vendor github.com/containers/image/v5@v5.2.0

See release notes:
	https://github.com/containers/image/releases/tag/v5.2.0

Fixes: #4877
Signed-off-by: Valentin Rothberg <rothberg@redhat.com>

36 files changed, 785 insertions, 244 deletions

diff --git a/vendor/github.com/acarl005/stripansi/LICENSE b/vendor/github.com/acarl005/stripansi/LICENSE
new file mode 100644
index 000000000..00abe0dbf
--- /dev/null
+++ b/vendor/github.com/acarl005/stripansi/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2018 Andrew Carlson
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/vendor/github.com/acarl005/stripansi/README.md b/vendor/github.com/acarl005/stripansi/README.md
new file mode 100644
index 000000000..8bdb1f505
--- /dev/null
+++ b/vendor/github.com/acarl005/stripansi/README.md
@@ -0,0 +1,30 @@
+Strip ANSI
+==========
+
+This Go package removes ANSI escape codes from strings.
+
+Ideally, we would prevent these from appearing in any text we want to process.
+However, sometimes this can't be helped, and we need to be able to deal with that noise.
+This will use a regexp to remove those unwanted escape codes.
+
+
+## Install
+
+```sh
+$ go get -u github.com/acarl005/stripansi
+```
+
+## Usage
+
+```go
+import (
+	"fmt"
+	"github.com/acarl005/stripansi"
+)
+
+func main() {
+	msg := "\x1b[38;5;140m foo\x1b[0m bar"
+	cleanMsg := stripansi.Strip(msg)
+	fmt.Println(cleanMsg) // " foo bar"
+}
+```
diff --git a/vendor/github.com/acarl005/stripansi/stripansi.go b/vendor/github.com/acarl005/stripansi/stripansi.go
new file mode 100644
index 000000000..235732a78
--- /dev/null
+++ b/vendor/github.com/acarl005/stripansi/stripansi.go
@@ -0,0 +1,13 @@
+package stripansi
+
+import (
+	"regexp"
+)
+
+const ansi = "[\u001B\u009B][[\\]()#;?]*(?:(?:(?:[a-zA-Z\\d]*(?:;[a-zA-Z\\d]*)*)?\u0007)|(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PRZcf-ntqry=><~]))"
+
+var re = regexp.MustCompile(ansi)
+
+func Strip(str string) string {
+	return re.ReplaceAllString(str, "")
+}
diff --git a/vendor/github.com/containers/image/v5/copy/copy.go b/vendor/github.com/containers/image/v5/copy/copy.go
index 29660b6b2..36957fc77 100644
--- a/vendor/github.com/containers/image/v5/copy/copy.go
+++ b/vendor/github.com/containers/image/v5/copy/copy.go
@@ -709,7 +709,7 @@ func checkImageDestinationForCurrentRuntime(ctx context.Context, sys *types.Syst
 			wantedOS = sys.OSChoice
 		}
 		if wantedOS != c.OS {
-			return fmt.Errorf("Image operating system mismatch: image uses %q, expecting %q", c.OS, wantedOS)
+			logrus.Infof("Image operating system mismatch: image uses %q, expecting %q", c.OS, wantedOS)
 		}
 
 		wantedArch := runtime.GOARCH
@@ -717,7 +717,7 @@ func checkImageDestinationForCurrentRuntime(ctx context.Context, sys *types.Syst
 			wantedArch = sys.ArchitectureChoice
 		}
 		if wantedArch != c.Architecture {
-			return fmt.Errorf("Image architecture mismatch: image uses %q, expecting %q", c.Architecture, wantedArch)
+			logrus.Infof("Image architecture mismatch: image uses %q, expecting %q", c.Architecture, wantedArch)
 		}
 	}
 	return nil
diff --git a/vendor/github.com/containers/image/v5/directory/directory_dest.go b/vendor/github.com/containers/image/v5/directory/directory_dest.go
index caa7a207f..d70b6c07f 100644
--- a/vendor/github.com/containers/image/v5/directory/directory_dest.go
+++ b/vendor/github.com/containers/image/v5/directory/directory_dest.go
@@ -6,6 +6,7 @@ import (
 	"io/ioutil"
 	"os"
 	"path/filepath"
+	"runtime"
 
 	"github.com/containers/image/v5/types"
 	"github.com/opencontainers/go-digest"
@@ -142,8 +143,11 @@ func (d *dirImageDestination) PutBlob(ctx context.Context, stream io.Reader, inp
 		return types.BlobInfo{}, err
 	}
 	succeeded := false
+	explicitClosed := false
 	defer func() {
-		blobFile.Close()
+		if !explicitClosed {
+			blobFile.Close()
+		}
 		if !succeeded {
 			os.Remove(blobFile.Name())
 		}
@@ -164,10 +168,21 @@ func (d *dirImageDestination) PutBlob(ctx context.Context, stream io.Reader, inp
 	if err := blobFile.Sync(); err != nil {
 		return types.BlobInfo{}, err
 	}
-	if err := blobFile.Chmod(0644); err != nil {
-		return types.BlobInfo{}, err
+
+	// On POSIX systems, blobFile was created with mode 0600, so we need to make it readable.
+	// On Windows, the “permissions of newly created files” argument to syscall.Open is
+	// ignored and the file is already readable; besides, blobFile.Chmod, i.e. syscall.Fchmod,
+	// always fails on Windows.
+	if runtime.GOOS != "windows" {
+		if err := blobFile.Chmod(0644); err != nil {
+			return types.BlobInfo{}, err
+		}
 	}
+
 	blobPath := d.ref.layerPath(computedDigest)
+	// need to explicitly close the file, since a rename won't otherwise not work on Windows
+	blobFile.Close()
+	explicitClosed = true
 	if err := os.Rename(blobFile.Name(), blobPath); err != nil {
 		return types.BlobInfo{}, err
 	}
diff --git a/vendor/github.com/containers/image/v5/docker/docker_client.go b/vendor/github.com/containers/image/v5/docker/docker_client.go
index 986bcb986..aa8463d18 100644
--- a/vendor/github.com/containers/image/v5/docker/docker_client.go
+++ b/vendor/github.com/containers/image/v5/docker/docker_client.go
@@ -6,7 +6,6 @@ import (
 	"encoding/json"
 	"fmt"
 	"io"
-	"io/ioutil"
 	"net/http"
 	"net/url"
 	"os"
@@ -17,6 +16,7 @@ import (
 	"time"
 
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/pkg/docker/config"
 	"github.com/containers/image/v5/pkg/sysregistriesv2"
 	"github.com/containers/image/v5/pkg/tlsclientconfig"
@@ -45,6 +45,10 @@ const (
 
 	extensionSignatureSchemaVersion = 2        // extensionSignature.Version
 	extensionSignatureTypeAtomic    = "atomic" // extensionSignature.Type
+
+	backoffNumIterations = 5
+	backoffInitialDelay  = 2 * time.Second
+	backoffMaxDelay      = 60 * time.Second
 )
 
 var systemPerHostCertDirPaths = [2]string{"/etc/containers/certs.d", "/etc/docker/certs.d"}
@@ -277,7 +281,7 @@ func CheckAuth(ctx context.Context, sys *types.SystemContext, username, password
 	}
 	defer resp.Body.Close()
 
-	return httpResponseToError(resp)
+	return httpResponseToError(resp, "")
 }
 
 // SearchResult holds the information of each matching image
@@ -351,7 +355,7 @@ func SearchRegistry(ctx context.Context, sys *types.SystemContext, registry, ima
 		} else {
 			defer resp.Body.Close()
 			if resp.StatusCode != http.StatusOK {
-				logrus.Debugf("error getting search results from v1 endpoint %q: %v", registry, httpResponseToError(resp))
+				logrus.Debugf("error getting search results from v1 endpoint %q: %v", registry, httpResponseToError(resp, ""))
 			} else {
 				if err := json.NewDecoder(resp.Body).Decode(v1Res); err != nil {
 					return nil, err
@@ -368,7 +372,7 @@ func SearchRegistry(ctx context.Context, sys *types.SystemContext, registry, ima
 	} else {
 		defer resp.Body.Close()
 		if resp.StatusCode != http.StatusOK {
-			logrus.Errorf("error getting search results from v2 endpoint %q: %v", registry, httpResponseToError(resp))
+			logrus.Errorf("error getting search results from v2 endpoint %q: %v", registry, httpResponseToError(resp, ""))
 		} else {
 			if err := json.NewDecoder(resp.Body).Decode(v2Res); err != nil {
 				return nil, err
@@ -400,74 +404,64 @@ func (c *dockerClient) makeRequest(ctx context.Context, method, path string, hea
 	return c.makeRequestToResolvedURL(ctx, method, url, headers, stream, -1, auth, extraScope)
 }
 
+// parseRetryAfter determines the delay required by the "Retry-After" header in res and returns it,
+// silently falling back to fallbackDelay if the header is missing or invalid.
+func parseRetryAfter(res *http.Response, fallbackDelay time.Duration) time.Duration {
+	after := res.Header.Get("Retry-After")
+	if after == "" {
+		return fallbackDelay
+	}
+	logrus.Debugf("Detected 'Retry-After' header %q", after)
+	// First, check if we have a numerical value.
+	if num, err := strconv.ParseInt(after, 10, 64); err == nil {
+		return time.Duration(num) * time.Second
+	}
+	// Second, check if we have an HTTP date.
+	// If the delta between the date and now is positive, use it.
+	// Otherwise, fall back to using the default exponential back off.
+	if t, err := http.ParseTime(after); err == nil {
+		delta := time.Until(t)
+		if delta > 0 {
+			return delta
+		}
+		logrus.Debugf("Retry-After date in the past, ignoring it")
+		return fallbackDelay
+	}
+	// If the header contents are bogus, fall back to using the default exponential back off.
+	logrus.Debugf("Invalid Retry-After format, ignoring it")
+	return fallbackDelay
+}
+
 // makeRequestToResolvedURL creates and executes a http.Request with the specified parameters, adding authentication and TLS options for the Docker client.
 // streamLen, if not -1, specifies the length of the data expected on stream.
 // makeRequest should generally be preferred.
-// In case of an http 429 status code in the response, it performs an exponential back off starting at 2 seconds for at most 5 iterations.
-// If the `Retry-After` header is set in the response, the specified value or date is
-// If the stream is non-nil, no back off will be performed.
+// In case of an HTTP 429 status code in the response, it may automatically retry a few times.
 // TODO(runcom): too many arguments here, use a struct
 func (c *dockerClient) makeRequestToResolvedURL(ctx context.Context, method, url string, headers map[string][]string, stream io.Reader, streamLen int64, auth sendAuth, extraScope *authScope) (*http.Response, error) {
-	var (
-		res   *http.Response
-		err   error
-		delay int64
-	)
-	delay = 2
-	const numIterations = 5
-	const maxDelay = 60
-
-	// math.Min() only supports float64, so have an anonymous func to avoid
-	// casting.
-	min := func(a int64, b int64) int64 {
-		if a < b {
-			return a
+	delay := backoffInitialDelay
+	attempts := 0
+	for {
+		res, err := c.makeRequestToResolvedURLOnce(ctx, method, url, headers, stream, streamLen, auth, extraScope)
+		attempts++
+		if res == nil || res.StatusCode != http.StatusTooManyRequests || // Only retry on StatusTooManyRequests, success or other failure is returned to caller immediately
+			stream != nil || // We can't retry with a body (which is not restartable in the general case)
+			attempts == backoffNumIterations {
+			return res, err
 		}
-		return b
-	}
 
