diff options
| author | OpenShift Merge Robot <openshift-merge-robot@users.noreply.github.com> | 2019-11-13 20:19:54 +0100 |
|---|---|---|
| committer | GitHub <noreply@github.com> | 2019-11-13 20:19:54 +0100 |
| commit | 225f22b9d5dfd0d1582a56530142fe8ffb960a91 (patch) | |
| tree | 4dcc994bb1e48602e5be5f42b7599abdc0cc7937 /vendor | |
| parent | 15220af08ce2346686e54851a6d498ec573e950c (diff) | |
| parent | 6003033adae775f1d725b05231a246a4462ae669 (diff) | |
| download | podman-225f22b9d5dfd0d1582a56530142fe8ffb960a91.tar.gz podman-225f22b9d5dfd0d1582a56530142fe8ffb960a91.tar.bz2 podman-225f22b9d5dfd0d1582a56530142fe8ffb960a91.zip | |
Merge pull request #4506 from TomSweeneyRedHat/dev/tsweeney/bump_buildah1.11.5
Bump to Buildah v1.11.5
Diffstat (limited to 'vendor')
309 files changed, 25052 insertions, 1612 deletions
diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod index b3846826b..50b9d6e2e 100644 --- a/vendor/github.com/Microsoft/go-winio/go.mod +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -5,5 +5,5 @@ go 1.12 require ( github.com/pkg/errors v0.8.1 github.com/sirupsen/logrus v1.4.1 - golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 ) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum index babb4a70d..209aa8cf4 100644 --- a/vendor/github.com/Microsoft/go-winio/go.sum +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -14,3 +14,5 @@ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXf golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 000000000..47d7650fb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,54 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +# Lock down runhcs config + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" +target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" +target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +]
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml index a8ec5a593..7f0f81632 100644 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml @@ -8,22 +8,34 @@ environment: GOPATH: c:\gopath PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% -stack: go 1.11 +stack: go 1.12.9 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer + - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 + - go build ./cmd/wclayer + - go build ./internal/tools/grantvmgroupaccess + - go build ./internal/tools/uvmboot + - go build ./internal/tools/zapdir - go test -v ./... -tags admin + - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional + - go test -c ./test/cri-containerd/ -tags functional - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration + - go test -c ./test/runhcs/ -tags functional artifacts: - - path: 'wclayer.exe' + - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' + - path: 'wclayer.exe' + - path: 'grantvmgroupaccess.exe' + - path: 'uvmboot.exe' + - path: 'zapdir.exe' + - path: 'containerd-shim-runhcs-v1.test.exe' + - path: 'cri-containerd.test.exe' - path: 'functional.test.exe' - path: 'runhcs.test.exe'
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c3154..53c0a3854 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcessNoStdio(c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 000000000..5f76d444d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,37 @@ +module github.com/Microsoft/hcsshim + +go 1.12 + +require ( + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/prometheus/procfs v0.0.5 // indirect + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 000000000..578b78e81 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,131 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c4..09b3860a7 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 000000000..8193315f0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,83 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfef..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c030..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4b..62ba81751 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b56535..9a4705a49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbcf..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a2..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf9..d366f629f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,45 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,7 +55,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -86,120 +83,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) if err != nil { - return makeProcessError(process, operation, err, nil) + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") - return nil + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) - } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; but this function can only +// be called once on each Process. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,96 +334,116 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + if process.stdin != nil { + process.stdin.Close() + } return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + if process.stdin != nil { + process.stdin.Close() + } + if process.stdout != nil { + process.stdout.Close() + } + if process.stderr != nil { + process.stderr.Close() + } + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b242524..98df25bd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,24 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,49 +44,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, - } -} - -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" + id: id, + waitBlock: make(chan struct{}), } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) } // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + computeSystem.handle = handle defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) + if err != nil { + computeSystem.Close() } }() + if err = computeSystem.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } + return computeSystem, nil +} - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) if err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, events) + return err } - - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, nil) + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" } + return nil +} - return computeSystem, nil +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" } // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -271,360 +255,388 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError +} - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::System::Properties" + + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - return nil + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + return properties, nil } -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +// PropertiesV2 returns the requested container properties targeting a V2 schema container. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::PropertiesV2" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + properties := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) + } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) +// CreateProcessNoStdio launches a new process within the computeSystem. The +// Stdio handles are not cached on the process struct. +func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) { + operation := "hcsshim::System::CreateProcessNoStdio" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() + + // We don't do anything with these handles. Close them so they don't leak. + syscall.Close(processInfo.StdInput) + syscall.Close(processInfo.StdOutput) + syscall.Close(processInfo.StdError) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() + + return process, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,15 +644,15 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 @@ -649,36 +661,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c57..f07f532c1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed3187..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = <syscall>(args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004c..6a1c41e15 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b263..2df4a57f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de91..b7ae96fdd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 2318a4fce..61da242ee 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -55,8 +55,9 @@ type PaPolicy struct { type OutboundNatPolicy struct { Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` } type ActionType string diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029e..922f7c679 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 000000000..ba6b1a4a5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 000000000..f428bdaf7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 000000000..fee4765cb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ace..fb23617f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc2..bcfeb34d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779eab..c1ea3953b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707a..b4f9c315b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d5..8bf8cab60 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d285..10cea67e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d9..1d5dfe68a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -}
\ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe5..68aa04a57 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28bc..4fb231076 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e21..1fd7ca5d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c571..781a88401 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f71..85450c41e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe4..fe86cab65 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa76735..af8280048 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c3..8838519a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c5..ea3084bca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8dd..23b2ee9e7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c1..a017691f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef12..176c49d49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3b..9b86a4045 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604a..208074e9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3a..ec93d004e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go index 27d0b8c48..b4a36954d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -22,4 +22,9 @@ type Memory2 struct { // EnableDeferredCommit is private in the schema. If regenerated need to add back. EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dffd..811779b04 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,8 +10,7 @@ package hcsschema type MemoryInformationForVm struct { - - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f6..906ba597f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,10 +11,9 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` - - MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c2..a9c750b34 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827c..e5ea187a2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d179..d96c9501f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae2..21707a88e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e1..29d8c8012 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817a..41f8fdea0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8f..e9a662dd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d0..e4ed095c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c55734..82b0d0532 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d150..ad9a4fa9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b0245..bb24e88da 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e7356..21fe46062 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e57..6157e2522 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,10 +11,9 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` - RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` - - RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f6..17558cba0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -9,8 +9,11 @@ package hcsschema -type Properties struct { +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) +type Properties struct { Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` @@ -44,4 +47,8 @@ type Properties struct { SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffdf..d6d80df13 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - - PropertyTypes []string `json:"PropertyTypes,omitempty"` + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go new file mode 100644 index 000000000..f092b737f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e453128..8d5f5c171 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc8..006906f6e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc60..26fde99c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f4841..3f203176c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6cd..df9baa921 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba7..825b71865 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7d..f67b08eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8a..5eaf6a7f4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93b..ba7a6b396 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,12 +15,11 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` - Uptime100ns int32 `json:"Uptime100ns,omitempty"` + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` Processor *ProcessorStats `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df1..9c5e6eb53 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d7..4f042ffd9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,12 +11,11 @@ package hcsschema // Storage runtime statistics type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` - ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` - WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` - - WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c823..834869940 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f9..0e48ece50 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2bc..3ab409d82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d12..2abfccca3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e5606..ec5d0fb93 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8ec..91a3c83d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444a..70cf2d90d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a7..362df363e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a42..915e9b638 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279d..75196bd8c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f628667..8e1836dd6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,14 +10,13 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` - ReservedMemory int32 `json:"ReservedMemory,omitempty"` + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` - AssignedMemory int32 `json:"AssignedMemory,omitempty"` + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` SlpActive bool `json:"SlpActive,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc8..8ed7e566d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 000000000..7c2a0dc28 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,565 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc87..0f2a69f6a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 651676fb2..b3b431e35 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,7 +1,13 @@ package wclayer import ( + "os" + "path/filepath" + "syscall" + "unsafe" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" ) @@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) { if err != nil { return hcserror.New(err, title+" - failed", "") } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bedc..443596fba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a07..06671309d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf65..a259c1b82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd8..dc40bf519 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go @@ -24,4 +24,9 @@ import "github.com/Microsoft/hcsshim/internal/guid" //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index d853ab259..67f917f07 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") @@ -57,6 +59,9 @@ var ( procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") ) func activateLayer(info *driverInfo, id string) (hr error) { @@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bbd..f60ba5501 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 916950c02..477fe7078 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -46,6 +46,12 @@ func Get() OSVersion { return osv } +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + func (osv OSVersion) ToString() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index 2d9567f6f..3488cc451 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,10 +1,27 @@ package osversion const ( - - // RS2 was a client-only release in case you're asking why it's not in the list. + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Sever 1903 (semi-annual + // channel). + V19H1 = 18362 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7c..3362c6833 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed1566..000000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb
\ No newline at end of file diff --git a/vendor/github.com/containerd/cgroups/LICENSE b/vendor/github.com/containerd/cgroups/LICENSE new file mode 100644 index 000000000..261eeb9e9 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/cgroups/stats/v1/doc.go b/vendor/github.com/containerd/cgroups/stats/v1/doc.go new file mode 100644 index 000000000..23f3cdd4b --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package v1 diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go new file mode 100644 index 000000000..c7884e8ef --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go @@ -0,0 +1,5368 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/cgroups/stats/v1/metrics.proto + +package v1 + +import ( + fmt "fmt" + _ "github.com/gogo/protobuf/gogoproto" + proto "github.com/gogo/protobuf/proto" + io "io" + math "math" + reflect "reflect" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Metrics struct { + Hugetlb []*HugetlbStat `protobuf:"bytes,1,rep,name=hugetlb,proto3" json:"hugetlb,omitempty"` + Pids *PidsStat `protobuf:"bytes,2,opt,name=pids,proto3" json:"pids,omitempty"` + CPU *CPUStat `protobuf:"bytes,3,opt,name=cpu,proto3" json:"cpu,omitempty"` + Memory *MemoryStat `protobuf:"bytes,4,opt,name=memory,proto3" json:"memory,omitempty"` + Blkio *BlkIOStat `protobuf:"bytes,5,opt,name=blkio,proto3" json:"blkio,omitempty"` + Rdma *RdmaStat `protobuf:"bytes,6,opt,name=rdma,proto3" json:"rdma,omitempty"` + Network []*NetworkStat `protobuf:"bytes,7,rep,name=network,proto3" json:"network,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Metrics) Reset() { *m = Metrics{} } +func (*Metrics) ProtoMessage() {} +func (*Metrics) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{0} +} +func (m *Metrics) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Metrics) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Metrics.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Metrics) XXX_Merge(src proto.Message) { + xxx_messageInfo_Metrics.Merge(m, src) +} +func (m *Metrics) XXX_Size() int { + return m.Size() +} +func (m *Metrics) XXX_DiscardUnknown() { + xxx_messageInfo_Metrics.DiscardUnknown(m) +} + +var xxx_messageInfo_Metrics proto.InternalMessageInfo + +type HugetlbStat struct { + Usage uint64 `protobuf:"varint,1,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,2,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,3,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + Pagesize string `protobuf:"bytes,4,opt,name=pagesize,proto3" json:"pagesize,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *HugetlbStat) Reset() { *m = HugetlbStat{} } +func (*HugetlbStat) ProtoMessage() {} +func (*HugetlbStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{1} +} +func (m *HugetlbStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *HugetlbStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_HugetlbStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *HugetlbStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_HugetlbStat.Merge(m, src) +} +func (m *HugetlbStat) XXX_Size() int { + return m.Size() +} +func (m *HugetlbStat) XXX_DiscardUnknown() { + xxx_messageInfo_HugetlbStat.DiscardUnknown(m) +} + +var xxx_messageInfo_HugetlbStat proto.InternalMessageInfo + +type PidsStat struct { + Current uint64 `protobuf:"varint,1,opt,name=current,proto3" json:"current,omitempty"` + Limit uint64 `protobuf:"varint,2,opt,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PidsStat) Reset() { *m = PidsStat{} } +func (*PidsStat) ProtoMessage() {} +func (*PidsStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{2} +} +func (m *PidsStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *PidsStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_PidsStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *PidsStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_PidsStat.Merge(m, src) +} +func (m *PidsStat) XXX_Size() int { + return m.Size() +} +func (m *PidsStat) XXX_DiscardUnknown() { + xxx_messageInfo_PidsStat.DiscardUnknown(m) +} + +var xxx_messageInfo_PidsStat proto.InternalMessageInfo + +type CPUStat struct { + Usage *CPUUsage `protobuf:"bytes,1,opt,name=usage,proto3" json:"usage,omitempty"` + Throttling *Throttle `protobuf:"bytes,2,opt,name=throttling,proto3" json:"throttling,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUStat) Reset() { *m = CPUStat{} } +func (*CPUStat) ProtoMessage() {} +func (*CPUStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{3} +} +func (m *CPUStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUStat.Merge(m, src) +} +func (m *CPUStat) XXX_Size() int { + return m.Size() +} +func (m *CPUStat) XXX_DiscardUnknown() { + xxx_messageInfo_CPUStat.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUStat proto.InternalMessageInfo + +type CPUUsage struct { + // values in nanoseconds + Total uint64 `protobuf:"varint,1,opt,name=total,proto3" json:"total,omitempty"` + Kernel uint64 `protobuf:"varint,2,opt,name=kernel,proto3" json:"kernel,omitempty"` + User uint64 `protobuf:"varint,3,opt,name=user,proto3" json:"user,omitempty"` + PerCPU []uint64 `protobuf:"varint,4,rep,packed,name=per_cpu,json=perCpu,proto3" json:"per_cpu,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUUsage) Reset() { *m = CPUUsage{} } +func (*CPUUsage) ProtoMessage() {} +func (*CPUUsage) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{4} +} +func (m *CPUUsage) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUUsage) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUUsage.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUUsage) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUUsage.Merge(m, src) +} +func (m *CPUUsage) XXX_Size() int { + return m.Size() +} +func (m *CPUUsage) XXX_DiscardUnknown() { + xxx_messageInfo_CPUUsage.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUUsage proto.InternalMessageInfo + +type Throttle struct { + Periods uint64 `protobuf:"varint,1,opt,name=periods,proto3" json:"periods,omitempty"` + ThrottledPeriods uint64 `protobuf:"varint,2,opt,name=throttled_periods,json=throttledPeriods,proto3" json:"throttled_periods,omitempty"` + ThrottledTime uint64 `protobuf:"varint,3,opt,name=throttled_time,json=throttledTime,proto3" json:"throttled_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Throttle) Reset() { *m = Throttle{} } +func (*Throttle) ProtoMessage() {} +func (*Throttle) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{5} +} +func (m *Throttle) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Throttle) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Throttle.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Throttle) XXX_Merge(src proto.Message) { + xxx_messageInfo_Throttle.Merge(m, src) +} +func (m *Throttle) XXX_Size() int { + return m.Size() +} +func (m *Throttle) XXX_DiscardUnknown() { + xxx_messageInfo_Throttle.DiscardUnknown(m) +} + +var xxx_messageInfo_Throttle proto.InternalMessageInfo + +type MemoryStat struct { + Cache uint64 `protobuf:"varint,1,opt,name=cache,proto3" json:"cache,omitempty"` + RSS uint64 `protobuf:"varint,2,opt,name=rss,proto3" json:"rss,omitempty"` + RSSHuge uint64 `protobuf:"varint,3,opt,name=rss_huge,json=rssHuge,proto3" json:"rss_huge,omitempty"` + MappedFile uint64 `protobuf:"varint,4,opt,name=mapped_file,json=mappedFile,proto3" json:"mapped_file,omitempty"` + Dirty uint64 `protobuf:"varint,5,opt,name=dirty,proto3" json:"dirty,omitempty"` + Writeback uint64 `protobuf:"varint,6,opt,name=writeback,proto3" json:"writeback,omitempty"` + PgPgIn uint64 `protobuf:"varint,7,opt,name=pg_pg_in,json=pgPgIn,proto3" json:"pg_pg_in,omitempty"` + PgPgOut uint64 `protobuf:"varint,8,opt,name=pg_pg_out,json=pgPgOut,proto3" json:"pg_pg_out,omitempty"` + PgFault uint64 `protobuf:"varint,9,opt,name=pg_fault,json=pgFault,proto3" json:"pg_fault,omitempty"` + PgMajFault uint64 `protobuf:"varint,10,opt,name=pg_maj_fault,json=pgMajFault,proto3" json:"pg_maj_fault,omitempty"` + InactiveAnon uint64 `protobuf:"varint,11,opt,name=inactive_anon,json=inactiveAnon,proto3" json:"inactive_anon,omitempty"` + ActiveAnon uint64 `protobuf:"varint,12,opt,name=active_anon,json=activeAnon,proto3" json:"active_anon,omitempty"` + InactiveFile uint64 `protobuf:"varint,13,opt,name=inactive_file,json=inactiveFile,proto3" json:"inactive_file,omitempty"` + ActiveFile uint64 `protobuf:"varint,14,opt,name=active_file,json=activeFile,proto3" json:"active_file,omitempty"` + Unevictable uint64 `protobuf:"varint,15,opt,name=unevictable,proto3" json:"unevictable,omitempty"` + HierarchicalMemoryLimit uint64 `protobuf:"varint,16,opt,name=hierarchical_memory_limit,json=hierarchicalMemoryLimit,proto3" json:"hierarchical_memory_limit,omitempty"` + HierarchicalSwapLimit uint64 `protobuf:"varint,17,opt,name=hierarchical_swap_limit,json=hierarchicalSwapLimit,proto3" json:"hierarchical_swap_limit,omitempty"` + TotalCache uint64 `protobuf:"varint,18,opt,name=total_cache,json=totalCache,proto3" json:"total_cache,omitempty"` + TotalRSS uint64 `protobuf:"varint,19,opt,name=total_rss,json=totalRss,proto3" json:"total_rss,omitempty"` + TotalRSSHuge uint64 `protobuf:"varint,20,opt,name=total_rss_huge,json=totalRssHuge,proto3" json:"total_rss_huge,omitempty"` + TotalMappedFile uint64 `protobuf:"varint,21,opt,name=total_mapped_file,json=totalMappedFile,proto3" json:"total_mapped_file,omitempty"` + TotalDirty uint64 `protobuf:"varint,22,opt,name=total_dirty,json=totalDirty,proto3" json:"total_dirty,omitempty"` + TotalWriteback uint64 `protobuf:"varint,23,opt,name=total_writeback,json=totalWriteback,proto3" json:"total_writeback,omitempty"` + TotalPgPgIn uint64 `protobuf:"varint,24,opt,name=total_pg_pg_in,json=totalPgPgIn,proto3" json:"total_pg_pg_in,omitempty"` + TotalPgPgOut uint64 `protobuf:"varint,25,opt,name=total_pg_pg_out,json=totalPgPgOut,proto3" json:"total_pg_pg_out,omitempty"` + TotalPgFault uint64 `protobuf:"varint,26,opt,name=total_pg_fault,json=totalPgFault,proto3" json:"total_pg_fault,omitempty"` + TotalPgMajFault uint64 `protobuf:"varint,27,opt,name=total_pg_maj_fault,json=totalPgMajFault,proto3" json:"total_pg_maj_fault,omitempty"` + TotalInactiveAnon uint64 `protobuf:"varint,28,opt,name=total_inactive_anon,json=totalInactiveAnon,proto3" json:"total_inactive_anon,omitempty"` + TotalActiveAnon uint64 `protobuf:"varint,29,opt,name=total_active_anon,json=totalActiveAnon,proto3" json:"total_active_anon,omitempty"` + TotalInactiveFile uint64 `protobuf:"varint,30,opt,name=total_inactive_file,json=totalInactiveFile,proto3" json:"total_inactive_file,omitempty"` + TotalActiveFile uint64 `protobuf:"varint,31,opt,name=total_active_file,json=totalActiveFile,proto3" json:"total_active_file,omitempty"` + TotalUnevictable uint64 `protobuf:"varint,32,opt,name=total_unevictable,json=totalUnevictable,proto3" json:"total_unevictable,omitempty"` + Usage *MemoryEntry `protobuf:"bytes,33,opt,name=usage,proto3" json:"usage,omitempty"` + Swap *MemoryEntry `protobuf:"bytes,34,opt,name=swap,proto3" json:"swap,omitempty"` + Kernel *MemoryEntry `protobuf:"bytes,35,opt,name=kernel,proto3" json:"kernel,omitempty"` + KernelTCP *MemoryEntry `protobuf:"bytes,36,opt,name=kernel_tcp,json=kernelTcp,proto3" json:"kernel_tcp,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryStat) Reset() { *m = MemoryStat{} } +func (*MemoryStat) ProtoMessage() {} +func (*MemoryStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{6} +} +func (m *MemoryStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryStat.Merge(m, src) +} +func (m *MemoryStat) XXX_Size() int { + return m.Size() +} +func (m *MemoryStat) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryStat.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryStat proto.InternalMessageInfo + +type MemoryEntry struct { + Limit uint64 `protobuf:"varint,1,opt,name=limit,proto3" json:"limit,omitempty"` + Usage uint64 `protobuf:"varint,2,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,3,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,4,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryEntry) Reset() { *m = MemoryEntry{} } +func (*MemoryEntry) ProtoMessage() {} +func (*MemoryEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{7} +} +func (m *MemoryEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryEntry.Merge(m, src) +} +func (m *MemoryEntry) XXX_Size() int { + return m.Size() +} +func (m *MemoryEntry) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryEntry proto.InternalMessageInfo + +type BlkIOStat struct { + IoServiceBytesRecursive []*BlkIOEntry `protobuf:"bytes,1,rep,name=io_service_bytes_recursive,json=ioServiceBytesRecursive,proto3" json:"io_service_bytes_recursive,omitempty"` + IoServicedRecursive []*BlkIOEntry `protobuf:"bytes,2,rep,name=io_serviced_recursive,json=ioServicedRecursive,proto3" json:"io_serviced_recursive,omitempty"` + IoQueuedRecursive []*BlkIOEntry `protobuf:"bytes,3,rep,name=io_queued_recursive,json=ioQueuedRecursive,proto3" json:"io_queued_recursive,omitempty"` + IoServiceTimeRecursive []*BlkIOEntry `protobuf:"bytes,4,rep,name=io_service_time_recursive,json=ioServiceTimeRecursive,proto3" json:"io_service_time_recursive,omitempty"` + IoWaitTimeRecursive []*BlkIOEntry `protobuf:"bytes,5,rep,name=io_wait_time_recursive,json=ioWaitTimeRecursive,proto3" json:"io_wait_time_recursive,omitempty"` + IoMergedRecursive []*BlkIOEntry `protobuf:"bytes,6,rep,name=io_merged_recursive,json=ioMergedRecursive,proto3" json:"io_merged_recursive,omitempty"` + IoTimeRecursive []*BlkIOEntry `protobuf:"bytes,7,rep,name=io_time_recursive,json=ioTimeRecursive,proto3" json:"io_time_recursive,omitempty"` + SectorsRecursive []*BlkIOEntry `protobuf:"bytes,8,rep,name=sectors_recursive,json=sectorsRecursive,proto3" json:"sectors_recursive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOStat) Reset() { *m = BlkIOStat{} } +func (*BlkIOStat) ProtoMessage() {} +func (*BlkIOStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{8} +} +func (m *BlkIOStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOStat.Merge(m, src) +} +func (m *BlkIOStat) XXX_Size() int { + return m.Size() +} +func (m *BlkIOStat) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOStat.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOStat proto.InternalMessageInfo + +type BlkIOEntry struct { + Op string `protobuf:"bytes,1,opt,name=op,proto3" json:"op,omitempty"` + Device string `protobuf:"bytes,2,opt,name=device,proto3" json:"device,omitempty"` + Major uint64 `protobuf:"varint,3,opt,name=major,proto3" json:"major,omitempty"` + Minor uint64 `protobuf:"varint,4,opt,name=minor,proto3" json:"minor,omitempty"` + Value uint64 `protobuf:"varint,5,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOEntry) Reset() { *m = BlkIOEntry{} } +func (*BlkIOEntry) ProtoMessage() {} +func (*BlkIOEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{9} +} +func (m *BlkIOEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOEntry.Merge(m, src) +} +func (m *BlkIOEntry) XXX_Size() int { + return m.Size() +} +func (m *BlkIOEntry) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOEntry proto.InternalMessageInfo + +type RdmaStat struct { + Current []*RdmaEntry `protobuf:"bytes,1,rep,name=current,proto3" json:"current,omitempty"` + Limit []*RdmaEntry `protobuf:"bytes,2,rep,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaStat) Reset() { *m = RdmaStat{} } +func (*RdmaStat) ProtoMessage() {} +func (*RdmaStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{10} +} +func (m *RdmaStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaStat.Merge(m, src) +} +func (m *RdmaStat) XXX_Size() int { + return m.Size() +} +func (m *RdmaStat) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaStat.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaStat proto.InternalMessageInfo + +type RdmaEntry struct { + Device string `protobuf:"bytes,1,opt,name=device,proto3" json:"device,omitempty"` + HcaHandles uint32 `protobuf:"varint,2,opt,name=hca_handles,json=hcaHandles,proto3" json:"hca_handles,omitempty"` + HcaObjects uint32 `protobuf:"varint,3,opt,name=hca_objects,json=hcaObjects,proto3" json:"hca_objects,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaEntry) Reset() { *m = RdmaEntry{} } +func (*RdmaEntry) ProtoMessage() {} +func (*RdmaEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{11} +} +func (m *RdmaEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaEntry.Merge(m, src) +} +func (m *RdmaEntry) XXX_Size() int { + return m.Size() +} +func (m *RdmaEntry) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaEntry proto.InternalMessageInfo + +type NetworkStat struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + RxBytes uint64 `protobuf:"varint,2,opt,name=rx_bytes,json=rxBytes,proto3" json:"rx_bytes,omitempty"` + RxPackets uint64 `protobuf:"varint,3,opt,name=rx_packets,json=rxPackets,proto3" json:"rx_packets,omitempty"` + RxErrors uint64 `protobuf:"varint,4,opt,name=rx_errors,json=rxErrors,proto3" json:"rx_errors,omitempty"` + RxDropped uint64 `protobuf:"varint,5,opt,name=rx_dropped,json=rxDropped,proto3" json:"rx_dropped,omitempty"` + TxBytes uint64 `protobuf:"varint,6,opt,name=tx_bytes,json=txBytes,proto3" json:"tx_bytes,omitempty"` + TxPackets uint64 `protobuf:"varint,7,opt,name=tx_packets,json=txPackets,proto3" json:"tx_packets,omitempty"` + TxErrors uint64 `protobuf:"varint,8,opt,name=tx_errors,json=txErrors,proto3" json:"tx_errors,omitempty"` + TxDropped uint64 `protobuf:"varint,9,opt,name=tx_dropped,json=txDropped,proto3" json:"tx_dropped,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NetworkStat) Reset() { *m = NetworkStat{} } +func (*NetworkStat) ProtoMessage() {} +func (*NetworkStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{12} +} +func (m *NetworkStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *NetworkStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_NetworkStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *NetworkStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_NetworkStat.Merge(m, src) +} +func (m *NetworkStat) XXX_Size() int { + return m.Size() +} +func (m *NetworkStat) XXX_DiscardUnknown() { + xxx_messageInfo_NetworkStat.DiscardUnknown(m) +} + +var xxx_messageInfo_NetworkStat proto.InternalMessageInfo + +func init() { + proto.RegisterType((*Metrics)(nil), "io.containerd.cgroups.v1.Metrics") + proto.RegisterType((*HugetlbStat)(nil), "io.containerd.cgroups.v1.HugetlbStat") + proto.RegisterType((*PidsStat)(nil), "io.containerd.cgroups.v1.PidsStat") + proto.RegisterType((*CPUStat)(nil), "io.containerd.cgroups.v1.CPUStat") + proto.RegisterType((*CPUUsage)(nil), "io.containerd.cgroups.v1.CPUUsage") + proto.RegisterType((*Throttle)(nil), "io.containerd.cgroups.v1.Throttle") + proto.RegisterType((*MemoryStat)(nil), "io.containerd.cgroups.v1.MemoryStat") + proto.RegisterType((*MemoryEntry)(nil), "io.containerd.cgroups.v1.MemoryEntry") + proto.RegisterType((*BlkIOStat)(nil), "io.containerd.cgroups.v1.BlkIOStat") + proto.RegisterType((*BlkIOEntry)(nil), "io.containerd.cgroups.v1.BlkIOEntry") + proto.RegisterType((*RdmaStat)(nil), "io.containerd.cgroups.v1.RdmaStat") + proto.RegisterType((*RdmaEntry)(nil), "io.containerd.cgroups.v1.RdmaEntry") + proto.RegisterType((*NetworkStat)(nil), "io.containerd.cgroups.v1.NetworkStat") +} + +func init() { + proto.RegisterFile("github.com/containerd/cgroups/stats/v1/metrics.proto", fileDescriptor_a17b2d87c332bfaa) +} + +var