCPSocket = (*v1.TCPSocketAction)(unsafe.Pointer(in.TCPSocket)) + return nil +} + +// Convert_core_Handler_To_v1_Handler is an autogenerated conversion function. +func Convert_core_Handler_To_v1_Handler(in *core.Handler, out *v1.Handler, s conversion.Scope) error { + return autoConvert_core_Handler_To_v1_Handler(in, out, s) +} + +func autoConvert_v1_HostAlias_To_core_HostAlias(in *v1.HostAlias, out *core.HostAlias, s conversion.Scope) error { + out.IP = in.IP + out.Hostnames = *(*[]string)(unsafe.Pointer(&in.Hostnames)) + return nil +} + +// Convert_v1_HostAlias_To_core_HostAlias is an autogenerated conversion function. +func Convert_v1_HostAlias_To_core_HostAlias(in *v1.HostAlias, out *core.HostAlias, s conversion.Scope) error { + return autoConvert_v1_HostAlias_To_core_HostAlias(in, out, s) +} + +func autoConvert_core_HostAlias_To_v1_HostAlias(in *core.HostAlias, out *v1.HostAlias, s conversion.Scope) error { + out.IP = in.IP + out.Hostnames = *(*[]string)(unsafe.Pointer(&in.Hostnames)) + return nil +} + +// Convert_core_HostAlias_To_v1_HostAlias is an autogenerated conversion function. +func Convert_core_HostAlias_To_v1_HostAlias(in *core.HostAlias, out *v1.HostAlias, s conversion.Scope) error { + return autoConvert_core_HostAlias_To_v1_HostAlias(in, out, s) +} + +func autoConvert_v1_HostPathVolumeSource_To_core_HostPathVolumeSource(in *v1.HostPathVolumeSource, out *core.HostPathVolumeSource, s conversion.Scope) error { + out.Path = in.Path + out.Type = (*core.HostPathType)(unsafe.Pointer(in.Type)) + return nil +} + +// Convert_v1_HostPathVolumeSource_To_core_HostPathVolumeSource is an autogenerated conversion function. +func Convert_v1_HostPathVolumeSource_To_core_HostPathVolumeSource(in *v1.HostPathVolumeSource, out *core.HostPathVolumeSource, s conversion.Scope) error { + return autoConvert_v1_HostPathVolumeSource_To_core_HostPathVolumeSource(in, out, s) +} + +func autoConvert_core_HostPathVolumeSource_To_v1_HostPathVolumeSource(in *core.HostPathVolumeSource, out *v1.HostPathVolumeSource, s conversion.Scope) error { + out.Path = in.Path + out.Type = (*v1.HostPathType)(unsafe.Pointer(in.Type)) + return nil +} + +// Convert_core_HostPathVolumeSource_To_v1_HostPathVolumeSource is an autogenerated conversion function. +func Convert_core_HostPathVolumeSource_To_v1_HostPathVolumeSource(in *core.HostPathVolumeSource, out *v1.HostPathVolumeSource, s conversion.Scope) error { + return autoConvert_core_HostPathVolumeSource_To_v1_HostPathVolumeSource(in, out, s) +} + +func autoConvert_v1_ISCSIPersistentVolumeSource_To_core_ISCSIPersistentVolumeSource(in *v1.ISCSIPersistentVolumeSource, out *core.ISCSIPersistentVolumeSource, s conversion.Scope) error { + out.TargetPortal = in.TargetPortal + out.IQN = in.IQN + out.Lun = in.Lun + out.ISCSIInterface = in.ISCSIInterface + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.Portals = *(*[]string)(unsafe.Pointer(&in.Portals)) + out.DiscoveryCHAPAuth = in.DiscoveryCHAPAuth + out.SessionCHAPAuth = in.SessionCHAPAuth + out.SecretRef = (*core.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.InitiatorName = (*string)(unsafe.Pointer(in.InitiatorName)) + return nil +} + +// Convert_v1_ISCSIPersistentVolumeSource_To_core_ISCSIPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_ISCSIPersistentVolumeSource_To_core_ISCSIPersistentVolumeSource(in *v1.ISCSIPersistentVolumeSource, out *core.ISCSIPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_ISCSIPersistentVolumeSource_To_core_ISCSIPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_ISCSIPersistentVolumeSource_To_v1_ISCSIPersistentVolumeSource(in *core.ISCSIPersistentVolumeSource, out *v1.ISCSIPersistentVolumeSource, s conversion.Scope) error { + out.TargetPortal = in.TargetPortal + out.IQN = in.IQN + out.Lun = in.Lun + out.ISCSIInterface = in.ISCSIInterface + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.Portals = *(*[]string)(unsafe.Pointer(&in.Portals)) + out.DiscoveryCHAPAuth = in.DiscoveryCHAPAuth + out.SessionCHAPAuth = in.SessionCHAPAuth + out.SecretRef = (*v1.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.InitiatorName = (*string)(unsafe.Pointer(in.InitiatorName)) + return nil +} + +// Convert_core_ISCSIPersistentVolumeSource_To_v1_ISCSIPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_ISCSIPersistentVolumeSource_To_v1_ISCSIPersistentVolumeSource(in *core.ISCSIPersistentVolumeSource, out *v1.ISCSIPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_ISCSIPersistentVolumeSource_To_v1_ISCSIPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_ISCSIVolumeSource_To_core_ISCSIVolumeSource(in *v1.ISCSIVolumeSource, out *core.ISCSIVolumeSource, s conversion.Scope) error { + out.TargetPortal = in.TargetPortal + out.IQN = in.IQN + out.Lun = in.Lun + out.ISCSIInterface = in.ISCSIInterface + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.Portals = *(*[]string)(unsafe.Pointer(&in.Portals)) + out.DiscoveryCHAPAuth = in.DiscoveryCHAPAuth + out.SessionCHAPAuth = in.SessionCHAPAuth + out.SecretRef = (*core.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.InitiatorName = (*string)(unsafe.Pointer(in.InitiatorName)) + return nil +} + +// Convert_v1_ISCSIVolumeSource_To_core_ISCSIVolumeSource is an autogenerated conversion function. +func Convert_v1_ISCSIVolumeSource_To_core_ISCSIVolumeSource(in *v1.ISCSIVolumeSource, out *core.ISCSIVolumeSource, s conversion.Scope) error { + return autoConvert_v1_ISCSIVolumeSource_To_core_ISCSIVolumeSource(in, out, s) +} + +func autoConvert_core_ISCSIVolumeSource_To_v1_ISCSIVolumeSource(in *core.ISCSIVolumeSource, out *v1.ISCSIVolumeSource, s conversion.Scope) error { + out.TargetPortal = in.TargetPortal + out.IQN = in.IQN + out.Lun = in.Lun + out.ISCSIInterface = in.ISCSIInterface + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.Portals = *(*[]string)(unsafe.Pointer(&in.Portals)) + out.DiscoveryCHAPAuth = in.DiscoveryCHAPAuth + out.SessionCHAPAuth = in.SessionCHAPAuth + out.SecretRef = (*v1.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.InitiatorName = (*string)(unsafe.Pointer(in.InitiatorName)) + return nil +} + +// Convert_core_ISCSIVolumeSource_To_v1_ISCSIVolumeSource is an autogenerated conversion function. +func Convert_core_ISCSIVolumeSource_To_v1_ISCSIVolumeSource(in *core.ISCSIVolumeSource, out *v1.ISCSIVolumeSource, s conversion.Scope) error { + return autoConvert_core_ISCSIVolumeSource_To_v1_ISCSIVolumeSource(in, out, s) +} + +func autoConvert_v1_KeyToPath_To_core_KeyToPath(in *v1.KeyToPath, out *core.KeyToPath, s conversion.Scope) error { + out.Key = in.Key + out.Path = in.Path + out.Mode = (*int32)(unsafe.Pointer(in.Mode)) + return nil +} + +// Convert_v1_KeyToPath_To_core_KeyToPath is an autogenerated conversion function. +func Convert_v1_KeyToPath_To_core_KeyToPath(in *v1.KeyToPath, out *core.KeyToPath, s conversion.Scope) error { + return autoConvert_v1_KeyToPath_To_core_KeyToPath(in, out, s) +} + +func autoConvert_core_KeyToPath_To_v1_KeyToPath(in *core.KeyToPath, out *v1.KeyToPath, s conversion.Scope) error { + out.Key = in.Key + out.Path = in.Path + out.Mode = (*int32)(unsafe.Pointer(in.Mode)) + return nil +} + +// Convert_core_KeyToPath_To_v1_KeyToPath is an autogenerated conversion function. +func Convert_core_KeyToPath_To_v1_KeyToPath(in *core.KeyToPath, out *v1.KeyToPath, s conversion.Scope) error { + return autoConvert_core_KeyToPath_To_v1_KeyToPath(in, out, s) +} + +func autoConvert_v1_Lifecycle_To_core_Lifecycle(in *v1.Lifecycle, out *core.Lifecycle, s conversion.Scope) error { + out.PostStart = (*core.Handler)(unsafe.Pointer(in.PostStart)) + out.PreStop = (*core.Handler)(unsafe.Pointer(in.PreStop)) + return nil +} + +// Convert_v1_Lifecycle_To_core_Lifecycle is an autogenerated conversion function. +func Convert_v1_Lifecycle_To_core_Lifecycle(in *v1.Lifecycle, out *core.Lifecycle, s conversion.Scope) error { + return autoConvert_v1_Lifecycle_To_core_Lifecycle(in, out, s) +} + +func autoConvert_core_Lifecycle_To_v1_Lifecycle(in *core.Lifecycle, out *v1.Lifecycle, s conversion.Scope) error { + out.PostStart = (*v1.Handler)(unsafe.Pointer(in.PostStart)) + out.PreStop = (*v1.Handler)(unsafe.Pointer(in.PreStop)) + return nil +} + +// Convert_core_Lifecycle_To_v1_Lifecycle is an autogenerated conversion function. +func Convert_core_Lifecycle_To_v1_Lifecycle(in *core.Lifecycle, out *v1.Lifecycle, s conversion.Scope) error { + return autoConvert_core_Lifecycle_To_v1_Lifecycle(in, out, s) +} + +func autoConvert_v1_LimitRange_To_core_LimitRange(in *v1.LimitRange, out *core.LimitRange, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_LimitRangeSpec_To_core_LimitRangeSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + return nil +} + +// Convert_v1_LimitRange_To_core_LimitRange is an autogenerated conversion function. +func Convert_v1_LimitRange_To_core_LimitRange(in *v1.LimitRange, out *core.LimitRange, s conversion.Scope) error { + return autoConvert_v1_LimitRange_To_core_LimitRange(in, out, s) +} + +func autoConvert_core_LimitRange_To_v1_LimitRange(in *core.LimitRange, out *v1.LimitRange, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_LimitRangeSpec_To_v1_LimitRangeSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + return nil +} + +// Convert_core_LimitRange_To_v1_LimitRange is an autogenerated conversion function. +func Convert_core_LimitRange_To_v1_LimitRange(in *core.LimitRange, out *v1.LimitRange, s conversion.Scope) error { + return autoConvert_core_LimitRange_To_v1_LimitRange(in, out, s) +} + +func autoConvert_v1_LimitRangeItem_To_core_LimitRangeItem(in *v1.LimitRangeItem, out *core.LimitRangeItem, s conversion.Scope) error { + out.Type = core.LimitType(in.Type) + out.Max = *(*core.ResourceList)(unsafe.Pointer(&in.Max)) + out.Min = *(*core.ResourceList)(unsafe.Pointer(&in.Min)) + out.Default = *(*core.ResourceList)(unsafe.Pointer(&in.Default)) + out.DefaultRequest = *(*core.ResourceList)(unsafe.Pointer(&in.DefaultRequest)) + out.MaxLimitRequestRatio = *(*core.ResourceList)(unsafe.Pointer(&in.MaxLimitRequestRatio)) + return nil +} + +// Convert_v1_LimitRangeItem_To_core_LimitRangeItem is an autogenerated conversion function. +func Convert_v1_LimitRangeItem_To_core_LimitRangeItem(in *v1.LimitRangeItem, out *core.LimitRangeItem, s conversion.Scope) error { + return autoConvert_v1_LimitRangeItem_To_core_LimitRangeItem(in, out, s) +} + +func autoConvert_core_LimitRangeItem_To_v1_LimitRangeItem(in *core.LimitRangeItem, out *v1.LimitRangeItem, s conversion.Scope) error { + out.Type = v1.LimitType(in.Type) + out.Max = *(*v1.ResourceList)(unsafe.Pointer(&in.Max)) + out.Min = *(*v1.ResourceList)(unsafe.Pointer(&in.Min)) + out.Default = *(*v1.ResourceList)(unsafe.Pointer(&in.Default)) + out.DefaultRequest = *(*v1.ResourceList)(unsafe.Pointer(&in.DefaultRequest)) + out.MaxLimitRequestRatio = *(*v1.ResourceList)(unsafe.Pointer(&in.MaxLimitRequestRatio)) + return nil +} + +// Convert_core_LimitRangeItem_To_v1_LimitRangeItem is an autogenerated conversion function. +func Convert_core_LimitRangeItem_To_v1_LimitRangeItem(in *core.LimitRangeItem, out *v1.LimitRangeItem, s conversion.Scope) error { + return autoConvert_core_LimitRangeItem_To_v1_LimitRangeItem(in, out, s) +} + +func autoConvert_v1_LimitRangeList_To_core_LimitRangeList(in *v1.LimitRangeList, out *core.LimitRangeList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.LimitRange)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_LimitRangeList_To_core_LimitRangeList is an autogenerated conversion function. +func Convert_v1_LimitRangeList_To_core_LimitRangeList(in *v1.LimitRangeList, out *core.LimitRangeList, s conversion.Scope) error { + return autoConvert_v1_LimitRangeList_To_core_LimitRangeList(in, out, s) +} + +func autoConvert_core_LimitRangeList_To_v1_LimitRangeList(in *core.LimitRangeList, out *v1.LimitRangeList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.LimitRange)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_LimitRangeList_To_v1_LimitRangeList is an autogenerated conversion function. +func Convert_core_LimitRangeList_To_v1_LimitRangeList(in *core.LimitRangeList, out *v1.LimitRangeList, s conversion.Scope) error { + return autoConvert_core_LimitRangeList_To_v1_LimitRangeList(in, out, s) +} + +func autoConvert_v1_LimitRangeSpec_To_core_LimitRangeSpec(in *v1.LimitRangeSpec, out *core.LimitRangeSpec, s conversion.Scope) error { + out.Limits = *(*[]core.LimitRangeItem)(unsafe.Pointer(&in.Limits)) + return nil +} + +// Convert_v1_LimitRangeSpec_To_core_LimitRangeSpec is an autogenerated conversion function. +func Convert_v1_LimitRangeSpec_To_core_LimitRangeSpec(in *v1.LimitRangeSpec, out *core.LimitRangeSpec, s conversion.Scope) error { + return autoConvert_v1_LimitRangeSpec_To_core_LimitRangeSpec(in, out, s) +} + +func autoConvert_core_LimitRangeSpec_To_v1_LimitRangeSpec(in *core.LimitRangeSpec, out *v1.LimitRangeSpec, s conversion.Scope) error { + out.Limits = *(*[]v1.LimitRangeItem)(unsafe.Pointer(&in.Limits)) + return nil +} + +// Convert_core_LimitRangeSpec_To_v1_LimitRangeSpec is an autogenerated conversion function. +func Convert_core_LimitRangeSpec_To_v1_LimitRangeSpec(in *core.LimitRangeSpec, out *v1.LimitRangeSpec, s conversion.Scope) error { + return autoConvert_core_LimitRangeSpec_To_v1_LimitRangeSpec(in, out, s) +} + +func autoConvert_v1_List_To_core_List(in *v1.List, out *core.List, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]runtime.Object, len(*in)) + for i := range *in { + if err := runtime.Convert_runtime_RawExtension_To_runtime_Object(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_List_To_core_List is an autogenerated conversion function. +func Convert_v1_List_To_core_List(in *v1.List, out *core.List, s conversion.Scope) error { + return autoConvert_v1_List_To_core_List(in, out, s) +} + +func autoConvert_core_List_To_v1_List(in *core.List, out *v1.List, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]runtime.RawExtension, len(*in)) + for i := range *in { + if err := runtime.Convert_runtime_Object_To_runtime_RawExtension(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_List_To_v1_List is an autogenerated conversion function. +func Convert_core_List_To_v1_List(in *core.List, out *v1.List, s conversion.Scope) error { + return autoConvert_core_List_To_v1_List(in, out, s) +} + +func autoConvert_v1_ListOptions_To_core_ListOptions(in *v1.ListOptions, out *core.ListOptions, s conversion.Scope) error { + if err := meta_v1.Convert_string_To_labels_Selector(&in.LabelSelector, &out.LabelSelector, s); err != nil { + return err + } + if err := meta_v1.Convert_string_To_fields_Selector(&in.FieldSelector, &out.FieldSelector, s); err != nil { + return err + } + out.IncludeUninitialized = in.IncludeUninitialized + out.Watch = in.Watch + out.ResourceVersion = in.ResourceVersion + out.TimeoutSeconds = (*int64)(unsafe.Pointer(in.TimeoutSeconds)) + return nil +} + +// Convert_v1_ListOptions_To_core_ListOptions is an autogenerated conversion function. +func Convert_v1_ListOptions_To_core_ListOptions(in *v1.ListOptions, out *core.ListOptions, s conversion.Scope) error { + return autoConvert_v1_ListOptions_To_core_ListOptions(in, out, s) +} + +func autoConvert_core_ListOptions_To_v1_ListOptions(in *core.ListOptions, out *v1.ListOptions, s conversion.Scope) error { + if err := meta_v1.Convert_labels_Selector_To_string(&in.LabelSelector, &out.LabelSelector, s); err != nil { + return err + } + if err := meta_v1.Convert_fields_Selector_To_string(&in.FieldSelector, &out.FieldSelector, s); err != nil { + return err + } + out.IncludeUninitialized = in.IncludeUninitialized + out.Watch = in.Watch + out.ResourceVersion = in.ResourceVersion + out.TimeoutSeconds = (*int64)(unsafe.Pointer(in.TimeoutSeconds)) + return nil +} + +// Convert_core_ListOptions_To_v1_ListOptions is an autogenerated conversion function. +func Convert_core_ListOptions_To_v1_ListOptions(in *core.ListOptions, out *v1.ListOptions, s conversion.Scope) error { + return autoConvert_core_ListOptions_To_v1_ListOptions(in, out, s) +} + +func autoConvert_v1_LoadBalancerIngress_To_core_LoadBalancerIngress(in *v1.LoadBalancerIngress, out *core.LoadBalancerIngress, s conversion.Scope) error { + out.IP = in.IP + out.Hostname = in.Hostname + return nil +} + +// Convert_v1_LoadBalancerIngress_To_core_LoadBalancerIngress is an autogenerated conversion function. +func Convert_v1_LoadBalancerIngress_To_core_LoadBalancerIngress(in *v1.LoadBalancerIngress, out *core.LoadBalancerIngress, s conversion.Scope) error { + return autoConvert_v1_LoadBalancerIngress_To_core_LoadBalancerIngress(in, out, s) +} + +func autoConvert_core_LoadBalancerIngress_To_v1_LoadBalancerIngress(in *core.LoadBalancerIngress, out *v1.LoadBalancerIngress, s conversion.Scope) error { + out.IP = in.IP + out.Hostname = in.Hostname + return nil +} + +// Convert_core_LoadBalancerIngress_To_v1_LoadBalancerIngress is an autogenerated conversion function. +func Convert_core_LoadBalancerIngress_To_v1_LoadBalancerIngress(in *core.LoadBalancerIngress, out *v1.LoadBalancerIngress, s conversion.Scope) error { + return autoConvert_core_LoadBalancerIngress_To_v1_LoadBalancerIngress(in, out, s) +} + +func autoConvert_v1_LoadBalancerStatus_To_core_LoadBalancerStatus(in *v1.LoadBalancerStatus, out *core.LoadBalancerStatus, s conversion.Scope) error { + out.Ingress = *(*[]core.LoadBalancerIngress)(unsafe.Pointer(&in.Ingress)) + return nil +} + +// Convert_v1_LoadBalancerStatus_To_core_LoadBalancerStatus is an autogenerated conversion function. +func Convert_v1_LoadBalancerStatus_To_core_LoadBalancerStatus(in *v1.LoadBalancerStatus, out *core.LoadBalancerStatus, s conversion.Scope) error { + return autoConvert_v1_LoadBalancerStatus_To_core_LoadBalancerStatus(in, out, s) +} + +func autoConvert_core_LoadBalancerStatus_To_v1_LoadBalancerStatus(in *core.LoadBalancerStatus, out *v1.LoadBalancerStatus, s conversion.Scope) error { + out.Ingress = *(*[]v1.LoadBalancerIngress)(unsafe.Pointer(&in.Ingress)) + return nil +} + +// Convert_core_LoadBalancerStatus_To_v1_LoadBalancerStatus is an autogenerated conversion function. +func Convert_core_LoadBalancerStatus_To_v1_LoadBalancerStatus(in *core.LoadBalancerStatus, out *v1.LoadBalancerStatus, s conversion.Scope) error { + return autoConvert_core_LoadBalancerStatus_To_v1_LoadBalancerStatus(in, out, s) +} + +func autoConvert_v1_LocalObjectReference_To_core_LocalObjectReference(in *v1.LocalObjectReference, out *core.LocalObjectReference, s conversion.Scope) error { + out.Name = in.Name + return nil +} + +// Convert_v1_LocalObjectReference_To_core_LocalObjectReference is an autogenerated conversion function. +func Convert_v1_LocalObjectReference_To_core_LocalObjectReference(in *v1.LocalObjectReference, out *core.LocalObjectReference, s conversion.Scope) error { + return autoConvert_v1_LocalObjectReference_To_core_LocalObjectReference(in, out, s) +} + +func autoConvert_core_LocalObjectReference_To_v1_LocalObjectReference(in *core.LocalObjectReference, out *v1.LocalObjectReference, s conversion.Scope) error { + out.Name = in.Name + return nil +} + +// Convert_core_LocalObjectReference_To_v1_LocalObjectReference is an autogenerated conversion function. +func Convert_core_LocalObjectReference_To_v1_LocalObjectReference(in *core.LocalObjectReference, out *v1.LocalObjectReference, s conversion.Scope) error { + return autoConvert_core_LocalObjectReference_To_v1_LocalObjectReference(in, out, s) +} + +func autoConvert_v1_LocalVolumeSource_To_core_LocalVolumeSource(in *v1.LocalVolumeSource, out *core.LocalVolumeSource, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_v1_LocalVolumeSource_To_core_LocalVolumeSource is an autogenerated conversion function. +func Convert_v1_LocalVolumeSource_To_core_LocalVolumeSource(in *v1.LocalVolumeSource, out *core.LocalVolumeSource, s conversion.Scope) error { + return autoConvert_v1_LocalVolumeSource_To_core_LocalVolumeSource(in, out, s) +} + +func autoConvert_core_LocalVolumeSource_To_v1_LocalVolumeSource(in *core.LocalVolumeSource, out *v1.LocalVolumeSource, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_core_LocalVolumeSource_To_v1_LocalVolumeSource is an autogenerated conversion function. +func Convert_core_LocalVolumeSource_To_v1_LocalVolumeSource(in *core.LocalVolumeSource, out *v1.LocalVolumeSource, s conversion.Scope) error { + return autoConvert_core_LocalVolumeSource_To_v1_LocalVolumeSource(in, out, s) +} + +func autoConvert_v1_NFSVolumeSource_To_core_NFSVolumeSource(in *v1.NFSVolumeSource, out *core.NFSVolumeSource, s conversion.Scope) error { + out.Server = in.Server + out.Path = in.Path + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_NFSVolumeSource_To_core_NFSVolumeSource is an autogenerated conversion function. +func Convert_v1_NFSVolumeSource_To_core_NFSVolumeSource(in *v1.NFSVolumeSource, out *core.NFSVolumeSource, s conversion.Scope) error { + return autoConvert_v1_NFSVolumeSource_To_core_NFSVolumeSource(in, out, s) +} + +func autoConvert_core_NFSVolumeSource_To_v1_NFSVolumeSource(in *core.NFSVolumeSource, out *v1.NFSVolumeSource, s conversion.Scope) error { + out.Server = in.Server + out.Path = in.Path + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_NFSVolumeSource_To_v1_NFSVolumeSource is an autogenerated conversion function. +func Convert_core_NFSVolumeSource_To_v1_NFSVolumeSource(in *core.NFSVolumeSource, out *v1.NFSVolumeSource, s conversion.Scope) error { + return autoConvert_core_NFSVolumeSource_To_v1_NFSVolumeSource(in, out, s) +} + +func autoConvert_v1_Namespace_To_core_Namespace(in *v1.Namespace, out *core.Namespace, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_NamespaceSpec_To_core_NamespaceSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_NamespaceStatus_To_core_NamespaceStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_Namespace_To_core_Namespace is an autogenerated conversion function. +func Convert_v1_Namespace_To_core_Namespace(in *v1.Namespace, out *core.Namespace, s conversion.Scope) error { + return autoConvert_v1_Namespace_To_core_Namespace(in, out, s) +} + +func autoConvert_core_Namespace_To_v1_Namespace(in *core.Namespace, out *v1.Namespace, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_NamespaceSpec_To_v1_NamespaceSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_NamespaceStatus_To_v1_NamespaceStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_Namespace_To_v1_Namespace is an autogenerated conversion function. +func Convert_core_Namespace_To_v1_Namespace(in *core.Namespace, out *v1.Namespace, s conversion.Scope) error { + return autoConvert_core_Namespace_To_v1_Namespace(in, out, s) +} + +func autoConvert_v1_NamespaceList_To_core_NamespaceList(in *v1.NamespaceList, out *core.NamespaceList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.Namespace)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_NamespaceList_To_core_NamespaceList is an autogenerated conversion function. +func Convert_v1_NamespaceList_To_core_NamespaceList(in *v1.NamespaceList, out *core.NamespaceList, s conversion.Scope) error { + return autoConvert_v1_NamespaceList_To_core_NamespaceList(in, out, s) +} + +func autoConvert_core_NamespaceList_To_v1_NamespaceList(in *core.NamespaceList, out *v1.NamespaceList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.Namespace)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_NamespaceList_To_v1_NamespaceList is an autogenerated conversion function. +func Convert_core_NamespaceList_To_v1_NamespaceList(in *core.NamespaceList, out *v1.NamespaceList, s conversion.Scope) error { + return autoConvert_core_NamespaceList_To_v1_NamespaceList(in, out, s) +} + +func autoConvert_v1_NamespaceSpec_To_core_NamespaceSpec(in *v1.NamespaceSpec, out *core.NamespaceSpec, s conversion.Scope) error { + out.Finalizers = *(*[]core.FinalizerName)(unsafe.Pointer(&in.Finalizers)) + return nil +} + +// Convert_v1_NamespaceSpec_To_core_NamespaceSpec is an autogenerated conversion function. +func Convert_v1_NamespaceSpec_To_core_NamespaceSpec(in *v1.NamespaceSpec, out *core.NamespaceSpec, s conversion.Scope) error { + return autoConvert_v1_NamespaceSpec_To_core_NamespaceSpec(in, out, s) +} + +func autoConvert_core_NamespaceSpec_To_v1_NamespaceSpec(in *core.NamespaceSpec, out *v1.NamespaceSpec, s conversion.Scope) error { + out.Finalizers = *(*[]v1.FinalizerName)(unsafe.Pointer(&in.Finalizers)) + return nil +} + +// Convert_core_NamespaceSpec_To_v1_NamespaceSpec is an autogenerated conversion function. +func Convert_core_NamespaceSpec_To_v1_NamespaceSpec(in *core.NamespaceSpec, out *v1.NamespaceSpec, s conversion.Scope) error { + return autoConvert_core_NamespaceSpec_To_v1_NamespaceSpec(in, out, s) +} + +func autoConvert_v1_NamespaceStatus_To_core_NamespaceStatus(in *v1.NamespaceStatus, out *core.NamespaceStatus, s conversion.Scope) error { + out.Phase = core.NamespacePhase(in.Phase) + return nil +} + +// Convert_v1_NamespaceStatus_To_core_NamespaceStatus is an autogenerated conversion function. +func Convert_v1_NamespaceStatus_To_core_NamespaceStatus(in *v1.NamespaceStatus, out *core.NamespaceStatus, s conversion.Scope) error { + return autoConvert_v1_NamespaceStatus_To_core_NamespaceStatus(in, out, s) +} + +func autoConvert_core_NamespaceStatus_To_v1_NamespaceStatus(in *core.NamespaceStatus, out *v1.NamespaceStatus, s conversion.Scope) error { + out.Phase = v1.NamespacePhase(in.Phase) + return nil +} + +// Convert_core_NamespaceStatus_To_v1_NamespaceStatus is an autogenerated conversion function. +func Convert_core_NamespaceStatus_To_v1_NamespaceStatus(in *core.NamespaceStatus, out *v1.NamespaceStatus, s conversion.Scope) error { + return autoConvert_core_NamespaceStatus_To_v1_NamespaceStatus(in, out, s) +} + +func autoConvert_v1_Node_To_core_Node(in *v1.Node, out *core.Node, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_NodeSpec_To_core_NodeSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_NodeStatus_To_core_NodeStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_Node_To_core_Node is an autogenerated conversion function. +func Convert_v1_Node_To_core_Node(in *v1.Node, out *core.Node, s conversion.Scope) error { + return autoConvert_v1_Node_To_core_Node(in, out, s) +} + +func autoConvert_core_Node_To_v1_Node(in *core.Node, out *v1.Node, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_NodeSpec_To_v1_NodeSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_NodeStatus_To_v1_NodeStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_Node_To_v1_Node is an autogenerated conversion function. +func Convert_core_Node_To_v1_Node(in *core.Node, out *v1.Node, s conversion.Scope) error { + return autoConvert_core_Node_To_v1_Node(in, out, s) +} + +func autoConvert_v1_NodeAddress_To_core_NodeAddress(in *v1.NodeAddress, out *core.NodeAddress, s conversion.Scope) error { + out.Type = core.NodeAddressType(in.Type) + out.Address = in.Address + return nil +} + +// Convert_v1_NodeAddress_To_core_NodeAddress is an autogenerated conversion function. +func Convert_v1_NodeAddress_To_core_NodeAddress(in *v1.NodeAddress, out *core.NodeAddress, s conversion.Scope) error { + return autoConvert_v1_NodeAddress_To_core_NodeAddress(in, out, s) +} + +func autoConvert_core_NodeAddress_To_v1_NodeAddress(in *core.NodeAddress, out *v1.NodeAddress, s conversion.Scope) error { + out.Type = v1.NodeAddressType(in.Type) + out.Address = in.Address + return nil +} + +// Convert_core_NodeAddress_To_v1_NodeAddress is an autogenerated conversion function. +func Convert_core_NodeAddress_To_v1_NodeAddress(in *core.NodeAddress, out *v1.NodeAddress, s conversion.Scope) error { + return autoConvert_core_NodeAddress_To_v1_NodeAddress(in, out, s) +} + +func autoConvert_v1_NodeAffinity_To_core_NodeAffinity(in *v1.NodeAffinity, out *core.NodeAffinity, s conversion.Scope) error { + out.RequiredDuringSchedulingIgnoredDuringExecution = (*core.NodeSelector)(unsafe.Pointer(in.RequiredDuringSchedulingIgnoredDuringExecution)) + out.PreferredDuringSchedulingIgnoredDuringExecution = *(*[]core.PreferredSchedulingTerm)(unsafe.Pointer(&in.PreferredDuringSchedulingIgnoredDuringExecution)) + return nil +} + +// Convert_v1_NodeAffinity_To_core_NodeAffinity is an autogenerated conversion function. +func Convert_v1_NodeAffinity_To_core_NodeAffinity(in *v1.NodeAffinity, out *core.NodeAffinity, s conversion.Scope) error { + return autoConvert_v1_NodeAffinity_To_core_NodeAffinity(in, out, s) +} + +func autoConvert_core_NodeAffinity_To_v1_NodeAffinity(in *core.NodeAffinity, out *v1.NodeAffinity, s conversion.Scope) error { + out.RequiredDuringSchedulingIgnoredDuringExecution = (*v1.NodeSelector)(unsafe.Pointer(in.RequiredDuringSchedulingIgnoredDuringExecution)) + out.PreferredDuringSchedulingIgnoredDuringExecution = *(*[]v1.PreferredSchedulingTerm)(unsafe.Pointer(&in.PreferredDuringSchedulingIgnoredDuringExecution)) + return nil +} + +// Convert_core_NodeAffinity_To_v1_NodeAffinity is an autogenerated conversion function. +func Convert_core_NodeAffinity_To_v1_NodeAffinity(in *core.NodeAffinity, out *v1.NodeAffinity, s conversion.Scope) error { + return autoConvert_core_NodeAffinity_To_v1_NodeAffinity(in, out, s) +} + +func autoConvert_v1_NodeCondition_To_core_NodeCondition(in *v1.NodeCondition, out *core.NodeCondition, s conversion.Scope) error { + out.Type = core.NodeConditionType(in.Type) + out.Status = core.ConditionStatus(in.Status) + out.LastHeartbeatTime = in.LastHeartbeatTime + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_v1_NodeCondition_To_core_NodeCondition is an autogenerated conversion function. +func Convert_v1_NodeCondition_To_core_NodeCondition(in *v1.NodeCondition, out *core.NodeCondition, s conversion.Scope) error { + return autoConvert_v1_NodeCondition_To_core_NodeCondition(in, out, s) +} + +func autoConvert_core_NodeCondition_To_v1_NodeCondition(in *core.NodeCondition, out *v1.NodeCondition, s conversion.Scope) error { + out.Type = v1.NodeConditionType(in.Type) + out.Status = v1.ConditionStatus(in.Status) + out.LastHeartbeatTime = in.LastHeartbeatTime + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_core_NodeCondition_To_v1_NodeCondition is an autogenerated conversion function. +func Convert_core_NodeCondition_To_v1_NodeCondition(in *core.NodeCondition, out *v1.NodeCondition, s conversion.Scope) error { + return autoConvert_core_NodeCondition_To_v1_NodeCondition(in, out, s) +} + +func autoConvert_v1_NodeConfigSource_To_core_NodeConfigSource(in *v1.NodeConfigSource, out *core.NodeConfigSource, s conversion.Scope) error { + out.ConfigMapRef = (*core.ObjectReference)(unsafe.Pointer(in.ConfigMapRef)) + return nil +} + +// Convert_v1_NodeConfigSource_To_core_NodeConfigSource is an autogenerated conversion function. +func Convert_v1_NodeConfigSource_To_core_NodeConfigSource(in *v1.NodeConfigSource, out *core.NodeConfigSource, s conversion.Scope) error { + return autoConvert_v1_NodeConfigSource_To_core_NodeConfigSource(in, out, s) +} + +func autoConvert_core_NodeConfigSource_To_v1_NodeConfigSource(in *core.NodeConfigSource, out *v1.NodeConfigSource, s conversion.Scope) error { + out.ConfigMapRef = (*v1.ObjectReference)(unsafe.Pointer(in.ConfigMapRef)) + return nil +} + +// Convert_core_NodeConfigSource_To_v1_NodeConfigSource is an autogenerated conversion function. +func Convert_core_NodeConfigSource_To_v1_NodeConfigSource(in *core.NodeConfigSource, out *v1.NodeConfigSource, s conversion.Scope) error { + return autoConvert_core_NodeConfigSource_To_v1_NodeConfigSource(in, out, s) +} + +func autoConvert_v1_NodeDaemonEndpoints_To_core_NodeDaemonEndpoints(in *v1.NodeDaemonEndpoints, out *core.NodeDaemonEndpoints, s conversion.Scope) error { + if err := Convert_v1_DaemonEndpoint_To_core_DaemonEndpoint(&in.KubeletEndpoint, &out.KubeletEndpoint, s); err != nil { + return err + } + return nil +} + +// Convert_v1_NodeDaemonEndpoints_To_core_NodeDaemonEndpoints is an autogenerated conversion function. +func Convert_v1_NodeDaemonEndpoints_To_core_NodeDaemonEndpoints(in *v1.NodeDaemonEndpoints, out *core.NodeDaemonEndpoints, s conversion.Scope) error { + return autoConvert_v1_NodeDaemonEndpoints_To_core_NodeDaemonEndpoints(in, out, s) +} + +func autoConvert_core_NodeDaemonEndpoints_To_v1_NodeDaemonEndpoints(in *core.NodeDaemonEndpoints, out *v1.NodeDaemonEndpoints, s conversion.Scope) error { + if err := Convert_core_DaemonEndpoint_To_v1_DaemonEndpoint(&in.KubeletEndpoint, &out.KubeletEndpoint, s); err != nil { + return err + } + return nil +} + +// Convert_core_NodeDaemonEndpoints_To_v1_NodeDaemonEndpoints is an autogenerated conversion function. +func Convert_core_NodeDaemonEndpoints_To_v1_NodeDaemonEndpoints(in *core.NodeDaemonEndpoints, out *v1.NodeDaemonEndpoints, s conversion.Scope) error { + return autoConvert_core_NodeDaemonEndpoints_To_v1_NodeDaemonEndpoints(in, out, s) +} + +func autoConvert_v1_NodeList_To_core_NodeList(in *v1.NodeList, out *core.NodeList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.Node)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_NodeList_To_core_NodeList is an autogenerated conversion function. +func Convert_v1_NodeList_To_core_NodeList(in *v1.NodeList, out *core.NodeList, s conversion.Scope) error { + return autoConvert_v1_NodeList_To_core_NodeList(in, out, s) +} + +func autoConvert_core_NodeList_To_v1_NodeList(in *core.NodeList, out *v1.NodeList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.Node)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_NodeList_To_v1_NodeList is an autogenerated conversion function. +func Convert_core_NodeList_To_v1_NodeList(in *core.NodeList, out *v1.NodeList, s conversion.Scope) error { + return autoConvert_core_NodeList_To_v1_NodeList(in, out, s) +} + +func autoConvert_v1_NodeProxyOptions_To_core_NodeProxyOptions(in *v1.NodeProxyOptions, out *core.NodeProxyOptions, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_v1_NodeProxyOptions_To_core_NodeProxyOptions is an autogenerated conversion function. +func Convert_v1_NodeProxyOptions_To_core_NodeProxyOptions(in *v1.NodeProxyOptions, out *core.NodeProxyOptions, s conversion.Scope) error { + return autoConvert_v1_NodeProxyOptions_To_core_NodeProxyOptions(in, out, s) +} + +func autoConvert_core_NodeProxyOptions_To_v1_NodeProxyOptions(in *core.NodeProxyOptions, out *v1.NodeProxyOptions, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_core_NodeProxyOptions_To_v1_NodeProxyOptions is an autogenerated conversion function. +func Convert_core_NodeProxyOptions_To_v1_NodeProxyOptions(in *core.NodeProxyOptions, out *v1.NodeProxyOptions, s conversion.Scope) error { + return autoConvert_core_NodeProxyOptions_To_v1_NodeProxyOptions(in, out, s) +} + +func autoConvert_v1_NodeResources_To_core_NodeResources(in *v1.NodeResources, out *core.NodeResources, s conversion.Scope) error { + out.Capacity = *(*core.ResourceList)(unsafe.Pointer(&in.Capacity)) + return nil +} + +// Convert_v1_NodeResources_To_core_NodeResources is an autogenerated conversion function. +func Convert_v1_NodeResources_To_core_NodeResources(in *v1.NodeResources, out *core.NodeResources, s conversion.Scope) error { + return autoConvert_v1_NodeResources_To_core_NodeResources(in, out, s) +} + +func autoConvert_core_NodeResources_To_v1_NodeResources(in *core.NodeResources, out *v1.NodeResources, s conversion.Scope) error { + out.Capacity = *(*v1.ResourceList)(unsafe.Pointer(&in.Capacity)) + return nil +} + +// Convert_core_NodeResources_To_v1_NodeResources is an autogenerated conversion function. +func Convert_core_NodeResources_To_v1_NodeResources(in *core.NodeResources, out *v1.NodeResources, s conversion.Scope) error { + return autoConvert_core_NodeResources_To_v1_NodeResources(in, out, s) +} + +func autoConvert_v1_NodeSelector_To_core_NodeSelector(in *v1.NodeSelector, out *core.NodeSelector, s conversion.Scope) error { + out.NodeSelectorTerms = *(*[]core.NodeSelectorTerm)(unsafe.Pointer(&in.NodeSelectorTerms)) + return nil +} + +// Convert_v1_NodeSelector_To_core_NodeSelector is an autogenerated conversion function. +func Convert_v1_NodeSelector_To_core_NodeSelector(in *v1.NodeSelector, out *core.NodeSelector, s conversion.Scope) error { + return autoConvert_v1_NodeSelector_To_core_NodeSelector(in, out, s) +} + +func autoConvert_core_NodeSelector_To_v1_NodeSelector(in *core.NodeSelector, out *v1.NodeSelector, s conversion.Scope) error { + out.NodeSelectorTerms = *(*[]v1.NodeSelectorTerm)(unsafe.Pointer(&in.NodeSelectorTerms)) + return nil +} + +// Convert_core_NodeSelector_To_v1_NodeSelector is an autogenerated conversion function. +func Convert_core_NodeSelector_To_v1_NodeSelector(in *core.NodeSelector, out *v1.NodeSelector, s conversion.Scope) error { + return autoConvert_core_NodeSelector_To_v1_NodeSelector(in, out, s) +} + +func autoConvert_v1_NodeSelectorRequirement_To_core_NodeSelectorRequirement(in *v1.NodeSelectorRequirement, out *core.NodeSelectorRequirement, s conversion.Scope) error { + out.Key = in.Key + out.Operator = core.NodeSelectorOperator(in.Operator) + out.Values = *(*[]string)(unsafe.Pointer(&in.Values)) + return nil +} + +// Convert_v1_NodeSelectorRequirement_To_core_NodeSelectorRequirement is an autogenerated conversion function. +func Convert_v1_NodeSelectorRequirement_To_core_NodeSelectorRequirement(in *v1.NodeSelectorRequirement, out *core.NodeSelectorRequirement, s conversion.Scope) error { + return autoConvert_v1_NodeSelectorRequirement_To_core_NodeSelectorRequirement(in, out, s) +} + +func autoConvert_core_NodeSelectorRequirement_To_v1_NodeSelectorRequirement(in *core.NodeSelectorRequirement, out *v1.NodeSelectorRequirement, s conversion.Scope) error { + out.Key = in.Key + out.Operator = v1.NodeSelectorOperator(in.Operator) + out.Values = *(*[]string)(unsafe.Pointer(&in.Values)) + return nil +} + +// Convert_core_NodeSelectorRequirement_To_v1_NodeSelectorRequirement is an autogenerated conversion function. +func Convert_core_NodeSelectorRequirement_To_v1_NodeSelectorRequirement(in *core.NodeSelectorRequirement, out *v1.NodeSelectorRequirement, s conversion.Scope) error { + return autoConvert_core_NodeSelectorRequirement_To_v1_NodeSelectorRequirement(in, out, s) +} + +func autoConvert_v1_NodeSelectorTerm_To_core_NodeSelectorTerm(in *v1.NodeSelectorTerm, out *core.NodeSelectorTerm, s conversion.Scope) error { + out.MatchExpressions = *(*[]core.NodeSelectorRequirement)(unsafe.Pointer(&in.MatchExpressions)) + return nil +} + +// Convert_v1_NodeSelectorTerm_To_core_NodeSelectorTerm is an autogenerated conversion function. +func Convert_v1_NodeSelectorTerm_To_core_NodeSelectorTerm(in *v1.NodeSelectorTerm, out *core.NodeSelectorTerm, s conversion.Scope) error { + return autoConvert_v1_NodeSelectorTerm_To_core_NodeSelectorTerm(in, out, s) +} + +func autoConvert_core_NodeSelectorTerm_To_v1_NodeSelectorTerm(in *core.NodeSelectorTerm, out *v1.NodeSelectorTerm, s conversion.Scope) error { + out.MatchExpressions = *(*[]v1.NodeSelectorRequirement)(unsafe.Pointer(&in.MatchExpressions)) + return nil +} + +// Convert_core_NodeSelectorTerm_To_v1_NodeSelectorTerm is an autogenerated conversion function. +func Convert_core_NodeSelectorTerm_To_v1_NodeSelectorTerm(in *core.NodeSelectorTerm, out *v1.NodeSelectorTerm, s conversion.Scope) error { + return autoConvert_core_NodeSelectorTerm_To_v1_NodeSelectorTerm(in, out, s) +} + +func autoConvert_v1_NodeSpec_To_core_NodeSpec(in *v1.NodeSpec, out *core.NodeSpec, s conversion.Scope) error { + out.PodCIDR = in.PodCIDR + out.ExternalID = in.ExternalID + out.ProviderID = in.ProviderID + out.Unschedulable = in.Unschedulable + out.Taints = *(*[]core.Taint)(unsafe.Pointer(&in.Taints)) + out.ConfigSource = (*core.NodeConfigSource)(unsafe.Pointer(in.ConfigSource)) + return nil +} + +// Convert_v1_NodeSpec_To_core_NodeSpec is an autogenerated conversion function. +func Convert_v1_NodeSpec_To_core_NodeSpec(in *v1.NodeSpec, out *core.NodeSpec, s conversion.Scope) error { + return autoConvert_v1_NodeSpec_To_core_NodeSpec(in, out, s) +} + +func autoConvert_core_NodeSpec_To_v1_NodeSpec(in *core.NodeSpec, out *v1.NodeSpec, s conversion.Scope) error { + out.PodCIDR = in.PodCIDR + out.ExternalID = in.ExternalID + out.ProviderID = in.ProviderID + out.Unschedulable = in.Unschedulable + out.Taints = *(*[]v1.Taint)(unsafe.Pointer(&in.Taints)) + out.ConfigSource = (*v1.NodeConfigSource)(unsafe.Pointer(in.ConfigSource)) + return nil +} + +// Convert_core_NodeSpec_To_v1_NodeSpec is an autogenerated conversion function. +func Convert_core_NodeSpec_To_v1_NodeSpec(in *core.NodeSpec, out *v1.NodeSpec, s conversion.Scope) error { + return autoConvert_core_NodeSpec_To_v1_NodeSpec(in, out, s) +} + +func autoConvert_v1_NodeStatus_To_core_NodeStatus(in *v1.NodeStatus, out *core.NodeStatus, s conversion.Scope) error { + out.Capacity = *(*core.ResourceList)(unsafe.Pointer(&in.Capacity)) + out.Allocatable = *(*core.ResourceList)(unsafe.Pointer(&in.Allocatable)) + out.Phase = core.NodePhase(in.Phase) + out.Conditions = *(*[]core.NodeCondition)(unsafe.Pointer(&in.Conditions)) + out.Addresses = *(*[]core.NodeAddress)(unsafe.Pointer(&in.Addresses)) + if err := Convert_v1_NodeDaemonEndpoints_To_core_NodeDaemonEndpoints(&in.DaemonEndpoints, &out.DaemonEndpoints, s); err != nil { + return err + } + if err := Convert_v1_NodeSystemInfo_To_core_NodeSystemInfo(&in.NodeInfo, &out.NodeInfo, s); err != nil { + return err + } + out.Images = *(*[]core.ContainerImage)(unsafe.Pointer(&in.Images)) + out.VolumesInUse = *(*[]core.UniqueVolumeName)(unsafe.Pointer(&in.VolumesInUse)) + out.VolumesAttached = *(*[]core.AttachedVolume)(unsafe.Pointer(&in.VolumesAttached)) + return nil +} + +// Convert_v1_NodeStatus_To_core_NodeStatus is an autogenerated conversion function. +func Convert_v1_NodeStatus_To_core_NodeStatus(in *v1.NodeStatus, out *core.NodeStatus, s conversion.Scope) error { + return autoConvert_v1_NodeStatus_To_core_NodeStatus(in, out, s) +} + +func autoConvert_core_NodeStatus_To_v1_NodeStatus(in *core.NodeStatus, out *v1.NodeStatus, s conversion.Scope) error { + out.Capacity = *(*v1.ResourceList)(unsafe.Pointer(&in.Capacity)) + out.Allocatable = *(*v1.ResourceList)(unsafe.Pointer(&in.Allocatable)) + out.Phase = v1.NodePhase(in.Phase) + out.Conditions = *(*[]v1.NodeCondition)(unsafe.Pointer(&in.Conditions)) + out.Addresses = *(*[]v1.NodeAddress)(unsafe.Pointer(&in.Addresses)) + if err := Convert_core_NodeDaemonEndpoints_To_v1_NodeDaemonEndpoints(&in.DaemonEndpoints, &out.DaemonEndpoints, s); err != nil { + return err + } + if err := Convert_core_NodeSystemInfo_To_v1_NodeSystemInfo(&in.NodeInfo, &out.NodeInfo, s); err != nil { + return err + } + out.Images = *(*[]v1.ContainerImage)(unsafe.Pointer(&in.Images)) + out.VolumesInUse = *(*[]v1.UniqueVolumeName)(unsafe.Pointer(&in.VolumesInUse)) + out.VolumesAttached = *(*[]v1.AttachedVolume)(unsafe.Pointer(&in.VolumesAttached)) + return nil +} + +// Convert_core_NodeStatus_To_v1_NodeStatus is an autogenerated conversion function. +func Convert_core_NodeStatus_To_v1_NodeStatus(in *core.NodeStatus, out *v1.NodeStatus, s conversion.Scope) error { + return autoConvert_core_NodeStatus_To_v1_NodeStatus(in, out, s) +} + +func autoConvert_v1_NodeSystemInfo_To_core_NodeSystemInfo(in *v1.NodeSystemInfo, out *core.NodeSystemInfo, s conversion.Scope) error { + out.MachineID = in.MachineID + out.SystemUUID = in.SystemUUID + out.BootID = in.BootID + out.KernelVersion = in.KernelVersion + out.OSImage = in.OSImage + out.ContainerRuntimeVersion = in.ContainerRuntimeVersion + out.KubeletVersion = in.KubeletVersion + out.KubeProxyVersion = in.KubeProxyVersion + out.OperatingSystem = in.OperatingSystem + out.Architecture = in.Architecture + return nil +} + +// Convert_v1_NodeSystemInfo_To_core_NodeSystemInfo is an autogenerated conversion function. +func Convert_v1_NodeSystemInfo_To_core_NodeSystemInfo(in *v1.NodeSystemInfo, out *core.NodeSystemInfo, s conversion.Scope) error { + return autoConvert_v1_NodeSystemInfo_To_core_NodeSystemInfo(in, out, s) +} + +func autoConvert_core_NodeSystemInfo_To_v1_NodeSystemInfo(in *core.NodeSystemInfo, out *v1.NodeSystemInfo, s conversion.Scope) error { + out.MachineID = in.MachineID + out.SystemUUID = in.SystemUUID + out.BootID = in.BootID + out.KernelVersion = in.KernelVersion + out.OSImage = in.OSImage + out.ContainerRuntimeVersion = in.ContainerRuntimeVersion + out.KubeletVersion = in.KubeletVersion + out.KubeProxyVersion = in.KubeProxyVersion + out.OperatingSystem = in.OperatingSystem + out.Architecture = in.Architecture + return nil +} + +// Convert_core_NodeSystemInfo_To_v1_NodeSystemInfo is an autogenerated conversion function. +func Convert_core_NodeSystemInfo_To_v1_NodeSystemInfo(in *core.NodeSystemInfo, out *v1.NodeSystemInfo, s conversion.Scope) error { + return autoConvert_core_NodeSystemInfo_To_v1_NodeSystemInfo(in, out, s) +} + +func autoConvert_v1_ObjectFieldSelector_To_core_ObjectFieldSelector(in *v1.ObjectFieldSelector, out *core.ObjectFieldSelector, s conversion.Scope) error { + out.APIVersion = in.APIVersion + out.FieldPath = in.FieldPath + return nil +} + +// Convert_v1_ObjectFieldSelector_To_core_ObjectFieldSelector is an autogenerated conversion function. +func Convert_v1_ObjectFieldSelector_To_core_ObjectFieldSelector(in *v1.ObjectFieldSelector, out *core.ObjectFieldSelector, s conversion.Scope) error { + return autoConvert_v1_ObjectFieldSelector_To_core_ObjectFieldSelector(in, out, s) +} + +func autoConvert_core_ObjectFieldSelector_To_v1_ObjectFieldSelector(in *core.ObjectFieldSelector, out *v1.ObjectFieldSelector, s conversion.Scope) error { + out.APIVersion = in.APIVersion + out.FieldPath = in.FieldPath + return nil +} + +// Convert_core_ObjectFieldSelector_To_v1_ObjectFieldSelector is an autogenerated conversion function. +func Convert_core_ObjectFieldSelector_To_v1_ObjectFieldSelector(in *core.ObjectFieldSelector, out *v1.ObjectFieldSelector, s conversion.Scope) error { + return autoConvert_core_ObjectFieldSelector_To_v1_ObjectFieldSelector(in, out, s) +} + +func autoConvert_v1_ObjectMeta_To_core_ObjectMeta(in *v1.ObjectMeta, out *core.ObjectMeta, s conversion.Scope) error { + out.Name = in.Name + out.GenerateName = in.GenerateName + out.Namespace = in.Namespace + out.SelfLink = in.SelfLink + out.UID = types.UID(in.UID) + out.ResourceVersion = in.ResourceVersion + out.Generation = in.Generation + out.CreationTimestamp = in.CreationTimestamp + out.DeletionTimestamp = (*meta_v1.Time)(unsafe.Pointer(in.DeletionTimestamp)) + out.DeletionGracePeriodSeconds = (*int64)(unsafe.Pointer(in.DeletionGracePeriodSeconds)) + out.Labels = *(*map[string]string)(unsafe.Pointer(&in.Labels)) + out.Annotations = *(*map[string]string)(unsafe.Pointer(&in.Annotations)) + out.OwnerReferences = *(*[]meta_v1.OwnerReference)(unsafe.Pointer(&in.OwnerReferences)) + out.Initializers = (*meta_v1.Initializers)(unsafe.Pointer(in.Initializers)) + out.Finalizers = *(*[]string)(unsafe.Pointer(&in.Finalizers)) + out.ClusterName = in.ClusterName + return nil +} + +// Convert_v1_ObjectMeta_To_core_ObjectMeta is an autogenerated conversion function. +func Convert_v1_ObjectMeta_To_core_ObjectMeta(in *v1.ObjectMeta, out *core.ObjectMeta, s conversion.Scope) error { + return autoConvert_v1_ObjectMeta_To_core_ObjectMeta(in, out, s) +} + +func autoConvert_core_ObjectMeta_To_v1_ObjectMeta(in *core.ObjectMeta, out *v1.ObjectMeta, s conversion.Scope) error { + out.Name = in.Name + out.GenerateName = in.GenerateName + out.Namespace = in.Namespace + out.SelfLink = in.SelfLink + out.UID = types.UID(in.UID) + out.ResourceVersion = in.ResourceVersion + out.Generation = in.Generation + out.CreationTimestamp = in.CreationTimestamp + out.DeletionTimestamp = (*meta_v1.Time)(unsafe.Pointer(in.DeletionTimestamp)) + out.DeletionGracePeriodSeconds = (*int64)(unsafe.Pointer(in.DeletionGracePeriodSeconds)) + out.Labels = *(*map[string]string)(unsafe.Pointer(&in.Labels)) + out.Annotations = *(*map[string]string)(unsafe.Pointer(&in.Annotations)) + out.OwnerReferences = *(*[]meta_v1.OwnerReference)(unsafe.Pointer(&in.OwnerReferences)) + out.Initializers = (*meta_v1.Initializers)(unsafe.Pointer(in.Initializers)) + out.Finalizers = *(*[]string)(unsafe.Pointer(&in.Finalizers)) + out.ClusterName = in.ClusterName + return nil +} + +// Convert_core_ObjectMeta_To_v1_ObjectMeta is an autogenerated conversion function. +func Convert_core_ObjectMeta_To_v1_ObjectMeta(in *core.ObjectMeta, out *v1.ObjectMeta, s conversion.Scope) error { + return autoConvert_core_ObjectMeta_To_v1_ObjectMeta(in, out, s) +} + +func autoConvert_v1_ObjectReference_To_core_ObjectReference(in *v1.ObjectReference, out *core.ObjectReference, s conversion.Scope) error { + out.Kind = in.Kind + out.Namespace = in.Namespace + out.Name = in.Name + out.UID = types.UID(in.UID) + out.APIVersion = in.APIVersion + out.ResourceVersion = in.ResourceVersion + out.FieldPath = in.FieldPath + return nil +} + +// Convert_v1_ObjectReference_To_core_ObjectReference is an autogenerated conversion function. +func Convert_v1_ObjectReference_To_core_ObjectReference(in *v1.ObjectReference, out *core.ObjectReference, s conversion.Scope) error { + return autoConvert_v1_ObjectReference_To_core_ObjectReference(in, out, s) +} + +func autoConvert_core_ObjectReference_To_v1_ObjectReference(in *core.ObjectReference, out *v1.ObjectReference, s conversion.Scope) error { + out.Kind = in.Kind + out.Namespace = in.Namespace + out.Name = in.Name + out.UID = types.UID(in.UID) + out.APIVersion = in.APIVersion + out.ResourceVersion = in.ResourceVersion + out.FieldPath = in.FieldPath + return nil +} + +// Convert_core_ObjectReference_To_v1_ObjectReference is an autogenerated conversion function. +func Convert_core_ObjectReference_To_v1_ObjectReference(in *core.ObjectReference, out *v1.ObjectReference, s conversion.Scope) error { + return autoConvert_core_ObjectReference_To_v1_ObjectReference(in, out, s) +} + +func autoConvert_v1_PersistentVolume_To_core_PersistentVolume(in *v1.PersistentVolume, out *core.PersistentVolume, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_PersistentVolumeSpec_To_core_PersistentVolumeSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_PersistentVolumeStatus_To_core_PersistentVolumeStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_PersistentVolume_To_core_PersistentVolume is an autogenerated conversion function. +func Convert_v1_PersistentVolume_To_core_PersistentVolume(in *v1.PersistentVolume, out *core.PersistentVolume, s conversion.Scope) error { + return autoConvert_v1_PersistentVolume_To_core_PersistentVolume(in, out, s) +} + +func autoConvert_core_PersistentVolume_To_v1_PersistentVolume(in *core.PersistentVolume, out *v1.PersistentVolume, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_PersistentVolumeSpec_To_v1_PersistentVolumeSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_PersistentVolumeStatus_To_v1_PersistentVolumeStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_PersistentVolume_To_v1_PersistentVolume is an autogenerated conversion function. +func Convert_core_PersistentVolume_To_v1_PersistentVolume(in *core.PersistentVolume, out *v1.PersistentVolume, s conversion.Scope) error { + return autoConvert_core_PersistentVolume_To_v1_PersistentVolume(in, out, s) +} + +func autoConvert_v1_PersistentVolumeClaim_To_core_PersistentVolumeClaim(in *v1.PersistentVolumeClaim, out *core.PersistentVolumeClaim, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_PersistentVolumeClaimSpec_To_core_PersistentVolumeClaimSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_PersistentVolumeClaimStatus_To_core_PersistentVolumeClaimStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_PersistentVolumeClaim_To_core_PersistentVolumeClaim is an autogenerated conversion function. +func Convert_v1_PersistentVolumeClaim_To_core_PersistentVolumeClaim(in *v1.PersistentVolumeClaim, out *core.PersistentVolumeClaim, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeClaim_To_core_PersistentVolumeClaim(in, out, s) +} + +func autoConvert_core_PersistentVolumeClaim_To_v1_PersistentVolumeClaim(in *core.PersistentVolumeClaim, out *v1.PersistentVolumeClaim, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_PersistentVolumeClaimSpec_To_v1_PersistentVolumeClaimSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_PersistentVolumeClaimStatus_To_v1_PersistentVolumeClaimStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_PersistentVolumeClaim_To_v1_PersistentVolumeClaim is an autogenerated conversion function. +func Convert_core_PersistentVolumeClaim_To_v1_PersistentVolumeClaim(in *core.PersistentVolumeClaim, out *v1.PersistentVolumeClaim, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeClaim_To_v1_PersistentVolumeClaim(in, out, s) +} + +func autoConvert_v1_PersistentVolumeClaimCondition_To_core_PersistentVolumeClaimCondition(in *v1.PersistentVolumeClaimCondition, out *core.PersistentVolumeClaimCondition, s conversion.Scope) error { + out.Type = core.PersistentVolumeClaimConditionType(in.Type) + out.Status = core.ConditionStatus(in.Status) + out.LastProbeTime = in.LastProbeTime + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_v1_PersistentVolumeClaimCondition_To_core_PersistentVolumeClaimCondition is an autogenerated conversion function. +func Convert_v1_PersistentVolumeClaimCondition_To_core_PersistentVolumeClaimCondition(in *v1.PersistentVolumeClaimCondition, out *core.PersistentVolumeClaimCondition, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeClaimCondition_To_core_PersistentVolumeClaimCondition(in, out, s) +} + +func autoConvert_core_PersistentVolumeClaimCondition_To_v1_PersistentVolumeClaimCondition(in *core.PersistentVolumeClaimCondition, out *v1.PersistentVolumeClaimCondition, s conversion.Scope) error { + out.Type = v1.PersistentVolumeClaimConditionType(in.Type) + out.Status = v1.ConditionStatus(in.Status) + out.LastProbeTime = in.LastProbeTime + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_core_PersistentVolumeClaimCondition_To_v1_PersistentVolumeClaimCondition is an autogenerated conversion function. +func Convert_core_PersistentVolumeClaimCondition_To_v1_PersistentVolumeClaimCondition(in *core.PersistentVolumeClaimCondition, out *v1.PersistentVolumeClaimCondition, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeClaimCondition_To_v1_PersistentVolumeClaimCondition(in, out, s) +} + +func autoConvert_v1_PersistentVolumeClaimList_To_core_PersistentVolumeClaimList(in *v1.PersistentVolumeClaimList, out *core.PersistentVolumeClaimList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.PersistentVolumeClaim)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_PersistentVolumeClaimList_To_core_PersistentVolumeClaimList is an autogenerated conversion function. +func Convert_v1_PersistentVolumeClaimList_To_core_PersistentVolumeClaimList(in *v1.PersistentVolumeClaimList, out *core.PersistentVolumeClaimList, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeClaimList_To_core_PersistentVolumeClaimList(in, out, s) +} + +func autoConvert_core_PersistentVolumeClaimList_To_v1_PersistentVolumeClaimList(in *core.PersistentVolumeClaimList, out *v1.PersistentVolumeClaimList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.PersistentVolumeClaim)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_PersistentVolumeClaimList_To_v1_PersistentVolumeClaimList is an autogenerated conversion function. +func Convert_core_PersistentVolumeClaimList_To_v1_PersistentVolumeClaimList(in *core.PersistentVolumeClaimList, out *v1.PersistentVolumeClaimList, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeClaimList_To_v1_PersistentVolumeClaimList(in, out, s) +} + +func autoConvert_v1_PersistentVolumeClaimSpec_To_core_PersistentVolumeClaimSpec(in *v1.PersistentVolumeClaimSpec, out *core.PersistentVolumeClaimSpec, s conversion.Scope) error { + out.AccessModes = *(*[]core.PersistentVolumeAccessMode)(unsafe.Pointer(&in.AccessModes)) + out.Selector = (*meta_v1.LabelSelector)(unsafe.Pointer(in.Selector)) + if err := Convert_v1_ResourceRequirements_To_core_ResourceRequirements(&in.Resources, &out.Resources, s); err != nil { + return err + } + out.VolumeName = in.VolumeName + out.StorageClassName = (*string)(unsafe.Pointer(in.StorageClassName)) + out.VolumeMode = (*core.PersistentVolumeMode)(unsafe.Pointer(in.VolumeMode)) + return nil +} + +// Convert_v1_PersistentVolumeClaimSpec_To_core_PersistentVolumeClaimSpec is an autogenerated conversion function. +func Convert_v1_PersistentVolumeClaimSpec_To_core_PersistentVolumeClaimSpec(in *v1.PersistentVolumeClaimSpec, out *core.PersistentVolumeClaimSpec, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeClaimSpec_To_core_PersistentVolumeClaimSpec(in, out, s) +} + +func autoConvert_core_PersistentVolumeClaimSpec_To_v1_PersistentVolumeClaimSpec(in *core.PersistentVolumeClaimSpec, out *v1.PersistentVolumeClaimSpec, s conversion.Scope) error { + out.AccessModes = *(*[]v1.PersistentVolumeAccessMode)(unsafe.Pointer(&in.AccessModes)) + out.Selector = (*meta_v1.LabelSelector)(unsafe.Pointer(in.Selector)) + if err := Convert_core_ResourceRequirements_To_v1_ResourceRequirements(&in.Resources, &out.Resources, s); err != nil { + return err + } + out.VolumeName = in.VolumeName + out.StorageClassName = (*string)(unsafe.Pointer(in.StorageClassName)) + out.VolumeMode = (*v1.PersistentVolumeMode)(unsafe.Pointer(in.VolumeMode)) + return nil +} + +// Convert_core_PersistentVolumeClaimSpec_To_v1_PersistentVolumeClaimSpec is an autogenerated conversion function. +func Convert_core_PersistentVolumeClaimSpec_To_v1_PersistentVolumeClaimSpec(in *core.PersistentVolumeClaimSpec, out *v1.PersistentVolumeClaimSpec, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeClaimSpec_To_v1_PersistentVolumeClaimSpec(in, out, s) +} + +func autoConvert_v1_PersistentVolumeClaimStatus_To_core_PersistentVolumeClaimStatus(in *v1.PersistentVolumeClaimStatus, out *core.PersistentVolumeClaimStatus, s conversion.Scope) error { + out.Phase = core.PersistentVolumeClaimPhase(in.Phase) + out.AccessModes = *(*[]core.PersistentVolumeAccessMode)(unsafe.Pointer(&in.AccessModes)) + out.Capacity = *(*core.ResourceList)(unsafe.Pointer(&in.Capacity)) + out.Conditions = *(*[]core.PersistentVolumeClaimCondition)(unsafe.Pointer(&in.Conditions)) + return nil +} + +// Convert_v1_PersistentVolumeClaimStatus_To_core_PersistentVolumeClaimStatus is an autogenerated conversion function. +func Convert_v1_PersistentVolumeClaimStatus_To_core_PersistentVolumeClaimStatus(in *v1.PersistentVolumeClaimStatus, out *core.PersistentVolumeClaimStatus, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeClaimStatus_To_core_PersistentVolumeClaimStatus(in, out, s) +} + +func autoConvert_core_PersistentVolumeClaimStatus_To_v1_PersistentVolumeClaimStatus(in *core.PersistentVolumeClaimStatus, out *v1.PersistentVolumeClaimStatus, s conversion.Scope) error { + out.Phase = v1.PersistentVolumeClaimPhase(in.Phase) + out.AccessModes = *(*[]v1.PersistentVolumeAccessMode)(unsafe.Pointer(&in.AccessModes)) + out.Capacity = *(*v1.ResourceList)(unsafe.Pointer(&in.Capacity)) + out.Conditions = *(*[]v1.PersistentVolumeClaimCondition)(unsafe.Pointer(&in.Conditions)) + return nil +} + +// Convert_core_PersistentVolumeClaimStatus_To_v1_PersistentVolumeClaimStatus is an autogenerated conversion function. +func Convert_core_PersistentVolumeClaimStatus_To_v1_PersistentVolumeClaimStatus(in *core.PersistentVolumeClaimStatus, out *v1.PersistentVolumeClaimStatus, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeClaimStatus_To_v1_PersistentVolumeClaimStatus(in, out, s) +} + +func autoConvert_v1_PersistentVolumeClaimVolumeSource_To_core_PersistentVolumeClaimVolumeSource(in *v1.PersistentVolumeClaimVolumeSource, out *core.PersistentVolumeClaimVolumeSource, s conversion.Scope) error { + out.ClaimName = in.ClaimName + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_PersistentVolumeClaimVolumeSource_To_core_PersistentVolumeClaimVolumeSource is an autogenerated conversion function. +func Convert_v1_PersistentVolumeClaimVolumeSource_To_core_PersistentVolumeClaimVolumeSource(in *v1.PersistentVolumeClaimVolumeSource, out *core.PersistentVolumeClaimVolumeSource, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeClaimVolumeSource_To_core_PersistentVolumeClaimVolumeSource(in, out, s) +} + +func autoConvert_core_PersistentVolumeClaimVolumeSource_To_v1_PersistentVolumeClaimVolumeSource(in *core.PersistentVolumeClaimVolumeSource, out *v1.PersistentVolumeClaimVolumeSource, s conversion.Scope) error { + out.ClaimName = in.ClaimName + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_PersistentVolumeClaimVolumeSource_To_v1_PersistentVolumeClaimVolumeSource is an autogenerated conversion function. +func Convert_core_PersistentVolumeClaimVolumeSource_To_v1_PersistentVolumeClaimVolumeSource(in *core.PersistentVolumeClaimVolumeSource, out *v1.PersistentVolumeClaimVolumeSource, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeClaimVolumeSource_To_v1_PersistentVolumeClaimVolumeSource(in, out, s) +} + +func autoConvert_v1_PersistentVolumeList_To_core_PersistentVolumeList(in *v1.PersistentVolumeList, out *core.PersistentVolumeList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]core.PersistentVolume, len(*in)) + for i := range *in { + if err := Convert_v1_PersistentVolume_To_core_PersistentVolume(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_PersistentVolumeList_To_core_PersistentVolumeList is an autogenerated conversion function. +func Convert_v1_PersistentVolumeList_To_core_PersistentVolumeList(in *v1.PersistentVolumeList, out *core.PersistentVolumeList, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeList_To_core_PersistentVolumeList(in, out, s) +} + +func autoConvert_core_PersistentVolumeList_To_v1_PersistentVolumeList(in *core.PersistentVolumeList, out *v1.PersistentVolumeList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]v1.PersistentVolume, len(*in)) + for i := range *in { + if err := Convert_core_PersistentVolume_To_v1_PersistentVolume(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_PersistentVolumeList_To_v1_PersistentVolumeList is an autogenerated conversion function. +func Convert_core_PersistentVolumeList_To_v1_PersistentVolumeList(in *core.PersistentVolumeList, out *v1.PersistentVolumeList, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeList_To_v1_PersistentVolumeList(in, out, s) +} + +func autoConvert_v1_PersistentVolumeSource_To_core_PersistentVolumeSource(in *v1.PersistentVolumeSource, out *core.PersistentVolumeSource, s conversion.Scope) error { + out.GCEPersistentDisk = (*core.GCEPersistentDiskVolumeSource)(unsafe.Pointer(in.GCEPersistentDisk)) + out.AWSElasticBlockStore = (*core.AWSElasticBlockStoreVolumeSource)(unsafe.Pointer(in.AWSElasticBlockStore)) + out.HostPath = (*core.HostPathVolumeSource)(unsafe.Pointer(in.HostPath)) + out.Glusterfs = (*core.GlusterfsVolumeSource)(unsafe.Pointer(in.Glusterfs)) + out.NFS = (*core.NFSVolumeSource)(unsafe.Pointer(in.NFS)) + out.RBD = (*core.RBDPersistentVolumeSource)(unsafe.Pointer(in.RBD)) + out.ISCSI = (*core.ISCSIPersistentVolumeSource)(unsafe.Pointer(in.ISCSI)) + out.Cinder = (*core.CinderVolumeSource)(unsafe.Pointer(in.Cinder)) + out.CephFS = (*core.CephFSPersistentVolumeSource)(unsafe.Pointer(in.CephFS)) + out.FC = (*core.FCVolumeSource)(unsafe.Pointer(in.FC)) + out.Flocker = (*core.FlockerVolumeSource)(unsafe.Pointer(in.Flocker)) + out.FlexVolume = (*core.FlexPersistentVolumeSource)(unsafe.Pointer(in.FlexVolume)) + out.AzureFile = (*core.AzureFilePersistentVolumeSource)(unsafe.Pointer(in.AzureFile)) + out.VsphereVolume = (*core.VsphereVirtualDiskVolumeSource)(unsafe.Pointer(in.VsphereVolume)) + out.Quobyte = (*core.QuobyteVolumeSource)(unsafe.Pointer(in.Quobyte)) + out.AzureDisk = (*core.AzureDiskVolumeSource)(unsafe.Pointer(in.AzureDisk)) + out.PhotonPersistentDisk = (*core.PhotonPersistentDiskVolumeSource)(unsafe.Pointer(in.PhotonPersistentDisk)) + out.PortworxVolume = (*core.PortworxVolumeSource)(unsafe.Pointer(in.PortworxVolume)) + out.ScaleIO = (*core.ScaleIOPersistentVolumeSource)(unsafe.Pointer(in.ScaleIO)) + out.Local = (*core.LocalVolumeSource)(unsafe.Pointer(in.Local)) + out.StorageOS = (*core.StorageOSPersistentVolumeSource)(unsafe.Pointer(in.StorageOS)) + out.CSI = (*core.CSIPersistentVolumeSource)(unsafe.Pointer(in.CSI)) + return nil +} + +// Convert_v1_PersistentVolumeSource_To_core_PersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_PersistentVolumeSource_To_core_PersistentVolumeSource(in *v1.PersistentVolumeSource, out *core.PersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeSource_To_core_PersistentVolumeSource(in, out, s) +} + +func autoConvert_core_PersistentVolumeSource_To_v1_PersistentVolumeSource(in *core.PersistentVolumeSource, out *v1.PersistentVolumeSource, s conversion.Scope) error { + out.GCEPersistentDisk = (*v1.GCEPersistentDiskVolumeSource)(unsafe.Pointer(in.GCEPersistentDisk)) + out.AWSElasticBlockStore = (*v1.AWSElasticBlockStoreVolumeSource)(unsafe.Pointer(in.AWSElasticBlockStore)) + out.HostPath = (*v1.HostPathVolumeSource)(unsafe.Pointer(in.HostPath)) + out.Glusterfs = (*v1.GlusterfsVolumeSource)(unsafe.Pointer(in.Glusterfs)) + out.NFS = (*v1.NFSVolumeSource)(unsafe.Pointer(in.NFS)) + out.RBD = (*v1.RBDPersistentVolumeSource)(unsafe.Pointer(in.RBD)) + out.Quobyte = (*v1.QuobyteVolumeSource)(unsafe.Pointer(in.Quobyte)) + out.ISCSI = (*v1.ISCSIPersistentVolumeSource)(unsafe.Pointer(in.ISCSI)) + out.FlexVolume = (*v1.FlexPersistentVolumeSource)(unsafe.Pointer(in.FlexVolume)) + out.Cinder = (*v1.CinderVolumeSource)(unsafe.Pointer(in.Cinder)) + out.CephFS = (*v1.CephFSPersistentVolumeSource)(unsafe.Pointer(in.CephFS)) + out.FC = (*v1.FCVolumeSource)(unsafe.Pointer(in.FC)) + out.Flocker = (*v1.FlockerVolumeSource)(unsafe.Pointer(in.Flocker)) + out.AzureFile = (*v1.AzureFilePersistentVolumeSource)(unsafe.Pointer(in.AzureFile)) + out.VsphereVolume = (*v1.VsphereVirtualDiskVolumeSource)(unsafe.Pointer(in.VsphereVolume)) + out.AzureDisk = (*v1.AzureDiskVolumeSource)(unsafe.Pointer(in.AzureDisk)) + out.PhotonPersistentDisk = (*v1.PhotonPersistentDiskVolumeSource)(unsafe.Pointer(in.PhotonPersistentDisk)) + out.PortworxVolume = (*v1.PortworxVolumeSource)(unsafe.Pointer(in.PortworxVolume)) + out.ScaleIO = (*v1.ScaleIOPersistentVolumeSource)(unsafe.Pointer(in.ScaleIO)) + out.Local = (*v1.LocalVolumeSource)(unsafe.Pointer(in.Local)) + out.StorageOS = (*v1.StorageOSPersistentVolumeSource)(unsafe.Pointer(in.StorageOS)) + out.CSI = (*v1.CSIPersistentVolumeSource)(unsafe.Pointer(in.CSI)) + return nil +} + +// Convert_core_PersistentVolumeSource_To_v1_PersistentVolumeSource is an autogenerated conversion function. +func Convert_core_PersistentVolumeSource_To_v1_PersistentVolumeSource(in *core.PersistentVolumeSource, out *v1.PersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeSource_To_v1_PersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_PersistentVolumeSpec_To_core_PersistentVolumeSpec(in *v1.PersistentVolumeSpec, out *core.PersistentVolumeSpec, s conversion.Scope) error { + out.Capacity = *(*core.ResourceList)(unsafe.Pointer(&in.Capacity)) + if err := Convert_v1_PersistentVolumeSource_To_core_PersistentVolumeSource(&in.PersistentVolumeSource, &out.PersistentVolumeSource, s); err != nil { + return err + } + out.AccessModes = *(*[]core.PersistentVolumeAccessMode)(unsafe.Pointer(&in.AccessModes)) + out.ClaimRef = (*core.ObjectReference)(unsafe.Pointer(in.ClaimRef)) + out.PersistentVolumeReclaimPolicy = core.PersistentVolumeReclaimPolicy(in.PersistentVolumeReclaimPolicy) + out.StorageClassName = in.StorageClassName + out.MountOptions = *(*[]string)(unsafe.Pointer(&in.MountOptions)) + out.VolumeMode = (*core.PersistentVolumeMode)(unsafe.Pointer(in.VolumeMode)) + out.NodeAffinity = (*core.VolumeNodeAffinity)(unsafe.Pointer(in.NodeAffinity)) + return nil +} + +// Convert_v1_PersistentVolumeSpec_To_core_PersistentVolumeSpec is an autogenerated conversion function. +func Convert_v1_PersistentVolumeSpec_To_core_PersistentVolumeSpec(in *v1.PersistentVolumeSpec, out *core.PersistentVolumeSpec, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeSpec_To_core_PersistentVolumeSpec(in, out, s) +} + +func autoConvert_core_PersistentVolumeSpec_To_v1_PersistentVolumeSpec(in *core.PersistentVolumeSpec, out *v1.PersistentVolumeSpec, s conversion.Scope) error { + out.Capacity = *(*v1.ResourceList)(unsafe.Pointer(&in.Capacity)) + if err := Convert_core_PersistentVolumeSource_To_v1_PersistentVolumeSource(&in.PersistentVolumeSource, &out.PersistentVolumeSource, s); err != nil { + return err + } + out.AccessModes = *(*[]v1.PersistentVolumeAccessMode)(unsafe.Pointer(&in.AccessModes)) + out.ClaimRef = (*v1.ObjectReference)(unsafe.Pointer(in.ClaimRef)) + out.PersistentVolumeReclaimPolicy = v1.PersistentVolumeReclaimPolicy(in.PersistentVolumeReclaimPolicy) + out.StorageClassName = in.StorageClassName + out.MountOptions = *(*[]string)(unsafe.Pointer(&in.MountOptions)) + out.VolumeMode = (*v1.PersistentVolumeMode)(unsafe.Pointer(in.VolumeMode)) + out.NodeAffinity = (*v1.VolumeNodeAffinity)(unsafe.Pointer(in.NodeAffinity)) + return nil +} + +// Convert_core_PersistentVolumeSpec_To_v1_PersistentVolumeSpec is an autogenerated conversion function. +func Convert_core_PersistentVolumeSpec_To_v1_PersistentVolumeSpec(in *core.PersistentVolumeSpec, out *v1.PersistentVolumeSpec, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeSpec_To_v1_PersistentVolumeSpec(in, out, s) +} + +func autoConvert_v1_PersistentVolumeStatus_To_core_PersistentVolumeStatus(in *v1.PersistentVolumeStatus, out *core.PersistentVolumeStatus, s conversion.Scope) error { + out.Phase = core.PersistentVolumePhase(in.Phase) + out.Message = in.Message + out.Reason = in.Reason + return nil +} + +// Convert_v1_PersistentVolumeStatus_To_core_PersistentVolumeStatus is an autogenerated conversion function. +func Convert_v1_PersistentVolumeStatus_To_core_PersistentVolumeStatus(in *v1.PersistentVolumeStatus, out *core.PersistentVolumeStatus, s conversion.Scope) error { + return autoConvert_v1_PersistentVolumeStatus_To_core_PersistentVolumeStatus(in, out, s) +} + +func autoConvert_core_PersistentVolumeStatus_To_v1_PersistentVolumeStatus(in *core.PersistentVolumeStatus, out *v1.PersistentVolumeStatus, s conversion.Scope) error { + out.Phase = v1.PersistentVolumePhase(in.Phase) + out.Message = in.Message + out.Reason = in.Reason + return nil +} + +// Convert_core_PersistentVolumeStatus_To_v1_PersistentVolumeStatus is an autogenerated conversion function. +func Convert_core_PersistentVolumeStatus_To_v1_PersistentVolumeStatus(in *core.PersistentVolumeStatus, out *v1.PersistentVolumeStatus, s conversion.Scope) error { + return autoConvert_core_PersistentVolumeStatus_To_v1_PersistentVolumeStatus(in, out, s) +} + +func autoConvert_v1_PhotonPersistentDiskVolumeSource_To_core_PhotonPersistentDiskVolumeSource(in *v1.PhotonPersistentDiskVolumeSource, out *core.PhotonPersistentDiskVolumeSource, s conversion.Scope) error { + out.PdID = in.PdID + out.FSType = in.FSType + return nil +} + +// Convert_v1_PhotonPersistentDiskVolumeSource_To_core_PhotonPersistentDiskVolumeSource is an autogenerated conversion function. +func Convert_v1_PhotonPersistentDiskVolumeSource_To_core_PhotonPersistentDiskVolumeSource(in *v1.PhotonPersistentDiskVolumeSource, out *core.PhotonPersistentDiskVolumeSource, s conversion.Scope) error { + return autoConvert_v1_PhotonPersistentDiskVolumeSource_To_core_PhotonPersistentDiskVolumeSource(in, out, s) +} + +func autoConvert_core_PhotonPersistentDiskVolumeSource_To_v1_PhotonPersistentDiskVolumeSource(in *core.PhotonPersistentDiskVolumeSource, out *v1.PhotonPersistentDiskVolumeSource, s conversion.Scope) error { + out.PdID = in.PdID + out.FSType = in.FSType + return nil +} + +// Convert_core_PhotonPersistentDiskVolumeSource_To_v1_PhotonPersistentDiskVolumeSource is an autogenerated conversion function. +func Convert_core_PhotonPersistentDiskVolumeSource_To_v1_PhotonPersistentDiskVolumeSource(in *core.PhotonPersistentDiskVolumeSource, out *v1.PhotonPersistentDiskVolumeSource, s conversion.Scope) error { + return autoConvert_core_PhotonPersistentDiskVolumeSource_To_v1_PhotonPersistentDiskVolumeSource(in, out, s) +} + +func autoConvert_v1_Pod_To_core_Pod(in *v1.Pod, out *core.Pod, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_PodSpec_To_core_PodSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_PodStatus_To_core_PodStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +func autoConvert_core_Pod_To_v1_Pod(in *core.Pod, out *v1.Pod, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_PodSpec_To_v1_PodSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_PodStatus_To_v1_PodStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +func autoConvert_v1_PodAffinity_To_core_PodAffinity(in *v1.PodAffinity, out *core.PodAffinity, s conversion.Scope) error { + out.RequiredDuringSchedulingIgnoredDuringExecution = *(*[]core.PodAffinityTerm)(unsafe.Pointer(&in.RequiredDuringSchedulingIgnoredDuringExecution)) + out.PreferredDuringSchedulingIgnoredDuringExecution = *(*[]core.WeightedPodAffinityTerm)(unsafe.Pointer(&in.PreferredDuringSchedulingIgnoredDuringExecution)) + return nil +} + +// Convert_v1_PodAffinity_To_core_PodAffinity is an autogenerated conversion function. +func Convert_v1_PodAffinity_To_core_PodAffinity(in *v1.PodAffinity, out *core.PodAffinity, s conversion.Scope) error { + return autoConvert_v1_PodAffinity_To_core_PodAffinity(in, out, s) +} + +func autoConvert_core_PodAffinity_To_v1_PodAffinity(in *core.PodAffinity, out *v1.PodAffinity, s conversion.Scope) error { + out.RequiredDuringSchedulingIgnoredDuringExecution = *(*[]v1.PodAffinityTerm)(unsafe.Pointer(&in.RequiredDuringSchedulingIgnoredDuringExecution)) + out.PreferredDuringSchedulingIgnoredDuringExecution = *(*[]v1.WeightedPodAffinityTerm)(unsafe.Pointer(&in.PreferredDuringSchedulingIgnoredDuringExecution)) + return nil +} + +// Convert_core_PodAffinity_To_v1_PodAffinity is an autogenerated conversion function. +func Convert_core_PodAffinity_To_v1_PodAffinity(in *core.PodAffinity, out *v1.PodAffinity, s conversion.Scope) error { + return autoConvert_core_PodAffinity_To_v1_PodAffinity(in, out, s) +} + +func autoConvert_v1_PodAffinityTerm_To_core_PodAffinityTerm(in *v1.PodAffinityTerm, out *core.PodAffinityTerm, s conversion.Scope) error { + out.LabelSelector = (*meta_v1.LabelSelector)(unsafe.Pointer(in.LabelSelector)) + out.Namespaces = *(*[]string)(unsafe.Pointer(&in.Namespaces)) + out.TopologyKey = in.TopologyKey + return nil +} + +// Convert_v1_PodAffinityTerm_To_core_PodAffinityTerm is an autogenerated conversion function. +func Convert_v1_PodAffinityTerm_To_core_PodAffinityTerm(in *v1.PodAffinityTerm, out *core.PodAffinityTerm, s conversion.Scope) error { + return autoConvert_v1_PodAffinityTerm_To_core_PodAffinityTerm(in, out, s) +} + +func autoConvert_core_PodAffinityTerm_To_v1_PodAffinityTerm(in *core.PodAffinityTerm, out *v1.PodAffinityTerm, s conversion.Scope) error { + out.LabelSelector = (*meta_v1.LabelSelector)(unsafe.Pointer(in.LabelSelector)) + out.Namespaces = *(*[]string)(unsafe.Pointer(&in.Namespaces)) + out.TopologyKey = in.TopologyKey + return nil +} + +// Convert_core_PodAffinityTerm_To_v1_PodAffinityTerm is an autogenerated conversion function. +func Convert_core_PodAffinityTerm_To_v1_PodAffinityTerm(in *core.PodAffinityTerm, out *v1.PodAffinityTerm, s conversion.Scope) error { + return autoConvert_core_PodAffinityTerm_To_v1_PodAffinityTerm(in, out, s) +} + +func autoConvert_v1_PodAntiAffinity_To_core_PodAntiAffinity(in *v1.PodAntiAffinity, out *core.PodAntiAffinity, s conversion.Scope) error { + out.RequiredDuringSchedulingIgnoredDuringExecution = *(*[]core.PodAffinityTerm)(unsafe.Pointer(&in.RequiredDuringSchedulingIgnoredDuringExecution)) + out.PreferredDuringSchedulingIgnoredDuringExecution = *(*[]core.WeightedPodAffinityTerm)(unsafe.Pointer(&in.PreferredDuringSchedulingIgnoredDuringExecution)) + return nil +} + +// Convert_v1_PodAntiAffinity_To_core_PodAntiAffinity is an autogenerated conversion function. +func Convert_v1_PodAntiAffinity_To_core_PodAntiAffinity(in *v1.PodAntiAffinity, out *core.PodAntiAffinity, s conversion.Scope) error { + return autoConvert_v1_PodAntiAffinity_To_core_PodAntiAffinity(in, out, s) +} + +func autoConvert_core_PodAntiAffinity_To_v1_PodAntiAffinity(in *core.PodAntiAffinity, out *v1.PodAntiAffinity, s conversion.Scope) error { + out.RequiredDuringSchedulingIgnoredDuringExecution = *(*[]v1.PodAffinityTerm)(unsafe.Pointer(&in.RequiredDuringSchedulingIgnoredDuringExecution)) + out.PreferredDuringSchedulingIgnoredDuringExecution = *(*[]v1.WeightedPodAffinityTerm)(unsafe.Pointer(&in.PreferredDuringSchedulingIgnoredDuringExecution)) + return nil +} + +// Convert_core_PodAntiAffinity_To_v1_PodAntiAffinity is an autogenerated conversion function. +func Convert_core_PodAntiAffinity_To_v1_PodAntiAffinity(in *core.PodAntiAffinity, out *v1.PodAntiAffinity, s conversion.Scope) error { + return autoConvert_core_PodAntiAffinity_To_v1_PodAntiAffinity(in, out, s) +} + +func autoConvert_v1_PodAttachOptions_To_core_PodAttachOptions(in *v1.PodAttachOptions, out *core.PodAttachOptions, s conversion.Scope) error { + out.Stdin = in.Stdin + out.Stdout = in.Stdout + out.Stderr = in.Stderr + out.TTY = in.TTY + out.Container = in.Container + return nil +} + +// Convert_v1_PodAttachOptions_To_core_PodAttachOptions is an autogenerated conversion function. +func Convert_v1_PodAttachOptions_To_core_PodAttachOptions(in *v1.PodAttachOptions, out *core.PodAttachOptions, s conversion.Scope) error { + return autoConvert_v1_PodAttachOptions_To_core_PodAttachOptions(in, out, s) +} + +func autoConvert_core_PodAttachOptions_To_v1_PodAttachOptions(in *core.PodAttachOptions, out *v1.PodAttachOptions, s conversion.Scope) error { + out.Stdin = in.Stdin + out.Stdout = in.Stdout + out.Stderr = in.Stderr + out.TTY = in.TTY + out.Container = in.Container + return nil +} + +// Convert_core_PodAttachOptions_To_v1_PodAttachOptions is an autogenerated conversion function. +func Convert_core_PodAttachOptions_To_v1_PodAttachOptions(in *core.PodAttachOptions, out *v1.PodAttachOptions, s conversion.Scope) error { + return autoConvert_core_PodAttachOptions_To_v1_PodAttachOptions(in, out, s) +} + +func autoConvert_v1_PodCondition_To_core_PodCondition(in *v1.PodCondition, out *core.PodCondition, s conversion.Scope) error { + out.Type = core.PodConditionType(in.Type) + out.Status = core.ConditionStatus(in.Status) + out.LastProbeTime = in.LastProbeTime + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_v1_PodCondition_To_core_PodCondition is an autogenerated conversion function. +func Convert_v1_PodCondition_To_core_PodCondition(in *v1.PodCondition, out *core.PodCondition, s conversion.Scope) error { + return autoConvert_v1_PodCondition_To_core_PodCondition(in, out, s) +} + +func autoConvert_core_PodCondition_To_v1_PodCondition(in *core.PodCondition, out *v1.PodCondition, s conversion.Scope) error { + out.Type = v1.PodConditionType(in.Type) + out.Status = v1.ConditionStatus(in.Status) + out.LastProbeTime = in.LastProbeTime + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_core_PodCondition_To_v1_PodCondition is an autogenerated conversion function. +func Convert_core_PodCondition_To_v1_PodCondition(in *core.PodCondition, out *v1.PodCondition, s conversion.Scope) error { + return autoConvert_core_PodCondition_To_v1_PodCondition(in, out, s) +} + +func autoConvert_v1_PodDNSConfig_To_core_PodDNSConfig(in *v1.PodDNSConfig, out *core.PodDNSConfig, s conversion.Scope) error { + out.Nameservers = *(*[]string)(unsafe.Pointer(&in.Nameservers)) + out.Searches = *(*[]string)(unsafe.Pointer(&in.Searches)) + out.Options = *(*[]core.PodDNSConfigOption)(unsafe.Pointer(&in.Options)) + return nil +} + +// Convert_v1_PodDNSConfig_To_core_PodDNSConfig is an autogenerated conversion function. +func Convert_v1_PodDNSConfig_To_core_PodDNSConfig(in *v1.PodDNSConfig, out *core.PodDNSConfig, s conversion.Scope) error { + return autoConvert_v1_PodDNSConfig_To_core_PodDNSConfig(in, out, s) +} + +func autoConvert_core_PodDNSConfig_To_v1_PodDNSConfig(in *core.PodDNSConfig, out *v1.PodDNSConfig, s conversion.Scope) error { + out.Nameservers = *(*[]string)(unsafe.Pointer(&in.Nameservers)) + out.Searches = *(*[]string)(unsafe.Pointer(&in.Searches)) + out.Options = *(*[]v1.PodDNSConfigOption)(unsafe.Pointer(&in.Options)) + return nil +} + +// Convert_core_PodDNSConfig_To_v1_PodDNSConfig is an autogenerated conversion function. +func Convert_core_PodDNSConfig_To_v1_PodDNSConfig(in *core.PodDNSConfig, out *v1.PodDNSConfig, s conversion.Scope) error { + return autoConvert_core_PodDNSConfig_To_v1_PodDNSConfig(in, out, s) +} + +func autoConvert_v1_PodDNSConfigOption_To_core_PodDNSConfigOption(in *v1.PodDNSConfigOption, out *core.PodDNSConfigOption, s conversion.Scope) error { + out.Name = in.Name + out.Value = (*string)(unsafe.Pointer(in.Value)) + return nil +} + +// Convert_v1_PodDNSConfigOption_To_core_PodDNSConfigOption is an autogenerated conversion function. +func Convert_v1_PodDNSConfigOption_To_core_PodDNSConfigOption(in *v1.PodDNSConfigOption, out *core.PodDNSConfigOption, s conversion.Scope) error { + return autoConvert_v1_PodDNSConfigOption_To_core_PodDNSConfigOption(in, out, s) +} + +func autoConvert_core_PodDNSConfigOption_To_v1_PodDNSConfigOption(in *core.PodDNSConfigOption, out *v1.PodDNSConfigOption, s conversion.Scope) error { + out.Name = in.Name + out.Value = (*string)(unsafe.Pointer(in.Value)) + return nil +} + +// Convert_core_PodDNSConfigOption_To_v1_PodDNSConfigOption is an autogenerated conversion function. +func Convert_core_PodDNSConfigOption_To_v1_PodDNSConfigOption(in *core.PodDNSConfigOption, out *v1.PodDNSConfigOption, s conversion.Scope) error { + return autoConvert_core_PodDNSConfigOption_To_v1_PodDNSConfigOption(in, out, s) +} + +func autoConvert_v1_PodExecOptions_To_core_PodExecOptions(in *v1.PodExecOptions, out *core.PodExecOptions, s conversion.Scope) error { + out.Stdin = in.Stdin + out.Stdout = in.Stdout + out.Stderr = in.Stderr + out.TTY = in.TTY + out.Container = in.Container + out.Command = *(*[]string)(unsafe.Pointer(&in.Command)) + return nil +} + +// Convert_v1_PodExecOptions_To_core_PodExecOptions is an autogenerated conversion function. +func Convert_v1_PodExecOptions_To_core_PodExecOptions(in *v1.PodExecOptions, out *core.PodExecOptions, s conversion.Scope) error { + return autoConvert_v1_PodExecOptions_To_core_PodExecOptions(in, out, s) +} + +func autoConvert_core_PodExecOptions_To_v1_PodExecOptions(in *core.PodExecOptions, out *v1.PodExecOptions, s conversion.Scope) error { + out.Stdin = in.Stdin + out.Stdout = in.Stdout + out.Stderr = in.Stderr + out.TTY = in.TTY + out.Container = in.Container + out.Command = *(*[]string)(unsafe.Pointer(&in.Command)) + return nil +} + +// Convert_core_PodExecOptions_To_v1_PodExecOptions is an autogenerated conversion function. +func Convert_core_PodExecOptions_To_v1_PodExecOptions(in *core.PodExecOptions, out *v1.PodExecOptions, s conversion.Scope) error { + return autoConvert_core_PodExecOptions_To_v1_PodExecOptions(in, out, s) +} + +func autoConvert_v1_PodList_To_core_PodList(in *v1.PodList, out *core.PodList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]core.Pod, len(*in)) + for i := range *in { + if err := Convert_v1_Pod_To_core_Pod(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_PodList_To_core_PodList is an autogenerated conversion function. +func Convert_v1_PodList_To_core_PodList(in *v1.PodList, out *core.PodList, s conversion.Scope) error { + return autoConvert_v1_PodList_To_core_PodList(in, out, s) +} + +func autoConvert_core_PodList_To_v1_PodList(in *core.PodList, out *v1.PodList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]v1.Pod, len(*in)) + for i := range *in { + if err := Convert_core_Pod_To_v1_Pod(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_PodList_To_v1_PodList is an autogenerated conversion function. +func Convert_core_PodList_To_v1_PodList(in *core.PodList, out *v1.PodList, s conversion.Scope) error { + return autoConvert_core_PodList_To_v1_PodList(in, out, s) +} + +func autoConvert_v1_PodLogOptions_To_core_PodLogOptions(in *v1.PodLogOptions, out *core.PodLogOptions, s conversion.Scope) error { + out.Container = in.Container + out.Follow = in.Follow + out.Previous = in.Previous + out.SinceSeconds = (*int64)(unsafe.Pointer(in.SinceSeconds)) + out.SinceTime = (*meta_v1.Time)(unsafe.Pointer(in.SinceTime)) + out.Timestamps = in.Timestamps + out.TailLines = (*int64)(unsafe.Pointer(in.TailLines)) + out.LimitBytes = (*int64)(unsafe.Pointer(in.LimitBytes)) + return nil +} + +// Convert_v1_PodLogOptions_To_core_PodLogOptions is an autogenerated conversion function. +func Convert_v1_PodLogOptions_To_core_PodLogOptions(in *v1.PodLogOptions, out *core.PodLogOptions, s conversion.Scope) error { + return autoConvert_v1_PodLogOptions_To_core_PodLogOptions(in, out, s) +} + +func autoConvert_core_PodLogOptions_To_v1_PodLogOptions(in *core.PodLogOptions, out *v1.PodLogOptions, s conversion.Scope) error { + out.Container = in.Container + out.Follow = in.Follow + out.Previous = in.Previous + out.SinceSeconds = (*int64)(unsafe.Pointer(in.SinceSeconds)) + out.SinceTime = (*meta_v1.Time)(unsafe.Pointer(in.SinceTime)) + out.Timestamps = in.Timestamps + out.TailLines = (*int64)(unsafe.Pointer(in.TailLines)) + out.LimitBytes = (*int64)(unsafe.Pointer(in.LimitBytes)) + return nil +} + +// Convert_core_PodLogOptions_To_v1_PodLogOptions is an autogenerated conversion function. +func Convert_core_PodLogOptions_To_v1_PodLogOptions(in *core.PodLogOptions, out *v1.PodLogOptions, s conversion.Scope) error { + return autoConvert_core_PodLogOptions_To_v1_PodLogOptions(in, out, s) +} + +func autoConvert_v1_PodPortForwardOptions_To_core_PodPortForwardOptions(in *v1.PodPortForwardOptions, out *core.PodPortForwardOptions, s conversion.Scope) error { + out.Ports = *(*[]int32)(unsafe.Pointer(&in.Ports)) + return nil +} + +// Convert_v1_PodPortForwardOptions_To_core_PodPortForwardOptions is an autogenerated conversion function. +func Convert_v1_PodPortForwardOptions_To_core_PodPortForwardOptions(in *v1.PodPortForwardOptions, out *core.PodPortForwardOptions, s conversion.Scope) error { + return autoConvert_v1_PodPortForwardOptions_To_core_PodPortForwardOptions(in, out, s) +} + +func autoConvert_core_PodPortForwardOptions_To_v1_PodPortForwardOptions(in *core.PodPortForwardOptions, out *v1.PodPortForwardOptions, s conversion.Scope) error { + out.Ports = *(*[]int32)(unsafe.Pointer(&in.Ports)) + return nil +} + +// Convert_core_PodPortForwardOptions_To_v1_PodPortForwardOptions is an autogenerated conversion function. +func Convert_core_PodPortForwardOptions_To_v1_PodPortForwardOptions(in *core.PodPortForwardOptions, out *v1.PodPortForwardOptions, s conversion.Scope) error { + return autoConvert_core_PodPortForwardOptions_To_v1_PodPortForwardOptions(in, out, s) +} + +func autoConvert_v1_PodProxyOptions_To_core_PodProxyOptions(in *v1.PodProxyOptions, out *core.PodProxyOptions, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_v1_PodProxyOptions_To_core_PodProxyOptions is an autogenerated conversion function. +func Convert_v1_PodProxyOptions_To_core_PodProxyOptions(in *v1.PodProxyOptions, out *core.PodProxyOptions, s conversion.Scope) error { + return autoConvert_v1_PodProxyOptions_To_core_PodProxyOptions(in, out, s) +} + +func autoConvert_core_PodProxyOptions_To_v1_PodProxyOptions(in *core.PodProxyOptions, out *v1.PodProxyOptions, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_core_PodProxyOptions_To_v1_PodProxyOptions is an autogenerated conversion function. +func Convert_core_PodProxyOptions_To_v1_PodProxyOptions(in *core.PodProxyOptions, out *v1.PodProxyOptions, s conversion.Scope) error { + return autoConvert_core_PodProxyOptions_To_v1_PodProxyOptions(in, out, s) +} + +func autoConvert_v1_PodSecurityContext_To_core_PodSecurityContext(in *v1.PodSecurityContext, out *core.PodSecurityContext, s conversion.Scope) error { + out.SELinuxOptions = (*core.SELinuxOptions)(unsafe.Pointer(in.SELinuxOptions)) + out.RunAsUser = (*int64)(unsafe.Pointer(in.RunAsUser)) + out.RunAsNonRoot = (*bool)(unsafe.Pointer(in.RunAsNonRoot)) + out.SupplementalGroups = *(*[]int64)(unsafe.Pointer(&in.SupplementalGroups)) + out.FSGroup = (*int64)(unsafe.Pointer(in.FSGroup)) + return nil +} + +func autoConvert_core_PodSecurityContext_To_v1_PodSecurityContext(in *core.PodSecurityContext, out *v1.PodSecurityContext, s conversion.Scope) error { + // INFO: in.HostNetwork opted out of conversion generation + // INFO: in.HostPID opted out of conversion generation + // INFO: in.HostIPC opted out of conversion generation + // INFO: in.ShareProcessNamespace opted out of conversion generation + out.SELinuxOptions = (*v1.SELinuxOptions)(unsafe.Pointer(in.SELinuxOptions)) + out.RunAsUser = (*int64)(unsafe.Pointer(in.RunAsUser)) + out.RunAsNonRoot = (*bool)(unsafe.Pointer(in.RunAsNonRoot)) + out.SupplementalGroups = *(*[]int64)(unsafe.Pointer(&in.SupplementalGroups)) + out.FSGroup = (*int64)(unsafe.Pointer(in.FSGroup)) + return nil +} + +func autoConvert_v1_PodSignature_To_core_PodSignature(in *v1.PodSignature, out *core.PodSignature, s conversion.Scope) error { + out.PodController = (*meta_v1.OwnerReference)(unsafe.Pointer(in.PodController)) + return nil +} + +// Convert_v1_PodSignature_To_core_PodSignature is an autogenerated conversion function. +func Convert_v1_PodSignature_To_core_PodSignature(in *v1.PodSignature, out *core.PodSignature, s conversion.Scope) error { + return autoConvert_v1_PodSignature_To_core_PodSignature(in, out, s) +} + +func autoConvert_core_PodSignature_To_v1_PodSignature(in *core.PodSignature, out *v1.PodSignature, s conversion.Scope) error { + out.PodController = (*meta_v1.OwnerReference)(unsafe.Pointer(in.PodController)) + return nil +} + +// Convert_core_PodSignature_To_v1_PodSignature is an autogenerated conversion function. +func Convert_core_PodSignature_To_v1_PodSignature(in *core.PodSignature, out *v1.PodSignature, s conversion.Scope) error { + return autoConvert_core_PodSignature_To_v1_PodSignature(in, out, s) +} + +func autoConvert_v1_PodSpec_To_core_PodSpec(in *v1.PodSpec, out *core.PodSpec, s conversion.Scope) error { + if in.Volumes != nil { + in, out := &in.Volumes, &out.Volumes + *out = make([]core.Volume, len(*in)) + for i := range *in { + if err := Convert_v1_Volume_To_core_Volume(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Volumes = nil + } + if in.InitContainers != nil { + in, out := &in.InitContainers, &out.InitContainers + *out = make([]core.Container, len(*in)) + for i := range *in { + if err := Convert_v1_Container_To_core_Container(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.InitContainers = nil + } + if in.Containers != nil { + in, out := &in.Containers, &out.Containers + *out = make([]core.Container, len(*in)) + for i := range *in { + if err := Convert_v1_Container_To_core_Container(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Containers = nil + } + out.RestartPolicy = core.RestartPolicy(in.RestartPolicy) + out.TerminationGracePeriodSeconds = (*int64)(unsafe.Pointer(in.TerminationGracePeriodSeconds)) + out.ActiveDeadlineSeconds = (*int64)(unsafe.Pointer(in.ActiveDeadlineSeconds)) + out.DNSPolicy = core.DNSPolicy(in.DNSPolicy) + out.NodeSelector = *(*map[string]string)(unsafe.Pointer(&in.NodeSelector)) + out.ServiceAccountName = in.ServiceAccountName + // INFO: in.DeprecatedServiceAccount opted out of conversion generation + out.AutomountServiceAccountToken = (*bool)(unsafe.Pointer(in.AutomountServiceAccountToken)) + out.NodeName = in.NodeName + // INFO: in.HostNetwork opted out of conversion generation + // INFO: in.HostPID opted out of conversion generation + // INFO: in.HostIPC opted out of conversion generation + // INFO: in.ShareProcessNamespace opted out of conversion generation + if in.SecurityContext != nil { + in, out := &in.SecurityContext, &out.SecurityContext + *out = new(core.PodSecurityContext) + if err := Convert_v1_PodSecurityContext_To_core_PodSecurityContext(*in, *out, s); err != nil { + return err + } + } else { + out.SecurityContext = nil + } + out.ImagePullSecrets = *(*[]core.LocalObjectReference)(unsafe.Pointer(&in.ImagePullSecrets)) + out.Hostname = in.Hostname + out.Subdomain = in.Subdomain + out.Affinity = (*core.Affinity)(unsafe.Pointer(in.Affinity)) + out.SchedulerName = in.SchedulerName + out.Tolerations = *(*[]core.Toleration)(unsafe.Pointer(&in.Tolerations)) + out.HostAliases = *(*[]core.HostAlias)(unsafe.Pointer(&in.HostAliases)) + out.PriorityClassName = in.PriorityClassName + out.Priority = (*int32)(unsafe.Pointer(in.Priority)) + out.DNSConfig = (*core.PodDNSConfig)(unsafe.Pointer(in.DNSConfig)) + return nil +} + +func autoConvert_core_PodSpec_To_v1_PodSpec(in *core.PodSpec, out *v1.PodSpec, s conversion.Scope) error { + if in.Volumes != nil { + in, out := &in.Volumes, &out.Volumes + *out = make([]v1.Volume, len(*in)) + for i := range *in { + if err := Convert_core_Volume_To_v1_Volume(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Volumes = nil + } + if in.InitContainers != nil { + in, out := &in.InitContainers, &out.InitContainers + *out = make([]v1.Container, len(*in)) + for i := range *in { + if err := Convert_core_Container_To_v1_Container(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.InitContainers = nil + } + if in.Containers != nil { + in, out := &in.Containers, &out.Containers + *out = make([]v1.Container, len(*in)) + for i := range *in { + if err := Convert_core_Container_To_v1_Container(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Containers = nil + } + out.RestartPolicy = v1.RestartPolicy(in.RestartPolicy) + out.TerminationGracePeriodSeconds = (*int64)(unsafe.Pointer(in.TerminationGracePeriodSeconds)) + out.ActiveDeadlineSeconds = (*int64)(unsafe.Pointer(in.ActiveDeadlineSeconds)) + out.DNSPolicy = v1.DNSPolicy(in.DNSPolicy) + out.NodeSelector = *(*map[string]string)(unsafe.Pointer(&in.NodeSelector)) + out.ServiceAccountName = in.ServiceAccountName + out.AutomountServiceAccountToken = (*bool)(unsafe.Pointer(in.AutomountServiceAccountToken)) + out.NodeName = in.NodeName + if in.SecurityContext != nil { + in, out := &in.SecurityContext, &out.SecurityContext + *out = new(v1.PodSecurityContext) + if err := Convert_core_PodSecurityContext_To_v1_PodSecurityContext(*in, *out, s); err != nil { + return err + } + } else { + out.SecurityContext = nil + } + out.ImagePullSecrets = *(*[]v1.LocalObjectReference)(unsafe.Pointer(&in.ImagePullSecrets)) + out.Hostname = in.Hostname + out.Subdomain = in.Subdomain + out.Affinity = (*v1.Affinity)(unsafe.Pointer(in.Affinity)) + out.SchedulerName = in.SchedulerName + out.Tolerations = *(*[]v1.Toleration)(unsafe.Pointer(&in.Tolerations)) + out.HostAliases = *(*[]v1.HostAlias)(unsafe.Pointer(&in.HostAliases)) + out.PriorityClassName = in.PriorityClassName + out.Priority = (*int32)(unsafe.Pointer(in.Priority)) + out.DNSConfig = (*v1.PodDNSConfig)(unsafe.Pointer(in.DNSConfig)) + return nil +} + +func autoConvert_v1_PodStatus_To_core_PodStatus(in *v1.PodStatus, out *core.PodStatus, s conversion.Scope) error { + out.Phase = core.PodPhase(in.Phase) + out.Conditions = *(*[]core.PodCondition)(unsafe.Pointer(&in.Conditions)) + out.Message = in.Message + out.Reason = in.Reason + out.NominatedNodeName = in.NominatedNodeName + out.HostIP = in.HostIP + out.PodIP = in.PodIP + out.StartTime = (*meta_v1.Time)(unsafe.Pointer(in.StartTime)) + out.InitContainerStatuses = *(*[]core.ContainerStatus)(unsafe.Pointer(&in.InitContainerStatuses)) + out.ContainerStatuses = *(*[]core.ContainerStatus)(unsafe.Pointer(&in.ContainerStatuses)) + out.QOSClass = core.PodQOSClass(in.QOSClass) + return nil +} + +// Convert_v1_PodStatus_To_core_PodStatus is an autogenerated conversion function. +func Convert_v1_PodStatus_To_core_PodStatus(in *v1.PodStatus, out *core.PodStatus, s conversion.Scope) error { + return autoConvert_v1_PodStatus_To_core_PodStatus(in, out, s) +} + +func autoConvert_core_PodStatus_To_v1_PodStatus(in *core.PodStatus, out *v1.PodStatus, s conversion.Scope) error { + out.Phase = v1.PodPhase(in.Phase) + out.Conditions = *(*[]v1.PodCondition)(unsafe.Pointer(&in.Conditions)) + out.Message = in.Message + out.Reason = in.Reason + out.NominatedNodeName = in.NominatedNodeName + out.HostIP = in.HostIP + out.PodIP = in.PodIP + out.StartTime = (*meta_v1.Time)(unsafe.Pointer(in.StartTime)) + out.QOSClass = v1.PodQOSClass(in.QOSClass) + out.InitContainerStatuses = *(*[]v1.ContainerStatus)(unsafe.Pointer(&in.InitContainerStatuses)) + out.ContainerStatuses = *(*[]v1.ContainerStatus)(unsafe.Pointer(&in.ContainerStatuses)) + return nil +} + +// Convert_core_PodStatus_To_v1_PodStatus is an autogenerated conversion function. +func Convert_core_PodStatus_To_v1_PodStatus(in *core.PodStatus, out *v1.PodStatus, s conversion.Scope) error { + return autoConvert_core_PodStatus_To_v1_PodStatus(in, out, s) +} + +func autoConvert_v1_PodStatusResult_To_core_PodStatusResult(in *v1.PodStatusResult, out *core.PodStatusResult, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_PodStatus_To_core_PodStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_PodStatusResult_To_core_PodStatusResult is an autogenerated conversion function. +func Convert_v1_PodStatusResult_To_core_PodStatusResult(in *v1.PodStatusResult, out *core.PodStatusResult, s conversion.Scope) error { + return autoConvert_v1_PodStatusResult_To_core_PodStatusResult(in, out, s) +} + +func autoConvert_core_PodStatusResult_To_v1_PodStatusResult(in *core.PodStatusResult, out *v1.PodStatusResult, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_PodStatus_To_v1_PodStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_PodStatusResult_To_v1_PodStatusResult is an autogenerated conversion function. +func Convert_core_PodStatusResult_To_v1_PodStatusResult(in *core.PodStatusResult, out *v1.PodStatusResult, s conversion.Scope) error { + return autoConvert_core_PodStatusResult_To_v1_PodStatusResult(in, out, s) +} + +func autoConvert_v1_PodTemplate_To_core_PodTemplate(in *v1.PodTemplate, out *core.PodTemplate, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_PodTemplateSpec_To_core_PodTemplateSpec(&in.Template, &out.Template, s); err != nil { + return err + } + return nil +} + +// Convert_v1_PodTemplate_To_core_PodTemplate is an autogenerated conversion function. +func Convert_v1_PodTemplate_To_core_PodTemplate(in *v1.PodTemplate, out *core.PodTemplate, s conversion.Scope) error { + return autoConvert_v1_PodTemplate_To_core_PodTemplate(in, out, s) +} + +func autoConvert_core_PodTemplate_To_v1_PodTemplate(in *core.PodTemplate, out *v1.PodTemplate, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_PodTemplateSpec_To_v1_PodTemplateSpec(&in.Template, &out.Template, s); err != nil { + return err + } + return nil +} + +// Convert_core_PodTemplate_To_v1_PodTemplate is an autogenerated conversion function. +func Convert_core_PodTemplate_To_v1_PodTemplate(in *core.PodTemplate, out *v1.PodTemplate, s conversion.Scope) error { + return autoConvert_core_PodTemplate_To_v1_PodTemplate(in, out, s) +} + +func autoConvert_v1_PodTemplateList_To_core_PodTemplateList(in *v1.PodTemplateList, out *core.PodTemplateList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]core.PodTemplate, len(*in)) + for i := range *in { + if err := Convert_v1_PodTemplate_To_core_PodTemplate(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_PodTemplateList_To_core_PodTemplateList is an autogenerated conversion function. +func Convert_v1_PodTemplateList_To_core_PodTemplateList(in *v1.PodTemplateList, out *core.PodTemplateList, s conversion.Scope) error { + return autoConvert_v1_PodTemplateList_To_core_PodTemplateList(in, out, s) +} + +func autoConvert_core_PodTemplateList_To_v1_PodTemplateList(in *core.PodTemplateList, out *v1.PodTemplateList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]v1.PodTemplate, len(*in)) + for i := range *in { + if err := Convert_core_PodTemplate_To_v1_PodTemplate(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_PodTemplateList_To_v1_PodTemplateList is an autogenerated conversion function. +func Convert_core_PodTemplateList_To_v1_PodTemplateList(in *core.PodTemplateList, out *v1.PodTemplateList, s conversion.Scope) error { + return autoConvert_core_PodTemplateList_To_v1_PodTemplateList(in, out, s) +} + +func autoConvert_v1_PodTemplateSpec_To_core_PodTemplateSpec(in *v1.PodTemplateSpec, out *core.PodTemplateSpec, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_PodSpec_To_core_PodSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + return nil +} + +func autoConvert_core_PodTemplateSpec_To_v1_PodTemplateSpec(in *core.PodTemplateSpec, out *v1.PodTemplateSpec, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_PodSpec_To_v1_PodSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + return nil +} + +func autoConvert_v1_PortworxVolumeSource_To_core_PortworxVolumeSource(in *v1.PortworxVolumeSource, out *core.PortworxVolumeSource, s conversion.Scope) error { + out.VolumeID = in.VolumeID + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_PortworxVolumeSource_To_core_PortworxVolumeSource is an autogenerated conversion function. +func Convert_v1_PortworxVolumeSource_To_core_PortworxVolumeSource(in *v1.PortworxVolumeSource, out *core.PortworxVolumeSource, s conversion.Scope) error { + return autoConvert_v1_PortworxVolumeSource_To_core_PortworxVolumeSource(in, out, s) +} + +func autoConvert_core_PortworxVolumeSource_To_v1_PortworxVolumeSource(in *core.PortworxVolumeSource, out *v1.PortworxVolumeSource, s conversion.Scope) error { + out.VolumeID = in.VolumeID + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_PortworxVolumeSource_To_v1_PortworxVolumeSource is an autogenerated conversion function. +func Convert_core_PortworxVolumeSource_To_v1_PortworxVolumeSource(in *core.PortworxVolumeSource, out *v1.PortworxVolumeSource, s conversion.Scope) error { + return autoConvert_core_PortworxVolumeSource_To_v1_PortworxVolumeSource(in, out, s) +} + +func autoConvert_v1_Preconditions_To_core_Preconditions(in *v1.Preconditions, out *core.Preconditions, s conversion.Scope) error { + out.UID = (*types.UID)(unsafe.Pointer(in.UID)) + return nil +} + +// Convert_v1_Preconditions_To_core_Preconditions is an autogenerated conversion function. +func Convert_v1_Preconditions_To_core_Preconditions(in *v1.Preconditions, out *core.Preconditions, s conversion.Scope) error { + return autoConvert_v1_Preconditions_To_core_Preconditions(in, out, s) +} + +func autoConvert_core_Preconditions_To_v1_Preconditions(in *core.Preconditions, out *v1.Preconditions, s conversion.Scope) error { + out.UID = (*types.UID)(unsafe.Pointer(in.UID)) + return nil +} + +// Convert_core_Preconditions_To_v1_Preconditions is an autogenerated conversion function. +func Convert_core_Preconditions_To_v1_Preconditions(in *core.Preconditions, out *v1.Preconditions, s conversion.Scope) error { + return autoConvert_core_Preconditions_To_v1_Preconditions(in, out, s) +} + +func autoConvert_v1_PreferAvoidPodsEntry_To_core_PreferAvoidPodsEntry(in *v1.PreferAvoidPodsEntry, out *core.PreferAvoidPodsEntry, s conversion.Scope) error { + if err := Convert_v1_PodSignature_To_core_PodSignature(&in.PodSignature, &out.PodSignature, s); err != nil { + return err + } + out.EvictionTime = in.EvictionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_v1_PreferAvoidPodsEntry_To_core_PreferAvoidPodsEntry is an autogenerated conversion function. +func Convert_v1_PreferAvoidPodsEntry_To_core_PreferAvoidPodsEntry(in *v1.PreferAvoidPodsEntry, out *core.PreferAvoidPodsEntry, s conversion.Scope) error { + return autoConvert_v1_PreferAvoidPodsEntry_To_core_PreferAvoidPodsEntry(in, out, s) +} + +func autoConvert_core_PreferAvoidPodsEntry_To_v1_PreferAvoidPodsEntry(in *core.PreferAvoidPodsEntry, out *v1.PreferAvoidPodsEntry, s conversion.Scope) error { + if err := Convert_core_PodSignature_To_v1_PodSignature(&in.PodSignature, &out.PodSignature, s); err != nil { + return err + } + out.EvictionTime = in.EvictionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_core_PreferAvoidPodsEntry_To_v1_PreferAvoidPodsEntry is an autogenerated conversion function. +func Convert_core_PreferAvoidPodsEntry_To_v1_PreferAvoidPodsEntry(in *core.PreferAvoidPodsEntry, out *v1.PreferAvoidPodsEntry, s conversion.Scope) error { + return autoConvert_core_PreferAvoidPodsEntry_To_v1_PreferAvoidPodsEntry(in, out, s) +} + +func autoConvert_v1_PreferredSchedulingTerm_To_core_PreferredSchedulingTerm(in *v1.PreferredSchedulingTerm, out *core.PreferredSchedulingTerm, s conversion.Scope) error { + out.Weight = in.Weight + if err := Convert_v1_NodeSelectorTerm_To_core_NodeSelectorTerm(&in.Preference, &out.Preference, s); err != nil { + return err + } + return nil +} + +// Convert_v1_PreferredSchedulingTerm_To_core_PreferredSchedulingTerm is an autogenerated conversion function. +func Convert_v1_PreferredSchedulingTerm_To_core_PreferredSchedulingTerm(in *v1.PreferredSchedulingTerm, out *core.PreferredSchedulingTerm, s conversion.Scope) error { + return autoConvert_v1_PreferredSchedulingTerm_To_core_PreferredSchedulingTerm(in, out, s) +} + +func autoConvert_core_PreferredSchedulingTerm_To_v1_PreferredSchedulingTerm(in *core.PreferredSchedulingTerm, out *v1.PreferredSchedulingTerm, s conversion.Scope) error { + out.Weight = in.Weight + if err := Convert_core_NodeSelectorTerm_To_v1_NodeSelectorTerm(&in.Preference, &out.Preference, s); err != nil { + return err + } + return nil +} + +// Convert_core_PreferredSchedulingTerm_To_v1_PreferredSchedulingTerm is an autogenerated conversion function. +func Convert_core_PreferredSchedulingTerm_To_v1_PreferredSchedulingTerm(in *core.PreferredSchedulingTerm, out *v1.PreferredSchedulingTerm, s conversion.Scope) error { + return autoConvert_core_PreferredSchedulingTerm_To_v1_PreferredSchedulingTerm(in, out, s) +} + +func autoConvert_v1_Probe_To_core_Probe(in *v1.Probe, out *core.Probe, s conversion.Scope) error { + if err := Convert_v1_Handler_To_core_Handler(&in.Handler, &out.Handler, s); err != nil { + return err + } + out.InitialDelaySeconds = in.InitialDelaySeconds + out.TimeoutSeconds = in.TimeoutSeconds + out.PeriodSeconds = in.PeriodSeconds + out.SuccessThreshold = in.SuccessThreshold + out.FailureThreshold = in.FailureThreshold + return nil +} + +// Convert_v1_Probe_To_core_Probe is an autogenerated conversion function. +func Convert_v1_Probe_To_core_Probe(in *v1.Probe, out *core.Probe, s conversion.Scope) error { + return autoConvert_v1_Probe_To_core_Probe(in, out, s) +} + +func autoConvert_core_Probe_To_v1_Probe(in *core.Probe, out *v1.Probe, s conversion.Scope) error { + if err := Convert_core_Handler_To_v1_Handler(&in.Handler, &out.Handler, s); err != nil { + return err + } + out.InitialDelaySeconds = in.InitialDelaySeconds + out.TimeoutSeconds = in.TimeoutSeconds + out.PeriodSeconds = in.PeriodSeconds + out.SuccessThreshold = in.SuccessThreshold + out.FailureThreshold = in.FailureThreshold + return nil +} + +// Convert_core_Probe_To_v1_Probe is an autogenerated conversion function. +func Convert_core_Probe_To_v1_Probe(in *core.Probe, out *v1.Probe, s conversion.Scope) error { + return autoConvert_core_Probe_To_v1_Probe(in, out, s) +} + +func autoConvert_v1_ProjectedVolumeSource_To_core_ProjectedVolumeSource(in *v1.ProjectedVolumeSource, out *core.ProjectedVolumeSource, s conversion.Scope) error { + out.Sources = *(*[]core.VolumeProjection)(unsafe.Pointer(&in.Sources)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + return nil +} + +// Convert_v1_ProjectedVolumeSource_To_core_ProjectedVolumeSource is an autogenerated conversion function. +func Convert_v1_ProjectedVolumeSource_To_core_ProjectedVolumeSource(in *v1.ProjectedVolumeSource, out *core.ProjectedVolumeSource, s conversion.Scope) error { + return autoConvert_v1_ProjectedVolumeSource_To_core_ProjectedVolumeSource(in, out, s) +} + +func autoConvert_core_ProjectedVolumeSource_To_v1_ProjectedVolumeSource(in *core.ProjectedVolumeSource, out *v1.ProjectedVolumeSource, s conversion.Scope) error { + out.Sources = *(*[]v1.VolumeProjection)(unsafe.Pointer(&in.Sources)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + return nil +} + +// Convert_core_ProjectedVolumeSource_To_v1_ProjectedVolumeSource is an autogenerated conversion function. +func Convert_core_ProjectedVolumeSource_To_v1_ProjectedVolumeSource(in *core.ProjectedVolumeSource, out *v1.ProjectedVolumeSource, s conversion.Scope) error { + return autoConvert_core_ProjectedVolumeSource_To_v1_ProjectedVolumeSource(in, out, s) +} + +func autoConvert_v1_QuobyteVolumeSource_To_core_QuobyteVolumeSource(in *v1.QuobyteVolumeSource, out *core.QuobyteVolumeSource, s conversion.Scope) error { + out.Registry = in.Registry + out.Volume = in.Volume + out.ReadOnly = in.ReadOnly + out.User = in.User + out.Group = in.Group + return nil +} + +// Convert_v1_QuobyteVolumeSource_To_core_QuobyteVolumeSource is an autogenerated conversion function. +func Convert_v1_QuobyteVolumeSource_To_core_QuobyteVolumeSource(in *v1.QuobyteVolumeSource, out *core.QuobyteVolumeSource, s conversion.Scope) error { + return autoConvert_v1_QuobyteVolumeSource_To_core_QuobyteVolumeSource(in, out, s) +} + +func autoConvert_core_QuobyteVolumeSource_To_v1_QuobyteVolumeSource(in *core.QuobyteVolumeSource, out *v1.QuobyteVolumeSource, s conversion.Scope) error { + out.Registry = in.Registry + out.Volume = in.Volume + out.ReadOnly = in.ReadOnly + out.User = in.User + out.Group = in.Group + return nil +} + +// Convert_core_QuobyteVolumeSource_To_v1_QuobyteVolumeSource is an autogenerated conversion function. +func Convert_core_QuobyteVolumeSource_To_v1_QuobyteVolumeSource(in *core.QuobyteVolumeSource, out *v1.QuobyteVolumeSource, s conversion.Scope) error { + return autoConvert_core_QuobyteVolumeSource_To_v1_QuobyteVolumeSource(in, out, s) +} + +func autoConvert_v1_RBDPersistentVolumeSource_To_core_RBDPersistentVolumeSource(in *v1.RBDPersistentVolumeSource, out *core.RBDPersistentVolumeSource, s conversion.Scope) error { + out.CephMonitors = *(*[]string)(unsafe.Pointer(&in.CephMonitors)) + out.RBDImage = in.RBDImage + out.FSType = in.FSType + out.RBDPool = in.RBDPool + out.RadosUser = in.RadosUser + out.Keyring = in.Keyring + out.SecretRef = (*core.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_RBDPersistentVolumeSource_To_core_RBDPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_RBDPersistentVolumeSource_To_core_RBDPersistentVolumeSource(in *v1.RBDPersistentVolumeSource, out *core.RBDPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_RBDPersistentVolumeSource_To_core_RBDPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_RBDPersistentVolumeSource_To_v1_RBDPersistentVolumeSource(in *core.RBDPersistentVolumeSource, out *v1.RBDPersistentVolumeSource, s conversion.Scope) error { + out.CephMonitors = *(*[]string)(unsafe.Pointer(&in.CephMonitors)) + out.RBDImage = in.RBDImage + out.FSType = in.FSType + out.RBDPool = in.RBDPool + out.RadosUser = in.RadosUser + out.Keyring = in.Keyring + out.SecretRef = (*v1.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_RBDPersistentVolumeSource_To_v1_RBDPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_RBDPersistentVolumeSource_To_v1_RBDPersistentVolumeSource(in *core.RBDPersistentVolumeSource, out *v1.RBDPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_RBDPersistentVolumeSource_To_v1_RBDPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_RBDVolumeSource_To_core_RBDVolumeSource(in *v1.RBDVolumeSource, out *core.RBDVolumeSource, s conversion.Scope) error { + out.CephMonitors = *(*[]string)(unsafe.Pointer(&in.CephMonitors)) + out.RBDImage = in.RBDImage + out.FSType = in.FSType + out.RBDPool = in.RBDPool + out.RadosUser = in.RadosUser + out.Keyring = in.Keyring + out.SecretRef = (*core.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_RBDVolumeSource_To_core_RBDVolumeSource is an autogenerated conversion function. +func Convert_v1_RBDVolumeSource_To_core_RBDVolumeSource(in *v1.RBDVolumeSource, out *core.RBDVolumeSource, s conversion.Scope) error { + return autoConvert_v1_RBDVolumeSource_To_core_RBDVolumeSource(in, out, s) +} + +func autoConvert_core_RBDVolumeSource_To_v1_RBDVolumeSource(in *core.RBDVolumeSource, out *v1.RBDVolumeSource, s conversion.Scope) error { + out.CephMonitors = *(*[]string)(unsafe.Pointer(&in.CephMonitors)) + out.RBDImage = in.RBDImage + out.FSType = in.FSType + out.RBDPool = in.RBDPool + out.RadosUser = in.RadosUser + out.Keyring = in.Keyring + out.SecretRef = (*v1.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_RBDVolumeSource_To_v1_RBDVolumeSource is an autogenerated conversion function. +func Convert_core_RBDVolumeSource_To_v1_RBDVolumeSource(in *core.RBDVolumeSource, out *v1.RBDVolumeSource, s conversion.Scope) error { + return autoConvert_core_RBDVolumeSource_To_v1_RBDVolumeSource(in, out, s) +} + +func autoConvert_v1_RangeAllocation_To_core_RangeAllocation(in *v1.RangeAllocation, out *core.RangeAllocation, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Range = in.Range + out.Data = *(*[]byte)(unsafe.Pointer(&in.Data)) + return nil +} + +// Convert_v1_RangeAllocation_To_core_RangeAllocation is an autogenerated conversion function. +func Convert_v1_RangeAllocation_To_core_RangeAllocation(in *v1.RangeAllocation, out *core.RangeAllocation, s conversion.Scope) error { + return autoConvert_v1_RangeAllocation_To_core_RangeAllocation(in, out, s) +} + +func autoConvert_core_RangeAllocation_To_v1_RangeAllocation(in *core.RangeAllocation, out *v1.RangeAllocation, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Range = in.Range + out.Data = *(*[]byte)(unsafe.Pointer(&in.Data)) + return nil +} + +// Convert_core_RangeAllocation_To_v1_RangeAllocation is an autogenerated conversion function. +func Convert_core_RangeAllocation_To_v1_RangeAllocation(in *core.RangeAllocation, out *v1.RangeAllocation, s conversion.Scope) error { + return autoConvert_core_RangeAllocation_To_v1_RangeAllocation(in, out, s) +} + +func autoConvert_v1_ReplicationController_To_core_ReplicationController(in *v1.ReplicationController, out *core.ReplicationController, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_ReplicationControllerSpec_To_core_ReplicationControllerSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_ReplicationControllerStatus_To_core_ReplicationControllerStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_ReplicationController_To_core_ReplicationController is an autogenerated conversion function. +func Convert_v1_ReplicationController_To_core_ReplicationController(in *v1.ReplicationController, out *core.ReplicationController, s conversion.Scope) error { + return autoConvert_v1_ReplicationController_To_core_ReplicationController(in, out, s) +} + +func autoConvert_core_ReplicationController_To_v1_ReplicationController(in *core.ReplicationController, out *v1.ReplicationController, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_ReplicationControllerSpec_To_v1_ReplicationControllerSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_ReplicationControllerStatus_To_v1_ReplicationControllerStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_ReplicationController_To_v1_ReplicationController is an autogenerated conversion function. +func Convert_core_ReplicationController_To_v1_ReplicationController(in *core.ReplicationController, out *v1.ReplicationController, s conversion.Scope) error { + return autoConvert_core_ReplicationController_To_v1_ReplicationController(in, out, s) +} + +func autoConvert_v1_ReplicationControllerCondition_To_core_ReplicationControllerCondition(in *v1.ReplicationControllerCondition, out *core.ReplicationControllerCondition, s conversion.Scope) error { + out.Type = core.ReplicationControllerConditionType(in.Type) + out.Status = core.ConditionStatus(in.Status) + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_v1_ReplicationControllerCondition_To_core_ReplicationControllerCondition is an autogenerated conversion function. +func Convert_v1_ReplicationControllerCondition_To_core_ReplicationControllerCondition(in *v1.ReplicationControllerCondition, out *core.ReplicationControllerCondition, s conversion.Scope) error { + return autoConvert_v1_ReplicationControllerCondition_To_core_ReplicationControllerCondition(in, out, s) +} + +func autoConvert_core_ReplicationControllerCondition_To_v1_ReplicationControllerCondition(in *core.ReplicationControllerCondition, out *v1.ReplicationControllerCondition, s conversion.Scope) error { + out.Type = v1.ReplicationControllerConditionType(in.Type) + out.Status = v1.ConditionStatus(in.Status) + out.LastTransitionTime = in.LastTransitionTime + out.Reason = in.Reason + out.Message = in.Message + return nil +} + +// Convert_core_ReplicationControllerCondition_To_v1_ReplicationControllerCondition is an autogenerated conversion function. +func Convert_core_ReplicationControllerCondition_To_v1_ReplicationControllerCondition(in *core.ReplicationControllerCondition, out *v1.ReplicationControllerCondition, s conversion.Scope) error { + return autoConvert_core_ReplicationControllerCondition_To_v1_ReplicationControllerCondition(in, out, s) +} + +func autoConvert_v1_ReplicationControllerList_To_core_ReplicationControllerList(in *v1.ReplicationControllerList, out *core.ReplicationControllerList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]core.ReplicationController, len(*in)) + for i := range *in { + if err := Convert_v1_ReplicationController_To_core_ReplicationController(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_ReplicationControllerList_To_core_ReplicationControllerList is an autogenerated conversion function. +func Convert_v1_ReplicationControllerList_To_core_ReplicationControllerList(in *v1.ReplicationControllerList, out *core.ReplicationControllerList, s conversion.Scope) error { + return autoConvert_v1_ReplicationControllerList_To_core_ReplicationControllerList(in, out, s) +} + +func autoConvert_core_ReplicationControllerList_To_v1_ReplicationControllerList(in *core.ReplicationControllerList, out *v1.ReplicationControllerList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]v1.ReplicationController, len(*in)) + for i := range *in { + if err := Convert_core_ReplicationController_To_v1_ReplicationController(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_ReplicationControllerList_To_v1_ReplicationControllerList is an autogenerated conversion function. +func Convert_core_ReplicationControllerList_To_v1_ReplicationControllerList(in *core.ReplicationControllerList, out *v1.ReplicationControllerList, s conversion.Scope) error { + return autoConvert_core_ReplicationControllerList_To_v1_ReplicationControllerList(in, out, s) +} + +func autoConvert_v1_ReplicationControllerSpec_To_core_ReplicationControllerSpec(in *v1.ReplicationControllerSpec, out *core.ReplicationControllerSpec, s conversion.Scope) error { + if err := meta_v1.Convert_Pointer_int32_To_int32(&in.Replicas, &out.Replicas, s); err != nil { + return err + } + out.MinReadySeconds = in.MinReadySeconds + out.Selector = *(*map[string]string)(unsafe.Pointer(&in.Selector)) + if in.Template != nil { + in, out := &in.Template, &out.Template + *out = new(core.PodTemplateSpec) + if err := Convert_v1_PodTemplateSpec_To_core_PodTemplateSpec(*in, *out, s); err != nil { + return err + } + } else { + out.Template = nil + } + return nil +} + +func autoConvert_core_ReplicationControllerSpec_To_v1_ReplicationControllerSpec(in *core.ReplicationControllerSpec, out *v1.ReplicationControllerSpec, s conversion.Scope) error { + if err := meta_v1.Convert_int32_To_Pointer_int32(&in.Replicas, &out.Replicas, s); err != nil { + return err + } + out.MinReadySeconds = in.MinReadySeconds + out.Selector = *(*map[string]string)(unsafe.Pointer(&in.Selector)) + if in.Template != nil { + in, out := &in.Template, &out.Template + *out = new(v1.PodTemplateSpec) + if err := Convert_core_PodTemplateSpec_To_v1_PodTemplateSpec(*in, *out, s); err != nil { + return err + } + } else { + out.Template = nil + } + return nil +} + +func autoConvert_v1_ReplicationControllerStatus_To_core_ReplicationControllerStatus(in *v1.ReplicationControllerStatus, out *core.ReplicationControllerStatus, s conversion.Scope) error { + out.Replicas = in.Replicas + out.FullyLabeledReplicas = in.FullyLabeledReplicas + out.ReadyReplicas = in.ReadyReplicas + out.AvailableReplicas = in.AvailableReplicas + out.ObservedGeneration = in.ObservedGeneration + out.Conditions = *(*[]core.ReplicationControllerCondition)(unsafe.Pointer(&in.Conditions)) + return nil +} + +// Convert_v1_ReplicationControllerStatus_To_core_ReplicationControllerStatus is an autogenerated conversion function. +func Convert_v1_ReplicationControllerStatus_To_core_ReplicationControllerStatus(in *v1.ReplicationControllerStatus, out *core.ReplicationControllerStatus, s conversion.Scope) error { + return autoConvert_v1_ReplicationControllerStatus_To_core_ReplicationControllerStatus(in, out, s) +} + +func autoConvert_core_ReplicationControllerStatus_To_v1_ReplicationControllerStatus(in *core.ReplicationControllerStatus, out *v1.ReplicationControllerStatus, s conversion.Scope) error { + out.Replicas = in.Replicas + out.FullyLabeledReplicas = in.FullyLabeledReplicas + out.ReadyReplicas = in.ReadyReplicas + out.AvailableReplicas = in.AvailableReplicas + out.ObservedGeneration = in.ObservedGeneration + out.Conditions = *(*[]v1.ReplicationControllerCondition)(unsafe.Pointer(&in.Conditions)) + return nil +} + +// Convert_core_ReplicationControllerStatus_To_v1_ReplicationControllerStatus is an autogenerated conversion function. +func Convert_core_ReplicationControllerStatus_To_v1_ReplicationControllerStatus(in *core.ReplicationControllerStatus, out *v1.ReplicationControllerStatus, s conversion.Scope) error { + return autoConvert_core_ReplicationControllerStatus_To_v1_ReplicationControllerStatus(in, out, s) +} + +func autoConvert_v1_ResourceFieldSelector_To_core_ResourceFieldSelector(in *v1.ResourceFieldSelector, out *core.ResourceFieldSelector, s conversion.Scope) error { + out.ContainerName = in.ContainerName + out.Resource = in.Resource + out.Divisor = in.Divisor + return nil +} + +// Convert_v1_ResourceFieldSelector_To_core_ResourceFieldSelector is an autogenerated conversion function. +func Convert_v1_ResourceFieldSelector_To_core_ResourceFieldSelector(in *v1.ResourceFieldSelector, out *core.ResourceFieldSelector, s conversion.Scope) error { + return autoConvert_v1_ResourceFieldSelector_To_core_ResourceFieldSelector(in, out, s) +} + +func autoConvert_core_ResourceFieldSelector_To_v1_ResourceFieldSelector(in *core.ResourceFieldSelector, out *v1.ResourceFieldSelector, s conversion.Scope) error { + out.ContainerName = in.ContainerName + out.Resource = in.Resource + out.Divisor = in.Divisor + return nil +} + +// Convert_core_ResourceFieldSelector_To_v1_ResourceFieldSelector is an autogenerated conversion function. +func Convert_core_ResourceFieldSelector_To_v1_ResourceFieldSelector(in *core.ResourceFieldSelector, out *v1.ResourceFieldSelector, s conversion.Scope) error { + return autoConvert_core_ResourceFieldSelector_To_v1_ResourceFieldSelector(in, out, s) +} + +func autoConvert_v1_ResourceQuota_To_core_ResourceQuota(in *v1.ResourceQuota, out *core.ResourceQuota, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_ResourceQuotaSpec_To_core_ResourceQuotaSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_ResourceQuotaStatus_To_core_ResourceQuotaStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_ResourceQuota_To_core_ResourceQuota is an autogenerated conversion function. +func Convert_v1_ResourceQuota_To_core_ResourceQuota(in *v1.ResourceQuota, out *core.ResourceQuota, s conversion.Scope) error { + return autoConvert_v1_ResourceQuota_To_core_ResourceQuota(in, out, s) +} + +func autoConvert_core_ResourceQuota_To_v1_ResourceQuota(in *core.ResourceQuota, out *v1.ResourceQuota, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_ResourceQuotaSpec_To_v1_ResourceQuotaSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_ResourceQuotaStatus_To_v1_ResourceQuotaStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_ResourceQuota_To_v1_ResourceQuota is an autogenerated conversion function. +func Convert_core_ResourceQuota_To_v1_ResourceQuota(in *core.ResourceQuota, out *v1.ResourceQuota, s conversion.Scope) error { + return autoConvert_core_ResourceQuota_To_v1_ResourceQuota(in, out, s) +} + +func autoConvert_v1_ResourceQuotaList_To_core_ResourceQuotaList(in *v1.ResourceQuotaList, out *core.ResourceQuotaList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.ResourceQuota)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_ResourceQuotaList_To_core_ResourceQuotaList is an autogenerated conversion function. +func Convert_v1_ResourceQuotaList_To_core_ResourceQuotaList(in *v1.ResourceQuotaList, out *core.ResourceQuotaList, s conversion.Scope) error { + return autoConvert_v1_ResourceQuotaList_To_core_ResourceQuotaList(in, out, s) +} + +func autoConvert_core_ResourceQuotaList_To_v1_ResourceQuotaList(in *core.ResourceQuotaList, out *v1.ResourceQuotaList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.ResourceQuota)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_ResourceQuotaList_To_v1_ResourceQuotaList is an autogenerated conversion function. +func Convert_core_ResourceQuotaList_To_v1_ResourceQuotaList(in *core.ResourceQuotaList, out *v1.ResourceQuotaList, s conversion.Scope) error { + return autoConvert_core_ResourceQuotaList_To_v1_ResourceQuotaList(in, out, s) +} + +func autoConvert_v1_ResourceQuotaSpec_To_core_ResourceQuotaSpec(in *v1.ResourceQuotaSpec, out *core.ResourceQuotaSpec, s conversion.Scope) error { + out.Hard = *(*core.ResourceList)(unsafe.Pointer(&in.Hard)) + out.Scopes = *(*[]core.ResourceQuotaScope)(unsafe.Pointer(&in.Scopes)) + return nil +} + +// Convert_v1_ResourceQuotaSpec_To_core_ResourceQuotaSpec is an autogenerated conversion function. +func Convert_v1_ResourceQuotaSpec_To_core_ResourceQuotaSpec(in *v1.ResourceQuotaSpec, out *core.ResourceQuotaSpec, s conversion.Scope) error { + return autoConvert_v1_ResourceQuotaSpec_To_core_ResourceQuotaSpec(in, out, s) +} + +func autoConvert_core_ResourceQuotaSpec_To_v1_ResourceQuotaSpec(in *core.ResourceQuotaSpec, out *v1.ResourceQuotaSpec, s conversion.Scope) error { + out.Hard = *(*v1.ResourceList)(unsafe.Pointer(&in.Hard)) + out.Scopes = *(*[]v1.ResourceQuotaScope)(unsafe.Pointer(&in.Scopes)) + return nil +} + +// Convert_core_ResourceQuotaSpec_To_v1_ResourceQuotaSpec is an autogenerated conversion function. +func Convert_core_ResourceQuotaSpec_To_v1_ResourceQuotaSpec(in *core.ResourceQuotaSpec, out *v1.ResourceQuotaSpec, s conversion.Scope) error { + return autoConvert_core_ResourceQuotaSpec_To_v1_ResourceQuotaSpec(in, out, s) +} + +func autoConvert_v1_ResourceQuotaStatus_To_core_ResourceQuotaStatus(in *v1.ResourceQuotaStatus, out *core.ResourceQuotaStatus, s conversion.Scope) error { + out.Hard = *(*core.ResourceList)(unsafe.Pointer(&in.Hard)) + out.Used = *(*core.ResourceList)(unsafe.Pointer(&in.Used)) + return nil +} + +// Convert_v1_ResourceQuotaStatus_To_core_ResourceQuotaStatus is an autogenerated conversion function. +func Convert_v1_ResourceQuotaStatus_To_core_ResourceQuotaStatus(in *v1.ResourceQuotaStatus, out *core.ResourceQuotaStatus, s conversion.Scope) error { + return autoConvert_v1_ResourceQuotaStatus_To_core_ResourceQuotaStatus(in, out, s) +} + +func autoConvert_core_ResourceQuotaStatus_To_v1_ResourceQuotaStatus(in *core.ResourceQuotaStatus, out *v1.ResourceQuotaStatus, s conversion.Scope) error { + out.Hard = *(*v1.ResourceList)(unsafe.Pointer(&in.Hard)) + out.Used = *(*v1.ResourceList)(unsafe.Pointer(&in.Used)) + return nil +} + +// Convert_core_ResourceQuotaStatus_To_v1_ResourceQuotaStatus is an autogenerated conversion function. +func Convert_core_ResourceQuotaStatus_To_v1_ResourceQuotaStatus(in *core.ResourceQuotaStatus, out *v1.ResourceQuotaStatus, s conversion.Scope) error { + return autoConvert_core_ResourceQuotaStatus_To_v1_ResourceQuotaStatus(in, out, s) +} + +func autoConvert_v1_ResourceRequirements_To_core_ResourceRequirements(in *v1.ResourceRequirements, out *core.ResourceRequirements, s conversion.Scope) error { + out.Limits = *(*core.ResourceList)(unsafe.Pointer(&in.Limits)) + out.Requests = *(*core.ResourceList)(unsafe.Pointer(&in.Requests)) + return nil +} + +// Convert_v1_ResourceRequirements_To_core_ResourceRequirements is an autogenerated conversion function. +func Convert_v1_ResourceRequirements_To_core_ResourceRequirements(in *v1.ResourceRequirements, out *core.ResourceRequirements, s conversion.Scope) error { + return autoConvert_v1_ResourceRequirements_To_core_ResourceRequirements(in, out, s) +} + +func autoConvert_core_ResourceRequirements_To_v1_ResourceRequirements(in *core.ResourceRequirements, out *v1.ResourceRequirements, s conversion.Scope) error { + out.Limits = *(*v1.ResourceList)(unsafe.Pointer(&in.Limits)) + out.Requests = *(*v1.ResourceList)(unsafe.Pointer(&in.Requests)) + return nil +} + +// Convert_core_ResourceRequirements_To_v1_ResourceRequirements is an autogenerated conversion function. +func Convert_core_ResourceRequirements_To_v1_ResourceRequirements(in *core.ResourceRequirements, out *v1.ResourceRequirements, s conversion.Scope) error { + return autoConvert_core_ResourceRequirements_To_v1_ResourceRequirements(in, out, s) +} + +func autoConvert_v1_SELinuxOptions_To_core_SELinuxOptions(in *v1.SELinuxOptions, out *core.SELinuxOptions, s conversion.Scope) error { + out.User = in.User + out.Role = in.Role + out.Type = in.Type + out.Level = in.Level + return nil +} + +// Convert_v1_SELinuxOptions_To_core_SELinuxOptions is an autogenerated conversion function. +func Convert_v1_SELinuxOptions_To_core_SELinuxOptions(in *v1.SELinuxOptions, out *core.SELinuxOptions, s conversion.Scope) error { + return autoConvert_v1_SELinuxOptions_To_core_SELinuxOptions(in, out, s) +} + +func autoConvert_core_SELinuxOptions_To_v1_SELinuxOptions(in *core.SELinuxOptions, out *v1.SELinuxOptions, s conversion.Scope) error { + out.User = in.User + out.Role = in.Role + out.Type = in.Type + out.Level = in.Level + return nil +} + +// Convert_core_SELinuxOptions_To_v1_SELinuxOptions is an autogenerated conversion function. +func Convert_core_SELinuxOptions_To_v1_SELinuxOptions(in *core.SELinuxOptions, out *v1.SELinuxOptions, s conversion.Scope) error { + return autoConvert_core_SELinuxOptions_To_v1_SELinuxOptions(in, out, s) +} + +func autoConvert_v1_ScaleIOPersistentVolumeSource_To_core_ScaleIOPersistentVolumeSource(in *v1.ScaleIOPersistentVolumeSource, out *core.ScaleIOPersistentVolumeSource, s conversion.Scope) error { + out.Gateway = in.Gateway + out.System = in.System + out.SecretRef = (*core.