-	nextDelay := func(r *http.Response, delay int64) int64 {
-		after := res.Header.Get("Retry-After")
-		if after == "" {
-			return min(delay, maxDelay)
-		}
-		logrus.Debugf("detected 'Retry-After' header %q", after)
-		// First check if we have a numerical value.
-		if num, err := strconv.ParseInt(after, 10, 64); err == nil {
-			return min(num, maxDelay)
+		delay = parseRetryAfter(res, delay)
+		if delay > backoffMaxDelay {
+			delay = backoffMaxDelay
 		}
-		// Secondly check if we have an http date.
-		// If the delta between the date and now is positive, use it.
-		// Otherwise, fall back to using the default exponential back off.
-		if t, err := http.ParseTime(after); err == nil {
-			delta := int64(time.Until(t).Seconds())
-			if delta > 0 {
-				return min(delta, maxDelay)
-			}
-			logrus.Debugf("negative date: falling back to using %d seconds", delay)
-			return min(delay, maxDelay)
+		logrus.Debugf("Too many requests to %s: sleeping for %f seconds before next attempt", url, delay.Seconds())
+		select {
+		case <-ctx.Done():
+			return nil, ctx.Err()
+		case <-time.After(delay):
+			// Nothing
 		}
-		// If the header contains bogus, fall back to using the default
-		// exponential back off.
-		logrus.Debugf("invalid format: falling back to using %d seconds", delay)
-		return min(delay, maxDelay)
-	}
-
-	for i := 0; i < numIterations; i++ {
-		res, err = c.makeRequestToResolvedURLOnce(ctx, method, url, headers, stream, streamLen, auth, extraScope)
-		if stream == nil && res != nil && res.StatusCode == http.StatusTooManyRequests {
-			if i < numIterations-1 {
-				logrus.Errorf("HEADER %v", res.Header)
-				delay = nextDelay(res, delay) // compute next delay - does NOT exceed maxDelay
-				logrus.Debugf("too many request to %s: sleeping for %d seconds before next attempt", url, delay)
-				time.Sleep(time.Duration(delay) * time.Second)
-				delay = delay * 2 // exponential back off
-			}
-			continue
-		}
-		break
+		delay = delay * 2 // exponential back off
 	}
-	return res, err
 }
 
 // makeRequestToResolvedURLOnce creates and executes a http.Request with the specified parameters, adding authentication and TLS options for the Docker client.
@@ -597,7 +591,7 @@ func (c *dockerClient) getBearerToken(ctx context.Context, challenge challenge,
 	default:
 		return nil, errors.Errorf("unexpected http code: %d (%s), URL: %s", res.StatusCode, http.StatusText(res.StatusCode), authReq.URL)
 	}
-	tokenBlob, err := ioutil.ReadAll(res.Body)
+	tokenBlob, err := iolimits.ReadAtMost(res.Body, iolimits.MaxAuthTokenBodySize)
 	if err != nil {
 		return nil, err
 	}
@@ -627,7 +621,7 @@ func (c *dockerClient) detectPropertiesHelper(ctx context.Context) error {
 		defer resp.Body.Close()
 		logrus.Debugf("Ping %s status %d", url, resp.StatusCode)
 		if resp.StatusCode != http.StatusOK && resp.StatusCode != http.StatusUnauthorized {
-			return httpResponseToError(resp)
+			return httpResponseToError(resp, "")
 		}
 		c.challenges = parseAuthHeader(resp.Header)
 		c.scheme = scheme
@@ -690,7 +684,7 @@ func (c *dockerClient) getExtensionsSignatures(ctx context.Context, ref dockerRe
 		return nil, errors.Wrapf(clientLib.HandleErrorResponse(res), "Error downloading signatures for %s in %s", manifestDigest, ref.ref.Name())
 	}
 
-	body, err := ioutil.ReadAll(res.Body)
+	body, err := iolimits.ReadAtMost(res.Body, iolimits.MaxSignatureListBodySize)
 	if err != nil {
 		return nil, err
 	}
diff --git a/vendor/github.com/containers/image/v5/docker/docker_image.go b/vendor/github.com/containers/image/v5/docker/docker_image.go
index dad382cd0..483581dbc 100644
--- a/vendor/github.com/containers/image/v5/docker/docker_image.go
+++ b/vendor/github.com/containers/image/v5/docker/docker_image.go
@@ -70,7 +70,7 @@ func GetRepositoryTags(ctx context.Context, sys *types.SystemContext, ref types.
 			return nil, err
 		}
 		defer res.Body.Close()
-		if err := httpResponseToError(res); err != nil {
+		if err := httpResponseToError(res, "Error fetching tags list"); err != nil {
 			return nil, err
 		}
 
diff --git a/vendor/github.com/containers/image/v5/docker/docker_image_dest.go b/vendor/github.com/containers/image/v5/docker/docker_image_dest.go
index 47a73d868..ab74e1607 100644
--- a/vendor/github.com/containers/image/v5/docker/docker_image_dest.go
+++ b/vendor/github.com/containers/image/v5/docker/docker_image_dest.go
@@ -15,6 +15,7 @@ import (
 	"strings"
 
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/pkg/blobinfocache/none"
 	"github.com/containers/image/v5/types"
@@ -58,14 +59,16 @@ func (d *dockerImageDestination) Close() error {
 }
 
 func (d *dockerImageDestination) SupportedManifestMIMETypes() []string {
-	return []string{
+	mimeTypes := []string{
 		imgspecv1.MediaTypeImageManifest,
 		manifest.DockerV2Schema2MediaType,
 		imgspecv1.MediaTypeImageIndex,
 		manifest.DockerV2ListMediaType,
-		manifest.DockerV2Schema1SignedMediaType,
-		manifest.DockerV2Schema1MediaType,
 	}
+	if d.c.sys == nil || !d.c.sys.DockerDisableDestSchema1MIMETypes {
+		mimeTypes = append(mimeTypes, manifest.DockerV2Schema1SignedMediaType, manifest.DockerV2Schema1MediaType)
+	}
+	return mimeTypes
 }
 
 // SupportsSignatures returns an error (to be displayed to the user) if the destination certainly can't store signatures.
@@ -620,7 +623,7 @@ sigExists:
 		}
 		defer res.Body.Close()
 		if res.StatusCode != http.StatusCreated {
-			body, err := ioutil.ReadAll(res.Body)
+			body, err := iolimits.ReadAtMost(res.Body, iolimits.MaxErrorBodySize)
 			if err == nil {
 				logrus.Debugf("Error body %s", string(body))
 			}
diff --git a/vendor/github.com/containers/image/v5/docker/docker_image_src.go b/vendor/github.com/containers/image/v5/docker/docker_image_src.go
index 35beb30e5..967845e72 100644
--- a/vendor/github.com/containers/image/v5/docker/docker_image_src.go
+++ b/vendor/github.com/containers/image/v5/docker/docker_image_src.go
@@ -10,8 +10,10 @@ import (
 	"net/url"
 	"os"
 	"strconv"
+	"strings"
 
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/pkg/sysregistriesv2"
 	"github.com/containers/image/v5/types"
@@ -53,43 +55,77 @@ func newImageSource(ctx context.Context, sys *types.SystemContext, ref dockerRef
 	// non-mirror original location last; this both transparently handles the case
 	// of no mirrors configured, and ensures we return the error encountered when
 	// acessing the upstream location if all endpoints fail.
-	manifestLoadErr := errors.New("Internal error: newImageSource returned without trying any endpoint")
 	pullSources, err := registry.PullSourcesFromReference(ref.ref)
 	if err != nil {
 		return nil, err
 	}
+	type attempt struct {
+		ref reference.Named
+		err error
+	}
+	attempts := []attempt{}
 	for _, pullSource := range pullSources {
-		logrus.Debugf("Trying to pull %q", pullSource.Reference)
-		dockerRef, err := newReference(pullSource.Reference)
-		if err != nil {
-			return nil, err
+		logrus.Debugf("Trying to access %q", pullSource.Reference)
+		s, err := newImageSourceAttempt(ctx, sys, pullSource, primaryDomain)
+		if err == nil {
+			return s, nil
 		}
-
-		endpointSys := sys
-		// sys.DockerAuthConfig does not explicitly specify a registry; we must not blindly send the credentials intended for the primary endpoint to mirrors.
-		if endpointSys != nil && endpointSys.DockerAuthConfig != nil && reference.Domain(dockerRef.ref) != primaryDomain {
-			copy := *endpointSys
-			copy.DockerAuthConfig = nil
-			endpointSys = &copy
+		logrus.Debugf("Accessing %q failed: %v", pullSource.Reference, err)
+		attempts = append(attempts, attempt{
+			ref: pullSource.Reference,
+			err: err,
+		})
+	}
+	switch len(attempts) {
+	case 0:
+		return nil, errors.New("Internal error: newImageSource returned without trying any endpoint")
+	case 1:
+		return nil, attempts[0].err // If no mirrors are used, perfectly preserve the error type and add no noise.
+	default:
+		// Don’t just build a string, try to preserve the typed error.
+		primary := &attempts[len(attempts)-1]
+		extras := []string{}
+		for i := 0; i < len(attempts)-1; i++ {
+			// This is difficult to fit into a single-line string, when the error can contain arbitrary strings including any metacharacters we decide to use.
+			// The paired [] at least have some chance of being unambiguous.
+			extras = append(extras, fmt.Sprintf("[%s: %v]", attempts[i].ref.String(), attempts[i].err))
 		}
+		return nil, errors.Wrapf(primary.err, "(Mirrors also failed: %s): %s", strings.Join(extras, "\n"), primary.ref.String())
+	}
+}
 
-		client, err := newDockerClientFromRef(endpointSys, dockerRef, false, "pull")
-		if err != nil {
-			return nil, err
-		}
-		client.tlsClientConfig.InsecureSkipVerify = pullSource.Endpoint.Insecure
+// newImageSourceAttempt is an internal helper for newImageSource. Everyone else must call newImageSource.
+// Given a pullSource and primaryDomain, return a dockerImageSource if it is reachable.
+// The caller must call .Close() on the returned ImageSource.
+func newImageSourceAttempt(ctx context.Context, sys *types.SystemContext, pullSource sysregistriesv2.PullSource, primaryDomain string) (*dockerImageSource, error) {
+	ref, err := newReference(pullSource.Reference)
+	if err != nil {
+		return nil, err
+	}
 