fileDescriptor_a17b2d87c332bfaa = []byte{ + // 1558 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x57, 0xcf, 0x73, 0x13, 0x39, + 0x16, 0xc6, 0xb1, 0x13, 0xbb, 0x9f, 0x93, 0x90, 0x28, 0x10, 0x3a, 0x01, 0xe2, 0xe0, 0x24, 0xbb, + 0xd9, 0xa5, 0xca, 0x29, 0xd8, 0x2d, 0x6a, 0x61, 0xa1, 0xb6, 0x70, 0x80, 0x82, 0xda, 0xcd, 0x62, + 0xda, 0x49, 0xb1, 0x7b, 0xea, 0x92, 0xdb, 0xa2, 0xad, 0xc4, 0x6e, 0x35, 0x6a, 0xb5, 0xe3, 0xcc, + 0x69, 0x0e, 0x53, 0x35, 0xa7, 0xf9, 0x67, 0xe6, 0xaf, 0xe0, 0x38, 0x97, 0xa9, 0x9a, 0xb9, 0xa4, + 0x06, 0xff, 0x25, 0x53, 0x92, 0xfa, 0x87, 0x0c, 0x84, 0x8c, 0x6f, 0x2d, 0xe9, 0xfb, 0xbe, 0xf7, + 0xf4, 0xfa, 0x53, 0xeb, 0x35, 0xfc, 0xdd, 0xa7, 0xa2, 0x17, 0x77, 0x1a, 0x1e, 0x1b, 0xec, 0x79, + 0x2c, 0x10, 0x98, 0x06, 0x84, 0x77, 0xf7, 0x3c, 0x9f, 0xb3, 0x38, 0x8c, 0xf6, 0x22, 0x81, 0x45, + 0xb4, 0x37, 0xbc, 0xb7, 0x37, 0x20, 0x82, 0x53, 0x2f, 0x6a, 0x84, 0x9c, 0x09, 0x86, 0x6c, 0xca, + 0x1a, 0x39, 0xba, 0x91, 0xa0, 0x1b, 0xc3, 0x7b, 0xeb, 0xd7, 0x7c, 0xe6, 0x33, 0x05, 0xda, 0x93, + 0x4f, 0x1a, 0x5f, 0xff, 0xb1, 0x08, 0xe5, 0x03, 0xad, 0x80, 0xfe, 0x05, 0xe5, 0x5e, 0xec, 0x13, + 0xd1, 0xef, 0xd8, 0x85, 0xcd, 0xe2, 0x6e, 0xf5, 0xfe, 0x4e, 0xe3, 0x22, 0xb5, 0xc6, 0x4b, 0x0d, + 0x6c, 0x0b, 0x2c, 0x9c, 0x94, 0x85, 0x1e, 0x40, 0x29, 0xa4, 0xdd, 0xc8, 0x9e, 0xd9, 0x2c, 0xec, + 0x56, 0xef, 0xd7, 0x2f, 0x66, 0xb7, 0x68, 0x37, 0x52, 0x54, 0x85, 0x47, 0x8f, 0xa1, 0xe8, 0x85, + 0xb1, 0x5d, 0x54, 0xb4, 0x3b, 0x17, 0xd3, 0xf6, 0x5b, 0x47, 0x92, 0xd5, 0x2c, 0x8f, 0xcf, 0x6b, + 0xc5, 0xfd, 0xd6, 0x91, 0x23, 0x69, 0xe8, 0x31, 0xcc, 0x0d, 0xc8, 0x80, 0xf1, 0x33, 0xbb, 0xa4, + 0x04, 0xb6, 0x2f, 0x16, 0x38, 0x50, 0x38, 0x15, 0x39, 0xe1, 0xa0, 0x87, 0x30, 0xdb, 0xe9, 0x9f, + 0x50, 0x66, 0xcf, 0x2a, 0xf2, 0xd6, 0xc5, 0xe4, 0x66, 0xff, 0xe4, 0xd5, 0x6b, 0xc5, 0xd5, 0x0c, + 0xb9, 0x5d, 0xde, 0x1d, 0x60, 0x7b, 0xee, 0xb2, 0xed, 0x3a, 0xdd, 0x01, 0xd6, 0xdb, 0x95, 0x78, + 0x59, 0xe7, 0x80, 0x88, 0x53, 0xc6, 0x4f, 0xec, 0xf2, 0x65, 0x75, 0xfe, 0xaf, 0x06, 0xea, 0x3a, + 0x27, 0xac, 0xfa, 0x09, 0x54, 0x8d, 0xfa, 0xa3, 0x6b, 0x30, 0x1b, 0x47, 0xd8, 0x27, 0x76, 0x61, + 0xb3, 0xb0, 0x5b, 0x72, 0xf4, 0x00, 0x2d, 0x41, 0x71, 0x80, 0x47, 0xea, 0x5d, 0x94, 0x1c, 0xf9, + 0x88, 0x6c, 0x28, 0xbf, 0xc3, 0xb4, 0xef, 0x05, 0x42, 0x95, 0xba, 0xe4, 0xa4, 0x43, 0xb4, 0x0e, + 0x95, 0x10, 0xfb, 0x24, 0xa2, 0xdf, 0x10, 0x55, 0x44, 0xcb, 0xc9, 0xc6, 0xf5, 0x47, 0x50, 0x49, + 0x5f, 0x97, 0x54, 0xf0, 0x62, 0xce, 0x49, 0x20, 0x92, 0x58, 0xe9, 0x50, 0xe6, 0xd0, 0xa7, 0x03, + 0x2a, 0x92, 0x78, 0x7a, 0x50, 0xff, 0xbe, 0x00, 0xe5, 0xe4, 0xa5, 0xa1, 0x7f, 0x98, 0x59, 0x7e, + 0xb5, 0x5c, 0xfb, 0xad, 0xa3, 0x23, 0x89, 0x4c, 0x77, 0xd2, 0x04, 0x10, 0x3d, 0xce, 0x84, 0xe8, + 0xd3, 0xc0, 0xbf, 0xdc, 0x5c, 0x87, 0x1a, 0x4b, 0x1c, 0x83, 0x55, 0x7f, 0x0f, 0x95, 0x54, 0x56, + 0xe6, 0x2a, 0x98, 0xc0, 0xfd, 0xb4, 0x5e, 0x6a, 0x80, 0x56, 0x61, 0xee, 0x84, 0xf0, 0x80, 0xf4, + 0x93, 0x2d, 0x24, 0x23, 0x84, 0xa0, 0x14, 0x47, 0x84, 0x27, 0x25, 0x53, 0xcf, 0x68, 0x0b, 0xca, + 0x21, 0xe1, 0xae, 0x34, 0x6d, 0x69, 0xb3, 0xb8, 0x5b, 0x6a, 0xc2, 0xf8, 0xbc, 0x36, 0xd7, 0x22, + 0x5c, 0x9a, 0x72, 0x2e, 0x24, 0x7c, 0x3f, 0x8c, 0xeb, 0x23, 0xa8, 0xa4, 0xa9, 0xc8, 0xc2, 0x85, + 0x84, 0x53, 0xd6, 0x8d, 0xd2, 0xc2, 0x25, 0x43, 0x74, 0x17, 0x96, 0x93, 0x34, 0x49, 0xd7, 0x4d, + 0x31, 0x3a, 0x83, 0xa5, 0x6c, 0xa1, 0x95, 0x80, 0x77, 0x60, 0x31, 0x07, 0x0b, 0x3a, 0x20, 0x49, + 0x56, 0x0b, 0xd9, 0xec, 0x21, 0x1d, 0x90, 0xfa, 0xaf, 0x55, 0x80, 0xdc, 0xea, 0x72, 0xbf, 0x1e, + 0xf6, 0x7a, 0x99, 0x3f, 0xd4, 0x00, 0xad, 0x41, 0x91, 0x47, 0x49, 0x28, 0x7d, 0xa2, 0x9c, 0x76, + 0xdb, 0x91, 0x73, 0xe8, 0x4f, 0x50, 0xe1, 0x51, 0xe4, 0xca, 0x63, 0xad, 0x03, 0x34, 0xab, 0xe3, + 0xf3, 0x5a, 0xd9, 0x69, 0xb7, 0xa5, 0xed, 0x9c, 0x32, 0x8f, 0x22, 0xf9, 0x80, 0x6a, 0x50, 0x1d, + 0xe0, 0x30, 0x24, 0x5d, 0xf7, 0x1d, 0xed, 0x6b, 0xe7, 0x94, 0x1c, 0xd0, 0x53, 0x2f, 0x68, 0x5f, + 0x55, 0xba, 0x4b, 0xb9, 0x38, 0x53, 0x87, 0xab, 0xe4, 0xe8, 0x01, 0xba, 0x05, 0xd6, 0x29, 0xa7, + 0x82, 0x74, 0xb0, 0x77, 0xa2, 0x0e, 0x4f, 0xc9, 0xc9, 0x27, 0x90, 0x0d, 0x95, 0xd0, 0x77, 0x43, + 0xdf, 0xa5, 0x81, 0x5d, 0xd6, 0x6f, 0x22, 0xf4, 0x5b, 0xfe, 0xab, 0x00, 0xad, 0x83, 0xa5, 0x57, + 0x58, 0x2c, 0xec, 0x4a, 0x52, 0x46, 0xbf, 0xe5, 0xbf, 0x8e, 0x05, 0x5a, 0x53, 0xac, 0x77, 0x38, + 0xee, 0x0b, 0xdb, 0x4a, 0x97, 0x5e, 0xc8, 0x21, 0xda, 0x84, 0xf9, 0xd0, 0x77, 0x07, 0xf8, 0x38, + 0x59, 0x06, 0x9d, 0x66, 0xe8, 0x1f, 0xe0, 0x63, 0x8d, 0xd8, 0x82, 0x05, 0x1a, 0x60, 0x4f, 0xd0, + 0x21, 0x71, 0x71, 0xc0, 0x02, 0xbb, 0xaa, 0x20, 0xf3, 0xe9, 0xe4, 0xd3, 0x80, 0x05, 0x72, 0xb3, + 0x26, 0x64, 0x5e, 0xab, 0x18, 0x00, 0x53, 0x45, 0xd5, 0x63, 0x61, 0x52, 0x45, 0x55, 0x24, 0x57, + 0x51, 0x90, 0x45, 0x53, 0x45, 0x01, 0x36, 0xa1, 0x1a, 0x07, 0x64, 0x48, 0x3d, 0x81, 0x3b, 0x7d, + 0x62, 0x5f, 0x55, 0x00, 0x73, 0x0a, 0x3d, 0x82, 0xb5, 0x1e, 0x25, 0x1c, 0x73, 0xaf, 0x47, 0x3d, + 0xdc, 0x77, 0xf5, 0x87, 0xcc, 0xd5, 0xc7, 0x6f, 0x49, 0xe1, 0x6f, 0x98, 0x00, 0xed, 0x84, 0xff, + 0xc8, 0x65, 0xf4, 0x00, 0x26, 0x96, 0xdc, 0xe8, 0x14, 0x87, 0x09, 0x73, 0x59, 0x31, 0xaf, 0x9b, + 0xcb, 0xed, 0x53, 0x1c, 0x6a, 0x5e, 0x0d, 0xaa, 0xea, 0x94, 0xb8, 0xda, 0x48, 0x48, 0xa7, 0xad, + 0xa6, 0xf6, 0x95, 0x9b, 0xfe, 0x02, 0x96, 0x06, 0x48, 0x4f, 0xad, 0x28, 0xcf, 0xcc, 0x8f, 0xcf, + 0x6b, 0x95, 0x43, 0x39, 0x29, 0x8d, 0x55, 0x51, 0xcb, 0x4e, 0x14, 0xa1, 0x07, 0xb0, 0x98, 0x41, + 0xb5, 0xc7, 0xae, 0x29, 0xfc, 0xd2, 0xf8, 0xbc, 0x36, 0x9f, 0xe2, 0x95, 0xd1, 0xe6, 0x53, 0x8e, + 0x72, 0xdb, 0x5f, 0x61, 0x59, 0xf3, 0x4c, 0xcf, 0x5d, 0x57, 0x99, 0x5c, 0x55, 0x0b, 0x07, 0xb9, + 0xf1, 0xb2, 0x7c, 0xb5, 0xfd, 0x56, 0x8d, 0x7c, 0x9f, 0x29, 0x0f, 0xfe, 0x19, 0x34, 0xc7, 0xcd, + 0x9d, 0x78, 0x43, 0x81, 0x74, 0x6e, 0x6f, 0x33, 0x3b, 0x6e, 0xa5, 0xd9, 0x66, 0xa6, 0xb4, 0xf5, + 0x2b, 0x51, 0xb3, 0x2d, 0xed, 0xcc, 0x9d, 0x54, 0x2d, 0xf7, 0xe7, 0x9a, 0x7e, 0xf9, 0x19, 0x4a, + 0x9a, 0x74, 0xdb, 0xd0, 0xd2, 0x5e, 0x5c, 0x9f, 0x40, 0x69, 0x37, 0xde, 0x05, 0x94, 0xa1, 0x72, + 0xd7, 0xde, 0x34, 0x36, 0xda, 0xca, 0xad, 0xdb, 0x80, 0x15, 0x0d, 0x9e, 0x34, 0xf0, 0x2d, 0x85, + 0xd6, 0xf5, 0x7a, 0x65, 0xba, 0x38, 0x2b, 0xa2, 0x89, 0xbe, 0x6d, 0x68, 0x3f, 0xcd, 0xb1, 0x9f, + 0x6b, 0xab, 0x92, 0x6f, 0x7c, 0x41, 0x5b, 0x15, 0xfd, 0x53, 0x6d, 0x85, 0xae, 0x7d, 0xa6, 0xad, + 0xb0, 0x77, 0x53, 0xac, 0x69, 0xf6, 0xcd, 0xe4, 0xb3, 0x27, 0x17, 0x8e, 0x0c, 0xc7, 0xff, 0x33, + 0xbd, 0x3a, 0xee, 0xa8, 0x6f, 0xff, 0xce, 0x65, 0x17, 0xfc, 0xf3, 0x40, 0xf0, 0xb3, 0xf4, 0xf6, + 0x78, 0x08, 0x25, 0xe9, 0x72, 0xbb, 0x3e, 0x0d, 0x57, 0x51, 0xd0, 0x93, 0xec, 0x4a, 0xd8, 0x9a, + 0x86, 0x9c, 0xde, 0x1c, 0x6d, 0x00, 0xfd, 0xe4, 0x0a, 0x2f, 0xb4, 0xb7, 0xa7, 0x90, 0x68, 0x2e, + 0x8c, 0xcf, 0x6b, 0xd6, 0xbf, 0x15, 0xf9, 0x70, 0xbf, 0xe5, 0x58, 0x5a, 0xe7, 0xd0, 0x0b, 0xeb, + 0x04, 0xaa, 0x06, 0x30, 0xbf, 0x77, 0x0b, 0xc6, 0xbd, 0x9b, 0x77, 0x04, 0x33, 0x5f, 0xe8, 0x08, + 0x8a, 0x5f, 0xec, 0x08, 0x4a, 0x13, 0x1d, 0x41, 0xfd, 0xe7, 0x59, 0xb0, 0xb2, 0x86, 0x07, 0x61, + 0x58, 0xa7, 0xcc, 0x8d, 0x08, 0x1f, 0x52, 0x8f, 0xb8, 0x9d, 0x33, 0x41, 0x22, 0x97, 0x13, 0x2f, + 0xe6, 0x11, 0x1d, 0x92, 0xa4, 0x59, 0xdc, 0xbe, 0xa4, 0x73, 0xd2, 0xb5, 0xb9, 0x41, 0x59, 0x5b, + 0xcb, 0x34, 0xa5, 0x8a, 0x93, 0x8a, 0xa0, 0xff, 0xc1, 0xf5, 0x3c, 0x44, 0xd7, 0x50, 0x9f, 0x99, + 0x42, 0x7d, 0x25, 0x53, 0xef, 0xe6, 0xca, 0x87, 0xb0, 0x42, 0x99, 0xfb, 0x3e, 0x26, 0xf1, 0x84, + 0x6e, 0x71, 0x0a, 0xdd, 0x65, 0xca, 0xde, 0x28, 0x7e, 0xae, 0xea, 0xc2, 0x9a, 0x51, 0x12, 0x79, + 0x17, 0x1b, 0xda, 0xa5, 0x29, 0xb4, 0x57, 0xb3, 0x9c, 0xe5, 0xdd, 0x9d, 0x07, 0xf8, 0x3f, 0xac, + 0x52, 0xe6, 0x9e, 0x62, 0x2a, 0x3e, 0x55, 0x9f, 0x9d, 0xae, 0x22, 0x6f, 0x31, 0x15, 0x93, 0xd2, + 0xba, 0x22, 0x03, 0xc2, 0xfd, 0x89, 0x8a, 0xcc, 0x4d, 0x57, 0x91, 0x03, 0xc5, 0xcf, 0x55, 0x5b, + 0xb0, 0x4c, 0xd9, 0xa7, 0xb9, 0x96, 0xa7, 0xd0, 0xbc, 0x4a, 0xd9, 0x64, 0x9e, 0x6f, 0x60, 0x39, + 0x22, 0x9e, 0x60, 0xdc, 0x74, 0x5b, 0x65, 0x0a, 0xc5, 0xa5, 0x84, 0x9e, 0x49, 0xd6, 0x87, 0x00, + 0xf9, 0x3a, 0x5a, 0x84, 0x19, 0x16, 0xaa, 0xa3, 0x63, 0x39, 0x33, 0x2c, 0x94, 0x3d, 0x60, 0x57, + 0x7e, 0x76, 0xf4, 0xc1, 0xb1, 0x9c, 0x64, 0x24, 0xcf, 0xd3, 0x00, 0x1f, 0xb3, 0xb4, 0x09, 0xd4, + 0x03, 0x35, 0x4b, 0x03, 0xc6, 0x93, 0xb3, 0xa3, 0x07, 0x72, 0x76, 0x88, 0xfb, 0x31, 0x49, 0x7b, + 0x1e, 0x35, 0xa8, 0x7f, 0x57, 0x80, 0x4a, 0xfa, 0x1b, 0x80, 0x9e, 0x98, 0x6d, 0x74, 0xf1, 0xeb, + 0x7f, 0x1d, 0x92, 0xa4, 0x37, 0x93, 0xf5, 0xda, 0x0f, 0xf3, 0x5e, 0xfb, 0x0f, 0x93, 0x93, 0x86, + 0x9c, 0x80, 0x95, 0xcd, 0x19, 0xbb, 0x2d, 0x4c, 0xec, 0xb6, 0x06, 0xd5, 0x9e, 0x87, 0xdd, 0x1e, + 0x0e, 0xba, 0x7d, 0xa2, 0x3b, 0xc4, 0x05, 0x07, 0x7a, 0x1e, 0x7e, 0xa9, 0x67, 0x52, 0x00, 0xeb, + 0x1c, 0x13, 0x4f, 0x44, 0xaa, 0x28, 0x1a, 0xf0, 0x5a, 0xcf, 0xd4, 0x7f, 0x98, 0x81, 0xaa, 0xf1, + 0xe7, 0x22, 0x7b, 0xe8, 0x00, 0x0f, 0xd2, 0x38, 0xea, 0x59, 0x76, 0x6c, 0x7c, 0xa4, 0xbf, 0x25, + 0xc9, 0x67, 0xaa, 0xcc, 0x47, 0xea, 0xa3, 0x80, 0x6e, 0x03, 0xf0, 0x91, 0x1b, 0x62, 0xef, 0x84, + 0x24, 0xf2, 0x25, 0xc7, 0xe2, 0xa3, 0x96, 0x9e, 0x40, 0x37, 0xc1, 0xe2, 0x23, 0x97, 0x70, 0xce, + 0x78, 0x94, 0xd4, 0xbe, 0xc2, 0x47, 0xcf, 0xd5, 0x38, 0xe1, 0x76, 0x39, 0x93, 0xbd, 0x40, 0xf2, + 0x0e, 0x2c, 0x3e, 0x7a, 0xa6, 0x27, 0x64, 0x54, 0x91, 0x46, 0xd5, 0xad, 0x67, 0x59, 0xe4, 0x51, + 0x45, 0x1e, 0x55, 0xb7, 0x9e, 0x96, 0x30, 0xa3, 0x8a, 0x2c, 0xaa, 0xee, 0x3e, 0x2b, 0xc2, 0x88, + 0x2a, 0xf2, 0xa8, 0x56, 0xca, 0x4d, 0xa2, 0x36, 0xed, 0x0f, 0x1f, 0x37, 0xae, 0xfc, 0xf2, 0x71, + 0xe3, 0xca, 0xb7, 0xe3, 0x8d, 0xc2, 0x87, 0xf1, 0x46, 0xe1, 0xa7, 0xf1, 0x46, 0xe1, 0xb7, 0xf1, + 0x46, 0xa1, 0x33, 0xa7, 0x7e, 0xc3, 0xff, 0xf6, 0x7b, 0x00, 0x00, 0x00, 0xff, 0xff, 0x2f, 0xc0, + 0x49, 0x92, 0xee, 0x0f, 0x00, 0x00, +} + +func (m *Metrics) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metrics) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, msg := range m.Hugetlb { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.Pids != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Pids.Size())) + n1, err := m.Pids.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + if m.CPU != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.CPU.Size())) + n2, err := m.CPU.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + if m.Memory != nil { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Memory.Size())) + n3, err := m.Memory.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + } + if m.Blkio != nil { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Blkio.Size())) + n4, err := m.Blkio.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n4 + } + if m.Rdma != nil { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Rdma.Size())) + n5, err := m.Rdma.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n5 + } + if len(m.Network) > 0 { + for _, msg := range m.Network { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *HugetlbStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *HugetlbStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if len(m.Pagesize) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Pagesize))) + i += copy(dAtA[i:], m.Pagesize) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *PidsStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Current != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Current)) + } + if m.Limit != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != nil { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n6, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n6 + } + if m.Throttling != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Throttling.Size())) + n7, err := m.Throttling.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUUsage) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUUsage) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Total != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Total)) + } + if m.Kernel != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel)) + } + if m.User != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.User)) + } + if len(m.PerCPU) > 0 { + dAtA9 := make([]byte, len(m.PerCPU)*10) + var j8 int + for _, num := range m.PerCPU { + for num >= 1<<7 { + dAtA9[j8] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j8++ + } + dAtA9[j8] = uint8(num) + j8++ + } + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(j8)) + i += copy(dAtA[i:], dAtA9[:j8]) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *Throttle) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Throttle) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Periods != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Cache != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Cache)) + } + if m.RSS != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSS)) + } + if m.RSSHuge != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.MappedFile)) + } + if m.Dirty != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Dirty)) + } + if m.Writeback != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + dAtA[i] = 0x50 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + dAtA[i] = 0x58 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + dAtA[i] = 0x60 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + dAtA[i] = 0x68 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + dAtA[i] = 0x70 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + dAtA[i] = 0x78 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + dAtA[i] = 0x88 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + dAtA[i] = 0x90 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + dAtA[i] = 0x98 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + dAtA[i] = 0xa0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + dAtA[i] = 0xa8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + dAtA[i] = 0xb0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + dAtA[i] = 0xb8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + dAtA[i] = 0xc0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + dAtA[i] = 0xc8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + dAtA[i] = 0xd0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + dAtA[i] = 0xd8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + dAtA[i] = 0xe0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + dAtA[i] = 0xe8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + dAtA[i] = 0xf0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + dAtA[i] = 0xf8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + dAtA[i] = 0x8a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n10, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n10 + } + if m.Swap != nil { + dAtA[i] = 0x92 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Swap.Size())) + n11, err := m.Swap.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n11 + } + if m.Kernel != nil { + dAtA[i] = 0x9a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel.Size())) + n12, err := m.Kernel.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n12 + } + if m.KernelTCP != nil { + dAtA[i] = 0xa2 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.KernelTCP.Size())) + n13, err := m.KernelTCP.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n13 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Limit != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.Usage != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, msg := range m.IoServiceBytesRecursive { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServicedRecursive) > 0 { + for _, msg := range m.IoServicedRecursive { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, msg := range m.IoQueuedRecursive { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, msg := range m.IoServiceTimeRecursive { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, msg := range m.IoWaitTimeRecursive { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoMergedRecursive) > 0 { + for _, msg := range m.IoMergedRecursive { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoTimeRecursive) > 0 { + for _, msg := range m.IoTimeRecursive { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.SectorsRecursive) > 0 { + for _, msg := range m.SectorsRecursive { + dAtA[i] = 0x42 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Op) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Op))) + i += copy(dAtA[i:], m.Op) + } + if len(m.Device) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.Major != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Major)) + } + if m.Minor != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Minor)) + } + if m.Value != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Current) > 0 { + for _, msg := range m.Current { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.Limit) > 0 { + for _, msg := range m.Limit { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Device) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.HcaHandles != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *NetworkStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NetworkStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if m.RxBytes != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Metrics) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, e := range m.Hugetlb { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.Pids != nil { + l = m.Pids.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.CPU != nil { + l = m.CPU.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Memory != nil { + l = m.Memory.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Blkio != nil { + l = m.Blkio.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Rdma != nil { + l = m.Rdma.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if len(m.Network) > 0 { + for _, e := range m.Network { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *HugetlbStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + l = len(m.Pagesize) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *PidsStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Current != 0 { + n += 1 + sovMetrics(uint64(m.Current)) + } + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != nil { + l = m.Usage.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Throttling != nil { + l = m.Throttling.