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.SSLEnabled = in.SSLEnabled + out.ProtectionDomain = in.ProtectionDomain + out.StoragePool = in.StoragePool + out.StorageMode = in.StorageMode + out.VolumeName = in.VolumeName + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_ScaleIOPersistentVolumeSource_To_core_ScaleIOPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_ScaleIOPersistentVolumeSource_To_core_ScaleIOPersistentVolumeSource(in *v1.ScaleIOPersistentVolumeSource, out *core.ScaleIOPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_ScaleIOPersistentVolumeSource_To_core_ScaleIOPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_ScaleIOPersistentVolumeSource_To_v1_ScaleIOPersistentVolumeSource(in *core.ScaleIOPersistentVolumeSource, out *v1.ScaleIOPersistentVolumeSource, s conversion.Scope) error { + out.Gateway = in.Gateway + out.System = in.System + out.SecretRef = (*v1.SecretReference)(unsafe.Pointer(in.SecretRef)) + out.SSLEnabled = in.SSLEnabled + out.ProtectionDomain = in.ProtectionDomain + out.StoragePool = in.StoragePool + out.StorageMode = in.StorageMode + out.VolumeName = in.VolumeName + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_ScaleIOPersistentVolumeSource_To_v1_ScaleIOPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_ScaleIOPersistentVolumeSource_To_v1_ScaleIOPersistentVolumeSource(in *core.ScaleIOPersistentVolumeSource, out *v1.ScaleIOPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_ScaleIOPersistentVolumeSource_To_v1_ScaleIOPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_ScaleIOVolumeSource_To_core_ScaleIOVolumeSource(in *v1.ScaleIOVolumeSource, out *core.ScaleIOVolumeSource, s conversion.Scope) error { + out.Gateway = in.Gateway + out.System = in.System + out.SecretRef = (*core.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.SSLEnabled = in.SSLEnabled + out.ProtectionDomain = in.ProtectionDomain + out.StoragePool = in.StoragePool + out.StorageMode = in.StorageMode + out.VolumeName = in.VolumeName + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_v1_ScaleIOVolumeSource_To_core_ScaleIOVolumeSource is an autogenerated conversion function. +func Convert_v1_ScaleIOVolumeSource_To_core_ScaleIOVolumeSource(in *v1.ScaleIOVolumeSource, out *core.ScaleIOVolumeSource, s conversion.Scope) error { + return autoConvert_v1_ScaleIOVolumeSource_To_core_ScaleIOVolumeSource(in, out, s) +} + +func autoConvert_core_ScaleIOVolumeSource_To_v1_ScaleIOVolumeSource(in *core.ScaleIOVolumeSource, out *v1.ScaleIOVolumeSource, s conversion.Scope) error { + out.Gateway = in.Gateway + out.System = in.System + out.SecretRef = (*v1.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + out.SSLEnabled = in.SSLEnabled + out.ProtectionDomain = in.ProtectionDomain + out.StoragePool = in.StoragePool + out.StorageMode = in.StorageMode + out.VolumeName = in.VolumeName + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + return nil +} + +// Convert_core_ScaleIOVolumeSource_To_v1_ScaleIOVolumeSource is an autogenerated conversion function. +func Convert_core_ScaleIOVolumeSource_To_v1_ScaleIOVolumeSource(in *core.ScaleIOVolumeSource, out *v1.ScaleIOVolumeSource, s conversion.Scope) error { + return autoConvert_core_ScaleIOVolumeSource_To_v1_ScaleIOVolumeSource(in, out, s) +} + +func autoConvert_v1_Secret_To_core_Secret(in *v1.Secret, out *core.Secret, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Data = *(*map[string][]byte)(unsafe.Pointer(&in.Data)) + // INFO: in.StringData opted out of conversion generation + out.Type = core.SecretType(in.Type) + return nil +} + +func autoConvert_core_Secret_To_v1_Secret(in *core.Secret, out *v1.Secret, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Data = *(*map[string][]byte)(unsafe.Pointer(&in.Data)) + out.Type = v1.SecretType(in.Type) + return nil +} + +// Convert_core_Secret_To_v1_Secret is an autogenerated conversion function. +func Convert_core_Secret_To_v1_Secret(in *core.Secret, out *v1.Secret, s conversion.Scope) error { + return autoConvert_core_Secret_To_v1_Secret(in, out, s) +} + +func autoConvert_v1_SecretEnvSource_To_core_SecretEnvSource(in *v1.SecretEnvSource, out *core.SecretEnvSource, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_SecretEnvSource_To_core_SecretEnvSource is an autogenerated conversion function. +func Convert_v1_SecretEnvSource_To_core_SecretEnvSource(in *v1.SecretEnvSource, out *core.SecretEnvSource, s conversion.Scope) error { + return autoConvert_v1_SecretEnvSource_To_core_SecretEnvSource(in, out, s) +} + +func autoConvert_core_SecretEnvSource_To_v1_SecretEnvSource(in *core.SecretEnvSource, out *v1.SecretEnvSource, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_SecretEnvSource_To_v1_SecretEnvSource is an autogenerated conversion function. +func Convert_core_SecretEnvSource_To_v1_SecretEnvSource(in *core.SecretEnvSource, out *v1.SecretEnvSource, s conversion.Scope) error { + return autoConvert_core_SecretEnvSource_To_v1_SecretEnvSource(in, out, s) +} + +func autoConvert_v1_SecretKeySelector_To_core_SecretKeySelector(in *v1.SecretKeySelector, out *core.SecretKeySelector, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Key = in.Key + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_SecretKeySelector_To_core_SecretKeySelector is an autogenerated conversion function. +func Convert_v1_SecretKeySelector_To_core_SecretKeySelector(in *v1.SecretKeySelector, out *core.SecretKeySelector, s conversion.Scope) error { + return autoConvert_v1_SecretKeySelector_To_core_SecretKeySelector(in, out, s) +} + +func autoConvert_core_SecretKeySelector_To_v1_SecretKeySelector(in *core.SecretKeySelector, out *v1.SecretKeySelector, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Key = in.Key + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_SecretKeySelector_To_v1_SecretKeySelector is an autogenerated conversion function. +func Convert_core_SecretKeySelector_To_v1_SecretKeySelector(in *core.SecretKeySelector, out *v1.SecretKeySelector, s conversion.Scope) error { + return autoConvert_core_SecretKeySelector_To_v1_SecretKeySelector(in, out, s) +} + +func autoConvert_v1_SecretList_To_core_SecretList(in *v1.SecretList, out *core.SecretList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]core.Secret, len(*in)) + for i := range *in { + if err := Convert_v1_Secret_To_core_Secret(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_SecretList_To_core_SecretList is an autogenerated conversion function. +func Convert_v1_SecretList_To_core_SecretList(in *v1.SecretList, out *core.SecretList, s conversion.Scope) error { + return autoConvert_v1_SecretList_To_core_SecretList(in, out, s) +} + +func autoConvert_core_SecretList_To_v1_SecretList(in *core.SecretList, out *v1.SecretList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]v1.Secret, len(*in)) + for i := range *in { + if err := Convert_core_Secret_To_v1_Secret(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_SecretList_To_v1_SecretList is an autogenerated conversion function. +func Convert_core_SecretList_To_v1_SecretList(in *core.SecretList, out *v1.SecretList, s conversion.Scope) error { + return autoConvert_core_SecretList_To_v1_SecretList(in, out, s) +} + +func autoConvert_v1_SecretProjection_To_core_SecretProjection(in *v1.SecretProjection, out *core.SecretProjection, s conversion.Scope) error { + if err := Convert_v1_LocalObjectReference_To_core_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Items = *(*[]core.KeyToPath)(unsafe.Pointer(&in.Items)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_SecretProjection_To_core_SecretProjection is an autogenerated conversion function. +func Convert_v1_SecretProjection_To_core_SecretProjection(in *v1.SecretProjection, out *core.SecretProjection, s conversion.Scope) error { + return autoConvert_v1_SecretProjection_To_core_SecretProjection(in, out, s) +} + +func autoConvert_core_SecretProjection_To_v1_SecretProjection(in *core.SecretProjection, out *v1.SecretProjection, s conversion.Scope) error { + if err := Convert_core_LocalObjectReference_To_v1_LocalObjectReference(&in.LocalObjectReference, &out.LocalObjectReference, s); err != nil { + return err + } + out.Items = *(*[]v1.KeyToPath)(unsafe.Pointer(&in.Items)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_SecretProjection_To_v1_SecretProjection is an autogenerated conversion function. +func Convert_core_SecretProjection_To_v1_SecretProjection(in *core.SecretProjection, out *v1.SecretProjection, s conversion.Scope) error { + return autoConvert_core_SecretProjection_To_v1_SecretProjection(in, out, s) +} + +func autoConvert_v1_SecretReference_To_core_SecretReference(in *v1.SecretReference, out *core.SecretReference, s conversion.Scope) error { + out.Name = in.Name + out.Namespace = in.Namespace + return nil +} + +// Convert_v1_SecretReference_To_core_SecretReference is an autogenerated conversion function. +func Convert_v1_SecretReference_To_core_SecretReference(in *v1.SecretReference, out *core.SecretReference, s conversion.Scope) error { + return autoConvert_v1_SecretReference_To_core_SecretReference(in, out, s) +} + +func autoConvert_core_SecretReference_To_v1_SecretReference(in *core.SecretReference, out *v1.SecretReference, s conversion.Scope) error { + out.Name = in.Name + out.Namespace = in.Namespace + return nil +} + +// Convert_core_SecretReference_To_v1_SecretReference is an autogenerated conversion function. +func Convert_core_SecretReference_To_v1_SecretReference(in *core.SecretReference, out *v1.SecretReference, s conversion.Scope) error { + return autoConvert_core_SecretReference_To_v1_SecretReference(in, out, s) +} + +func autoConvert_v1_SecretVolumeSource_To_core_SecretVolumeSource(in *v1.SecretVolumeSource, out *core.SecretVolumeSource, s conversion.Scope) error { + out.SecretName = in.SecretName + out.Items = *(*[]core.KeyToPath)(unsafe.Pointer(&in.Items)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_v1_SecretVolumeSource_To_core_SecretVolumeSource is an autogenerated conversion function. +func Convert_v1_SecretVolumeSource_To_core_SecretVolumeSource(in *v1.SecretVolumeSource, out *core.SecretVolumeSource, s conversion.Scope) error { + return autoConvert_v1_SecretVolumeSource_To_core_SecretVolumeSource(in, out, s) +} + +func autoConvert_core_SecretVolumeSource_To_v1_SecretVolumeSource(in *core.SecretVolumeSource, out *v1.SecretVolumeSource, s conversion.Scope) error { + out.SecretName = in.SecretName + out.Items = *(*[]v1.KeyToPath)(unsafe.Pointer(&in.Items)) + out.DefaultMode = (*int32)(unsafe.Pointer(in.DefaultMode)) + out.Optional = (*bool)(unsafe.Pointer(in.Optional)) + return nil +} + +// Convert_core_SecretVolumeSource_To_v1_SecretVolumeSource is an autogenerated conversion function. +func Convert_core_SecretVolumeSource_To_v1_SecretVolumeSource(in *core.SecretVolumeSource, out *v1.SecretVolumeSource, s conversion.Scope) error { + return autoConvert_core_SecretVolumeSource_To_v1_SecretVolumeSource(in, out, s) +} + +func autoConvert_v1_SecurityContext_To_core_SecurityContext(in *v1.SecurityContext, out *core.SecurityContext, s conversion.Scope) error { + out.Capabilities = (*core.Capabilities)(unsafe.Pointer(in.Capabilities)) + out.Privileged = (*bool)(unsafe.Pointer(in.Privileged)) + out.SELinuxOptions = (*core.SELinuxOptions)(unsafe.Pointer(in.SELinuxOptions)) + out.RunAsUser = (*int64)(unsafe.Pointer(in.RunAsUser)) + out.RunAsNonRoot = (*bool)(unsafe.Pointer(in.RunAsNonRoot)) + out.ReadOnlyRootFilesystem = (*bool)(unsafe.Pointer(in.ReadOnlyRootFilesystem)) + out.AllowPrivilegeEscalation = (*bool)(unsafe.Pointer(in.AllowPrivilegeEscalation)) + return nil +} + +// Convert_v1_SecurityContext_To_core_SecurityContext is an autogenerated conversion function. +func Convert_v1_SecurityContext_To_core_SecurityContext(in *v1.SecurityContext, out *core.SecurityContext, s conversion.Scope) error { + return autoConvert_v1_SecurityContext_To_core_SecurityContext(in, out, s) +} + +func autoConvert_core_SecurityContext_To_v1_SecurityContext(in *core.SecurityContext, out *v1.SecurityContext, s conversion.Scope) error { + out.Capabilities = (*v1.Capabilities)(unsafe.Pointer(in.Capabilities)) + out.Privileged = (*bool)(unsafe.Pointer(in.Privileged)) + out.SELinuxOptions = (*v1.SELinuxOptions)(unsafe.Pointer(in.SELinuxOptions)) + out.RunAsUser = (*int64)(unsafe.Pointer(in.RunAsUser)) + out.RunAsNonRoot = (*bool)(unsafe.Pointer(in.RunAsNonRoot)) + out.ReadOnlyRootFilesystem = (*bool)(unsafe.Pointer(in.ReadOnlyRootFilesystem)) + out.AllowPrivilegeEscalation = (*bool)(unsafe.Pointer(in.AllowPrivilegeEscalation)) + return nil +} + +func autoConvert_v1_SerializedReference_To_core_SerializedReference(in *v1.SerializedReference, out *core.SerializedReference, s conversion.Scope) error { + if err := Convert_v1_ObjectReference_To_core_ObjectReference(&in.Reference, &out.Reference, s); err != nil { + return err + } + return nil +} + +// Convert_v1_SerializedReference_To_core_SerializedReference is an autogenerated conversion function. +func Convert_v1_SerializedReference_To_core_SerializedReference(in *v1.SerializedReference, out *core.SerializedReference, s conversion.Scope) error { + return autoConvert_v1_SerializedReference_To_core_SerializedReference(in, out, s) +} + +func autoConvert_core_SerializedReference_To_v1_SerializedReference(in *core.SerializedReference, out *v1.SerializedReference, s conversion.Scope) error { + if err := Convert_core_ObjectReference_To_v1_ObjectReference(&in.Reference, &out.Reference, s); err != nil { + return err + } + return nil +} + +// Convert_core_SerializedReference_To_v1_SerializedReference is an autogenerated conversion function. +func Convert_core_SerializedReference_To_v1_SerializedReference(in *core.SerializedReference, out *v1.SerializedReference, s conversion.Scope) error { + return autoConvert_core_SerializedReference_To_v1_SerializedReference(in, out, s) +} + +func autoConvert_v1_Service_To_core_Service(in *v1.Service, out *core.Service, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_v1_ServiceSpec_To_core_ServiceSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_v1_ServiceStatus_To_core_ServiceStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_v1_Service_To_core_Service is an autogenerated conversion function. +func Convert_v1_Service_To_core_Service(in *v1.Service, out *core.Service, s conversion.Scope) error { + return autoConvert_v1_Service_To_core_Service(in, out, s) +} + +func autoConvert_core_Service_To_v1_Service(in *core.Service, out *v1.Service, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + if err := Convert_core_ServiceSpec_To_v1_ServiceSpec(&in.Spec, &out.Spec, s); err != nil { + return err + } + if err := Convert_core_ServiceStatus_To_v1_ServiceStatus(&in.Status, &out.Status, s); err != nil { + return err + } + return nil +} + +// Convert_core_Service_To_v1_Service is an autogenerated conversion function. +func Convert_core_Service_To_v1_Service(in *core.Service, out *v1.Service, s conversion.Scope) error { + return autoConvert_core_Service_To_v1_Service(in, out, s) +} + +func autoConvert_v1_ServiceAccount_To_core_ServiceAccount(in *v1.ServiceAccount, out *core.ServiceAccount, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Secrets = *(*[]core.ObjectReference)(unsafe.Pointer(&in.Secrets)) + out.ImagePullSecrets = *(*[]core.LocalObjectReference)(unsafe.Pointer(&in.ImagePullSecrets)) + out.AutomountServiceAccountToken = (*bool)(unsafe.Pointer(in.AutomountServiceAccountToken)) + return nil +} + +// Convert_v1_ServiceAccount_To_core_ServiceAccount is an autogenerated conversion function. +func Convert_v1_ServiceAccount_To_core_ServiceAccount(in *v1.ServiceAccount, out *core.ServiceAccount, s conversion.Scope) error { + return autoConvert_v1_ServiceAccount_To_core_ServiceAccount(in, out, s) +} + +func autoConvert_core_ServiceAccount_To_v1_ServiceAccount(in *core.ServiceAccount, out *v1.ServiceAccount, s conversion.Scope) error { + out.ObjectMeta = in.ObjectMeta + out.Secrets = *(*[]v1.ObjectReference)(unsafe.Pointer(&in.Secrets)) + out.ImagePullSecrets = *(*[]v1.LocalObjectReference)(unsafe.Pointer(&in.ImagePullSecrets)) + out.AutomountServiceAccountToken = (*bool)(unsafe.Pointer(in.AutomountServiceAccountToken)) + return nil +} + +// Convert_core_ServiceAccount_To_v1_ServiceAccount is an autogenerated conversion function. +func Convert_core_ServiceAccount_To_v1_ServiceAccount(in *core.ServiceAccount, out *v1.ServiceAccount, s conversion.Scope) error { + return autoConvert_core_ServiceAccount_To_v1_ServiceAccount(in, out, s) +} + +func autoConvert_v1_ServiceAccountList_To_core_ServiceAccountList(in *v1.ServiceAccountList, out *core.ServiceAccountList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]core.ServiceAccount)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_v1_ServiceAccountList_To_core_ServiceAccountList is an autogenerated conversion function. +func Convert_v1_ServiceAccountList_To_core_ServiceAccountList(in *v1.ServiceAccountList, out *core.ServiceAccountList, s conversion.Scope) error { + return autoConvert_v1_ServiceAccountList_To_core_ServiceAccountList(in, out, s) +} + +func autoConvert_core_ServiceAccountList_To_v1_ServiceAccountList(in *core.ServiceAccountList, out *v1.ServiceAccountList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + out.Items = *(*[]v1.ServiceAccount)(unsafe.Pointer(&in.Items)) + return nil +} + +// Convert_core_ServiceAccountList_To_v1_ServiceAccountList is an autogenerated conversion function. +func Convert_core_ServiceAccountList_To_v1_ServiceAccountList(in *core.ServiceAccountList, out *v1.ServiceAccountList, s conversion.Scope) error { + return autoConvert_core_ServiceAccountList_To_v1_ServiceAccountList(in, out, s) +} + +func autoConvert_v1_ServiceList_To_core_ServiceList(in *v1.ServiceList, out *core.ServiceList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]core.Service, len(*in)) + for i := range *in { + if err := Convert_v1_Service_To_core_Service(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_v1_ServiceList_To_core_ServiceList is an autogenerated conversion function. +func Convert_v1_ServiceList_To_core_ServiceList(in *v1.ServiceList, out *core.ServiceList, s conversion.Scope) error { + return autoConvert_v1_ServiceList_To_core_ServiceList(in, out, s) +} + +func autoConvert_core_ServiceList_To_v1_ServiceList(in *core.ServiceList, out *v1.ServiceList, s conversion.Scope) error { + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]v1.Service, len(*in)) + for i := range *in { + if err := Convert_core_Service_To_v1_Service(&(*in)[i], &(*out)[i], s); err != nil { + return err + } + } + } else { + out.Items = nil + } + return nil +} + +// Convert_core_ServiceList_To_v1_ServiceList is an autogenerated conversion function. +func Convert_core_ServiceList_To_v1_ServiceList(in *core.ServiceList, out *v1.ServiceList, s conversion.Scope) error { + return autoConvert_core_ServiceList_To_v1_ServiceList(in, out, s) +} + +func autoConvert_v1_ServicePort_To_core_ServicePort(in *v1.ServicePort, out *core.ServicePort, s conversion.Scope) error { + out.Name = in.Name + out.Protocol = core.Protocol(in.Protocol) + out.Port = in.Port + out.TargetPort = in.TargetPort + out.NodePort = in.NodePort + return nil +} + +// Convert_v1_ServicePort_To_core_ServicePort is an autogenerated conversion function. +func Convert_v1_ServicePort_To_core_ServicePort(in *v1.ServicePort, out *core.ServicePort, s conversion.Scope) error { + return autoConvert_v1_ServicePort_To_core_ServicePort(in, out, s) +} + +func autoConvert_core_ServicePort_To_v1_ServicePort(in *core.ServicePort, out *v1.ServicePort, s conversion.Scope) error { + out.Name = in.Name + out.Protocol = v1.Protocol(in.Protocol) + out.Port = in.Port + out.TargetPort = in.TargetPort + out.NodePort = in.NodePort + return nil +} + +// Convert_core_ServicePort_To_v1_ServicePort is an autogenerated conversion function. +func Convert_core_ServicePort_To_v1_ServicePort(in *core.ServicePort, out *v1.ServicePort, s conversion.Scope) error { + return autoConvert_core_ServicePort_To_v1_ServicePort(in, out, s) +} + +func autoConvert_v1_ServiceProxyOptions_To_core_ServiceProxyOptions(in *v1.ServiceProxyOptions, out *core.ServiceProxyOptions, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_v1_ServiceProxyOptions_To_core_ServiceProxyOptions is an autogenerated conversion function. +func Convert_v1_ServiceProxyOptions_To_core_ServiceProxyOptions(in *v1.ServiceProxyOptions, out *core.ServiceProxyOptions, s conversion.Scope) error { + return autoConvert_v1_ServiceProxyOptions_To_core_ServiceProxyOptions(in, out, s) +} + +func autoConvert_core_ServiceProxyOptions_To_v1_ServiceProxyOptions(in *core.ServiceProxyOptions, out *v1.ServiceProxyOptions, s conversion.Scope) error { + out.Path = in.Path + return nil +} + +// Convert_core_ServiceProxyOptions_To_v1_ServiceProxyOptions is an autogenerated conversion function. +func Convert_core_ServiceProxyOptions_To_v1_ServiceProxyOptions(in *core.ServiceProxyOptions, out *v1.ServiceProxyOptions, s conversion.Scope) error { + return autoConvert_core_ServiceProxyOptions_To_v1_ServiceProxyOptions(in, out, s) +} + +func autoConvert_v1_ServiceSpec_To_core_ServiceSpec(in *v1.ServiceSpec, out *core.ServiceSpec, s conversion.Scope) error { + out.Ports = *(*[]core.ServicePort)(unsafe.Pointer(&in.Ports)) + out.Selector = *(*map[string]string)(unsafe.Pointer(&in.Selector)) + out.ClusterIP = in.ClusterIP + out.Type = core.ServiceType(in.Type) + out.ExternalIPs = *(*[]string)(unsafe.Pointer(&in.ExternalIPs)) + out.SessionAffinity = core.ServiceAffinity(in.SessionAffinity) + out.LoadBalancerIP = in.LoadBalancerIP + out.LoadBalancerSourceRanges = *(*[]string)(unsafe.Pointer(&in.LoadBalancerSourceRanges)) + out.ExternalName = in.ExternalName + out.ExternalTrafficPolicy = core.ServiceExternalTrafficPolicyType(in.ExternalTrafficPolicy) + out.HealthCheckNodePort = in.HealthCheckNodePort + out.PublishNotReadyAddresses = in.PublishNotReadyAddresses + out.SessionAffinityConfig = (*core.SessionAffinityConfig)(unsafe.Pointer(in.SessionAffinityConfig)) + return nil +} + +// Convert_v1_ServiceSpec_To_core_ServiceSpec is an autogenerated conversion function. +func Convert_v1_ServiceSpec_To_core_ServiceSpec(in *v1.ServiceSpec, out *core.ServiceSpec, s conversion.Scope) error { + return autoConvert_v1_ServiceSpec_To_core_ServiceSpec(in, out, s) +} + +func autoConvert_core_ServiceSpec_To_v1_ServiceSpec(in *core.ServiceSpec, out *v1.ServiceSpec, s conversion.Scope) error { + out.Type = v1.ServiceType(in.Type) + out.Ports = *(*[]v1.ServicePort)(unsafe.Pointer(&in.Ports)) + out.Selector = *(*map[string]string)(unsafe.Pointer(&in.Selector)) + out.ClusterIP = in.ClusterIP + out.ExternalName = in.ExternalName + out.ExternalIPs = *(*[]string)(unsafe.Pointer(&in.ExternalIPs)) + out.LoadBalancerIP = in.LoadBalancerIP + out.SessionAffinity = v1.ServiceAffinity(in.SessionAffinity) + out.SessionAffinityConfig = (*v1.SessionAffinityConfig)(unsafe.Pointer(in.SessionAffinityConfig)) + out.LoadBalancerSourceRanges = *(*[]string)(unsafe.Pointer(&in.LoadBalancerSourceRanges)) + out.ExternalTrafficPolicy = v1.ServiceExternalTrafficPolicyType(in.ExternalTrafficPolicy) + out.HealthCheckNodePort = in.HealthCheckNodePort + out.PublishNotReadyAddresses = in.PublishNotReadyAddresses + return nil +} + +// Convert_core_ServiceSpec_To_v1_ServiceSpec is an autogenerated conversion function. +func Convert_core_ServiceSpec_To_v1_ServiceSpec(in *core.ServiceSpec, out *v1.ServiceSpec, s conversion.Scope) error { + return autoConvert_core_ServiceSpec_To_v1_ServiceSpec(in, out, s) +} + +func autoConvert_v1_ServiceStatus_To_core_ServiceStatus(in *v1.ServiceStatus, out *core.ServiceStatus, s conversion.Scope) error { + if err := Convert_v1_LoadBalancerStatus_To_core_LoadBalancerStatus(&in.LoadBalancer, &out.LoadBalancer, s); err != nil { + return err + } + return nil +} + +// Convert_v1_ServiceStatus_To_core_ServiceStatus is an autogenerated conversion function. +func Convert_v1_ServiceStatus_To_core_ServiceStatus(in *v1.ServiceStatus, out *core.ServiceStatus, s conversion.Scope) error { + return autoConvert_v1_ServiceStatus_To_core_ServiceStatus(in, out, s) +} + +func autoConvert_core_ServiceStatus_To_v1_ServiceStatus(in *core.ServiceStatus, out *v1.ServiceStatus, s conversion.Scope) error { + if err := Convert_core_LoadBalancerStatus_To_v1_LoadBalancerStatus(&in.LoadBalancer, &out.LoadBalancer, s); err != nil { + return err + } + return nil +} + +// Convert_core_ServiceStatus_To_v1_ServiceStatus is an autogenerated conversion function. +func Convert_core_ServiceStatus_To_v1_ServiceStatus(in *core.ServiceStatus, out *v1.ServiceStatus, s conversion.Scope) error { + return autoConvert_core_ServiceStatus_To_v1_ServiceStatus(in, out, s) +} + +func autoConvert_v1_SessionAffinityConfig_To_core_SessionAffinityConfig(in *v1.SessionAffinityConfig, out *core.SessionAffinityConfig, s conversion.Scope) error { + out.ClientIP = (*core.ClientIPConfig)(unsafe.Pointer(in.ClientIP)) + return nil +} + +// Convert_v1_SessionAffinityConfig_To_core_SessionAffinityConfig is an autogenerated conversion function. +func Convert_v1_SessionAffinityConfig_To_core_SessionAffinityConfig(in *v1.SessionAffinityConfig, out *core.SessionAffinityConfig, s conversion.Scope) error { + return autoConvert_v1_SessionAffinityConfig_To_core_SessionAffinityConfig(in, out, s) +} + +func autoConvert_core_SessionAffinityConfig_To_v1_SessionAffinityConfig(in *core.SessionAffinityConfig, out *v1.SessionAffinityConfig, s conversion.Scope) error { + out.ClientIP = (*v1.ClientIPConfig)(unsafe.Pointer(in.ClientIP)) + return nil +} + +// Convert_core_SessionAffinityConfig_To_v1_SessionAffinityConfig is an autogenerated conversion function. +func Convert_core_SessionAffinityConfig_To_v1_SessionAffinityConfig(in *core.SessionAffinityConfig, out *v1.SessionAffinityConfig, s conversion.Scope) error { + return autoConvert_core_SessionAffinityConfig_To_v1_SessionAffinityConfig(in, out, s) +} + +func autoConvert_v1_StorageOSPersistentVolumeSource_To_core_StorageOSPersistentVolumeSource(in *v1.StorageOSPersistentVolumeSource, out *core.StorageOSPersistentVolumeSource, s conversion.Scope) error { + out.VolumeName = in.VolumeName + out.VolumeNamespace = in.VolumeNamespace + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.SecretRef = (*core.ObjectReference)(unsafe.Pointer(in.SecretRef)) + return nil +} + +// Convert_v1_StorageOSPersistentVolumeSource_To_core_StorageOSPersistentVolumeSource is an autogenerated conversion function. +func Convert_v1_StorageOSPersistentVolumeSource_To_core_StorageOSPersistentVolumeSource(in *v1.StorageOSPersistentVolumeSource, out *core.StorageOSPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_v1_StorageOSPersistentVolumeSource_To_core_StorageOSPersistentVolumeSource(in, out, s) +} + +func autoConvert_core_StorageOSPersistentVolumeSource_To_v1_StorageOSPersistentVolumeSource(in *core.StorageOSPersistentVolumeSource, out *v1.StorageOSPersistentVolumeSource, s conversion.Scope) error { + out.VolumeName = in.VolumeName + out.VolumeNamespace = in.VolumeNamespace + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.SecretRef = (*v1.ObjectReference)(unsafe.Pointer(in.SecretRef)) + return nil +} + +// Convert_core_StorageOSPersistentVolumeSource_To_v1_StorageOSPersistentVolumeSource is an autogenerated conversion function. +func Convert_core_StorageOSPersistentVolumeSource_To_v1_StorageOSPersistentVolumeSource(in *core.StorageOSPersistentVolumeSource, out *v1.StorageOSPersistentVolumeSource, s conversion.Scope) error { + return autoConvert_core_StorageOSPersistentVolumeSource_To_v1_StorageOSPersistentVolumeSource(in, out, s) +} + +func autoConvert_v1_StorageOSVolumeSource_To_core_StorageOSVolumeSource(in *v1.StorageOSVolumeSource, out *core.StorageOSVolumeSource, s conversion.Scope) error { + out.VolumeName = in.VolumeName + out.VolumeNamespace = in.VolumeNamespace + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.SecretRef = (*core.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + return nil +} + +// Convert_v1_StorageOSVolumeSource_To_core_StorageOSVolumeSource is an autogenerated conversion function. +func Convert_v1_StorageOSVolumeSource_To_core_StorageOSVolumeSource(in *v1.StorageOSVolumeSource, out *core.StorageOSVolumeSource, s conversion.Scope) error { + return autoConvert_v1_StorageOSVolumeSource_To_core_StorageOSVolumeSource(in, out, s) +} + +func autoConvert_core_StorageOSVolumeSource_To_v1_StorageOSVolumeSource(in *core.StorageOSVolumeSource, out *v1.StorageOSVolumeSource, s conversion.Scope) error { + out.VolumeName = in.VolumeName + out.VolumeNamespace = in.VolumeNamespace + out.FSType = in.FSType + out.ReadOnly = in.ReadOnly + out.SecretRef = (*v1.LocalObjectReference)(unsafe.Pointer(in.SecretRef)) + return nil +} + +// Convert_core_StorageOSVolumeSource_To_v1_StorageOSVolumeSource is an autogenerated conversion function. +func Convert_core_StorageOSVolumeSource_To_v1_StorageOSVolumeSource(in *core.StorageOSVolumeSource, out *v1.StorageOSVolumeSource, s conversion.Scope) error { + return autoConvert_core_StorageOSVolumeSource_To_v1_StorageOSVolumeSource(in, out, s) +} + +func autoConvert_v1_Sysctl_To_core_Sysctl(in *v1.Sysctl, out *core.Sysctl, s conversion.Scope) error { + out.Name = in.Name + out.Value = in.Value + return nil +} + +// Convert_v1_Sysctl_To_core_Sysctl is an autogenerated conversion function. +func Convert_v1_Sysctl_To_core_Sysctl(in *v1.Sysctl, out *core.Sysctl, s conversion.Scope) error { + return autoConvert_v1_Sysctl_To_core_Sysctl(in, out, s) +} + +func autoConvert_core_Sysctl_To_v1_Sysctl(in *core.Sysctl, out *v1.Sysctl, s conversion.Scope) error { + out.Name = in.Name + out.Value = in.Value + return nil +} + +// Convert_core_Sysctl_To_v1_Sysctl is an autogenerated conversion function. +func Convert_core_Sysctl_To_v1_Sysctl(in *core.Sysctl, out *v1.Sysctl, s conversion.Scope) error { + return autoConvert_core_Sysctl_To_v1_Sysctl(in, out, s) +} + +func autoConvert_v1_TCPSocketAction_To_core_TCPSocketAction(in *v1.TCPSocketAction, out *core.TCPSocketAction, s conversion.Scope) error { + out.Port = in.Port + out.Host = in.Host + return nil +} + +// Convert_v1_TCPSocketAction_To_core_TCPSocketAction is an autogenerated conversion function. +func Convert_v1_TCPSocketAction_To_core_TCPSocketAction(in *v1.TCPSocketAction, out *core.TCPSocketAction, s conversion.Scope) error { + return autoConvert_v1_TCPSocketAction_To_core_TCPSocketAction(in, out, s) +} + +func autoConvert_core_TCPSocketAction_To_v1_TCPSocketAction(in *core.TCPSocketAction, out *v1.TCPSocketAction, s conversion.Scope) error { + out.Port = in.Port + out.Host = in.Host + return nil +} + +// Convert_core_TCPSocketAction_To_v1_TCPSocketAction is an autogenerated conversion function. +func Convert_core_TCPSocketAction_To_v1_TCPSocketAction(in *core.TCPSocketAction, out *v1.TCPSocketAction, s conversion.Scope) error { + return autoConvert_core_TCPSocketAction_To_v1_TCPSocketAction(in, out, s) +} + +func autoConvert_v1_Taint_To_core_Taint(in *v1.Taint, out *core.Taint, s conversion.Scope) error { + out.Key = in.Key + out.Value = in.Value + out.Effect = core.TaintEffect(in.Effect) + out.TimeAdded = (*meta_v1.Time)(unsafe.Pointer(in.TimeAdded)) + return nil +} + +// Convert_v1_Taint_To_core_Taint is an autogenerated conversion function. +func Convert_v1_Taint_To_core_Taint(in *v1.Taint, out *core.Taint, s conversion.Scope) error { + return autoConvert_v1_Taint_To_core_Taint(in, out, s) +} + +func autoConvert_core_Taint_To_v1_Taint(in *core.Taint, out *v1.Taint, s conversion.Scope) error { + out.Key = in.Key + out.Value = in.Value + out.Effect = v1.TaintEffect(in.Effect) + out.TimeAdded = (*meta_v1.Time)(unsafe.Pointer(in.TimeAdded)) + return nil +} + +// Convert_core_Taint_To_v1_Taint is an autogenerated conversion function. +func Convert_core_Taint_To_v1_Taint(in *core.Taint, out *v1.Taint, s conversion.Scope) error { + return autoConvert_core_Taint_To_v1_Taint(in, out, s) +} + +func autoConvert_v1_Toleration_To_core_Toleration(in *v1.Toleration, out *core.Toleration, s conversion.Scope) error { + out.Key = in.Key + out.Operator = core.TolerationOperator(in.Operator) + out.Value = in.Value + out.Effect = core.TaintEffect(in.Effect) + out.TolerationSeconds = (*int64)(unsafe.Pointer(in.TolerationSeconds)) + return nil +} + +// Convert_v1_Toleration_To_core_Toleration is an autogenerated conversion function. +func Convert_v1_Toleration_To_core_Toleration(in *v1.Toleration, out *core.Toleration, s conversion.Scope) error { + return autoConvert_v1_Toleration_To_core_Toleration(in, out, s) +} + +func autoConvert_core_Toleration_To_v1_Toleration(in *core.Toleration, out *v1.Toleration, s conversion.Scope) error { + out.Key = in.Key + out.Operator = v1.TolerationOperator(in.Operator) + out.Value = in.Value + out.Effect = v1.TaintEffect(in.Effect) + out.TolerationSeconds = (*int64)(unsafe.Pointer(in.TolerationSeconds)) + return nil +} + +// Convert_core_Toleration_To_v1_Toleration is an autogenerated conversion function. +func Convert_core_Toleration_To_v1_Toleration(in *core.Toleration, out *v1.Toleration, s conversion.Scope) error { + return autoConvert_core_Toleration_To_v1_Toleration(in, out, s) +} + +func autoConvert_v1_Volume_To_core_Volume(in *v1.Volume, out *core.Volume, s conversion.Scope) error { + out.Name = in.Name + if err := Convert_v1_VolumeSource_To_core_VolumeSource(&in.VolumeSource, &out.VolumeSource, s); err != nil { + return err + } + return nil +} + +// Convert_v1_Volume_To_core_Volume is an autogenerated conversion function. +func Convert_v1_Volume_To_core_Volume(in *v1.Volume, out *core.Volume, s conversion.Scope) error { + return autoConvert_v1_Volume_To_core_Volume(in, out, s) +} + +func autoConvert_core_Volume_To_v1_Volume(in *core.Volume, out *v1.Volume, s conversion.Scope) error { + out.Name = in.Name + if err := Convert_core_VolumeSource_To_v1_VolumeSource(&in.VolumeSource, &out.VolumeSource, s); err != nil { + return err + } + return nil +} + +// Convert_core_Volume_To_v1_Volume is an autogenerated conversion function. +func Convert_core_Volume_To_v1_Volume(in *core.Volume, out *v1.Volume, s conversion.Scope) error { + return autoConvert_core_Volume_To_v1_Volume(in, out, s) +} + +func autoConvert_v1_VolumeDevice_To_core_VolumeDevice(in *v1.VolumeDevice, out *core.VolumeDevice, s conversion.Scope) error { + out.Name = in.Name + out.DevicePath = in.DevicePath + return nil +} + +// Convert_v1_VolumeDevice_To_core_VolumeDevice is an autogenerated conversion function. +func Convert_v1_VolumeDevice_To_core_VolumeDevice(in *v1.VolumeDevice, out *core.VolumeDevice, s conversion.Scope) error { + return autoConvert_v1_VolumeDevice_To_core_VolumeDevice(in, out, s) +} + +func autoConvert_core_VolumeDevice_To_v1_VolumeDevice(in *core.VolumeDevice, out *v1.VolumeDevice, s conversion.Scope) error { + out.Name = in.Name + out.DevicePath = in.DevicePath + return nil +} + +// Convert_core_VolumeDevice_To_v1_VolumeDevice is an autogenerated conversion function. +func Convert_core_VolumeDevice_To_v1_VolumeDevice(in *core.VolumeDevice, out *v1.VolumeDevice, s conversion.Scope) error { + return autoConvert_core_VolumeDevice_To_v1_VolumeDevice(in, out, s) +} + +func autoConvert_v1_VolumeMount_To_core_VolumeMount(in *v1.VolumeMount, out *core.VolumeMount, s conversion.Scope) error { + out.Name = in.Name + out.ReadOnly = in.ReadOnly + out.MountPath = in.MountPath + out.SubPath = in.SubPath + out.MountPropagation = (*core.MountPropagationMode)(unsafe.Pointer(in.MountPropagation)) + return nil +} + +// Convert_v1_VolumeMount_To_core_VolumeMount is an autogenerated conversion function. +func Convert_v1_VolumeMount_To_core_VolumeMount(in *v1.VolumeMount, out *core.VolumeMount, s conversion.Scope) error { + return autoConvert_v1_VolumeMount_To_core_VolumeMount(in, out, s) +} + +func autoConvert_core_VolumeMount_To_v1_VolumeMount(in *core.VolumeMount, out *v1.VolumeMount, s conversion.Scope) error { + out.Name = in.Name + out.ReadOnly = in.ReadOnly + out.MountPath = in.MountPath + out.SubPath = in.SubPath + out.MountPropagation = (*v1.MountPropagationMode)(unsafe.Pointer(in.MountPropagation)) + return nil +} + +// Convert_core_VolumeMount_To_v1_VolumeMount is an autogenerated conversion function. +func Convert_core_VolumeMount_To_v1_VolumeMount(in *core.VolumeMount, out *v1.VolumeMount, s conversion.Scope) error { + return autoConvert_core_VolumeMount_To_v1_VolumeMount(in, out, s) +} + +func autoConvert_v1_VolumeNodeAffinity_To_core_VolumeNodeAffinity(in *v1.VolumeNodeAffinity, out *core.VolumeNodeAffinity, s conversion.Scope) error { + out.Required = (*core.NodeSelector)(unsafe.Pointer(in.Required)) + return nil +} + +// Convert_v1_VolumeNodeAffinity_To_core_VolumeNodeAffinity is an autogenerated conversion function. +func Convert_v1_VolumeNodeAffinity_To_core_VolumeNodeAffinity(in *v1.VolumeNodeAffinity, out *core.VolumeNodeAffinity, s conversion.Scope) error { + return autoConvert_v1_VolumeNodeAffinity_To_core_VolumeNodeAffinity(in, out, s) +} + +func autoConvert_core_VolumeNodeAffinity_To_v1_VolumeNodeAffinity(in *core.VolumeNodeAffinity, out *v1.VolumeNodeAffinity, s conversion.Scope) error { + out.Required = (*v1.NodeSelector)(unsafe.Pointer(in.Required)) + return nil +} + +// Convert_core_VolumeNodeAffinity_To_v1_VolumeNodeAffinity is an autogenerated conversion function. +func Convert_core_VolumeNodeAffinity_To_v1_VolumeNodeAffinity(in *core.VolumeNodeAffinity, out *v1.VolumeNodeAffinity, s conversion.Scope) error { + return autoConvert_core_VolumeNodeAffinity_To_v1_VolumeNodeAffinity(in, out, s) +} + +func autoConvert_v1_VolumeProjection_To_core_VolumeProjection(in *v1.VolumeProjection, out *core.VolumeProjection, s conversion.Scope) error { + out.Secret = (*core.SecretProjection)(unsafe.Pointer(in.Secret)) + out.DownwardAPI = (*core.DownwardAPIProjection)(unsafe.Pointer(in.DownwardAPI)) + out.ConfigMap = (*core.ConfigMapProjection)(unsafe.Pointer(in.ConfigMap)) + return nil +} + +// Convert_v1_VolumeProjection_To_core_VolumeProjection is an autogenerated conversion function. +func Convert_v1_VolumeProjection_To_core_VolumeProjection(in *v1.VolumeProjection, out *core.VolumeProjection, s conversion.Scope) error { + return autoConvert_v1_VolumeProjection_To_core_VolumeProjection(in, out, s) +} + +func autoConvert_core_VolumeProjection_To_v1_VolumeProjection(in *core.VolumeProjection, out *v1.VolumeProjection, s conversion.Scope) error { + out.Secret = (*v1.SecretProjection)(unsafe.Pointer(in.Secret)) + out.DownwardAPI = (*v1.DownwardAPIProjection)(unsafe.Pointer(in.DownwardAPI)) + out.ConfigMap = (*v1.ConfigMapProjection)(unsafe.Pointer(in.ConfigMap)) + return nil +} + +// Convert_core_VolumeProjection_To_v1_VolumeProjection is an autogenerated conversion function. +func Convert_core_VolumeProjection_To_v1_VolumeProjection(in *core.VolumeProjection, out *v1.VolumeProjection, s conversion.Scope) error { + return autoConvert_core_VolumeProjection_To_v1_VolumeProjection(in, out, s) +} + +func autoConvert_v1_VolumeSource_To_core_VolumeSource(in *v1.VolumeSource, out *core.VolumeSource, s conversion.Scope) error { + out.HostPath = (*core.HostPathVolumeSource)(unsafe.Pointer(in.HostPath)) + out.EmptyDir = (*core.EmptyDirVolumeSource)(unsafe.Pointer(in.EmptyDir)) + out.GCEPersistentDisk = (*core.GCEPersistentDiskVolumeSource)(unsafe.Pointer(in.GCEPersistentDisk)) + out.AWSElasticBlockStore = (*core.AWSElasticBlockStoreVolumeSource)(unsafe.Pointer(in.AWSElasticBlockStore)) + out.GitRepo = (*core.GitRepoVolumeSource)(unsafe.Pointer(in.GitRepo)) + out.Secret = (*core.SecretVolumeSource)(unsafe.Pointer(in.Secret)) + out.NFS = (*core.NFSVolumeSource)(unsafe.Pointer(in.NFS)) + out.ISCSI = (*core.ISCSIVolumeSource)(unsafe.Pointer(in.ISCSI)) + out.Glusterfs = (*core.GlusterfsVolumeSource)(unsafe.Pointer(in.Glusterfs)) + out.PersistentVolumeClaim = (*core.PersistentVolumeClaimVolumeSource)(unsafe.Pointer(in.PersistentVolumeClaim)) + out.RBD = (*core.RBDVolumeSource)(unsafe.Pointer(in.RBD)) + out.FlexVolume = (*core.FlexVolumeSource)(unsafe.Pointer(in.FlexVolume)) + out.Cinder = (*core.CinderVolumeSource)(unsafe.Pointer(in.Cinder)) + out.CephFS = (*core.CephFSVolumeSource)(unsafe.Pointer(in.CephFS)) + out.Flocker = (*core.FlockerVolumeSource)(unsafe.Pointer(in.Flocker)) + out.DownwardAPI = (*core.DownwardAPIVolumeSource)(unsafe.Pointer(in.DownwardAPI)) + out.FC = (*core.FCVolumeSource)(unsafe.Pointer(in.FC)) + out.AzureFile = (*core.AzureFileVolumeSource)(unsafe.Pointer(in.AzureFile)) + out.ConfigMap = (*core.ConfigMapVolumeSource)(unsafe.Pointer(in.ConfigMap)) + out.VsphereVolume = (*core.VsphereVirtualDiskVolumeSource)(unsafe.Pointer(in.VsphereVolume)) + out.Quobyte = (*core.QuobyteVolumeSource)(unsafe.Pointer(in.Quobyte)) + out.AzureDisk = (*core.AzureDiskVolumeSource)(unsafe.Pointer(in.AzureDisk)) + out.PhotonPersistentDisk = (*core.PhotonPersistentDiskVolumeSource)(unsafe.Pointer(in.PhotonPersistentDisk)) + out.Projected = (*core.ProjectedVolumeSource)(unsafe.Pointer(in.Projected)) + out.PortworxVolume = (*core.PortworxVolumeSource)(unsafe.Pointer(in.PortworxVolume)) + out.ScaleIO = (*core.ScaleIOVolumeSource)(unsafe.Pointer(in.ScaleIO)) + out.StorageOS = (*core.StorageOSVolumeSource)(unsafe.Pointer(in.StorageOS)) + return nil +} + +// Convert_v1_VolumeSource_To_core_VolumeSource is an autogenerated conversion function. +func Convert_v1_VolumeSource_To_core_VolumeSource(in *v1.VolumeSource, out *core.VolumeSource, s conversion.Scope) error { + return autoConvert_v1_VolumeSource_To_core_VolumeSource(in, out, s) +} + +func autoConvert_core_VolumeSource_To_v1_VolumeSource(in *core.VolumeSource, out *v1.VolumeSource, s conversion.Scope) error { + out.HostPath = (*v1.HostPathVolumeSource)(unsafe.Pointer(in.HostPath)) + out.EmptyDir = (*v1.EmptyDirVolumeSource)(unsafe.Pointer(in.EmptyDir)) + out.GCEPersistentDisk = (*v1.GCEPersistentDiskVolumeSource)(unsafe.Pointer(in.GCEPersistentDisk)) + out.AWSElasticBlockStore = (*v1.AWSElasticBlockStoreVolumeSource)(unsafe.Pointer(in.AWSElasticBlockStore)) + out.GitRepo = (*v1.GitRepoVolumeSource)(unsafe.Pointer(in.GitRepo)) + out.Secret = (*v1.SecretVolumeSource)(unsafe.Pointer(in.Secret)) + out.NFS = (*v1.NFSVolumeSource)(unsafe.Pointer(in.NFS)) + out.ISCSI = (*v1.ISCSIVolumeSource)(unsafe.Pointer(in.ISCSI)) + out.Glusterfs = (*v1.GlusterfsVolumeSource)(unsafe.Pointer(in.Glusterfs)) + out.PersistentVolumeClaim = (*v1.PersistentVolumeClaimVolumeSource)(unsafe.Pointer(in.PersistentVolumeClaim)) + out.RBD = (*v1.RBDVolumeSource)(unsafe.Pointer(in.RBD)) + out.Quobyte = (*v1.QuobyteVolumeSource)(unsafe.Pointer(in.Quobyte)) + out.FlexVolume = (*v1.FlexVolumeSource)(unsafe.Pointer(in.FlexVolume)) + out.Cinder = (*v1.CinderVolumeSource)(unsafe.Pointer(in.Cinder)) + out.CephFS = (*v1.CephFSVolumeSource)(unsafe.Pointer(in.CephFS)) + out.Flocker = (*v1.FlockerVolumeSource)(unsafe.Pointer(in.Flocker)) + out.DownwardAPI = (*v1.DownwardAPIVolumeSource)(unsafe.Pointer(in.DownwardAPI)) + out.FC = (*v1.FCVolumeSource)(unsafe.Pointer(in.FC)) + out.AzureFile = (*v1.AzureFileVolumeSource)(unsafe.Pointer(in.AzureFile)) + out.ConfigMap = (*v1.ConfigMapVolumeSource)(unsafe.Pointer(in.ConfigMap)) + out.VsphereVolume = (*v1.VsphereVirtualDiskVolumeSource)(unsafe.Pointer(in.VsphereVolume)) + out.AzureDisk = (*v1.AzureDiskVolumeSource)(unsafe.Pointer(in.AzureDisk)) + out.PhotonPersistentDisk = (*v1.PhotonPersistentDiskVolumeSource)(unsafe.Pointer(in.PhotonPersistentDisk)) + out.Projected = (*v1.ProjectedVolumeSource)(unsafe.Pointer(in.Projected)) + out.PortworxVolume = (*v1.PortworxVolumeSource)(unsafe.Pointer(in.PortworxVolume)) + out.ScaleIO = (*v1.ScaleIOVolumeSource)(unsafe.Pointer(in.ScaleIO)) + out.StorageOS = (*v1.StorageOSVolumeSource)(unsafe.Pointer(in.StorageOS)) + return nil +} + +// Convert_core_VolumeSource_To_v1_VolumeSource is an autogenerated conversion function. +func Convert_core_VolumeSource_To_v1_VolumeSource(in *core.VolumeSource, out *v1.VolumeSource, s conversion.Scope) error { + return autoConvert_core_VolumeSource_To_v1_VolumeSource(in, out, s) +} + +func autoConvert_v1_VsphereVirtualDiskVolumeSource_To_core_VsphereVirtualDiskVolumeSource(in *v1.VsphereVirtualDiskVolumeSource, out *core.VsphereVirtualDiskVolumeSource, s conversion.Scope) error { + out.VolumePath = in.VolumePath + out.FSType = in.FSType + out.StoragePolicyName = in.StoragePolicyName + out.StoragePolicyID = in.StoragePolicyID + return nil +} + +// Convert_v1_VsphereVirtualDiskVolumeSource_To_core_VsphereVirtualDiskVolumeSource is an autogenerated conversion function. +func Convert_v1_VsphereVirtualDiskVolumeSource_To_core_VsphereVirtualDiskVolumeSource(in *v1.VsphereVirtualDiskVolumeSource, out *core.VsphereVirtualDiskVolumeSource, s conversion.Scope) error { + return autoConvert_v1_VsphereVirtualDiskVolumeSource_To_core_VsphereVirtualDiskVolumeSource(in, out, s) +} + +func autoConvert_core_VsphereVirtualDiskVolumeSource_To_v1_VsphereVirtualDiskVolumeSource(in *core.VsphereVirtualDiskVolumeSource, out *v1.VsphereVirtualDiskVolumeSource, s conversion.Scope) error { + out.VolumePath = in.VolumePath + out.FSType = in.FSType + out.StoragePolicyName = in.StoragePolicyName + out.StoragePolicyID = in.StoragePolicyID + return nil +} + +// Convert_core_VsphereVirtualDiskVolumeSource_To_v1_VsphereVirtualDiskVolumeSource is an autogenerated conversion function. +func Convert_core_VsphereVirtualDiskVolumeSource_To_v1_VsphereVirtualDiskVolumeSource(in *core.VsphereVirtualDiskVolumeSource, out *v1.VsphereVirtualDiskVolumeSource, s conversion.Scope) error { + return autoConvert_core_VsphereVirtualDiskVolumeSource_To_v1_VsphereVirtualDiskVolumeSource(in, out, s) +} + +func autoConvert_v1_WeightedPodAffinityTerm_To_core_WeightedPodAffinityTerm(in *v1.WeightedPodAffinityTerm, out *core.WeightedPodAffinityTerm, s conversion.Scope) error { + out.Weight = in.Weight + if err := Convert_v1_PodAffinityTerm_To_core_PodAffinityTerm(&in.PodAffinityTerm, &out.PodAffinityTerm, s); err != nil { + return err + } + return nil +} + +// Convert_v1_WeightedPodAffinityTerm_To_core_WeightedPodAffinityTerm is an autogenerated conversion function. +func Convert_v1_WeightedPodAffinityTerm_To_core_WeightedPodAffinityTerm(in *v1.WeightedPodAffinityTerm, out *core.WeightedPodAffinityTerm, s conversion.Scope) error { + return autoConvert_v1_WeightedPodAffinityTerm_To_core_WeightedPodAffinityTerm(in, out, s) +} + +func autoConvert_core_WeightedPodAffinityTerm_To_v1_WeightedPodAffinityTerm(in *core.WeightedPodAffinityTerm, out *v1.WeightedPodAffinityTerm, s conversion.Scope) error { + out.Weight = in.Weight + if err := Convert_core_PodAffinityTerm_To_v1_PodAffinityTerm(&in.PodAffinityTerm, &out.PodAffinityTerm, s); err != nil { + return err + } + return nil +} + +// Convert_core_WeightedPodAffinityTerm_To_v1_WeightedPodAffinityTerm is an autogenerated conversion function. +func Convert_core_WeightedPodAffinityTerm_To_v1_WeightedPodAffinityTerm(in *core.WeightedPodAffinityTerm, out *v1.WeightedPodAffinityTerm, s conversion.Scope) error { + return autoConvert_core_WeightedPodAffinityTerm_To_v1_WeightedPodAffinityTerm(in, out, s) +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/v1/zz_generated.defaults.go b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/zz_generated.defaults.go new file mode 100644 index 000000000..084c9516b --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/v1/zz_generated.defaults.go @@ -0,0 +1,638 @@ +// +build !ignore_autogenerated + +/* +Copyright 2018 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by defaulter-gen. DO NOT EDIT. + +package v1 + +import ( + v1 "k8s.io/api/core/v1" + runtime "k8s.io/apimachinery/pkg/runtime" +) + +// RegisterDefaults adds defaulters functions to the given scheme. +// Public to allow building arbitrary schemes. +// All generated defaulters are covering - they call all nested defaulters. +func RegisterDefaults(scheme *runtime.Scheme) error { + scheme.AddTypeDefaultingFunc(&v1.ConfigMap{}, func(obj interface{}) { SetObjectDefaults_ConfigMap(obj.(*v1.ConfigMap)) }) + scheme.AddTypeDefaultingFunc(&v1.ConfigMapList{}, func(obj interface{}) { SetObjectDefaults_ConfigMapList(obj.(*v1.ConfigMapList)) }) + scheme.AddTypeDefaultingFunc(&v1.Endpoints{}, func(obj interface{}) { SetObjectDefaults_Endpoints(obj.(*v1.Endpoints)) }) + scheme.AddTypeDefaultingFunc(&v1.EndpointsList{}, func(obj interface{}) { SetObjectDefaults_EndpointsList(obj.(*v1.EndpointsList)) }) + scheme.AddTypeDefaultingFunc(&v1.LimitRange{}, func(obj interface{}) { SetObjectDefaults_LimitRange(obj.(*v1.LimitRange)) }) + scheme.AddTypeDefaultingFunc(&v1.LimitRangeList{}, func(obj interface{}) { SetObjectDefaults_LimitRangeList(obj.(*v1.LimitRangeList)) }) + scheme.AddTypeDefaultingFunc(&v1.Namespace{}, func(obj interface{}) { SetObjectDefaults_Namespace(obj.(*v1.Namespace)) }) + scheme.AddTypeDefaultingFunc(&v1.NamespaceList{}, func(obj interface{}) { SetObjectDefaults_NamespaceList(obj.(*v1.NamespaceList)) }) + scheme.AddTypeDefaultingFunc(&v1.Node{}, func(obj interface{}) { SetObjectDefaults_Node(obj.(*v1.Node)) }) + scheme.AddTypeDefaultingFunc(&v1.NodeList{}, func(obj interface{}) { SetObjectDefaults_NodeList(obj.(*v1.NodeList)) }) + scheme.AddTypeDefaultingFunc(&v1.PersistentVolume{}, func(obj interface{}) { SetObjectDefaults_PersistentVolume(obj.(*v1.PersistentVolume)) }) + scheme.AddTypeDefaultingFunc(&v1.PersistentVolumeClaim{}, func(obj interface{}) { SetObjectDefaults_PersistentVolumeClaim(obj.(*v1.PersistentVolumeClaim)) }) + scheme.AddTypeDefaultingFunc(&v1.PersistentVolumeClaimList{}, func(obj interface{}) { + SetObjectDefaults_PersistentVolumeClaimList(obj.(*v1.PersistentVolumeClaimList)) + }) + scheme.AddTypeDefaultingFunc(&v1.PersistentVolumeList{}, func(obj interface{}) { SetObjectDefaults_PersistentVolumeList(obj.(*v1.PersistentVolumeList)) }) + scheme.AddTypeDefaultingFunc(&v1.Pod{}, func(obj interface{}) { SetObjectDefaults_Pod(obj.(*v1.Pod)) }) + scheme.AddTypeDefaultingFunc(&v1.PodList{}, func(obj interface{}) { SetObjectDefaults_PodList(obj.(*v1.PodList)) }) + scheme.AddTypeDefaultingFunc(&v1.PodTemplate{}, func(obj interface{}) { SetObjectDefaults_PodTemplate(obj.(*v1.PodTemplate)) }) + scheme.AddTypeDefaultingFunc(&v1.PodTemplateList{}, func(obj interface{}) { SetObjectDefaults_PodTemplateList(obj.(*v1.PodTemplateList)) }) + scheme.AddTypeDefaultingFunc(&v1.ReplicationController{}, func(obj interface{}) { SetObjectDefaults_ReplicationController(obj.(*v1.ReplicationController)) }) + scheme.AddTypeDefaultingFunc(&v1.ReplicationControllerList{}, func(obj interface{}) { + SetObjectDefaults_ReplicationControllerList(obj.(*v1.ReplicationControllerList)) + }) + scheme.AddTypeDefaultingFunc(&v1.ResourceQuota{}, func(obj interface{}) { SetObjectDefaults_ResourceQuota(obj.(*v1.ResourceQuota)) }) + scheme.AddTypeDefaultingFunc(&v1.ResourceQuotaList{}, func(obj interface{}) { SetObjectDefaults_ResourceQuotaList(obj.(*v1.ResourceQuotaList)) }) + scheme.AddTypeDefaultingFunc(&v1.Secret{}, func(obj interface{}) { SetObjectDefaults_Secret(obj.(*v1.Secret)) }) + scheme.AddTypeDefaultingFunc(&v1.SecretList{}, func(obj interface{}) { SetObjectDefaults_SecretList(obj.(*v1.SecretList)) }) + scheme.AddTypeDefaultingFunc(&v1.Service{}, func(obj interface{}) { SetObjectDefaults_Service(obj.(*v1.Service)) }) + scheme.AddTypeDefaultingFunc(&v1.ServiceList{}, func(obj interface{}) { SetObjectDefaults_ServiceList(obj.(*v1.ServiceList)) }) + return nil +} + +func SetObjectDefaults_ConfigMap(in *v1.ConfigMap) { + SetDefaults_ConfigMap(in) +} + +func SetObjectDefaults_ConfigMapList(in *v1.ConfigMapList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_ConfigMap(a) + } +} + +func SetObjectDefaults_Endpoints(in *v1.Endpoints) { + SetDefaults_Endpoints(in) +} + +func SetObjectDefaults_EndpointsList(in *v1.EndpointsList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_Endpoints(a) + } +} + +func SetObjectDefaults_LimitRange(in *v1.LimitRange) { + for i := range in.Spec.Limits { + a := &in.Spec.Limits[i] + SetDefaults_LimitRangeItem(a) + SetDefaults_ResourceList(&a.Max) + SetDefaults_ResourceList(&a.Min) + SetDefaults_ResourceList(&a.Default) + SetDefaults_ResourceList(&a.DefaultRequest) + SetDefaults_ResourceList(&a.MaxLimitRequestRatio) + } +} + +func SetObjectDefaults_LimitRangeList(in *v1.LimitRangeList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_LimitRange(a) + } +} + +func SetObjectDefaults_Namespace(in *v1.Namespace) { + SetDefaults_NamespaceStatus(&in.Status) +} + +func SetObjectDefaults_NamespaceList(in *v1.NamespaceList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_Namespace(a) + } +} + +func SetObjectDefaults_Node(in *v1.Node) { + SetDefaults_Node(in) + SetDefaults_NodeStatus(&in.Status) + SetDefaults_ResourceList(&in.Status.Capacity) + SetDefaults_ResourceList(&in.Status.Allocatable) +} + +func SetObjectDefaults_NodeList(in *v1.NodeList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_Node(a) + } +} + +func SetObjectDefaults_PersistentVolume(in *v1.PersistentVolume) { + SetDefaults_PersistentVolume(in) + SetDefaults_ResourceList(&in.Spec.Capacity) + if in.Spec.PersistentVolumeSource.HostPath != nil { + SetDefaults_HostPathVolumeSource(in.Spec.PersistentVolumeSource.HostPath) + } + if in.Spec.PersistentVolumeSource.RBD != nil { + SetDefaults_RBDPersistentVolumeSource(in.Spec.PersistentVolumeSource.RBD) + } + if in.Spec.PersistentVolumeSource.ISCSI != nil { + SetDefaults_ISCSIPersistentVolumeSource(in.Spec.PersistentVolumeSource.ISCSI) + } + if in.Spec.PersistentVolumeSource.AzureDisk != nil { + SetDefaults_AzureDiskVolumeSource(in.Spec.PersistentVolumeSource.AzureDisk) + } + if in.Spec.PersistentVolumeSource.ScaleIO != nil { + SetDefaults_ScaleIOPersistentVolumeSource(in.Spec.PersistentVolumeSource.ScaleIO) + } +} + +func SetObjectDefaults_PersistentVolumeClaim(in *v1.PersistentVolumeClaim) { + SetDefaults_PersistentVolumeClaim(in) + SetDefaults_ResourceList(&in.Spec.Resources.Limits) + SetDefaults_ResourceList(&in.Spec.Resources.Requests) + SetDefaults_ResourceList(&in.Status.Capacity) +} + +func SetObjectDefaults_PersistentVolumeClaimList(in *v1.PersistentVolumeClaimList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_PersistentVolumeClaim(a) + } +} + +func SetObjectDefaults_PersistentVolumeList(in *v1.PersistentVolumeList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_PersistentVolume(a) + } +} + +func SetObjectDefaults_Pod(in *v1.Pod) { + SetDefaults_Pod(in) + SetDefaults_PodSpec(&in.Spec) + for i := range in.Spec.Volumes { + a := &in.Spec.Volumes[i] + SetDefaults_Volume(a) + if a.VolumeSource.HostPath != nil { + SetDefaults_HostPathVolumeSource(a.VolumeSource.HostPath) + } + if a.VolumeSource.Secret != nil { + SetDefaults_SecretVolumeSource(a.VolumeSource.Secret) + } + if a.VolumeSource.ISCSI != nil { + SetDefaults_ISCSIVolumeSource(a.VolumeSource.ISCSI) + } + if a.VolumeSource.RBD != nil { + SetDefaults_RBDVolumeSource(a.VolumeSource.RBD) + } + if a.VolumeSource.DownwardAPI != nil { + SetDefaults_DownwardAPIVolumeSource(a.VolumeSource.DownwardAPI) + for j := range a.VolumeSource.DownwardAPI.Items { + b := &a.VolumeSource.DownwardAPI.Items[j] + if b.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.FieldRef) + } + } + } + if a.VolumeSource.ConfigMap != nil { + SetDefaults_ConfigMapVolumeSource(a.VolumeSource.ConfigMap) + } + if a.VolumeSource.AzureDisk != nil { + SetDefaults_AzureDiskVolumeSource(a.VolumeSource.AzureDisk) + } + if a.VolumeSource.Projected != nil { + SetDefaults_ProjectedVolumeSource(a.VolumeSource.Projected) + for j := range a.VolumeSource.Projected.Sources { + b := &a.VolumeSource.Projected.Sources[j] + if b.DownwardAPI != nil { + for k := range b.DownwardAPI.Items { + c := &b.DownwardAPI.Items[k] + if c.FieldRef != nil { + SetDefaults_ObjectFieldSelector(c.FieldRef) + } + } + } + } + } + if a.VolumeSource.ScaleIO != nil { + SetDefaults_ScaleIOVolumeSource(a.VolumeSource.ScaleIO) + } + } + for i := range in.Spec.InitContainers { + a := &in.Spec.InitContainers[i] + SetDefaults_Container(a) + for j := range a.Ports { + b := &a.Ports[j] + SetDefaults_ContainerPort(b) + } + for j := range a.Env { + b := &a.Env[j] + if b.ValueFrom != nil { + if b.ValueFrom.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.ValueFrom.FieldRef) + } + } + } + SetDefaults_ResourceList(&a.Resources.Limits) + SetDefaults_ResourceList(&a.Resources.Requests) + if a.LivenessProbe != nil { + SetDefaults_Probe(a.LivenessProbe) + if a.LivenessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.LivenessProbe.Handler.HTTPGet) + } + } + if a.ReadinessProbe != nil { + SetDefaults_Probe(a.ReadinessProbe) + if a.ReadinessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.ReadinessProbe.Handler.HTTPGet) + } + } + if a.Lifecycle != nil { + if a.Lifecycle.PostStart != nil { + if a.Lifecycle.PostStart.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PostStart.HTTPGet) + } + } + if a.Lifecycle.PreStop != nil { + if a.Lifecycle.PreStop.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PreStop.HTTPGet) + } + } + } + } + for i := range in.Spec.Containers { + a := &in.Spec.Containers[i] + SetDefaults_Container(a) + for j := range a.Ports { + b := &a.Ports[j] + SetDefaults_ContainerPort(b) + } + for j := range a.Env { + b := &a.Env[j] + if b.ValueFrom != nil { + if b.ValueFrom.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.ValueFrom.FieldRef) + } + } + } + SetDefaults_ResourceList(&a.Resources.Limits) + SetDefaults_ResourceList(&a.Resources.Requests) + if a.LivenessProbe != nil { + SetDefaults_Probe(a.LivenessProbe) + if a.LivenessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.LivenessProbe.Handler.HTTPGet) + } + } + if a.ReadinessProbe != nil { + SetDefaults_Probe(a.ReadinessProbe) + if a.ReadinessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.ReadinessProbe.Handler.HTTPGet) + } + } + if a.Lifecycle != nil { + if a.Lifecycle.PostStart != nil { + if a.Lifecycle.PostStart.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PostStart.HTTPGet) + } + } + if a.Lifecycle.PreStop != nil { + if a.Lifecycle.PreStop.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PreStop.HTTPGet) + } + } + } + } +} + +func SetObjectDefaults_PodList(in *v1.PodList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_Pod(a) + } +} + +func SetObjectDefaults_PodTemplate(in *v1.PodTemplate) { + SetDefaults_PodSpec(&in.Template.Spec) + for i := range in.Template.Spec.Volumes { + a := &in.Template.Spec.Volumes[i] + SetDefaults_Volume(a) + if a.VolumeSource.HostPath != nil { + SetDefaults_HostPathVolumeSource(a.VolumeSource.HostPath) + } + if a.VolumeSource.Secret != nil { + SetDefaults_SecretVolumeSource(a.VolumeSource.Secret) + } + if a.VolumeSource.ISCSI != nil { + SetDefaults_ISCSIVolumeSource(a.VolumeSource.ISCSI) + } + if a.VolumeSource.RBD != nil { + SetDefaults_RBDVolumeSource(a.VolumeSource.RBD) + } + if a.VolumeSource.DownwardAPI != nil { + SetDefaults_DownwardAPIVolumeSource(a.VolumeSource.DownwardAPI) + for j := range a.VolumeSource.DownwardAPI.Items { + b := &a.VolumeSource.DownwardAPI.Items[j] + if b.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.FieldRef) + } + } + } + if a.VolumeSource.ConfigMap != nil { + SetDefaults_ConfigMapVolumeSource(a.VolumeSource.ConfigMap) + } + if a.VolumeSource.AzureDisk != nil { + SetDefaults_AzureDiskVolumeSource(a.VolumeSource.AzureDisk) + } + if a.VolumeSource.Projected != nil { + SetDefaults_ProjectedVolumeSource(a.VolumeSource.Projected) + for j := range a.VolumeSource.Projected.Sources { + b := &a.VolumeSource.Projected.Sources[j] + if b.DownwardAPI != nil { + for k := range b.DownwardAPI.Items { + c := &b.DownwardAPI.Items[k] + if c.FieldRef != nil { + SetDefaults_ObjectFieldSelector(c.FieldRef) + } + } + } + } + } + if a.VolumeSource.ScaleIO != nil { + SetDefaults_ScaleIOVolumeSource(a.VolumeSource.ScaleIO) + } + } + for i := range in.Template.Spec.InitContainers { + a := &in.Template.Spec.InitContainers[i] + SetDefaults_Container(a) + for j := range a.Ports { + b := &a.Ports[j] + SetDefaults_ContainerPort(b) + } + for j := range a.Env { + b := &a.Env[j] + if b.ValueFrom != nil { + if b.ValueFrom.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.ValueFrom.FieldRef) + } + } + } + SetDefaults_ResourceList(&a.Resources.Limits) + SetDefaults_ResourceList(&a.Resources.Requests) + if a.LivenessProbe != nil { + SetDefaults_Probe(a.LivenessProbe) + if a.LivenessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.LivenessProbe.Handler.HTTPGet) + } + } + if a.ReadinessProbe != nil { + SetDefaults_Probe(a.ReadinessProbe) + if a.ReadinessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.ReadinessProbe.Handler.HTTPGet) + } + } + if a.Lifecycle != nil { + if a.Lifecycle.PostStart != nil { + if a.Lifecycle.PostStart.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PostStart.HTTPGet) + } + } + if a.Lifecycle.PreStop != nil { + if a.Lifecycle.PreStop.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PreStop.HTTPGet) + } + } + } + } + for i := range in.Template.Spec.Containers { + a := &in.Template.Spec.Containers[i] + SetDefaults_Container(a) + for j := range a.Ports { + b := &a.Ports[j] + SetDefaults_ContainerPort(b) + } + for j := range a.Env { + b := &a.Env[j] + if b.ValueFrom != nil { + if b.ValueFrom.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.ValueFrom.FieldRef) + } + } + } + SetDefaults_ResourceList(&a.Resources.Limits) + SetDefaults_ResourceList(&a.Resources.Requests) + if a.LivenessProbe != nil { + SetDefaults_Probe(a.LivenessProbe) + if a.LivenessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.LivenessProbe.Handler.HTTPGet) + } + } + if a.ReadinessProbe != nil { + SetDefaults_Probe(a.ReadinessProbe) + if a.ReadinessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.ReadinessProbe.Handler.HTTPGet) + } + } + if a.Lifecycle != nil { + if a.Lifecycle.PostStart != nil { + if a.Lifecycle.PostStart.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PostStart.HTTPGet) + } + } + if a.Lifecycle.PreStop != nil { + if a.Lifecycle.PreStop.