-		testImageSource := &dockerImageSource{
-			ref: dockerRef,
-			c:   client,
-		}
+	endpointSys := sys
+	// sys.DockerAuthConfig does not explicitly specify a registry; we must not blindly send the credentials intended for the primary endpoint to mirrors.
+	if endpointSys != nil && endpointSys.DockerAuthConfig != nil && reference.Domain(ref.ref) != primaryDomain {
+		copy := *endpointSys
+		copy.DockerAuthConfig = nil
+		endpointSys = &copy
+	}
 
-		manifestLoadErr = testImageSource.ensureManifestIsLoaded(ctx)
-		if manifestLoadErr == nil {
-			return testImageSource, nil
-		}
+	client, err := newDockerClientFromRef(endpointSys, ref, false, "pull")
+	if err != nil {
+		return nil, err
 	}
-	return nil, manifestLoadErr
+	client.tlsClientConfig.InsecureSkipVerify = pullSource.Endpoint.Insecure
+
+	s := &dockerImageSource{
+		ref: ref,
+		c:   client,
+	}
+
+	if err := s.ensureManifestIsLoaded(ctx); err != nil {
+		return nil, err
+	}
+	return s, nil
 }
 
 // Reference returns the reference used to set up this source, _as specified by the user_
@@ -156,7 +192,8 @@ func (s *dockerImageSource) fetchManifest(ctx context.Context, tagOrDigest strin
 	if res.StatusCode != http.StatusOK {
 		return nil, "", errors.Wrapf(client.HandleErrorResponse(res), "Error reading manifest %s in %s", tagOrDigest, s.ref.ref.Name())
 	}
-	manblob, err := ioutil.ReadAll(res.Body)
+
+	manblob, err := iolimits.ReadAtMost(res.Body, iolimits.MaxManifestBodySize)
 	if err != nil {
 		return nil, "", err
 	}
@@ -239,7 +276,7 @@ func (s *dockerImageSource) GetBlob(ctx context.Context, info types.BlobInfo, ca
 	if err != nil {
 		return nil, 0, err
 	}
-	if err := httpResponseToError(res); err != nil {
+	if err := httpResponseToError(res, "Error fetching blob"); err != nil {
 		return nil, 0, err
 	}
 	cache.RecordKnownLocation(s.ref.Transport(), bicTransportScope(s.ref), info.Digest, newBICLocationReference(s.ref))
@@ -342,7 +379,7 @@ func (s *dockerImageSource) getOneSignature(ctx context.Context, url *url.URL) (
 		} else if res.StatusCode != http.StatusOK {
 			return nil, false, errors.Errorf("Error reading signature from %s: status %d (%s)", url.String(), res.StatusCode, http.StatusText(res.StatusCode))
 		}
-		sig, err := ioutil.ReadAll(res.Body)
+		sig, err := iolimits.ReadAtMost(res.Body, iolimits.MaxSignatureBodySize)
 		if err != nil {
 			return nil, false, err
 		}
@@ -401,7 +438,7 @@ func deleteImage(ctx context.Context, sys *types.SystemContext, ref dockerRefere
 		return err
 	}
 	defer get.Body.Close()
-	manifestBody, err := ioutil.ReadAll(get.Body)
+	manifestBody, err := iolimits.ReadAtMost(get.Body, iolimits.MaxManifestBodySize)
 	if err != nil {
 		return err
 	}
@@ -424,7 +461,7 @@ func deleteImage(ctx context.Context, sys *types.SystemContext, ref dockerRefere
 	}
 	defer delete.Body.Close()
 
-	body, err := ioutil.ReadAll(delete.Body)
+	body, err := iolimits.ReadAtMost(delete.Body, iolimits.MaxErrorBodySize)
 	if err != nil {
 		return err
 	}
diff --git a/vendor/github.com/containers/image/v5/docker/errors.go b/vendor/github.com/containers/image/v5/docker/errors.go
index 860868f41..f626cc7da 100644
--- a/vendor/github.com/containers/image/v5/docker/errors.go
+++ b/vendor/github.com/containers/image/v5/docker/errors.go
@@ -14,7 +14,7 @@ var (
 	// docker V1 registry.
 	ErrV1NotSupported = errors.New("can't talk to a V1 docker registry")
 	// ErrTooManyRequests is returned when the status code returned is 429
-	ErrTooManyRequests = errors.New("too many request to registry")
+	ErrTooManyRequests = errors.New("too many requests to registry")
 )
 
 // ErrUnauthorizedForCredentials is returned when the status code returned is 401
@@ -26,9 +26,9 @@ func (e ErrUnauthorizedForCredentials) Error() string {
 	return fmt.Sprintf("unable to retrieve auth token: invalid username/password: %s", e.Err.Error())
 }
 
-// httpResponseToError translates the https.Response into an error. It returns
+// httpResponseToError translates the https.Response into an error, possibly prefixing it with the supplied context. It returns
 // nil if the response is not considered an error.
-func httpResponseToError(res *http.Response) error {
+func httpResponseToError(res *http.Response, context string) error {
 	switch res.StatusCode {
 	case http.StatusOK:
 		return nil
@@ -38,6 +38,9 @@ func httpResponseToError(res *http.Response) error {
 		err := client.HandleErrorResponse(res)
 		return ErrUnauthorizedForCredentials{Err: err}
 	default:
-		return perrors.Errorf("invalid status code from registry %d (%s)", res.StatusCode, http.StatusText(res.StatusCode))
+		if context != "" {
+			context = context + ": "
+		}
+		return perrors.Errorf("%sinvalid status code from registry %d (%s)", context, res.StatusCode, http.StatusText(res.StatusCode))
 	}
 }
diff --git a/vendor/github.com/containers/image/v5/docker/tarfile/dest.go b/vendor/github.com/containers/image/v5/docker/tarfile/dest.go
index c322156b5..c171da505 100644
--- a/vendor/github.com/containers/image/v5/docker/tarfile/dest.go
+++ b/vendor/github.com/containers/image/v5/docker/tarfile/dest.go
@@ -13,6 +13,7 @@ import (
 	"time"
 
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/internal/tmpdir"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/types"
@@ -143,7 +144,7 @@ func (d *Destination) PutBlob(ctx context.Context, stream io.Reader, inputInfo t
 	}
 
 	if isConfig {
-		buf, err := ioutil.ReadAll(stream)
+		buf, err := iolimits.ReadAtMost(stream, iolimits.MaxConfigBodySize)
 		if err != nil {
 			return types.BlobInfo{}, errors.Wrap(err, "Error reading Config file stream")
 		}
diff --git a/vendor/github.com/containers/image/v5/docker/tarfile/src.go b/vendor/github.com/containers/image/v5/docker/tarfile/src.go
index 80dd753e4..c1f1a0f27 100644
--- a/vendor/github.com/containers/image/v5/docker/tarfile/src.go
+++ b/vendor/github.com/containers/image/v5/docker/tarfile/src.go
@@ -11,6 +11,7 @@ import (
 	"path"
 	"sync"
 
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/internal/tmpdir"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/pkg/compression"
@@ -203,13 +204,13 @@ func findTarComponent(inputFile io.Reader, path string) (*tar.Reader, *tar.Heade
 }
 
 // readTarComponent returns full contents of componentPath.
-func (s *Source) readTarComponent(path string) ([]byte, error) {
+func (s *Source) readTarComponent(path string, limit int) ([]byte, error) {
 	file, err := s.openTarComponent(path)
 	if err != nil {
 		return nil, errors.Wrapf(err, "Error loading tar component %s", path)
 	}
 	defer file.Close()
-	bytes, err := ioutil.ReadAll(file)
+	bytes, err := iolimits.ReadAtMost(file, limit)
 	if err != nil {
 		return nil, err
 	}
@@ -240,7 +241,7 @@ func (s *Source) ensureCachedDataIsPresentPrivate() error {
 	}
 
 	// Read and parse config.
-	configBytes, err := s.readTarComponent(tarManifest[0].Config)
+	configBytes, err := s.readTarComponent(tarManifest[0].Config, iolimits.MaxConfigBodySize)
 	if err != nil {
 		return err
 	}
@@ -266,7 +267,7 @@ func (s *Source) ensureCachedDataIsPresentPrivate() error {
 // loadTarManifest loads and decodes the manifest.json.
 func (s *Source) loadTarManifest() ([]ManifestItem, error) {
 	// FIXME? Do we need to deal with the legacy format?
-	bytes, err := s.readTarComponent(manifestFileName)
+	bytes, err := s.readTarComponent(manifestFileName, iolimits.MaxTarFileManifestSize)
 	if err != nil {
 		return nil, err
 	}
diff --git a/vendor/github.com/containers/image/v5/image/docker_schema2.go b/vendor/github.com/containers/image/v5/image/docker_schema2.go
index 7891562b7..1e2114d7e 100644
--- a/vendor/github.com/containers/image/v5/image/docker_schema2.go
+++ b/vendor/github.com/containers/image/v5/image/docker_schema2.go
@@ -7,10 +7,10 @@ import (
 	"encoding/hex"
 	"encoding/json"
 	"fmt"
-	"io/ioutil"
 	"strings"
 
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/pkg/blobinfocache/none"
 	"github.com/containers/image/v5/types"
@@ -102,7 +102,7 @@ func (m *manifestSchema2) ConfigBlob(ctx context.Context) ([]byte, error) {
 			return nil, err
 		}
 		defer stream.Close()
-		blob, err := ioutil.ReadAll(stream)
+		blob, err := iolimits.ReadAtMost(stream, iolimits.MaxConfigBodySize)
 		if err != nil {
 			return nil, err
 		}
diff --git a/vendor/github.com/containers/image/v5/image/oci.go b/vendor/github.com/containers/image/v5/image/oci.go
index 059d84977..b5ddb9aaa 100644
--- a/vendor/github.com/containers/image/v5/image/oci.go
+++ b/vendor/github.com/containers/image/v5/image/oci.go
@@ -4,9 +4,9 @@ import (
 	"context"
 	"encoding/json"
 	"fmt"
-	"io/ioutil"
 