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUUsage) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Total != 0 { + n += 1 + sovMetrics(uint64(m.Total)) + } + if m.Kernel != 0 { + n += 1 + sovMetrics(uint64(m.Kernel)) + } + if m.User != 0 { + n += 1 + sovMetrics(uint64(m.User)) + } + if len(m.PerCPU) > 0 { + l = 0 + for _, e := range m.PerCPU { + l += sovMetrics(uint64(e)) + } + n += 1 + sovMetrics(uint64(l)) + l + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *Throttle) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Periods != 0 { + n += 1 + sovMetrics(uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cache != 0 { + n += 1 + sovMetrics(uint64(m.Cache)) + } + if m.RSS != 0 { + n += 1 + sovMetrics(uint64(m.RSS)) + } + if m.RSSHuge != 0 { + n += 1 + sovMetrics(uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + n += 1 + sovMetrics(uint64(m.MappedFile)) + } + if m.Dirty != 0 { + n += 1 + sovMetrics(uint64(m.Dirty)) + } + if m.Writeback != 0 { + n += 1 + sovMetrics(uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + n += 1 + sovMetrics(uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + n += 1 + sovMetrics(uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + n += 1 + sovMetrics(uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + n += 1 + sovMetrics(uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + n += 1 + sovMetrics(uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + n += 1 + sovMetrics(uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + n += 1 + sovMetrics(uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + n += 2 + sovMetrics(uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + n += 2 + sovMetrics(uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + n += 2 + sovMetrics(uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + n += 2 + sovMetrics(uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + l = m.Usage.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Swap != nil { + l = m.Swap.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Kernel != nil { + l = m.Kernel.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.KernelTCP != nil { + l = m.KernelTCP.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, e := range m.IoServiceBytesRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServicedRecursive) > 0 { + for _, e := range m.IoServicedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, e := range m.IoQueuedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, e := range m.IoServiceTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, e := range m.IoWaitTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoMergedRecursive) > 0 { + for _, e := range m.IoMergedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoTimeRecursive) > 0 { + for _, e := range m.IoTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.SectorsRecursive) > 0 { + for _, e := range m.SectorsRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Op) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Major != 0 { + n += 1 + sovMetrics(uint64(m.Major)) + } + if m.Minor != 0 { + n += 1 + sovMetrics(uint64(m.Minor)) + } + if m.Value != 0 { + n += 1 + sovMetrics(uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Current) > 0 { + for _, e := range m.Current { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.Limit) > 0 { + for _, e := range m.Limit { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.HcaHandles != 0 { + n += 1 + sovMetrics(uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + n += 1 + sovMetrics(uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *NetworkStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.RxBytes != 0 { + n += 1 + sovMetrics(uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + n += 1 + sovMetrics(uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + n += 1 + sovMetrics(uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + n += 1 + sovMetrics(uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + n += 1 + sovMetrics(uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + n += 1 + sovMetrics(uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + n += 1 + sovMetrics(uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + n += 1 + sovMetrics(uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovMetrics(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metrics) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Metrics{`, + `Hugetlb:` + strings.Replace(fmt.Sprintf("%v", this.Hugetlb), "HugetlbStat", "HugetlbStat", 1) + `,`, + `Pids:` + strings.Replace(fmt.Sprintf("%v", this.Pids), "PidsStat", "PidsStat", 1) + `,`, + `CPU:` + strings.Replace(fmt.Sprintf("%v", this.CPU), "CPUStat", "CPUStat", 1) + `,`, + `Memory:` + strings.Replace(fmt.Sprintf("%v", this.Memory), "MemoryStat", "MemoryStat", 1) + `,`, + `Blkio:` + strings.Replace(fmt.Sprintf("%v", this.Blkio), "BlkIOStat", "BlkIOStat", 1) + `,`, + `Rdma:` + strings.Replace(fmt.Sprintf("%v", this.Rdma), "RdmaStat", "RdmaStat", 1) + `,`, + `Network:` + strings.Replace(fmt.Sprintf("%v", this.Network), "NetworkStat", "NetworkStat", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *HugetlbStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&HugetlbStat{`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `Pagesize:` + fmt.Sprintf("%v", this.Pagesize) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *PidsStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsStat{`, + `Current:` + fmt.Sprintf("%v", this.Current) + `,`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUStat{`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "CPUUsage", "CPUUsage", 1) + `,`, + `Throttling:` + strings.Replace(fmt.Sprintf("%v", this.Throttling), "Throttle", "Throttle", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUUsage) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUUsage{`, + `Total:` + fmt.Sprintf("%v", this.Total) + `,`, + `Kernel:` + fmt.Sprintf("%v", this.Kernel) + `,`, + `User:` + fmt.Sprintf("%v", this.User) + `,`, + `PerCPU:` + fmt.Sprintf("%v", this.PerCPU) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *Throttle) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Throttle{`, + `Periods:` + fmt.Sprintf("%v", this.Periods) + `,`, + `ThrottledPeriods:` + fmt.Sprintf("%v", this.ThrottledPeriods) + `,`, + `ThrottledTime:` + fmt.Sprintf("%v", this.ThrottledTime) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryStat{`, + `Cache:` + fmt.Sprintf("%v", this.Cache) + `,`, + `RSS:` + fmt.Sprintf("%v", this.RSS) + `,`, + `RSSHuge:` + fmt.Sprintf("%v", this.RSSHuge) + `,`, + `MappedFile:` + fmt.Sprintf("%v", this.MappedFile) + `,`, + `Dirty:` + fmt.Sprintf("%v", this.Dirty) + `,`, + `Writeback:` + fmt.Sprintf("%v", this.Writeback) + `,`, + `PgPgIn:` + fmt.Sprintf("%v", this.PgPgIn) + `,`, + `PgPgOut:` + fmt.Sprintf("%v", this.PgPgOut) + `,`, + `PgFault:` + fmt.Sprintf("%v", this.PgFault) + `,`, + `PgMajFault:` + fmt.Sprintf("%v", this.PgMajFault) + `,`, + `InactiveAnon:` + fmt.Sprintf("%v", this.InactiveAnon) + `,`, + `ActiveAnon:` + fmt.Sprintf("%v", this.ActiveAnon) + `,`, + `InactiveFile:` + fmt.Sprintf("%v", this.InactiveFile) + `,`, + `ActiveFile:` + fmt.Sprintf("%v", this.ActiveFile) + `,`, + `Unevictable:` + fmt.Sprintf("%v", this.Unevictable) + `,`, + `HierarchicalMemoryLimit:` + fmt.Sprintf("%v", this.HierarchicalMemoryLimit) + `,`, + `HierarchicalSwapLimit:` + fmt.Sprintf("%v", this.HierarchicalSwapLimit) + `,`, + `TotalCache:` + fmt.Sprintf("%v", this.TotalCache) + `,`, + `TotalRSS:` + fmt.Sprintf("%v", this.TotalRSS) + `,`, + `TotalRSSHuge:` + fmt.Sprintf("%v", this.TotalRSSHuge) + `,`, + `TotalMappedFile:` + fmt.Sprintf("%v", this.TotalMappedFile) + `,`, + `TotalDirty:` + fmt.Sprintf("%v", this.TotalDirty) + `,`, + `TotalWriteback:` + fmt.Sprintf("%v", this.TotalWriteback) + `,`, + `TotalPgPgIn:` + fmt.Sprintf("%v", this.TotalPgPgIn) + `,`, + `TotalPgPgOut:` + fmt.Sprintf("%v", this.TotalPgPgOut) + `,`, + `TotalPgFault:` + fmt.Sprintf("%v", this.TotalPgFault) + `,`, + `TotalPgMajFault:` + fmt.Sprintf("%v", this.TotalPgMajFault) + `,`, + `TotalInactiveAnon:` + fmt.Sprintf("%v", this.TotalInactiveAnon) + `,`, + `TotalActiveAnon:` + fmt.Sprintf("%v", this.TotalActiveAnon) + `,`, + `TotalInactiveFile:` + fmt.Sprintf("%v", this.TotalInactiveFile) + `,`, + `TotalActiveFile:` + fmt.Sprintf("%v", this.TotalActiveFile) + `,`, + `TotalUnevictable:` + fmt.Sprintf("%v", this.TotalUnevictable) + `,`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Swap:` + strings.Replace(fmt.Sprintf("%v", this.Swap), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Kernel:` + strings.Replace(fmt.Sprintf("%v", this.Kernel), "MemoryEntry", "MemoryEntry", 1) + `,`, + `KernelTCP:` + strings.Replace(fmt.Sprintf("%v", this.KernelTCP), "MemoryEntry", "MemoryEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryEntry{`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOStat{`, + `IoServiceBytesRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceBytesRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServicedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServicedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoQueuedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoQueuedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServiceTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoWaitTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoWaitTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoMergedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoMergedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `SectorsRecursive:` + strings.Replace(fmt.Sprintf("%v", this.SectorsRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOEntry{`, + `Op:` + fmt.Sprintf("%v", this.Op) + `,`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `Major:` + fmt.Sprintf("%v", this.Major) + `,`, + `Minor:` + fmt.Sprintf("%v", this.Minor) + `,`, + `Value:` + fmt.Sprintf("%v", this.Value) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaStat{`, + `Current:` + strings.Replace(fmt.Sprintf("%v", this.Current), "RdmaEntry", "RdmaEntry", 1) + `,`, + `Limit:` + strings.Replace(fmt.Sprintf("%v", this.Limit), "RdmaEntry", "RdmaEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaEntry{`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `HcaHandles:` + fmt.Sprintf("%v", this.HcaHandles) + `,`, + `HcaObjects:` + fmt.Sprintf("%v", this.HcaObjects) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *NetworkStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NetworkStat{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `RxBytes:` + fmt.Sprintf("%v", this.RxBytes) + `,`, + `RxPackets:` + fmt.Sprintf("%v", this.RxPackets) + `,`, + `RxErrors:` + fmt.Sprintf("%v", this.RxErrors) + `,`, + `RxDropped:` + fmt.Sprintf("%v", this.RxDropped) + `,`, + `TxBytes:` + fmt.Sprintf("%v", this.TxBytes) + `,`, + `TxPackets:` + fmt.Sprintf("%v", this.TxPackets) + `,`, + `TxErrors:` + fmt.Sprintf("%v", this.TxErrors) + `,`, + `TxDropped:` + fmt.Sprintf("%v", this.TxDropped) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metrics) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metrics: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metrics: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Hugetlb", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Hugetlb = append(m.Hugetlb, &HugetlbStat{}) + if err := m.Hugetlb[len(m.Hugetlb)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pids", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Pids == nil { + m.Pids = &PidsStat{} + } + if err := m.Pids.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CPU", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CPU == nil { + m.CPU = &CPUStat{} + } + if err := m.CPU.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Memory", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Memory == nil { + m.Memory = &MemoryStat{} + } + if err := m.Memory.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Blkio", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Blkio == nil { + m.Blkio = &BlkIOStat{} + } + if err := m.Blkio.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rdma", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Rdma == nil { + m.Rdma = &RdmaStat{} + } + if err := m.Rdma.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Network", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Network = append(m.Network, &NetworkStat{}) + if err := m.Network[len(m.Network)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *HugetlbStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: HugetlbStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: HugetlbStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pagesize", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Pagesize = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + m.Current = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Current |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &CPUUsage{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Throttling", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Throttling == nil { + m.Throttling = &Throttle{} + } + if err := m.Throttling.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUUsage) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUUsage: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUUsage: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Total", wireType) + } + m.Total = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Total |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + m.Kernel = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Kernel |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field User", wireType) + } + m.User = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.User |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType == 0 { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.PerCPU) == 0 { + m.PerCPU = make([]uint64, 0, elementCount) + } + for iNdEx < postIndex { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field PerCPU", wireType) + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Throttle) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Throttle: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Throttle: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Periods", wireType) + } + m.Periods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Periods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledPeriods", wireType) + } + m.ThrottledPeriods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledPeriods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledTime", wireType) + } + m.ThrottledTime = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledTime |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Cache", wireType) + } + m.Cache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Cache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSS", wireType) + } + m.RSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSSHuge", wireType) + } + m.RSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MappedFile", wireType) + } + m.MappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Dirty", wireType) + } + m.Dirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Dirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Writeback", wireType) + } + m.Writeback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Writeback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgIn", wireType) + } + m.PgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgOut", wireType) + } + m.PgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgFault", wireType) + } + m.PgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgMajFault", wireType) + } + m.PgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveAnon", wireType) + } + m.InactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveAnon", wireType) + } + m.ActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveFile", wireType) + } + m.InactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 14: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveFile", wireType) + } + m.ActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 15: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Unevictable", wireType) + } + m.Unevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Unevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 16: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalMemoryLimit", wireType) + } + m.HierarchicalMemoryLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalMemoryLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 17: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalSwapLimit", wireType) + } + m.HierarchicalSwapLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalSwapLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 18: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalCache", wireType) + } + m.TotalCache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalCache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 19: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSS", wireType) + } + m.TotalRSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 20: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSSHuge", wireType) + } + m.TotalRSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 21: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalMappedFile", wireType) + } + m.TotalMappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalMappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 22: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalDirty", wireType) + } + m.TotalDirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalDirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 23: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalWriteback", wireType) + } + m.TotalWriteback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalWriteback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 24: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgIn", wireType) + } + m.TotalPgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 25: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgOut", wireType) + } + m.TotalPgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 26: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgFault", wireType) + } + m.TotalPgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 27: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgMajFault", wireType) + } + m.TotalPgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 28: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveAnon", wireType) + } + m.TotalInactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 29: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveAnon", wireType) + } + m.TotalActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 30: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveFile", wireType) + } + m.TotalInactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 31: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveFile", wireType) + } + m.TotalActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 32: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalUnevictable", wireType) + } + m.TotalUnevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalUnevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 33: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &MemoryEntry{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 34: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Swap", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Swap == nil { + m.Swap = &MemoryEntry{} + } + if err := m.Swap.