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PreStop.HTTPGet) + } + } + } + } +} + +func SetObjectDefaults_PodTemplateList(in *v1.PodTemplateList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_PodTemplate(a) + } +} + +func SetObjectDefaults_ReplicationController(in *v1.ReplicationController) { + SetDefaults_ReplicationController(in) + if in.Spec.Template != nil { + SetDefaults_PodSpec(&in.Spec.Template.Spec) + for i := range in.Spec.Template.Spec.Volumes { + a := &in.Spec.Template.Spec.Volumes[i] + SetDefaults_Volume(a) + if a.VolumeSource.HostPath != nil { + SetDefaults_HostPathVolumeSource(a.VolumeSource.HostPath) + } + if a.VolumeSource.Secret != nil { + SetDefaults_SecretVolumeSource(a.VolumeSource.Secret) + } + if a.VolumeSource.ISCSI != nil { + SetDefaults_ISCSIVolumeSource(a.VolumeSource.ISCSI) + } + if a.VolumeSource.RBD != nil { + SetDefaults_RBDVolumeSource(a.VolumeSource.RBD) + } + if a.VolumeSource.DownwardAPI != nil { + SetDefaults_DownwardAPIVolumeSource(a.VolumeSource.DownwardAPI) + for j := range a.VolumeSource.DownwardAPI.Items { + b := &a.VolumeSource.DownwardAPI.Items[j] + if b.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.FieldRef) + } + } + } + if a.VolumeSource.ConfigMap != nil { + SetDefaults_ConfigMapVolumeSource(a.VolumeSource.ConfigMap) + } + if a.VolumeSource.AzureDisk != nil { + SetDefaults_AzureDiskVolumeSource(a.VolumeSource.AzureDisk) + } + if a.VolumeSource.Projected != nil { + SetDefaults_ProjectedVolumeSource(a.VolumeSource.Projected) + for j := range a.VolumeSource.Projected.Sources { + b := &a.VolumeSource.Projected.Sources[j] + if b.DownwardAPI != nil { + for k := range b.DownwardAPI.Items { + c := &b.DownwardAPI.Items[k] + if c.FieldRef != nil { + SetDefaults_ObjectFieldSelector(c.FieldRef) + } + } + } + } + } + if a.VolumeSource.ScaleIO != nil { + SetDefaults_ScaleIOVolumeSource(a.VolumeSource.ScaleIO) + } + } + for i := range in.Spec.Template.Spec.InitContainers { + a := &in.Spec.Template.Spec.InitContainers[i] + SetDefaults_Container(a) + for j := range a.Ports { + b := &a.Ports[j] + SetDefaults_ContainerPort(b) + } + for j := range a.Env { + b := &a.Env[j] + if b.ValueFrom != nil { + if b.ValueFrom.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.ValueFrom.FieldRef) + } + } + } + SetDefaults_ResourceList(&a.Resources.Limits) + SetDefaults_ResourceList(&a.Resources.Requests) + if a.LivenessProbe != nil { + SetDefaults_Probe(a.LivenessProbe) + if a.LivenessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.LivenessProbe.Handler.HTTPGet) + } + } + if a.ReadinessProbe != nil { + SetDefaults_Probe(a.ReadinessProbe) + if a.ReadinessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.ReadinessProbe.Handler.HTTPGet) + } + } + if a.Lifecycle != nil { + if a.Lifecycle.PostStart != nil { + if a.Lifecycle.PostStart.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PostStart.HTTPGet) + } + } + if a.Lifecycle.PreStop != nil { + if a.Lifecycle.PreStop.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PreStop.HTTPGet) + } + } + } + } + for i := range in.Spec.Template.Spec.Containers { + a := &in.Spec.Template.Spec.Containers[i] + SetDefaults_Container(a) + for j := range a.Ports { + b := &a.Ports[j] + SetDefaults_ContainerPort(b) + } + for j := range a.Env { + b := &a.Env[j] + if b.ValueFrom != nil { + if b.ValueFrom.FieldRef != nil { + SetDefaults_ObjectFieldSelector(b.ValueFrom.FieldRef) + } + } + } + SetDefaults_ResourceList(&a.Resources.Limits) + SetDefaults_ResourceList(&a.Resources.Requests) + if a.LivenessProbe != nil { + SetDefaults_Probe(a.LivenessProbe) + if a.LivenessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.LivenessProbe.Handler.HTTPGet) + } + } + if a.ReadinessProbe != nil { + SetDefaults_Probe(a.ReadinessProbe) + if a.ReadinessProbe.Handler.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.ReadinessProbe.Handler.HTTPGet) + } + } + if a.Lifecycle != nil { + if a.Lifecycle.PostStart != nil { + if a.Lifecycle.PostStart.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PostStart.HTTPGet) + } + } + if a.Lifecycle.PreStop != nil { + if a.Lifecycle.PreStop.HTTPGet != nil { + SetDefaults_HTTPGetAction(a.Lifecycle.PreStop.HTTPGet) + } + } + } + } + } +} + +func SetObjectDefaults_ReplicationControllerList(in *v1.ReplicationControllerList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_ReplicationController(a) + } +} + +func SetObjectDefaults_ResourceQuota(in *v1.ResourceQuota) { + SetDefaults_ResourceList(&in.Spec.Hard) + SetDefaults_ResourceList(&in.Status.Hard) + SetDefaults_ResourceList(&in.Status.Used) +} + +func SetObjectDefaults_ResourceQuotaList(in *v1.ResourceQuotaList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_ResourceQuota(a) + } +} + +func SetObjectDefaults_Secret(in *v1.Secret) { + SetDefaults_Secret(in) +} + +func SetObjectDefaults_SecretList(in *v1.SecretList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_Secret(a) + } +} + +func SetObjectDefaults_Service(in *v1.Service) { + SetDefaults_Service(in) +} + +func SetObjectDefaults_ServiceList(in *v1.ServiceList) { + for i := range in.Items { + a := &in.Items[i] + SetObjectDefaults_Service(a) + } +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/validation/doc.go b/vendor/k8s.io/kubernetes/pkg/apis/core/validation/doc.go new file mode 100644 index 000000000..0c1cfaab5 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/validation/doc.go @@ -0,0 +1,19 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Package validation has functions for validating the correctness of api +// objects and explaining what is wrong with them when they aren't valid. +package validation // import "k8s.io/kubernetes/pkg/apis/core/validation" diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/validation/events.go b/vendor/k8s.io/kubernetes/pkg/apis/core/validation/events.go new file mode 100644 index 000000000..ab265bd76 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/validation/events.go @@ -0,0 +1,129 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package validation + +import ( + "fmt" + "time" + + "k8s.io/apimachinery/pkg/api/meta" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + "k8s.io/apimachinery/pkg/runtime/schema" + "k8s.io/apimachinery/pkg/util/validation" + "k8s.io/apimachinery/pkg/util/validation/field" + "k8s.io/kubernetes/pkg/api/legacyscheme" + "k8s.io/kubernetes/pkg/apis/core" +) + +const ( + ReportingInstanceLengthLimit = 128 + ActionLengthLimit = 128 + ReasonLengthLimit = 128 + NoteLengthLimit = 1024 +) + +// ValidateEvent makes sure that the event makes sense. +func ValidateEvent(event *core.Event) field.ErrorList { + allErrs := field.ErrorList{} + // Because go + zeroTime := time.Time{} + + // "New" Events need to have EventTime set, so it's validating old object. + if event.EventTime.Time == zeroTime { + // Make sure event.Namespace and the involvedInvolvedObject.Namespace agree + if len(event.InvolvedObject.Namespace) == 0 { + // event.Namespace must also be empty (or "default", for compatibility with old clients) + if event.Namespace != metav1.NamespaceNone && event.Namespace != metav1.NamespaceDefault { + allErrs = append(allErrs, field.Invalid(field.NewPath("involvedObject", "namespace"), event.InvolvedObject.Namespace, "does not match event.namespace")) + } + } else { + // event namespace must match + if event.Namespace != event.InvolvedObject.Namespace { + allErrs = append(allErrs, field.Invalid(field.NewPath("involvedObject", "namespace"), event.InvolvedObject.Namespace, "does not match event.namespace")) + } + } + + } else { + if len(event.InvolvedObject.Namespace) == 0 && event.Namespace != metav1.NamespaceSystem { + allErrs = append(allErrs, field.Invalid(field.NewPath("involvedObject", "namespace"), event.InvolvedObject.Namespace, "does not match event.namespace")) + } + if len(event.ReportingController) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("reportingController"), "")) + } + for _, msg := range validation.IsQualifiedName(event.ReportingController) { + allErrs = append(allErrs, field.Invalid(field.NewPath("reportingController"), event.ReportingController, msg)) + } + if len(event.ReportingInstance) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("reportingInstance"), "")) + } + if len(event.ReportingInstance) > ReportingInstanceLengthLimit { + allErrs = append(allErrs, field.Invalid(field.NewPath("repotingIntance"), "", fmt.Sprintf("can have at most %v characters", ReportingInstanceLengthLimit))) + } + if len(event.Action) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("action"), "")) + } + if len(event.Action) > ActionLengthLimit { + allErrs = append(allErrs, field.Invalid(field.NewPath("action"), "", fmt.Sprintf("can have at most %v characters", ActionLengthLimit))) + } + if len(event.Reason) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("reason"), "")) + } + if len(event.Reason) > ReasonLengthLimit { + allErrs = append(allErrs, field.Invalid(field.NewPath("reason"), "", fmt.Sprintf("can have at most %v characters", ReasonLengthLimit))) + } + if len(event.Message) > NoteLengthLimit { + allErrs = append(allErrs, field.Invalid(field.NewPath("message"), "", fmt.Sprintf("can have at most %v characters", NoteLengthLimit))) + } + } + + // For kinds we recognize, make sure InvolvedObject.Namespace is set for namespaced kinds + if namespaced, err := isNamespacedKind(event.InvolvedObject.Kind, event.InvolvedObject.APIVersion); err == nil { + if namespaced && len(event.InvolvedObject.Namespace) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("involvedObject", "namespace"), fmt.Sprintf("required for kind %s", event.InvolvedObject.Kind))) + } + if !namespaced && len(event.InvolvedObject.Namespace) > 0 { + allErrs = append(allErrs, field.Invalid(field.NewPath("involvedObject", "namespace"), event.InvolvedObject.Namespace, fmt.Sprintf("not allowed for kind %s", event.InvolvedObject.Kind))) + } + } + + for _, msg := range validation.IsDNS1123Subdomain(event.Namespace) { + allErrs = append(allErrs, field.Invalid(field.NewPath("namespace"), event.Namespace, msg)) + } + return allErrs +} + +// Check whether the kind in groupVersion is scoped at the root of the api hierarchy +func isNamespacedKind(kind, groupVersion string) (bool, error) { + gv, err := schema.ParseGroupVersion(groupVersion) + if err != nil { + return false, err + } + g, err := legacyscheme.Registry.Group(gv.Group) + if err != nil { + return false, err + } + + restMapping, err := g.RESTMapper.RESTMapping(schema.GroupKind{Group: gv.Group, Kind: kind}, gv.Version) + if err != nil { + return false, err + } + scopeName := restMapping.Scope.Name() + if scopeName == meta.RESTScopeNameNamespace { + return true, nil + } + return false, nil +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/validation/validation.go b/vendor/k8s.io/kubernetes/pkg/apis/core/validation/validation.go new file mode 100644 index 000000000..ec93a1968 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/validation/validation.go @@ -0,0 +1,5066 @@ +/* +Copyright 2014 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package validation + +import ( + "encoding/json" + "fmt" + "math" + "net" + "path" + "path/filepath" + "reflect" + "regexp" + "strings" + + "github.com/golang/glog" + + "k8s.io/api/core/v1" + apiequality "k8s.io/apimachinery/pkg/api/equality" + "k8s.io/apimachinery/pkg/api/resource" + apimachineryvalidation "k8s.io/apimachinery/pkg/api/validation" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + unversionedvalidation "k8s.io/apimachinery/pkg/apis/meta/v1/validation" + "k8s.io/apimachinery/pkg/labels" + "k8s.io/apimachinery/pkg/util/diff" + "k8s.io/apimachinery/pkg/util/intstr" + "k8s.io/apimachinery/pkg/util/sets" + "k8s.io/apimachinery/pkg/util/validation" + "k8s.io/apimachinery/pkg/util/validation/field" + utilfeature "k8s.io/apiserver/pkg/util/feature" + apiservice "k8s.io/kubernetes/pkg/api/service" + "k8s.io/kubernetes/pkg/apis/core" + "k8s.io/kubernetes/pkg/apis/core/helper" + podshelper "k8s.io/kubernetes/pkg/apis/core/pods" + corev1 "k8s.io/kubernetes/pkg/apis/core/v1" + v1helper "k8s.io/kubernetes/pkg/apis/core/v1/helper" + "k8s.io/kubernetes/pkg/capabilities" + "k8s.io/kubernetes/pkg/features" + "k8s.io/kubernetes/pkg/fieldpath" + "k8s.io/kubernetes/pkg/master/ports" + "k8s.io/kubernetes/pkg/security/apparmor" +) + +// TODO: delete this global variable when we enable the validation of common +// fields by default. +var RepairMalformedUpdates bool = apimachineryvalidation.RepairMalformedUpdates + +const isNegativeErrorMsg string = apimachineryvalidation.IsNegativeErrorMsg +const isInvalidQuotaResource string = `must be a standard resource for quota` +const fieldImmutableErrorMsg string = apimachineryvalidation.FieldImmutableErrorMsg +const isNotIntegerErrorMsg string = `must be an integer` +const isNotPositiveErrorMsg string = `must be greater than zero` +const csiDriverNameRexpErrMsg string = "must consist of alphanumeric characters, '-', '_' or '.', and must start and end with an alphanumeric character" +const csiDriverNameRexpFmt string = `^[a-zA-Z0-9][-a-zA-Z0-9_.]{0,61}[a-zA-Z-0-9]$` + +var pdPartitionErrorMsg string = validation.InclusiveRangeError(1, 255) +var fileModeErrorMsg string = "must be a number between 0 and 0777 (octal), both inclusive" + +// BannedOwners is a black list of object that are not allowed to be owners. +var BannedOwners = apimachineryvalidation.BannedOwners + +var iscsiInitiatorIqnRegex = regexp.MustCompile(`iqn\.\d{4}-\d{2}\.([[:alnum:]-.]+)(:[^,;*&$|\s]+)$`) +var iscsiInitiatorEuiRegex = regexp.MustCompile(`^eui.[[:alnum:]]{16}$`) +var iscsiInitiatorNaaRegex = regexp.MustCompile(`^naa.[[:alnum:]]{32}$`) + +var csiDriverNameRexp = regexp.MustCompile(csiDriverNameRexpFmt) + +// ValidateHasLabel requires that metav1.ObjectMeta has a Label with key and expectedValue +func ValidateHasLabel(meta metav1.ObjectMeta, fldPath *field.Path, key, expectedValue string) field.ErrorList { + allErrs := field.ErrorList{} + actualValue, found := meta.Labels[key] + if !found { + allErrs = append(allErrs, field.Required(fldPath.Child("labels").Key(key), + fmt.Sprintf("must be '%s'", expectedValue))) + return allErrs + } + if actualValue != expectedValue { + allErrs = append(allErrs, field.Invalid(fldPath.Child("labels").Key(key), meta.Labels, + fmt.Sprintf("must be '%s'", expectedValue))) + } + return allErrs +} + +// ValidateAnnotations validates that a set of annotations are correctly defined. +func ValidateAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + return apimachineryvalidation.ValidateAnnotations(annotations, fldPath) +} + +func ValidateDNS1123Label(value string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for _, msg := range validation.IsDNS1123Label(value) { + allErrs = append(allErrs, field.Invalid(fldPath, value, msg)) + } + return allErrs +} + +// ValidateDNS1123Subdomain validates that a name is a proper DNS subdomain. +func ValidateDNS1123Subdomain(value string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for _, msg := range validation.IsDNS1123Subdomain(value) { + allErrs = append(allErrs, field.Invalid(fldPath, value, msg)) + } + return allErrs +} + +func ValidatePodSpecificAnnotations(annotations map[string]string, spec *core.PodSpec, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if value, isMirror := annotations[core.MirrorPodAnnotationKey]; isMirror { + if len(spec.NodeName) == 0 { + allErrs = append(allErrs, field.Invalid(fldPath.Key(core.MirrorPodAnnotationKey), value, "must set spec.nodeName if mirror pod annotation is set")) + } + } + + if annotations[core.TolerationsAnnotationKey] != "" { + allErrs = append(allErrs, ValidateTolerationsInPodAnnotations(annotations, fldPath)...) + } + + allErrs = append(allErrs, ValidateSeccompPodAnnotations(annotations, fldPath)...) + allErrs = append(allErrs, ValidateAppArmorPodAnnotations(annotations, spec, fldPath)...) + + sysctls, err := helper.SysctlsFromPodAnnotation(annotations[core.SysctlsPodAnnotationKey]) + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Key(core.SysctlsPodAnnotationKey), annotations[core.SysctlsPodAnnotationKey], err.Error())) + } else { + allErrs = append(allErrs, validateSysctls(sysctls, fldPath.Key(core.SysctlsPodAnnotationKey))...) + } + unsafeSysctls, err := helper.SysctlsFromPodAnnotation(annotations[core.UnsafeSysctlsPodAnnotationKey]) + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Key(core.UnsafeSysctlsPodAnnotationKey), annotations[core.UnsafeSysctlsPodAnnotationKey], err.Error())) + } else { + allErrs = append(allErrs, validateSysctls(unsafeSysctls, fldPath.Key(core.UnsafeSysctlsPodAnnotationKey))...) + } + inBoth := sysctlIntersection(sysctls, unsafeSysctls) + if len(inBoth) > 0 { + allErrs = append(allErrs, field.Invalid(fldPath.Key(core.UnsafeSysctlsPodAnnotationKey), strings.Join(inBoth, ", "), "can not be safe and unsafe")) + } + + return allErrs +} + +// ValidateTolerationsInPodAnnotations tests that the serialized tolerations in Pod.Annotations has valid data +func ValidateTolerationsInPodAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + tolerations, err := helper.GetTolerationsFromPodAnnotations(annotations) + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath, core.TolerationsAnnotationKey, err.Error())) + return allErrs + } + + if len(tolerations) > 0 { + allErrs = append(allErrs, ValidateTolerations(tolerations, fldPath.Child(core.TolerationsAnnotationKey))...) + } + + return allErrs +} + +func ValidatePodSpecificAnnotationUpdates(newPod, oldPod *core.Pod, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + newAnnotations := newPod.Annotations + oldAnnotations := oldPod.Annotations + for k, oldVal := range oldAnnotations { + if newVal, exists := newAnnotations[k]; exists && newVal == oldVal { + continue // No change. + } + if strings.HasPrefix(k, apparmor.ContainerAnnotationKeyPrefix) { + allErrs = append(allErrs, field.Forbidden(fldPath.Key(k), "may not remove or update AppArmor annotations")) + } + if k == core.MirrorPodAnnotationKey { + allErrs = append(allErrs, field.Forbidden(fldPath.Key(k), "may not remove or update mirror pod annotation")) + } + } + // Check for additions + for k := range newAnnotations { + if _, ok := oldAnnotations[k]; ok { + continue // No change. + } + if strings.HasPrefix(k, apparmor.ContainerAnnotationKeyPrefix) { + allErrs = append(allErrs, field.Forbidden(fldPath.Key(k), "may not add AppArmor annotations")) + } + if k == core.MirrorPodAnnotationKey { + allErrs = append(allErrs, field.Forbidden(fldPath.Key(k), "may not add mirror pod annotation")) + } + } + allErrs = append(allErrs, ValidatePodSpecificAnnotations(newAnnotations, &newPod.Spec, fldPath)...) + return allErrs +} + +func ValidateEndpointsSpecificAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + return allErrs +} + +// ValidateNameFunc validates that the provided name is valid for a given resource type. +// Not all resources have the same validation rules for names. Prefix is true +// if the name will have a value appended to it. If the name is not valid, +// this returns a list of descriptions of individual characteristics of the +// value that were not valid. Otherwise this returns an empty list or nil. +type ValidateNameFunc apimachineryvalidation.ValidateNameFunc + +// ValidatePodName can be used to check whether the given pod name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidatePodName = NameIsDNSSubdomain + +// ValidateReplicationControllerName can be used to check whether the given replication +// controller name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateReplicationControllerName = NameIsDNSSubdomain + +// ValidateServiceName can be used to check whether the given service name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateServiceName = NameIsDNS1035Label + +// ValidateNodeName can be used to check whether the given node name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateNodeName = NameIsDNSSubdomain + +// ValidateNamespaceName can be used to check whether the given namespace name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateNamespaceName = apimachineryvalidation.ValidateNamespaceName + +// ValidateLimitRangeName can be used to check whether the given limit range name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateLimitRangeName = NameIsDNSSubdomain + +// ValidateResourceQuotaName can be used to check whether the given +// resource quota name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateResourceQuotaName = NameIsDNSSubdomain + +// ValidateSecretName can be used to check whether the given secret name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateSecretName = NameIsDNSSubdomain + +// ValidateServiceAccountName can be used to check whether the given service account name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateServiceAccountName = apimachineryvalidation.ValidateServiceAccountName + +// ValidateEndpointsName can be used to check whether the given endpoints name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateEndpointsName = NameIsDNSSubdomain + +// ValidateClusterName can be used to check whether the given cluster name is valid. +var ValidateClusterName = apimachineryvalidation.ValidateClusterName + +// ValidateClassName can be used to check whether the given class name is valid. +// It is defined here to avoid import cycle between pkg/apis/storage/validation +// (where it should be) and this file. +var ValidateClassName = NameIsDNSSubdomain + +// ValidatePiorityClassName can be used to check whether the given priority +// class name is valid. +var ValidatePriorityClassName = NameIsDNSSubdomain + +// TODO update all references to these functions to point to the apimachineryvalidation ones +// NameIsDNSSubdomain is a ValidateNameFunc for names that must be a DNS subdomain. +func NameIsDNSSubdomain(name string, prefix bool) []string { + return apimachineryvalidation.NameIsDNSSubdomain(name, prefix) +} + +// NameIsDNS1035Label is a ValidateNameFunc for names that must be a DNS 952 label. +func NameIsDNS1035Label(name string, prefix bool) []string { + return apimachineryvalidation.NameIsDNS1035Label(name, prefix) +} + +// Validates that given value is not negative. +func ValidateNonnegativeField(value int64, fldPath *field.Path) field.ErrorList { + return apimachineryvalidation.ValidateNonnegativeField(value, fldPath) +} + +// Validates that a Quantity is not negative +func ValidateNonnegativeQuantity(value resource.Quantity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if value.Cmp(resource.Quantity{}) < 0 { + allErrs = append(allErrs, field.Invalid(fldPath, value.String(), isNegativeErrorMsg)) + } + return allErrs +} + +// Validates that a Quantity is positive +func ValidatePositiveQuantityValue(value resource.Quantity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if value.Cmp(resource.Quantity{}) <= 0 { + allErrs = append(allErrs, field.Invalid(fldPath, value.String(), isNotPositiveErrorMsg)) + } + return allErrs +} + +func ValidateImmutableField(newVal, oldVal interface{}, fldPath *field.Path) field.ErrorList { + return apimachineryvalidation.ValidateImmutableField(newVal, oldVal, fldPath) +} + +func ValidateImmutableAnnotation(newVal string, oldVal string, annotation string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if oldVal != newVal { + allErrs = append(allErrs, field.Invalid(fldPath.Child("annotations", annotation), newVal, fieldImmutableErrorMsg)) + } + return allErrs +} + +// ValidateObjectMeta validates an object's metadata on creation. It expects that name generation has already +// been performed. +// It doesn't return an error for rootscoped resources with namespace, because namespace should already be cleared before. +// TODO: Remove calls to this method scattered in validations of specific resources, e.g., ValidatePodUpdate. +func ValidateObjectMeta(meta *metav1.ObjectMeta, requiresNamespace bool, nameFn ValidateNameFunc, fldPath *field.Path) field.ErrorList { + allErrs := apimachineryvalidation.ValidateObjectMeta(meta, requiresNamespace, apimachineryvalidation.ValidateNameFunc(nameFn), fldPath) + // run additional checks for the finalizer name + for i := range meta.Finalizers { + allErrs = append(allErrs, validateKubeFinalizerName(string(meta.Finalizers[i]), fldPath.Child("finalizers").Index(i))...) + } + return allErrs +} + +// ValidateObjectMetaUpdate validates an object's metadata when updated +func ValidateObjectMetaUpdate(newMeta, oldMeta *metav1.ObjectMeta, fldPath *field.Path) field.ErrorList { + allErrs := apimachineryvalidation.ValidateObjectMetaUpdate(newMeta, oldMeta, fldPath) + // run additional checks for the finalizer name + for i := range newMeta.Finalizers { + allErrs = append(allErrs, validateKubeFinalizerName(string(newMeta.Finalizers[i]), fldPath.Child("finalizers").Index(i))...) + } + + return allErrs +} + +func ValidateVolumes(volumes []core.Volume, fldPath *field.Path) (map[string]core.VolumeSource, field.ErrorList) { + allErrs := field.ErrorList{} + + allNames := sets.String{} + vols := make(map[string]core.VolumeSource) + for i, vol := range volumes { + idxPath := fldPath.Index(i) + namePath := idxPath.Child("name") + el := validateVolumeSource(&vol.VolumeSource, idxPath, vol.Name) + if len(vol.Name) == 0 { + el = append(el, field.Required(namePath, "")) + } else { + el = append(el, ValidateDNS1123Label(vol.Name, namePath)...) + } + if allNames.Has(vol.Name) { + el = append(el, field.Duplicate(namePath, vol.Name)) + } + if len(el) == 0 { + allNames.Insert(vol.Name) + vols[vol.Name] = vol.VolumeSource + } else { + allErrs = append(allErrs, el...) + } + + } + return vols, allErrs +} + +func IsMatchedVolume(name string, volumes map[string]core.VolumeSource) bool { + if _, ok := volumes[name]; ok { + return true + } else { + return false + } +} + +func isMatchedDevice(name string, volumes map[string]core.VolumeSource) (bool, bool) { + if source, ok := volumes[name]; ok { + if source.PersistentVolumeClaim != nil { + return true, true + } else { + return true, false + } + } else { + return false, false + } +} + +func mountNameAlreadyExists(name string, devices map[string]string) bool { + if _, ok := devices[name]; ok { + return true + } else { + return false + } +} + +func mountPathAlreadyExists(mountPath string, devices map[string]string) bool { + for _, devPath := range devices { + if mountPath == devPath { + return true + } + } + + return false +} + +func deviceNameAlreadyExists(name string, mounts map[string]string) bool { + if _, ok := mounts[name]; ok { + return true + } else { + return false + } +} + +func devicePathAlreadyExists(devicePath string, mounts map[string]string) bool { + for _, mountPath := range mounts { + if mountPath == devicePath { + return true + } + } + + return false +} + +func validateVolumeSource(source *core.VolumeSource, fldPath *field.Path, volName string) field.ErrorList { + numVolumes := 0 + allErrs := field.ErrorList{} + if source.EmptyDir != nil { + numVolumes++ + if !utilfeature.DefaultFeatureGate.Enabled(features.LocalStorageCapacityIsolation) { + if source.EmptyDir.SizeLimit != nil && source.EmptyDir.SizeLimit.Cmp(resource.Quantity{}) != 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("emptyDir").Child("sizeLimit"), "SizeLimit field disabled by feature-gate for EmptyDir volumes")) + } + } else { + if source.EmptyDir.SizeLimit != nil && source.EmptyDir.SizeLimit.Cmp(resource.Quantity{}) < 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("emptyDir").Child("sizeLimit"), "SizeLimit field must be a valid resource quantity")) + } + } + if !utilfeature.DefaultFeatureGate.Enabled(features.HugePages) && source.EmptyDir.Medium == core.StorageMediumHugePages { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("emptyDir").Child("medium"), "HugePages medium is disabled by feature-gate for EmptyDir volumes")) + } + } + if source.HostPath != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("hostPath"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateHostPathVolumeSource(source.HostPath, fldPath.Child("hostPath"))...) + } + } + if source.GitRepo != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("gitRepo"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateGitRepoVolumeSource(source.GitRepo, fldPath.Child("gitRepo"))...) + } + } + if source.GCEPersistentDisk != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("gcePersistentDisk"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateGCEPersistentDiskVolumeSource(source.GCEPersistentDisk, fldPath.Child("persistentDisk"))...) + } + } + if source.AWSElasticBlockStore != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("awsElasticBlockStore"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateAWSElasticBlockStoreVolumeSource(source.AWSElasticBlockStore, fldPath.Child("awsElasticBlockStore"))...) + } + } + if source.Secret != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("secret"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateSecretVolumeSource(source.Secret, fldPath.Child("secret"))...) + } + } + if source.NFS != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("nfs"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateNFSVolumeSource(source.NFS, fldPath.Child("nfs"))...) + } + } + if source.ISCSI != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("iscsi"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateISCSIVolumeSource(source.ISCSI, fldPath.Child("iscsi"))...) + } + if source.ISCSI.InitiatorName != nil && len(volName+":"+source.ISCSI.TargetPortal) > 64 { + tooLongErr := "Total length of <volume name>:<iscsi.targetPortal> must be under 64 characters if iscsi.initiatorName is specified." + allErrs = append(allErrs, field.Invalid(fldPath.Child("name"), volName, tooLongErr)) + } + } + if source.Glusterfs != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("glusterfs"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateGlusterfsVolumeSource(source.Glusterfs, fldPath.Child("glusterfs"))...) + } + } + if source.Flocker != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("flocker"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateFlockerVolumeSource(source.Flocker, fldPath.Child("flocker"))...) + } + } + if source.PersistentVolumeClaim != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("persistentVolumeClaim"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validatePersistentClaimVolumeSource(source.PersistentVolumeClaim, fldPath.Child("persistentVolumeClaim"))...) + } + } + if source.RBD != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("rbd"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateRBDVolumeSource(source.RBD, fldPath.Child("rbd"))...) + } + } + if source.Cinder != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("cinder"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateCinderVolumeSource(source.Cinder, fldPath.Child("cinder"))...) + } + } + if source.CephFS != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("cephFS"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateCephFSVolumeSource(source.CephFS, fldPath.Child("cephfs"))...) + } + } + if source.Quobyte != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("quobyte"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateQuobyteVolumeSource(source.Quobyte, fldPath.Child("quobyte"))...) + } + } + if source.DownwardAPI != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("downwarAPI"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateDownwardAPIVolumeSource(source.DownwardAPI, fldPath.Child("downwardAPI"))...) + } + } + if source.FC != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("fc"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateFCVolumeSource(source.FC, fldPath.Child("fc"))...) + } + } + if source.FlexVolume != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("flexVolume"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateFlexVolumeSource(source.FlexVolume, fldPath.Child("flexVolume"))...) + } + } + if source.ConfigMap != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("configMap"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateConfigMapVolumeSource(source.ConfigMap, fldPath.Child("configMap"))...) + } + } + + if source.AzureFile != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("azureFile"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateAzureFile(source.AzureFile, fldPath.Child("azureFile"))...) + } + } + + if source.VsphereVolume != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("vsphereVolume"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateVsphereVolumeSource(source.VsphereVolume, fldPath.Child("vsphereVolume"))...) + } + } + if source.PhotonPersistentDisk != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("photonPersistentDisk"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validatePhotonPersistentDiskVolumeSource(source.PhotonPersistentDisk, fldPath.Child("photonPersistentDisk"))...) + } + } + if source.PortworxVolume != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("portworxVolume"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validatePortworxVolumeSource(source.PortworxVolume, fldPath.Child("portworxVolume"))...) + } + } + if source.AzureDisk != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("azureDisk"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateAzureDisk(source.AzureDisk, fldPath.Child("azureDisk"))...) + } + } + if source.StorageOS != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("storageos"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateStorageOSVolumeSource(source.StorageOS, fldPath.Child("storageos"))...) + } + } + if source.Projected != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("projected"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateProjectedVolumeSource(source.Projected, fldPath.Child("projected"))...) + } + } + if source.ScaleIO != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("scaleIO"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateScaleIOVolumeSource(source.ScaleIO, fldPath.Child("scaleIO"))...) + } + } + + if numVolumes == 0 { + allErrs = append(allErrs, field.Required(fldPath, "must specify a volume type")) + } + + return allErrs +} + +func validateHostPathVolumeSource(hostPath *core.HostPathVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(hostPath.Path) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("path"), "")) + return allErrs + } + + allErrs = append(allErrs, validatePathNoBacksteps(hostPath.Path, fldPath.Child("path"))...) + allErrs = append(allErrs, validateHostPathType(hostPath.Type, fldPath.Child("type"))...) + return allErrs +} + +func validateGitRepoVolumeSource(gitRepo *core.GitRepoVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(gitRepo.Repository) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("repository"), "")) + } + + pathErrs := validateLocalDescendingPath(gitRepo.Directory, fldPath.Child("directory")) + allErrs = append(allErrs, pathErrs...) + return allErrs +} + +func validateISCSIVolumeSource(iscsi *core.ISCSIVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(iscsi.TargetPortal) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("targetPortal"), "")) + } + if len(iscsi.IQN) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("iqn"), "")) + } else { + if !strings.HasPrefix(iscsi.IQN, "iqn") && !strings.HasPrefix(iscsi.IQN, "eui") && !strings.HasPrefix(iscsi.IQN, "naa") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format starting with iqn, eui, or naa")) + } else if strings.HasPrefix(iscsi.IQN, "iqn") && !iscsiInitiatorIqnRegex.MatchString(iscsi.IQN) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } else if strings.HasPrefix(iscsi.IQN, "eui") && !iscsiInitiatorEuiRegex.MatchString(iscsi.IQN) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } else if strings.HasPrefix(iscsi.IQN, "naa") && !iscsiInitiatorNaaRegex.MatchString(iscsi.IQN) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } + } + if iscsi.Lun < 0 || iscsi.Lun > 255 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("lun"), iscsi.Lun, validation.InclusiveRangeError(0, 255))) + } + if (iscsi.DiscoveryCHAPAuth || iscsi.SessionCHAPAuth) && iscsi.SecretRef == nil { + allErrs = append(allErrs, field.Required(fldPath.Child("secretRef"), "")) + } + if iscsi.InitiatorName != nil { + initiator := *iscsi.InitiatorName + if !strings.HasPrefix(initiator, "iqn") && !strings.HasPrefix(initiator, "eui") && !strings.HasPrefix(initiator, "naa") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format starting with iqn, eui, or naa")) + } + if strings.HasPrefix(initiator, "iqn") && !iscsiInitiatorIqnRegex.MatchString(initiator) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } else if strings.HasPrefix(initiator, "eui") && !iscsiInitiatorEuiRegex.MatchString(initiator) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } else if strings.HasPrefix(initiator, "naa") && !iscsiInitiatorNaaRegex.MatchString(initiator) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } + } + return allErrs +} + +func validateISCSIPersistentVolumeSource(iscsi *core.ISCSIPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(iscsi.TargetPortal) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("targetPortal"), "")) + } + if len(iscsi.IQN) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("iqn"), "")) + } else { + if !strings.HasPrefix(iscsi.IQN, "iqn") && !strings.HasPrefix(iscsi.IQN, "eui") && !strings.HasPrefix(iscsi.IQN, "naa") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } else if strings.HasPrefix(iscsi.IQN, "iqn") && !iscsiInitiatorIqnRegex.MatchString(iscsi.IQN) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } else if strings.HasPrefix(iscsi.IQN, "eui") && !iscsiInitiatorEuiRegex.MatchString(iscsi.IQN) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } else if strings.HasPrefix(iscsi.IQN, "naa") && !iscsiInitiatorNaaRegex.MatchString(iscsi.IQN) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("iqn"), iscsi.IQN, "must be valid format")) + } + } + if iscsi.Lun < 0 || iscsi.Lun > 255 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("lun"), iscsi.Lun, validation.InclusiveRangeError(0, 255))) + } + if (iscsi.DiscoveryCHAPAuth || iscsi.SessionCHAPAuth) && iscsi.SecretRef == nil { + allErrs = append(allErrs, field.Required(fldPath.Child("secretRef"), "")) + } + if iscsi.SecretRef != nil { + if len(iscsi.SecretRef.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("secretRef", "name"), "")) + } + } + if iscsi.InitiatorName != nil { + initiator := *iscsi.InitiatorName + if !strings.HasPrefix(initiator, "iqn") && !strings.HasPrefix(initiator, "eui") && !strings.HasPrefix(initiator, "naa") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } + if strings.HasPrefix(initiator, "iqn") && !iscsiInitiatorIqnRegex.MatchString(initiator) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } else if strings.HasPrefix(initiator, "eui") && !iscsiInitiatorEuiRegex.MatchString(initiator) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } else if strings.HasPrefix(initiator, "naa") && !iscsiInitiatorNaaRegex.MatchString(initiator) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("initiatorname"), initiator, "must be valid format")) + } + } + return allErrs +} + +func validateFCVolumeSource(fc *core.FCVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(fc.TargetWWNs) < 1 && len(fc.WWIDs) < 1 { + allErrs = append(allErrs, field.Required(fldPath.Child("targetWWNs"), "must specify either targetWWNs or wwids, but not both")) + } + + if len(fc.TargetWWNs) != 0 && len(fc.WWIDs) != 0 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("targetWWNs"), fc.TargetWWNs, "targetWWNs and wwids can not be specified simultaneously")) + } + + if len(fc.TargetWWNs) != 0 { + if fc.Lun == nil { + allErrs = append(allErrs, field.Required(fldPath.Child("lun"), "lun is required if targetWWNs is specified")) + } else { + if *fc.Lun < 0 || *fc.Lun > 255 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("lun"), fc.Lun, validation.InclusiveRangeError(0, 255))) + } + } + } + return allErrs +} + +func validateGCEPersistentDiskVolumeSource(pd *core.GCEPersistentDiskVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(pd.PDName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("pdName"), "")) + } + if pd.Partition < 0 || pd.Partition > 255 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("partition"), pd.Partition, pdPartitionErrorMsg)) + } + return allErrs +} + +func validateAWSElasticBlockStoreVolumeSource(PD *core.AWSElasticBlockStoreVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(PD.VolumeID) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeID"), "")) + } + if PD.Partition < 0 || PD.Partition > 255 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("partition"), PD.Partition, pdPartitionErrorMsg)) + } + return allErrs +} + +func validateSecretVolumeSource(secretSource *core.SecretVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(secretSource.SecretName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("secretName"), "")) + } + + secretMode := secretSource.DefaultMode + if secretMode != nil && (*secretMode > 0777 || *secretMode < 0) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("defaultMode"), *secretMode, fileModeErrorMsg)) + } + + itemsPath := fldPath.Child("items") + for i, kp := range secretSource.Items { + itemPath := itemsPath.Index(i) + allErrs = append(allErrs, validateKeyToPath(&kp, itemPath)...) + } + return allErrs +} + +func validateConfigMapVolumeSource(configMapSource *core.ConfigMapVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(configMapSource.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } + + configMapMode := configMapSource.DefaultMode + if configMapMode != nil && (*configMapMode > 0777 || *configMapMode < 0) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("defaultMode"), *configMapMode, fileModeErrorMsg)) + } + + itemsPath := fldPath.Child("items") + for i, kp := range configMapSource.Items { + itemPath := itemsPath.Index(i) + allErrs = append(allErrs, validateKeyToPath(&kp, itemPath)...) + } + return allErrs +} + +func validateKeyToPath(kp *core.KeyToPath, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(kp.Key) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("key"), "")) + } + if len(kp.Path) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("path"), "")) + } + allErrs = append(allErrs, validateLocalNonReservedPath(kp.Path, fldPath.Child("path"))...) + if kp.Mode != nil && (*kp.Mode > 0777 || *kp.Mode < 0) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("mode"), *kp.Mode, fileModeErrorMsg)) + } + + return allErrs +} + +func validatePersistentClaimVolumeSource(claim *core.PersistentVolumeClaimVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(claim.ClaimName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("claimName"), "")) + } + return allErrs +} + +func validateNFSVolumeSource(nfs *core.NFSVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(nfs.Server) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("server"), "")) + } + if len(nfs.Path) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("path"), "")) + } + if !path.IsAbs(nfs.Path) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("path"), nfs.Path, "must be an absolute path")) + } + return allErrs +} + +func validateQuobyteVolumeSource(quobyte *core.QuobyteVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(quobyte.Registry) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("registry"), "must be a host:port pair or multiple pairs separated by commas")) + } else { + for _, hostPortPair := range strings.Split(quobyte.Registry, ",") { + if _, _, err := net.SplitHostPort(hostPortPair); err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("registry"), quobyte.Registry, "must be a host:port pair or multiple pairs separated by commas")) + } + } + } + + if len(quobyte.Volume) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volume"), "")) + } + return allErrs +} + +func validateGlusterfsVolumeSource(glusterfs *core.GlusterfsVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(glusterfs.EndpointsName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("endpoints"), "")) + } + if len(glusterfs.Path) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("path"), "")) + } + return allErrs +} + +func validateFlockerVolumeSource(flocker *core.FlockerVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(flocker.DatasetName) == 0 && len(flocker.DatasetUUID) == 0 { + //TODO: consider adding a RequiredOneOf() error for this and similar cases + allErrs = append(allErrs, field.Required(fldPath, "one of datasetName and datasetUUID is required")) + } + if len(flocker.DatasetName) != 0 && len(flocker.DatasetUUID) != 0 { + allErrs = append(allErrs, field.Invalid(fldPath, "resource", "datasetName and datasetUUID can not be specified simultaneously")) + } + if strings.Contains(flocker.DatasetName, "/") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("datasetName"), flocker.DatasetName, "must not contain '/'")) + } + return allErrs +} + +var validVolumeDownwardAPIFieldPathExpressions = sets.NewString( + "metadata.name", + "metadata.namespace", + "metadata.labels", + "metadata.annotations", + "metadata.uid") + +func validateDownwardAPIVolumeFile(file *core.DownwardAPIVolumeFile, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if len(file.Path) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("path"), "")) + } + allErrs = append(allErrs, validateLocalNonReservedPath(file.Path, fldPath.Child("path"))...) + if file.FieldRef != nil { + allErrs = append(allErrs, validateObjectFieldSelector(file.FieldRef, &validVolumeDownwardAPIFieldPathExpressions, fldPath.Child("fieldRef"))...) + if file.ResourceFieldRef != nil { + allErrs = append(allErrs, field.Invalid(fldPath, "resource", "fieldRef and resourceFieldRef can not be specified simultaneously")) + } + } else if file.ResourceFieldRef != nil { + allErrs = append(allErrs, validateContainerResourceFieldSelector(file.ResourceFieldRef, &validContainerResourceFieldPathExpressions, fldPath.Child("resourceFieldRef"), true)...) + } else { + allErrs = append(allErrs, field.Required(fldPath, "one of fieldRef and resourceFieldRef is required")) + } + if file.Mode != nil && (*file.Mode > 0777 || *file.Mode < 0) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("mode"), *file.Mode, fileModeErrorMsg)) + } + + return allErrs +} + +func validateDownwardAPIVolumeSource(downwardAPIVolume *core.DownwardAPIVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + downwardAPIMode := downwardAPIVolume.DefaultMode + if downwardAPIMode != nil && (*downwardAPIMode > 0777 || *downwardAPIMode < 0) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("defaultMode"), *downwardAPIMode, fileModeErrorMsg)) + } + + for _, file := range downwardAPIVolume.Items { + allErrs = append(allErrs, validateDownwardAPIVolumeFile(&file, fldPath)...) + } + return allErrs +} + +func validateProjectionSources(projection *core.ProjectedVolumeSource, projectionMode *int32, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + allPaths := sets.String{} + + for _, source := range projection.Sources { + numSources := 0 + if source.Secret != nil { + if numSources > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("secret"), "may not specify more than 1 volume type")) + } else { + numSources++ + if len(source.Secret.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } + itemsPath := fldPath.Child("items") + for i, kp := range source.Secret.Items { + itemPath := itemsPath.Index(i) + allErrs = append(allErrs, validateKeyToPath(&kp, itemPath)...) + if len(kp.Path) > 0 { + curPath := kp.Path + if !allPaths.Has(curPath) { + allPaths.Insert(curPath) + } else { + allErrs = append(allErrs, field.Invalid(fldPath, source.Secret.Name, "conflicting duplicate paths")) + } + } + } + } + } + if source.ConfigMap != nil { + if numSources > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("configMap"), "may not specify more than 1 volume type")) + } else { + numSources++ + if len(source.ConfigMap.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } + itemsPath := fldPath.Child("items") + for i, kp := range source.ConfigMap.Items { + itemPath := itemsPath.Index(i) + allErrs = append(allErrs, validateKeyToPath(&kp, itemPath)...) + if len(kp.Path) > 0 { + curPath := kp.Path + if !allPaths.Has(curPath) { + allPaths.Insert(curPath) + } else { + allErrs = append(allErrs, field.Invalid(fldPath, source.ConfigMap.Name, "conflicting duplicate paths")) + } + + } + } + } + } + if source.DownwardAPI != nil { + if numSources > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("downwardAPI"), "may not specify more than 1 volume type")) + } else { + numSources++ + for _, file := range source.DownwardAPI.Items { + allErrs = append(allErrs, validateDownwardAPIVolumeFile(&file, fldPath.Child("downwardAPI"))...) + if len(file.Path) > 0 { + curPath := file.Path + if !allPaths.Has(curPath) { + allPaths.Insert(curPath) + } else { + allErrs = append(allErrs, field.Invalid(fldPath, curPath, "conflicting duplicate paths")) + } + + } + } + } + } + } + return allErrs +} + +func validateProjectedVolumeSource(projection *core.ProjectedVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + projectionMode := projection.DefaultMode + if projectionMode != nil && (*projectionMode > 0777 || *projectionMode < 0) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("defaultMode"), *projectionMode, fileModeErrorMsg)) + } + + allErrs = append(allErrs, validateProjectionSources(projection, projectionMode, fldPath)...) + return allErrs +} + +var supportedHostPathTypes = sets.NewString( + string(core.HostPathUnset), + string(core.HostPathDirectoryOrCreate), + string(core.HostPathDirectory), + string(core.HostPathFileOrCreate), + string(core.HostPathFile), + string(core.HostPathSocket), + string(core.HostPathCharDev), + string(core.HostPathBlockDev)) + +func validateHostPathType(hostPathType *core.HostPathType, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if hostPathType != nil && !supportedHostPathTypes.Has(string(*hostPathType)) { + allErrs = append(allErrs, field.NotSupported(fldPath, hostPathType, supportedHostPathTypes.List())) + } + + return allErrs +} + +// This validate will make sure targetPath: +// 1. is not abs path +// 2. does not have any element which is ".." +func validateLocalDescendingPath(targetPath string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if path.IsAbs(targetPath) { + allErrs = append(allErrs, field.Invalid(fldPath, targetPath, "must be a relative path")) + } + + allErrs = append(allErrs, validatePathNoBacksteps(targetPath, fldPath)...) + + return allErrs +} + +// validatePathNoBacksteps makes sure the targetPath does not have any `..` path elements when split +// +// This assumes the OS of the apiserver and the nodes are the same. The same check should be done +// on the node to ensure there are no backsteps. +func validatePathNoBacksteps(targetPath string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + parts := strings.Split(filepath.ToSlash(targetPath), "/") + for _, item := range parts { + if item == ".." { + allErrs = append(allErrs, field.Invalid(fldPath, targetPath, "must not contain '..'")) + break // even for `../../..`, one error is sufficient to make the point + } + } + return allErrs +} + +// validateMountPropagation verifies that MountPropagation field is valid and +// allowed for given container. +func validateMountPropagation(mountPropagation *core.MountPropagationMode, container *core.Container, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if mountPropagation == nil { + return allErrs + } + if !utilfeature.DefaultFeatureGate.Enabled(features.MountPropagation) { + allErrs = append(allErrs, field.Forbidden(fldPath, "mount propagation is disabled by feature-gate")) + return allErrs + } + + supportedMountPropagations := sets.NewString(string(core.MountPropagationBidirectional), string(core.MountPropagationHostToContainer)) + if !supportedMountPropagations.Has(string(*mountPropagation)) { + allErrs = append(allErrs, field.NotSupported(fldPath, *mountPropagation, supportedMountPropagations.List())) + } + + if container == nil { + // The container is not available yet, e.g. during validation of + // PodPreset. Stop validation now, Pod validation will refuse final + // Pods with Bidirectional propagation in non-privileged containers. + return allErrs + } + + privileged := container.SecurityContext != nil && container.SecurityContext.Privileged != nil && *container.SecurityContext.Privileged + if *mountPropagation == core.MountPropagationBidirectional && !privileged { + allErrs = append(allErrs, field.Forbidden(fldPath, "Bidirectional mount propagation is available only to privileged containers")) + } + return allErrs +} + +// This validate will make sure targetPath: +// 1. is not abs path +// 2. does not contain any '..' elements +// 3. does not start with '..' +func validateLocalNonReservedPath(targetPath string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, validateLocalDescendingPath(targetPath, fldPath)...) + // Don't report this error if the check for .. elements already caught it. + if strings.HasPrefix(targetPath, "..") && !strings.HasPrefix(targetPath, "../") { + allErrs = append(allErrs, field.Invalid(fldPath, targetPath, "must not start with '..'")) + } + return allErrs +} + +func validateRBDVolumeSource(rbd *core.RBDVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(rbd.CephMonitors) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("monitors"), "")) + } + if len(rbd.RBDImage) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("image"), "")) + } + return allErrs +} + +func validateRBDPersistentVolumeSource(rbd *core.RBDPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(rbd.CephMonitors) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("monitors"), "")) + } + if len(rbd.RBDImage) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("image"), "")) + } + return allErrs +} + +func validateCinderVolumeSource(cd *core.CinderVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(cd.VolumeID) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeID"), "")) + } + return allErrs +} + +func validateCephFSVolumeSource(cephfs *core.CephFSVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(cephfs.Monitors) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("monitors"), "")) + } + return allErrs +} + +func validateCephFSPersistentVolumeSource(cephfs *core.CephFSPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(cephfs.Monitors) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("monitors"), "")) + } + return allErrs +} + +func validateFlexVolumeSource(fv *core.FlexVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(fv.Driver) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("driver"), "")) + } + + // Make sure user-specified options don't use kubernetes namespaces + for k := range fv.Options { + namespace := k + if parts := strings.SplitN(k, "/", 2); len(parts) == 2 { + namespace = parts[0] + } + normalized := "." + strings.ToLower(namespace) + if strings.HasSuffix(normalized, ".kubernetes.io") || strings.HasSuffix(normalized, ".k8s.io") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("options").Key(k), k, "kubernetes.io and k8s.io namespaces are reserved")) + } + } + + return allErrs +} + +func validateFlexPersistentVolumeSource(fv *core.FlexPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(fv.Driver) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("driver"), "")) + } + + // Make sure user-specified options don't use kubernetes namespaces + for k := range fv.Options { + namespace := k + if parts := strings.SplitN(k, "/", 2); len(parts) == 2 { + namespace = parts[0] + } + normalized := "." + strings.ToLower(namespace) + if strings.HasSuffix(normalized, ".kubernetes.io") || strings.HasSuffix(normalized, ".k8s.io") { + allErrs = append(allErrs, field.Invalid(fldPath.Child("options").Key(k), k, "kubernetes.io and k8s.io namespaces are reserved")) + } + } + + return allErrs +} + +func validateAzureFile(azure *core.AzureFileVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if azure.SecretName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("secretName"), "")) + } + if azure.ShareName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("shareName"), "")) + } + return allErrs +} + +func validateAzureFilePV(azure *core.AzureFilePersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if azure.SecretName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("secretName"), "")) + } + if azure.ShareName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("shareName"), "")) + } + if azure.SecretNamespace != nil { + if len(*azure.SecretNamespace) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("secretNamespace"), "")) + } + } + return allErrs +} + +func validateAzureDisk(azure *core.AzureDiskVolumeSource, fldPath *field.Path) field.ErrorList { + var supportedCachingModes = sets.NewString(string(core.AzureDataDiskCachingNone), string(core.AzureDataDiskCachingReadOnly), string(core.AzureDataDiskCachingReadWrite)) + var supportedDiskKinds = sets.NewString(string(core.AzureSharedBlobDisk), string(core.AzureDedicatedBlobDisk), string(core.AzureManagedDisk)) + + diskUriSupportedManaged := []string{"/subscriptions/{sub-id}/resourcegroups/{group-name}/providers/microsoft.compute/disks/{disk-id}"} + diskUriSupportedblob := []string{"https://{account-name}.blob.core.windows.net/{container-name}/{disk-name}.vhd"} + + allErrs := field.ErrorList{} + if azure.DiskName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("diskName"), "")) + } + + if azure.DataDiskURI == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("diskURI"), "")) + } + + if azure.CachingMode != nil && !supportedCachingModes.Has(string(*azure.CachingMode)) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("cachingMode"), *azure.CachingMode, supportedCachingModes.List())) + } + + if azure.Kind != nil && !supportedDiskKinds.Has(string(*azure.Kind)) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("kind"), *azure.Kind, supportedDiskKinds.List())) + } + + // validate that DiskUri is the correct format + if azure.Kind != nil && *azure.Kind == core.AzureManagedDisk && strings.Index(azure.DataDiskURI, "/subscriptions/") != 0 { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("diskURI"), azure.DataDiskURI, diskUriSupportedManaged)) + } + + if azure.Kind != nil && *azure.Kind != core.AzureManagedDisk && strings.Index(azure.DataDiskURI, "https://") != 0 { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("diskURI"), azure.DataDiskURI, diskUriSupportedblob)) + } + + return allErrs +} + +func validateVsphereVolumeSource(cd *core.VsphereVirtualDiskVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(cd.VolumePath) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumePath"), "")) + } + return allErrs +} + +func validatePhotonPersistentDiskVolumeSource(cd *core.PhotonPersistentDiskVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(cd.PdID) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("pdID"), "")) + } + return allErrs +} + +func validatePortworxVolumeSource(pwx *core.PortworxVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(pwx.VolumeID) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeID"), "")) + } + return allErrs +} + +func validateScaleIOVolumeSource(sio *core.ScaleIOVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if sio.Gateway == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("gateway"), "")) + } + if sio.System == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("system"), "")) + } + if sio.VolumeName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeName"), "")) + } + return allErrs +} + +func validateScaleIOPersistentVolumeSource(sio *core.ScaleIOPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if sio.Gateway == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("gateway"), "")) + } + if sio.System == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("system"), "")) + } + if sio.VolumeName == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeName"), "")) + } + return allErrs +} + +func validateLocalVolumeSource(ls *core.LocalVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if ls.Path == "" { + allErrs = append(allErrs, field.Required(fldPath.Child("path"), "")) + return allErrs + } + + if !path.IsAbs(ls.Path) { + allErrs = append(allErrs, field.Invalid(fldPath, ls.Path, "must be an absolute path")) + } + allErrs = append(allErrs, validatePathNoBacksteps(ls.Path, fldPath.Child("path"))...) + return allErrs +} + +func validateStorageOSVolumeSource(storageos *core.StorageOSVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(storageos.VolumeName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeName"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(storageos.VolumeName, fldPath.Child("volumeName"))...) + } + if len(storageos.VolumeNamespace) > 0 { + allErrs = append(allErrs, ValidateDNS1123Label(storageos.VolumeNamespace, fldPath.Child("volumeNamespace"))...) + } + if storageos.SecretRef != nil { + if len(storageos.SecretRef.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("secretRef", "name"), "")) + } + } + return allErrs +} + +func validateStorageOSPersistentVolumeSource(storageos *core.StorageOSPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(storageos.VolumeName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeName"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(storageos.VolumeName, fldPath.Child("volumeName"))...) + } + if len(storageos.VolumeNamespace) > 0 { + allErrs = append(allErrs, ValidateDNS1123Label(storageos.VolumeNamespace, fldPath.Child("volumeNamespace"))...) + } + if storageos.SecretRef != nil { + if len(storageos.SecretRef.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("secretRef", "name"), "")) + } + if len(storageos.SecretRef.Namespace) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("secretRef", "namespace"), "")) + } + } + return allErrs +} + +func validateCSIPersistentVolumeSource(csi *core.CSIPersistentVolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if !utilfeature.DefaultFeatureGate.Enabled(features.CSIPersistentVolume) { + allErrs = append(allErrs, field.Forbidden(fldPath, "CSIPersistentVolume disabled by feature-gate")) + } + + if len(csi.Driver) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("driver"), "")) + } + + if len(csi.Driver) > 63 { + allErrs = append(allErrs, field.TooLong(fldPath.Child("driver"), csi.Driver, 63)) + } + + if !csiDriverNameRexp.MatchString(csi.Driver) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("driver"), csi.Driver, validation.RegexError(csiDriverNameRexpErrMsg, csiDriverNameRexpFmt, "csi-hostpath"))) + } + + if len(csi.VolumeHandle) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("volumeHandle"), "")) + } + + if csi.ControllerPublishSecretRef != nil { + if len(csi.ControllerPublishSecretRef.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("controllerPublishSecretRef", "name"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(csi.ControllerPublishSecretRef.Name, fldPath.Child("name"))...) + } + if len(csi.ControllerPublishSecretRef.Namespace) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("controllerPublishSecretRef", "namespace"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(csi.ControllerPublishSecretRef.Namespace, fldPath.Child("namespace"))...) + } + } + + if csi.NodePublishSecretRef != nil { + if len(csi.NodePublishSecretRef.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("nodePublishSecretRef ", "name"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(csi.NodePublishSecretRef.Name, fldPath.Child("name"))...) + } + if len(csi.NodePublishSecretRef.Namespace) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("nodePublishSecretRef ", "namespace"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(csi.NodePublishSecretRef.Namespace, fldPath.Child("namespace"))...) + } + } + + if csi.NodeStageSecretRef != nil { + if len(csi.NodeStageSecretRef.