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/pkg/blobinfocache/none"
 	"github.com/containers/image/v5/types"
@@ -67,7 +67,7 @@ func (m *manifestOCI1) ConfigBlob(ctx context.Context) ([]byte, error) {
 			return nil, err
 		}
 		defer stream.Close()
-		blob, err := ioutil.ReadAll(stream)
+		blob, err := iolimits.ReadAtMost(stream, iolimits.MaxConfigBodySize)
 		if err != nil {
 			return nil, err
 		}
diff --git a/vendor/github.com/containers/image/v5/internal/iolimits/iolimits.go b/vendor/github.com/containers/image/v5/internal/iolimits/iolimits.go
new file mode 100644
index 000000000..3fed1995c
--- /dev/null
+++ b/vendor/github.com/containers/image/v5/internal/iolimits/iolimits.go
@@ -0,0 +1,60 @@
+package iolimits
+
+import (
+	"io"
+	"io/ioutil"
+
+	"github.com/pkg/errors"
+)
+
+// All constants below are intended to be used as limits for `ReadAtMost`. The
+// immediate use-case for limiting the size of in-memory copied data is to
+// protect against OOM DOS attacks as described inCVE-2020-1702. Instead of
+// copying data until running out of memory, we error out after hitting the
+// specified limit.
+const (
+	// megaByte denotes one megabyte and is intended to be used as a limit in
+	// `ReadAtMost`.
+	megaByte = 1 << 20
+	// MaxManifestBodySize is the maximum allowed size of a manifest. The limit
+	// of 4 MB aligns with the one of a Docker registry:
+	// https://github.com/docker/distribution/blob/a8371794149d1d95f1e846744b05c87f2f825e5a/registry/handlers/manifests.go#L30
+	MaxManifestBodySize = 4 * megaByte
+	// MaxAuthTokenBodySize is the maximum allowed size of an auth token.
+	// The limit of 1 MB is considered to be greatly sufficient.
+	MaxAuthTokenBodySize = megaByte
+	// MaxSignatureListBodySize is the maximum allowed size of a signature list.
+	// The limit of 4 MB is considered to be greatly sufficient.
+	MaxSignatureListBodySize = 4 * megaByte
+	// MaxSignatureBodySize is the maximum allowed size of a signature.
+	// The limit of 4 MB is considered to be greatly sufficient.
+	MaxSignatureBodySize = 4 * megaByte
+	// MaxErrorBodySize is the maximum allowed size of an error-response body.
+	// The limit of 1 MB is considered to be greatly sufficient.
+	MaxErrorBodySize = megaByte
+	// MaxConfigBodySize is the maximum allowed size of a config blob.
+	// The limit of 4 MB is considered to be greatly sufficient.
+	MaxConfigBodySize = 4 * megaByte
+	// MaxOpenShiftStatusBody is the maximum allowed size of an OpenShift status body.
+	// The limit of 4 MB is considered to be greatly sufficient.
+	MaxOpenShiftStatusBody = 4 * megaByte
+	// MaxTarFileManifestSize is the maximum allowed size of a (docker save)-like manifest (which may contain multiple images)
+	// The limit of 1 MB is considered to be greatly sufficient.
+	MaxTarFileManifestSize = megaByte
+)
+
+// ReadAtMost reads from reader and errors out if the specified limit (in bytes) is exceeded.
+func ReadAtMost(reader io.Reader, limit int) ([]byte, error) {
+	limitedReader := io.LimitReader(reader, int64(limit+1))
+
+	res, err := ioutil.ReadAll(limitedReader)
+	if err != nil {
+		return nil, err
+	}
+
+	if len(res) > limit {
+		return nil, errors.Errorf("exceeded maximum allowed size of %d bytes", limit)
+	}
+
+	return res, nil
+}
diff --git a/vendor/github.com/containers/image/v5/openshift/openshift.go b/vendor/github.com/containers/image/v5/openshift/openshift.go
index b9242da6e..28bfc456d 100644
--- a/vendor/github.com/containers/image/v5/openshift/openshift.go
+++ b/vendor/github.com/containers/image/v5/openshift/openshift.go
@@ -7,13 +7,13 @@ import (
 	"encoding/json"
 	"fmt"
 	"io"
-	"io/ioutil"
 	"net/http"
 	"net/url"
 	"strings"
 
 	"github.com/containers/image/v5/docker"
 	"github.com/containers/image/v5/docker/reference"
+	"github.com/containers/image/v5/internal/iolimits"
 	"github.com/containers/image/v5/manifest"
 	"github.com/containers/image/v5/types"
 	"github.com/containers/image/v5/version"
@@ -102,7 +102,7 @@ func (c *openshiftClient) doRequest(ctx context.Context, method, path string, re
 		return nil, err
 	}
 	defer res.Body.Close()
-	body, err := ioutil.ReadAll(res.Body)
+	body, err := iolimits.ReadAtMost(res.Body, iolimits.MaxOpenShiftStatusBody)
 	if err != nil {
 		return nil, err
 	}
diff --git a/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go b/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go
index 4825ab27c..277fba16b 100644
--- a/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go
+++ b/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go
@@ -139,7 +139,7 @@ func (m *gpgmeSigningMechanism) Sign(input []byte, keyIdentity string) ([]byte,
 }
 
 // Verify parses unverifiedSignature and returns the content and the signer's identity
-func (m gpgmeSigningMechanism) Verify(unverifiedSignature []byte) (contents []byte, keyIdentity string, err error) {
+func (m *gpgmeSigningMechanism) Verify(unverifiedSignature []byte) (contents []byte, keyIdentity string, err error) {
 	signedBuffer := bytes.Buffer{}
 	signedData, err := gpgme.NewDataWriter(&signedBuffer)
 	if err != nil {
@@ -170,6 +170,6 @@ func (m gpgmeSigningMechanism) Verify(unverifiedSignature []byte) (contents []by
 // WARNING: The short key identifier (which correponds to "Key ID" for OpenPGP keys)
 // is NOT the same as a "key identity" used in other calls ot this interface, and
 // the values may have no recognizable relationship if the public key is not available.
-func (m gpgmeSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) {
+func (m *gpgmeSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) {
 	return gpgUntrustedSignatureContents(untrustedSignature)
 }
diff --git a/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go b/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go
index eccd610c9..51f20f310 100644
--- a/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go
+++ b/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go
@@ -154,6 +154,6 @@ func (m *openpgpSigningMechanism) Verify(unverifiedSignature []byte) (contents [
 // WARNING: The short key identifier (which correponds to "Key ID" for OpenPGP keys)
 // is NOT the same as a "key identity" used in other calls ot this interface, and
 // the values may have no recognizable relationship if the public key is not available.
-func (m openpgpSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) {
+func (m *openpgpSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) {
 	return gpgUntrustedSignatureContents(untrustedSignature)
 }
diff --git a/vendor/github.com/containers/image/v5/types/types.go b/vendor/github.com/containers/image/v5/types/types.go
index d38a17fab..ba249ca25 100644
--- a/vendor/github.com/containers/image/v5/types/types.go
+++ b/vendor/github.com/containers/image/v5/types/types.go
@@ -547,6 +547,8 @@ type SystemContext struct {
 	// Note that this field is used mainly to integrate containers/image into projectatomic/docker
 	// in order to not break any existing docker's integration tests.
 	DockerDisableV1Ping bool
+	// If true, dockerImageDestination.SupportedManifestMIMETypes will omit the Schema1 media types from the supported list
+	DockerDisableDestSchema1MIMETypes bool
 	// Directory to use for OSTree temporary files
 	OSTreeTmpDirPath string
 
diff --git a/vendor/github.com/containers/image/v5/version/version.go b/vendor/github.com/containers/image/v5/version/version.go
index a92774466..1a44baf99 100644
--- a/vendor/github.com/containers/image/v5/version/version.go
+++ b/vendor/github.com/containers/image/v5/version/version.go
@@ -6,7 +6,7 @@ const (
 	// VersionMajor is for an API incompatible changes
 	VersionMajor = 5
 	// VersionMinor is for functionality in a backwards-compatible manner
-	VersionMinor = 1
+	VersionMinor = 2
 	// VersionPatch is for backwards-compatible bug fixes
 	VersionPatch = 0
 
diff --git a/vendor/github.com/mtrmac/gpgme/.appveyor.yml b/vendor/github.com/mtrmac/gpgme/.appveyor.yml
new file mode 100644
index 000000000..2fdc09ab5
--- /dev/null
+++ b/vendor/github.com/mtrmac/gpgme/.appveyor.yml
@@ -0,0 +1,40 @@
+---
+version: 0.{build}
+platform: x86
+branches:
+  only:
+    - master
+
+clone_folder: c:\gopath\src\github.com\proglottis\gpgme
+
+environment:   
+  GOPATH: c:\gopath
+  GOROOT: C:\go-x86
+  CGO_LDFLAGS: -LC:\gpg\lib
+  CGO_CFLAGS: -IC:\gpg\include
+  GPG_DIR: C:\gpg
+
+install:
+  - nuget install 7ZipCLI -ExcludeVersion
+  - set PATH=%appveyor_build_folder%\7ZipCLI\tools;%PATH%
+  - appveyor DownloadFile https://www.gnupg.org/ftp/gcrypt/binary/gnupg-w32-2.1.20_20170403.exe -FileName gnupg-w32-2.1.20_20170403.exe
+  - 7z x -o%GPG_DIR% gnupg-w32-2.1.20_20170403.exe
+  - copy "%GPG_DIR%\lib\libgpg-error.imp" "%GPG_DIR%\lib\libgpg-error.a"
+  - copy "%GPG_DIR%\lib\libassuan.imp" "%GPG_DIR%\lib\libassuan.a"
+  - copy "%GPG_DIR%\lib\libgpgme.imp" "%GPG_DIR%\lib\libgpgme.a"
+  - set PATH=%GOPATH%\bin;%GOROOT%\bin;%GPG_DIR%\bin;C:\MinGW\bin;%PATH%
+  - C:\cygwin\bin\sed -i 's/"GPG_AGENT_INFO"/"GPG_AGENT_INFO="/;s/C.unsetenv(v)/C.putenv(v)/' %APPVEYOR_BUILD_FOLDER%\gpgme.go
+
+test_script:
+  - go test -v github.com/proglottis/gpgme
+
+
+build_script:
+  - go build -o example_decrypt.exe -i %APPVEYOR_BUILD_FOLDER%\examples\decrypt.go
+  - go build -o example_encrypt.exe -i %APPVEYOR_BUILD_FOLDER%\examples\encrypt.go
+
+artifacts:
+  - path: example_decrypt.exe
+    name: decrypt example binary
+  - path: example_encrypt.exe
+    name: encrypt example binary
\ No newline at end of file
diff --git a/vendor/github.com/mtrmac/gpgme/.travis.yml b/vendor/github.com/mtrmac/gpgme/.travis.yml
new file mode 100644
index 000000000..619e33721
--- /dev/null
+++ b/vendor/github.com/mtrmac/gpgme/.travis.yml
@@ -0,0 +1,32 @@
+---
+language: go
+os:
+  - linux
+  - osx
+  - windows
+dist: xenial
+sudo: false
+
+go:
+  - 1.11
+  - 1.12
+  - 1.13
+
+addons:
+  apt:
+    packages:
+    - libgpgme11-dev
+  homebrew:
+    packages:
+    - gnupg
+    - gnupg@1.4
+    - gpgme
+    update: true
+
+matrix:
+  allow_failures:
+    - os: windows
+
+before_install:
+  - if [[ "$TRAVIS_OS_NAME" == "windows" ]]; then choco install msys2; fi
+  - if [[ "$TRAVIS_OS_NAME" == "windows" ]]; then choco install gpg4win; fi
diff --git a/vendor/github.com/mtrmac/gpgme/data.go b/vendor/github.com/mtrmac/gpgme/data.go
index eebc97263..eee32c032 100644
--- a/vendor/github.com/mtrmac/gpgme/data.go
+++ b/vendor/github.com/mtrmac/gpgme/data.go
@@ -50,25 +50,25 @@ func gogpgme_writefunc(handle, buffer unsafe.Pointer, size C.size_t) C.ssize_t {
 }
 