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 35: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Kernel == nil { + m.Kernel = &MemoryEntry{} + } + if err := m.Kernel.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 36: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTCP", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.KernelTCP == nil { + m.KernelTCP = &MemoryEntry{} + } + if err := m.KernelTCP.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceBytesRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceBytesRecursive = append(m.IoServiceBytesRecursive, &BlkIOEntry{}) + if err := m.IoServiceBytesRecursive[len(m.IoServiceBytesRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServicedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServicedRecursive = append(m.IoServicedRecursive, &BlkIOEntry{}) + if err := m.IoServicedRecursive[len(m.IoServicedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoQueuedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoQueuedRecursive = append(m.IoQueuedRecursive, &BlkIOEntry{}) + if err := m.IoQueuedRecursive[len(m.IoQueuedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceTimeRecursive = append(m.IoServiceTimeRecursive, &BlkIOEntry{}) + if err := m.IoServiceTimeRecursive[len(m.IoServiceTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoWaitTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoWaitTimeRecursive = append(m.IoWaitTimeRecursive, &BlkIOEntry{}) + if err := m.IoWaitTimeRecursive[len(m.IoWaitTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoMergedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoMergedRecursive = append(m.IoMergedRecursive, &BlkIOEntry{}) + if err := m.IoMergedRecursive[len(m.IoMergedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoTimeRecursive = append(m.IoTimeRecursive, &BlkIOEntry{}) + if err := m.IoTimeRecursive[len(m.IoTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SectorsRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SectorsRecursive = append(m.SectorsRecursive, &BlkIOEntry{}) + if err := m.SectorsRecursive[len(m.SectorsRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Op", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Op = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Major", wireType) + } + m.Major = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Major |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Minor", wireType) + } + m.Minor = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Minor |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Value", wireType) + } + m.Value = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Value |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Current = append(m.Current, &RdmaEntry{}) + if err := m.Current[len(m.Current)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Limit = append(m.Limit, &RdmaEntry{}) + if err := m.Limit[len(m.Limit)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaHandles", wireType) + } + m.HcaHandles = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaHandles |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaObjects", wireType) + } + m.HcaObjects = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaObjects |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NetworkStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NetworkStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NetworkStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxBytes", wireType) + } + m.RxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxPackets", wireType) + } + m.RxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxErrors", wireType) + } + m.RxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxDropped", wireType) + } + m.RxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxBytes", wireType) + } + m.TxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxPackets", wireType) + } + m.TxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxErrors", wireType) + } + m.TxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxDropped", wireType) + } + m.TxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMetrics(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt new file mode 100644 index 000000000..7a960c678 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt @@ -0,0 +1,712 @@ +file { + name: "github.com/containerd/cgroups/stats/v1/metrics.proto" + package: "io.containerd.cgroups.v1" + dependency: "gogoproto/gogo.proto" + message_type { + name: "Metrics" + field { + name: "hugetlb" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.HugetlbStat" + json_name: "hugetlb" + } + field { + name: "pids" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.PidsStat" + json_name: "pids" + } + field { + name: "cpu" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUStat" + options { + 65004: "CPU" + } + json_name: "cpu" + } + field { + name: "memory" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryStat" + json_name: "memory" + } + field { + name: "blkio" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOStat" + json_name: "blkio" + } + field { + name: "rdma" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaStat" + json_name: "rdma" + } + field { + name: "network" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.NetworkStat" + json_name: "network" + } + } + message_type { + name: "HugetlbStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + field { + name: "pagesize" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "pagesize" + } + } + message_type { + name: "PidsStat" + field { + name: "current" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + } + message_type { + name: "CPUStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUUsage" + json_name: "usage" + } + field { + name: "throttling" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.Throttle" + json_name: "throttling" + } + } + message_type { + name: "CPUUsage" + field { + name: "total" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "total" + } + field { + name: "kernel" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "kernel" + } + field { + name: "user" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "user" + } + field { + name: "per_cpu" + number: 4 + label: LABEL_REPEATED + type: TYPE_UINT64 + options { + 65004: "PerCPU" + } + json_name: "perCpu" + } + } + message_type { + name: "Throttle" + field { + name: "periods" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "periods" + } + field { + name: "throttled_periods" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledPeriods" + } + field { + name: "throttled_time" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledTime" + } + } + message_type { + name: "MemoryStat" + field { + name: "cache" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "cache" + } + field { + name: "rss" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSS" + } + json_name: "rss" + } + field { + name: "rss_huge" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSSHuge" + } + json_name: "rssHuge" + } + field { + name: "mapped_file" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "mappedFile" + } + field { + name: "dirty" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "dirty" + } + field { + name: "writeback" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "writeback" + } + field { + name: "pg_pg_in" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgIn" + } + field { + name: "pg_pg_out" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgOut" + } + field { + name: "pg_fault" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgFault" + } + field { + name: "pg_maj_fault" + number: 10 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgMajFault" + } + field { + name: "inactive_anon" + number: 11 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveAnon" + } + field { + name: "active_anon" + number: 12 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeAnon" + } + field { + name: "inactive_file" + number: 13 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveFile" + } + field { + name: "active_file" + number: 14 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeFile" + } + field { + name: "unevictable" + number: 15 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "unevictable" + } + field { + name: "hierarchical_memory_limit" + number: 16 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalMemoryLimit" + } + field { + name: "hierarchical_swap_limit" + number: 17 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalSwapLimit" + } + field { + name: "total_cache" + number: 18 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalCache" + } + field { + name: "total_rss" + number: 19 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSS" + } + json_name: "totalRss" + } + field { + name: "total_rss_huge" + number: 20 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSSHuge" + } + json_name: "totalRssHuge" + } + field { + name: "total_mapped_file" + number: 21 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalMappedFile" + } + field { + name: "total_dirty" + number: 22 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalDirty" + } + field { + name: "total_writeback" + number: 23 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalWriteback" + } + field { + name: "total_pg_pg_in" + number: 24 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgIn" + } + field { + name: "total_pg_pg_out" + number: 25 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgOut" + } + field { + name: "total_pg_fault" + number: 26 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgFault" + } + field { + name: "total_pg_maj_fault" + number: 27 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgMajFault" + } + field { + name: "total_inactive_anon" + number: 28 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveAnon" + } + field { + name: "total_active_anon" + number: 29 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveAnon" + } + field { + name: "total_inactive_file" + number: 30 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveFile" + } + field { + name: "total_active_file" + number: 31 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveFile" + } + field { + name: "total_unevictable" + number: 32 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalUnevictable" + } + field { + name: "usage" + number: 33 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "usage" + } + field { + name: "swap" + number: 34 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "swap" + } + field { + name: "kernel" + number: 35 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "kernel" + } + field { + name: "kernel_tcp" + number: 36 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + options { + 65004: "KernelTCP" + } + json_name: "kernelTcp" + } + } + message_type { + name: "MemoryEntry" + field { + name: "limit" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + field { + name: "usage" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + } + message_type { + name: "BlkIOStat" + field { + name: "io_service_bytes_recursive" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceBytesRecursive" + } + field { + name: "io_serviced_recursive" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServicedRecursive" + } + field { + name: "io_queued_recursive" + number: 3 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioQueuedRecursive" + } + field { + name: "io_service_time_recursive" + number: 4 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceTimeRecursive" + } + field { + name: "io_wait_time_recursive" + number: 5 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioWaitTimeRecursive" + } + field { + name: "io_merged_recursive" + number: 6 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioMergedRecursive" + } + field { + name: "io_time_recursive" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioTimeRecursive" + } + field { + name: "sectors_recursive" + number: 8 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "sectorsRecursive" + } + } + message_type { + name: "BlkIOEntry" + field { + name: "op" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "op" + } + field { + name: "device" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "major" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "major" + } + field { + name: "minor" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "minor" + } + field { + name: "value" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "value" + } + } + message_type { + name: "RdmaStat" + field { + name: "current" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "limit" + } + } + message_type { + name: "RdmaEntry" + field { + name: "device" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "hca_handles" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaHandles" + } + field { + name: "hca_objects" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaObjects" + } + } + message_type { + name: "NetworkStat" + field { + name: "name" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "name" + } + field { + name: "rx_bytes" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxBytes" + } + field { + name: "rx_packets" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxPackets" + } + field { + name: "rx_errors" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxErrors" + } + field { + name: "rx_dropped" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxDropped" + } + field { + name: "tx_bytes" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txBytes" + } + field { + name: "tx_packets" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txPackets" + } + field { + name: "tx_errors" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txErrors" + } + field { + name: "tx_dropped" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txDropped" + } + } + syntax: "proto3" +} diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto new file mode 100644 index 000000000..62b519806 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto @@ -0,0 +1,136 @@ +syntax = "proto3"; + +package io.containerd.cgroups.v1; + +import "gogoproto/gogo.proto"; + +message Metrics { + repeated HugetlbStat hugetlb = 1; + PidsStat pids = 2; + CPUStat cpu = 3 [(gogoproto.customname) = "CPU"]; + MemoryStat memory = 4; + BlkIOStat blkio = 5; + RdmaStat rdma = 6; + repeated NetworkStat network = 7; +} + +message HugetlbStat { + uint64 usage = 1; + uint64 max = 2; + uint64 failcnt = 3; + string pagesize = 4; +} + +message PidsStat { + uint64 current = 1; + uint64 limit = 2; +} + +message CPUStat { + CPUUsage usage = 1; + Throttle throttling = 2; +} + +message CPUUsage { + // values in nanoseconds + uint64 total = 1; + uint64 kernel = 2; + uint64 user = 3; + repeated uint64 per_cpu = 4 [(gogoproto.customname) = "PerCPU"]; + +} + +message Throttle { + uint64 periods = 1; + uint64 throttled_periods = 2; + uint64 throttled_time = 3; +} + +message MemoryStat { + uint64 cache = 1; + uint64 rss = 2 [(gogoproto.customname) = "RSS"]; + uint64 rss_huge = 3 [(gogoproto.customname) = "RSSHuge"]; + uint64 mapped_file = 4; + uint64 dirty = 5; + uint64 writeback = 6; + uint64 pg_pg_in = 7; + uint64 pg_pg_out = 8; + uint64 pg_fault = 9; + uint64 pg_maj_fault = 10; + uint64 inactive_anon = 11; + uint64 active_anon = 12; + uint64 inactive_file = 13; + uint64 active_file = 14; + uint64 unevictable = 15; + uint64 hierarchical_memory_limit = 16; + uint64 hierarchical_swap_limit = 17; + uint64 total_cache = 18; + uint64 total_rss = 19 [(gogoproto.customname) = "TotalRSS"]; + uint64 total_rss_huge = 20 [(gogoproto.customname) = "TotalRSSHuge"]; + uint64 total_mapped_file = 21; + uint64 total_dirty = 22; + uint64 total_writeback = 23; + uint64 total_pg_pg_in = 24; + uint64 total_pg_pg_out = 25; + uint64 total_pg_fault = 26; + uint64 total_pg_maj_fault = 27; + uint64 total_inactive_anon = 28; + uint64 total_active_anon = 29; + uint64 total_inactive_file = 30; + uint64 total_active_file = 31; + uint64 total_unevictable = 32; + MemoryEntry usage = 33; + MemoryEntry swap = 34; + MemoryEntry kernel = 35; + MemoryEntry kernel_tcp = 36 [(gogoproto.customname) = "KernelTCP"]; + +} + +message MemoryEntry { + uint64 limit = 1; + uint64 usage = 2; + uint64 max = 3; + uint64 failcnt = 4; +} + +message BlkIOStat { + repeated BlkIOEntry io_service_bytes_recursive = 1; + repeated BlkIOEntry io_serviced_recursive = 2; + repeated BlkIOEntry io_queued_recursive = 3; + repeated BlkIOEntry io_service_time_recursive = 4; + repeated BlkIOEntry io_wait_time_recursive = 5; + repeated BlkIOEntry io_merged_recursive = 6; + repeated BlkIOEntry io_time_recursive = 7; + repeated BlkIOEntry sectors_recursive = 8; +} + +message BlkIOEntry { + string op = 1; + string device = 2; + uint64 major = 3; + uint64 minor = 4; + uint64 value = 5; +} + +message RdmaStat { + repeated RdmaEntry current = 1; + repeated RdmaEntry limit = 2; +} + +message RdmaEntry { + string device = 1; + uint32 hca_handles = 2; + uint32 hca_objects = 3; +} + +message NetworkStat { + string