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("nodeStageSecretRef", "name"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(csi.NodeStageSecretRef.Name, fldPath.Child("name"))...) + } + if len(csi.NodeStageSecretRef.Namespace) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("nodeStageSecretRef", "namespace"), "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(csi.NodeStageSecretRef.Namespace, fldPath.Child("namespace"))...) + } + } + + return allErrs +} + +// ValidatePersistentVolumeName checks that a name is appropriate for a +// PersistentVolumeName object. +var ValidatePersistentVolumeName = NameIsDNSSubdomain + +var supportedAccessModes = sets.NewString(string(core.ReadWriteOnce), string(core.ReadOnlyMany), string(core.ReadWriteMany)) + +var supportedReclaimPolicy = sets.NewString(string(core.PersistentVolumeReclaimDelete), string(core.PersistentVolumeReclaimRecycle), string(core.PersistentVolumeReclaimRetain)) + +var supportedVolumeModes = sets.NewString(string(core.PersistentVolumeBlock), string(core.PersistentVolumeFilesystem)) + +func ValidatePersistentVolume(pv *core.PersistentVolume) field.ErrorList { + metaPath := field.NewPath("metadata") + allErrs := ValidateObjectMeta(&pv.ObjectMeta, false, ValidatePersistentVolumeName, metaPath) + + specPath := field.NewPath("spec") + if len(pv.Spec.AccessModes) == 0 { + allErrs = append(allErrs, field.Required(specPath.Child("accessModes"), "")) + } + for _, mode := range pv.Spec.AccessModes { + if !supportedAccessModes.Has(string(mode)) { + allErrs = append(allErrs, field.NotSupported(specPath.Child("accessModes"), mode, supportedAccessModes.List())) + } + } + + if len(pv.Spec.Capacity) == 0 { + allErrs = append(allErrs, field.Required(specPath.Child("capacity"), "")) + } + + if _, ok := pv.Spec.Capacity[core.ResourceStorage]; !ok || len(pv.Spec.Capacity) > 1 { + allErrs = append(allErrs, field.NotSupported(specPath.Child("capacity"), pv.Spec.Capacity, []string{string(core.ResourceStorage)})) + } + capPath := specPath.Child("capacity") + for r, qty := range pv.Spec.Capacity { + allErrs = append(allErrs, validateBasicResource(qty, capPath.Key(string(r)))...) + allErrs = append(allErrs, ValidatePositiveQuantityValue(qty, capPath.Key(string(r)))...) + } + if len(string(pv.Spec.PersistentVolumeReclaimPolicy)) > 0 { + if !supportedReclaimPolicy.Has(string(pv.Spec.PersistentVolumeReclaimPolicy)) { + allErrs = append(allErrs, field.NotSupported(specPath.Child("persistentVolumeReclaimPolicy"), pv.Spec.PersistentVolumeReclaimPolicy, supportedReclaimPolicy.List())) + } + } + + nodeAffinitySpecified, errs := validateStorageNodeAffinityAnnotation(pv.ObjectMeta.Annotations, metaPath.Child("annotations")) + allErrs = append(allErrs, errs...) + + volumeNodeAffinitySpecified, errs := validateVolumeNodeAffinity(pv.Spec.NodeAffinity, specPath.Child("nodeAffinity")) + allErrs = append(allErrs, errs...) + + if nodeAffinitySpecified && volumeNodeAffinitySpecified { + allErrs = append(allErrs, field.Forbidden(specPath.Child("nodeAffinity"), "may not specify both alpha nodeAffinity annotation and nodeAffinity field")) + } + + nodeAffinitySpecified = nodeAffinitySpecified || volumeNodeAffinitySpecified + + numVolumes := 0 + if pv.Spec.HostPath != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("hostPath"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateHostPathVolumeSource(pv.Spec.HostPath, specPath.Child("hostPath"))...) + } + } + if pv.Spec.GCEPersistentDisk != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("gcePersistentDisk"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateGCEPersistentDiskVolumeSource(pv.Spec.GCEPersistentDisk, specPath.Child("persistentDisk"))...) + } + } + if pv.Spec.AWSElasticBlockStore != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("awsElasticBlockStore"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateAWSElasticBlockStoreVolumeSource(pv.Spec.AWSElasticBlockStore, specPath.Child("awsElasticBlockStore"))...) + } + } + if pv.Spec.Glusterfs != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("glusterfs"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateGlusterfsVolumeSource(pv.Spec.Glusterfs, specPath.Child("glusterfs"))...) + } + } + if pv.Spec.Flocker != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("flocker"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateFlockerVolumeSource(pv.Spec.Flocker, specPath.Child("flocker"))...) + } + } + if pv.Spec.NFS != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("nfs"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateNFSVolumeSource(pv.Spec.NFS, specPath.Child("nfs"))...) + } + } + if pv.Spec.RBD != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("rbd"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateRBDPersistentVolumeSource(pv.Spec.RBD, specPath.Child("rbd"))...) + } + } + if pv.Spec.Quobyte != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("quobyte"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateQuobyteVolumeSource(pv.Spec.Quobyte, specPath.Child("quobyte"))...) + } + } + if pv.Spec.CephFS != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("cephFS"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateCephFSPersistentVolumeSource(pv.Spec.CephFS, specPath.Child("cephfs"))...) + } + } + if pv.Spec.ISCSI != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("iscsi"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateISCSIPersistentVolumeSource(pv.Spec.ISCSI, specPath.Child("iscsi"))...) + } + if pv.Spec.ISCSI.InitiatorName != nil && len(pv.ObjectMeta.Name+":"+pv.Spec.ISCSI.TargetPortal) > 64 { + tooLongErr := "Total length of <volume name>:<iscsi.targetPortal> must be under 64 characters if iscsi.initiatorName is specified." + allErrs = append(allErrs, field.Invalid(metaPath.Child("name"), pv.ObjectMeta.Name, tooLongErr)) + } + } + if pv.Spec.Cinder != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("cinder"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateCinderVolumeSource(pv.Spec.Cinder, specPath.Child("cinder"))...) + } + } + if pv.Spec.FC != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("fc"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateFCVolumeSource(pv.Spec.FC, specPath.Child("fc"))...) + } + } + if pv.Spec.FlexVolume != nil { + numVolumes++ + allErrs = append(allErrs, validateFlexPersistentVolumeSource(pv.Spec.FlexVolume, specPath.Child("flexVolume"))...) + } + if pv.Spec.AzureFile != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("azureFile"), "may not specify more than 1 volume type")) + + } else { + numVolumes++ + allErrs = append(allErrs, validateAzureFilePV(pv.Spec.AzureFile, specPath.Child("azureFile"))...) + } + } + + if pv.Spec.VsphereVolume != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("vsphereVolume"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateVsphereVolumeSource(pv.Spec.VsphereVolume, specPath.Child("vsphereVolume"))...) + } + } + if pv.Spec.PhotonPersistentDisk != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("photonPersistentDisk"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validatePhotonPersistentDiskVolumeSource(pv.Spec.PhotonPersistentDisk, specPath.Child("photonPersistentDisk"))...) + } + } + if pv.Spec.PortworxVolume != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("portworxVolume"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validatePortworxVolumeSource(pv.Spec.PortworxVolume, specPath.Child("portworxVolume"))...) + } + } + if pv.Spec.AzureDisk != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("azureDisk"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateAzureDisk(pv.Spec.AzureDisk, specPath.Child("azureDisk"))...) + } + } + if pv.Spec.ScaleIO != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("scaleIO"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateScaleIOPersistentVolumeSource(pv.Spec.ScaleIO, specPath.Child("scaleIO"))...) + } + } + if pv.Spec.Local != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("local"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + if !utilfeature.DefaultFeatureGate.Enabled(features.PersistentLocalVolumes) { + allErrs = append(allErrs, field.Forbidden(specPath.Child("local"), "Local volumes are disabled by feature-gate")) + } + allErrs = append(allErrs, validateLocalVolumeSource(pv.Spec.Local, specPath.Child("local"))...) + + // NodeAffinity is required + if !nodeAffinitySpecified { + allErrs = append(allErrs, field.Required(metaPath.Child("annotations"), "Local volume requires node affinity")) + } + } + } + if pv.Spec.StorageOS != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("storageos"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateStorageOSPersistentVolumeSource(pv.Spec.StorageOS, specPath.Child("storageos"))...) + } + } + + if pv.Spec.CSI != nil { + if numVolumes > 0 { + allErrs = append(allErrs, field.Forbidden(specPath.Child("csi"), "may not specify more than 1 volume type")) + } else { + numVolumes++ + allErrs = append(allErrs, validateCSIPersistentVolumeSource(pv.Spec.CSI, specPath.Child("csi"))...) + } + } + + if numVolumes == 0 { + allErrs = append(allErrs, field.Required(specPath, "must specify a volume type")) + } + + // do not allow hostPath mounts of '/' to have a 'recycle' reclaim policy + if pv.Spec.HostPath != nil && path.Clean(pv.Spec.HostPath.Path) == "/" && pv.Spec.PersistentVolumeReclaimPolicy == core.PersistentVolumeReclaimRecycle { + allErrs = append(allErrs, field.Forbidden(specPath.Child("persistentVolumeReclaimPolicy"), "may not be 'recycle' for a hostPath mount of '/'")) + } + + if len(pv.Spec.StorageClassName) > 0 { + for _, msg := range ValidateClassName(pv.Spec.StorageClassName, false) { + allErrs = append(allErrs, field.Invalid(specPath.Child("storageClassName"), pv.Spec.StorageClassName, msg)) + } + } + if pv.Spec.VolumeMode != nil && !utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + allErrs = append(allErrs, field.Forbidden(specPath.Child("volumeMode"), "PersistentVolume volumeMode is disabled by feature-gate")) + } else if pv.Spec.VolumeMode != nil && !supportedVolumeModes.Has(string(*pv.Spec.VolumeMode)) { + allErrs = append(allErrs, field.NotSupported(specPath.Child("volumeMode"), *pv.Spec.VolumeMode, supportedVolumeModes.List())) + } + return allErrs +} + +// ValidatePersistentVolumeUpdate tests to see if the update is legal for an end user to make. +// newPv is updated with fields that cannot be changed. +func ValidatePersistentVolumeUpdate(newPv, oldPv *core.PersistentVolume) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = ValidatePersistentVolume(newPv) + + // PersistentVolumeSource should be immutable after creation. + if !apiequality.Semantic.DeepEqual(newPv.Spec.PersistentVolumeSource, oldPv.Spec.PersistentVolumeSource) { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec", "persistentvolumesource"), "is immutable after creation")) + } + + newPv.Status = oldPv.Status + + if utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + allErrs = append(allErrs, ValidateImmutableField(newPv.Spec.VolumeMode, oldPv.Spec.VolumeMode, field.NewPath("volumeMode"))...) + } + + if utilfeature.DefaultFeatureGate.Enabled(features.VolumeScheduling) { + // Allow setting NodeAffinity if oldPv NodeAffinity was not set + if oldPv.Spec.NodeAffinity != nil { + allErrs = append(allErrs, ValidateImmutableField(newPv.Spec.NodeAffinity, oldPv.Spec.NodeAffinity, field.NewPath("nodeAffinity"))...) + } + } + + return allErrs +} + +// ValidatePersistentVolumeStatusUpdate tests to see if the status update is legal for an end user to make. +// newPv is updated with fields that cannot be changed. +func ValidatePersistentVolumeStatusUpdate(newPv, oldPv *core.PersistentVolume) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newPv.ObjectMeta, &oldPv.ObjectMeta, field.NewPath("metadata")) + if len(newPv.ResourceVersion) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("resourceVersion"), "")) + } + newPv.Spec = oldPv.Spec + return allErrs +} + +// ValidatePersistentVolumeClaim validates a PersistentVolumeClaim +func ValidatePersistentVolumeClaim(pvc *core.PersistentVolumeClaim) field.ErrorList { + allErrs := ValidateObjectMeta(&pvc.ObjectMeta, true, ValidatePersistentVolumeName, field.NewPath("metadata")) + allErrs = append(allErrs, ValidatePersistentVolumeClaimSpec(&pvc.Spec, field.NewPath("spec"))...) + return allErrs +} + +// ValidatePersistentVolumeClaimSpec validates a PersistentVolumeClaimSpec +func ValidatePersistentVolumeClaimSpec(spec *core.PersistentVolumeClaimSpec, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(spec.AccessModes) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("accessModes"), "at least 1 access mode is required")) + } + if spec.Selector != nil { + allErrs = append(allErrs, unversionedvalidation.ValidateLabelSelector(spec.Selector, fldPath.Child("selector"))...) + } + for _, mode := range spec.AccessModes { + if mode != core.ReadWriteOnce && mode != core.ReadOnlyMany && mode != core.ReadWriteMany { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("accessModes"), mode, supportedAccessModes.List())) + } + } + storageValue, ok := spec.Resources.Requests[core.ResourceStorage] + if !ok { + allErrs = append(allErrs, field.Required(fldPath.Child("resources").Key(string(core.ResourceStorage)), "")) + } else { + allErrs = append(allErrs, ValidateResourceQuantityValue(string(core.ResourceStorage), storageValue, fldPath.Child("resources").Key(string(core.ResourceStorage)))...) + allErrs = append(allErrs, ValidatePositiveQuantityValue(storageValue, fldPath.Child("resources").Key(string(core.ResourceStorage)))...) + } + + if spec.StorageClassName != nil && len(*spec.StorageClassName) > 0 { + for _, msg := range ValidateClassName(*spec.StorageClassName, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("storageClassName"), *spec.StorageClassName, msg)) + } + } + if spec.VolumeMode != nil && !utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("volumeMode"), "PersistentVolumeClaim volumeMode is disabled by feature-gate")) + } else if spec.VolumeMode != nil && !supportedVolumeModes.Has(string(*spec.VolumeMode)) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("volumeMode"), *spec.VolumeMode, supportedVolumeModes.List())) + } + return allErrs +} + +// ValidatePersistentVolumeClaimUpdate validates an update to a PersistentVolumeClaim +func ValidatePersistentVolumeClaimUpdate(newPvc, oldPvc *core.PersistentVolumeClaim) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newPvc.ObjectMeta, &oldPvc.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidatePersistentVolumeClaim(newPvc)...) + newPvcClone := newPvc.DeepCopy() + oldPvcClone := oldPvc.DeepCopy() + + // PVController needs to update PVC.Spec w/ VolumeName. + // Claims are immutable in order to enforce quota, range limits, etc. without gaming the system. + if len(oldPvc.Spec.VolumeName) == 0 { + // volumeName changes are allowed once. + oldPvcClone.Spec.VolumeName = newPvcClone.Spec.VolumeName + } + + if validateStorageClassUpgrade(oldPvcClone.Annotations, newPvcClone.Annotations, + oldPvcClone.Spec.StorageClassName, newPvcClone.Spec.StorageClassName) { + newPvcClone.Spec.StorageClassName = nil + metav1.SetMetaDataAnnotation(&newPvcClone.ObjectMeta, core.BetaStorageClassAnnotation, oldPvcClone.Annotations[core.BetaStorageClassAnnotation]) + } else { + // storageclass annotation should be immutable after creation + // TODO: remove Beta when no longer needed + allErrs = append(allErrs, ValidateImmutableAnnotation(newPvc.ObjectMeta.Annotations[v1.BetaStorageClassAnnotation], oldPvc.ObjectMeta.Annotations[v1.BetaStorageClassAnnotation], v1.BetaStorageClassAnnotation, field.NewPath("metadata"))...) + } + + if utilfeature.DefaultFeatureGate.Enabled(features.ExpandPersistentVolumes) { + // lets make sure storage values are same. + if newPvc.Status.Phase == core.ClaimBound && newPvcClone.Spec.Resources.Requests != nil { + newPvcClone.Spec.Resources.Requests["storage"] = oldPvc.Spec.Resources.Requests["storage"] + } + + oldSize := oldPvc.Spec.Resources.Requests["storage"] + newSize := newPvc.Spec.Resources.Requests["storage"] + + if !apiequality.Semantic.DeepEqual(newPvcClone.Spec, oldPvcClone.Spec) { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec"), "is immutable after creation except resources.requests for bound claims")) + } + if newSize.Cmp(oldSize) < 0 { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec", "resources", "requests", "storage"), "field can not be less than previous value")) + } + + } else { + // changes to Spec are not allowed, but updates to label/and some annotations are OK. + // no-op updates pass validation. + if !apiequality.Semantic.DeepEqual(newPvcClone.Spec, oldPvcClone.Spec) { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec"), "field is immutable after creation")) + } + } + + if utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + allErrs = append(allErrs, ValidateImmutableField(newPvc.Spec.VolumeMode, oldPvc.Spec.VolumeMode, field.NewPath("volumeMode"))...) + } + return allErrs +} + +// Provide an upgrade path from PVC with storage class specified in beta +// annotation to storage class specified in attribute. We allow update of +// StorageClassName only if following four conditions are met at the same time: +// 1. The old pvc's StorageClassAnnotation is set +// 2. The old pvc's StorageClassName is not set +// 3. The new pvc's StorageClassName is set and equal to the old value in annotation +// 4. If the new pvc's StorageClassAnnotation is set,it must be equal to the old pv/pvc's StorageClassAnnotation +func validateStorageClassUpgrade(oldAnnotations, newAnnotations map[string]string, oldScName, newScName *string) bool { + oldSc, oldAnnotationExist := oldAnnotations[core.BetaStorageClassAnnotation] + newScInAnnotation, newAnnotationExist := newAnnotations[core.BetaStorageClassAnnotation] + return oldAnnotationExist /* condition 1 */ && + oldScName == nil /* condition 2*/ && + (newScName != nil && *newScName == oldSc) /* condition 3 */ && + (!newAnnotationExist || newScInAnnotation == oldSc) /* condition 4 */ +} + +// ValidatePersistentVolumeClaimStatusUpdate validates an update to status of a PersistentVolumeClaim +func ValidatePersistentVolumeClaimStatusUpdate(newPvc, oldPvc *core.PersistentVolumeClaim) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newPvc.ObjectMeta, &oldPvc.ObjectMeta, field.NewPath("metadata")) + if len(newPvc.ResourceVersion) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("resourceVersion"), "")) + } + if len(newPvc.Spec.AccessModes) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("Spec", "accessModes"), "")) + } + if !utilfeature.DefaultFeatureGate.Enabled(features.ExpandPersistentVolumes) && len(newPvc.Status.Conditions) > 0 { + conditionPath := field.NewPath("status", "conditions") + allErrs = append(allErrs, field.Forbidden(conditionPath, "invalid field")) + } + capPath := field.NewPath("status", "capacity") + for r, qty := range newPvc.Status.Capacity { + allErrs = append(allErrs, validateBasicResource(qty, capPath.Key(string(r)))...) + } + newPvc.Spec = oldPvc.Spec + return allErrs +} + +var supportedPortProtocols = sets.NewString(string(core.ProtocolTCP), string(core.ProtocolUDP)) + +func validateContainerPorts(ports []core.ContainerPort, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + allNames := sets.String{} + for i, port := range ports { + idxPath := fldPath.Index(i) + if len(port.Name) > 0 { + if msgs := validation.IsValidPortName(port.Name); len(msgs) != 0 { + for i = range msgs { + allErrs = append(allErrs, field.Invalid(idxPath.Child("name"), port.Name, msgs[i])) + } + } else if allNames.Has(port.Name) { + allErrs = append(allErrs, field.Duplicate(idxPath.Child("name"), port.Name)) + } else { + allNames.Insert(port.Name) + } + } + if port.ContainerPort == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("containerPort"), "")) + } else { + for _, msg := range validation.IsValidPortNum(int(port.ContainerPort)) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("containerPort"), port.ContainerPort, msg)) + } + } + if port.HostPort != 0 { + for _, msg := range validation.IsValidPortNum(int(port.HostPort)) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("hostPort"), port.HostPort, msg)) + } + } + if len(port.Protocol) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("protocol"), "")) + } else if !supportedPortProtocols.Has(string(port.Protocol)) { + allErrs = append(allErrs, field.NotSupported(idxPath.Child("protocol"), port.Protocol, supportedPortProtocols.List())) + } + } + return allErrs +} + +// ValidateEnv validates env vars +func ValidateEnv(vars []core.EnvVar, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + for i, ev := range vars { + idxPath := fldPath.Index(i) + if len(ev.Name) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("name"), "")) + } else { + for _, msg := range validation.IsEnvVarName(ev.Name) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("name"), ev.Name, msg)) + } + } + allErrs = append(allErrs, validateEnvVarValueFrom(ev, idxPath.Child("valueFrom"))...) + } + return allErrs +} + +var validEnvDownwardAPIFieldPathExpressions = sets.NewString( + "metadata.name", + "metadata.namespace", + "metadata.uid", + "spec.nodeName", + "spec.serviceAccountName", + "status.hostIP", + "status.podIP") +var validContainerResourceFieldPathExpressions = sets.NewString("limits.cpu", "limits.memory", "limits.ephemeral-storage", "requests.cpu", "requests.memory", "requests.ephemeral-storage") + +func validateEnvVarValueFrom(ev core.EnvVar, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if ev.ValueFrom == nil { + return allErrs + } + + numSources := 0 + + if ev.ValueFrom.FieldRef != nil { + numSources++ + allErrs = append(allErrs, validateObjectFieldSelector(ev.ValueFrom.FieldRef, &validEnvDownwardAPIFieldPathExpressions, fldPath.Child("fieldRef"))...) + } + if ev.ValueFrom.ResourceFieldRef != nil { + numSources++ + allErrs = append(allErrs, validateContainerResourceFieldSelector(ev.ValueFrom.ResourceFieldRef, &validContainerResourceFieldPathExpressions, fldPath.Child("resourceFieldRef"), false)...) + } + if ev.ValueFrom.ConfigMapKeyRef != nil { + numSources++ + allErrs = append(allErrs, validateConfigMapKeySelector(ev.ValueFrom.ConfigMapKeyRef, fldPath.Child("configMapKeyRef"))...) + } + if ev.ValueFrom.SecretKeyRef != nil { + numSources++ + allErrs = append(allErrs, validateSecretKeySelector(ev.ValueFrom.SecretKeyRef, fldPath.Child("secretKeyRef"))...) + } + + if numSources == 0 { + allErrs = append(allErrs, field.Invalid(fldPath, "", "must specify one of: `fieldRef`, `resourceFieldRef`, `configMapKeyRef` or `secretKeyRef`")) + } else if len(ev.Value) != 0 { + if numSources != 0 { + allErrs = append(allErrs, field.Invalid(fldPath, "", "may not be specified when `value` is not empty")) + } + } else if numSources > 1 { + allErrs = append(allErrs, field.Invalid(fldPath, "", "may not have more than one field specified at a time")) + } + + return allErrs +} + +func validateObjectFieldSelector(fs *core.ObjectFieldSelector, expressions *sets.String, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if len(fs.APIVersion) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("apiVersion"), "")) + return allErrs + } + if len(fs.FieldPath) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("fieldPath"), "")) + return allErrs + } + + internalFieldPath, _, err := podshelper.ConvertDownwardAPIFieldLabel(fs.APIVersion, fs.FieldPath, "") + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("fieldPath"), fs.FieldPath, fmt.Sprintf("error converting fieldPath: %v", err))) + return allErrs + } + + if path, subscript, ok := fieldpath.SplitMaybeSubscriptedPath(internalFieldPath); ok { + switch path { + case "metadata.annotations": + for _, msg := range validation.IsQualifiedName(strings.ToLower(subscript)) { + allErrs = append(allErrs, field.Invalid(fldPath, subscript, msg)) + } + case "metadata.labels": + for _, msg := range validation.IsQualifiedName(subscript) { + allErrs = append(allErrs, field.Invalid(fldPath, subscript, msg)) + } + default: + allErrs = append(allErrs, field.Invalid(fldPath, path, "does not support subscript")) + } + } else if !expressions.Has(path) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("fieldPath"), path, expressions.List())) + return allErrs + } + + return allErrs +} + +func fsResourceIsEphemeralStorage(resource string) bool { + if resource == "limits.ephemeral-storage" || resource == "requests.ephemeral-storage" { + return true + } + return false +} + +func validateContainerResourceFieldSelector(fs *core.ResourceFieldSelector, expressions *sets.String, fldPath *field.Path, volume bool) field.ErrorList { + allErrs := field.ErrorList{} + + if volume && len(fs.ContainerName) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("containerName"), "")) + } else if len(fs.Resource) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("resource"), "")) + } else if !expressions.Has(fs.Resource) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("resource"), fs.Resource, expressions.List())) + } else if fsResourceIsEphemeralStorage(fs.Resource) && !utilfeature.DefaultFeatureGate.Enabled(features.LocalStorageCapacityIsolation) { + allErrs = append(allErrs, field.Forbidden(fldPath, "Containers' ephemeral storage requests/limits disabled by feature-gate for Downward API")) + } + allErrs = append(allErrs, validateContainerResourceDivisor(fs.Resource, fs.Divisor, fldPath)...) + return allErrs +} + +func ValidateEnvFrom(vars []core.EnvFromSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for i, ev := range vars { + idxPath := fldPath.Index(i) + if len(ev.Prefix) > 0 { + for _, msg := range validation.IsEnvVarName(ev.Prefix) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("prefix"), ev.Prefix, msg)) + } + } + + numSources := 0 + if ev.ConfigMapRef != nil { + numSources++ + allErrs = append(allErrs, validateConfigMapEnvSource(ev.ConfigMapRef, idxPath.Child("configMapRef"))...) + } + if ev.SecretRef != nil { + numSources++ + allErrs = append(allErrs, validateSecretEnvSource(ev.SecretRef, idxPath.Child("secretRef"))...) + } + + if numSources == 0 { + allErrs = append(allErrs, field.Invalid(fldPath, "", "must specify one of: `configMapRef` or `secretRef`")) + } else if numSources > 1 { + allErrs = append(allErrs, field.Invalid(fldPath, "", "may not have more than one field specified at a time")) + } + } + return allErrs +} + +func validateConfigMapEnvSource(configMapSource *core.ConfigMapEnvSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(configMapSource.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } else { + for _, msg := range ValidateConfigMapName(configMapSource.Name, true) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("name"), configMapSource.Name, msg)) + } + } + return allErrs +} + +func validateSecretEnvSource(secretSource *core.SecretEnvSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(secretSource.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } else { + for _, msg := range ValidateSecretName(secretSource.Name, true) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("name"), secretSource.Name, msg)) + } + } + return allErrs +} + +var validContainerResourceDivisorForCPU = sets.NewString("1m", "1") +var validContainerResourceDivisorForMemory = sets.NewString("1", "1k", "1M", "1G", "1T", "1P", "1E", "1Ki", "1Mi", "1Gi", "1Ti", "1Pi", "1Ei") +var validContainerResourceDivisorForEphemeralStorage = sets.NewString("1", "1k", "1M", "1G", "1T", "1P", "1E", "1Ki", "1Mi", "1Gi", "1Ti", "1Pi", "1Ei") + +func validateContainerResourceDivisor(rName string, divisor resource.Quantity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + unsetDivisor := resource.Quantity{} + if unsetDivisor.Cmp(divisor) == 0 { + return allErrs + } + switch rName { + case "limits.cpu", "requests.cpu": + if !validContainerResourceDivisorForCPU.Has(divisor.String()) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("divisor"), rName, "only divisor's values 1m and 1 are supported with the cpu resource")) + } + case "limits.memory", "requests.memory": + if !validContainerResourceDivisorForMemory.Has(divisor.String()) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("divisor"), rName, "only divisor's values 1, 1k, 1M, 1G, 1T, 1P, 1E, 1Ki, 1Mi, 1Gi, 1Ti, 1Pi, 1Ei are supported with the memory resource")) + } + case "limits.ephemeral-storage", "requests.ephemeral-storage": + if !validContainerResourceDivisorForEphemeralStorage.Has(divisor.String()) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("divisor"), rName, "only divisor's values 1, 1k, 1M, 1G, 1T, 1P, 1E, 1Ki, 1Mi, 1Gi, 1Ti, 1Pi, 1Ei are supported with the local ephemeral storage resource")) + } + } + return allErrs +} + +func validateConfigMapKeySelector(s *core.ConfigMapKeySelector, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + nameFn := ValidateNameFunc(ValidateSecretName) + for _, msg := range nameFn(s.Name, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("name"), s.Name, msg)) + } + if len(s.Key) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("key"), "")) + } else { + for _, msg := range validation.IsConfigMapKey(s.Key) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("key"), s.Key, msg)) + } + } + + return allErrs +} + +func validateSecretKeySelector(s *core.SecretKeySelector, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + nameFn := ValidateNameFunc(ValidateSecretName) + for _, msg := range nameFn(s.Name, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("name"), s.Name, msg)) + } + if len(s.Key) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("key"), "")) + } else { + for _, msg := range validation.IsConfigMapKey(s.Key) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("key"), s.Key, msg)) + } + } + + return allErrs +} + +func GetVolumeMountMap(mounts []core.VolumeMount) map[string]string { + volmounts := make(map[string]string) + + for _, mnt := range mounts { + volmounts[mnt.Name] = mnt.MountPath + } + + return volmounts +} + +func GetVolumeDeviceMap(devices []core.VolumeDevice) map[string]string { + voldevices := make(map[string]string) + + for _, dev := range devices { + voldevices[dev.Name] = dev.DevicePath + } + + return voldevices +} + +func ValidateVolumeMounts(mounts []core.VolumeMount, voldevices map[string]string, volumes map[string]core.VolumeSource, container *core.Container, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + mountpoints := sets.NewString() + + for i, mnt := range mounts { + idxPath := fldPath.Index(i) + if len(mnt.Name) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("name"), "")) + } + if !IsMatchedVolume(mnt.Name, volumes) { + allErrs = append(allErrs, field.NotFound(idxPath.Child("name"), mnt.Name)) + } + if len(mnt.MountPath) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("mountPath"), "")) + } + if mountpoints.Has(mnt.MountPath) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("mountPath"), mnt.MountPath, "must be unique")) + } + mountpoints.Insert(mnt.MountPath) + + // check for overlap with VolumeDevice + if mountNameAlreadyExists(mnt.Name, voldevices) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("name"), mnt.Name, "must not already exist in volumeDevices")) + } + if mountPathAlreadyExists(mnt.MountPath, voldevices) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("mountPath"), mnt.MountPath, "must not already exist as a path in volumeDevices")) + } + + if len(mnt.SubPath) > 0 { + allErrs = append(allErrs, validateLocalDescendingPath(mnt.SubPath, fldPath.Child("subPath"))...) + } + + if mnt.MountPropagation != nil { + allErrs = append(allErrs, validateMountPropagation(mnt.MountPropagation, container, fldPath.Child("mountPropagation"))...) + } + } + return allErrs +} + +func ValidateVolumeDevices(devices []core.VolumeDevice, volmounts map[string]string, volumes map[string]core.VolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + devicepath := sets.NewString() + devicename := sets.NewString() + + if devices != nil && !utilfeature.DefaultFeatureGate.Enabled(features.BlockVolume) { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("volumeDevices"), "Container volumeDevices is disabled by feature-gate")) + return allErrs + } + if devices != nil { + for i, dev := range devices { + idxPath := fldPath.Index(i) + devName := dev.Name + devPath := dev.DevicePath + didMatch, isPVC := isMatchedDevice(devName, volumes) + if len(devName) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("name"), "")) + } + if devicename.Has(devName) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("name"), devName, "must be unique")) + } + // Must be PersistentVolumeClaim volume source + if didMatch && !isPVC { + allErrs = append(allErrs, field.Invalid(idxPath.Child("name"), devName, "can only use volume source type of PersistentVolumeClaim for block mode")) + } + if !didMatch { + allErrs = append(allErrs, field.NotFound(idxPath.Child("name"), devName)) + } + if len(devPath) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("devicePath"), "")) + } + if devicepath.Has(devPath) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("devicePath"), devPath, "must be unique")) + } + if len(devPath) > 0 && len(validatePathNoBacksteps(devPath, fldPath.Child("devicePath"))) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("devicePath"), devPath, "can not contain backsteps ('..')")) + } else { + devicepath.Insert(devPath) + } + // check for overlap with VolumeMount + if deviceNameAlreadyExists(devName, volmounts) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("name"), devName, "must not already exist in volumeMounts")) + } + if devicePathAlreadyExists(devPath, volmounts) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("devicePath"), devPath, "must not already exist as a path in volumeMounts")) + } + if len(devName) > 0 { + devicename.Insert(devName) + } + } + } + return allErrs +} + +func validateProbe(probe *core.Probe, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if probe == nil { + return allErrs + } + allErrs = append(allErrs, validateHandler(&probe.Handler, fldPath)...) + + allErrs = append(allErrs, ValidateNonnegativeField(int64(probe.InitialDelaySeconds), fldPath.Child("initialDelaySeconds"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(probe.TimeoutSeconds), fldPath.Child("timeoutSeconds"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(probe.PeriodSeconds), fldPath.Child("periodSeconds"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(probe.SuccessThreshold), fldPath.Child("successThreshold"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(probe.FailureThreshold), fldPath.Child("failureThreshold"))...) + return allErrs +} + +func validateClientIPAffinityConfig(config *core.SessionAffinityConfig, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if config == nil { + allErrs = append(allErrs, field.Required(fldPath, fmt.Sprintf("when session affinity type is %s", core.ServiceAffinityClientIP))) + return allErrs + } + if config.ClientIP == nil { + allErrs = append(allErrs, field.Required(fldPath.Child("clientIP"), fmt.Sprintf("when session affinity type is %s", core.ServiceAffinityClientIP))) + return allErrs + } + if config.ClientIP.TimeoutSeconds == nil { + allErrs = append(allErrs, field.Required(fldPath.Child("clientIP").Child("timeoutSeconds"), fmt.Sprintf("when session affinity type is %s", core.ServiceAffinityClientIP))) + return allErrs + } + allErrs = append(allErrs, validateAffinityTimeout(config.ClientIP.TimeoutSeconds, fldPath.Child("clientIP").Child("timeoutSeconds"))...) + + return allErrs +} + +func validateAffinityTimeout(timeout *int32, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if *timeout <= 0 || *timeout > core.MaxClientIPServiceAffinitySeconds { + allErrs = append(allErrs, field.Invalid(fldPath, timeout, fmt.Sprintf("must be greater than 0 and less than %d", core.MaxClientIPServiceAffinitySeconds))) + } + return allErrs +} + +// AccumulateUniqueHostPorts extracts each HostPort of each Container, +// accumulating the results and returning an error if any ports conflict. +func AccumulateUniqueHostPorts(containers []core.Container, accumulator *sets.String, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + for ci, ctr := range containers { + idxPath := fldPath.Index(ci) + portsPath := idxPath.Child("ports") + for pi := range ctr.Ports { + idxPath := portsPath.Index(pi) + port := ctr.Ports[pi].HostPort + if port == 0 { + continue + } + str := fmt.Sprintf("%s/%s/%d", ctr.Ports[pi].Protocol, ctr.Ports[pi].HostIP, port) + if accumulator.Has(str) { + allErrs = append(allErrs, field.Duplicate(idxPath.Child("hostPort"), str)) + } else { + accumulator.Insert(str) + } + } + } + return allErrs +} + +// checkHostPortConflicts checks for colliding Port.HostPort values across +// a slice of containers. +func checkHostPortConflicts(containers []core.Container, fldPath *field.Path) field.ErrorList { + allPorts := sets.String{} + return AccumulateUniqueHostPorts(containers, &allPorts, fldPath) +} + +func validateExecAction(exec *core.ExecAction, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + if len(exec.Command) == 0 { + allErrors = append(allErrors, field.Required(fldPath.Child("command"), "")) + } + return allErrors +} + +var supportedHTTPSchemes = sets.NewString(string(core.URISchemeHTTP), string(core.URISchemeHTTPS)) + +func validateHTTPGetAction(http *core.HTTPGetAction, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + if len(http.Path) == 0 { + allErrors = append(allErrors, field.Required(fldPath.Child("path"), "")) + } + allErrors = append(allErrors, ValidatePortNumOrName(http.Port, fldPath.Child("port"))...) + if !supportedHTTPSchemes.Has(string(http.Scheme)) { + allErrors = append(allErrors, field.NotSupported(fldPath.Child("scheme"), http.Scheme, supportedHTTPSchemes.List())) + } + for _, header := range http.HTTPHeaders { + for _, msg := range validation.IsHTTPHeaderName(header.Name) { + allErrors = append(allErrors, field.Invalid(fldPath.Child("httpHeaders"), header.Name, msg)) + } + } + return allErrors +} + +func ValidatePortNumOrName(port intstr.IntOrString, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if port.Type == intstr.Int { + for _, msg := range validation.IsValidPortNum(port.IntValue()) { + allErrs = append(allErrs, field.Invalid(fldPath, port.IntValue(), msg)) + } + } else if port.Type == intstr.String { + for _, msg := range validation.IsValidPortName(port.StrVal) { + allErrs = append(allErrs, field.Invalid(fldPath, port.StrVal, msg)) + } + } else { + allErrs = append(allErrs, field.InternalError(fldPath, fmt.Errorf("unknown type: %v", port.Type))) + } + return allErrs +} + +func validateTCPSocketAction(tcp *core.TCPSocketAction, fldPath *field.Path) field.ErrorList { + return ValidatePortNumOrName(tcp.Port, fldPath.Child("port")) +} + +func validateHandler(handler *core.Handler, fldPath *field.Path) field.ErrorList { + numHandlers := 0 + allErrors := field.ErrorList{} + if handler.Exec != nil { + if numHandlers > 0 { + allErrors = append(allErrors, field.Forbidden(fldPath.Child("exec"), "may not specify more than 1 handler type")) + } else { + numHandlers++ + allErrors = append(allErrors, validateExecAction(handler.Exec, fldPath.Child("exec"))...) + } + } + if handler.HTTPGet != nil { + if numHandlers > 0 { + allErrors = append(allErrors, field.Forbidden(fldPath.Child("httpGet"), "may not specify more than 1 handler type")) + } else { + numHandlers++ + allErrors = append(allErrors, validateHTTPGetAction(handler.HTTPGet, fldPath.Child("httpGet"))...) + } + } + if handler.TCPSocket != nil { + if numHandlers > 0 { + allErrors = append(allErrors, field.Forbidden(fldPath.Child("tcpSocket"), "may not specify more than 1 handler type")) + } else { + numHandlers++ + allErrors = append(allErrors, validateTCPSocketAction(handler.TCPSocket, fldPath.Child("tcpSocket"))...) + } + } + if numHandlers == 0 { + allErrors = append(allErrors, field.Required(fldPath, "must specify a handler type")) + } + return allErrors +} + +func validateLifecycle(lifecycle *core.Lifecycle, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if lifecycle.PostStart != nil { + allErrs = append(allErrs, validateHandler(lifecycle.PostStart, fldPath.Child("postStart"))...) + } + if lifecycle.PreStop != nil { + allErrs = append(allErrs, validateHandler(lifecycle.PreStop, fldPath.Child("preStop"))...) + } + return allErrs +} + +var supportedPullPolicies = sets.NewString(string(core.PullAlways), string(core.PullIfNotPresent), string(core.PullNever)) + +func validatePullPolicy(policy core.PullPolicy, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + + switch policy { + case core.PullAlways, core.PullIfNotPresent, core.PullNever: + break + case "": + allErrors = append(allErrors, field.Required(fldPath, "")) + default: + allErrors = append(allErrors, field.NotSupported(fldPath, policy, supportedPullPolicies.List())) + } + + return allErrors +} + +func validateInitContainers(containers, otherContainers []core.Container, deviceVolumes map[string]core.VolumeSource, fldPath *field.Path) field.ErrorList { + var allErrs field.ErrorList + if len(containers) > 0 { + allErrs = append(allErrs, validateContainers(containers, deviceVolumes, fldPath)...) + } + + allNames := sets.String{} + for _, ctr := range otherContainers { + allNames.Insert(ctr.Name) + } + for i, ctr := range containers { + idxPath := fldPath.Index(i) + if allNames.Has(ctr.Name) { + allErrs = append(allErrs, field.Duplicate(idxPath.Child("name"), ctr.Name)) + } + if len(ctr.Name) > 0 { + allNames.Insert(ctr.Name) + } + if ctr.Lifecycle != nil { + allErrs = append(allErrs, field.Invalid(idxPath.Child("lifecycle"), ctr.Lifecycle, "must not be set for init containers")) + } + if ctr.LivenessProbe != nil { + allErrs = append(allErrs, field.Invalid(idxPath.Child("livenessProbe"), ctr.LivenessProbe, "must not be set for init containers")) + } + if ctr.ReadinessProbe != nil { + allErrs = append(allErrs, field.Invalid(idxPath.Child("readinessProbe"), ctr.ReadinessProbe, "must not be set for init containers")) + } + } + return allErrs +} + +func validateContainers(containers []core.Container, volumes map[string]core.VolumeSource, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if len(containers) == 0 { + return append(allErrs, field.Required(fldPath, "")) + } + + allNames := sets.String{} + for i, ctr := range containers { + idxPath := fldPath.Index(i) + namePath := idxPath.Child("name") + volMounts := GetVolumeMountMap(ctr.VolumeMounts) + volDevices := GetVolumeDeviceMap(ctr.VolumeDevices) + + if len(ctr.Name) == 0 { + allErrs = append(allErrs, field.Required(namePath, "")) + } else { + allErrs = append(allErrs, ValidateDNS1123Label(ctr.Name, namePath)...) + } + if allNames.Has(ctr.Name) { + allErrs = append(allErrs, field.Duplicate(namePath, ctr.Name)) + } else { + allNames.Insert(ctr.Name) + } + // TODO: do not validate leading and trailing whitespace to preserve backward compatibility. + // for example: https://github.com/openshift/origin/issues/14659 image = " " is special token in pod template + // others may have done similar + if len(ctr.Image) == 0 { + allErrs = append(allErrs, field.Required(idxPath.Child("image"), "")) + } + if ctr.Lifecycle != nil { + allErrs = append(allErrs, validateLifecycle(ctr.Lifecycle, idxPath.Child("lifecycle"))...) + } + allErrs = append(allErrs, validateProbe(ctr.LivenessProbe, idxPath.Child("livenessProbe"))...) + // Liveness-specific validation + if ctr.LivenessProbe != nil && ctr.LivenessProbe.SuccessThreshold != 1 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("livenessProbe", "successThreshold"), ctr.LivenessProbe.SuccessThreshold, "must be 1")) + } + + switch ctr.TerminationMessagePolicy { + case core.TerminationMessageReadFile, core.TerminationMessageFallbackToLogsOnError: + case "": + allErrs = append(allErrs, field.Required(idxPath.Child("terminationMessagePolicy"), "must be 'File' or 'FallbackToLogsOnError'")) + default: + allErrs = append(allErrs, field.Invalid(idxPath.Child("terminationMessagePolicy"), ctr.TerminationMessagePolicy, "must be 'File' or 'FallbackToLogsOnError'")) + } + + allErrs = append(allErrs, validateProbe(ctr.ReadinessProbe, idxPath.Child("readinessProbe"))...) + allErrs = append(allErrs, validateContainerPorts(ctr.Ports, idxPath.Child("ports"))...) + allErrs = append(allErrs, ValidateEnv(ctr.Env, idxPath.Child("env"))...) + allErrs = append(allErrs, ValidateEnvFrom(ctr.EnvFrom, idxPath.Child("envFrom"))...) + allErrs = append(allErrs, ValidateVolumeMounts(ctr.VolumeMounts, volDevices, volumes, &ctr, idxPath.Child("volumeMounts"))...) + allErrs = append(allErrs, ValidateVolumeDevices(ctr.VolumeDevices, volMounts, volumes, idxPath.Child("volumeDevices"))...) + allErrs = append(allErrs, validatePullPolicy(ctr.ImagePullPolicy, idxPath.Child("imagePullPolicy"))...) + allErrs = append(allErrs, ValidateResourceRequirements(&ctr.Resources, idxPath.Child("resources"))...) + allErrs = append(allErrs, ValidateSecurityContext(ctr.SecurityContext, idxPath.Child("securityContext"))...) + } + // Check for colliding ports across all containers. + allErrs = append(allErrs, checkHostPortConflicts(containers, fldPath)...) + + return allErrs +} + +func validateRestartPolicy(restartPolicy *core.RestartPolicy, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + switch *restartPolicy { + case core.RestartPolicyAlways, core.RestartPolicyOnFailure, core.RestartPolicyNever: + break + case "": + allErrors = append(allErrors, field.Required(fldPath, "")) + default: + validValues := []string{string(core.RestartPolicyAlways), string(core.RestartPolicyOnFailure), string(core.RestartPolicyNever)} + allErrors = append(allErrors, field.NotSupported(fldPath, *restartPolicy, validValues)) + } + + return allErrors +} + +func validateDNSPolicy(dnsPolicy *core.DNSPolicy, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + switch *dnsPolicy { + case core.DNSClusterFirstWithHostNet, core.DNSClusterFirst, core.DNSDefault: + case core.DNSNone: + if !utilfeature.DefaultFeatureGate.Enabled(features.CustomPodDNS) { + allErrors = append(allErrors, field.Invalid(fldPath, dnsPolicy, "DNSPolicy: can not use 'None', custom pod DNS is disabled by feature gate")) + } + case "": + allErrors = append(allErrors, field.Required(fldPath, "")) + default: + validValues := []string{string(core.DNSClusterFirstWithHostNet), string(core.DNSClusterFirst), string(core.DNSDefault)} + if utilfeature.DefaultFeatureGate.Enabled(features.CustomPodDNS) { + validValues = append(validValues, string(core.DNSNone)) + } + allErrors = append(allErrors, field.NotSupported(fldPath, dnsPolicy, validValues)) + } + return allErrors +} + +const ( + // Limits on various DNS parameters. These are derived from + // restrictions in Linux libc name resolution handling. + // Max number of DNS name servers. + MaxDNSNameservers = 3 + // Max number of domains in search path. + MaxDNSSearchPaths = 6 + // Max number of characters in search path. + MaxDNSSearchListChars = 256 +) + +func validatePodDNSConfig(dnsConfig *core.PodDNSConfig, dnsPolicy *core.DNSPolicy, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + // Validate DNSNone case. Must provide at least one DNS name server. + if utilfeature.DefaultFeatureGate.Enabled(features.CustomPodDNS) && dnsPolicy != nil && *dnsPolicy == core.DNSNone { + if dnsConfig == nil { + return append(allErrs, field.Required(fldPath, fmt.Sprintf("must provide `dnsConfig` when `dnsPolicy` is %s", core.DNSNone))) + } + if len(dnsConfig.Nameservers) == 0 { + return append(allErrs, field.Required(fldPath.Child("nameservers"), fmt.Sprintf("must provide at least one DNS nameserver when `dnsPolicy` is %s", core.DNSNone))) + } + } + + if dnsConfig != nil { + if !utilfeature.DefaultFeatureGate.Enabled(features.CustomPodDNS) { + return append(allErrs, field.Forbidden(fldPath, "DNSConfig: custom pod DNS is disabled by feature gate")) + } + + // Validate nameservers. + if len(dnsConfig.Nameservers) > MaxDNSNameservers { + allErrs = append(allErrs, field.Invalid(fldPath.Child("nameservers"), dnsConfig.Nameservers, fmt.Sprintf("must not have more than %v nameservers", MaxDNSNameservers))) + } + for i, ns := range dnsConfig.Nameservers { + if ip := net.ParseIP(ns); ip == nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("nameservers").Index(i), ns, "must be valid IP address")) + } + } + // Validate searches. + if len(dnsConfig.Searches) > MaxDNSSearchPaths { + allErrs = append(allErrs, field.Invalid(fldPath.Child("searches"), dnsConfig.Searches, fmt.Sprintf("must not have more than %v search paths", MaxDNSSearchPaths))) + } + // Include the space between search paths. + if len(strings.Join(dnsConfig.Searches, " ")) > MaxDNSSearchListChars { + allErrs = append(allErrs, field.Invalid(fldPath.Child("searches"), dnsConfig.Searches, "must not have more than 256 characters (including spaces) in the search list")) + } + for i, search := range dnsConfig.Searches { + allErrs = append(allErrs, ValidateDNS1123Subdomain(search, fldPath.Child("searches").Index(i))...) + } + // Validate options. + for i, option := range dnsConfig.Options { + if len(option.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("options").Index(i), "must not be empty")) + } + } + } + return allErrs +} + +func validateHostNetwork(hostNetwork bool, containers []core.Container, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + if hostNetwork { + for i, container := range containers { + portsPath := fldPath.Index(i).Child("ports") + for i, port := range container.Ports { + idxPath := portsPath.Index(i) + if port.HostPort != port.ContainerPort { + allErrors = append(allErrors, field.Invalid(idxPath.Child("containerPort"), port.ContainerPort, "must match `hostPort` when `hostNetwork` is true")) + } + } + } + } + return allErrors +} + +// validateImagePullSecrets checks to make sure the pull secrets are well +// formed. Right now, we only expect name to be set (it's the only field). If +// this ever changes and someone decides to set those fields, we'd like to +// know. +func validateImagePullSecrets(imagePullSecrets []core.LocalObjectReference, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + for i, currPullSecret := range imagePullSecrets { + idxPath := fldPath.Index(i) + strippedRef := core.LocalObjectReference{Name: currPullSecret.Name} + if !reflect.DeepEqual(strippedRef, currPullSecret) { + allErrors = append(allErrors, field.Invalid(idxPath, currPullSecret, "only name may be set")) + } + } + return allErrors +} + +// validateAffinity checks if given affinities are valid +func validateAffinity(affinity *core.Affinity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if affinity != nil { + if affinity.NodeAffinity != nil { + allErrs = append(allErrs, validateNodeAffinity(affinity.NodeAffinity, fldPath.Child("nodeAffinity"))...) + } + if affinity.PodAffinity != nil { + allErrs = append(allErrs, validatePodAffinity(affinity.PodAffinity, fldPath.Child("podAffinity"))...) + } + if affinity.PodAntiAffinity != nil { + allErrs = append(allErrs, validatePodAntiAffinity(affinity.PodAntiAffinity, fldPath.Child("podAntiAffinity"))...) + } + } + + return allErrs +} + +func validateTaintEffect(effect *core.TaintEffect, allowEmpty bool, fldPath *field.Path) field.ErrorList { + if !allowEmpty && len(*effect) == 0 { + return field.ErrorList{field.Required(fldPath, "")} + } + + allErrors := field.ErrorList{} + switch *effect { + // TODO: Replace next line with subsequent commented-out line when implement TaintEffectNoScheduleNoAdmit. + case core.TaintEffectNoSchedule, core.TaintEffectPreferNoSchedule, core.TaintEffectNoExecute: + // case core.TaintEffectNoSchedule, core.TaintEffectPreferNoSchedule, core.TaintEffectNoScheduleNoAdmit, core.TaintEffectNoExecute: + default: + validValues := []string{ + string(core.TaintEffectNoSchedule), + string(core.TaintEffectPreferNoSchedule), + string(core.TaintEffectNoExecute), + // TODO: Uncomment this block when implement TaintEffectNoScheduleNoAdmit. + // string(core.TaintEffectNoScheduleNoAdmit), + } + allErrors = append(allErrors, field.NotSupported(fldPath, effect, validValues)) + } + return allErrors +} + +// validateOnlyAddedTolerations validates updated pod tolerations. +func validateOnlyAddedTolerations(newTolerations []core.Toleration, oldTolerations []core.Toleration, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for _, old := range oldTolerations { + found := false + old.TolerationSeconds = nil + for _, new := range newTolerations { + new.TolerationSeconds = nil + if reflect.DeepEqual(old, new) { + found = true + break + } + } + if !found { + allErrs = append(allErrs, field.Forbidden(fldPath, "existing toleration can not be modified except its tolerationSeconds")) + return allErrs + } + } + + allErrs = append(allErrs, ValidateTolerations(newTolerations, fldPath)...) + return allErrs +} + +func ValidateHostAliases(hostAliases []core.HostAlias, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for _, hostAlias := range hostAliases { + if ip := net.ParseIP(hostAlias.IP); ip == nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("ip"), hostAlias.IP, "must be valid IP address")) + } + for _, hostname := range hostAlias.Hostnames { + allErrs = append(allErrs, ValidateDNS1123Subdomain(hostname, fldPath.Child("hostnames"))...) + } + } + return allErrs +} + +// ValidateTolerations tests if given tolerations have valid data. +func ValidateTolerations(tolerations []core.Toleration, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + for i, toleration := range tolerations { + idxPath := fldPath.Index(i) + // validate the toleration key + if len(toleration.Key) > 0 { + allErrors = append(allErrors, unversionedvalidation.ValidateLabelName(toleration.Key, idxPath.Child("key"))...) + } + + // empty toleration key with Exists operator and empty value means match all taints + if len(toleration.Key) == 0 && toleration.Operator != core.TolerationOpExists { + allErrors = append(allErrors, field.Invalid(idxPath.Child("operator"), toleration.Operator, + "operator must be Exists when `key` is empty, which means \"match all values and all keys\"")) + } + + if toleration.TolerationSeconds != nil && toleration.Effect != core.TaintEffectNoExecute { + allErrors = append(allErrors, field.Invalid(idxPath.Child("effect"), toleration.Effect, + "effect must be 'NoExecute' when `tolerationSeconds` is set")) + } + + // validate toleration operator and value + switch toleration.Operator { + // empty operator means Equal + case core.TolerationOpEqual, "": + if errs := validation.IsValidLabelValue(toleration.Value); len(errs) != 0 { + allErrors = append(allErrors, field.Invalid(idxPath.Child("operator"), toleration.Value, strings.Join(errs, ";"))) + } + case core.TolerationOpExists: + if len(toleration.Value) > 0 { + allErrors = append(allErrors, field.Invalid(idxPath.Child("operator"), toleration, "value must be empty when `operator` is 'Exists'")) + } + default: + validValues := []string{string(core.TolerationOpEqual), string(core.TolerationOpExists)} + allErrors = append(allErrors, field.NotSupported(idxPath.Child("operator"), toleration.Operator, validValues)) + } + + // validate toleration effect, empty toleration effect means match all taint effects + if len(toleration.Effect) > 0 { + allErrors = append(allErrors, validateTaintEffect(&toleration.Effect, true, idxPath.Child("effect"))...) + } + } + return allErrors +} + +func toResourceNames(resources core.ResourceList) []core.ResourceName { + result := []core.ResourceName{} + for resourceName := range resources { + result = append(result, resourceName) + } + return result +} + +func toSet(resourceNames []core.ResourceName) sets.String { + result := sets.NewString() + for _, resourceName := range resourceNames { + result.Insert(string(resourceName)) + } + return result +} + +func toContainerResourcesSet(ctr *core.Container) sets.String { + resourceNames := toResourceNames(ctr.Resources.Requests) + resourceNames = append(resourceNames, toResourceNames(ctr.Resources.Limits)...) + return toSet(resourceNames) +} + +// validateContainersOnlyForPod does additional validation for containers on a pod versus a pod template +// it only does additive validation of fields not covered in validateContainers +func validateContainersOnlyForPod(containers []core.Container, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for i, ctr := range containers { + idxPath := fldPath.Index(i) + if len(ctr.Image) != len(strings.TrimSpace(ctr.Image)) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("image"), ctr.Image, "must not have leading or trailing whitespace")) + } + } + return allErrs +} + +// ValidatePod tests if required fields in the pod are set. +func ValidatePod(pod *core.Pod) field.ErrorList { + fldPath := field.NewPath("metadata") + allErrs := ValidateObjectMeta(&pod.ObjectMeta, true, ValidatePodName, fldPath) + allErrs = append(allErrs, ValidatePodSpecificAnnotations(pod.ObjectMeta.Annotations, &pod.Spec, fldPath.Child("annotations"))...) + allErrs = append(allErrs, ValidatePodSpec(&pod.Spec, field.NewPath("spec"))...) + + // we do additional validation only pertinent for pods and not pod templates + // this was done to preserve backwards compatibility + specPath := field.NewPath("spec") + + allErrs = append(allErrs, validateContainersOnlyForPod(pod.Spec.Containers, specPath.Child("containers"))...) + allErrs = append(allErrs, validateContainersOnlyForPod(pod.Spec.InitContainers, specPath.Child("initContainers"))...) + + if utilfeature.DefaultFeatureGate.Enabled(features.HugePages) { + hugePageResources := sets.NewString() + for i := range pod.Spec.Containers { + resourceSet := toContainerResourcesSet(&pod.Spec.Containers[i]) + for resourceStr := range resourceSet { + if v1helper.IsHugePageResourceName(v1.ResourceName(resourceStr)) { + hugePageResources.Insert(resourceStr) + } + } + } + if len(hugePageResources) > 1 { + allErrs = append(allErrs, field.Invalid(specPath, hugePageResources, "must use a single hugepage size in a pod spec")) + } + } + + return allErrs +} + +// ValidatePodSpec tests that the specified PodSpec has valid data. +// This includes checking formatting and uniqueness. It also canonicalizes the +// structure by setting default values and implementing any backwards-compatibility +// tricks. +func ValidatePodSpec(spec *core.PodSpec, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + vols, vErrs := ValidateVolumes(spec.Volumes, fldPath.Child("volumes")) + allErrs = append(allErrs, vErrs...) + allErrs = append(allErrs, validateContainers(spec.Containers, vols, fldPath.Child("containers"))...) + allErrs = append(allErrs, validateInitContainers(spec.InitContainers, spec.Containers, vols, fldPath.Child("initContainers"))...) + allErrs = append(allErrs, validateRestartPolicy(&spec.RestartPolicy, fldPath.Child("restartPolicy"))...) + allErrs = append(allErrs, validateDNSPolicy(&spec.DNSPolicy, fldPath.Child("dnsPolicy"))...) + allErrs = append(allErrs, unversionedvalidation.ValidateLabels(spec.NodeSelector, fldPath.Child("nodeSelector"))...) + allErrs = append(allErrs, ValidatePodSecurityContext(spec.SecurityContext, spec, fldPath, fldPath.Child("securityContext"))...) + allErrs = append(allErrs, validateImagePullSecrets(spec.ImagePullSecrets, fldPath.Child("imagePullSecrets"))...) + allErrs = append(allErrs, validateAffinity(spec.Affinity, fldPath.Child("affinity"))...) + allErrs = append(allErrs, validatePodDNSConfig(spec.DNSConfig, &spec.DNSPolicy, fldPath.Child("dnsConfig"))...) + if len(spec.ServiceAccountName) > 0 { + for _, msg := range ValidateServiceAccountName(spec.ServiceAccountName, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("serviceAccountName"), spec.ServiceAccountName, msg)) + } + } + + if len(spec.NodeName) > 0 { + for _, msg := range ValidateNodeName(spec.NodeName, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("nodeName"), spec.NodeName, msg)) + } + } + + if spec.ActiveDeadlineSeconds != nil { + value := *spec.ActiveDeadlineSeconds + if value < 1 || value > math.MaxInt32 { + allErrs = append(allErrs, field.Invalid(fldPath.Child("activeDeadlineSeconds"), value, validation.InclusiveRangeError(1, math.MaxInt32))) + } + } + + if len(spec.Hostname) > 0 { + allErrs = append(allErrs, ValidateDNS1123Label(spec.Hostname, fldPath.Child("hostname"))...) + } + + if len(spec.Subdomain) > 0 { + allErrs = append(allErrs, ValidateDNS1123Label(spec.Subdomain, fldPath.Child("subdomain"))...) + } + + if len(spec.Tolerations) > 0 { + allErrs = append(allErrs, ValidateTolerations(spec.Tolerations, fldPath.Child("tolerations"))...) + } + + if len(spec.HostAliases) > 0 { + allErrs = append(allErrs, ValidateHostAliases(spec.HostAliases, fldPath.Child("hostAliases"))...) + } + + if len(spec.PriorityClassName) > 0 { + if utilfeature.DefaultFeatureGate.Enabled(features.PodPriority) { + for _, msg := range ValidatePriorityClassName(spec.PriorityClassName, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("priorityClassName"), spec.PriorityClassName, msg)) + } + } + } + + return allErrs +} + +// ValidateNodeSelectorRequirement tests that the specified NodeSelectorRequirement fields has valid data +func ValidateNodeSelectorRequirement(rq core.NodeSelectorRequirement, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + switch rq.Operator { + case core.NodeSelectorOpIn, core.NodeSelectorOpNotIn: + if len(rq.Values) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("values"), "must be specified when `operator` is 'In' or 'NotIn'")) + } + case core.NodeSelectorOpExists, core.NodeSelectorOpDoesNotExist: + if len(rq.Values) > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("values"), "may not be specified when `operator` is 'Exists' or 'DoesNotExist'")) + } + + case core.NodeSelectorOpGt, core.NodeSelectorOpLt: + if len(rq.Values) != 1 { + allErrs = append(allErrs, field.Required(fldPath.Child("values"), "must be specified single value when `operator` is 'Lt' or 'Gt'")) + } + default: + allErrs = append(allErrs, field.Invalid(fldPath.Child("operator"), rq.Operator, "not a valid selector operator")) + } + allErrs = append(allErrs, unversionedvalidation.ValidateLabelName(rq.Key, fldPath.Child("key"))...) + return allErrs +} + +// ValidateNodeSelectorTerm tests that the specified node selector term has valid data +func ValidateNodeSelectorTerm(term core.NodeSelectorTerm, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if len(term.MatchExpressions) == 0 { + return append(allErrs, field.Required(fldPath.Child("matchExpressions"), "must have at least one node selector requirement")) + } + for j, req := range term.MatchExpressions { + allErrs = append(allErrs, ValidateNodeSelectorRequirement(req, fldPath.Child("matchExpressions").Index(j))...) + } + return allErrs +} + +// ValidateNodeSelector tests that the specified nodeSelector fields has valid data +func ValidateNodeSelector(nodeSelector *core.NodeSelector, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + termFldPath := fldPath.Child("nodeSelectorTerms") + if len(nodeSelector.NodeSelectorTerms) == 0 { + return append(allErrs, field.Required(termFldPath, "must have at least one node selector term")) + } + + for i, term := range nodeSelector.NodeSelectorTerms { + allErrs = append(allErrs, ValidateNodeSelectorTerm(term, termFldPath.Index(i))...) + } + + return allErrs +} + +// ValidateAvoidPodsInNodeAnnotations tests that the serialized AvoidPods in Node.Annotations has valid data +func ValidateAvoidPodsInNodeAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + v1Avoids, err := v1helper.GetAvoidPodsFromNodeAnnotations(annotations) + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("AvoidPods"), core.PreferAvoidPodsAnnotationKey, err.Error())) + return allErrs + } + var avoids core.AvoidPods + if err := corev1.Convert_v1_AvoidPods_To_core_AvoidPods(&v1Avoids, &avoids, nil); err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("AvoidPods"), core.PreferAvoidPodsAnnotationKey, err.Error())) + return allErrs + } + + if len(avoids.PreferAvoidPods) != 0 { + for i, pa := range avoids.PreferAvoidPods { + idxPath := fldPath.Child(core.PreferAvoidPodsAnnotationKey).Index(i) + allErrs = append(allErrs, validatePreferAvoidPodsEntry(pa, idxPath)...) + } + } + + return allErrs +} + +// validatePreferAvoidPodsEntry tests if given PreferAvoidPodsEntry has valid data. +func validatePreferAvoidPodsEntry(avoidPodEntry core.PreferAvoidPodsEntry, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + if avoidPodEntry.PodSignature.PodController == nil { + allErrors = append(allErrors, field.Required(fldPath.Child("PodSignature"), "")) + } else { + if *(avoidPodEntry.PodSignature.PodController.Controller) != true { + allErrors = append(allErrors, + field.Invalid(fldPath.Child("PodSignature").Child("PodController").Child("Controller"), + *(avoidPodEntry.PodSignature.PodController.Controller), "must point to a controller")) + } + } + return allErrors +} + +// ValidatePreferredSchedulingTerms tests that the specified SoftNodeAffinity fields has valid data +func ValidatePreferredSchedulingTerms(terms []core.PreferredSchedulingTerm, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + for i, term := range terms { + if term.Weight <= 0 || term.Weight > 100 { + allErrs = append(allErrs, field.Invalid(fldPath.Index(i).Child("weight"), term.Weight, "must be in the range 1-100")) + } + + allErrs = append(allErrs, ValidateNodeSelectorTerm(term.Preference, fldPath.Index(i).Child("preference"))...) + } + return allErrs +} + +// validatePodAffinityTerm tests that the specified podAffinityTerm fields have valid data +func validatePodAffinityTerm(podAffinityTerm core.PodAffinityTerm, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + allErrs = append(allErrs, unversionedvalidation.ValidateLabelSelector(podAffinityTerm.LabelSelector, fldPath.Child("matchExpressions"))...) + for _, name := range podAffinityTerm.Namespaces { + for _, msg := range ValidateNamespaceName(name, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("namespace"), name, msg)) + } + } + if len(podAffinityTerm.TopologyKey) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("topologyKey"), "can not be empty")) + } + return append(allErrs, unversionedvalidation.ValidateLabelName(podAffinityTerm.TopologyKey, fldPath.Child("topologyKey"))...) +} + +// validatePodAffinityTerms tests that the specified podAffinityTerms fields have valid data +func validatePodAffinityTerms(podAffinityTerms []core.PodAffinityTerm, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for i, podAffinityTerm := range podAffinityTerms { + allErrs = append(allErrs, validatePodAffinityTerm(podAffinityTerm, fldPath.Index(i))...) + } + return allErrs +} + +// validateWeightedPodAffinityTerms tests that the specified weightedPodAffinityTerms fields have valid data +func validateWeightedPodAffinityTerms(weightedPodAffinityTerms []core.WeightedPodAffinityTerm, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for j, weightedTerm := range weightedPodAffinityTerms { + if weightedTerm.Weight <= 0 || weightedTerm.Weight > 100 { + allErrs = append(allErrs, field.Invalid(fldPath.Index(j).Child("weight"), weightedTerm.Weight, "must be in the range 1-100")) + } + allErrs = append(allErrs, validatePodAffinityTerm(weightedTerm.PodAffinityTerm, fldPath.Index(j).Child("podAffinityTerm"))...) + } + return allErrs +} + +// validatePodAntiAffinity tests that the specified podAntiAffinity fields have valid data +func validatePodAntiAffinity(podAntiAffinity *core.PodAntiAffinity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + // TODO:Uncomment below code once RequiredDuringSchedulingRequiredDuringExecution is implemented. + // if podAntiAffinity.RequiredDuringSchedulingRequiredDuringExecution != nil { + // allErrs = append(allErrs, validatePodAffinityTerms(podAntiAffinity.RequiredDuringSchedulingRequiredDuringExecution, false, + // fldPath.Child("requiredDuringSchedulingRequiredDuringExecution"))...) + //} + if podAntiAffinity.RequiredDuringSchedulingIgnoredDuringExecution != nil { + allErrs = append(allErrs, validatePodAffinityTerms(podAntiAffinity.RequiredDuringSchedulingIgnoredDuringExecution, + fldPath.Child("requiredDuringSchedulingIgnoredDuringExecution"))...) + } + if podAntiAffinity.PreferredDuringSchedulingIgnoredDuringExecution != nil { + allErrs = append(allErrs, validateWeightedPodAffinityTerms(podAntiAffinity.PreferredDuringSchedulingIgnoredDuringExecution, + fldPath.Child("preferredDuringSchedulingIgnoredDuringExecution"))...) + } + return allErrs +} + +// validateNodeAffinity tests that the specified nodeAffinity fields have valid data +func validateNodeAffinity(na *core.NodeAffinity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + // TODO: Uncomment the next three lines once RequiredDuringSchedulingRequiredDuringExecution is implemented. + // if na.RequiredDuringSchedulingRequiredDuringExecution != nil { + // allErrs = append(allErrs, ValidateNodeSelector(na.RequiredDuringSchedulingRequiredDuringExecution, fldPath.Child("requiredDuringSchedulingRequiredDuringExecution"))...) + // } + if na.RequiredDuringSchedulingIgnoredDuringExecution != nil { + allErrs = append(allErrs, ValidateNodeSelector(na.RequiredDuringSchedulingIgnoredDuringExecution, fldPath.Child("requiredDuringSchedulingIgnoredDuringExecution"))...) + } + if len(na.PreferredDuringSchedulingIgnoredDuringExecution) > 0 { + allErrs = append(allErrs, ValidatePreferredSchedulingTerms(na.PreferredDuringSchedulingIgnoredDuringExecution, fldPath.Child("preferredDuringSchedulingIgnoredDuringExecution"))...) + } + return allErrs +} + +// validatePodAffinity tests that the specified podAffinity fields have valid data +func validatePodAffinity(podAffinity *core.PodAffinity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + // TODO:Uncomment below code once RequiredDuringSchedulingRequiredDuringExecution is implemented. + // if podAffinity.RequiredDuringSchedulingRequiredDuringExecution != nil { + // allErrs = append(allErrs, validatePodAffinityTerms(podAffinity.RequiredDuringSchedulingRequiredDuringExecution, false, + // fldPath.Child("requiredDuringSchedulingRequiredDuringExecution"))...) + //} + if podAffinity.RequiredDuringSchedulingIgnoredDuringExecution != nil { + allErrs = append(allErrs, validatePodAffinityTerms(podAffinity.RequiredDuringSchedulingIgnoredDuringExecution, + fldPath.Child("requiredDuringSchedulingIgnoredDuringExecution"))...) + } + if podAffinity.PreferredDuringSchedulingIgnoredDuringExecution != nil { + allErrs = append(allErrs, validateWeightedPodAffinityTerms(podAffinity.PreferredDuringSchedulingIgnoredDuringExecution, + fldPath.Child("preferredDuringSchedulingIgnoredDuringExecution"))...) + } + return allErrs +} + +func ValidateSeccompProfile(p string, fldPath *field.Path) field.ErrorList { + if p == "docker/default" { + return nil + } + if p == "unconfined" { + return nil + } + if strings.HasPrefix(p, "localhost/") { + return validateLocalDescendingPath(strings.TrimPrefix(p, "localhost/"), fldPath) + } + return field.ErrorList{field.Invalid(fldPath, p, "must be a valid seccomp profile")} +} + +func ValidateSeccompPodAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if p, exists := annotations[core.SeccompPodAnnotationKey]; exists { + allErrs = append(allErrs, ValidateSeccompProfile(p, fldPath.Child(core.SeccompPodAnnotationKey))...) + } + for k, p := range annotations { + if strings.HasPrefix(k, core.SeccompContainerAnnotationKeyPrefix) { + allErrs = append(allErrs, ValidateSeccompProfile(p, fldPath.Child(k))...) + } + } + + return allErrs +} + +func ValidateAppArmorPodAnnotations(annotations map[string]string, spec *core.PodSpec, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for k, p := range annotations { + if !strings.HasPrefix(k, apparmor.ContainerAnnotationKeyPrefix) { + continue + } + // TODO: this belongs to admission, not general pod validation: + if !utilfeature.DefaultFeatureGate.Enabled(features.AppArmor) { + allErrs = append(allErrs, field.Forbidden(fldPath.Key(k), "AppArmor is disabled by feature-gate")) + continue + } + containerName := strings.TrimPrefix(k, apparmor.ContainerAnnotationKeyPrefix) + if !podSpecHasContainer(spec, containerName) { + allErrs = append(allErrs, field.Invalid(fldPath.Key(k), containerName, "container not found")) + } + + if err := apparmor.ValidateProfileFormat(p); err != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Key(k), p, err.Error())) + } + } + + return allErrs +} + +func podSpecHasContainer(spec *core.PodSpec, containerName string) bool { + for _, c := range spec.InitContainers { + if c.Name == containerName { + return true + } + } + for _, c := range spec.Containers { + if c.Name == containerName { + return true + } + } + return false +} + +const ( + // a sysctl segment regex, concatenated with dots to form a sysctl name + SysctlSegmentFmt string = "[a-z0-9]([-_a-z0-9]*[a-z0-9])?" + + // a sysctl name regex + SysctlFmt string = "(" + SysctlSegmentFmt + "\\.)*" + SysctlSegmentFmt + + // the maximal length of a sysctl name + SysctlMaxLength int = 253 +) + +var sysctlRegexp = regexp.MustCompile("^" + SysctlFmt + "$") + +// IsValidSysctlName checks that the given string is a valid sysctl name, +// i.e. matches SysctlFmt. +func IsValidSysctlName(name string) bool { + if len(name) > SysctlMaxLength { + return false + } + return sysctlRegexp.MatchString(name) +} + +func validateSysctls(sysctls []core.Sysctl, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for i, s := range sysctls { + if len(s.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Index(i).Child("name"), "")) + } else if !IsValidSysctlName(s.Name) { + allErrs = append(allErrs, field.Invalid(fldPath.Index(i).Child("name"), s.Name, fmt.Sprintf("must have at most %d characters and match regex %s", SysctlMaxLength, SysctlFmt))) + } + } + return allErrs +} + +// ValidatePodSecurityContext test that the specified PodSecurityContext has valid data. +func ValidatePodSecurityContext(securityContext *core.PodSecurityContext, spec *core.PodSpec, specPath, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if securityContext != nil { + allErrs = append(allErrs, validateHostNetwork(securityContext.HostNetwork, spec.Containers, specPath.Child("containers"))...) + if securityContext.FSGroup != nil { + for _, msg := range validation.IsValidGroupID(*securityContext.FSGroup) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("fsGroup"), *(securityContext.FSGroup), msg)) + } + } + if securityContext.RunAsUser != nil { + for _, msg := range validation.IsValidUserID(*securityContext.RunAsUser) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("runAsUser"), *(securityContext.RunAsUser), msg)) + } + } + for g, gid := range securityContext.SupplementalGroups { + for _, msg := range validation.IsValidGroupID(gid) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("supplementalGroups").Index(g), gid, msg)) + } + } + if securityContext.ShareProcessNamespace != nil { + if !utilfeature.DefaultFeatureGate.Enabled(features.PodShareProcessNamespace) { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("shareProcessNamespace"), "Process Namespace Sharing is disabled by PodShareProcessNamespace feature-gate")) + } else if securityContext.HostPID && *securityContext.ShareProcessNamespace { + allErrs = append(allErrs, field.Invalid(fldPath.Child("shareProcessNamespace"), *securityContext.ShareProcessNamespace, "ShareProcessNamespace and HostPID cannot both be enabled")) + } + } + } + + return allErrs +} + +func ValidateContainerUpdates(newContainers, oldContainers []core.Container, fldPath *field.Path) (allErrs field.ErrorList, stop bool) { + allErrs = field.ErrorList{} + if len(newContainers) != len(oldContainers) { + //TODO: Pinpoint the specific container that causes the invalid error after we have strategic merge diff + allErrs = append(allErrs, field.Forbidden(fldPath, "pod updates may not add or remove containers")) + return allErrs, true + } + + // validate updated container images + for i, ctr := range newContainers { + if len(ctr.Image) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Index(i).Child("image"), "")) + } + // this is only called from ValidatePodUpdate so its safe to check leading/trailing whitespace. + if len(strings.TrimSpace(ctr.Image)) != len(ctr.Image) { + allErrs = append(allErrs, field.Invalid(fldPath.Index(i).Child("image"), ctr.Image, "must not have leading or trailing whitespace")) + } + } + return allErrs, false +} + +// ValidatePodUpdate tests to see if the update is legal for an end user to make. newPod is updated with fields +// that cannot be changed. +func ValidatePodUpdate(newPod, oldPod *core.Pod) field.ErrorList { + fldPath := field.NewPath("metadata") + allErrs := ValidateObjectMetaUpdate(&newPod.ObjectMeta, &oldPod.ObjectMeta, fldPath) + allErrs = append(allErrs, ValidatePodSpecificAnnotationUpdates(newPod, oldPod, fldPath.Child("annotations"))...) + specPath := field.NewPath("spec") + + // validate updateable fields: + // 1. spec.containers[*].image + // 2. spec.initContainers[*].image + // 3. spec.activeDeadlineSeconds + + containerErrs, stop := ValidateContainerUpdates(newPod.Spec.Containers, oldPod.Spec.Containers, specPath.Child("containers")) + allErrs = append(allErrs, containerErrs...) + if stop { + return allErrs + } + containerErrs, stop = ValidateContainerUpdates(newPod.Spec.InitContainers, oldPod.Spec.InitContainers, specPath.Child("initContainers")) + allErrs = append(allErrs, containerErrs...) + if stop { + return allErrs + } + + // validate updated spec.activeDeadlineSeconds. two types of updates are allowed: + // 1. from nil to a positive value + // 2. from a positive value to a lesser, non-negative value + if newPod.Spec.ActiveDeadlineSeconds != nil { + newActiveDeadlineSeconds := *newPod.Spec.ActiveDeadlineSeconds + if newActiveDeadlineSeconds < 0 || newActiveDeadlineSeconds > math.MaxInt32 { + allErrs = append(allErrs, field.Invalid(specPath.Child("activeDeadlineSeconds"), newActiveDeadlineSeconds, validation.InclusiveRangeError(0, math.MaxInt32))) + return allErrs + } + if oldPod.Spec.ActiveDeadlineSeconds != nil { + oldActiveDeadlineSeconds := *oldPod.Spec.ActiveDeadlineSeconds + if oldActiveDeadlineSeconds < newActiveDeadlineSeconds { + allErrs = append(allErrs, field.Invalid(specPath.Child("activeDeadlineSeconds"), newActiveDeadlineSeconds, "must be less than or equal to previous value")) + return allErrs + } + } + } else if oldPod.Spec.ActiveDeadlineSeconds != nil { + allErrs = append(allErrs, field.Invalid(specPath.Child("activeDeadlineSeconds"), newPod.Spec.ActiveDeadlineSeconds, "must not update from a positive integer to nil value")) + } + + // handle updateable fields by munging those fields prior to deep equal comparison. + mungedPod := *newPod + // munge spec.containers[*].image + var newContainers []core.Container + for ix, container := range mungedPod.Spec.Containers { + container.Image = oldPod.Spec.Containers[ix].Image + newContainers = append(newContainers, container) + } + mungedPod.Spec.Containers = newContainers + // munge spec.initContainers[*].image + var newInitContainers []core.Container + for ix, container := range mungedPod.Spec.InitContainers { + container.Image = oldPod.Spec.InitContainers[ix].Image + newInitContainers = append(newInitContainers, container) + } + mungedPod.Spec.InitContainers = newInitContainers + // munge spec.activeDeadlineSeconds + mungedPod.Spec.ActiveDeadlineSeconds = nil + if oldPod.Spec.ActiveDeadlineSeconds != nil { + activeDeadlineSeconds := *oldPod.Spec.ActiveDeadlineSeconds + mungedPod.Spec.ActiveDeadlineSeconds = &activeDeadlineSeconds + } + + // Allow only additions to tolerations updates. + mungedPod.Spec.Tolerations = oldPod.Spec.Tolerations + allErrs = append(allErrs, validateOnlyAddedTolerations(newPod.Spec.Tolerations, oldPod.Spec.Tolerations, specPath.Child("tolerations"))...) + + if !apiequality.Semantic.DeepEqual(mungedPod.Spec, oldPod.Spec) { + // This diff isn't perfect, but it's a helluva lot better an "I'm not going to tell you what the difference is". + //TODO: Pinpoint the specific field that causes the invalid error after we have strategic merge diff + specDiff := diff.ObjectDiff(mungedPod.Spec, oldPod.Spec) + allErrs = append(allErrs, field.Forbidden(specPath, fmt.Sprintf("pod updates may not change fields other than `spec.containers[*].image`, `spec.initContainers[*].image`, `spec.activeDeadlineSeconds` or `spec.tolerations` (only additions to existing tolerations)\n%v", specDiff))) + } + + return allErrs +} + +// ValidateContainerStateTransition test to if any illegal container state transitions are being attempted +func ValidateContainerStateTransition(newStatuses, oldStatuses []core.ContainerStatus, fldpath *field.Path, restartPolicy core.RestartPolicy) field.ErrorList { + allErrs := field.ErrorList{} + // If we should always restart, containers are allowed to leave the terminated state + if restartPolicy == core.RestartPolicyAlways { + return allErrs + } + for i, oldStatus := range oldStatuses { + // Skip any container that is not terminated + if oldStatus.State.Terminated == nil { + continue + } + // Skip any container that failed but is allowed to restart + if oldStatus.State.Terminated.ExitCode != 0 && restartPolicy == core.RestartPolicyOnFailure { + continue + } + for _, newStatus := range newStatuses { + if oldStatus.Name == newStatus.Name && newStatus.State.Terminated == nil { + allErrs = append(allErrs, field.Forbidden(fldpath.Index(i).Child("state"), "may not be transitioned to non-terminated state")) + } + } + } + return allErrs +} + +// ValidatePodStatusUpdate tests to see if the update is legal for an end user to make. newPod is updated with fields +// that cannot be changed. +func ValidatePodStatusUpdate(newPod, oldPod *core.Pod) field.ErrorList { + fldPath := field.NewPath("metadata") + allErrs := ValidateObjectMetaUpdate(&newPod.ObjectMeta, &oldPod.ObjectMeta, fldPath) + allErrs = append(allErrs, ValidatePodSpecificAnnotationUpdates(newPod, oldPod, fldPath.Child("annotations"))...) + + fldPath = field.NewPath("status") + if newPod.Spec.NodeName != oldPod.Spec.NodeName { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("nodeName"), "may not be changed directly")) + } + + if newPod.Status.NominatedNodeName != oldPod.Status.NominatedNodeName && len(newPod.Status.NominatedNodeName) > 0 { + for _, msg := range ValidateNodeName(newPod.Status.NominatedNodeName, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("nominatedNodeName"), newPod.Status.NominatedNodeName, msg)) + } + } + + // If pod should not restart, make sure the status update does not transition + // any terminated containers to a non-terminated state. + allErrs = append(allErrs, ValidateContainerStateTransition(newPod.Status.ContainerStatuses, oldPod.Status.ContainerStatuses, fldPath.Child("containerStatuses"), oldPod.Spec.RestartPolicy)...) + allErrs = append(allErrs, ValidateContainerStateTransition(newPod.Status.InitContainerStatuses, oldPod.Status.InitContainerStatuses, fldPath.Child("initContainerStatuses"), oldPod.Spec.RestartPolicy)...) + + // For status update we ignore changes to pod spec. + newPod.Spec = oldPod.Spec + + return allErrs +} + +// ValidatePodBinding tests if required fields in the pod binding are legal. +func ValidatePodBinding(binding *core.Binding) field.ErrorList { + allErrs := field.ErrorList{} + + if len(binding.Target.Kind) != 0 && binding.Target.Kind != "Node" { + // TODO: When validation becomes versioned, this gets more complicated. + allErrs = append(allErrs, field.NotSupported(field.NewPath("target", "kind"), binding.Target.Kind, []string{"Node", "<empty>"})) + } + if len(binding.Target.Name) == 0 { + // TODO: When validation becomes versioned, this gets more complicated. + allErrs = append(allErrs, field.Required(field.NewPath("target", "name"), "")) + } + + return allErrs +} + +// ValidatePodTemplate tests if required fields in the pod template are set. +func ValidatePodTemplate(pod *core.PodTemplate) field.ErrorList { + allErrs := ValidateObjectMeta(&pod.ObjectMeta, true, ValidatePodName, field.NewPath("metadata")) + allErrs = append(allErrs, ValidatePodTemplateSpec(&pod.Template, field.NewPath("template"))...) + return allErrs +} + +// ValidatePodTemplateUpdate tests to see if the update is legal for an end user to make. newPod is updated with fields +// that cannot be changed. +func ValidatePodTemplateUpdate(newPod, oldPod *core.PodTemplate) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&oldPod.ObjectMeta, &newPod.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidatePodTemplateSpec(&newPod.Template, field.NewPath("template"))...) + return allErrs +} + +var supportedSessionAffinityType = sets.NewString(string(core.ServiceAffinityClientIP), string(core.ServiceAffinityNone)) +var supportedServiceType = sets.NewString(string(core.ServiceTypeClusterIP), string(core.ServiceTypeNodePort), + string(core.ServiceTypeLoadBalancer), string(core.ServiceTypeExternalName)) + +// ValidateService tests if required fields/annotations of a Service are valid. +func ValidateService(service *core.Service) field.ErrorList { + allErrs := ValidateObjectMeta(&service.ObjectMeta, true, ValidateServiceName, field.NewPath("metadata")) + + specPath := field.NewPath("spec") + isHeadlessService := service.Spec.ClusterIP == core.ClusterIPNone + if len(service.Spec.Ports) == 0 && !isHeadlessService && service.Spec.Type != core.ServiceTypeExternalName { + allErrs = append(allErrs, field.Required(specPath.Child("ports"), "")) + } + switch service.Spec.Type { + case core.ServiceTypeLoadBalancer: + for ix := range service.Spec.Ports { + port := &service.Spec.Ports[ix] + // This is a workaround for broken cloud environments that + // over-open firewalls. Hopefully it can go away when more clouds + // understand containers better. + if port.Port == ports.KubeletPort { + portPath := specPath.Child("ports").Index(ix) + allErrs = append(allErrs, field.Invalid(portPath, port.Port, fmt.Sprintf("may not expose port %v externally since it is used by kubelet", ports.KubeletPort))) + } + } + if service.Spec.ClusterIP == "None" { + allErrs = append(allErrs, field.Invalid(specPath.Child("clusterIP"), service.Spec.ClusterIP, "may not be set to 'None' for LoadBalancer services")) + } + case core.ServiceTypeNodePort: + if service.Spec.ClusterIP == "None" { + allErrs = append(allErrs, field.Invalid(specPath.Child("clusterIP"), service.Spec.ClusterIP, "may not be set to 'None' for NodePort services")) + } + case core.ServiceTypeExternalName: + if service.Spec.ClusterIP != "" { + allErrs = append(allErrs, field.Forbidden(specPath.Child("clusterIP"), "must be empty for ExternalName services")) + } + if len(service.Spec.ExternalName) > 0 { + allErrs = append(allErrs, ValidateDNS1123Subdomain(service.Spec.ExternalName, specPath.Child("externalName"))...) + } else { + allErrs = append(allErrs, field.Required(specPath.Child("externalName"), "")) + } + } + + allPortNames := sets.String{} + portsPath := specPath.Child("ports") + for i := range service.Spec.Ports { + portPath := portsPath.Index(i) + allErrs = append(allErrs, validateServicePort(&service.Spec.Ports[i], len(service.Spec.Ports) > 1, isHeadlessService, &allPortNames, portPath)...) + } + + if service.Spec.Selector != nil { + allErrs = append(allErrs, unversionedvalidation.ValidateLabels(service.Spec.Selector, specPath.Child("selector"))...) + } + + if len(service.Spec.SessionAffinity) == 0 { + allErrs = append(allErrs, field.Required(specPath.Child("sessionAffinity"), "")) + } else if !supportedSessionAffinityType.Has(string(service.Spec.SessionAffinity)) { + allErrs = append(allErrs, field.NotSupported(specPath.Child("sessionAffinity"), service.Spec.SessionAffinity, supportedSessionAffinityType.List())) + } + + if service.Spec.SessionAffinity == core.ServiceAffinityClientIP { + allErrs = append(allErrs, validateClientIPAffinityConfig(service.Spec.SessionAffinityConfig, specPath.Child("sessionAffinityConfig"))...) + } else if service.Spec.SessionAffinity == core.ServiceAffinityNone { + if service.Spec.SessionAffinityConfig != nil { + allErrs = append(allErrs, field.Forbidden(specPath.Child("sessionAffinityConfig"), fmt.Sprintf("must not be set when session affinity is %s", string(core.ServiceAffinityNone)))) + } + } + + if helper.IsServiceIPSet(service) { + if ip := net.ParseIP(service.Spec.ClusterIP); ip == nil { + allErrs = append(allErrs, field.Invalid(specPath.Child("clusterIP"), service.Spec.ClusterIP, "must be empty, 'None', or a valid IP address")) + } + } + + ipPath := specPath.Child("externalIPs") + for i, ip := range service.Spec.ExternalIPs { + idxPath := ipPath.Index(i) + if msgs := validation.IsValidIP(ip); len(msgs) != 0 { + for i := range msgs { + allErrs = append(allErrs, field.Invalid(idxPath, ip, msgs[i])) + } + } else { + allErrs = append(allErrs, validateNonSpecialIP(ip, idxPath)...) + } + } + + if len(service.Spec.Type) == 0 { + allErrs = append(allErrs, field.Required(specPath.Child("type"), "")) + } else if !supportedServiceType.Has(string(service.Spec.Type)) { + allErrs = append(allErrs, field.NotSupported(specPath.Child("type"), service.Spec.Type, supportedServiceType.List())) + } + + if service.Spec.Type == core.ServiceTypeLoadBalancer { + portsPath := specPath.Child("ports") + includeProtocols := sets.NewString() + for i := range service.Spec.Ports { + portPath := portsPath.Index(i) + if !supportedPortProtocols.Has(string(service.Spec.Ports[i].Protocol)) { + allErrs = append(allErrs, field.Invalid(portPath.Child("protocol"), service.Spec.Ports[i].Protocol, "cannot create an external load balancer with non-TCP/UDP ports")) + } else { + includeProtocols.Insert(string(service.Spec.Ports[i].Protocol)) + } + } + if includeProtocols.Len() > 1 { + allErrs = append(allErrs, field.Invalid(portsPath, service.Spec.Ports, "cannot create an external load balancer with mix protocols")) + } + } + + if service.Spec.Type == core.ServiceTypeClusterIP { + portsPath := specPath.Child("ports") + for i := range service.Spec.Ports { + portPath := portsPath.Index(i) + if service.Spec.Ports[i].NodePort != 0 { + allErrs = append(allErrs, field.Forbidden(portPath.Child("nodePort"), "may not be used when `type` is 'ClusterIP'")) + } + } + } + + // Check for duplicate NodePorts, considering (protocol,port) pairs + portsPath = specPath.Child("ports") + nodePorts := make(map[core.ServicePort]bool) + for i := range service.Spec.Ports { + port := &service.Spec.Ports[i] + if port.NodePort == 0 { + continue + } + portPath := portsPath.Index(i) + var key core.ServicePort + key.Protocol = port.Protocol + key.NodePort = port.NodePort + _, found := nodePorts[key] + if found { + allErrs = append(allErrs, field.Duplicate(portPath.Child("nodePort"), port.NodePort)) + } + nodePorts[key] = true + } + + // Check for duplicate Ports, considering (protocol,port) pairs + portsPath = specPath.Child("ports") + ports := make(map[core.ServicePort]bool) + for i, port := range service.Spec.Ports { + portPath := portsPath.Index(i) + key := core.ServicePort{Protocol: port.Protocol, Port: port.Port} + _, found := ports[key] + if found { + allErrs = append(allErrs, field.Duplicate(portPath, key)) + } + ports[key] = true + } + + // Validate SourceRange field and annotation + _, ok := service.Annotations[core.AnnotationLoadBalancerSourceRangesKey] + if len(service.Spec.LoadBalancerSourceRanges) > 0 || ok { + var fieldPath *field.Path + var val string + if len(service.Spec.LoadBalancerSourceRanges) > 0 { + fieldPath = specPath.Child("LoadBalancerSourceRanges") + val = fmt.Sprintf("%v", service.Spec.LoadBalancerSourceRanges) + } else { + fieldPath = field.NewPath("metadata", "annotations").Key(core.AnnotationLoadBalancerSourceRangesKey) + val = service.Annotations[core.AnnotationLoadBalancerSourceRangesKey] + } + if service.Spec.Type != core.ServiceTypeLoadBalancer { + allErrs = append(allErrs, field.Forbidden(fieldPath, "may only be used when `type` is 'LoadBalancer'")) + } + _, err := apiservice.GetLoadBalancerSourceRanges(service) + if err != nil { + allErrs = append(allErrs, field.Invalid(fieldPath, val, "must be a list of IP ranges. For example, 10.240.0.0/24,10.250.0.0/24 ")) + } + } + + allErrs = append(allErrs, validateServiceExternalTrafficFieldsValue(service)...) + + return allErrs +} + +func validateServicePort(sp *core.ServicePort, requireName, isHeadlessService bool, allNames *sets.String, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if requireName && len(sp.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } else if len(sp.Name) != 0 { + allErrs = append(allErrs, ValidateDNS1123Label(sp.Name, fldPath.Child("name"))...) + if allNames.Has(sp.Name) { + allErrs = append(allErrs, field.Duplicate(fldPath.Child("name"), sp.Name)) + } else { + allNames.Insert(sp.Name) + } + } + + for _, msg := range validation.IsValidPortNum(int(sp.Port)) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("port"), sp.Port, msg)) + } + + if len(sp.Protocol) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("protocol"), "")) + } else if !supportedPortProtocols.Has(string(sp.Protocol)) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("protocol"), sp.Protocol, supportedPortProtocols.List())) + } + + allErrs = append(allErrs, ValidatePortNumOrName(sp.TargetPort, fldPath.Child("targetPort"))...) + + // in the v1 API, targetPorts on headless services were tolerated. + // once we have version-specific validation, we can reject this on newer API versions, but until then, we have to tolerate it for compatibility. + // + // if isHeadlessService { + // if sp.TargetPort.Type == intstr.String || (sp.TargetPort.Type == intstr.Int && sp.Port != sp.TargetPort.IntValue()) { + // allErrs = append(allErrs, field.Invalid(fldPath.Child("targetPort"), sp.TargetPort, "must be equal to the value of 'port' when clusterIP = None")) + // } + // } + + return allErrs +} + +// validateServiceExternalTrafficFieldsValue validates ExternalTraffic related annotations +// have legal value. +func validateServiceExternalTrafficFieldsValue(service *core.Service) field.ErrorList { + allErrs := field.ErrorList{} + + // Check first class fields. + if service.Spec.ExternalTrafficPolicy != "" && + service.Spec.ExternalTrafficPolicy != core.ServiceExternalTrafficPolicyTypeCluster && + service.Spec.ExternalTrafficPolicy != core.ServiceExternalTrafficPolicyTypeLocal { + allErrs = append(allErrs, field.Invalid(field.NewPath("spec").Child("externalTrafficPolicy"), service.Spec.ExternalTrafficPolicy, + fmt.Sprintf("ExternalTrafficPolicy must be empty, %v or %v", core.ServiceExternalTrafficPolicyTypeCluster, core.ServiceExternalTrafficPolicyTypeLocal))) + } + if service.Spec.HealthCheckNodePort < 0 { + allErrs = append(allErrs, field.Invalid(field.NewPath("spec").Child("healthCheckNodePort"), service.Spec.HealthCheckNodePort, + "HealthCheckNodePort must be not less than 0")) + } + + return allErrs +} + +// ValidateServiceExternalTrafficFieldsCombination validates if ExternalTrafficPolicy, +// HealthCheckNodePort and Type combination are legal. For update, it should be called +// after clearing externalTraffic related fields for the ease of transitioning between +// different service types. +func ValidateServiceExternalTrafficFieldsCombination(service *core.Service) field.ErrorList { + allErrs := field.ErrorList{} + + if service.Spec.Type != core.ServiceTypeLoadBalancer && + service.Spec.Type != core.ServiceTypeNodePort && + service.Spec.ExternalTrafficPolicy != "" { + allErrs = append(allErrs, field.Invalid(field.NewPath("spec", "externalTrafficPolicy"), service.Spec.ExternalTrafficPolicy, + "ExternalTrafficPolicy can only be set on NodePort and LoadBalancer service")) + } + + if !apiservice.NeedsHealthCheck(service) && + service.Spec.HealthCheckNodePort != 0 { + allErrs = append(allErrs, field.Invalid(field.NewPath("spec", "healthCheckNodePort"), service.Spec.HealthCheckNodePort, + "HealthCheckNodePort can only be set on LoadBalancer service with ExternalTrafficPolicy=Local")) + } + + return allErrs +} + +// ValidateServiceUpdate tests if required fields in the service are set during an update +func ValidateServiceUpdate(service, oldService *core.Service) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&service.ObjectMeta, &oldService.ObjectMeta, field.NewPath("metadata")) + + // ClusterIP should be immutable for services using it (every type other than ExternalName) + // which do not have ClusterIP assigned yet (empty string value) + if service.Spec.Type != core.ServiceTypeExternalName { + if oldService.Spec.Type != core.ServiceTypeExternalName && oldService.Spec.ClusterIP != "" { + allErrs = append(allErrs, ValidateImmutableField(service.Spec.ClusterIP, oldService.Spec.ClusterIP, field.NewPath("spec", "clusterIP"))...) + } + } + + allErrs = append(allErrs, ValidateService(service)...) + return allErrs +} + +// ValidateServiceStatusUpdate tests if required fields in the Service are set when updating status. +func ValidateServiceStatusUpdate(service, oldService *core.Service) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&service.ObjectMeta, &oldService.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateLoadBalancerStatus(&service.Status.LoadBalancer, field.NewPath("status", "loadBalancer"))...) + return allErrs +} + +// ValidateReplicationController tests if required fields in the replication controller are set. +func ValidateReplicationController(controller *core.ReplicationController) field.ErrorList { + allErrs := ValidateObjectMeta(&controller.ObjectMeta, true, ValidateReplicationControllerName, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateReplicationControllerSpec(&controller.Spec, field.NewPath("spec"))...) + return allErrs +} + +// ValidateReplicationControllerUpdate tests if required fields in the replication controller are set. +func ValidateReplicationControllerUpdate(controller, oldController *core.ReplicationController) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&controller.ObjectMeta, &oldController.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateReplicationControllerSpec(&controller.Spec, field.NewPath("spec"))...) + return allErrs +} + +// ValidateReplicationControllerStatusUpdate tests if required fields in the replication controller are set. +func ValidateReplicationControllerStatusUpdate(controller, oldController *core.ReplicationController) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&controller.ObjectMeta, &oldController.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateReplicationControllerStatus(controller.Status, field.NewPath("status"))...) + return allErrs +} + +func ValidateReplicationControllerStatus(status core.ReplicationControllerStatus, statusPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, ValidateNonnegativeField(int64(status.Replicas), statusPath.Child("replicas"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(status.FullyLabeledReplicas), statusPath.Child("fullyLabeledReplicas"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(status.ReadyReplicas), statusPath.Child("readyReplicas"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(status.AvailableReplicas), statusPath.Child("availableReplicas"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(status.ObservedGeneration), statusPath.Child("observedGeneration"))...) + msg := "cannot be greater than status.replicas" + if status.FullyLabeledReplicas > status.Replicas { + allErrs = append(allErrs, field.Invalid(statusPath.Child("fullyLabeledReplicas"), status.FullyLabeledReplicas, msg)) + } + if status.ReadyReplicas > status.Replicas { + allErrs = append(allErrs, field.Invalid(statusPath.Child("readyReplicas"), status.ReadyReplicas, msg)) + } + if status.AvailableReplicas > status.Replicas { + allErrs = append(allErrs, field.Invalid(statusPath.Child("availableReplicas"), status.AvailableReplicas, msg)) + } + if status.AvailableReplicas > status.ReadyReplicas { + allErrs = append(allErrs, field.Invalid(statusPath.Child("availableReplicas"), status.AvailableReplicas, "cannot be greater than readyReplicas")) + } + return allErrs +} + +// Validates that the given selector is non-empty. +func ValidateNonEmptySelector(selectorMap map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + selector := labels.Set(selectorMap).AsSelector() + if selector.Empty() { + allErrs = append(allErrs, field.Required(fldPath, "")) + } + return allErrs +} + +// Validates the given template and ensures that it is in accordance with the desired selector and replicas. +func ValidatePodTemplateSpecForRC(template *core.PodTemplateSpec, selectorMap map[string]string, replicas int32, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if template == nil { + allErrs = append(allErrs, field.Required(fldPath, "")) + } else { + selector := labels.Set(selectorMap).AsSelector() + if !selector.Empty() { + // Verify that the RC selector matches the labels in template. + labels := labels.Set(template.Labels) + if !selector.Matches(labels) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("metadata", "labels"), template.Labels, "`selector` does not match template `labels`")) + } + } + allErrs = append(allErrs, ValidatePodTemplateSpec(template, fldPath)...) + if replicas > 1 { + allErrs = append(allErrs, ValidateReadOnlyPersistentDisks(template.Spec.Volumes, fldPath.Child("spec", "volumes"))...) + } + // RestartPolicy has already been first-order validated as per ValidatePodTemplateSpec(). + if template.Spec.RestartPolicy != core.RestartPolicyAlways { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("spec", "restartPolicy"), template.Spec.RestartPolicy, []string{string(core.RestartPolicyAlways)})) + } + if template.Spec.ActiveDeadlineSeconds != nil { + allErrs = append(allErrs, field.Invalid(fldPath.Child("spec", "activeDeadlineSeconds"), template.Spec.ActiveDeadlineSeconds, "must not be specified")) + } + } + return allErrs +} + +// ValidateReplicationControllerSpec tests if required fields in the replication controller spec are set. +func ValidateReplicationControllerSpec(spec *core.ReplicationControllerSpec, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, ValidateNonnegativeField(int64(spec.MinReadySeconds), fldPath.Child("minReadySeconds"))...) + allErrs = append(allErrs, ValidateNonEmptySelector(spec.Selector, fldPath.Child("selector"))...) + allErrs = append(allErrs, ValidateNonnegativeField(int64(spec.Replicas), fldPath.Child("replicas"))...) + allErrs = append(allErrs, ValidatePodTemplateSpecForRC(spec.Template, spec.Selector, spec.Replicas, fldPath.Child("template"))...) + return allErrs +} + +// ValidatePodTemplateSpec validates the spec of a pod template +func ValidatePodTemplateSpec(spec *core.PodTemplateSpec, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, unversionedvalidation.ValidateLabels(spec.Labels, fldPath.Child("labels"))...) + allErrs = append(allErrs, ValidateAnnotations(spec.Annotations, fldPath.Child("annotations"))...) + allErrs = append(allErrs, ValidatePodSpecificAnnotations(spec.Annotations, &spec.Spec, fldPath.Child("annotations"))...) + allErrs = append(allErrs, ValidatePodSpec(&spec.Spec, fldPath.Child("spec"))...) + return allErrs +} + +func ValidateReadOnlyPersistentDisks(volumes []core.Volume, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for i := range volumes { + vol := &volumes[i] + idxPath := fldPath.Index(i) + if vol.GCEPersistentDisk != nil { + if vol.GCEPersistentDisk.ReadOnly == false { + allErrs = append(allErrs, field.Invalid(idxPath.Child("gcePersistentDisk", "readOnly"), false, "must be true for replicated pods > 1; GCE PD can only be mounted on multiple machines if it is read-only")) + } + } + // TODO: What to do for AWS? It doesn't support replicas + } + return allErrs +} + +// ValidateTaintsInNodeAnnotations tests that the serialized taints in Node.Annotations has valid data +func ValidateTaintsInNodeAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + taints, err := helper.GetTaintsFromNodeAnnotations(annotations) + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath, core.TaintsAnnotationKey, err.Error())) + return allErrs + } + + if len(taints) > 0 { + allErrs = append(allErrs, validateNodeTaints(taints, fldPath.Child(core.TaintsAnnotationKey))...) + } + + return allErrs +} + +// validateNodeTaints tests if given taints have valid data. +func validateNodeTaints(taints []core.Taint, fldPath *field.Path) field.ErrorList { + allErrors := field.ErrorList{} + + uniqueTaints := map[core.TaintEffect]sets.String{} + + for i, currTaint := range taints { + idxPath := fldPath.Index(i) + // validate the taint key + allErrors = append(allErrors, unversionedvalidation.ValidateLabelName(currTaint.Key, idxPath.Child("key"))...) + // validate the taint value + if errs := validation.IsValidLabelValue(currTaint.Value); len(errs) != 0 { + allErrors = append(allErrors, field.Invalid(idxPath.Child("value"), currTaint.Value, strings.Join(errs, ";"))) + } + // validate the taint effect + allErrors = append(allErrors, validateTaintEffect(&currTaint.Effect, false, idxPath.Child("effect"))...) + + // validate if taint is unique by <key, effect> + if len(uniqueTaints[currTaint.Effect]) > 0 && uniqueTaints[currTaint.Effect].Has(currTaint.Key) { + duplicatedError := field.Duplicate(idxPath, currTaint) + duplicatedError.Detail = "taints must be unique by key and effect pair" + allErrors = append(allErrors, duplicatedError) + continue + } + + // add taint to existingTaints for uniqueness check + if len(uniqueTaints[currTaint.Effect]) == 0 { + uniqueTaints[currTaint.Effect] = sets.String{} + } + uniqueTaints[currTaint.Effect].Insert(currTaint.Key) + } + return allErrors +} + +func ValidateNodeSpecificAnnotations(annotations map[string]string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + if annotations[core.TaintsAnnotationKey] != "" { + allErrs = append(allErrs, ValidateTaintsInNodeAnnotations(annotations, fldPath)...) + } + + if annotations[core.PreferAvoidPodsAnnotationKey] != "" { + allErrs = append(allErrs, ValidateAvoidPodsInNodeAnnotations(annotations, fldPath)...) + } + return allErrs +} + +// ValidateNode tests if required fields in the node are set. +func ValidateNode(node *core.Node) field.ErrorList { + fldPath := field.NewPath("metadata") + allErrs := ValidateObjectMeta(&node.ObjectMeta, false, ValidateNodeName, fldPath) + allErrs = append(allErrs, ValidateNodeSpecificAnnotations(node.ObjectMeta.Annotations, fldPath.Child("annotations"))...) + if len(node.Spec.Taints) > 0 { + allErrs = append(allErrs, validateNodeTaints(node.Spec.Taints, fldPath.Child("taints"))...) + } + + // Only validate spec. + // All status fields are optional and can be updated later. + // That said, if specified, we need to ensure they are valid. + allErrs = append(allErrs, ValidateNodeResources(node)...) + + // external ID is required. + if len(node.Spec.ExternalID) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("spec", "externalID"), "")) + } + + // Only allow Node.Spec.ConfigSource to be set if the DynamicKubeletConfig feature gate is enabled + if node.Spec.ConfigSource != nil && !utilfeature.DefaultFeatureGate.Enabled(features.DynamicKubeletConfig) { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec", "configSource"), "configSource may only be set if the DynamicKubeletConfig feature gate is enabled)")) + } + + if len(node.Spec.PodCIDR) != 0 { + _, err := ValidateCIDR(node.Spec.PodCIDR) + if err != nil { + allErrs = append(allErrs, field.Invalid(field.NewPath("spec", "podCIDR"), node.Spec.PodCIDR, "not a valid CIDR")) + } + } + return allErrs +} + +// ValidateNodeResources is used to make sure a node has valid capacity and allocatable values. +func ValidateNodeResources(node *core.Node) field.ErrorList { + allErrs := field.ErrorList{} + // Validate resource quantities in capacity. + hugePageSizes := sets.NewString() + for k, v := range node.Status.Capacity { + resPath := field.NewPath("status", "capacity", string(k)) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + // track any huge page size that has a positive value + if helper.IsHugePageResourceName(k) && v.Value() > int64(0) { + hugePageSizes.Insert(string(k)) + } + if len(hugePageSizes) > 1 { + allErrs = append(allErrs, field.Invalid(resPath, v, "may not have pre-allocated hugepages for multiple page sizes")) + } + } + // Validate resource quantities in allocatable. + hugePageSizes = sets.NewString() + for k, v := range node.Status.Allocatable { + resPath := field.NewPath("status", "allocatable", string(k)) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + // track any huge page size that has a positive value + if helper.IsHugePageResourceName(k) && v.Value() > int64(0) { + hugePageSizes.Insert(string(k)) + } + if len(hugePageSizes) > 1 { + allErrs = append(allErrs, field.Invalid(resPath, v, "may not have pre-allocated hugepages for multiple page sizes")) + } + } + return allErrs +} + +// ValidateNodeUpdate tests to make sure a node update can be applied. Modifies oldNode. +func ValidateNodeUpdate(node, oldNode *core.Node) field.ErrorList { + fldPath := field.NewPath("metadata") + allErrs := ValidateObjectMetaUpdate(&node.ObjectMeta, &oldNode.ObjectMeta, fldPath) + allErrs = append(allErrs, ValidateNodeSpecificAnnotations(node.ObjectMeta.Annotations, fldPath.Child("annotations"))...) + + // TODO: Enable the code once we have better core object.status update model. Currently, + // anyone can update node status. + // if !apiequality.Semantic.DeepEqual(node.Status, core.NodeStatus{}) { + // allErrs = append(allErrs, field.Invalid("status", node.Status, "must be empty")) + // } + + allErrs = append(allErrs, ValidateNodeResources(node)...) + + // Validate no duplicate addresses in node status. + addresses := make(map[core.NodeAddress]bool) + for i, address := range node.Status.Addresses { + if _, ok := addresses[address]; ok { + allErrs = append(allErrs, field.Duplicate(field.NewPath("status", "addresses").Index(i), address)) + } + addresses[address] = true + } + + if len(oldNode.Spec.PodCIDR) == 0 { + // Allow the controller manager to assign a CIDR to a node if it doesn't have one. + oldNode.Spec.PodCIDR = node.Spec.PodCIDR + } else { + if oldNode.Spec.PodCIDR != node.Spec.PodCIDR { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec", "podCIDR"), "node updates may not change podCIDR except from \"\" to valid")) + } + } + + // Allow controller manager updating provider ID when not set + if len(oldNode.Spec.ProviderID) == 0 { + oldNode.Spec.ProviderID = node.Spec.ProviderID + } else { + if oldNode.Spec.ProviderID != node.Spec.ProviderID { + allErrs = append(allErrs, field.Forbidden(field.NewPath("spec", "providerID"), "node updates may not change providerID except from \"\" to valid")) + } + } + + // TODO: move reset function to its own location + // Ignore metadata changes now that they have been tested + oldNode.ObjectMeta = node.ObjectMeta + // Allow users to update capacity + oldNode.Status.Capacity = node.Status.Capacity + // Allow users to unschedule node + oldNode.Spec.Unschedulable = node.Spec.Unschedulable + // Clear status + oldNode.Status = node.Status + + // update taints + if len(node.Spec.Taints) > 0 { + allErrs = append(allErrs, validateNodeTaints(node.Spec.Taints, fldPath.Child("taints"))...) + } + oldNode.Spec.Taints = node.Spec.Taints + + // Allow updates to Node.Spec.ConfigSource if DynamicKubeletConfig feature gate is enabled + if utilfeature.DefaultFeatureGate.Enabled(features.DynamicKubeletConfig) { + oldNode.Spec.ConfigSource = node.Spec.ConfigSource + } + + // We made allowed changes to oldNode, and now we compare oldNode to node. Any remaining differences indicate changes to protected fields. + // TODO: Add a 'real' error type for this error and provide print actual diffs. + if !apiequality.Semantic.DeepEqual(oldNode, node) { + glog.V(4).Infof("Update failed validation %#v vs %#v", oldNode, node) + allErrs = append(allErrs, field.Forbidden(field.NewPath(""), "node updates may only change labels, taints, or capacity (or configSource, if the DynamicKubeletConfig feature gate is enabled)")) + } + + return allErrs +} + +// Validate compute resource typename. +// Refer to docs/design/resources.md for more details. +func validateResourceName(value string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for _, msg := range validation.IsQualifiedName(value) { + allErrs = append(allErrs, field.Invalid(fldPath, value, msg)) + } + if len(allErrs) != 0 { + return allErrs + } + + if len(strings.Split(value, "/")) == 1 { + if !helper.IsStandardResourceName(value) { + return append(allErrs, field.Invalid(fldPath, value, "must be a standard resource type or fully qualified")) + } + } + + return allErrs +} + +// Validate container resource name +// Refer to docs/design/resources.md for more details. +func validateContainerResourceName(value string, fldPath *field.Path) field.ErrorList { + allErrs := validateResourceName(value, fldPath) + + if len(strings.Split(value, "/")) == 1 { + if !helper.IsStandardContainerResourceName(value) { + return append(allErrs, field.Invalid(fldPath, value, "must be a standard resource for containers")) + } + } else if !helper.IsDefaultNamespaceResource(core.ResourceName(value)) { + if !helper.IsExtendedResourceName(core.ResourceName(value)) { + return append(allErrs, field.Invalid(fldPath, value, "doesn't follow extended resource name standard")) + } + } + return allErrs +} + +// isLocalStorageResource checks whether the resource is local ephemeral storage +func isLocalStorageResource(name string) bool { + if name == string(core.ResourceEphemeralStorage) || name == string(core.ResourceRequestsEphemeralStorage) || + name == string(core.ResourceLimitsEphemeralStorage) { + return true + } else { + return false + } +} + +// Validate resource names that can go in a resource quota +// Refer to docs/design/resources.md for more details. +func ValidateResourceQuotaResourceName(value string, fldPath *field.Path) field.ErrorList { + allErrs := validateResourceName(value, fldPath) + if isLocalStorageResource(value) && !utilfeature.DefaultFeatureGate.Enabled(features.LocalStorageCapacityIsolation) { + return append(allErrs, field.Forbidden(fldPath, "ResourceEphemeralStorage field disabled by feature-gate for ResourceQuota")) + } + if len(strings.Split(value, "/")) == 1 { + if !helper.IsStandardQuotaResourceName(value) { + return append(allErrs, field.Invalid(fldPath, value, isInvalidQuotaResource)) + } + } + return allErrs +} + +// Validate limit range types +func validateLimitRangeTypeName(value string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for _, msg := range validation.IsQualifiedName(value) { + allErrs = append(allErrs, field.Invalid(fldPath, value, msg)) + } + if len(allErrs) != 0 { + return allErrs + } + + if len(strings.Split(value, "/")) == 1 { + if !helper.IsStandardLimitRangeType(value) { + return append(allErrs, field.Invalid(fldPath, value, "must be a standard limit type or fully qualified")) + } + } + + return allErrs +} + +// Validate limit range resource name +// limit types (other than Pod/Container) could contain storage not just cpu or memory +func validateLimitRangeResourceName(limitType core.LimitType, value string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if value == string(core.ResourceEphemeralStorage) && !utilfeature.DefaultFeatureGate.Enabled(features.LocalStorageCapacityIsolation) { + return append(allErrs, field.Forbidden(fldPath, "ResourceEphemeralStorage field disabled by feature-gate for Resource LimitRange")) + } + switch limitType { + case core.LimitTypePod, core.LimitTypeContainer: + return validateContainerResourceName(value, fldPath) + default: + return validateResourceName(value, fldPath) + } +} + +// ValidateLimitRange tests if required fields in the LimitRange are set. +func ValidateLimitRange(limitRange *core.LimitRange) field.ErrorList { + allErrs := ValidateObjectMeta(&limitRange.ObjectMeta, true, ValidateLimitRangeName, field.NewPath("metadata")) + + // ensure resource names are properly qualified per docs/design/resources.md + limitTypeSet := map[core.LimitType]bool{} + fldPath := field.NewPath("spec", "limits") + for i := range limitRange.Spec.Limits { + idxPath := fldPath.Index(i) + limit := &limitRange.Spec.Limits[i] + allErrs = append(allErrs, validateLimitRangeTypeName(string(limit.Type), idxPath.Child("type"))...) + + _, found := limitTypeSet[limit.Type] + if found { + allErrs = append(allErrs, field.Duplicate(idxPath.Child("type"), limit.Type)) + } + limitTypeSet[limit.Type] = true + + keys := sets.String{} + min := map[string]resource.Quantity{} + max := map[string]resource.Quantity{} + defaults := map[string]resource.Quantity{} + defaultRequests := map[string]resource.Quantity{} + maxLimitRequestRatios := map[string]resource.Quantity{} + + for k, q := range limit.Max { + allErrs = append(allErrs, validateLimitRangeResourceName(limit.Type, string(k), idxPath.Child("max").Key(string(k)))...) + keys.Insert(string(k)) + max[string(k)] = q + } + for k, q := range limit.Min { + allErrs = append(allErrs, validateLimitRangeResourceName(limit.Type, string(k), idxPath.Child("min").Key(string(k)))...) + keys.Insert(string(k)) + min[string(k)] = q + } + + if limit.Type == core.LimitTypePod { + if len(limit.Default) > 0 { + allErrs = append(allErrs, field.Forbidden(idxPath.Child("default"), "may not be specified when `type` is 'Pod'")) + } + if len(limit.DefaultRequest) > 0 { + allErrs = append(allErrs, field.Forbidden(idxPath.Child("defaultRequest"), "may not be specified when `type` is 'Pod'")) + } + } else { + for k, q := range limit.Default { + allErrs = append(allErrs, validateLimitRangeResourceName(limit.Type, string(k), idxPath.Child("default").Key(string(k)))...) + keys.Insert(string(k)) + defaults[string(k)] = q + } + for k, q := range limit.DefaultRequest { + allErrs = append(allErrs, validateLimitRangeResourceName(limit.Type, string(k), idxPath.Child("defaultRequest").Key(string(k)))...) + keys.Insert(string(k)) + defaultRequests[string(k)] = q + } + } + + if limit.Type == core.LimitTypePersistentVolumeClaim { + _, minQuantityFound := limit.Min[core.ResourceStorage] + _, maxQuantityFound := limit.Max[core.ResourceStorage] + if !minQuantityFound && !maxQuantityFound { + allErrs = append(allErrs, field.Required(idxPath.Child("limits"), "either minimum or maximum storage value is required, but neither was provided")) + } + } + + for k, q := range limit.MaxLimitRequestRatio { + allErrs = append(allErrs, validateLimitRangeResourceName(limit.Type, string(k), idxPath.Child("maxLimitRequestRatio").Key(string(k)))...) + keys.Insert(string(k)) + maxLimitRequestRatios[string(k)] = q + } + + for k := range keys { + minQuantity, minQuantityFound := min[k] + maxQuantity, maxQuantityFound := max[k] + defaultQuantity, defaultQuantityFound := defaults[k] + defaultRequestQuantity, defaultRequestQuantityFound := defaultRequests[k] + maxRatio, maxRatioFound := maxLimitRequestRatios[k] + + if minQuantityFound && maxQuantityFound && minQuantity.Cmp(maxQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("min").Key(string(k)), minQuantity, fmt.Sprintf("min value %s is greater than max value %s", minQuantity.String(), maxQuantity.String()))) + } + + if defaultRequestQuantityFound && minQuantityFound && minQuantity.Cmp(defaultRequestQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("defaultRequest").Key(string(k)), defaultRequestQuantity, fmt.Sprintf("min value %s is greater than default request value %s", minQuantity.String(), defaultRequestQuantity.String()))) + } + + if defaultRequestQuantityFound && maxQuantityFound && defaultRequestQuantity.Cmp(maxQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("defaultRequest").Key(string(k)), defaultRequestQuantity, fmt.Sprintf("default request value %s is greater than max value %s", defaultRequestQuantity.String(), maxQuantity.String()))) + } + + if defaultRequestQuantityFound && defaultQuantityFound && defaultRequestQuantity.Cmp(defaultQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("defaultRequest").Key(string(k)), defaultRequestQuantity, fmt.Sprintf("default request value %s is greater than default limit value %s", defaultRequestQuantity.String(), defaultQuantity.String()))) + } + + if defaultQuantityFound && minQuantityFound && minQuantity.Cmp(defaultQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("default").Key(string(k)), minQuantity, fmt.Sprintf("min value %s is greater than default value %s", minQuantity.String(), defaultQuantity.String()))) + } + + if defaultQuantityFound && maxQuantityFound && defaultQuantity.Cmp(maxQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("default").Key(string(k)), maxQuantity, fmt.Sprintf("default value %s is greater than max value %s", defaultQuantity.String(), maxQuantity.String()))) + } + if maxRatioFound && maxRatio.Cmp(*resource.NewQuantity(1, resource.DecimalSI)) < 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("maxLimitRequestRatio").Key(string(k)), maxRatio, fmt.Sprintf("ratio %s is less than 1", maxRatio.String()))) + } + if maxRatioFound && minQuantityFound && maxQuantityFound { + maxRatioValue := float64(maxRatio.Value()) + minQuantityValue := minQuantity.Value() + maxQuantityValue := maxQuantity.Value() + if maxRatio.Value() < resource.MaxMilliValue && minQuantityValue < resource.MaxMilliValue && maxQuantityValue < resource.MaxMilliValue { + maxRatioValue = float64(maxRatio.MilliValue()) / 1000 + minQuantityValue = minQuantity.MilliValue() + maxQuantityValue = maxQuantity.MilliValue() + } + maxRatioLimit := float64(maxQuantityValue) / float64(minQuantityValue) + if maxRatioValue > maxRatioLimit { + allErrs = append(allErrs, field.Invalid(idxPath.Child("maxLimitRequestRatio").Key(string(k)), maxRatio, fmt.Sprintf("ratio %s is greater than max/min = %f", maxRatio.String(), maxRatioLimit))) + } + } + + // for GPU, hugepages and other resources that are not allowed to overcommit, + // the default value and defaultRequest value must match if both are specified + if !helper.IsOvercommitAllowed(core.ResourceName(k)) && defaultQuantityFound && defaultRequestQuantityFound && defaultQuantity.Cmp(defaultRequestQuantity) != 0 { + allErrs = append(allErrs, field.Invalid(idxPath.Child("defaultRequest").Key(string(k)), defaultRequestQuantity, fmt.Sprintf("default value %s must equal to defaultRequest value %s in %s", defaultQuantity.String(), defaultRequestQuantity.String(), k))) + } + } + } + + return allErrs +} + +// ValidateServiceAccount tests if required fields in the ServiceAccount are set. +func ValidateServiceAccount(serviceAccount *core.ServiceAccount) field.ErrorList { + allErrs := ValidateObjectMeta(&serviceAccount.ObjectMeta, true, ValidateServiceAccountName, field.NewPath("metadata")) + return allErrs +} + +// ValidateServiceAccountUpdate tests if required fields in the ServiceAccount are set. +func ValidateServiceAccountUpdate(newServiceAccount, oldServiceAccount *core.ServiceAccount) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newServiceAccount.ObjectMeta, &oldServiceAccount.