 //export gogpgme_seekfunc
-func gogpgme_seekfunc(handle unsafe.Pointer, offset C.off_t, whence C.int) C.off_t {
+func gogpgme_seekfunc(handle unsafe.Pointer, offset C.gpgme_off_t, whence C.int) C.gpgme_off_t {
 	d := callbackLookup(uintptr(handle)).(*Data)
 	n, err := d.s.Seek(int64(offset), int(whence))
 	if err != nil {
 		C.gpgme_err_set_errno(C.EIO)
 		return -1
 	}
-	return C.off_t(n)
+	return C.gpgme_off_t(n)
 }
 
 // The Data buffer used to communicate with GPGME
 type Data struct {
-	dh  C.gpgme_data_t
+	dh  C.gpgme_data_t // WARNING: Call runtime.KeepAlive(d) after ANY passing of d.dh to C
 	buf []byte
 	cbs C.struct_gpgme_data_cbs
 	r   io.Reader
 	w   io.Writer
 	s   io.Seeker
-	cbc uintptr
+	cbc uintptr // WARNING: Call runtime.KeepAlive(d) after ANY use of d.cbc in C (typically via d.dh)
 }
 
 func newData() *Data {
@@ -154,12 +154,14 @@ func (d *Data) Close() error {
 		callbackDelete(d.cbc)
 	}
 	_, err := C.gpgme_data_release(d.dh)
+	runtime.KeepAlive(d)
 	d.dh = nil
 	return err
 }
 
 func (d *Data) Write(p []byte) (int, error) {
 	n, err := C.gpgme_data_write(d.dh, unsafe.Pointer(&p[0]), C.size_t(len(p)))
+	runtime.KeepAlive(d)
 	if err != nil {
 		return 0, err
 	}
@@ -171,6 +173,7 @@ func (d *Data) Write(p []byte) (int, error) {
 
 func (d *Data) Read(p []byte) (int, error) {
 	n, err := C.gpgme_data_read(d.dh, unsafe.Pointer(&p[0]), C.size_t(len(p)))
+	runtime.KeepAlive(d)
 	if err != nil {
 		return 0, err
 	}
@@ -181,11 +184,14 @@ func (d *Data) Read(p []byte) (int, error) {
 }
 
 func (d *Data) Seek(offset int64, whence int) (int64, error) {
-	n, err := C.gpgme_data_seek(d.dh, C.off_t(offset), C.int(whence))
+	n, err := C.gogpgme_data_seek(d.dh, C.gpgme_off_t(offset), C.int(whence))
+	runtime.KeepAlive(d)
 	return int64(n), err
 }
 
 // Name returns the associated filename if any
 func (d *Data) Name() string {
-	return C.GoString(C.gpgme_data_get_file_name(d.dh))
+	res := C.GoString(C.gpgme_data_get_file_name(d.dh))
+	runtime.KeepAlive(d)
+	return res
 }
diff --git a/vendor/github.com/mtrmac/gpgme/go.mod b/vendor/github.com/mtrmac/gpgme/go.mod
new file mode 100644
index 000000000..3dd09c9fb
--- /dev/null
+++ b/vendor/github.com/mtrmac/gpgme/go.mod
@@ -0,0 +1,3 @@
+module github.com/mtrmac/gpgme
+
+go 1.11
diff --git a/vendor/github.com/mtrmac/gpgme/go_gpgme.c b/vendor/github.com/mtrmac/gpgme/go_gpgme.c
index b887574e0..00da3ab30 100644
--- a/vendor/github.com/mtrmac/gpgme/go_gpgme.c
+++ b/vendor/github.com/mtrmac/gpgme/go_gpgme.c
@@ -8,6 +8,28 @@ void gogpgme_set_passphrase_cb(gpgme_ctx_t ctx, gpgme_passphrase_cb_t cb, uintpt
 	gpgme_set_passphrase_cb(ctx, cb, (void *)handle);
 }
 
+gpgme_off_t gogpgme_data_seek(gpgme_data_t dh, gpgme_off_t offset, int whence) {
+	return gpgme_data_seek(dh, offset, whence);
+}
+
+gpgme_error_t gogpgme_op_assuan_transact_ext(
+		gpgme_ctx_t ctx,
+		char* cmd,
+		uintptr_t data_h,
+		uintptr_t inquiry_h,
+		uintptr_t status_h,
+		gpgme_error_t *operr
+	){
+	return gpgme_op_assuan_transact_ext(
+		ctx,
+		cmd,
+		(gpgme_assuan_data_cb_t)    gogpgme_assuan_data_callback,    (void *)data_h,
+		(gpgme_assuan_inquire_cb_t) gogpgme_assuan_inquiry_callback, (void *)inquiry_h,
+		(gpgme_assuan_status_cb_t)  gogpgme_assuan_status_callback,  (void *)status_h,
+		operr
+	);
+}
+
 unsigned int key_revoked(gpgme_key_t k) {
 	return k->revoked;
 }
diff --git a/vendor/github.com/mtrmac/gpgme/go_gpgme.h b/vendor/github.com/mtrmac/gpgme/go_gpgme.h
index a3678b127..eb3a4ba88 100644
--- a/vendor/github.com/mtrmac/gpgme/go_gpgme.h
+++ b/vendor/github.com/mtrmac/gpgme/go_gpgme.h
@@ -12,6 +12,13 @@ extern off_t gogpgme_seekfunc(void *handle, off_t offset, int whence);
 extern gpgme_error_t gogpgme_passfunc(void *hook, char *uid_hint, char *passphrase_info, int prev_was_bad, int fd);
 extern gpgme_error_t gogpgme_data_new_from_cbs(gpgme_data_t *dh, gpgme_data_cbs_t cbs, uintptr_t handle);
 extern void gogpgme_set_passphrase_cb(gpgme_ctx_t ctx, gpgme_passphrase_cb_t cb, uintptr_t handle);
+extern gpgme_off_t gogpgme_data_seek(gpgme_data_t dh, gpgme_off_t offset, int whence);
+
+extern gpgme_error_t gogpgme_op_assuan_transact_ext(gpgme_ctx_t ctx, char *cmd, uintptr_t data_h, uintptr_t inquiry_h , uintptr_t status_h, gpgme_error_t *operr);
+
+extern gpgme_error_t gogpgme_assuan_data_callback(void *opaque, void* data, size_t datalen );
+extern gpgme_error_t gogpgme_assuan_inquiry_callback(void *opaque, char* name, char* args);
+extern gpgme_error_t gogpgme_assuan_status_callback(void *opaque, char* status, char* args);
 
 extern unsigned int key_revoked(gpgme_key_t k);
 extern unsigned int key_expired(gpgme_key_t k);
diff --git a/vendor/github.com/mtrmac/gpgme/gpgme.go b/vendor/github.com/mtrmac/gpgme/gpgme.go
index 20aad737c..c19b9aebc 100644
--- a/vendor/github.com/mtrmac/gpgme/gpgme.go
+++ b/vendor/github.com/mtrmac/gpgme/gpgme.go
@@ -7,7 +7,6 @@ package gpgme
 // #include <gpgme.h>
 // #include "go_gpgme.h"
 import "C"
-
 import (
 	"fmt"
 	"io"
@@ -48,9 +47,8 @@ const (
 	ProtocolAssuan   Protocol = C.GPGME_PROTOCOL_ASSUAN
 	ProtocolG13      Protocol = C.GPGME_PROTOCOL_G13
 	ProtocolUIServer Protocol = C.GPGME_PROTOCOL_UISERVER
-	// ProtocolSpawn    Protocol = C.GPGME_PROTOCOL_SPAWN // Unavailable in 1.4.3
-	ProtocolDefault Protocol = C.GPGME_PROTOCOL_DEFAULT
-	ProtocolUnknown Protocol = C.GPGME_PROTOCOL_UNKNOWN
+	ProtocolDefault  Protocol = C.GPGME_PROTOCOL_DEFAULT
+	ProtocolUnknown  Protocol = C.GPGME_PROTOCOL_UNKNOWN
 )
 
 type PinEntryMode int
@@ -70,7 +68,6 @@ const (
 	EncryptNoEncryptTo EncryptFlag = C.GPGME_ENCRYPT_NO_ENCRYPT_TO
 	EncryptPrepare     EncryptFlag = C.GPGME_ENCRYPT_PREPARE
 	EncryptExceptSign  EncryptFlag = C.GPGME_ENCRYPT_EXPECT_SIGN
-	// EncryptNoCompress  EncryptFlag = C.GPGME_ENCRYPT_NO_COMPRESS // Unavailable in 1.4.3
 )
 
 type HashAlgo int
@@ -84,7 +81,6 @@ const (
 	KeyListModeExtern       KeyListMode = C.GPGME_KEYLIST_MODE_EXTERN
 	KeyListModeSigs         KeyListMode = C.GPGME_KEYLIST_MODE_SIGS
 	KeyListModeSigNotations KeyListMode = C.GPGME_KEYLIST_MODE_SIG_NOTATIONS
-	// KeyListModeWithSecret   KeyListMode = C.GPGME_KEYLIST_MODE_WITH_SECRET // Unavailable in 1.4.3
 	KeyListModeEphemeral    KeyListMode = C.GPGME_KEYLIST_MODE_EPHEMERAL
 	KeyListModeModeValidate KeyListMode = C.GPGME_KEYLIST_MODE_VALIDATE
 )
@@ -168,39 +164,60 @@ func EngineCheckVersion(p Protocol) error {
 }
 
 type EngineInfo struct {
-	info C.gpgme_engine_info_t
+	next            *EngineInfo
+	protocol        Protocol
+	fileName        string
+	homeDir         string
+	version         string
+	requiredVersion string
 }
 
-func (e *EngineInfo) Next() *EngineInfo {
-	if e.info.next == nil {
-		return nil
+func copyEngineInfo(info C.gpgme_engine_info_t) *EngineInfo {
+	res := &EngineInfo{
+		next:            nil,
+		protocol:        Protocol(info.protocol),
+		fileName:        C.GoString(info.file_name),
+		homeDir:         C.GoString(info.home_dir),
+		version:         C.GoString(info.version),
+		requiredVersion: C.GoString(info.req_version),
+	}
+	if info.next != nil {
+		res.next = copyEngineInfo(info.next)
 	}
-	return &EngineInfo{info: e.info.next}
+	return res
+}
+
+func (e *EngineInfo) Next() *EngineInfo {
+	return e.next
 }
 
 func (e *EngineInfo) Protocol() Protocol {
-	return Protocol(e.info.protocol)
+	return e.protocol
 }
 
 func (e *EngineInfo) FileName() string {
-	return C.GoString(e.info.file_name)
+	return e.fileName
 }
 
 func (e *EngineInfo) Version() string {
-	return C.GoString(e.info.version)
+	return e.version
 }
 
 func (e *EngineInfo) RequiredVersion() string {
-	return C.GoString(e.info.req_version)
+	return e.requiredVersion
 }
 
 func (e *EngineInfo) HomeDir() string {
-	return C.GoString(e.info.home_dir)
+	return e.homeDir
 }
 
 func GetEngineInfo() (*EngineInfo, error) {
-	info := &EngineInfo{}
-	return info, handleError(C.gpgme_get_engine_info(&info.info))
+	var cInfo C.gpgme_engine_info_t
+	err := handleError(C.gpgme_get_engine_info(&cInfo))
+	if err != nil {
+		return nil, err
+	}
+	return copyEngineInfo(cInfo), nil // It is up to the caller not to invalidate cInfo concurrently until this is done.
 }
 
 func SetEngineInfo(proto Protocol, fileName, homeDir string) error {
@@ -261,9 +278,9 @@ type Context struct {
 	KeyError error
 
 	callback Callback
-	cbc      uintptr
+	cbc      uintptr // WARNING: Call runtime.KeepAlive(c) after ANY use of c.cbc in C (typically via c.ctx)
 