name = 1; + uint64 rx_bytes = 2; + uint64 rx_packets = 3; + uint64 rx_errors = 4; + uint64 rx_dropped = 5; + uint64 tx_bytes = 6; + uint64 tx_packets = 7; + uint64 tx_errors = 8; + uint64 tx_dropped = 9; +} diff --git a/vendor/github.com/containers/buildah/.travis.yml b/vendor/github.com/containers/buildah/.travis.yml index a74108230..8bf3756f5 100644 --- a/vendor/github.com/containers/buildah/.travis.yml +++ b/vendor/github.com/containers/buildah/.travis.yml @@ -68,21 +68,25 @@ script: # Fail fast - set -e # Let's do some docker stuff just for verification purposes - - docker ps --all - - docker images - - ls -alF /home/travis/auth - - docker pull docker.io/alpine - - echo testpassword | docker login localhost:5000 --username testuser --password-stdin - - docker tag alpine localhost:5000/my-alpine - - docker push localhost:5000/my-alpine - - docker ps --all - - docker images - - docker rmi docker.io/alpine - - docker rmi localhost:5000/my-alpine - - docker pull localhost:5000/my-alpine - - docker ps --all - - docker images - - docker rmi localhost:5000/my-alpine +# Commented out the following in order to get travis runs +# under the 50 minute requirement. Do not remove as we may +# want to use this in cirrius testing when we move there. +# - docker ps --all +# - docker images +# - ls -alF /home/travis/auth +# - docker pull docker.io/alpine +# - echo testpassword | docker login localhost:5000 --username testuser --password-stdin +# - docker tag alpine localhost:5000/my-alpine +# - docker push localhost:5000/my-alpine +# - docker ps --all +# - docker images +# - docker rmi docker.io/alpine +# - docker rmi localhost:5000/my-alpine +# - docker pull localhost:5000/my-alpine +# - docker ps --all +# - docker images +# - docker rmi localhost:5000/my-alpine +# End Speed up comment # Setting up Docker Registry is complete, let's do Buildah testing! - make install.tools -j4 - make install.libseccomp.sudo all runc validate lint SECURITYTAGS="apparmor seccomp" diff --git a/vendor/github.com/containers/buildah/buildah.go b/vendor/github.com/containers/buildah/buildah.go index d57eea818..7042590d1 100644 --- a/vendor/github.com/containers/buildah/buildah.go +++ b/vendor/github.com/containers/buildah/buildah.go @@ -27,7 +27,7 @@ const ( Package = "buildah" // Version for the Package. Bump version in contrib/rpm/buildah.spec // too. - Version = "1.12.0-dev" + Version = "1.11.5" // The value we use to identify what type of information, currently a // serialized Builder structure, we are using as per-container state. // This should only be changed when we make incompatible changes to @@ -40,7 +40,7 @@ const ( stateFile = Package + ".json" ) -// PullPolicy takes the value PullIfMissing, PullAlways, or PullNever. +// PullPolicy takes the value PullIfMissing, PullAlways, PullIfNewer, or PullNever. type PullPolicy int const ( @@ -52,6 +52,11 @@ const ( // take, signalling that a fresh, possibly updated, copy of the image // should be pulled from a registry before the build proceeds. PullAlways + // PullIfNewer is one of the values that BuilderOptions.PullPolicy + // can take, signalling that the source image should only be pulled + // from a registry if a local copy is not already present or if a + // newer version the image is present on the repository. + PullIfNewer // PullNever is one of the values that BuilderOptions.PullPolicy can // take, signalling that the source image should not be pulled from a // registry if a local copy of it is not already present. @@ -65,6 +70,8 @@ func (p PullPolicy) String() string { return "PullIfMissing" case PullAlways: return "PullAlways" + case PullIfNewer: + return "PullIfNewer" case PullNever: return "PullNever" } diff --git a/vendor/github.com/containers/buildah/changelog.txt b/vendor/github.com/containers/buildah/changelog.txt index 6e98e5405..098e6d6d4 100644 --- a/vendor/github.com/containers/buildah/changelog.txt +++ b/vendor/github.com/containers/buildah/changelog.txt @@ -1,3 +1,30 @@ +- Changelog for v1.11.5 (2019-11-11) + * Enhance error on unsafe symbolic link targets + * Add OCIRuntime to info + * Check nonexsit authfile + * Only output image id if running buildah bud --quiet + * Fix --pull=true||false and add --pull-never to bud and from (retry) + * cgroups v2: tweak or skip tests + * Prepwork: new 'skip' helpers for tests + * Handle configuration blobs for manifest lists + * unmarshalConvertedConfig: avoid using the updated image's ref + * Add completions for Manifest commands + * Add disableFips option to secrets pkg + * Update bud.bats test archive test + * Add test for caching based on content digest + * Builder.untarPath(): always evaluate b.ContentDigester.Hash() + * Bump github.com/onsi/ginkgo from 1.10.1 to 1.10.2 + * Fix another broken test: copy-url-mtime + * yet more fixes + * Actual bug fix for 'add' test: fix the expected mode + * BATS tests - lots of mostly minor cleanup + * build: drop support for ostree + * Add support for make vendor-in-container + * imgtype: exit with error if storage fails + * remove XDG_RUNTIME_DIR from default authfile path + * fix troubleshooting redirect instructions + * Bump back to v1.12.0-dev + - Changelog for v1.11.4 (2019-10-28) * buildah: add a "manifest" command * manifests: add the module diff --git a/vendor/github.com/containers/buildah/config.go b/vendor/github.com/containers/buildah/config.go index 617619e45..32f2171eb 100644 --- a/vendor/github.com/containers/buildah/config.go +++ b/vendor/github.com/containers/buildah/config.go @@ -26,7 +26,7 @@ func unmarshalConvertedConfig(ctx context.Context, dest interface{}, img types.I return errors.Wrapf(err, "error getting manifest MIME type for %q", transports.ImageName(img.Reference())) } if wantedManifestMIMEType != actualManifestMIMEType { - img, err = img.UpdatedImage(ctx, types.ManifestUpdateOptions{ + updatedImg, err := img.UpdatedImage(ctx, types.ManifestUpdateOptions{ ManifestMIMEType: wantedManifestMIMEType, InformationOnly: types.ManifestUpdateInformation{ // Strictly speaking, every value in here is invalid. But… Destination: nil, // Destination is technically required, but actually necessary only for conversion _to_ v2s1. Leave it nil, we will crash if that ever changes. @@ -35,8 +35,9 @@ func unmarshalConvertedConfig(ctx context.Context, dest interface{}, img types.I }, }) if err != nil { - return errors.Wrapf(err, "error converting image %q to %s", transports.ImageName(img.Reference()), wantedManifestMIMEType) + return errors.Wrapf(err, "error converting image %q from %q to %q", transports.ImageName(img.Reference()), actualManifestMIMEType, wantedManifestMIMEType) } + img = updatedImg } config, err := img.ConfigBlob(ctx) if err != nil { diff --git a/vendor/github.com/containers/buildah/go.mod b/vendor/github.com/containers/buildah/go.mod index c8741b781..2c76c46bf 100644 --- a/vendor/github.com/containers/buildah/go.mod +++ b/vendor/github.com/containers/buildah/go.mod @@ -14,7 +14,7 @@ require ( github.com/docker/go-units v0.4.0 github.com/docker/libnetwork v0.8.0-dev.2.0.20190625141545-5a177b73e316 github.com/etcd-io/bbolt v1.3.3 - github.com/fsouza/go-dockerclient v1.5.0 + github.com/fsouza/go-dockerclient v1.6.0 github.com/ghodss/yaml v1.0.0 github.com/hashicorp/go-multierror v1.0.0 github.com/imdario/mergo v0.3.6 // indirect @@ -43,7 +43,7 @@ require ( github.com/vishvananda/netns v0.0.0-20190625233234-7109fa855b0f // indirect github.com/xeipuuv/gojsonschema v1.1.0 // indirect golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad - golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 golang.org/x/time v0.0.0-20190921001708-c4c64cad1fd0 // indirect google.golang.org/grpc v1.24.0 // indirect k8s.io/api v0.0.0-20190813020757-36bff7324fb7 // indirect diff --git a/vendor/github.com/containers/buildah/go.sum b/vendor/github.com/containers/buildah/go.sum index 4a6673b04..15dab4794 100644 --- a/vendor/github.com/containers/buildah/go.sum +++ b/vendor/github.com/containers/buildah/go.sum @@ -11,8 +11,12 @@ github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiU github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c h1:YMP6olTU903X3gxQJckdmiP8/zkSMq4kN3uipsU9XjU= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c/go.mod h1:7xhjOwRV2+0HXGmM0jxaEu+ZiXJFoVZOTfL/dmqbrD8= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= github.com/PuerkitoBio/purell v1.0.0/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= github.com/PuerkitoBio/urlesc v0.0.0-20160726150825-5bd2802263f2/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= @@ -25,14 +29,25 @@ github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24 github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM= github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/blang/semver v3.5.0+incompatible h1:CGxCgetQ64DKk7rdZ++Vfnb1+ogGNnB17OJKJXD2Cfs= github.com/blang/semver v3.5.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY= github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882bXEDKfWIf0wa8HRvpnBoPszJJXL+TVbBw4M= github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= github.com/containernetworking/cni v0.7.1 h1:fE3r16wpSEyaqY4Z4oFrLMmIGfBYIKpPrHK31EJ9FzE= github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= github.com/containers/image/v4 v4.0.1 h1:idNGHChj0Pyv3vLrxul2oSVMZLeFqpoq3CjLeVgapSQ= @@ -48,6 +63,7 @@ github.com/containers/storage v1.13.5/go.mod h1:HELz8Sn+UVbPaUZMI8RvIG9doD4y4z6G github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk= github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/cpuguy83/go-md2man v1.0.10/go.mod h1:SmD6nW6nTyfqj6ABTjUi3V3JVMnlJmwcJI5acqYI6dE= github.com/cyphar/filepath-securejoin v0.2.2 h1:jCwT2GTP+PY5nBz3c/YL5PAIbusElVrPujOBSCj8xRg= github.com/cyphar/filepath-securejoin v0.2.2/go.mod h1:FpkQEhXnPnOthhzymB7CGsFk2G9VLXONKD9G7QGMM+4= @@ -64,6 +80,8 @@ github.com/docker/docker v1.4.2-0.20190710153559-aa8249ae1b8b h1:+Ga+YpCDpcY1fln github.com/docker/docker v1.4.2-0.20190710153559-aa8249ae1b8b/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce h1:H3csZuxZESJeeEiOxq4YXPNmLFbjl7u2qVBrAAGX/sA= github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= github.com/docker/docker-credential-helpers v0.6.1 h1:Dq4iIfcM7cNtddhLVWe9h4QDjsi4OER3Z8voPu/I52g= github.com/docker/docker-credential-helpers v0.6.1/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= @@ -90,6 +108,8 @@ github.com/fsouza/go-dockerclient v1.4.4 h1:Sd5nD4wdAgiPxvrbYUzT2ZZNmPk3z+GGnZ+f github.com/fsouza/go-dockerclient v1.4.4/go.mod h1:PrwszSL5fbmsESocROrOGq/NULMXRw+bajY0ltzD6MA= github.com/fsouza/go-dockerclient v1.5.0 h1:7OtayOe5HnoG+KWMHgyyPymwaodnB2IDYuVfseKyxbA= github.com/fsouza/go-dockerclient v1.5.0/go.mod h1:AqZZK/zFO3phxYxlTsAaeAMSdQ9mgHuhy+bjN034Qds= +github.com/fsouza/go-dockerclient v1.6.0 h1:f7j+AX94143JL1H3TiqSMkM4EcLDI0De1qD4GGn3Hig= +github.com/fsouza/go-dockerclient v1.6.0/go.mod h1:YWwtNPuL4XTX1SKJQk86cWPmmqwx+4np9qfPbb+znGc= github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk= @@ -102,6 +122,7 @@ github.com/go-openapi/jsonreference v0.0.0-20160704190145-13c6e3589ad9/go.mod h1 github.com/go-openapi/spec v0.0.0-20160808142527-6aced65f8501/go.mod h1:J8+jY1nAiCcj+friV/PDoE1/3eeccG9LYBs0tYvLOWc= github.com/go-openapi/swag v0.0.0-20160704191624-1d0bd113de87/go.mod h1:DXUve3Dpr1UfpPtxFw+EFuQ41HhCWZfha5jSVRG7C7I= github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= @@ -133,11 +154,15 @@ github.com/gorilla/mux v0.0.0-20170217192616-94e7d24fd285/go.mod h1:1lud6UwP+6or github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gotestyourself/gotestyourself v2.2.0+incompatible/go.mod h1:zZKM6oeNM8k+FRljX1mnzVYeS8wiGgQyvST1/GafPbY= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ= github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI= github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= @@ -219,19 +244,23 @@ github.com/onsi/gomega v1.5.0 h1:izbySO9zDPmjJ8rDjLvkA2zJHIo+HkYXHnf7eN7SSyo= github.com/onsi/gomega v1.5.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.0 h1:XPnZz8VVBHjVsy1vzJmRwIcSwiUO+JFfrv/xGiigmME= github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU= github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0= github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158 h1:/A6bAdnSZoTQmKml3MdHAnSEPnBAQeigNBl4sxnfaaQ= github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7 h1:Dliu5QO+4JYWu/yMshaMU7G3JN2POGpwjJN7gjy10Go= github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/runtime-tools v0.9.0 h1:FYgwVsKRI/H9hU32MJ/4MLOzXWodKK5zsQavY8NPMkU= github.com/opencontainers/runtime-tools v0.9.0/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg= @@ -271,6 +300,8 @@ github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= github.com/prometheus/procfs v0.0.3 h1:CTwfnzjQ+8dS6MhHHu4YswVAD99sL2wjPqP+VkURmKE= github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= github.com/russross/blackfriday v1.5.2/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g= github.com/seccomp/containers-golang v0.0.0-20180629143253-cdfdaa7543f4 h1:rOG9oHVIndNR14f3HRyBy9UPQYmIPniWqTU1TDdHhq4= github.com/seccomp/containers-golang v0.0.0-20180629143253-cdfdaa7543f4/go.mod h1:f/98/SnvAzhAEFQJ3u836FePXvcbE8BS0YGMQNn4mhA= @@ -300,6 +331,7 @@ github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs= @@ -307,6 +339,7 @@ github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0= github.com/ulikunitz/xz v0.5.6 h1:jGHAfXawEGZQ3blwU5wnWKQJvAraT7Ftq9EXjnXYgt8= github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE= github.com/vbatts/tar-split v0.11.1/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g= github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tLAD8IceomUCNw= @@ -321,12 +354,15 @@ github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xeipuuv/gojsonschema v0.0.0-20190816131739-be0936907f66/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y= github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg= github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q= go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= @@ -335,12 +371,19 @@ golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4 h1:HuIa8hRrWRSrqYzx1qI49N golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad h1:5E5raQxcv+6CZ11RrBYQe5WRbUIWpScjh0kvHZkZIrQ= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= golang.org/x/net v0.0.0-20170114055629-f2499483f923/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU= golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= @@ -349,9 +392,11 @@ golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4 h1:YUO/7uOKsKeq9UokNS62b8FYywz3ker1l1vDZRCRefw= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20170830134202-bb24a47a89ea/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -360,7 +405,9 @@ golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5h golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190422165155-953cdadca894 h1:Cz4ceDQGXuKRnVBDTS23GTn/pU5OE2C0WrNTOYK1Uuc= golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -370,6 +417,8 @@ golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3 h1:4y9KwBHBgBNwDbtu44R5o1fdO golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 h1:tdsQdquKbTNMsSZLqnLELJGzCANp9oXhu6zFBW6ODx4= golang.org/x/sys v0.0.0-20190902133755-9109b7679e13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -382,12 +431,19 @@ golang.org/x/tools v0.0.0-20180810170437-e96c4e24768d/go.mod h1:n7NCudcB/nEzxVGm golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20181011042414-1f849cf54d09/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= google.golang.org/genproto v0.0.0-20180831171423-11092d34479b h1:lohp5blsw53GBXtLyLNaTXPXS9pJ1tiTw61ZHUoE9Qw= google.golang.org/genproto v0.0.0-20180831171423-11092d34479b/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.22.0 h1:J0UbZOIrCAl+fpTOf8YLs4dJo8L/owV4LYVtAXQoPkw= google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= google.golang.org/grpc v1.24.0 h1:vb/1TCsVn3DcJlQ0Gs1yB1pKI6Do2/QNwxdKqmc/b0s= @@ -410,6 +466,7 @@ gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gotest.tools v0.0.0-20190624233834-05ebafbffc79/go.mod h1:R//lfYlUuTOTfblYI3lGoAAAebUdzjvbmQsuB7Ykd90= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= k8s.io/api v0.0.0-20190813020757-36bff7324fb7 h1:4uJOjRn9kWq4AqJRE8+qzmAy+lJd9rh8TY455dNef4U= k8s.io/api v0.0.0-20190813020757-36bff7324fb7/go.mod h1:3Iy+myeAORNCLgjd/Xu9ebwN7Vh59Bw0vh9jhoX+V58= @@ -423,6 +480,7 @@ k8s.io/klog v0.0.0-20181102134211-b9b56d5dfc92/go.mod h1:Gq+BEi5rUBO/HRz0bTSXDUc k8s.io/klog v0.3.1 h1:RVgyDHY/kFKtLqh67NvEWIgkMneNoIrdkN0CxDSQc68= k8s.io/klog v0.3.1/go.mod h1:Gq+BEi5rUBO/HRz0bTSXDUcqjScdoY3a9IHpCEIOOfk= k8s.io/kube-openapi v0.0.0-20190709113604-33be087ad058/go.mod h1:nfDlWeOsu3pUf4yWGL+ERqohP4YsZcBJXWMK+gkzOA4= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= sigs.k8s.io/structured-merge-diff v0.0.0-20190525122527-15d366b2352e/go.mod h1:wWxsB5ozmmv/SG7nM11ayaAW51xMvak/t1r0CSlcokI= sigs.k8s.io/yaml v1.1.0 h1:4A07+ZFc2wgJwo8YNlQpr1rVlgUDlxXHhPJciaPY5gs= sigs.k8s.io/yaml v1.1.0/go.mod h1:UJmg0vDUVViEyp3mgSv9WPwZCDxu4rQW1olrI1uml+o= diff --git a/vendor/github.com/containers/buildah/imagebuildah/build.go b/vendor/github.com/containers/buildah/imagebuildah/build.go index 6b2c9c84c..fb9600b1a 100644 --- a/vendor/github.com/containers/buildah/imagebuildah/build.go +++ b/vendor/github.com/containers/buildah/imagebuildah/build.go @@ -27,6 +27,7 @@ import ( const ( PullIfMissing = buildah.PullIfMissing PullAlways = buildah.PullAlways + PullIfNewer = buildah.PullIfNewer PullNever = buildah.PullNever Gzip = archive.Gzip @@ -45,7 +46,7 @@ type BuildOptions struct { // commands. ContextDirectory string // PullPolicy controls whether or not we pull images. It should be one - // of PullIfMissing, PullAlways, or PullNever. + // of PullIfMissing, PullAlways, PullIfNewer, or PullNever. PullPolicy buildah.PullPolicy // Registry is a value which is prepended to the image's name, if it // needs to be pulled and the image name alone can not be resolved to a diff --git a/vendor/github.com/containers/buildah/imagebuildah/executor.go b/vendor/github.com/containers/buildah/imagebuildah/executor.go index 27ec1bb23..35fc3d63d 100644 --- a/vendor/github.com/containers/buildah/imagebuildah/executor.go +++ b/vendor/github.com/containers/buildah/imagebuildah/executor.go @@ -339,6 +339,11 @@ func (b *Executor) Build(ctx context.Context, stages imagebuilder.Stages) (image var cleanupImages []string cleanupStages := make(map[int]*StageExecutor) + stdout := b.out + if b.quiet { + b.out = ioutil.Discard + } + cleanup := func() error { var lastErr error // Clean up any containers associated with the final container @@ -527,6 +532,10 @@ func (b *Executor) Build(ctx context.Context, stages imagebuilder.Stages) (image if err = ioutil.WriteFile(b.iidfile, []byte(imageID), 0644); err != nil { return imageID, ref, errors.Wrapf(err, "failed to write image ID to file %q", b.iidfile) } + } else { + if _, err := stdout.Write([]byte(imageID + "\n")); err != nil { + return imageID, ref, errors.Wrapf(err, "failed to write image ID to stdout") + } } return imageID, ref, nil diff --git a/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go b/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go index fad2bfe95..67c0a0eb9 100644 --- a/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go +++ b/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go @@ -318,7 +318,7 @@ func (s *StageExecutor) digestSpecifiedContent(node *parser.Node, argValues []st // directory. contextSrc, err := securejoin.SecureJoin(contextDir, src) if err != nil { - return "", errors.Wrapf(err, "error joining %q and %q", contextDir, src) + return "", errors.Wrapf(err, "forbidden path for %q, it is outside of the build context %q", src, contextDir) } sources = append(sources, contextSrc) } @@ -432,7 +432,7 @@ func (s *StageExecutor) Copy(excludes []string, copies ...imagebuilder.Copy) err // directory. srcSecure, err := securejoin.SecureJoin(contextDir, src) if err != nil { - return err + return errors.Wrapf(err, "forbidden path for %q, it is outside of the build context %q", src, contextDir) } if hadFinalPathSeparator { // If destination is a folder, we need to take extra care to diff --git a/vendor/github.com/containers/buildah/import.go b/vendor/github.com/containers/buildah/import.go index 751ce6ae1..329633b44 100644 --- a/vendor/github.com/containers/buildah/import.go +++ b/vendor/github.com/containers/buildah/import.go @@ -5,8 +5,10 @@ import ( "github.com/containers/buildah/docker" "github.com/containers/buildah/util" + "github.com/containers/image/v5/image" "github.com/containers/image/v5/manifest" is "github.com/containers/image/v5/storage" + "github.com/containers/image/v5/transports" "github.com/containers/image/v5/types" "github.com/containers/storage" digest "github.com/opencontainers/go-digest" @@ -28,12 +30,39 @@ func importBuilderDataFromImage(ctx context.Context, store storage.Store, system if err != nil { return nil, errors.Wrapf(err, "no such image %q", imageID) } - src, err2 := ref.NewImage(ctx, systemContext) - if err2 != nil { - return nil, errors.Wrapf(err2, "error instantiating image") + src, err := ref.NewImageSource(ctx, systemContext) + if err != nil { + return nil, errors.Wrapf(err, "error instantiating image source") } defer src.Close() + imageDigest := "" + manifestBytes, manifestType, err := src.GetManifest(ctx, nil) + if err != nil { + return nil, errors.Wrapf(err, "error loading image manifest for %q", transports.ImageName(ref)) + } + if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { + imageDigest = manifestDigest.String() + } + + var instanceDigest *digest.Digest + if manifest.MIMETypeIsMultiImage(manifestType) { + list, err := manifest.ListFromBlob(manifestBytes, manifestType) + if err != nil { + return nil, errors.Wrapf(err, "error parsing image manifest for %q as list", transports.ImageName(ref)) + } + instance, err := list.ChooseInstance(systemContext) + if err != nil { + return nil, errors.Wrapf(err, "error finding an appropriate image in manifest list %q", transports.ImageName(ref)) + } + instanceDigest = &instance + } + + image, err := image.FromUnparsedImage(ctx, systemContext, image.UnparsedInstance(src, instanceDigest)) + if err != nil { + return nil, errors.Wrapf(err, "error instantiating image for %q instance %q", transports.ImageName(ref), instanceDigest) + } + imageName := "" if img, err3 := store.Image(imageID); err3 == nil { if len(img.Names) > 0 { @@ -48,13 +77,6 @@ func importBuilderDataFromImage(ctx context.Context, store storage.Store, system } } - imageDigest := "" - if manifestBytes, _, err := src.Manifest(ctx); err == nil { - if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { - imageDigest = manifestDigest.String() - } - } - defaultNamespaceOptions, err := DefaultNamespaceOptions() if err != nil { return nil, err @@ -79,7 +101,7 @@ func importBuilderDataFromImage(ctx context.Context, store storage.Store, system }, } - if err := builder.initConfig(ctx, src); err != nil { + if err := builder.initConfig(ctx, image); err != nil { return nil, errors.Wrapf(err, "error preparing image configuration") } diff --git a/vendor/github.com/containers/buildah/info.go b/vendor/github.com/containers/buildah/info.go index c741bb449..322bd8834 100644 --- a/vendor/github.com/containers/buildah/info.go +++ b/vendor/github.com/containers/buildah/info.go @@ -52,10 +52,13 @@ func hostInfo() map[string]interface{} { logrus.Error(err, "err reading cgroups mode") } cgroupVersion := "v1" + ociruntime := "runc" if unified { cgroupVersion = "v2" + ociruntime = "crun" } info["CgroupVersion"] = cgroupVersion + info["OCIRuntime"] = ociruntime mi, err := system.ReadMemInfo() if err != nil { diff --git a/vendor/github.com/containers/buildah/new.go b/vendor/github.com/containers/buildah/new.go index 87cfd5d0d..68c6ebd54 100644 --- a/vendor/github.com/containers/buildah/new.go +++ b/vendor/github.com/containers/buildah/new.go @@ -5,8 +5,10 @@ import ( "fmt" "math/rand" "strings" + "time" "github.com/containers/buildah/util" + "github.com/containers/image/v5/image" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/sysregistriesv2" is "github.com/containers/image/v5/storage" @@ -14,6 +16,7 @@ import ( "github.com/containers/image/v5/transports/alltransports" "github.com/containers/image/v5/types" "github.com/containers/storage" + digest "github.com/opencontainers/go-digest" "github.com/openshift/imagebuilder" "github.com/pkg/errors" "github.com/sirupsen/logrus" @@ -154,23 +157,47 @@ func resolveImage(ctx context.Context, systemContext *types.SystemContext, store if destImage == "" { return nil, "", nil, errors.Errorf("error computing local image name for %q", transports.ImageName(srcRef)) } - ref, err := is.Transport.ParseStoreReference(store, destImage) if err != nil { return nil, "", nil, errors.Wrapf(err, "error parsing reference to image %q", destImage) } - img, err := is.Transport.GetStoreImage(store, ref) - if err == nil { - return ref, transport, img, nil - } - if errors.Cause(err) == storage.ErrImageUnknown && options.PullPolicy != PullIfMissing { - logrus.Debugf("no such image %q: %v", transports.ImageName(ref), err) - failures = append(failures, failure{ - resolvedImageName: image, - err: fmt.Errorf("no such image %q", transports.ImageName(ref)), - }) - continue + if options.PullPolicy == PullIfNewer { + img, err := is.Transport.GetStoreImage(store, ref) + if err == nil { + // Let's see if this image is on the repository and if it's there + // then note it's Created date. + var repoImageCreated time.Time + repoImageFound := false + repoImage, err := srcRef.NewImage(ctx, systemContext) + if err == nil { + inspect, err := repoImage.Inspect(ctx) + if err == nil { + repoImageFound = true + repoImageCreated = *inspect.Created + } + repoImage.Close() + } + if !repoImageFound || repoImageCreated == img.Created { + // The image is only local or the same date is on the + // local and repo versions of the image, no need to pull. + return ref, transport, img, nil + } + } + } else { + // Get the image from the store if present for PullNever and PullIfMissing + img, err := is.Transport.GetStoreImage(store, ref) + if err == nil { + return ref, transport, img, nil + } + if errors.Cause(err) == storage.ErrImageUnknown && options.PullPolicy == PullNever { + logrus.Debugf("no such image %q: %v", transports.ImageName(ref), err) + failures = append(failures, failure{ + resolvedImageName: image, + err: fmt.Errorf("no such image %q", transports.ImageName(ref)), + }) + continue + } } pulledImg, pulledReference, err := pullAndFindImage(ctx, store, srcRef, options, systemContext) @@ -253,35 +280,53 @@ func newBuilder(ctx context.Context, store storage.Store, options BuilderOptions return nil, err } } - image := options.FromImage + imageSpec := options.FromImage imageID := "" imageDigest := "" topLayer := "" if img != nil { - image = getImageName(imageNamePrefix(image), img) + imageSpec = getImageName(imageNamePrefix(imageSpec), img) imageID = img.ID topLayer = img.TopLayer } - var src types.ImageCloser + var src types.Image if ref != nil { - src, err = ref.NewImage(ctx, systemContext) + srcSrc, err := ref.NewImageSource(ctx, systemContext) if err != nil { return nil, errors.Wrapf(err, "error instantiating image for %q", transports.ImageName(ref)) } - if manifestBytes, _, err := src.Manifest(ctx); err == nil { - if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { - imageDigest = manifestDigest.String() + defer srcSrc.Close() + manifestBytes, manifestType, err := srcSrc.GetManifest(ctx, nil) + if err != nil { + return nil, errors.Wrapf(err, "error loading image manifest for %q", transports.ImageName(ref)) + } + if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { + imageDigest = manifestDigest.String() + } + var instanceDigest *digest.Digest + if manifest.MIMETypeIsMultiImage(manifestType) { + list, err := manifest.ListFromBlob(manifestBytes, manifestType) + if err != nil { + return nil, errors.Wrapf(err, "error parsing image manifest for %q as list", transports.ImageName(ref)) + } + instance, err := list.ChooseInstance(systemContext) + if err != nil { + return nil, errors.Wrapf(err, "error finding an appropriate image in manifest list %q", transports.ImageName(ref)) } + instanceDigest = &instance + } + src, err = image.FromUnparsedImage(ctx, systemContext, image.UnparsedInstance(srcSrc, instanceDigest)) + if err != nil { + return nil, errors.Wrapf(err, "error instantiating image for %q instance %q", transports.ImageName(ref), instanceDigest) } - defer src.Close() } name := "working-container" if options.Container != "" { name = options.Container } else { - if image != "" { - name = imageNamePrefix(image) + "-" + name + if imageSpec != "" { + name = imageNamePrefix(imageSpec) + "-" + name } } var container *storage.Container @@ -332,7 +377,7 @@ func newBuilder(ctx context.Context, store storage.Store, options BuilderOptions builder := &Builder{ store: store, Type: containerType, - FromImage: image, + FromImage: imageSpec, FromImageID: imageID, FromImageDigest: imageDigest, Container: name, diff --git a/vendor/github.com/containers/buildah/pkg/cli/common.go b/vendor/github.com/containers/buildah/pkg/cli/common.go index e8979cd7f..6f49cc240 100644 --- a/vendor/github.com/containers/buildah/pkg/cli/common.go +++ b/vendor/github.com/containers/buildah/pkg/cli/common.go @@ -63,6 +63,7 @@ type BudResults struct { Platform string Pull bool PullAlways bool + PullNever bool Quiet bool Rm bool Runtime string @@ -159,8 +160,9 @@ func GetBudFlags(flags *BudResults) pflag.FlagSet { fs.StringVar(&flags.Logfile, "logfile", "", "log to `file` instead of stdout/stderr") fs.IntVar(&flags.Loglevel, "loglevel", 0, "adjust logging level (range from -2 to 3)") fs.StringVar(&flags.Platform, "platform", "", "CLI compatibility: no action or effect") - fs.BoolVar(&flags.Pull, "pull", true, "pull the image if not present") - fs.BoolVar(&flags.PullAlways, "pull-always", false, "pull the image, even if a version is present") + fs.BoolVar(&flags.Pull, "pull", true, "pull the image from the registry if newer or not present in store, if false, only pull the image if not present") + fs.BoolVar(&flags.PullAlways, "pull-always", false, "pull the image even if the named image is present in store") + fs.BoolVar(&flags.PullNever, "pull-never", false, "do not pull the image, use the image present in store if available") fs.BoolVarP(&flags.Quiet, "quiet", "q", false, "refrain from announcing build instructions and image read/write progress") fs.BoolVar(&flags.Rm, "rm", true, "Remove intermediate containers after a successful build") // "runtime" definition moved to avoid name collision in podman build. Defined in cmd/buildah/bud.go. @@ -265,9 +267,15 @@ func VerifyFlagsArgsOrder(args []string) error { } func GetDefaultAuthFile() string { - authfile := os.Getenv("REGISTRY_AUTH_FILE") - if authfile != "" { - return authfile + return os.Getenv("REGISTRY_AUTH_FILE") +} + +func CheckAuthFile(authfile string) error { + if authfile == "" { + return nil } - return "" + if _, err := os.Stat(authfile); err != nil { + return errors.Wrapf(err, "error checking authfile path %s", authfile) + } + return nil } diff --git a/vendor/github.com/docker/docker/AUTHORS b/vendor/github.com/docker/docker/AUTHORS index d5b6cbbea..ad166ba8d 100644 --- a/vendor/github.com/docker/docker/AUTHORS +++ b/vendor/github.com/docker/docker/AUTHORS @@ -18,6 +18,7 @@ Abhishek Chanda <abhishek.becs@gmail.com> Abhishek Sharma <abhishek@asharma.me> Abin Shahab <ashahab@altiscale.com> Adam Avilla <aavilla@yp.com> +Adam Dobrawy <naczelnik@jawnosc.tk> Adam Eijdenberg <adam.eijdenberg@gmail.com> Adam Kunk <adam.kunk@tiaa-cref.org> Adam Miller <admiller@redhat.com> @@ -113,6 +114,7 @@ Anda Xu <anda.xu@docker.com> Anders Janmyr <anders@janmyr.com> Andre Dublin <81dublin@gmail.com> Andre Granovsky <robotciti@live.com> +Andrea Denisse Gómez <crypto.andrea@protonmail.ch> Andrea Luzzardi <aluzzardi@gmail.com> Andrea Turli <andrea.turli@gmail.com> Andreas Elvers <andreas@work.de> @@ -177,8 +179,10 @@ Anusha Ragunathan <anusha.ragunathan@docker.com> apocas <petermdias@gmail.com> Arash Deshmeh <adeshmeh@ca.ibm.com> ArikaChen <eaglesora@gmail.com> +Arko Dasgupta <arko.dasgupta@docker.com> Arnaud Lefebvre <a.lefebvre@outlook.fr> Arnaud Porterie <arnaud.porterie@docker.com> +Arnaud Rebillout <arnaud.rebillout@collabora.com> Arthur Barr <arthur.barr@uk.ibm.com> Arthur Gautier <baloo@gandi.net> Artur Meyster <arthurfbi@yahoo.com> @@ -280,6 +284,7 @@ Carl Loa Odin <carlodin@gmail.com> Carl X. Su <bcbcarl@gmail.com> Carlo Mion <mion00@gmail.com> Carlos Alexandro Becker <caarlos0@gmail.com> +Carlos de Paula <me@carlosedp.com> Carlos Sanchez <carlos@apache.org> Carol Fager-Higgins <carol.fager-higgins@docker.com> Cary <caryhartline@users.noreply.github.com> @@ -329,6 +334,7 @@ Chris Gibson <chris@chrisg.io> Chris Khoo <chris.khoo@gmail.com> Chris McKinnel <chris.mckinnel@tangentlabs.co.uk> Chris McKinnel <chrismckinnel@gmail.com> +Chris Price <chris.price@docker.com> Chris Seto <chriskseto@gmail.com> Chris Snow <chsnow123@gmail.com> Chris St. Pierre <chris.a.st.pierre@gmail.com> @@ -418,12 +424,14 @@ Daniel Norberg <dano@spotify.com> Daniel Nordberg <dnordberg@gmail.com> Daniel Robinson <gottagetmac@gmail.com> Daniel S <dan.streby@gmail.com> +Daniel Sweet <danieljsweet@icloud.com> Daniel Von Fange <daniel@leancoder.com> Daniel Watkins <daniel@daniel-watkins.co.uk> Daniel X Moore <yahivin@gmail.com> Daniel YC Lin <dlin.tw@gmail.com> Daniel Zhang <jmzwcn@gmail.com> Danny Berger <dpb587@gmail.com> +Danny Milosavljevic <dannym@scratchpost.org> Danny Yates <danny@codeaholics.org> Danyal Khaliq <danyal.khaliq@tenpearls.com> Darren Coxall <darren@darrencoxall.com> @@ -517,6 +525,8 @@ Dmitry Smirnov <onlyjob@member.fsf.org> Dmitry V. Krivenok <krivenok.dmitry@gmail.com> Dmitry Vorobev <dimahabr@gmail.com> Dolph Mathews <dolph.mathews@gmail.com> +Dominic Tubach <dominic.tubach@to.com> +Dominic Yin <yindongchao@inspur.com> Dominik Dingel <dingel@linux.vnet.ibm.com> Dominik Finkbeiner <finkes93@gmail.com> Dominik Honnef <dominik@honnef.co> @@ -585,6 +595,7 @@ Erik Weathers <erikdw@gmail.com> Erno Hopearuoho <erno.hopearuoho@gmail.com> Erwin van der Koogh <info@erronis.nl> Ethan Bell <ebgamer29@gmail.com> +Ethan Mosbaugh <ethan@replicated.com> Euan Kemp <euan.kemp@coreos.com> Eugen Krizo <eugen.krizo@gmail.com> Eugene Yakubovich <eugene.yakubovich@coreos.com> @@ -621,6 +632,7 @@ Fareed Dudhia <fareeddudhia@googlemail.com> Fathi Boudra <fathi.boudra@linaro.org> Federico Gimenez <fgimenez@coit.es> Felipe Oliveira <felipeweb.programador@gmail.com> +Felipe Ruhland <felipe.ruhland@gmail.com> Felix Abecassis <fabecassis@nvidia.com> Felix Geisendörfer <felix@debuggable.com> Felix Hupfeld <felix@quobyte.com> @@ -655,6 +667,7 @@ Frank Groeneveld <frank@ivaldi.nl> Frank Herrmann <fgh@4gh.tv> Frank Macreery <frank@macreery.com> Frank Rosquin <frank.rosquin+github@gmail.com> +frankyang <yyb196@gmail.com> Fred Lifton <fred.lifton@docker.com> Frederick F. Kautz IV <fkautz@redhat.com> Frederik Loeffert <frederik@zitrusmedia.de> @@ -702,6 +715,7 @@ Gleb M Borisov <borisov.gleb@gmail.com> Glyn Normington <gnormington@gopivotal.com> GoBella <caili_welcome@163.com> Goffert van Gool <goffert@phusion.nl> +Goldwyn Rodrigues <rgoldwyn@suse.com> Gopikannan Venugopalsamy <gopikannan.venugopalsamy@gmail.com> Gosuke Miyashita <gosukenator@gmail.com> Gou Rao <gou@portworx.com> @@ -725,6 +739,7 @@ Guruprasad <lgp171188@gmail.com> Gustav Sinder <gustav.sinder@gmail.com> gwx296173 <gaojing3@huawei.com> Günter Zöchbauer <guenter@gzoechbauer.com> +Haichao Yang <yang.haichao@zte.com.cn> haikuoliu <haikuo@amazon.com> Hakan Özler <hakan.ozler@kodcu.com> Hamish Hutchings <moredhel@aoeu.me> @@ -733,6 +748,7 @@ Hans Rødtang <hansrodtang@gmail.com> Hao Shu Wei <haosw@cn.ibm.com> Hao Zhang <21521210@zju.edu.cn> Harald Albers <github@albersweb.de> +Harald Niesche <harald@niesche.de> Harley Laue <losinggeneration@gmail.com> Harold Cooper <hrldcpr@gmail.com> Harrison Turton <harrisonturton@gmail.com> @@ -752,9 +768,11 @@ Hobofan <goisser94@gmail.com> Hollie Teal <hollie@docker.com> Hong Xu <hong@topbug.net> Hongbin Lu <hongbin034@gmail.com> +Hongxu Jia <hongxu.jia@windriver.com> hsinko <21551195@zju.edu.cn> Hu Keping <hukeping@huawei.com> Hu Tao <hutao@cn.fujitsu.com> +HuanHuan Ye <logindaveye@gmail.com> Huanzhong Zhang <zhanghuanzhong90@gmail.com> Huayi