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateServiceAccount(newServiceAccount)...) + return allErrs +} + +// ValidateSecret tests if required fields in the Secret are set. +func ValidateSecret(secret *core.Secret) field.ErrorList { + allErrs := ValidateObjectMeta(&secret.ObjectMeta, true, ValidateSecretName, field.NewPath("metadata")) + + dataPath := field.NewPath("data") + totalSize := 0 + for key, value := range secret.Data { + for _, msg := range validation.IsConfigMapKey(key) { + allErrs = append(allErrs, field.Invalid(dataPath.Key(key), key, msg)) + } + totalSize += len(value) + } + if totalSize > core.MaxSecretSize { + allErrs = append(allErrs, field.TooLong(dataPath, "", core.MaxSecretSize)) + } + + switch secret.Type { + case core.SecretTypeServiceAccountToken: + // Only require Annotations[kubernetes.io/service-account.name] + // Additional fields (like Annotations[kubernetes.io/service-account.uid] and Data[token]) might be contributed later by a controller loop + if value := secret.Annotations[core.ServiceAccountNameKey]; len(value) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("metadata", "annotations").Key(core.ServiceAccountNameKey), "")) + } + case core.SecretTypeOpaque, "": + // no-op + case core.SecretTypeDockercfg: + dockercfgBytes, exists := secret.Data[core.DockerConfigKey] + if !exists { + allErrs = append(allErrs, field.Required(dataPath.Key(core.DockerConfigKey), "")) + break + } + + // make sure that the content is well-formed json. + if err := json.Unmarshal(dockercfgBytes, &map[string]interface{}{}); err != nil { + allErrs = append(allErrs, field.Invalid(dataPath.Key(core.DockerConfigKey), "<secret contents redacted>", err.Error())) + } + case core.SecretTypeDockerConfigJson: + dockerConfigJsonBytes, exists := secret.Data[core.DockerConfigJsonKey] + if !exists { + allErrs = append(allErrs, field.Required(dataPath.Key(core.DockerConfigJsonKey), "")) + break + } + + // make sure that the content is well-formed json. + if err := json.Unmarshal(dockerConfigJsonBytes, &map[string]interface{}{}); err != nil { + allErrs = append(allErrs, field.Invalid(dataPath.Key(core.DockerConfigJsonKey), "<secret contents redacted>", err.Error())) + } + case core.SecretTypeBasicAuth: + _, usernameFieldExists := secret.Data[core.BasicAuthUsernameKey] + _, passwordFieldExists := secret.Data[core.BasicAuthPasswordKey] + + // username or password might be empty, but the field must be present + if !usernameFieldExists && !passwordFieldExists { + allErrs = append(allErrs, field.Required(field.NewPath("data[%s]").Key(core.BasicAuthUsernameKey), "")) + allErrs = append(allErrs, field.Required(field.NewPath("data[%s]").Key(core.BasicAuthPasswordKey), "")) + break + } + case core.SecretTypeSSHAuth: + if len(secret.Data[core.SSHAuthPrivateKey]) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("data[%s]").Key(core.SSHAuthPrivateKey), "")) + break + } + + case core.SecretTypeTLS: + if _, exists := secret.Data[core.TLSCertKey]; !exists { + allErrs = append(allErrs, field.Required(dataPath.Key(core.TLSCertKey), "")) + } + if _, exists := secret.Data[core.TLSPrivateKeyKey]; !exists { + allErrs = append(allErrs, field.Required(dataPath.Key(core.TLSPrivateKeyKey), "")) + } + // TODO: Verify that the key matches the cert. + default: + // no-op + } + + return allErrs +} + +// ValidateSecretUpdate tests if required fields in the Secret are set. +func ValidateSecretUpdate(newSecret, oldSecret *core.Secret) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newSecret.ObjectMeta, &oldSecret.ObjectMeta, field.NewPath("metadata")) + + if len(newSecret.Type) == 0 { + newSecret.Type = oldSecret.Type + } + + allErrs = append(allErrs, ValidateImmutableField(newSecret.Type, oldSecret.Type, field.NewPath("type"))...) + + allErrs = append(allErrs, ValidateSecret(newSecret)...) + return allErrs +} + +// ValidateConfigMapName can be used to check whether the given ConfigMap name is valid. +// Prefix indicates this name will be used as part of generation, in which case +// trailing dashes are allowed. +var ValidateConfigMapName = NameIsDNSSubdomain + +// ValidateConfigMap tests whether required fields in the ConfigMap are set. +func ValidateConfigMap(cfg *core.ConfigMap) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, ValidateObjectMeta(&cfg.ObjectMeta, true, ValidateConfigMapName, field.NewPath("metadata"))...) + + totalSize := 0 + + for key, value := range cfg.Data { + for _, msg := range validation.IsConfigMapKey(key) { + allErrs = append(allErrs, field.Invalid(field.NewPath("data").Key(key), key, msg)) + } + // check if we have a duplicate key in the other bag + if _, isValue := cfg.BinaryData[key]; isValue { + msg := "duplicate of key present in binaryData" + allErrs = append(allErrs, field.Invalid(field.NewPath("data").Key(key), key, msg)) + } + totalSize += len(value) + } + for key, value := range cfg.BinaryData { + for _, msg := range validation.IsConfigMapKey(key) { + allErrs = append(allErrs, field.Invalid(field.NewPath("binaryData").Key(key), key, msg)) + } + totalSize += len(value) + } + if totalSize > core.MaxSecretSize { + // pass back "" to indicate that the error refers to the whole object. + allErrs = append(allErrs, field.TooLong(field.NewPath(""), cfg, core.MaxSecretSize)) + } + + return allErrs +} + +// ValidateConfigMapUpdate tests if required fields in the ConfigMap are set. +func ValidateConfigMapUpdate(newCfg, oldCfg *core.ConfigMap) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, ValidateObjectMetaUpdate(&newCfg.ObjectMeta, &oldCfg.ObjectMeta, field.NewPath("metadata"))...) + allErrs = append(allErrs, ValidateConfigMap(newCfg)...) + + return allErrs +} + +func validateBasicResource(quantity resource.Quantity, fldPath *field.Path) field.ErrorList { + if quantity.Value() < 0 { + return field.ErrorList{field.Invalid(fldPath, quantity.Value(), "must be a valid resource quantity")} + } + return field.ErrorList{} +} + +// Validates resource requirement spec. +func ValidateResourceRequirements(requirements *core.ResourceRequirements, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + limPath := fldPath.Child("limits") + reqPath := fldPath.Child("requests") + limContainsCpuOrMemory := false + reqContainsCpuOrMemory := false + limContainsHugePages := false + reqContainsHugePages := false + supportedQoSComputeResources := sets.NewString(string(core.ResourceCPU), string(core.ResourceMemory)) + for resourceName, quantity := range requirements.Limits { + + fldPath := limPath.Key(string(resourceName)) + // Validate resource name. + allErrs = append(allErrs, validateContainerResourceName(string(resourceName), fldPath)...) + + // Validate resource quantity. + allErrs = append(allErrs, ValidateResourceQuantityValue(string(resourceName), quantity, fldPath)...) + + if resourceName == core.ResourceEphemeralStorage && !utilfeature.DefaultFeatureGate.Enabled(features.LocalStorageCapacityIsolation) { + allErrs = append(allErrs, field.Forbidden(limPath, "ResourceEphemeralStorage field disabled by feature-gate for ResourceRequirements")) + } + if helper.IsHugePageResourceName(resourceName) { + if !utilfeature.DefaultFeatureGate.Enabled(features.HugePages) { + allErrs = append(allErrs, field.Forbidden(limPath, fmt.Sprintf("%s field disabled by feature-gate for ResourceRequirements", resourceName))) + } else { + limContainsHugePages = true + } + } + + if supportedQoSComputeResources.Has(string(resourceName)) { + limContainsCpuOrMemory = true + } + } + for resourceName, quantity := range requirements.Requests { + fldPath := reqPath.Key(string(resourceName)) + // Validate resource name. + allErrs = append(allErrs, validateContainerResourceName(string(resourceName), fldPath)...) + // Validate resource quantity. + allErrs = append(allErrs, ValidateResourceQuantityValue(string(resourceName), quantity, fldPath)...) + + // Check that request <= limit. + limitQuantity, exists := requirements.Limits[resourceName] + if exists { + // For non overcommitable resources, not only requests can't exceed limits, they also can't be lower, i.e. must be equal. + if quantity.Cmp(limitQuantity) != 0 && !helper.IsOvercommitAllowed(resourceName) { + allErrs = append(allErrs, field.Invalid(reqPath, quantity.String(), fmt.Sprintf("must be equal to %s limit", resourceName))) + } else if quantity.Cmp(limitQuantity) > 0 { + allErrs = append(allErrs, field.Invalid(reqPath, quantity.String(), fmt.Sprintf("must be less than or equal to %s limit", resourceName))) + } + } else if !helper.IsOvercommitAllowed(resourceName) { + allErrs = append(allErrs, field.Required(limPath, "Limit must be set for non overcommitable resources")) + } + if helper.IsHugePageResourceName(resourceName) { + reqContainsHugePages = true + } + if supportedQoSComputeResources.Has(string(resourceName)) { + reqContainsCpuOrMemory = true + } + + } + if !limContainsCpuOrMemory && !reqContainsCpuOrMemory && (reqContainsHugePages || limContainsHugePages) { + allErrs = append(allErrs, field.Forbidden(fldPath, fmt.Sprintf("HugePages require cpu or memory"))) + } + + return allErrs +} + +// validateResourceQuotaScopes ensures that each enumerated hard resource constraint is valid for set of scopes +func validateResourceQuotaScopes(resourceQuotaSpec *core.ResourceQuotaSpec, fld *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(resourceQuotaSpec.Scopes) == 0 { + return allErrs + } + hardLimits := sets.NewString() + for k := range resourceQuotaSpec.Hard { + hardLimits.Insert(string(k)) + } + fldPath := fld.Child("scopes") + scopeSet := sets.NewString() + for _, scope := range resourceQuotaSpec.Scopes { + if !helper.IsStandardResourceQuotaScope(string(scope)) { + allErrs = append(allErrs, field.Invalid(fldPath, resourceQuotaSpec.Scopes, "unsupported scope")) + } + for _, k := range hardLimits.List() { + if helper.IsStandardQuotaResourceName(k) && !helper.IsResourceQuotaScopeValidForResource(scope, k) { + allErrs = append(allErrs, field.Invalid(fldPath, resourceQuotaSpec.Scopes, "unsupported scope applied to resource")) + } + } + scopeSet.Insert(string(scope)) + } + invalidScopePairs := []sets.String{ + sets.NewString(string(core.ResourceQuotaScopeBestEffort), string(core.ResourceQuotaScopeNotBestEffort)), + sets.NewString(string(core.ResourceQuotaScopeTerminating), string(core.ResourceQuotaScopeNotTerminating)), + } + for _, invalidScopePair := range invalidScopePairs { + if scopeSet.HasAll(invalidScopePair.List()...) { + allErrs = append(allErrs, field.Invalid(fldPath, resourceQuotaSpec.Scopes, "conflicting scopes")) + } + } + return allErrs +} + +// ValidateResourceQuota tests if required fields in the ResourceQuota are set. +func ValidateResourceQuota(resourceQuota *core.ResourceQuota) field.ErrorList { + allErrs := ValidateObjectMeta(&resourceQuota.ObjectMeta, true, ValidateResourceQuotaName, field.NewPath("metadata")) + + allErrs = append(allErrs, ValidateResourceQuotaSpec(&resourceQuota.Spec, field.NewPath("spec"))...) + allErrs = append(allErrs, ValidateResourceQuotaStatus(&resourceQuota.Status, field.NewPath("status"))...) + + return allErrs +} + +func ValidateResourceQuotaStatus(status *core.ResourceQuotaStatus, fld *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + fldPath := fld.Child("hard") + for k, v := range status.Hard { + resPath := fldPath.Key(string(k)) + allErrs = append(allErrs, ValidateResourceQuotaResourceName(string(k), resPath)...) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + } + fldPath = fld.Child("used") + for k, v := range status.Used { + resPath := fldPath.Key(string(k)) + allErrs = append(allErrs, ValidateResourceQuotaResourceName(string(k), resPath)...) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + } + + return allErrs +} + +func ValidateResourceQuotaSpec(resourceQuotaSpec *core.ResourceQuotaSpec, fld *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + + fldPath := fld.Child("hard") + for k, v := range resourceQuotaSpec.Hard { + resPath := fldPath.Key(string(k)) + allErrs = append(allErrs, ValidateResourceQuotaResourceName(string(k), resPath)...) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + } + allErrs = append(allErrs, validateResourceQuotaScopes(resourceQuotaSpec, fld)...) + + return allErrs +} + +// ValidateResourceQuantityValue enforces that specified quantity is valid for specified resource +func ValidateResourceQuantityValue(resource string, value resource.Quantity, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + allErrs = append(allErrs, ValidateNonnegativeQuantity(value, fldPath)...) + if helper.IsIntegerResourceName(resource) { + if value.MilliValue()%int64(1000) != int64(0) { + allErrs = append(allErrs, field.Invalid(fldPath, value, isNotIntegerErrorMsg)) + } + } + return allErrs +} + +// ValidateResourceQuotaUpdate tests to see if the update is legal for an end user to make. +// newResourceQuota is updated with fields that cannot be changed. +func ValidateResourceQuotaUpdate(newResourceQuota, oldResourceQuota *core.ResourceQuota) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newResourceQuota.ObjectMeta, &oldResourceQuota.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateResourceQuotaSpec(&newResourceQuota.Spec, field.NewPath("spec"))...) + + // ensure scopes cannot change, and that resources are still valid for scope + fldPath := field.NewPath("spec", "scopes") + oldScopes := sets.NewString() + newScopes := sets.NewString() + for _, scope := range newResourceQuota.Spec.Scopes { + newScopes.Insert(string(scope)) + } + for _, scope := range oldResourceQuota.Spec.Scopes { + oldScopes.Insert(string(scope)) + } + if !oldScopes.Equal(newScopes) { + allErrs = append(allErrs, field.Invalid(fldPath, newResourceQuota.Spec.Scopes, fieldImmutableErrorMsg)) + } + + newResourceQuota.Status = oldResourceQuota.Status + return allErrs +} + +// ValidateResourceQuotaStatusUpdate tests to see if the status update is legal for an end user to make. +// newResourceQuota is updated with fields that cannot be changed. +func ValidateResourceQuotaStatusUpdate(newResourceQuota, oldResourceQuota *core.ResourceQuota) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newResourceQuota.ObjectMeta, &oldResourceQuota.ObjectMeta, field.NewPath("metadata")) + if len(newResourceQuota.ResourceVersion) == 0 { + allErrs = append(allErrs, field.Required(field.NewPath("resourceVersion"), "")) + } + fldPath := field.NewPath("status", "hard") + for k, v := range newResourceQuota.Status.Hard { + resPath := fldPath.Key(string(k)) + allErrs = append(allErrs, ValidateResourceQuotaResourceName(string(k), resPath)...) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + } + fldPath = field.NewPath("status", "used") + for k, v := range newResourceQuota.Status.Used { + resPath := fldPath.Key(string(k)) + allErrs = append(allErrs, ValidateResourceQuotaResourceName(string(k), resPath)...) + allErrs = append(allErrs, ValidateResourceQuantityValue(string(k), v, resPath)...) + } + newResourceQuota.Spec = oldResourceQuota.Spec + return allErrs +} + +// ValidateNamespace tests if required fields are set. +func ValidateNamespace(namespace *core.Namespace) field.ErrorList { + allErrs := ValidateObjectMeta(&namespace.ObjectMeta, false, ValidateNamespaceName, field.NewPath("metadata")) + for i := range namespace.Spec.Finalizers { + allErrs = append(allErrs, validateFinalizerName(string(namespace.Spec.Finalizers[i]), field.NewPath("spec", "finalizers"))...) + } + return allErrs +} + +// Validate finalizer names +func validateFinalizerName(stringValue string, fldPath *field.Path) field.ErrorList { + allErrs := apimachineryvalidation.ValidateFinalizerName(stringValue, fldPath) + for _, err := range validateKubeFinalizerName(stringValue, fldPath) { + allErrs = append(allErrs, err) + } + + return allErrs +} + +// validateKubeFinalizerName checks for "standard" names of legacy finalizer +func validateKubeFinalizerName(stringValue string, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if len(strings.Split(stringValue, "/")) == 1 { + if !helper.IsStandardFinalizerName(stringValue) { + return append(allErrs, field.Invalid(fldPath, stringValue, "name is neither a standard finalizer name nor is it fully qualified")) + } + } + + return allErrs +} + +// ValidateNamespaceUpdate tests to make sure a namespace update can be applied. +// newNamespace is updated with fields that cannot be changed +func ValidateNamespaceUpdate(newNamespace *core.Namespace, oldNamespace *core.Namespace) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newNamespace.ObjectMeta, &oldNamespace.ObjectMeta, field.NewPath("metadata")) + newNamespace.Spec.Finalizers = oldNamespace.Spec.Finalizers + newNamespace.Status = oldNamespace.Status + return allErrs +} + +// ValidateNamespaceStatusUpdate tests to see if the update is legal for an end user to make. newNamespace is updated with fields +// that cannot be changed. +func ValidateNamespaceStatusUpdate(newNamespace, oldNamespace *core.Namespace) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newNamespace.ObjectMeta, &oldNamespace.ObjectMeta, field.NewPath("metadata")) + newNamespace.Spec = oldNamespace.Spec + if newNamespace.DeletionTimestamp.IsZero() { + if newNamespace.Status.Phase != core.NamespaceActive { + allErrs = append(allErrs, field.Invalid(field.NewPath("status", "Phase"), newNamespace.Status.Phase, "may only be 'Active' if `deletionTimestamp` is empty")) + } + } else { + if newNamespace.Status.Phase != core.NamespaceTerminating { + allErrs = append(allErrs, field.Invalid(field.NewPath("status", "Phase"), newNamespace.Status.Phase, "may only be 'Terminating' if `deletionTimestamp` is not empty")) + } + } + return allErrs +} + +// ValidateNamespaceFinalizeUpdate tests to see if the update is legal for an end user to make. +// newNamespace is updated with fields that cannot be changed. +func ValidateNamespaceFinalizeUpdate(newNamespace, oldNamespace *core.Namespace) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newNamespace.ObjectMeta, &oldNamespace.ObjectMeta, field.NewPath("metadata")) + + fldPath := field.NewPath("spec", "finalizers") + for i := range newNamespace.Spec.Finalizers { + idxPath := fldPath.Index(i) + allErrs = append(allErrs, validateFinalizerName(string(newNamespace.Spec.Finalizers[i]), idxPath)...) + } + newNamespace.Status = oldNamespace.Status + return allErrs +} + +// Construct lookup map of old subset IPs to NodeNames. +func updateEpAddrToNodeNameMap(ipToNodeName map[string]string, addresses []core.EndpointAddress) { + for n := range addresses { + if addresses[n].NodeName == nil { + continue + } + ipToNodeName[addresses[n].IP] = *addresses[n].NodeName + } +} + +// Build a map across all subsets of IP -> NodeName +func buildEndpointAddressNodeNameMap(subsets []core.EndpointSubset) map[string]string { + ipToNodeName := make(map[string]string) + for i := range subsets { + updateEpAddrToNodeNameMap(ipToNodeName, subsets[i].Addresses) + updateEpAddrToNodeNameMap(ipToNodeName, subsets[i].NotReadyAddresses) + } + return ipToNodeName +} + +func validateEpAddrNodeNameTransition(addr *core.EndpointAddress, ipToNodeName map[string]string, fldPath *field.Path) field.ErrorList { + errList := field.ErrorList{} + existingNodeName, found := ipToNodeName[addr.IP] + if !found { + return errList + } + if addr.NodeName == nil || *addr.NodeName == existingNodeName { + return errList + } + // NodeName entry found for this endpoint IP, but user is attempting to change NodeName + return append(errList, field.Forbidden(fldPath, fmt.Sprintf("Cannot change NodeName for %s to %s", addr.IP, *addr.NodeName))) +} + +// ValidateEndpoints tests if required fields are set. +func ValidateEndpoints(endpoints *core.Endpoints) field.ErrorList { + allErrs := ValidateObjectMeta(&endpoints.ObjectMeta, true, ValidateEndpointsName, field.NewPath("metadata")) + allErrs = append(allErrs, ValidateEndpointsSpecificAnnotations(endpoints.Annotations, field.NewPath("annotations"))...) + allErrs = append(allErrs, validateEndpointSubsets(endpoints.Subsets, []core.EndpointSubset{}, field.NewPath("subsets"))...) + return allErrs +} + +func validateEndpointSubsets(subsets []core.EndpointSubset, oldSubsets []core.EndpointSubset, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + ipToNodeName := buildEndpointAddressNodeNameMap(oldSubsets) + for i := range subsets { + ss := &subsets[i] + idxPath := fldPath.Index(i) + + // EndpointSubsets must include endpoint address. For headless service, we allow its endpoints not to have ports. + if len(ss.Addresses) == 0 && len(ss.NotReadyAddresses) == 0 { + //TODO: consider adding a RequiredOneOf() error for this and similar cases + allErrs = append(allErrs, field.Required(idxPath, "must specify `addresses` or `notReadyAddresses`")) + } + for addr := range ss.Addresses { + allErrs = append(allErrs, validateEndpointAddress(&ss.Addresses[addr], idxPath.Child("addresses").Index(addr), ipToNodeName)...) + } + for addr := range ss.NotReadyAddresses { + allErrs = append(allErrs, validateEndpointAddress(&ss.NotReadyAddresses[addr], idxPath.Child("notReadyAddresses").Index(addr), ipToNodeName)...) + } + for port := range ss.Ports { + allErrs = append(allErrs, validateEndpointPort(&ss.Ports[port], len(ss.Ports) > 1, idxPath.Child("ports").Index(port))...) + } + } + + return allErrs +} + +func validateEndpointAddress(address *core.EndpointAddress, fldPath *field.Path, ipToNodeName map[string]string) field.ErrorList { + allErrs := field.ErrorList{} + for _, msg := range validation.IsValidIP(address.IP) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("ip"), address.IP, msg)) + } + if len(address.Hostname) > 0 { + allErrs = append(allErrs, ValidateDNS1123Label(address.Hostname, fldPath.Child("hostname"))...) + } + // During endpoint update, verify that NodeName is a DNS subdomain and transition rules allow the update + if address.NodeName != nil { + for _, msg := range ValidateNodeName(*address.NodeName, false) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("nodeName"), *address.NodeName, msg)) + } + } + allErrs = append(allErrs, validateEpAddrNodeNameTransition(address, ipToNodeName, fldPath.Child("nodeName"))...) + if len(allErrs) > 0 { + return allErrs + } + allErrs = append(allErrs, validateNonSpecialIP(address.IP, fldPath.Child("ip"))...) + return allErrs +} + +func validateNonSpecialIP(ipAddress string, fldPath *field.Path) field.ErrorList { + // We disallow some IPs as endpoints or external-ips. Specifically, + // unspecified and loopback addresses are nonsensical and link-local + // addresses tend to be used for node-centric purposes (e.g. metadata + // service). + allErrs := field.ErrorList{} + ip := net.ParseIP(ipAddress) + if ip == nil { + allErrs = append(allErrs, field.Invalid(fldPath, ipAddress, "must be a valid IP address")) + return allErrs + } + if ip.IsUnspecified() { + allErrs = append(allErrs, field.Invalid(fldPath, ipAddress, "may not be unspecified (0.0.0.0)")) + } + if ip.IsLoopback() { + allErrs = append(allErrs, field.Invalid(fldPath, ipAddress, "may not be in the loopback range (127.0.0.0/8)")) + } + if ip.IsLinkLocalUnicast() { + allErrs = append(allErrs, field.Invalid(fldPath, ipAddress, "may not be in the link-local range (169.254.0.0/16)")) + } + if ip.IsLinkLocalMulticast() { + allErrs = append(allErrs, field.Invalid(fldPath, ipAddress, "may not be in the link-local multicast range (224.0.0.0/24)")) + } + return allErrs +} + +func validateEndpointPort(port *core.EndpointPort, requireName bool, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + if requireName && len(port.Name) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("name"), "")) + } else if len(port.Name) != 0 { + allErrs = append(allErrs, ValidateDNS1123Label(port.Name, fldPath.Child("name"))...) + } + for _, msg := range validation.IsValidPortNum(int(port.Port)) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("port"), port.Port, msg)) + } + if len(port.Protocol) == 0 { + allErrs = append(allErrs, field.Required(fldPath.Child("protocol"), "")) + } else if !supportedPortProtocols.Has(string(port.Protocol)) { + allErrs = append(allErrs, field.NotSupported(fldPath.Child("protocol"), port.Protocol, supportedPortProtocols.List())) + } + return allErrs +} + +// ValidateEndpointsUpdate tests to make sure an endpoints update can be applied. +func ValidateEndpointsUpdate(newEndpoints, oldEndpoints *core.Endpoints) field.ErrorList { + allErrs := ValidateObjectMetaUpdate(&newEndpoints.ObjectMeta, &oldEndpoints.ObjectMeta, field.NewPath("metadata")) + allErrs = append(allErrs, validateEndpointSubsets(newEndpoints.Subsets, oldEndpoints.Subsets, field.NewPath("subsets"))...) + allErrs = append(allErrs, ValidateEndpointsSpecificAnnotations(newEndpoints.Annotations, field.NewPath("annotations"))...) + return allErrs +} + +// ValidateSecurityContext ensure the security context contains valid settings +func ValidateSecurityContext(sc *core.SecurityContext, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + //this should only be true for testing since SecurityContext is defaulted by the core + if sc == nil { + return allErrs + } + + if sc.Privileged != nil { + if *sc.Privileged && !capabilities.Get().AllowPrivileged { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("privileged"), "disallowed by cluster policy")) + } + } + + if sc.RunAsUser != nil { + for _, msg := range validation.IsValidUserID(*sc.RunAsUser) { + allErrs = append(allErrs, field.Invalid(fldPath.Child("runAsUser"), *sc.RunAsUser, msg)) + } + } + + if sc.AllowPrivilegeEscalation != nil && !*sc.AllowPrivilegeEscalation { + if sc.Privileged != nil && *sc.Privileged { + allErrs = append(allErrs, field.Invalid(fldPath, sc, "cannot set `allowPrivilegeEscalation` to false and `privileged` to true")) + } + + if sc.Capabilities != nil { + for _, cap := range sc.Capabilities.Add { + if string(cap) == "CAP_SYS_ADMIN" { + allErrs = append(allErrs, field.Invalid(fldPath, sc, "cannot set `allowPrivilegeEscalation` to false and `capabilities.Add` CAP_SYS_ADMIN")) + } + } + } + } + + return allErrs +} + +func ValidatePodLogOptions(opts *core.PodLogOptions) field.ErrorList { + allErrs := field.ErrorList{} + if opts.TailLines != nil && *opts.TailLines < 0 { + allErrs = append(allErrs, field.Invalid(field.NewPath("tailLines"), *opts.TailLines, isNegativeErrorMsg)) + } + if opts.LimitBytes != nil && *opts.LimitBytes < 1 { + allErrs = append(allErrs, field.Invalid(field.NewPath("limitBytes"), *opts.LimitBytes, "must be greater than 0")) + } + switch { + case opts.SinceSeconds != nil && opts.SinceTime != nil: + allErrs = append(allErrs, field.Forbidden(field.NewPath(""), "at most one of `sinceTime` or `sinceSeconds` may be specified")) + case opts.SinceSeconds != nil: + if *opts.SinceSeconds < 1 { + allErrs = append(allErrs, field.Invalid(field.NewPath("sinceSeconds"), *opts.SinceSeconds, "must be greater than 0")) + } + } + return allErrs +} + +// ValidateLoadBalancerStatus validates required fields on a LoadBalancerStatus +func ValidateLoadBalancerStatus(status *core.LoadBalancerStatus, fldPath *field.Path) field.ErrorList { + allErrs := field.ErrorList{} + for i, ingress := range status.Ingress { + idxPath := fldPath.Child("ingress").Index(i) + if len(ingress.IP) > 0 { + if isIP := (net.ParseIP(ingress.IP) != nil); !isIP { + allErrs = append(allErrs, field.Invalid(idxPath.Child("ip"), ingress.IP, "must be a valid IP address")) + } + } + if len(ingress.Hostname) > 0 { + for _, msg := range validation.IsDNS1123Subdomain(ingress.Hostname) { + allErrs = append(allErrs, field.Invalid(idxPath.Child("hostname"), ingress.Hostname, msg)) + } + if isIP := (net.ParseIP(ingress.Hostname) != nil); isIP { + allErrs = append(allErrs, field.Invalid(idxPath.Child("hostname"), ingress.Hostname, "must be a DNS name, not an IP address")) + } + } + } + return allErrs +} + +func sysctlIntersection(a []core.Sysctl, b []core.Sysctl) []string { + lookup := make(map[string]struct{}, len(a)) + result := []string{} + for i := range a { + lookup[a[i].Name] = struct{}{} + } + for i := range b { + if _, found := lookup[b[i].Name]; found { + result = append(result, b[i].Name) + } + } + return result +} + +// validateStorageNodeAffinityAnnotation tests that the serialized TopologyConstraints in PersistentVolume.Annotations has valid data +func validateStorageNodeAffinityAnnotation(annotations map[string]string, fldPath *field.Path) (bool, field.ErrorList) { + allErrs := field.ErrorList{} + + na, err := helper.GetStorageNodeAffinityFromAnnotation(annotations) + if err != nil { + allErrs = append(allErrs, field.Invalid(fldPath, core.AlphaStorageNodeAffinityAnnotation, err.Error())) + return false, allErrs + } + if na == nil { + return false, allErrs + } + + if !utilfeature.DefaultFeatureGate.Enabled(features.VolumeScheduling) { + allErrs = append(allErrs, field.Forbidden(fldPath, "Storage node affinity is disabled by feature-gate")) + } + + policySpecified := false + if na.RequiredDuringSchedulingIgnoredDuringExecution != nil { + allErrs = append(allErrs, ValidateNodeSelector(na.RequiredDuringSchedulingIgnoredDuringExecution, fldPath.Child("requiredDuringSchedulingIgnoredDuringExecution"))...) + policySpecified = true + } + + if len(na.PreferredDuringSchedulingIgnoredDuringExecution) > 0 { + allErrs = append(allErrs, field.Forbidden(fldPath.Child("preferredDuringSchedulingIgnoredDuringExection"), "Storage node affinity does not support preferredDuringSchedulingIgnoredDuringExecution")) + } + return policySpecified, allErrs +} + +// validateVolumeNodeAffinity tests that the PersistentVolume.NodeAffinity has valid data +// returns: +// - true if volumeNodeAffinity is set +// - errorList if there are validation errors +func validateVolumeNodeAffinity(nodeAffinity *core.VolumeNodeAffinity, fldPath *field.Path) (bool, field.ErrorList) { + allErrs := field.ErrorList{} + + if nodeAffinity == nil { + return false, allErrs + } + + if !utilfeature.DefaultFeatureGate.Enabled(features.VolumeScheduling) { + allErrs = append(allErrs, field.Forbidden(fldPath, "Volume node affinity is disabled by feature-gate")) + } + + if nodeAffinity.Required != nil { + allErrs = append(allErrs, ValidateNodeSelector(nodeAffinity.Required, fldPath.Child("required"))...) + } else { + allErrs = append(allErrs, field.Required(fldPath.Child("required"), "must specify required node constraints")) + } + + return true, allErrs +} + +// ValidateCIDR validates whether a CIDR matches the conventions expected by net.ParseCIDR +func ValidateCIDR(cidr string) (*net.IPNet, error) { + _, net, err := net.ParseCIDR(cidr) + if err != nil { + return nil, err + } + return net, nil +} + +func IsDecremented(update, old *int32) bool { + if update == nil && old != nil { + return true + } + if update == nil || old == nil { + return false + } + return *update < *old +} diff --git a/vendor/k8s.io/kubernetes/pkg/apis/core/zz_generated.deepcopy.go b/vendor/k8s.io/kubernetes/pkg/apis/core/zz_generated.deepcopy.go new file mode 100644 index 000000000..f0aa3b426 --- /dev/null +++ b/vendor/k8s.io/kubernetes/pkg/apis/core/zz_generated.deepcopy.go @@ -0,0 +1,5952 @@ +// +build !ignore_autogenerated + +/* +Copyright 2018 The Kubernetes Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by deepcopy-gen. DO NOT EDIT. + +package core + +import ( + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + runtime "k8s.io/apimachinery/pkg/runtime" + types "k8s.io/apimachinery/pkg/types" +) + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AWSElasticBlockStoreVolumeSource) DeepCopyInto(out *AWSElasticBlockStoreVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AWSElasticBlockStoreVolumeSource. +func (in *AWSElasticBlockStoreVolumeSource) DeepCopy() *AWSElasticBlockStoreVolumeSource { + if in == nil { + return nil + } + out := new(AWSElasticBlockStoreVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Affinity) DeepCopyInto(out *Affinity) { + *out = *in + if in.NodeAffinity != nil { + in, out := &in.NodeAffinity, &out.NodeAffinity + if *in == nil { + *out = nil + } else { + *out = new(NodeAffinity) + (*in).DeepCopyInto(*out) + } + } + if in.PodAffinity != nil { + in, out := &in.PodAffinity, &out.PodAffinity + if *in == nil { + *out = nil + } else { + *out = new(PodAffinity) + (*in).DeepCopyInto(*out) + } + } + if in.PodAntiAffinity != nil { + in, out := &in.PodAntiAffinity, &out.PodAntiAffinity + if *in == nil { + *out = nil + } else { + *out = new(PodAntiAffinity) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Affinity. +func (in *Affinity) DeepCopy() *Affinity { + if in == nil { + return nil + } + out := new(Affinity) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AttachedVolume) DeepCopyInto(out *AttachedVolume) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AttachedVolume. +func (in *AttachedVolume) DeepCopy() *AttachedVolume { + if in == nil { + return nil + } + out := new(AttachedVolume) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AvoidPods) DeepCopyInto(out *AvoidPods) { + *out = *in + if in.PreferAvoidPods != nil { + in, out := &in.PreferAvoidPods, &out.PreferAvoidPods + *out = make([]PreferAvoidPodsEntry, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AvoidPods. +func (in *AvoidPods) DeepCopy() *AvoidPods { + if in == nil { + return nil + } + out := new(AvoidPods) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AzureDiskVolumeSource) DeepCopyInto(out *AzureDiskVolumeSource) { + *out = *in + if in.CachingMode != nil { + in, out := &in.CachingMode, &out.CachingMode + if *in == nil { + *out = nil + } else { + *out = new(AzureDataDiskCachingMode) + **out = **in + } + } + if in.FSType != nil { + in, out := &in.FSType, &out.FSType + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + if in.ReadOnly != nil { + in, out := &in.ReadOnly, &out.ReadOnly + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.Kind != nil { + in, out := &in.Kind, &out.Kind + if *in == nil { + *out = nil + } else { + *out = new(AzureDataDiskKind) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AzureDiskVolumeSource. +func (in *AzureDiskVolumeSource) DeepCopy() *AzureDiskVolumeSource { + if in == nil { + return nil + } + out := new(AzureDiskVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AzureFilePersistentVolumeSource) DeepCopyInto(out *AzureFilePersistentVolumeSource) { + *out = *in + if in.SecretNamespace != nil { + in, out := &in.SecretNamespace, &out.SecretNamespace + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AzureFilePersistentVolumeSource. +func (in *AzureFilePersistentVolumeSource) DeepCopy() *AzureFilePersistentVolumeSource { + if in == nil { + return nil + } + out := new(AzureFilePersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AzureFileVolumeSource) DeepCopyInto(out *AzureFileVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AzureFileVolumeSource. +func (in *AzureFileVolumeSource) DeepCopy() *AzureFileVolumeSource { + if in == nil { + return nil + } + out := new(AzureFileVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Binding) DeepCopyInto(out *Binding) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + out.Target = in.Target + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Binding. +func (in *Binding) DeepCopy() *Binding { + if in == nil { + return nil + } + out := new(Binding) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Binding) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *CSIPersistentVolumeSource) DeepCopyInto(out *CSIPersistentVolumeSource) { + *out = *in + if in.VolumeAttributes != nil { + in, out := &in.VolumeAttributes, &out.VolumeAttributes + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.ControllerPublishSecretRef != nil { + in, out := &in.ControllerPublishSecretRef, &out.ControllerPublishSecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + if in.NodeStageSecretRef != nil { + in, out := &in.NodeStageSecretRef, &out.NodeStageSecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + if in.NodePublishSecretRef != nil { + in, out := &in.NodePublishSecretRef, &out.NodePublishSecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new CSIPersistentVolumeSource. +func (in *CSIPersistentVolumeSource) DeepCopy() *CSIPersistentVolumeSource { + if in == nil { + return nil + } + out := new(CSIPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Capabilities) DeepCopyInto(out *Capabilities) { + *out = *in + if in.Add != nil { + in, out := &in.Add, &out.Add + *out = make([]Capability, len(*in)) + copy(*out, *in) + } + if in.Drop != nil { + in, out := &in.Drop, &out.Drop + *out = make([]Capability, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Capabilities. +func (in *Capabilities) DeepCopy() *Capabilities { + if in == nil { + return nil + } + out := new(Capabilities) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *CephFSPersistentVolumeSource) DeepCopyInto(out *CephFSPersistentVolumeSource) { + *out = *in + if in.Monitors != nil { + in, out := &in.Monitors, &out.Monitors + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new CephFSPersistentVolumeSource. +func (in *CephFSPersistentVolumeSource) DeepCopy() *CephFSPersistentVolumeSource { + if in == nil { + return nil + } + out := new(CephFSPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *CephFSVolumeSource) DeepCopyInto(out *CephFSVolumeSource) { + *out = *in + if in.Monitors != nil { + in, out := &in.Monitors, &out.Monitors + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(LocalObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new CephFSVolumeSource. +func (in *CephFSVolumeSource) DeepCopy() *CephFSVolumeSource { + if in == nil { + return nil + } + out := new(CephFSVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *CinderVolumeSource) DeepCopyInto(out *CinderVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new CinderVolumeSource. +func (in *CinderVolumeSource) DeepCopy() *CinderVolumeSource { + if in == nil { + return nil + } + out := new(CinderVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ClientIPConfig) DeepCopyInto(out *ClientIPConfig) { + *out = *in + if in.TimeoutSeconds != nil { + in, out := &in.TimeoutSeconds, &out.TimeoutSeconds + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ClientIPConfig. +func (in *ClientIPConfig) DeepCopy() *ClientIPConfig { + if in == nil { + return nil + } + out := new(ClientIPConfig) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ComponentCondition) DeepCopyInto(out *ComponentCondition) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ComponentCondition. +func (in *ComponentCondition) DeepCopy() *ComponentCondition { + if in == nil { + return nil + } + out := new(ComponentCondition) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ComponentStatus) DeepCopyInto(out *ComponentStatus) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]ComponentCondition, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ComponentStatus. +func (in *ComponentStatus) DeepCopy() *ComponentStatus { + if in == nil { + return nil + } + out := new(ComponentStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ComponentStatus) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ComponentStatusList) DeepCopyInto(out *ComponentStatusList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]ComponentStatus, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ComponentStatusList. +func (in *ComponentStatusList) DeepCopy() *ComponentStatusList { + if in == nil { + return nil + } + out := new(ComponentStatusList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ComponentStatusList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ConfigMap) DeepCopyInto(out *ConfigMap) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + if in.Data != nil { + in, out := &in.Data, &out.Data + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.BinaryData != nil { + in, out := &in.BinaryData, &out.BinaryData + *out = make(map[string][]byte, len(*in)) + for key, val := range *in { + if val == nil { + (*out)[key] = nil + } else { + (*out)[key] = make([]byte, len(val)) + copy((*out)[key], val) + } + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ConfigMap. +func (in *ConfigMap) DeepCopy() *ConfigMap { + if in == nil { + return nil + } + out := new(ConfigMap) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ConfigMap) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ConfigMapEnvSource) DeepCopyInto(out *ConfigMapEnvSource) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ConfigMapEnvSource. +func (in *ConfigMapEnvSource) DeepCopy() *ConfigMapEnvSource { + if in == nil { + return nil + } + out := new(ConfigMapEnvSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ConfigMapKeySelector) DeepCopyInto(out *ConfigMapKeySelector) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ConfigMapKeySelector. +func (in *ConfigMapKeySelector) DeepCopy() *ConfigMapKeySelector { + if in == nil { + return nil + } + out := new(ConfigMapKeySelector) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ConfigMapList) DeepCopyInto(out *ConfigMapList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]ConfigMap, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ConfigMapList. +func (in *ConfigMapList) DeepCopy() *ConfigMapList { + if in == nil { + return nil + } + out := new(ConfigMapList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ConfigMapList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ConfigMapProjection) DeepCopyInto(out *ConfigMapProjection) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]KeyToPath, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ConfigMapProjection. +func (in *ConfigMapProjection) DeepCopy() *ConfigMapProjection { + if in == nil { + return nil + } + out := new(ConfigMapProjection) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ConfigMapVolumeSource) DeepCopyInto(out *ConfigMapVolumeSource) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]KeyToPath, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.DefaultMode != nil { + in, out := &in.DefaultMode, &out.DefaultMode + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ConfigMapVolumeSource. +func (in *ConfigMapVolumeSource) DeepCopy() *ConfigMapVolumeSource { + if in == nil { + return nil + } + out := new(ConfigMapVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Container) DeepCopyInto(out *Container) { + *out = *in + if in.Command != nil { + in, out := &in.Command, &out.Command + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.Args != nil { + in, out := &in.Args, &out.Args + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.Ports != nil { + in, out := &in.Ports, &out.Ports + *out = make([]ContainerPort, len(*in)) + copy(*out, *in) + } + if in.EnvFrom != nil { + in, out := &in.EnvFrom, &out.EnvFrom + *out = make([]EnvFromSource, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Env != nil { + in, out := &in.Env, &out.Env + *out = make([]EnvVar, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + in.Resources.DeepCopyInto(&out.Resources) + if in.VolumeMounts != nil { + in, out := &in.VolumeMounts, &out.VolumeMounts + *out = make([]VolumeMount, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.VolumeDevices != nil { + in, out := &in.VolumeDevices, &out.VolumeDevices + *out = make([]VolumeDevice, len(*in)) + copy(*out, *in) + } + if in.LivenessProbe != nil { + in, out := &in.LivenessProbe, &out.LivenessProbe + if *in == nil { + *out = nil + } else { + *out = new(Probe) + (*in).DeepCopyInto(*out) + } + } + if in.ReadinessProbe != nil { + in, out := &in.ReadinessProbe, &out.ReadinessProbe + if *in == nil { + *out = nil + } else { + *out = new(Probe) + (*in).DeepCopyInto(*out) + } + } + if in.Lifecycle != nil { + in, out := &in.Lifecycle, &out.Lifecycle + if *in == nil { + *out = nil + } else { + *out = new(Lifecycle) + (*in).DeepCopyInto(*out) + } + } + if in.SecurityContext != nil { + in, out := &in.SecurityContext, &out.SecurityContext + if *in == nil { + *out = nil + } else { + *out = new(SecurityContext) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Container. +func (in *Container) DeepCopy() *Container { + if in == nil { + return nil + } + out := new(Container) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerImage) DeepCopyInto(out *ContainerImage) { + *out = *in + if in.Names != nil { + in, out := &in.Names, &out.Names + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerImage. +func (in *ContainerImage) DeepCopy() *ContainerImage { + if in == nil { + return nil + } + out := new(ContainerImage) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerPort) DeepCopyInto(out *ContainerPort) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerPort. +func (in *ContainerPort) DeepCopy() *ContainerPort { + if in == nil { + return nil + } + out := new(ContainerPort) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerState) DeepCopyInto(out *ContainerState) { + *out = *in + if in.Waiting != nil { + in, out := &in.Waiting, &out.Waiting + if *in == nil { + *out = nil + } else { + *out = new(ContainerStateWaiting) + **out = **in + } + } + if in.Running != nil { + in, out := &in.Running, &out.Running + if *in == nil { + *out = nil + } else { + *out = new(ContainerStateRunning) + (*in).DeepCopyInto(*out) + } + } + if in.Terminated != nil { + in, out := &in.Terminated, &out.Terminated + if *in == nil { + *out = nil + } else { + *out = new(ContainerStateTerminated) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerState. +func (in *ContainerState) DeepCopy() *ContainerState { + if in == nil { + return nil + } + out := new(ContainerState) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerStateRunning) DeepCopyInto(out *ContainerStateRunning) { + *out = *in + in.StartedAt.DeepCopyInto(&out.StartedAt) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerStateRunning. +func (in *ContainerStateRunning) DeepCopy() *ContainerStateRunning { + if in == nil { + return nil + } + out := new(ContainerStateRunning) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerStateTerminated) DeepCopyInto(out *ContainerStateTerminated) { + *out = *in + in.StartedAt.DeepCopyInto(&out.StartedAt) + in.FinishedAt.DeepCopyInto(&out.FinishedAt) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerStateTerminated. +func (in *ContainerStateTerminated) DeepCopy() *ContainerStateTerminated { + if in == nil { + return nil + } + out := new(ContainerStateTerminated) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerStateWaiting) DeepCopyInto(out *ContainerStateWaiting) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerStateWaiting. +func (in *ContainerStateWaiting) DeepCopy() *ContainerStateWaiting { + if in == nil { + return nil + } + out := new(ContainerStateWaiting) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ContainerStatus) DeepCopyInto(out *ContainerStatus) { + *out = *in + in.State.DeepCopyInto(&out.State) + in.LastTerminationState.DeepCopyInto(&out.LastTerminationState) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ContainerStatus. +func (in *ContainerStatus) DeepCopy() *ContainerStatus { + if in == nil { + return nil + } + out := new(ContainerStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *DaemonEndpoint) DeepCopyInto(out *DaemonEndpoint) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new DaemonEndpoint. +func (in *DaemonEndpoint) DeepCopy() *DaemonEndpoint { + if in == nil { + return nil + } + out := new(DaemonEndpoint) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *DeleteOptions) DeepCopyInto(out *DeleteOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + if in.GracePeriodSeconds != nil { + in, out := &in.GracePeriodSeconds, &out.GracePeriodSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.Preconditions != nil { + in, out := &in.Preconditions, &out.Preconditions + if *in == nil { + *out = nil + } else { + *out = new(Preconditions) + (*in).DeepCopyInto(*out) + } + } + if in.OrphanDependents != nil { + in, out := &in.OrphanDependents, &out.OrphanDependents + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.PropagationPolicy != nil { + in, out := &in.PropagationPolicy, &out.PropagationPolicy + if *in == nil { + *out = nil + } else { + *out = new(DeletionPropagation) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new DeleteOptions. +func (in *DeleteOptions) DeepCopy() *DeleteOptions { + if in == nil { + return nil + } + out := new(DeleteOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *DeleteOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *DownwardAPIProjection) DeepCopyInto(out *DownwardAPIProjection) { + *out = *in + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]DownwardAPIVolumeFile, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new DownwardAPIProjection. +func (in *DownwardAPIProjection) DeepCopy() *DownwardAPIProjection { + if in == nil { + return nil + } + out := new(DownwardAPIProjection) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *DownwardAPIVolumeFile) DeepCopyInto(out *DownwardAPIVolumeFile) { + *out = *in + if in.FieldRef != nil { + in, out := &in.FieldRef, &out.FieldRef + if *in == nil { + *out = nil + } else { + *out = new(ObjectFieldSelector) + **out = **in + } + } + if in.ResourceFieldRef != nil { + in, out := &in.ResourceFieldRef, &out.ResourceFieldRef + if *in == nil { + *out = nil + } else { + *out = new(ResourceFieldSelector) + (*in).DeepCopyInto(*out) + } + } + if in.Mode != nil { + in, out := &in.Mode, &out.Mode + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new DownwardAPIVolumeFile. +func (in *DownwardAPIVolumeFile) DeepCopy() *DownwardAPIVolumeFile { + if in == nil { + return nil + } + out := new(DownwardAPIVolumeFile) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *DownwardAPIVolumeSource) DeepCopyInto(out *DownwardAPIVolumeSource) { + *out = *in + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]DownwardAPIVolumeFile, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.DefaultMode != nil { + in, out := &in.DefaultMode, &out.DefaultMode + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new DownwardAPIVolumeSource. +func (in *DownwardAPIVolumeSource) DeepCopy() *DownwardAPIVolumeSource { + if in == nil { + return nil + } + out := new(DownwardAPIVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EmptyDirVolumeSource) DeepCopyInto(out *EmptyDirVolumeSource) { + *out = *in + if in.SizeLimit != nil { + in, out := &in.SizeLimit, &out.SizeLimit + if *in == nil { + *out = nil + } else { + x := (*in).DeepCopy() + *out = &x + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EmptyDirVolumeSource. +func (in *EmptyDirVolumeSource) DeepCopy() *EmptyDirVolumeSource { + if in == nil { + return nil + } + out := new(EmptyDirVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointAddress) DeepCopyInto(out *EndpointAddress) { + *out = *in + if in.NodeName != nil { + in, out := &in.NodeName, &out.NodeName + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + if in.TargetRef != nil { + in, out := &in.TargetRef, &out.TargetRef + if *in == nil { + *out = nil + } else { + *out = new(ObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointAddress. +func (in *EndpointAddress) DeepCopy() *EndpointAddress { + if in == nil { + return nil + } + out := new(EndpointAddress) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointPort) DeepCopyInto(out *EndpointPort) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointPort. +func (in *EndpointPort) DeepCopy() *EndpointPort { + if in == nil { + return nil + } + out := new(EndpointPort) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointSubset) DeepCopyInto(out *EndpointSubset) { + *out = *in + if in.Addresses != nil { + in, out := &in.Addresses, &out.Addresses + *out = make([]EndpointAddress, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.NotReadyAddresses != nil { + in, out := &in.NotReadyAddresses, &out.NotReadyAddresses + *out = make([]EndpointAddress, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Ports != nil { + in, out := &in.Ports, &out.Ports + *out = make([]EndpointPort, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointSubset. +func (in *EndpointSubset) DeepCopy() *EndpointSubset { + if in == nil { + return nil + } + out := new(EndpointSubset) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Endpoints) DeepCopyInto(out *Endpoints) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + if in.Subsets != nil { + in, out := &in.Subsets, &out.Subsets + *out = make([]EndpointSubset, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Endpoints. +func (in *Endpoints) DeepCopy() *Endpoints { + if in == nil { + return nil + } + out := new(Endpoints) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Endpoints) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointsList) DeepCopyInto(out *EndpointsList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Endpoints, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointsList. +func (in *EndpointsList) DeepCopy() *EndpointsList { + if in == nil { + return nil + } + out := new(EndpointsList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *EndpointsList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EnvFromSource) DeepCopyInto(out *EnvFromSource) { + *out = *in + if in.ConfigMapRef != nil { + in, out := &in.ConfigMapRef, &out.ConfigMapRef + if *in == nil { + *out = nil + } else { + *out = new(ConfigMapEnvSource) + (*in).DeepCopyInto(*out) + } + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretEnvSource) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EnvFromSource. +func (in *EnvFromSource) DeepCopy() *EnvFromSource { + if in == nil { + return nil + } + out := new(EnvFromSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EnvVar) DeepCopyInto(out *EnvVar) { + *out = *in + if in.ValueFrom != nil { + in, out := &in.ValueFrom, &out.ValueFrom + if *in == nil { + *out = nil + } else { + *out = new(EnvVarSource) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EnvVar. +func (in *EnvVar) DeepCopy() *EnvVar { + if in == nil { + return nil + } + out := new(EnvVar) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EnvVarSource) DeepCopyInto(out *EnvVarSource) { + *out = *in + if in.FieldRef != nil { + in, out := &in.FieldRef, &out.FieldRef + if *in == nil { + *out = nil + } else { + *out = new(ObjectFieldSelector) + **out = **in + } + } + if in.ResourceFieldRef != nil { + in, out := &in.ResourceFieldRef, &out.ResourceFieldRef + if *in == nil { + *out = nil + } else { + *out = new(ResourceFieldSelector) + (*in).DeepCopyInto(*out) + } + } + if in.ConfigMapKeyRef != nil { + in, out := &in.ConfigMapKeyRef, &out.ConfigMapKeyRef + if *in == nil { + *out = nil + } else { + *out = new(ConfigMapKeySelector) + (*in).DeepCopyInto(*out) + } + } + if in.SecretKeyRef != nil { + in, out := &in.SecretKeyRef, &out.SecretKeyRef + if *in == nil { + *out = nil + } else { + *out = new(SecretKeySelector) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EnvVarSource. +func (in *EnvVarSource) DeepCopy() *EnvVarSource { + if in == nil { + return nil + } + out := new(EnvVarSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Event) DeepCopyInto(out *Event) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + out.InvolvedObject = in.InvolvedObject + out.Source = in.Source + in.FirstTimestamp.DeepCopyInto(&out.FirstTimestamp) + in.LastTimestamp.DeepCopyInto(&out.LastTimestamp) + in.EventTime.DeepCopyInto(&out.EventTime) + if in.Series != nil { + in, out := &in.Series, &out.Series + if *in == nil { + *out = nil + } else { + *out = new(EventSeries) + (*in).DeepCopyInto(*out) + } + } + if in.Related != nil { + in, out := &in.Related, &out.Related + if *in == nil { + *out = nil + } else { + *out = new(ObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Event. +func (in *Event) DeepCopy() *Event { + if in == nil { + return nil + } + out := new(Event) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Event) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EventList) DeepCopyInto(out *EventList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Event, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EventList. +func (in *EventList) DeepCopy() *EventList { + if in == nil { + return nil + } + out := new(EventList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *EventList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EventSeries) DeepCopyInto(out *EventSeries) { + *out = *in + in.LastObservedTime.DeepCopyInto(&out.LastObservedTime) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EventSeries. +func (in *EventSeries) DeepCopy() *EventSeries { + if in == nil { + return nil + } + out := new(EventSeries) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EventSource) DeepCopyInto(out *EventSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EventSource. +func (in *EventSource) DeepCopy() *EventSource { + if in == nil { + return nil + } + out := new(EventSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ExecAction) DeepCopyInto(out *ExecAction) { + *out = *in + if in.Command != nil { + in, out := &in.Command, &out.Command + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ExecAction. +func (in *ExecAction) DeepCopy() *ExecAction { + if in == nil { + return nil + } + out := new(ExecAction) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *FCVolumeSource) DeepCopyInto(out *FCVolumeSource) { + *out = *in + if in.TargetWWNs != nil { + in, out := &in.TargetWWNs, &out.TargetWWNs + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.Lun != nil { + in, out := &in.Lun, &out.Lun + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + if in.WWIDs != nil { + in, out := &in.WWIDs, &out.WWIDs + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new FCVolumeSource. +func (in *FCVolumeSource) DeepCopy() *FCVolumeSource { + if in == nil { + return nil + } + out := new(FCVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *FlexPersistentVolumeSource) DeepCopyInto(out *FlexPersistentVolumeSource) { + *out = *in + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + if in.Options != nil { + in, out := &in.Options, &out.Options + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new FlexPersistentVolumeSource. +func (in *FlexPersistentVolumeSource) DeepCopy() *FlexPersistentVolumeSource { + if in == nil { + return nil + } + out := new(FlexPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *FlexVolumeSource) DeepCopyInto(out *FlexVolumeSource) { + *out = *in + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(LocalObjectReference) + **out = **in + } + } + if in.Options != nil { + in, out := &in.Options, &out.Options + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new FlexVolumeSource. +func (in *FlexVolumeSource) DeepCopy() *FlexVolumeSource { + if in == nil { + return nil + } + out := new(FlexVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *FlockerVolumeSource) DeepCopyInto(out *FlockerVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new FlockerVolumeSource. +func (in *FlockerVolumeSource) DeepCopy() *FlockerVolumeSource { + if in == nil { + return nil + } + out := new(FlockerVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *GCEPersistentDiskVolumeSource) DeepCopyInto(out *GCEPersistentDiskVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new GCEPersistentDiskVolumeSource. +func (in *GCEPersistentDiskVolumeSource) DeepCopy() *GCEPersistentDiskVolumeSource { + if in == nil { + return nil + } + out := new(GCEPersistentDiskVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *GitRepoVolumeSource) DeepCopyInto(out *GitRepoVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new GitRepoVolumeSource. +func (in *GitRepoVolumeSource) DeepCopy() *GitRepoVolumeSource { + if in == nil { + return nil + } + out := new(GitRepoVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *GlusterfsVolumeSource) DeepCopyInto(out *GlusterfsVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new GlusterfsVolumeSource. +func (in *GlusterfsVolumeSource) DeepCopy() *GlusterfsVolumeSource { + if in == nil { + return nil + } + out := new(GlusterfsVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *HTTPGetAction) DeepCopyInto(out *HTTPGetAction) { + *out = *in + out.Port = in.Port + if in.HTTPHeaders != nil { + in, out := &in.HTTPHeaders, &out.HTTPHeaders + *out = make([]HTTPHeader, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new HTTPGetAction. +func (in *HTTPGetAction) DeepCopy() *HTTPGetAction { + if in == nil { + return nil + } + out := new(HTTPGetAction) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *HTTPHeader) DeepCopyInto(out *HTTPHeader) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new HTTPHeader. +func (in *HTTPHeader) DeepCopy() *HTTPHeader { + if in == nil { + return nil + } + out := new(HTTPHeader) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Handler) DeepCopyInto(out *Handler) { + *out = *in + if in.Exec != nil { + in, out := &in.Exec, &out.Exec + if *in == nil { + *out = nil + } else { + *out = new(ExecAction) + (*in).DeepCopyInto(*out) + } + } + if in.HTTPGet != nil { + in, out := &in.HTTPGet, &out.HTTPGet + if *in == nil { + *out = nil + } else { + *out = new(HTTPGetAction) + (*in).DeepCopyInto(*out) + } + } + if in.TCPSocket != nil { + in, out := &in.TCPSocket, &out.TCPSocket + if *in == nil { + *out = nil + } else { + *out = new(TCPSocketAction) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Handler. +func (in *Handler) DeepCopy() *Handler { + if in == nil { + return nil + } + out := new(Handler) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *HostAlias) DeepCopyInto(out *HostAlias) { + *out = *in + if in.Hostnames != nil { + in, out := &in.Hostnames, &out.Hostnames + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new HostAlias. +func (in *HostAlias) DeepCopy() *HostAlias { + if in == nil { + return nil + } + out := new(HostAlias) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *HostPathVolumeSource) DeepCopyInto(out *HostPathVolumeSource) { + *out = *in + if in.Type != nil { + in, out := &in.Type, &out.Type + if *in == nil { + *out = nil + } else { + *out = new(HostPathType) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new HostPathVolumeSource. +func (in *HostPathVolumeSource) DeepCopy() *HostPathVolumeSource { + if in == nil { + return nil + } + out := new(HostPathVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ISCSIPersistentVolumeSource) DeepCopyInto(out *ISCSIPersistentVolumeSource) { + *out = *in + if in.Portals != nil { + in, out := &in.Portals, &out.Portals + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + if in.InitiatorName != nil { + in, out := &in.InitiatorName, &out.InitiatorName + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ISCSIPersistentVolumeSource. +func (in *ISCSIPersistentVolumeSource) DeepCopy() *ISCSIPersistentVolumeSource { + if in == nil { + return nil + } + out := new(ISCSIPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ISCSIVolumeSource) DeepCopyInto(out *ISCSIVolumeSource) { + *out = *in + if in.Portals != nil { + in, out := &in.Portals, &out.Portals + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(LocalObjectReference) + **out = **in + } + } + if in.InitiatorName != nil { + in, out := &in.InitiatorName, &out.InitiatorName + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ISCSIVolumeSource. +func (in *ISCSIVolumeSource) DeepCopy() *ISCSIVolumeSource { + if in == nil { + return nil + } + out := new(ISCSIVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *KeyToPath) DeepCopyInto(out *KeyToPath) { + *out = *in + if in.Mode != nil { + in, out := &in.Mode, &out.Mode + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new KeyToPath. +func (in *KeyToPath) DeepCopy() *KeyToPath { + if in == nil { + return nil + } + out := new(KeyToPath) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Lifecycle) DeepCopyInto(out *Lifecycle) { + *out = *in + if in.PostStart != nil { + in, out := &in.PostStart, &out.PostStart + if *in == nil { + *out = nil + } else { + *out = new(Handler) + (*in).DeepCopyInto(*out) + } + } + if in.PreStop != nil { + in, out := &in.PreStop, &out.PreStop + if *in == nil { + *out = nil + } else { + *out = new(Handler) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Lifecycle. +func (in *Lifecycle) DeepCopy() *Lifecycle { + if in == nil { + return nil + } + out := new(Lifecycle) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LimitRange) DeepCopyInto(out *LimitRange) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LimitRange. +func (in *LimitRange) DeepCopy() *LimitRange { + if in == nil { + return nil + } + out := new(LimitRange) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *LimitRange) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LimitRangeItem) DeepCopyInto(out *LimitRangeItem) { + *out = *in + if in.Max != nil { + in, out := &in.Max, &out.Max + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Min != nil { + in, out := &in.Min, &out.Min + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Default != nil { + in, out := &in.Default, &out.Default + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.DefaultRequest != nil { + in, out := &in.DefaultRequest, &out.DefaultRequest + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.MaxLimitRequestRatio != nil { + in, out := &in.MaxLimitRequestRatio, &out.MaxLimitRequestRatio + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LimitRangeItem. +func (in *LimitRangeItem) DeepCopy() *LimitRangeItem { + if in == nil { + return nil + } + out := new(LimitRangeItem) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LimitRangeList) DeepCopyInto(out *LimitRangeList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]LimitRange, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LimitRangeList. +func (in *LimitRangeList) DeepCopy() *LimitRangeList { + if in == nil { + return nil + } + out := new(LimitRangeList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *LimitRangeList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LimitRangeSpec) DeepCopyInto(out *LimitRangeSpec) { + *out = *in + if in.Limits != nil { + in, out := &in.Limits, &out.Limits + *out = make([]LimitRangeItem, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LimitRangeSpec. +func (in *LimitRangeSpec) DeepCopy() *LimitRangeSpec { + if in == nil { + return nil + } + out := new(LimitRangeSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *List) DeepCopyInto(out *List) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]runtime.Object, len(*in)) + for i := range *in { + if (*in)[i] == nil { + (*out)[i] = nil + } else { + (*out)[i] = (*in)[i].DeepCopyObject() + } + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new List. +func (in *List) DeepCopy() *List { + if in == nil { + return nil + } + out := new(List) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *List) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ListOptions) DeepCopyInto(out *ListOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + if in.LabelSelector == nil { + out.LabelSelector = nil + } else { + out.LabelSelector = in.LabelSelector.DeepCopySelector() + } + if in.FieldSelector == nil { + out.FieldSelector = nil + } else { + out.FieldSelector = in.FieldSelector.DeepCopySelector() + } + if in.TimeoutSeconds != nil { + in, out := &in.TimeoutSeconds, &out.TimeoutSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ListOptions. +func (in *ListOptions) DeepCopy() *ListOptions { + if in == nil { + return nil + } + out := new(ListOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ListOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LoadBalancerIngress) DeepCopyInto(out *LoadBalancerIngress) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LoadBalancerIngress. +func (in *LoadBalancerIngress) DeepCopy() *LoadBalancerIngress { + if in == nil { + return nil + } + out := new(LoadBalancerIngress) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LoadBalancerStatus) DeepCopyInto(out *LoadBalancerStatus) { + *out = *in + if in.Ingress != nil { + in, out := &in.Ingress, &out.Ingress + *out = make([]LoadBalancerIngress, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LoadBalancerStatus. +func (in *LoadBalancerStatus) DeepCopy() *LoadBalancerStatus { + if in == nil { + return nil + } + out := new(LoadBalancerStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LocalObjectReference) DeepCopyInto(out *LocalObjectReference) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LocalObjectReference. +func (in *LocalObjectReference) DeepCopy() *LocalObjectReference { + if in == nil { + return nil + } + out := new(LocalObjectReference) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *LocalVolumeSource) DeepCopyInto(out *LocalVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new LocalVolumeSource. +func (in *LocalVolumeSource) DeepCopy() *LocalVolumeSource { + if in == nil { + return nil + } + out := new(LocalVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NFSVolumeSource) DeepCopyInto(out *NFSVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NFSVolumeSource. +func (in *NFSVolumeSource) DeepCopy() *NFSVolumeSource { + if in == nil { + return nil + } + out := new(NFSVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Namespace) DeepCopyInto(out *Namespace) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + out.Status = in.Status + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Namespace. +func (in *Namespace) DeepCopy() *Namespace { + if in == nil { + return nil + } + out := new(Namespace) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Namespace) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NamespaceList) DeepCopyInto(out *NamespaceList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Namespace, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NamespaceList. +func (in *NamespaceList) DeepCopy() *NamespaceList { + if in == nil { + return nil + } + out := new(NamespaceList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *NamespaceList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NamespaceSpec) DeepCopyInto(out *NamespaceSpec) { + *out = *in + if in.Finalizers != nil { + in, out := &in.Finalizers, &out.Finalizers + *out = make([]FinalizerName, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NamespaceSpec. +func (in *NamespaceSpec) DeepCopy() *NamespaceSpec { + if in == nil { + return nil + } + out := new(NamespaceSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NamespaceStatus) DeepCopyInto(out *NamespaceStatus) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NamespaceStatus. +func (in *NamespaceStatus) DeepCopy() *NamespaceStatus { + if in == nil { + return nil + } + out := new(NamespaceStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Node) DeepCopyInto(out *Node) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Node. +func (in *Node) DeepCopy() *Node { + if in == nil { + return nil + } + out := new(Node) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Node) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeAddress) DeepCopyInto(out *NodeAddress) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeAddress. +func (in *NodeAddress) DeepCopy() *NodeAddress { + if in == nil { + return nil + } + out := new(NodeAddress) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeAffinity) DeepCopyInto(out *NodeAffinity) { + *out = *in + if in.RequiredDuringSchedulingIgnoredDuringExecution != nil { + in, out := &in.RequiredDuringSchedulingIgnoredDuringExecution, &out.RequiredDuringSchedulingIgnoredDuringExecution + if *in == nil { + *out = nil + } else { + *out = new(NodeSelector) + (*in).DeepCopyInto(*out) + } + } + if in.PreferredDuringSchedulingIgnoredDuringExecution != nil { + in, out := &in.PreferredDuringSchedulingIgnoredDuringExecution, &out.PreferredDuringSchedulingIgnoredDuringExecution + *out = make([]PreferredSchedulingTerm, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeAffinity. +func (in *NodeAffinity) DeepCopy() *NodeAffinity { + if in == nil { + return nil + } + out := new(NodeAffinity) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeCondition) DeepCopyInto(out *NodeCondition) { + *out = *in + in.LastHeartbeatTime.DeepCopyInto(&out.LastHeartbeatTime) + in.LastTransitionTime.DeepCopyInto(&out.LastTransitionTime) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeCondition. +func (in *NodeCondition) DeepCopy() *NodeCondition { + if in == nil { + return nil + } + out := new(NodeCondition) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeConfigSource) DeepCopyInto(out *NodeConfigSource) { + *out = *in + out.TypeMeta = in.TypeMeta + if in.ConfigMapRef != nil { + in, out := &in.ConfigMapRef, &out.ConfigMapRef + if *in == nil { + *out = nil + } else { + *out = new(ObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeConfigSource. +func (in *NodeConfigSource) DeepCopy() *NodeConfigSource { + if in == nil { + return nil + } + out := new(NodeConfigSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *NodeConfigSource) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeDaemonEndpoints) DeepCopyInto(out *NodeDaemonEndpoints) { + *out = *in + out.KubeletEndpoint = in.KubeletEndpoint + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeDaemonEndpoints. +func (in *NodeDaemonEndpoints) DeepCopy() *NodeDaemonEndpoints { + if in == nil { + return nil + } + out := new(NodeDaemonEndpoints) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeList) DeepCopyInto(out *NodeList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Node, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeList. +func (in *NodeList) DeepCopy() *NodeList { + if in == nil { + return nil + } + out := new(NodeList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *NodeList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeProxyOptions) DeepCopyInto(out *NodeProxyOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeProxyOptions. +func (in *NodeProxyOptions) DeepCopy() *NodeProxyOptions { + if in == nil { + return nil + } + out := new(NodeProxyOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *NodeProxyOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeResources) DeepCopyInto(out *NodeResources) { + *out = *in + if in.Capacity != nil { + in, out := &in.Capacity, &out.Capacity + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeResources. +func (in *NodeResources) DeepCopy() *NodeResources { + if in == nil { + return nil + } + out := new(NodeResources) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeSelector) DeepCopyInto(out *NodeSelector) { + *out = *in + if in.NodeSelectorTerms != nil { + in, out := &in.NodeSelectorTerms, &out.NodeSelectorTerms + *out = make([]NodeSelectorTerm, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeSelector. +func (in *NodeSelector) DeepCopy() *NodeSelector { + if in == nil { + return nil + } + out := new(NodeSelector) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeSelectorRequirement) DeepCopyInto(out *NodeSelectorRequirement) { + *out = *in + if in.Values != nil { + in, out := &in.Values, &out.Values + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeSelectorRequirement. +func (in *NodeSelectorRequirement) DeepCopy() *NodeSelectorRequirement { + if in == nil { + return nil + } + out := new(NodeSelectorRequirement) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeSelectorTerm) DeepCopyInto(out *NodeSelectorTerm) { + *out = *in + if in.MatchExpressions != nil { + in, out := &in.MatchExpressions, &out.MatchExpressions + *out = make([]NodeSelectorRequirement, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeSelectorTerm. +func (in *NodeSelectorTerm) DeepCopy() *NodeSelectorTerm { + if in == nil { + return nil + } + out := new(NodeSelectorTerm) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeSpec) DeepCopyInto(out *NodeSpec) { + *out = *in + if in.Taints != nil { + in, out := &in.Taints, &out.Taints + *out = make([]Taint, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.ConfigSource != nil { + in, out := &in.ConfigSource, &out.ConfigSource + if *in == nil { + *out = nil + } else { + *out = new(NodeConfigSource) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeSpec. +func (in *NodeSpec) DeepCopy() *NodeSpec { + if in == nil { + return nil + } + out := new(NodeSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeStatus) DeepCopyInto(out *NodeStatus) { + *out = *in + if in.Capacity != nil { + in, out := &in.Capacity, &out.Capacity + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Allocatable != nil { + in, out := &in.Allocatable, &out.Allocatable + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]NodeCondition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Addresses != nil { + in, out := &in.Addresses, &out.Addresses + *out = make([]NodeAddress, len(*in)) + copy(*out, *in) + } + out.DaemonEndpoints = in.DaemonEndpoints + out.NodeInfo = in.NodeInfo + if in.Images != nil { + in, out := &in.Images, &out.Images + *out = make([]ContainerImage, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.VolumesInUse != nil { + in, out := &in.VolumesInUse, &out.VolumesInUse + *out = make([]UniqueVolumeName, len(*in)) + copy(*out, *in) + } + if in.VolumesAttached != nil { + in, out := &in.VolumesAttached, &out.VolumesAttached + *out = make([]AttachedVolume, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeStatus. +func (in *NodeStatus) DeepCopy() *NodeStatus { + if in == nil { + return nil + } + out := new(NodeStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *NodeSystemInfo) DeepCopyInto(out *NodeSystemInfo) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new NodeSystemInfo. +func (in *NodeSystemInfo) DeepCopy() *NodeSystemInfo { + if in == nil { + return nil + } + out := new(NodeSystemInfo) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ObjectFieldSelector) DeepCopyInto(out *ObjectFieldSelector) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ObjectFieldSelector. +func (in *ObjectFieldSelector) DeepCopy() *ObjectFieldSelector { + if in == nil { + return nil + } + out := new(ObjectFieldSelector) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ObjectMeta) DeepCopyInto(out *ObjectMeta) { + *out = *in + in.CreationTimestamp.DeepCopyInto(&out.CreationTimestamp) + if in.DeletionTimestamp != nil { + in, out := &in.DeletionTimestamp, &out.DeletionTimestamp + if *in == nil { + *out = nil + } else { + *out = (*in).DeepCopy() + } + } + if in.DeletionGracePeriodSeconds != nil { + in, out := &in.DeletionGracePeriodSeconds, &out.DeletionGracePeriodSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.Labels != nil { + in, out := &in.Labels, &out.Labels + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.Annotations != nil { + in, out := &in.Annotations, &out.Annotations + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.OwnerReferences != nil { + in, out := &in.OwnerReferences, &out.OwnerReferences + *out = make([]v1.OwnerReference, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Initializers != nil { + in, out := &in.Initializers, &out.Initializers + if *in == nil { + *out = nil + } else { + *out = new(v1.Initializers) + (*in).DeepCopyInto(*out) + } + } + if in.Finalizers != nil { + in, out := &in.Finalizers, &out.Finalizers + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ObjectMeta. +func (in *ObjectMeta) DeepCopy() *ObjectMeta { + if in == nil { + return nil + } + out := new(ObjectMeta) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ObjectReference) DeepCopyInto(out *ObjectReference) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ObjectReference. +func (in *ObjectReference) DeepCopy() *ObjectReference { + if in == nil { + return nil + } + out := new(ObjectReference) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ObjectReference) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolume) DeepCopyInto(out *PersistentVolume) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + out.Status = in.Status + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolume. +func (in *PersistentVolume) DeepCopy() *PersistentVolume { + if in == nil { + return nil + } + out := new(PersistentVolume) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PersistentVolume) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeClaim) DeepCopyInto(out *PersistentVolumeClaim) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeClaim. +func (in *PersistentVolumeClaim) DeepCopy() *PersistentVolumeClaim { + if in == nil { + return nil + } + out := new(PersistentVolumeClaim) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PersistentVolumeClaim) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeClaimCondition) DeepCopyInto(out *PersistentVolumeClaimCondition) { + *out = *in + in.LastProbeTime.DeepCopyInto(&out.LastProbeTime) + in.LastTransitionTime.DeepCopyInto(&out.LastTransitionTime) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeClaimCondition. +func (in *PersistentVolumeClaimCondition) DeepCopy() *PersistentVolumeClaimCondition { + if in == nil { + return nil + } + out := new(PersistentVolumeClaimCondition) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeClaimList) DeepCopyInto(out *PersistentVolumeClaimList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]PersistentVolumeClaim, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeClaimList. +func (in *PersistentVolumeClaimList) DeepCopy() *PersistentVolumeClaimList { + if in == nil { + return nil + } + out := new(PersistentVolumeClaimList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PersistentVolumeClaimList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeClaimSpec) DeepCopyInto(out *PersistentVolumeClaimSpec) { + *out = *in + if in.AccessModes != nil { + in, out := &in.AccessModes, &out.AccessModes + *out = make([]PersistentVolumeAccessMode, len(*in)) + copy(*out, *in) + } + if in.Selector != nil { + in, out := &in.Selector, &out.Selector + if *in == nil { + *out = nil + } else { + *out = new(v1.LabelSelector) + (*in).DeepCopyInto(*out) + } + } + in.Resources.DeepCopyInto(&out.Resources) + if in.StorageClassName != nil { + in, out := &in.StorageClassName, &out.StorageClassName + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + if in.VolumeMode != nil { + in, out := &in.VolumeMode, &out.VolumeMode + if *in == nil { + *out = nil + } else { + *out = new(PersistentVolumeMode) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeClaimSpec. +func (in *PersistentVolumeClaimSpec) DeepCopy() *PersistentVolumeClaimSpec { + if in == nil { + return nil + } + out := new(PersistentVolumeClaimSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeClaimStatus) DeepCopyInto(out *PersistentVolumeClaimStatus) { + *out = *in + if in.AccessModes != nil { + in, out := &in.AccessModes, &out.AccessModes + *out = make([]PersistentVolumeAccessMode, len(*in)) + copy(*out, *in) + } + if in.Capacity != nil { + in, out := &in.Capacity, &out.Capacity + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]PersistentVolumeClaimCondition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeClaimStatus. +func (in *PersistentVolumeClaimStatus) DeepCopy() *PersistentVolumeClaimStatus { + if in == nil { + return nil + } + out := new(PersistentVolumeClaimStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeClaimVolumeSource) DeepCopyInto(out *PersistentVolumeClaimVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeClaimVolumeSource. +func (in *PersistentVolumeClaimVolumeSource) DeepCopy() *PersistentVolumeClaimVolumeSource { + if in == nil { + return nil + } + out := new(PersistentVolumeClaimVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeList) DeepCopyInto(out *PersistentVolumeList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]PersistentVolume, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeList. +func (in *PersistentVolumeList) DeepCopy() *PersistentVolumeList { + if in == nil { + return nil + } + out := new(PersistentVolumeList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PersistentVolumeList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeSource) DeepCopyInto(out *PersistentVolumeSource) { + *out = *in + if in.GCEPersistentDisk != nil { + in, out := &in.GCEPersistentDisk, &out.GCEPersistentDisk + if *in == nil { + *out = nil + } else { + *out = new(GCEPersistentDiskVolumeSource) + **out = **in + } + } + if in.AWSElasticBlockStore != nil { + in, out := &in.AWSElasticBlockStore, &out.AWSElasticBlockStore + if *in == nil { + *out = nil + } else { + *out = new(AWSElasticBlockStoreVolumeSource) + **out = **in + } + } + if in.HostPath != nil { + in, out := &in.HostPath, &out.HostPath + if *in == nil { + *out = nil + } else { + *out = new(HostPathVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Glusterfs != nil { + in, out := &in.Glusterfs, &out.Glusterfs + if *in == nil { + *out = nil + } else { + *out = new(GlusterfsVolumeSource) + **out = **in + } + } + if in.NFS != nil { + in, out := &in.NFS, &out.NFS + if *in == nil { + *out = nil + } else { + *out = new(NFSVolumeSource) + **out = **in + } + } + if in.RBD != nil { + in, out := &in.RBD, &out.RBD + if *in == nil { + *out = nil + } else { + *out = new(RBDPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Quobyte != nil { + in, out := &in.Quobyte, &out.Quobyte + if *in == nil { + *out = nil + } else { + *out = new(QuobyteVolumeSource) + **out = **in + } + } + if in.ISCSI != nil { + in, out := &in.ISCSI, &out.ISCSI + if *in == nil { + *out = nil + } else { + *out = new(ISCSIPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.FlexVolume != nil { + in, out := &in.FlexVolume, &out.FlexVolume + if *in == nil { + *out = nil + } else { + *out = new(FlexPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Cinder != nil { + in, out := &in.Cinder, &out.Cinder + if *in == nil { + *out = nil + } else { + *out = new(CinderVolumeSource) + **out = **in + } + } + if in.CephFS != nil { + in, out := &in.CephFS, &out.CephFS + if *in == nil { + *out = nil + } else { + *out = new(CephFSPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.FC != nil { + in, out := &in.FC, &out.FC + if *in == nil { + *out = nil + } else { + *out = new(FCVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Flocker != nil { + in, out := &in.Flocker, &out.Flocker + if *in == nil { + *out = nil + } else { + *out = new(FlockerVolumeSource) + **out = **in + } + } + if in.AzureFile != nil { + in, out := &in.AzureFile, &out.AzureFile + if *in == nil { + *out = nil + } else { + *out = new(AzureFilePersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.VsphereVolume != nil { + in, out := &in.VsphereVolume, &out.VsphereVolume + if *in == nil { + *out = nil + } else { + *out = new(VsphereVirtualDiskVolumeSource) + **out = **in + } + } + if in.AzureDisk != nil { + in, out := &in.AzureDisk, &out.AzureDisk + if *in == nil { + *out = nil + } else { + *out = new(AzureDiskVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.PhotonPersistentDisk != nil { + in, out := &in.PhotonPersistentDisk, &out.PhotonPersistentDisk + if *in == nil { + *out = nil + } else { + *out = new(PhotonPersistentDiskVolumeSource) + **out = **in + } + } + if in.PortworxVolume != nil { + in, out := &in.PortworxVolume, &out.PortworxVolume + if *in == nil { + *out = nil + } else { + *out = new(PortworxVolumeSource) + **out = **in + } + } + if in.ScaleIO != nil { + in, out := &in.ScaleIO, &out.ScaleIO + if *in == nil { + *out = nil + } else { + *out = new(ScaleIOPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Local != nil { + in, out := &in.Local, &out.Local + if *in == nil { + *out = nil + } else { + *out = new(LocalVolumeSource) + **out = **in + } + } + if in.StorageOS != nil { + in, out := &in.StorageOS, &out.StorageOS + if *in == nil { + *out = nil + } else { + *out = new(StorageOSPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.CSI != nil { + in, out := &in.CSI, &out.CSI + if *in == nil { + *out = nil + } else { + *out = new(CSIPersistentVolumeSource) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeSource. +func (in *PersistentVolumeSource) DeepCopy() *PersistentVolumeSource { + if in == nil { + return nil + } + out := new(PersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeSpec) DeepCopyInto(out *PersistentVolumeSpec) { + *out = *in + if in.Capacity != nil { + in, out := &in.Capacity, &out.Capacity + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + in.PersistentVolumeSource.DeepCopyInto(&out.PersistentVolumeSource) + if in.AccessModes != nil { + in, out := &in.AccessModes, &out.AccessModes + *out = make([]PersistentVolumeAccessMode, len(*in)) + copy(*out, *in) + } + if in.ClaimRef != nil { + in, out := &in.ClaimRef, &out.ClaimRef + if *in == nil { + *out = nil + } else { + *out = new(ObjectReference) + **out = **in + } + } + if in.MountOptions != nil { + in, out := &in.MountOptions, &out.MountOptions + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.VolumeMode != nil { + in, out := &in.VolumeMode, &out.VolumeMode + if *in == nil { + *out = nil + } else { + *out = new(PersistentVolumeMode) + **out = **in + } + } + if in.NodeAffinity != nil { + in, out := &in.NodeAffinity, &out.NodeAffinity + if *in == nil { + *out = nil + } else { + *out = new(VolumeNodeAffinity) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeSpec. +func (in *PersistentVolumeSpec) DeepCopy() *PersistentVolumeSpec { + if in == nil { + return nil + } + out := new(PersistentVolumeSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PersistentVolumeStatus) DeepCopyInto(out *PersistentVolumeStatus) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PersistentVolumeStatus. +func (in *PersistentVolumeStatus) DeepCopy() *PersistentVolumeStatus { + if in == nil { + return nil + } + out := new(PersistentVolumeStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PhotonPersistentDiskVolumeSource) DeepCopyInto(out *PhotonPersistentDiskVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PhotonPersistentDiskVolumeSource. +func (in *PhotonPersistentDiskVolumeSource) DeepCopy() *PhotonPersistentDiskVolumeSource { + if in == nil { + return nil + } + out := new(PhotonPersistentDiskVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Pod) DeepCopyInto(out *Pod) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Pod. +func (in *Pod) DeepCopy() *Pod { + if in == nil { + return nil + } + out := new(Pod) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Pod) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodAffinity) DeepCopyInto(out *PodAffinity) { + *out = *in + if in.RequiredDuringSchedulingIgnoredDuringExecution != nil { + in, out := &in.RequiredDuringSchedulingIgnoredDuringExecution, &out.RequiredDuringSchedulingIgnoredDuringExecution + *out = make([]PodAffinityTerm, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.PreferredDuringSchedulingIgnoredDuringExecution != nil { + in, out := &in.PreferredDuringSchedulingIgnoredDuringExecution, &out.PreferredDuringSchedulingIgnoredDuringExecution + *out = make([]WeightedPodAffinityTerm, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodAffinity. +func (in *PodAffinity) DeepCopy() *PodAffinity { + if in == nil { + return nil + } + out := new(PodAffinity) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodAffinityTerm) DeepCopyInto(out *PodAffinityTerm) { + *out = *in + if in.LabelSelector != nil { + in, out := &in.LabelSelector, &out.LabelSelector + if *in == nil { + *out = nil + } else { + *out = new(v1.LabelSelector) + (*in).DeepCopyInto(*out) + } + } + if in.Namespaces != nil { + in, out := &in.Namespaces, &out.Namespaces + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodAffinityTerm. +func (in *PodAffinityTerm) DeepCopy() *PodAffinityTerm { + if in == nil { + return nil + } + out := new(PodAffinityTerm) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodAntiAffinity) DeepCopyInto(out *PodAntiAffinity) { + *out = *in + if in.RequiredDuringSchedulingIgnoredDuringExecution != nil { + in, out := &in.RequiredDuringSchedulingIgnoredDuringExecution, &out.RequiredDuringSchedulingIgnoredDuringExecution + *out = make([]PodAffinityTerm, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.PreferredDuringSchedulingIgnoredDuringExecution != nil { + in, out := &in.PreferredDuringSchedulingIgnoredDuringExecution, &out.PreferredDuringSchedulingIgnoredDuringExecution + *out = make([]WeightedPodAffinityTerm, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodAntiAffinity. +func (in *PodAntiAffinity) DeepCopy() *PodAntiAffinity { + if in == nil { + return nil + } + out := new(PodAntiAffinity) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodAttachOptions) DeepCopyInto(out *PodAttachOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodAttachOptions. +func (in *PodAttachOptions) DeepCopy() *PodAttachOptions { + if in == nil { + return nil + } + out := new(PodAttachOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodAttachOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodCondition) DeepCopyInto(out *PodCondition) { + *out = *in + in.LastProbeTime.DeepCopyInto(&out.LastProbeTime) + in.LastTransitionTime.DeepCopyInto(&out.LastTransitionTime) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodCondition. +func (in *PodCondition) DeepCopy() *PodCondition { + if in == nil { + return nil + } + out := new(PodCondition) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodDNSConfig) DeepCopyInto(out *PodDNSConfig) { + *out = *in + if in.Nameservers != nil { + in, out := &in.Nameservers, &out.Nameservers + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.Searches != nil { + in, out := &in.Searches, &out.Searches + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.Options != nil { + in, out := &in.Options, &out.Options + *out = make([]PodDNSConfigOption, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodDNSConfig. +func (in *PodDNSConfig) DeepCopy() *PodDNSConfig { + if in == nil { + return nil + } + out := new(PodDNSConfig) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodDNSConfigOption) DeepCopyInto(out *PodDNSConfigOption) { + *out = *in + if in.Value != nil { + in, out := &in.Value, &out.Value + if *in == nil { + *out = nil + } else { + *out = new(string) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodDNSConfigOption. +func (in *PodDNSConfigOption) DeepCopy() *PodDNSConfigOption { + if in == nil { + return nil + } + out := new(PodDNSConfigOption) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodExecOptions) DeepCopyInto(out *PodExecOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + if in.Command != nil { + in, out := &in.Command, &out.Command + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodExecOptions. +func (in *PodExecOptions) DeepCopy() *PodExecOptions { + if in == nil { + return nil + } + out := new(PodExecOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodExecOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodList) DeepCopyInto(out *PodList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Pod, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodList. +func (in *PodList) DeepCopy() *PodList { + if in == nil { + return nil + } + out := new(PodList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodLogOptions) DeepCopyInto(out *PodLogOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + if in.SinceSeconds != nil { + in, out := &in.SinceSeconds, &out.SinceSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.SinceTime != nil { + in, out := &in.SinceTime, &out.SinceTime + if *in == nil { + *out = nil + } else { + *out = (*in).DeepCopy() + } + } + if in.TailLines != nil { + in, out := &in.TailLines, &out.TailLines + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.LimitBytes != nil { + in, out := &in.LimitBytes, &out.LimitBytes + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodLogOptions. +func (in *PodLogOptions) DeepCopy() *PodLogOptions { + if in == nil { + return nil + } + out := new(PodLogOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodLogOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodPortForwardOptions) DeepCopyInto(out *PodPortForwardOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + if in.Ports != nil { + in, out := &in.Ports, &out.Ports + *out = make([]int32, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodPortForwardOptions. +func (in *PodPortForwardOptions) DeepCopy() *PodPortForwardOptions { + if in == nil { + return nil + } + out := new(PodPortForwardOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodPortForwardOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodProxyOptions) DeepCopyInto(out *PodProxyOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodProxyOptions. +func (in *PodProxyOptions) DeepCopy() *PodProxyOptions { + if in == nil { + return nil + } + out := new(PodProxyOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodProxyOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodSecurityContext) DeepCopyInto(out *PodSecurityContext) { + *out = *in + if in.ShareProcessNamespace != nil { + in, out := &in.ShareProcessNamespace, &out.ShareProcessNamespace + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.SELinuxOptions != nil { + in, out := &in.SELinuxOptions, &out.SELinuxOptions + if *in == nil { + *out = nil + } else { + *out = new(SELinuxOptions) + **out = **in + } + } + if in.RunAsUser != nil { + in, out := &in.RunAsUser, &out.RunAsUser + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.RunAsNonRoot != nil { + in, out := &in.RunAsNonRoot, &out.RunAsNonRoot + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.SupplementalGroups != nil { + in, out := &in.SupplementalGroups, &out.SupplementalGroups + *out = make([]int64, len(*in)) + copy(*out, *in) + } + if in.FSGroup != nil { + in, out := &in.FSGroup, &out.FSGroup + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodSecurityContext. +func (in *PodSecurityContext) DeepCopy() *PodSecurityContext { + if in == nil { + return nil + } + out := new(PodSecurityContext) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodSignature) DeepCopyInto(out *PodSignature) { + *out = *in + if in.PodController != nil { + in, out := &in.PodController, &out.PodController + if *in == nil { + *out = nil + } else { + *out = new(v1.OwnerReference) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodSignature. +func (in *PodSignature) DeepCopy() *PodSignature { + if in == nil { + return nil + } + out := new(PodSignature) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodSpec) DeepCopyInto(out *PodSpec) { + *out = *in + if in.Volumes != nil { + in, out := &in.Volumes, &out.Volumes + *out = make([]Volume, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.InitContainers != nil { + in, out := &in.InitContainers, &out.InitContainers + *out = make([]Container, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Containers != nil { + in, out := &in.Containers, &out.Containers + *out = make([]Container, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.TerminationGracePeriodSeconds != nil { + in, out := &in.TerminationGracePeriodSeconds, &out.TerminationGracePeriodSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.ActiveDeadlineSeconds != nil { + in, out := &in.ActiveDeadlineSeconds, &out.ActiveDeadlineSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.NodeSelector != nil { + in, out := &in.NodeSelector, &out.NodeSelector + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.AutomountServiceAccountToken != nil { + in, out := &in.AutomountServiceAccountToken, &out.AutomountServiceAccountToken + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.SecurityContext != nil { + in, out := &in.SecurityContext, &out.SecurityContext + if *in == nil { + *out = nil + } else { + *out = new(PodSecurityContext) + (*in).DeepCopyInto(*out) + } + } + if in.ImagePullSecrets != nil { + in, out := &in.ImagePullSecrets, &out.ImagePullSecrets + *out = make([]LocalObjectReference, len(*in)) + copy(*out, *in) + } + if in.Affinity != nil { + in, out := &in.Affinity, &out.Affinity + if *in == nil { + *out = nil + } else { + *out = new(Affinity) + (*in).DeepCopyInto(*out) + } + } + if in.Tolerations != nil { + in, out := &in.Tolerations, &out.Tolerations + *out = make([]Toleration, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.HostAliases != nil { + in, out := &in.HostAliases, &out.HostAliases + *out = make([]HostAlias, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Priority != nil { + in, out := &in.Priority, &out.Priority + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + if in.DNSConfig != nil { + in, out := &in.DNSConfig, &out.DNSConfig + if *in == nil { + *out = nil + } else { + *out = new(PodDNSConfig) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodSpec. +func (in *PodSpec) DeepCopy() *PodSpec { + if in == nil { + return nil + } + out := new(PodSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodStatus) DeepCopyInto(out *PodStatus) { + *out = *in + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]PodCondition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.StartTime != nil { + in, out := &in.StartTime, &out.StartTime + if *in == nil { + *out = nil + } else { + *out = (*in).DeepCopy() + } + } + if in.InitContainerStatuses != nil { + in, out := &in.InitContainerStatuses, &out.InitContainerStatuses + *out = make([]ContainerStatus, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.ContainerStatuses != nil { + in, out := &in.ContainerStatuses, &out.ContainerStatuses + *out = make([]ContainerStatus, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodStatus. +func (in *PodStatus) DeepCopy() *PodStatus { + if in == nil { + return nil + } + out := new(PodStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodStatusResult) DeepCopyInto(out *PodStatusResult) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodStatusResult. +func (in *PodStatusResult) DeepCopy() *PodStatusResult { + if in == nil { + return nil + } + out := new(PodStatusResult) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodStatusResult) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodTemplate) DeepCopyInto(out *PodTemplate) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Template.DeepCopyInto(&out.Template) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodTemplate. +func (in *PodTemplate) DeepCopy() *PodTemplate { + if in == nil { + return nil + } + out := new(PodTemplate) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodTemplate) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodTemplateList) DeepCopyInto(out *PodTemplateList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]PodTemplate, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodTemplateList. +func (in *PodTemplateList) DeepCopy() *PodTemplateList { + if in == nil { + return nil + } + out := new(PodTemplateList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *PodTemplateList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PodTemplateSpec) DeepCopyInto(out *PodTemplateSpec) { + *out = *in + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PodTemplateSpec. +func (in *PodTemplateSpec) DeepCopy() *PodTemplateSpec { + if in == nil { + return nil + } + out := new(PodTemplateSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PortworxVolumeSource) DeepCopyInto(out *PortworxVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PortworxVolumeSource. +func (in *PortworxVolumeSource) DeepCopy() *PortworxVolumeSource { + if in == nil { + return nil + } + out := new(PortworxVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Preconditions) DeepCopyInto(out *Preconditions) { + *out = *in + if in.UID != nil { + in, out := &in.UID, &out.UID + if *in == nil { + *out = nil + } else { + *out = new(types.UID) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Preconditions. +func (in *Preconditions) DeepCopy() *Preconditions { + if in == nil { + return nil + } + out := new(Preconditions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PreferAvoidPodsEntry) DeepCopyInto(out *PreferAvoidPodsEntry) { + *out = *in + in.PodSignature.DeepCopyInto(&out.PodSignature) + in.EvictionTime.DeepCopyInto(&out.EvictionTime) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PreferAvoidPodsEntry. +func (in *PreferAvoidPodsEntry) DeepCopy() *PreferAvoidPodsEntry { + if in == nil { + return nil + } + out := new(PreferAvoidPodsEntry) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *PreferredSchedulingTerm) DeepCopyInto(out *PreferredSchedulingTerm) { + *out = *in + in.Preference.DeepCopyInto(&out.Preference) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new PreferredSchedulingTerm. +func (in *PreferredSchedulingTerm) DeepCopy() *PreferredSchedulingTerm { + if in == nil { + return nil + } + out := new(PreferredSchedulingTerm) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Probe) DeepCopyInto(out *Probe) { + *out = *in + in.Handler.DeepCopyInto(&out.Handler) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Probe. +func (in *Probe) DeepCopy() *Probe { + if in == nil { + return nil + } + out := new(Probe) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ProjectedVolumeSource) DeepCopyInto(out *ProjectedVolumeSource) { + *out = *in + if in.Sources != nil { + in, out := &in.Sources, &out.Sources + *out = make([]VolumeProjection, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.DefaultMode != nil { + in, out := &in.DefaultMode, &out.DefaultMode + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ProjectedVolumeSource. +func (in *ProjectedVolumeSource) DeepCopy() *ProjectedVolumeSource { + if in == nil { + return nil + } + out := new(ProjectedVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *QuobyteVolumeSource) DeepCopyInto(out *QuobyteVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new QuobyteVolumeSource. +func (in *QuobyteVolumeSource) DeepCopy() *QuobyteVolumeSource { + if in == nil { + return nil + } + out := new(QuobyteVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *RBDPersistentVolumeSource) DeepCopyInto(out *RBDPersistentVolumeSource) { + *out = *in + if in.CephMonitors != nil { + in, out := &in.CephMonitors, &out.CephMonitors + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new RBDPersistentVolumeSource. +func (in *RBDPersistentVolumeSource) DeepCopy() *RBDPersistentVolumeSource { + if in == nil { + return nil + } + out := new(RBDPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *RBDVolumeSource) DeepCopyInto(out *RBDVolumeSource) { + *out = *in + if in.CephMonitors != nil { + in, out := &in.CephMonitors, &out.CephMonitors + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(LocalObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new RBDVolumeSource. +func (in *RBDVolumeSource) DeepCopy() *RBDVolumeSource { + if in == nil { + return nil + } + out := new(RBDVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *RangeAllocation) DeepCopyInto(out *RangeAllocation) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + if in.Data != nil { + in, out := &in.Data, &out.Data + *out = make([]byte, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new RangeAllocation. +func (in *RangeAllocation) DeepCopy() *RangeAllocation { + if in == nil { + return nil + } + out := new(RangeAllocation) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *RangeAllocation) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ReplicationController) DeepCopyInto(out *ReplicationController) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ReplicationController. +func (in *ReplicationController) DeepCopy() *ReplicationController { + if in == nil { + return nil + } + out := new(ReplicationController) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ReplicationController) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ReplicationControllerCondition) DeepCopyInto(out *ReplicationControllerCondition) { + *out = *in + in.LastTransitionTime.DeepCopyInto(&out.LastTransitionTime) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ReplicationControllerCondition. +func (in *ReplicationControllerCondition) DeepCopy() *ReplicationControllerCondition { + if in == nil { + return nil + } + out := new(ReplicationControllerCondition) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ReplicationControllerList) DeepCopyInto(out *ReplicationControllerList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]ReplicationController, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ReplicationControllerList. +func (in *ReplicationControllerList) DeepCopy() *ReplicationControllerList { + if in == nil { + return nil + } + out := new(ReplicationControllerList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ReplicationControllerList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ReplicationControllerSpec) DeepCopyInto(out *ReplicationControllerSpec) { + *out = *in + if in.Selector != nil { + in, out := &in.Selector, &out.Selector + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.Template != nil { + in, out := &in.Template, &out.Template + if *in == nil { + *out = nil + } else { + *out = new(PodTemplateSpec) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ReplicationControllerSpec. +func (in *ReplicationControllerSpec) DeepCopy() *ReplicationControllerSpec { + if in == nil { + return nil + } + out := new(ReplicationControllerSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ReplicationControllerStatus) DeepCopyInto(out *ReplicationControllerStatus) { + *out = *in + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]ReplicationControllerCondition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ReplicationControllerStatus. +func (in *ReplicationControllerStatus) DeepCopy() *ReplicationControllerStatus { + if in == nil { + return nil + } + out := new(ReplicationControllerStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ResourceFieldSelector) DeepCopyInto(out *ResourceFieldSelector) { + *out = *in + out.Divisor = in.Divisor.DeepCopy() + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceFieldSelector. +func (in *ResourceFieldSelector) DeepCopy() *ResourceFieldSelector { + if in == nil { + return nil + } + out := new(ResourceFieldSelector) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in ResourceList) DeepCopyInto(out *ResourceList) { + { + in := &in + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + return + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceList. +func (in ResourceList) DeepCopy() ResourceList { + if in == nil { + return nil + } + out := new(ResourceList) + in.DeepCopyInto(out) + return *out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ResourceQuota) DeepCopyInto(out *ResourceQuota) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceQuota. +func (in *ResourceQuota) DeepCopy() *ResourceQuota { + if in == nil { + return nil + } + out := new(ResourceQuota) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ResourceQuota) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ResourceQuotaList) DeepCopyInto(out *ResourceQuotaList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]ResourceQuota, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceQuotaList. +func (in *ResourceQuotaList) DeepCopy() *ResourceQuotaList { + if in == nil { + return nil + } + out := new(ResourceQuotaList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ResourceQuotaList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ResourceQuotaSpec) DeepCopyInto(out *ResourceQuotaSpec) { + *out = *in + if in.Hard != nil { + in, out := &in.Hard, &out.Hard + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Scopes != nil { + in, out := &in.Scopes, &out.Scopes + *out = make([]ResourceQuotaScope, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceQuotaSpec. +func (in *ResourceQuotaSpec) DeepCopy() *ResourceQuotaSpec { + if in == nil { + return nil + } + out := new(ResourceQuotaSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ResourceQuotaStatus) DeepCopyInto(out *ResourceQuotaStatus) { + *out = *in + if in.Hard != nil { + in, out := &in.Hard, &out.Hard + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Used != nil { + in, out := &in.Used, &out.Used + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceQuotaStatus. +func (in *ResourceQuotaStatus) DeepCopy() *ResourceQuotaStatus { + if in == nil { + return nil + } + out := new(ResourceQuotaStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ResourceRequirements) DeepCopyInto(out *ResourceRequirements) { + *out = *in + if in.Limits != nil { + in, out := &in.Limits, &out.Limits + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + if in.Requests != nil { + in, out := &in.Requests, &out.Requests + *out = make(ResourceList, len(*in)) + for key, val := range *in { + (*out)[key] = val.DeepCopy() + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ResourceRequirements. +func (in *ResourceRequirements) DeepCopy() *ResourceRequirements { + if in == nil { + return nil + } + out := new(ResourceRequirements) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SELinuxOptions) DeepCopyInto(out *SELinuxOptions) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SELinuxOptions. +func (in *SELinuxOptions) DeepCopy() *SELinuxOptions { + if in == nil { + return nil + } + out := new(SELinuxOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ScaleIOPersistentVolumeSource) DeepCopyInto(out *ScaleIOPersistentVolumeSource) { + *out = *in + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(SecretReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ScaleIOPersistentVolumeSource. +func (in *ScaleIOPersistentVolumeSource) DeepCopy() *ScaleIOPersistentVolumeSource { + if in == nil { + return nil + } + out := new(ScaleIOPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ScaleIOVolumeSource) DeepCopyInto(out *ScaleIOVolumeSource) { + *out = *in + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(LocalObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ScaleIOVolumeSource. +func (in *ScaleIOVolumeSource) DeepCopy() *ScaleIOVolumeSource { + if in == nil { + return nil + } + out := new(ScaleIOVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Secret) DeepCopyInto(out *Secret) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + if in.Data != nil { + in, out := &in.Data, &out.Data + *out = make(map[string][]byte, len(*in)) + for key, val := range *in { + if val == nil { + (*out)[key] = nil + } else { + (*out)[key] = make([]byte, len(val)) + copy((*out)[key], val) + } + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Secret. +func (in *Secret) DeepCopy() *Secret { + if in == nil { + return nil + } + out := new(Secret) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Secret) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecretEnvSource) DeepCopyInto(out *SecretEnvSource) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecretEnvSource. +func (in *SecretEnvSource) DeepCopy() *SecretEnvSource { + if in == nil { + return nil + } + out := new(SecretEnvSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecretKeySelector) DeepCopyInto(out *SecretKeySelector) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecretKeySelector. +func (in *SecretKeySelector) DeepCopy() *SecretKeySelector { + if in == nil { + return nil + } + out := new(SecretKeySelector) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecretList) DeepCopyInto(out *SecretList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Secret, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecretList. +func (in *SecretList) DeepCopy() *SecretList { + if in == nil { + return nil + } + out := new(SecretList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *SecretList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecretProjection) DeepCopyInto(out *SecretProjection) { + *out = *in + out.LocalObjectReference = in.LocalObjectReference + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]KeyToPath, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecretProjection. +func (in *SecretProjection) DeepCopy() *SecretProjection { + if in == nil { + return nil + } + out := new(SecretProjection) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecretReference) DeepCopyInto(out *SecretReference) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecretReference. +func (in *SecretReference) DeepCopy() *SecretReference { + if in == nil { + return nil + } + out := new(SecretReference) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecretVolumeSource) DeepCopyInto(out *SecretVolumeSource) { + *out = *in + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]KeyToPath, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.DefaultMode != nil { + in, out := &in.DefaultMode, &out.DefaultMode + if *in == nil { + *out = nil + } else { + *out = new(int32) + **out = **in + } + } + if in.Optional != nil { + in, out := &in.Optional, &out.Optional + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecretVolumeSource. +func (in *SecretVolumeSource) DeepCopy() *SecretVolumeSource { + if in == nil { + return nil + } + out := new(SecretVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SecurityContext) DeepCopyInto(out *SecurityContext) { + *out = *in + if in.Capabilities != nil { + in, out := &in.Capabilities, &out.Capabilities + if *in == nil { + *out = nil + } else { + *out = new(Capabilities) + (*in).DeepCopyInto(*out) + } + } + if in.Privileged != nil { + in, out := &in.Privileged, &out.Privileged + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.SELinuxOptions != nil { + in, out := &in.SELinuxOptions, &out.SELinuxOptions + if *in == nil { + *out = nil + } else { + *out = new(SELinuxOptions) + **out = **in + } + } + if in.RunAsUser != nil { + in, out := &in.RunAsUser, &out.RunAsUser + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + if in.RunAsNonRoot != nil { + in, out := &in.RunAsNonRoot, &out.RunAsNonRoot + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.ReadOnlyRootFilesystem != nil { + in, out := &in.ReadOnlyRootFilesystem, &out.ReadOnlyRootFilesystem + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + if in.AllowPrivilegeEscalation != nil { + in, out := &in.AllowPrivilegeEscalation, &out.AllowPrivilegeEscalation + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SecurityContext. +func (in *SecurityContext) DeepCopy() *SecurityContext { + if in == nil { + return nil + } + out := new(SecurityContext) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SerializedReference) DeepCopyInto(out *SerializedReference) { + *out = *in + out.TypeMeta = in.TypeMeta + out.Reference = in.Reference + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SerializedReference. +func (in *SerializedReference) DeepCopy() *SerializedReference { + if in == nil { + return nil + } + out := new(SerializedReference) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *SerializedReference) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Service) DeepCopyInto(out *Service) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Service. +func (in *Service) DeepCopy() *Service { + if in == nil { + return nil + } + out := new(Service) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Service) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServiceAccount) DeepCopyInto(out *ServiceAccount) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + if in.Secrets != nil { + in, out := &in.Secrets, &out.Secrets + *out = make([]ObjectReference, len(*in)) + copy(*out, *in) + } + if in.ImagePullSecrets != nil { + in, out := &in.ImagePullSecrets, &out.ImagePullSecrets + *out = make([]LocalObjectReference, len(*in)) + copy(*out, *in) + } + if in.AutomountServiceAccountToken != nil { + in, out := &in.AutomountServiceAccountToken, &out.AutomountServiceAccountToken + if *in == nil { + *out = nil + } else { + *out = new(bool) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServiceAccount. +func (in *ServiceAccount) DeepCopy() *ServiceAccount { + if in == nil { + return nil + } + out := new(ServiceAccount) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ServiceAccount) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServiceAccountList) DeepCopyInto(out *ServiceAccountList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]ServiceAccount, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServiceAccountList. +func (in *ServiceAccountList) DeepCopy() *ServiceAccountList { + if in == nil { + return nil + } + out := new(ServiceAccountList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ServiceAccountList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServiceList) DeepCopyInto(out *ServiceList) { + *out = *in + out.TypeMeta = in.TypeMeta + out.ListMeta = in.ListMeta + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Service, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServiceList. +func (in *ServiceList) DeepCopy() *ServiceList { + if in == nil { + return nil + } + out := new(ServiceList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ServiceList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServicePort) DeepCopyInto(out *ServicePort) { + *out = *in + out.TargetPort = in.TargetPort + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServicePort. +func (in *ServicePort) DeepCopy() *ServicePort { + if in == nil { + return nil + } + out := new(ServicePort) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServiceProxyOptions) DeepCopyInto(out *ServiceProxyOptions) { + *out = *in + out.TypeMeta = in.TypeMeta + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServiceProxyOptions. +func (in *ServiceProxyOptions) DeepCopy() *ServiceProxyOptions { + if in == nil { + return nil + } + out := new(ServiceProxyOptions) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *ServiceProxyOptions) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServiceSpec) DeepCopyInto(out *ServiceSpec) { + *out = *in + if in.Ports != nil { + in, out := &in.Ports, &out.Ports + *out = make([]ServicePort, len(*in)) + copy(*out, *in) + } + if in.Selector != nil { + in, out := &in.Selector, &out.Selector + *out = make(map[string]string, len(*in)) + for key, val := range *in { + (*out)[key] = val + } + } + if in.ExternalIPs != nil { + in, out := &in.ExternalIPs, &out.ExternalIPs + *out = make([]string, len(*in)) + copy(*out, *in) + } + if in.SessionAffinityConfig != nil { + in, out := &in.SessionAffinityConfig, &out.SessionAffinityConfig + if *in == nil { + *out = nil + } else { + *out = new(SessionAffinityConfig) + (*in).DeepCopyInto(*out) + } + } + if in.LoadBalancerSourceRanges != nil { + in, out := &in.LoadBalancerSourceRanges, &out.LoadBalancerSourceRanges + *out = make([]string, len(*in)) + copy(*out, *in) + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServiceSpec. +func (in *ServiceSpec) DeepCopy() *ServiceSpec { + if in == nil { + return nil + } + out := new(ServiceSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *ServiceStatus) DeepCopyInto(out *ServiceStatus) { + *out = *in + in.LoadBalancer.DeepCopyInto(&out.LoadBalancer) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new ServiceStatus. +func (in *ServiceStatus) DeepCopy() *ServiceStatus { + if in == nil { + return nil + } + out := new(ServiceStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *SessionAffinityConfig) DeepCopyInto(out *SessionAffinityConfig) { + *out = *in + if in.ClientIP != nil { + in, out := &in.ClientIP, &out.ClientIP + if *in == nil { + *out = nil + } else { + *out = new(ClientIPConfig) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new SessionAffinityConfig. +func (in *SessionAffinityConfig) DeepCopy() *SessionAffinityConfig { + if in == nil { + return nil + } + out := new(SessionAffinityConfig) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *StorageOSPersistentVolumeSource) DeepCopyInto(out *StorageOSPersistentVolumeSource) { + *out = *in + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(ObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new StorageOSPersistentVolumeSource. +func (in *StorageOSPersistentVolumeSource) DeepCopy() *StorageOSPersistentVolumeSource { + if in == nil { + return nil + } + out := new(StorageOSPersistentVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *StorageOSVolumeSource) DeepCopyInto(out *StorageOSVolumeSource) { + *out = *in + if in.SecretRef != nil { + in, out := &in.SecretRef, &out.SecretRef + if *in == nil { + *out = nil + } else { + *out = new(LocalObjectReference) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new StorageOSVolumeSource. +func (in *StorageOSVolumeSource) DeepCopy() *StorageOSVolumeSource { + if in == nil { + return nil + } + out := new(StorageOSVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Sysctl) DeepCopyInto(out *Sysctl) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Sysctl. +func (in *Sysctl) DeepCopy() *Sysctl { + if in == nil { + return nil + } + out := new(Sysctl) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TCPSocketAction) DeepCopyInto(out *TCPSocketAction) { + *out = *in + out.Port = in.Port + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TCPSocketAction. +func (in *TCPSocketAction) DeepCopy() *TCPSocketAction { + if in == nil { + return nil + } + out := new(TCPSocketAction) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Taint) DeepCopyInto(out *Taint) { + *out = *in + if in.TimeAdded != nil { + in, out := &in.TimeAdded, &out.TimeAdded + if *in == nil { + *out = nil + } else { + *out = (*in).DeepCopy() + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Taint. +func (in *Taint) DeepCopy() *Taint { + if in == nil { + return nil + } + out := new(Taint) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Toleration) DeepCopyInto(out *Toleration) { + *out = *in + if in.TolerationSeconds != nil { + in, out := &in.TolerationSeconds, &out.TolerationSeconds + if *in == nil { + *out = nil + } else { + *out = new(int64) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Toleration. +func (in *Toleration) DeepCopy() *Toleration { + if in == nil { + return nil + } + out := new(Toleration) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Volume) DeepCopyInto(out *Volume) { + *out = *in + in.VolumeSource.DeepCopyInto(&out.VolumeSource) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Volume. +func (in *Volume) DeepCopy() *Volume { + if in == nil { + return nil + } + out := new(Volume) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeDevice) DeepCopyInto(out *VolumeDevice) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeDevice. +func (in *VolumeDevice) DeepCopy() *VolumeDevice { + if in == nil { + return nil + } + out := new(VolumeDevice) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeMount) DeepCopyInto(out *VolumeMount) { + *out = *in + if in.MountPropagation != nil { + in, out := &in.MountPropagation, &out.MountPropagation + if *in == nil { + *out = nil + } else { + *out = new(MountPropagationMode) + **out = **in + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeMount. +func (in *VolumeMount) DeepCopy() *VolumeMount { + if in == nil { + return nil + } + out := new(VolumeMount) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeNodeAffinity) DeepCopyInto(out *VolumeNodeAffinity) { + *out = *in + if in.Required != nil { + in, out := &in.Required, &out.Required + if *in == nil { + *out = nil + } else { + *out = new(NodeSelector) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeNodeAffinity. +func (in *VolumeNodeAffinity) DeepCopy() *VolumeNodeAffinity { + if in == nil { + return nil + } + out := new(VolumeNodeAffinity) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeProjection) DeepCopyInto(out *VolumeProjection) { + *out = *in + if in.Secret != nil { + in, out := &in.Secret, &out.Secret + if *in == nil { + *out = nil + } else { + *out = new(SecretProjection) + (*in).DeepCopyInto(*out) + } + } + if in.DownwardAPI != nil { + in, out := &in.DownwardAPI, &out.DownwardAPI + if *in == nil { + *out = nil + } else { + *out = new(DownwardAPIProjection) + (*in).DeepCopyInto(*out) + } + } + if in.ConfigMap != nil { + in, out := &in.ConfigMap, &out.ConfigMap + if *in == nil { + *out = nil + } else { + *out = new(ConfigMapProjection) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeProjection. +func (in *VolumeProjection) DeepCopy() *VolumeProjection { + if in == nil { + return nil + } + out := new(VolumeProjection) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VolumeSource) DeepCopyInto(out *VolumeSource) { + *out = *in + if in.HostPath != nil { + in, out := &in.HostPath, &out.HostPath + if *in == nil { + *out = nil + } else { + *out = new(HostPathVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.EmptyDir != nil { + in, out := &in.EmptyDir, &out.EmptyDir + if *in == nil { + *out = nil + } else { + *out = new(EmptyDirVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.GCEPersistentDisk != nil { + in, out := &in.GCEPersistentDisk, &out.GCEPersistentDisk + if *in == nil { + *out = nil + } else { + *out = new(GCEPersistentDiskVolumeSource) + **out = **in + } + } + if in.AWSElasticBlockStore != nil { + in, out := &in.AWSElasticBlockStore, &out.AWSElasticBlockStore + if *in == nil { + *out = nil + } else { + *out = new(AWSElasticBlockStoreVolumeSource) + **out = **in + } + } + if in.GitRepo != nil { + in, out := &in.GitRepo, &out.GitRepo + if *in == nil { + *out = nil + } else { + *out = new(GitRepoVolumeSource) + **out = **in + } + } + if in.Secret != nil { + in, out := &in.Secret, &out.Secret + if *in == nil { + *out = nil + } else { + *out = new(SecretVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.NFS != nil { + in, out := &in.NFS, &out.NFS + if *in == nil { + *out = nil + } else { + *out = new(NFSVolumeSource) + **out = **in + } + } + if in.ISCSI != nil { + in, out := &in.ISCSI, &out.ISCSI + if *in == nil { + *out = nil + } else { + *out = new(ISCSIVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Glusterfs != nil { + in, out := &in.Glusterfs, &out.Glusterfs + if *in == nil { + *out = nil + } else { + *out = new(GlusterfsVolumeSource) + **out = **in + } + } + if in.PersistentVolumeClaim != nil { + in, out := &in.PersistentVolumeClaim, &out.PersistentVolumeClaim + if *in == nil { + *out = nil + } else { + *out = new(PersistentVolumeClaimVolumeSource) + **out = **in + } + } + if in.RBD != nil { + in, out := &in.RBD, &out.RBD + if *in == nil { + *out = nil + } else { + *out = new(RBDVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Quobyte != nil { + in, out := &in.Quobyte, &out.Quobyte + if *in == nil { + *out = nil + } else { + *out = new(QuobyteVolumeSource) + **out = **in + } + } + if in.FlexVolume != nil { + in, out := &in.FlexVolume, &out.FlexVolume + if *in == nil { + *out = nil + } else { + *out = new(FlexVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Cinder != nil { + in, out := &in.Cinder, &out.Cinder + if *in == nil { + *out = nil + } else { + *out = new(CinderVolumeSource) + **out = **in + } + } + if in.CephFS != nil { + in, out := &in.CephFS, &out.CephFS + if *in == nil { + *out = nil + } else { + *out = new(CephFSVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.Flocker != nil { + in, out := &in.Flocker, &out.Flocker + if *in == nil { + *out = nil + } else { + *out = new(FlockerVolumeSource) + **out = **in + } + } + if in.DownwardAPI != nil { + in, out := &in.DownwardAPI, &out.DownwardAPI + if *in == nil { + *out = nil + } else { + *out = new(DownwardAPIVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.FC != nil { + in, out := &in.FC, &out.FC + if *in == nil { + *out = nil + } else { + *out = new(FCVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.AzureFile != nil { + in, out := &in.AzureFile, &out.AzureFile + if *in == nil { + *out = nil + } else { + *out = new(AzureFileVolumeSource) + **out = **in + } + } + if in.ConfigMap != nil { + in, out := &in.ConfigMap, &out.ConfigMap + if *in == nil { + *out = nil + } else { + *out = new(ConfigMapVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.VsphereVolume != nil { + in, out := &in.VsphereVolume, &out.VsphereVolume + if *in == nil { + *out = nil + } else { + *out = new(VsphereVirtualDiskVolumeSource) + **out = **in + } + } + if in.AzureDisk != nil { + in, out := &in.AzureDisk, &out.AzureDisk + if *in == nil { + *out = nil + } else { + *out = new(AzureDiskVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.PhotonPersistentDisk != nil { + in, out := &in.PhotonPersistentDisk, &out.PhotonPersistentDisk + if *in == nil { + *out = nil + } else { + *out = new(PhotonPersistentDiskVolumeSource) + **out = **in + } + } + if in.Projected != nil { + in, out := &in.Projected, &out.Projected + if *in == nil { + *out = nil + } else { + *out = new(ProjectedVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.PortworxVolume != nil { + in, out := &in.PortworxVolume, &out.PortworxVolume + if *in == nil { + *out = nil + } else { + *out = new(PortworxVolumeSource) + **out = **in + } + } + if in.ScaleIO != nil { + in, out := &in.ScaleIO, &out.ScaleIO + if *in == nil { + *out = nil + } else { + *out = new(ScaleIOVolumeSource) + (*in).DeepCopyInto(*out) + } + } + if in.StorageOS != nil { + in, out := &in.StorageOS, &out.StorageOS + if *in == nil { + *out = nil + } else { + *out = new(StorageOSVolumeSource) + (*in).DeepCopyInto(*out) + } + } + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VolumeSource. +func (in *VolumeSource) DeepCopy() *VolumeSource { + if in == nil { + return nil + } + out := new(VolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *VsphereVirtualDiskVolumeSource) DeepCopyInto(out *VsphereVirtualDiskVolumeSource) { + *out = *in + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new VsphereVirtualDiskVolumeSource. +func (in *VsphereVirtualDiskVolumeSource) DeepCopy() *VsphereVirtualDiskVolumeSource { + if in == nil { + return nil + } + out := new(VsphereVirtualDiskVolumeSource) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *WeightedPodAffinityTerm) DeepCopyInto(out *WeightedPodAffinityTerm) { + *out = *in + in.PodAffinityTerm.DeepCopyInto(&out.PodAffinityTerm) + return +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new WeightedPodAffinityTerm. +func (in *WeightedPodAffinityTerm) DeepCopy() *WeightedPodAffinityTerm { + if in == nil { + return nil + } + out := new(WeightedPodAffinityTerm) + in.DeepCopyInto(out) + return out +} |