-	ctx C.gpgme_ctx_t
+	ctx C.gpgme_ctx_t // WARNING: Call runtime.KeepAlive(c) after ANY passing of c.ctx to C
 }
 
 func New() (*Context, error) {
@@ -281,49 +298,68 @@ func (c *Context) Release() {
 		callbackDelete(c.cbc)
 	}
 	C.gpgme_release(c.ctx)
+	runtime.KeepAlive(c)
 	c.ctx = nil
 }
 
 func (c *Context) SetArmor(yes bool) {
 	C.gpgme_set_armor(c.ctx, cbool(yes))
+	runtime.KeepAlive(c)
 }
 
 func (c *Context) Armor() bool {
-	return C.gpgme_get_armor(c.ctx) != 0
+	res := C.gpgme_get_armor(c.ctx) != 0
+	runtime.KeepAlive(c)
+	return res
 }
 
 func (c *Context) SetTextMode(yes bool) {
 	C.gpgme_set_textmode(c.ctx, cbool(yes))
+	runtime.KeepAlive(c)
 }
 
 func (c *Context) TextMode() bool {
-	return C.gpgme_get_textmode(c.ctx) != 0
+	res := C.gpgme_get_textmode(c.ctx) != 0
+	runtime.KeepAlive(c)
+	return res
 }
 
 func (c *Context) SetProtocol(p Protocol) error {
-	return handleError(C.gpgme_set_protocol(c.ctx, C.gpgme_protocol_t(p)))
+	err := handleError(C.gpgme_set_protocol(c.ctx, C.gpgme_protocol_t(p)))
+	runtime.KeepAlive(c)
+	return err
 }
 
 func (c *Context) Protocol() Protocol {
-	return Protocol(C.gpgme_get_protocol(c.ctx))
+	res := Protocol(C.gpgme_get_protocol(c.ctx))
+	runtime.KeepAlive(c)
+	return res
 }
 
 func (c *Context) SetKeyListMode(m KeyListMode) error {
-	return handleError(C.gpgme_set_keylist_mode(c.ctx, C.gpgme_keylist_mode_t(m)))
+	err := handleError(C.gpgme_set_keylist_mode(c.ctx, C.gpgme_keylist_mode_t(m)))
+	runtime.KeepAlive(c)
+	return err
 }
 
 func (c *Context) KeyListMode() KeyListMode {
-	return KeyListMode(C.gpgme_get_keylist_mode(c.ctx))
+	res := KeyListMode(C.gpgme_get_keylist_mode(c.ctx))
+	runtime.KeepAlive(c)
+	return res
 }
 
 // Unavailable in 1.3.2:
 // func (c *Context) SetPinEntryMode(m PinEntryMode) error {
-// 	return handleError(C.gpgme_set_pinentry_mode(c.ctx, C.gpgme_pinentry_mode_t(m)))
+// 	err := handleError(C.gpgme_set_pinentry_mode(c.ctx, C.gpgme_pinentry_mode_t(m)))
+// 	runtime.KeepAlive(c)
+// 	return err
 // }
 
 // Unavailable in 1.3.2:
 // func (c *Context) PinEntryMode() PinEntryMode {
-// 	return PinEntryMode(C.gpgme_get_pinentry_mode(c.ctx))
+// 	res := PinEntryMode(C.gpgme_get_pinentry_mode(c.ctx))
+// 	runtime.KeepAlive(c)
+// 	return res
 // }
 
 func (c *Context) SetCallback(callback Callback) error {
@@ -340,11 +376,17 @@ func (c *Context) SetCallback(callback Callback) error {
 		c.cbc = 0
 		_, err = C.gogpgme_set_passphrase_cb(c.ctx, nil, 0)
 	}
+	runtime.KeepAlive(c)
 	return err
 }
 
 func (c *Context) EngineInfo() *EngineInfo {
-	return &EngineInfo{info: C.gpgme_ctx_get_engine_info(c.ctx)}
+	cInfo := C.gpgme_ctx_get_engine_info(c.ctx)
+	runtime.KeepAlive(c)
+	// NOTE: c must be live as long as we are accessing cInfo.
+	res := copyEngineInfo(cInfo)
+	runtime.KeepAlive(c) // for accesses to cInfo
+	return res
 }
 
 func (c *Context) SetEngineInfo(proto Protocol, fileName, homeDir string) error {
@@ -357,19 +399,23 @@ func (c *Context) SetEngineInfo(proto Protocol, fileName, homeDir string) error
 		chome = C.CString(homeDir)
 		defer C.free(unsafe.Pointer(chome))
 	}
-	return handleError(C.gpgme_ctx_set_engine_info(c.ctx, C.gpgme_protocol_t(proto), cfn, chome))
+	err := handleError(C.gpgme_ctx_set_engine_info(c.ctx, C.gpgme_protocol_t(proto), cfn, chome))
+	runtime.KeepAlive(c)
+	return err
 }
 
 func (c *Context) KeyListStart(pattern string, secretOnly bool) error {
 	cpattern := C.CString(pattern)
 	defer C.free(unsafe.Pointer(cpattern))
-	err := C.gpgme_op_keylist_start(c.ctx, cpattern, cbool(secretOnly))
-	return handleError(err)
+	err := handleError(C.gpgme_op_keylist_start(c.ctx, cpattern, cbool(secretOnly)))
+	runtime.KeepAlive(c)
+	return err
 }
 
 func (c *Context) KeyListNext() bool {
 	c.Key = newKey()
 	err := handleError(C.gpgme_op_keylist_next(c.ctx, &c.Key.k))
+	runtime.KeepAlive(c) // implies runtime.KeepAlive(c.Key)
 	if err != nil {
 		if e, ok := err.(Error); ok && e.Code() == ErrorEOF {
 			c.KeyError = nil
@@ -383,7 +429,9 @@ func (c *Context) KeyListNext() bool {
 }
 
 func (c *Context) KeyListEnd() error {
-	return handleError(C.gpgme_op_keylist_end(c.ctx))
+	err := handleError(C.gpgme_op_keylist_end(c.ctx))
+	runtime.KeepAlive(c)
+	return err
 }
 
 func (c *Context) GetKey(fingerprint string, secret bool) (*Key, error) {
@@ -391,7 +439,11 @@ func (c *Context) GetKey(fingerprint string, secret bool) (*Key, error) {
 	cfpr := C.CString(fingerprint)
 	defer C.free(unsafe.Pointer(cfpr))
 	err := handleError(C.gpgme_get_key(c.ctx, cfpr, &key.k, cbool(secret)))
-	if e, ok := err.(Error); key.k == nil && ok && e.Code() == ErrorEOF {
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(key)
+	keyKIsNil := key.k == nil
+	runtime.KeepAlive(key)
+	if e, ok := err.(Error); keyKIsNil && ok && e.Code() == ErrorEOF {
 		return nil, fmt.Errorf("key %q not found", fingerprint)
 	}
 	if err != nil {
@@ -401,11 +453,19 @@ func (c *Context) GetKey(fingerprint string, secret bool) (*Key, error) {
 }
 
 func (c *Context) Decrypt(ciphertext, plaintext *Data) error {
-	return handleError(C.gpgme_op_decrypt(c.ctx, ciphertext.dh, plaintext.dh))
+	err := handleError(C.gpgme_op_decrypt(c.ctx, ciphertext.dh, plaintext.dh))
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(ciphertext)
+	runtime.KeepAlive(plaintext)
+	return err
 }
 
 func (c *Context) DecryptVerify(ciphertext, plaintext *Data) error {
-	return handleError(C.gpgme_op_decrypt_verify(c.ctx, ciphertext.dh, plaintext.dh))
+	err := handleError(C.gpgme_op_decrypt_verify(c.ctx, ciphertext.dh, plaintext.dh))
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(ciphertext)
+	runtime.KeepAlive(plaintext)
+	return err
 }
 
 type Signature struct {
@@ -432,10 +492,20 @@ func (c *Context) Verify(sig, signedText, plain *Data) (string, []Signature, err
 		plainPtr = plain.dh
 	}
 	err := handleError(C.gpgme_op_verify(c.ctx, sig.dh, signedTextPtr, plainPtr))
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(sig)
+	if signedText != nil {
+		runtime.KeepAlive(signedText)
+	}
+	if plain != nil {
+		runtime.KeepAlive(plain)
+	}
 	if err != nil {
 		return "", nil, err
 	}
 	res := C.gpgme_op_verify_result(c.ctx)
+	runtime.KeepAlive(c)
+	// NOTE: c must be live as long as we are accessing res.
 	sigs := []Signature{}
 	for s := res.signatures; s != nil; s = s.next {
 		sig := Signature{
@@ -455,7 +525,9 @@ func (c *Context) Verify(sig, signedText, plain *Data) (string, []Signature, err
 		}
 		sigs = append(sigs, sig)
 	}
-	return C.GoString(res.file_name), sigs, nil
+	fileName := C.GoString(res.file_name)
+	runtime.KeepAlive(c) // for all accesses to res above
+	return fileName, sigs, nil
 }
 
 func (c *Context) Encrypt(recipients []*Key, flags EncryptFlag, plaintext, ciphertext *Data) error {
@@ -467,18 +539,116 @@ func (c *Context) Encrypt(recipients []*Key, flags EncryptFlag, plaintext, ciphe
 		*ptr = recipients[i].k
 	}
 	err := C.gpgme_op_encrypt(c.ctx, (*C.gpgme_key_t)(recp), C.gpgme_encrypt_flags_t(flags), plaintext.dh, ciphertext.dh)
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(recipients)
+	runtime.KeepAlive(plaintext)
+	runtime.KeepAlive(ciphertext)
 	return handleError(err)
 }
 
 func (c *Context) Sign(signers []*Key, plain, sig *Data, mode SigMode) error {
 	C.gpgme_signers_clear(c.ctx)
+	runtime.KeepAlive(c)
 	for _, k := range signers {
-		if err := handleError(C.gpgme_signers_add(c.ctx, k.k)); err != nil {
+		err := handleError(C.gpgme_signers_add(c.ctx, k.k))
+		runtime.KeepAlive(c)
+		runtime.KeepAlive(k)
+		if err != nil {
 			C.gpgme_signers_clear(c.ctx)
+			runtime.KeepAlive(c)
 			return err
 		}
 	}
-	return handleError(C.gpgme_op_sign(c.ctx, plain.dh, sig.dh, C.gpgme_sig_mode_t(mode)))
+	err := handleError(C.gpgme_op_sign(c.ctx, plain.dh, sig.dh, C.gpgme_sig_mode_t(mode)))
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(plain)
+	runtime.KeepAlive(sig)
+	return err
+}
+
+type AssuanDataCallback func(data []byte) error
+type AssuanInquireCallback func(name, args string) error
+type AssuanStatusCallback func(status, args string) error
+
+// AssuanSend sends a raw Assuan command to gpg-agent
+func (c *Context) AssuanSend(
+	cmd string,
+	data AssuanDataCallback,
+	inquiry AssuanInquireCallback,
+	status AssuanStatusCallback,
+) error {
+	var operr C.gpgme_error_t
+
+	dataPtr := callbackAdd(&data)
+	inquiryPtr := callbackAdd(&inquiry)
+	statusPtr := callbackAdd(&status)
+	cmdCStr := C.CString(cmd)
+	defer C.free(unsafe.Pointer(cmdCStr))
+	err := C.gogpgme_op_assuan_transact_ext(
+		c.ctx,
+		cmdCStr,
+		C.uintptr_t(dataPtr),
+		C.uintptr_t(inquiryPtr),
+		C.uintptr_t(statusPtr),
+		&operr,
+	)
+	runtime.KeepAlive(c)
+
+	if handleError(operr) != nil {
+		return handleError(operr)
+	}
+	return handleError(err)
+}
+
+//export gogpgme_assuan_data_callback
+func gogpgme_assuan_data_callback(handle unsafe.Pointer, data unsafe.Pointer, datalen C.size_t) C.gpgme_error_t {
+	c := callbackLookup(uintptr(handle)).(*AssuanDataCallback)
+	if *c == nil {
+		return 0
+	}
+	(*c)(C.GoBytes(data, C.int(datalen)))
+	return 0
+}
+
+//export gogpgme_assuan_inquiry_callback
+func gogpgme_assuan_inquiry_callback(handle unsafe.Pointer, cName *C.char, cArgs *C.char) C.gpgme_error_t {
+	name := C.GoString(cName)
+	args := C.GoString(cArgs)
+	c := callbackLookup(uintptr(handle)).(*AssuanInquireCallback)
+	if *c == nil {
+		return 0
+	}
+	(*c)(name, args)
+	return 0
+}
+
+//export gogpgme_assuan_status_callback
+func gogpgme_assuan_status_callback(handle unsafe.Pointer, cStatus *C.char, cArgs *C.char) C.gpgme_error_t {
+	status := C.GoString(cStatus)
+	args := C.GoString(cArgs)
+	c := callbackLookup(uintptr(handle)).(*AssuanStatusCallback)
+	if *c == nil {
+		return 0
+	}
+	(*c)(status, args)
+	return 0
+}
+
+// ExportModeFlags defines how keys are exported from Export
+type ExportModeFlags uint
+
+const (
+	ExportModeExtern  ExportModeFlags = C.GPGME_EXPORT_MODE_EXTERN
+	ExportModeMinimal ExportModeFlags = C.GPGME_EXPORT_MODE_MINIMAL
+)
+
+func (c *Context) Export(pattern string, mode ExportModeFlags, data *Data) error {
+	pat := C.CString(pattern)
+	defer C.free(unsafe.Pointer(pat))
+	err := handleError(C.gpgme_op_export(c.ctx, pat, C.gpgme_export_mode_t(mode), data.dh))
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(data)
+	return err
 }
 
 // ImportStatusFlags describes the type of ImportStatus.Status. The C API in gpgme.h simply uses "unsigned".
@@ -517,10 +687,14 @@ type ImportResult struct {
 
 func (c *Context) Import(keyData *Data) (*ImportResult, error) {
 	err := handleError(C.gpgme_op_import(c.ctx, keyData.dh))
+	runtime.KeepAlive(c)
+	runtime.KeepAlive(keyData)
 	if err != nil {
 		return nil, err
 	}
 	res := C.gpgme_op_import_result(c.ctx)
+	runtime.KeepAlive(c)
+	// NOTE: c must be live as long as we are accessing res.
 	imports := []ImportStatus{}
 	for s := res.imports; s != nil; s = s.next {
 		imports = append(imports, ImportStatus{
@@ -529,7 +703,7 @@ func (c *Context) Import(keyData *Data) (*ImportResult, error) {
 			Status:      ImportStatusFlags(s.status),
 		})
 	}
-	return &ImportResult{
+	importResult := &ImportResult{
 		Considered:      int(res.considered),
 		NoUserID:        int(res.no_user_id),
 		Imported:        int(res.imported),
@@ -544,11 +718,13 @@ func (c *Context) Import(keyData *Data) (*ImportResult, error) {
 		SecretUnchanged: int(res.secret_unchanged),
 		NotImported:     int(res.not_imported),
 		Imports:         imports,
-	}, nil
+	}
+	runtime.KeepAlive(c) // for all accesses to res above
+	return importResult, nil
 }
 
 type Key struct {
-	k C.gpgme_key_t
+	k C.gpgme_key_t // WARNING: Call Runtime.KeepAlive(k) after ANY passing of k.k to C
 }
 
 func newKey() *Key {
@@ -559,85 +735,122 @@ func newKey() *Key {
 
 func (k *Key) Release() {
 	C.gpgme_key_release(k.k)
+	runtime.KeepAlive(k)
 	k.k = nil
 }
 
 func (k *Key) Revoked() bool {
-	return C.key_revoked(k.k) != 0
+	res := C.key_revoked(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) Expired() bool {
-	return C.key_expired(k.k) != 0
+	res := C.key_expired(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) Disabled() bool {
-	return C.key_disabled(k.k) != 0
+	res := C.key_disabled(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) Invalid() bool {
-	return C.key_invalid(k.k) != 0
+	res := C.key_invalid(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) CanEncrypt() bool {
-	return C.key_can_encrypt(k.k) != 0
+	res := C.key_can_encrypt(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) CanSign() bool {
-	return C.key_can_sign(k.k) != 0
+	res := C.key_can_sign(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) CanCertify() bool {
-	return C.key_can_certify(k.k) != 0
+	res := C.key_can_certify(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) Secret() bool {
-	return C.key_secret(k.k) != 0
+	res := C.key_secret(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) CanAuthenticate() bool {
-	return C.key_can_authenticate(k.k) != 0
+	res := C.key_can_authenticate(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) IsQualified() bool {
-	return C.key_is_qualified(k.k) != 0
+	res := C.key_is_qualified(k.k) != 0
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) Protocol() Protocol {
-	return Protocol(k.k.protocol)
+	res := Protocol(k.k.protocol)
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) IssuerSerial() string {
-	return C.GoString(k.k.issuer_serial)
+	res := C.GoString(k.k.issuer_serial)
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) IssuerName() string {
-	return C.GoString(k.k.issuer_name)
+	res := C.GoString(k.k.issuer_name)
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) ChainID() string {
-	return C.GoString(k.k.chain_id)
+	res := C.GoString(k.k.chain_id)
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) OwnerTrust() Validity {
-	return Validity(k.k.owner_trust)
+	res := Validity(k.k.owner_trust)
+	runtime.KeepAlive(k)
+	return res
 }
 
 func (k *Key) SubKeys() *SubKey {
-	if k.k.subkeys == nil {
+	subKeys := k.k.subkeys
+	runtime.KeepAlive(k)
+	if subKeys == nil {
 		return nil
 	}
-	return &SubKey{k: k.k.subkeys, parent: k}
+	return &SubKey{k: subKeys, parent: k} // The parent: k reference ensures subKeys remains valid
 }
 
 func (k *Key) UserIDs() *UserID {
-	if k.k.uids == nil {
+	uids := k.k.uids
+	runtime.KeepAlive(k)
+	if uids == nil {
 		return nil
 	}
-	return &UserID{u: k.k.uids, parent: k}
+	return &UserID{u: uids, parent: k} // The parent: k reference ensures uids remains valid
 }
 
 func (k *Key) KeyListMode() KeyListMode {
-	return KeyListMode(k.k.keylist_mode)
+	res := KeyListMode(k.k.keylist_mode)
+	runtime.KeepAlive(k)
+	return res
 }
 
 type SubKey struct {
@@ -737,12 +950,3 @@ func (u *UserID) Comment() string {
 func (u *UserID) Email() string {
 	return C.GoString(u.u.email)
 }
-
-// This is somewhat of a horrible hack. We need to unset GPG_AGENT_INFO so that gpgme does not pass --use-agent to GPG.
-// os.Unsetenv should be enough, but that only calls the underlying C library (which gpgme uses) if cgo is involved
-// - and cgo can't be used in tests. So, provide this helper for test initialization.
-func unsetenvGPGAgentInfo() {
-	v := C.CString("GPG_AGENT_INFO")
-	defer C.free(unsafe.Pointer(v))
-	C.unsetenv(v)
-}
diff --git a/vendor/github.com/mtrmac/gpgme/unset_agent_info.go b/vendor/github.com/mtrmac/gpgme/unset_agent_info.go
new file mode 100644
index 000000000..986aca59f
--- /dev/null
+++ b/vendor/github.com/mtrmac/gpgme/unset_agent_info.go
@@ -0,0 +1,18 @@
+// +build !windows
+
+package gpgme
+
+// #include <stdlib.h>
+import "C"
+import (
+	"unsafe"
+)
+
+// This is somewhat of a horrible hack. We need to unset GPG_AGENT_INFO so that gpgme does not pass --use-agent to GPG.
+// os.Unsetenv should be enough, but that only calls the underlying C library (which gpgme uses) if cgo is involved
+// - and cgo can't be used in tests. So, provide this helper for test initialization.
+func unsetenvGPGAgentInfo() {
+	v := C.CString("GPG_AGENT_INFO")
+	defer C.free(unsafe.Pointer(v))
+	C.unsetenv(v)
+}
diff --git a/vendor/github.com/mtrmac/gpgme/unset_agent_info_windows.go b/vendor/github.com/mtrmac/gpgme/unset_agent_info_windows.go
new file mode 100644
index 000000000..431ec86d3
--- /dev/null
+++ b/vendor/github.com/mtrmac/gpgme/unset_agent_info_windows.go
@@ -0,0 +1,14 @@
+package gpgme
+
+// #include <stdlib.h>
+import "C"
+import (
+	"unsafe"
+)
+
+// unsetenv is not available in mingw
+func unsetenvGPGAgentInfo() {
+	v := C.CString("GPG_AGENT_INFO=")
+	defer C.free(unsafe.Pointer(v))
+	C.putenv(v)
+}
diff --git a/vendor/github.com/vbauerster/mpb/v4/bar_option.go b/vendor/github.com/vbauerster/mpb/v4/bar_option.go
index bb79ac6a4..7fb152562 100644
--- a/vendor/github.com/vbauerster/mpb/v4/bar_option.go
+++ b/vendor/github.com/vbauerster/mpb/v4/bar_option.go
@@ -10,11 +10,10 @@ import (
 // BarOption is a function option which changes the default behavior of a bar.
 type BarOption func(*bState)
 
-type mergeWrapper interface {
-	MergeUnwrap() []decor.Decorator
-}
-
 func (s *bState) addDecorators(dest *[]decor.Decorator, decorators ...decor.Decorator) {
+	type mergeWrapper interface {
+		MergeUnwrap() []decor.Decorator
+	}
 	for _, decorator := range decorators {
 		if mw, ok := decorator.(mergeWrapper); ok {
 			*dest = append(*dest, mw.MergeUnwrap()...)
diff --git a/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go b/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go
index 5c0d16880..2271cbbe1 100644
--- a/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go
+++ b/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go
@@ -4,6 +4,8 @@ import (
 	"fmt"
 	"time"
 	"unicode/utf8"
+
+	"github.com/acarl005/stripansi"
 )
 
 const (
@@ -117,25 +119,29 @@ var (
 // W represents width and C represents bit set of width related config.
 // A decorator should embed WC, to enable width synchronization.
 type WC struct {
-	W            int
-	C            int
-	dynFormat    string
-	staticFormat string
-	wsync        chan int
+	W         int
+	C         int
+	dynFormat string
+	wsync     chan int
 }
 
 // FormatMsg formats final message according to WC.W and WC.C.
 // Should be called by any Decorator implementation.
 func (wc *WC) FormatMsg(msg string) string {
+	var format string
+	runeCount := utf8.RuneCountInString(stripansi.Strip(msg))
+	ansiCount := utf8.RuneCountInString(msg) - runeCount
 	if (wc.C & DSyncWidth) != 0 {
-		wc.wsync <- utf8.RuneCountInString(msg)
-		max := <-wc.wsync
 		if (wc.C & DextraSpace) != 0 {
-			max++
+			runeCount++
 		}
-		return fmt.Sprintf(fmt.Sprintf(wc.dynFormat, max), msg)
+		wc.wsync <- runeCount
+		max := <-wc.wsync
+		format = fmt.Sprintf(wc.dynFormat, ansiCount+max)
+	} else {
+		format = fmt.Sprintf(wc.dynFormat, ansiCount+wc.W)
 	}
-	return fmt.Sprintf(wc.staticFormat, msg)
+	return fmt.Sprintf(format, msg)
 }
 
 // Init initializes width related config.
@@ -145,7 +151,6 @@ func (wc *WC) Init() WC {
 		wc.dynFormat += "-"
 	}
 	wc.dynFormat += "%ds"
-	wc.staticFormat = fmt.Sprintf(wc.dynFormat, wc.W)
 	if (wc.C & DSyncWidth) != 0 {
 		// it's deliberate choice to override wsync on each Init() call,
 		// this way globals like WCSyncSpace can be reused
diff --git a/vendor/github.com/vbauerster/mpb/v4/decor/merge.go b/vendor/github.com/vbauerster/mpb/v4/decor/merge.go
index fdf9e107b..723869209 100644
--- a/vendor/github.com/vbauerster/mpb/v4/decor/merge.go
+++ b/vendor/github.com/vbauerster/mpb/v4/decor/merge.go
@@ -2,6 +2,7 @@ package decor
 
 import (
 	"fmt"
+	"strings"
 	"unicode/utf8"
 )
 
@@ -28,10 +29,7 @@ func Merge(decorator Decorator, placeholders ...WC) Decorator {
 		if (wc.C & DSyncWidth) == 0 {
 			return decorator
 		}
-		md.placeHolders[i] = &placeHolderDecorator{
-			WC:  wc.Init(),
-			wch: make(chan int),
-		}
+		md.placeHolders[i] = &placeHolderDecorator{wc.Init()}
 	}
 	return md
 }
@@ -69,29 +67,40 @@ func (d *mergeDecorator) Base() Decorator {
 func (d *mergeDecorator) Decor(st *Statistics) string {
 	msg := d.Decorator.Decor(st)
 	msgLen := utf8.RuneCountInString(msg)
-
-	var space int
-	for _, ph := range d.placeHolders {
-		space += <-ph.wch
+	if (d.wc.C & DextraSpace) != 0 {
+		msgLen++
 	}
 
-	d.wc.wsync <- msgLen - space
+	var total int
+	max := utf8.RuneCountInString(d.placeHolders[0].FormatMsg(""))
+	total += max
+	pw := (msgLen - max) / len(d.placeHolders)
+	rem := (msgLen - max) % len(d.placeHolders)
 
-	max := <-d.wc.wsync
-	if (d.wc.C & DextraSpace) != 0 {
-		max++
+	var diff int
+	for i := 1; i < len(d.placeHolders); i++ {
+		ph := d.placeHolders[i]
+		width := pw - diff
+		if (ph.WC.C & DextraSpace) != 0 {
+			width--
+			if width < 0 {
+				width = 0
+			}
+		}
+		max = utf8.RuneCountInString(ph.FormatMsg(strings.Repeat(" ", width)))
+		total += max
+		diff = max - pw
 	}
-	return fmt.Sprintf(fmt.Sprintf(d.wc.dynFormat, max+space), msg)
+
+	d.wc.wsync <- pw + rem
+	max = <-d.wc.wsync
+	return fmt.Sprintf(fmt.Sprintf(d.wc.dynFormat, max+total), msg)
 }
 
 type placeHolderDecorator struct {
 	WC
-	wch chan int
 }
 
-func (d *placeHolderDecorator) Decor(st *Statistics) string {
-	go func() {
-		d.wch <- utf8.RuneCountInString(d.FormatMsg(""))
-	}()
+func (d *placeHolderDecorator) Decor(_ *Statistics) string {
 	return ""
 }
diff --git a/vendor/github.com/vbauerster/mpb/v4/go.mod b/vendor/github.com/vbauerster/mpb/v4/go.mod
index 0c5ce51f1..9e7287d5d 100644
--- a/vendor/github.com/vbauerster/mpb/v4/go.mod
+++ b/vendor/github.com/vbauerster/mpb/v4/go.mod
@@ -2,6 +2,7 @@ module github.com/vbauerster/mpb/v4
 
 require (
 	github.com/VividCortex/ewma v1.1.1
+	github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d
 	golang.org/x/crypto v0.0.0-20191112222119-e1110fd1c708
 	golang.org/x/sys v0.0.0-20191113165036-4c7a9d0fe056 // indirect
 )
diff --git a/vendor/github.com/vbauerster/mpb/v4/go.sum b/vendor/github.com/vbauerster/mpb/v4/go.sum
index 94a9f1a28..5a1316274 100644
--- a/vendor/github.com/vbauerster/mpb/v4/go.sum
+++ b/vendor/github.com/vbauerster/mpb/v4/go.sum
@@ -1,5 +1,7 @@
 github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM=
 github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA=
+github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d h1:licZJFw2RwpHMqeKTCYkitsPqHNxTmd4SNR5r94FGM8=
+github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d/go.mod h1:asat636LX7Bqt5lYEZ27JNDcqxfjdBQuJ/MM4CN/Lzo=
 golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
 golang.org/x/crypto v0.0.0-20191112222119-e1110fd1c708 h1:pXVtWnwHkrWD9ru3sDxY/qFK/bfc0egRovX91EjWjf4=
 golang.org/x/crypto v0.0.0-20191112222119-e1110fd1c708/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
diff --git a/vendor/github.com/vbauerster/mpb/v4/proxyreader.go b/vendor/github.com/vbauerster/mpb/v4/proxyreader.go
index 736142412..0e4b51f09 100644
--- a/vendor/github.com/vbauerster/mpb/v4/proxyreader.go
+++ b/vendor/github.com/vbauerster/mpb/v4/proxyreader.go
@@ -18,9 +18,7 @@ func (prox *proxyReader) Read(p []byte) (n int, err error) {
 		prox.iT = time.Now()
 	}
 	if err == io.EOF {
-		go func() {
-			prox.bar.SetTotal(0, true)
-		}()
+		go prox.bar.SetTotal(0, true)
 	}
 	return
 }
@@ -37,9 +35,7 @@ func (prox *proxyWriterTo) WriteTo(w io.Writer) (n int64, err error) {
 		prox.iT = time.Now()
 	}
 	if err == io.EOF {
-		go func() {
-			prox.bar.SetTotal(0, true)
-		}()
+		go prox.bar.SetTotal(0, true)
 	}
 	return
 }
diff --git a/vendor/modules.txt b/vendor/modules.txt
index 2a384e865..d845a9ba0 100644
--- a/vendor/modules.txt
+++ b/vendor/modules.txt
@@ -29,6 +29,8 @@ github.com/Microsoft/hcsshim/internal/wclayer
 github.com/Microsoft/hcsshim/osversion
 # github.com/VividCortex/ewma v1.1.1
 github.com/VividCortex/ewma
+# github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d
+github.com/acarl005/stripansi
 # github.com/beorn7/perks v1.0.1
 github.com/beorn7/perks/quantile
 # github.com/blang/semver v3.5.1+incompatible
@@ -80,7 +82,7 @@ github.com/containers/common/pkg/cgroups
 github.com/containers/common/pkg/unshare
 # github.com/containers/conmon v2.0.10+incompatible
 github.com/containers/conmon/runner/config
-# github.com/containers/image/v5 v5.1.0
+# github.com/containers/image/v5 v5.2.0
 github.com/containers/image/v5/copy
 github.com/containers/image/v5/directory
 github.com/containers/image/v5/directory/explicitfilepath
@@ -91,6 +93,7 @@ github.com/containers/image/v5/docker/policyconfiguration
 github.com/containers/image/v5/docker/reference
 github.com/containers/image/v5/docker/tarfile
 github.com/containers/image/v5/image
+github.com/containers/image/v5/internal/iolimits
 github.com/containers/image/v5/internal/pkg/keyctl
 github.com/containers/image/v5/internal/tmpdir
 github.com/containers/image/v5/manifest
@@ -337,7 +340,7 @@ github.com/modern-go/reflect2
 github.com/morikuni/aec
 # github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618
 github.com/mrunalp/fileutils
-# github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c
+# github.com/mtrmac/gpgme v0.1.1
 github.com/mtrmac/gpgme
 # github.com/onsi/ginkgo v1.11.0
 github.com/onsi/ginkgo
@@ -510,7 +513,7 @@ github.com/varlink/go/varlink/idl
 github.com/vbatts/tar-split/archive/tar
 github.com/vbatts/tar-split/tar/asm
 github.com/vbatts/tar-split/tar/storage
-# github.com/vbauerster/mpb/v4 v4.11.1
+# github.com/vbauerster/mpb/v4 v4.11.2
 github.com/vbauerster/mpb/v4
 github.com/vbauerster/mpb/v4/cwriter
 github.com/vbauerster/mpb/v4/decor