Zhang <irachex@gmail.com> Hugo Duncan <hugo@hugoduncan.org> @@ -898,6 +916,7 @@ Jie Luo <luo612@zju.edu.cn> Jihyun Hwang <jhhwang@telcoware.com> Jilles Oldenbeuving <ojilles@gmail.com> Jim Alateras <jima@comware.com.au> +Jim Ehrismann <jim.ehrismann@docker.com> Jim Galasyn <jim.galasyn@docker.com> Jim Minter <jminter@redhat.com> Jim Perrin <jperrin@centos.org> @@ -935,7 +954,7 @@ John Feminella <jxf@jxf.me> John Gardiner Myers <jgmyers@proofpoint.com> John Gossman <johngos@microsoft.com> John Harris <john@johnharris.io> -John Howard (VM) <John.Howard@microsoft.com> +John Howard <github@lowenna.com> John Laswell <john.n.laswell@gmail.com> John Maguire <jmaguire@duosecurity.com> John Mulhausen <john@docker.com> @@ -949,6 +968,7 @@ John Willis <john.willis@docker.com> Jon Johnson <jonjohnson@google.com> Jon Surrell <jon.surrell@gmail.com> Jon Wedaman <jweede@gmail.com> +Jonas Dohse <jonas@dohse.ch> Jonas Pfenniger <jonas@pfenniger.name> Jonathan A. Schweder <jonathanschweder@gmail.com> Jonathan A. Sternberg <jonathansternberg@gmail.com> @@ -1002,6 +1022,7 @@ Julio Montes <imc.coder@gmail.com> Jun-Ru Chang <jrjang@gmail.com> Jussi Nummelin <jussi.nummelin@gmail.com> Justas Brazauskas <brazauskasjustas@gmail.com> +Justen Martin <jmart@the-coder.com> Justin Cormack <justin.cormack@docker.com> Justin Force <justin.force@gmail.com> Justin Menga <justin.menga@gmail.com> @@ -1010,6 +1031,7 @@ Justin Simonelis <justin.p.simonelis@gmail.com> Justin Terry <juterry@microsoft.com> Justyn Temme <justyntemme@gmail.com> Jyrki Puttonen <jyrkiput@gmail.com> +Jérémy Leherpeur <amenophis@leherpeur.net> Jérôme Petazzoni <jerome.petazzoni@docker.com> Jörg Thalheim <joerg@higgsboson.tk> K. Heller <pestophagous@gmail.com> @@ -1047,6 +1069,7 @@ Ken Reese <krrgithub@gmail.com> Kenfe-Mickaël Laventure <mickael.laventure@gmail.com> Kenjiro Nakayama <nakayamakenjiro@gmail.com> Kent Johnson <kentoj@gmail.com> +Kenta Tada <Kenta.Tada@sony.com> Kevin "qwazerty" Houdebert <kevin.houdebert@gmail.com> Kevin Burke <kev@inburke.com> Kevin Clark <kevin.clark@gmail.com> @@ -1057,6 +1080,7 @@ Kevin Kern <kaiwentan@harmonycloud.cn> Kevin Menard <kevin@nirvdrum.com> Kevin Meredith <kevin.m.meredith@gmail.com> Kevin P. Kucharczyk <kevinkucharczyk@gmail.com> +Kevin Parsons <kevpar@microsoft.com> Kevin Richardson <kevin@kevinrichardson.co> Kevin Shi <kshi@andrew.cmu.edu> Kevin Wallace <kevin@pentabarf.net> @@ -1147,6 +1171,7 @@ longliqiang88 <394564827@qq.com> Lorenz Leutgeb <lorenz.leutgeb@gmail.com> Lorenzo Fontana <fontanalorenz@gmail.com> Lotus Fenn <fenn.lotus@gmail.com> +Louis Delossantos <ldelossa.ld@gmail.com> Louis Opter <kalessin@kalessin.fr> Luca Favatella <luca.favatella@erlang-solutions.com> Luca Marturana <lucamarturana@gmail.com> @@ -1159,12 +1184,14 @@ Lucas Silvestre <lukas.silvestre@gmail.com> Luciano Mores <leslau@gmail.com> Luis Martínez de Bartolomé Izquierdo <lmartinez@biicode.com> Luiz Svoboda <luizek@gmail.com> +Lukas Heeren <lukas-heeren@hotmail.com> Lukas Waslowski <cr7pt0gr4ph7@gmail.com> lukaspustina <lukas.pustina@centerdevice.com> Lukasz Zajaczkowski <Lukasz.Zajaczkowski@ts.fujitsu.com> Luke Marsden <me@lukemarsden.net> Lyn <energylyn@zju.edu.cn> Lynda O'Leary <lyndaoleary29@gmail.com> +lzhfromutsc <lzhfromustc@gmail.com> Lénaïc Huard <lhuard@amadeus.com> Ma Müller <mueller-ma@users.noreply.github.com> Ma Shimiao <mashimiao.fnst@cn.fujitsu.com> @@ -1298,6 +1325,7 @@ Michael Stapelberg <michael+gh@stapelberg.de> Michael Steinert <mike.steinert@gmail.com> Michael Thies <michaelthies78@gmail.com> Michael West <mwest@mdsol.com> +Michael Zhao <michael.zhao@arm.com> Michal Fojtik <mfojtik@redhat.com> Michal Gebauer <mishak@mishak.net> Michal Jemala <michal.jemala@gmail.com> @@ -1382,6 +1410,7 @@ Neyazul Haque <nuhaque@gmail.com> Nghia Tran <nghia@google.com> Niall O'Higgins <niallo@unworkable.org> Nicholas E. Rabenau <nerab@gmx.at> +Nick Adcock <nick.adcock@docker.com> Nick DeCoursin <n.decoursin@foodpanda.com> Nick Irvine <nfirvine@nfirvine.com> Nick Neisen <nwneisen@gmail.com> @@ -1420,6 +1449,7 @@ Nuutti Kotivuori <naked@iki.fi> nzwsch <hi@nzwsch.com> O.S. Tezer <ostezer@gmail.com> objectified <objectified@gmail.com> +Odin Ugedal <odin@ugedal.com> Oguz Bilgic <fisyonet@gmail.com> Oh Jinkyun <tintypemolly@gmail.com> Ohad Schneider <ohadschn@users.noreply.github.com> @@ -1430,6 +1460,7 @@ Oliver Reason <oli@overrateddev.co> Olivier Gambier <dmp42@users.noreply.github.com> Olle Jonsson <olle.jonsson@gmail.com> Olli Janatuinen <olli.janatuinen@gmail.com> +Olly Pomeroy <oppomeroy@gmail.com> Omri Shiv <Omri.Shiv@teradata.com> Oriol Francès <oriolfa@gmail.com> Oskar Niburski <oskarniburski@gmail.com> @@ -1439,6 +1470,7 @@ Ovidio Mallo <ovidio.mallo@gmail.com> Panagiotis Moustafellos <pmoust@elastic.co> Paolo G. Giarrusso <p.giarrusso@gmail.com> Pascal <pascalgn@users.noreply.github.com> +Pascal Bach <pascal.bach@siemens.com> Pascal Borreli <pascal@borreli.com> Pascal Hartig <phartig@rdrei.net> Patrick Böänziger <patrick.baenziger@bsi-software.com> @@ -1463,6 +1495,7 @@ Paul Nasrat <pnasrat@gmail.com> Paul Weaver <pauweave@cisco.com> Paulo Ribeiro <paigr.io@gmail.com> Pavel Lobashov <ShockwaveNN@gmail.com> +Pavel Matěja <pavel@verotel.cz> Pavel Pletenev <cpp.create@gmail.com> Pavel Pospisil <pospispa@gmail.com> Pavel Sutyrin <pavel.sutyrin@gmail.com> @@ -1574,6 +1607,7 @@ Riku Voipio <riku.voipio@linaro.org> Riley Guerin <rileytg.dev@gmail.com> Ritesh H Shukla <sritesh@vmware.com> Riyaz Faizullabhoy <riyaz.faizullabhoy@docker.com> +Rob Gulewich <rgulewich@netflix.com> Rob Vesse <rvesse@dotnetrdf.org> Robert Bachmann <rb@robertbachmann.at> Robert Bittle <guywithnose@gmail.com> @@ -1582,11 +1616,13 @@ Robert Schneider <mail@shakeme.info> Robert Stern <lexandro2000@gmail.com> Robert Terhaar <rterhaar@atlanticdynamic.com> Robert Wallis <smilingrob@gmail.com> +Robert Wang <robert@arctic.tw> Roberto G. Hashioka <roberto.hashioka@docker.com> Roberto Muñoz Fernández <robertomf@gmail.com> Robin Naundorf <r.naundorf@fh-muenster.de> Robin Schneider <ypid@riseup.net> Robin Speekenbrink <robin@kingsquare.nl> +Robin Thoni <robin@rthoni.com> robpc <rpcann@gmail.com> Rodolfo Carvalho <rhcarvalho@gmail.com> Rodrigo Vaz <rodrigo.vaz@gmail.com> @@ -1620,6 +1656,7 @@ Rozhnov Alexandr <nox73@ya.ru> Rudolph Gottesheim <r.gottesheim@loot.at> Rui Cao <ruicao@alauda.io> Rui Lopes <rgl@ruilopes.com> +Ruilin Li <liruilin4@huawei.com> Runshen Zhu <runshen.zhu@gmail.com> Russ Magee <rmagee@gmail.com> Ryan Abrams <rdabrams@gmail.com> @@ -1658,6 +1695,7 @@ Sam J Sharpe <sam.sharpe@digital.cabinet-office.gov.uk> Sam Neirinck <sam@samneirinck.com> Sam Reis <sreis@atlassian.com> Sam Rijs <srijs@airpost.net> +Sam Whited <sam@samwhited.com> Sambuddha Basu <sambuddhabasu1@gmail.com> Sami Wagiaalla <swagiaal@redhat.com> Samuel Andaya <samuel@andaya.net> @@ -1672,6 +1710,7 @@ sapphiredev <se.imas.kr@gmail.com> Sargun Dhillon <sargun@netflix.com> Sascha Andres <sascha.andres@outlook.com> Sascha Grunert <sgrunert@suse.com> +SataQiu <qiushida@beyondcent.com> Satnam Singh <satnam@raintown.org> Satoshi Amemiya <satoshi_amemiya@voyagegroup.com> Satoshi Tagomori <tagomoris@gmail.com> @@ -1720,6 +1759,7 @@ Shijun Qin <qinshijun16@mails.ucas.ac.cn> Shishir Mahajan <shishir.mahajan@redhat.com> Shoubhik Bose <sbose78@gmail.com> Shourya Sarcar <shourya.sarcar@gmail.com> +Shu-Wai Chow <shu-wai.chow@seattlechildrens.org> shuai-z <zs.broccoli@gmail.com> Shukui Yang <yangshukui@huawei.com> Shuwei Hao <haosw@cn.ibm.com> @@ -1730,6 +1770,7 @@ Silas Sewell <silas@sewell.org> Silvan Jegen <s.jegen@gmail.com> Simão Reis <smnrsti@gmail.com> Simei He <hesimei@zju.edu.cn> +Simon Barendse <simon.barendse@gmail.com> Simon Eskildsen <sirup@sirupsen.com> Simon Ferquel <simon.ferquel@docker.com> Simon Leinen <simon.leinen@gmail.com> @@ -1738,6 +1779,7 @@ Simon Taranto <simon.taranto@gmail.com> Simon Vikstrom <pullreq@devsn.se> Sindhu S <sindhus@live.in> Sjoerd Langkemper <sjoerd-github@linuxonly.nl> +skanehira <sho19921005@gmail.com> Solganik Alexander <solganik@gmail.com> Solomon Hykes <solomon@docker.com> Song Gao <song@gao.io> @@ -1749,6 +1791,7 @@ Sridatta Thatipamala <sthatipamala@gmail.com> Sridhar Ratnakumar <sridharr@activestate.com> Srini Brahmaroutu <srbrahma@us.ibm.com> Srinivasan Srivatsan <srinivasan.srivatsan@hpe.com> +Staf Wagemakers <staf@wagemakers.be> Stanislav Bondarenko <stanislav.bondarenko@gmail.com> Steeve Morin <steeve.morin@gmail.com> Stefan Berger <stefanb@linux.vnet.ibm.com> @@ -1759,6 +1802,7 @@ Stefan Scherer <stefan.scherer@docker.com> Stefan Staudenmeyer <doerte@instana.com> Stefan Weil <sw@weilnetz.de> Stephan Spindler <shutefan@gmail.com> +Stephen Benjamin <stephen@redhat.com> Stephen Crosby <stevecrozz@gmail.com> Stephen Day <stephen.day@docker.com> Stephen Drake <stephen@xenolith.net> @@ -1775,10 +1819,12 @@ Steven Iveson <sjiveson@outlook.com> Steven Merrill <steven.merrill@gmail.com> Steven Richards <steven@axiomzen.co> Steven Taylor <steven.taylor@me.com> +Stig Larsson <stig@larsson.dev> Subhajit Ghosh <isubuz.g@gmail.com> Sujith Haridasan <sujith.h@gmail.com> Sun Gengze <690388648@qq.com> Sun Jianbo <wonderflow.sun@gmail.com> +Sune Keller <sune.keller@gmail.com> Sunny Gogoi <indiasuny000@gmail.com> Suryakumar Sudar <surya.trunks@gmail.com> Sven Dowideit <SvenDowideit@home.org.au> @@ -1829,6 +1875,7 @@ Tianyi Wang <capkurmagati@gmail.com> Tibor Vass <teabee89@gmail.com> Tiffany Jernigan <tiffany.f.j@gmail.com> Tiffany Low <tiffany@box.com> +Tim <elatllat@gmail.com> Tim Bart <tim@fewagainstmany.com> Tim Bosse <taim@bosboot.org> Tim Dettrick <t.dettrick@uq.edu.au> @@ -1914,6 +1961,7 @@ Victor Palma <palma.victor@gmail.com> Victor Vieux <victor.vieux@docker.com> Victoria Bialas <victoria.bialas@docker.com> Vijaya Kumar K <vijayak@caviumnetworks.com> +Vikram bir Singh <vikrambir.singh@docker.com> Viktor Stanchev <me@viktorstanchev.com> Viktor Vojnovski <viktor.vojnovski@amadeus.com> VinayRaghavanKS <raghavan.vinay@gmail.com> @@ -1971,6 +2019,7 @@ Wenyu You <21551128@zju.edu.cn> Wenzhi Liang <wenzhi.liang@gmail.com> Wes Morgan <cap10morgan@gmail.com> Wewang Xiaorenfine <wang.xiaoren@zte.com.cn> +Wiktor Kwapisiewicz <wiktor@metacode.biz> Will Dietz <w@wdtz.org> Will Rouesnel <w.rouesnel@gmail.com> Will Weaver <monkey@buildingbananas.com> @@ -1998,6 +2047,7 @@ xichengliudui <1693291525@qq.com> xiekeyang <xiekeyang@huawei.com> Ximo Guanter Gonzálbez <joaquin.guantergonzalbez@telefonica.com> Xinbo Weng <xihuanbo_0521@zju.edu.cn> +Xinfeng Liu <xinfeng.liu@gmail.com> Xinzi Zhou <imdreamrunner@gmail.com> Xiuming Chen <cc@cxm.cc> Xuecong Liao <satorulogic@gmail.com> @@ -2012,6 +2062,7 @@ Yang Pengfei <yangpengfei4@huawei.com> yangchenliang <yangchenliang@huawei.com> Yanqiang Miao <miao.yanqiang@zte.com.cn> Yao Zaiyong <yaozaiyong@hotmail.com> +Yash Murty <yashmurty@gmail.com> Yassine Tijani <yasstij11@gmail.com> Yasunori Mahata <nori@mahata.net> Yazhong Liu <yorkiefixer@gmail.com> @@ -2026,6 +2077,7 @@ Yongxin Li <yxli@alauda.io> Yongzhi Pan <panyongzhi@gmail.com> Yosef Fertel <yfertel@gmail.com> You-Sheng Yang (楊有勝) <vicamo@gmail.com> +youcai <omegacoleman@gmail.com> Youcef YEKHLEF <yyekhlef@gmail.com> Yu Changchun <yuchangchun1@huawei.com> Yu Chengxia <yuchengxia@huawei.com> @@ -2062,6 +2114,7 @@ Zhoulin Xie <zhoulin.xie@daocloud.io> Zhu Guihua <zhugh.fnst@cn.fujitsu.com> Zhu Kunjia <zhu.kunjia@zte.com.cn> Zhuoyun Wei <wzyboy@wzyboy.org> +Ziheng Liu <lzhfromustc@gmail.com> Zilin Du <zilin.du@gmail.com> zimbatm <zimbatm@zimbatm.com> Ziming Dong <bnudzm@foxmail.com> @@ -2070,7 +2123,7 @@ zmarouf <zeid.marouf@gmail.com> Zoltan Tombol <zoltan.tombol@gmail.com> Zou Yu <zouyu7@huawei.com> zqh <zqhxuyuan@gmail.com> -Zuhayr Elahi <elahi.zuhayr@gmail.com> +Zuhayr Elahi <zuhayr.elahi@docker.com> Zunayed Ali <zunayed@gmail.com> Álex González <agonzalezro@gmail.com> Álvaro Lázaro <alvaro.lazaro.g@gmail.com> diff --git a/vendor/github.com/docker/docker/api/swagger.yaml b/vendor/github.com/docker/docker/api/swagger.yaml index cc2451f03..0698bba52 100644 --- a/vendor/github.com/docker/docker/api/swagger.yaml +++ b/vendor/github.com/docker/docker/api/swagger.yaml @@ -3369,6 +3369,27 @@ definitions: format: "dateTime" Message: type: "string" + ServiceStatus: + description: | + The status of the service's tasks. Provided only when requested as + part of a ServiceList operation. + type: "object" + properties: + RunningTasks: + description: "The number of tasks for the service currently in the Running state" + type: "integer" + format: "uint64" + example: 7 + DesiredTasks: + description: | + The number of tasks for the service desired to be running. + For replicated services, this is the replica count from the + service spec. For global services, this is computed by taking + count of all tasks for the service with a Desired State other + than Shutdown. + type: "integer" + format: "uint64" + example: 10 example: ID: "9mnpnzenvg8p8tdbtq4wvbkcz" Version: @@ -4924,6 +4945,8 @@ paths: type: "integer" Driver: type: "string" + Platform: + type: "string" MountLabel: type: "string" ProcessLabel: @@ -9316,6 +9339,10 @@ paths: - `label=<service label>` - `mode=["replicated"|"global"]` - `name=<service name>` + - name: "status" + in: "query" + type: "boolean" + description: "Include service status, with count of running and desired tasks" tags: ["Service"] /services/create: post: @@ -10414,9 +10441,6 @@ paths: description: | Start a new interactive session with a server. Session allows server to call back to the client for advanced capabilities. - > **Note**: This endpoint is *experimental* and only available if the daemon is started with experimental - > features enabled. The specifications for this endpoint may still change in a future version of the API. - ### Hijacking This endpoint hijacks the HTTP connection to HTTP2 transport that allows the client to expose gPRC services on that connection. @@ -10450,4 +10474,4 @@ paths: description: "server error" schema: $ref: "#/definitions/ErrorResponse" - tags: ["Session (experimental)"] + tags: ["Session"] diff --git a/vendor/github.com/docker/docker/api/types/client.go b/vendor/github.com/docker/docker/api/types/client.go index 4b9f50282..8363ed736 100644 --- a/vendor/github.com/docker/docker/api/types/client.go +++ b/vendor/github.com/docker/docker/api/types/client.go @@ -363,6 +363,10 @@ type ServiceUpdateOptions struct { // ServiceListOptions holds parameters to list services with. type ServiceListOptions struct { Filters filters.Args + + // Status indicates whether the server should include the service task + // count of running and desired tasks. + Status bool } // ServiceInspectOptions holds parameters related to the "service inspect" diff --git a/vendor/github.com/docker/docker/api/types/filters/parse.go b/vendor/github.com/docker/docker/api/types/filters/parse.go index 2e24e769c..cd7ad92e7 100644 --- a/vendor/github.com/docker/docker/api/types/filters/parse.go +++ b/vendor/github.com/docker/docker/api/types/filters/parse.go @@ -36,6 +36,15 @@ func NewArgs(initialArgs ...KeyValuePair) Args { return args } +// Keys returns all the keys in list of Args +func (args Args) Keys() []string { + keys := make([]string, 0, len(args.fields)) + for k := range args.fields { + keys = append(keys, k) + } + return keys +} + // MarshalJSON returns a JSON byte representation of the Args func (args Args) MarshalJSON() ([]byte, error) { if len(args.fields) == 0 { diff --git a/vendor/github.com/docker/docker/api/types/swarm/service.go b/vendor/github.com/docker/docker/api/types/swarm/service.go index abf192e75..6b59711ab 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/service.go +++ b/vendor/github.com/docker/docker/api/types/swarm/service.go @@ -10,6 +10,13 @@ type Service struct { PreviousSpec *ServiceSpec `json:",omitempty"` Endpoint Endpoint `json:",omitempty"` UpdateStatus *UpdateStatus `json:",omitempty"` + + // ServiceStatus is an optional, extra field indicating the number of + // desired and running tasks. It is provided primarily as a shortcut to + // calculating these values client-side, which otherwise would require + // listing all tasks for a service, an operation that could be + // computation and network expensive. + ServiceStatus *ServiceStatus `json:",omitempty"` } // ServiceSpec represents the spec of a service. @@ -122,3 +129,17 @@ type UpdateConfig struct { // started, or the new task is started before the old task is shut down. Order string } + +// ServiceStatus represents the number of running tasks in a service and the +// number of tasks desired to be running. +type ServiceStatus struct { + // RunningTasks is the number of tasks for the service actually in the + // Running state + RunningTasks uint64 + + // DesiredTasks is the number of tasks desired to be running by the + // service. For replicated services, this is the replica count. For global + // services, this is computed by taking the number of tasks with desired + // state of not-Shutdown. + DesiredTasks uint64 +} diff --git a/vendor/github.com/docker/docker/client/container_list.go b/vendor/github.com/docker/docker/client/container_list.go index c099d80e2..a973de597 100644 --- a/vendor/github.com/docker/docker/client/container_list.go +++ b/vendor/github.com/docker/docker/client/container_list.go @@ -35,7 +35,7 @@ func (cli *Client) ContainerList(ctx context.Context, options types.ContainerLis } if options.Filters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, options.Filters) if err != nil { diff --git a/vendor/github.com/docker/docker/client/events.go b/vendor/github.com/docker/docker/client/events.go index f347cadf1..f0dc9d9e1 100644 --- a/vendor/github.com/docker/docker/client/events.go +++ b/vendor/github.com/docker/docker/client/events.go @@ -90,7 +90,7 @@ func buildEventsQueryParams(cliVersion string, options types.EventsOptions) (url } if options.Filters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cliVersion, options.Filters) if err != nil { return nil, err diff --git a/vendor/github.com/docker/docker/client/hijack.go b/vendor/github.com/docker/docker/client/hijack.go index e77084af6..e1dc49ef0 100644 --- a/vendor/github.com/docker/docker/client/hijack.go +++ b/vendor/github.com/docker/docker/client/hijack.go @@ -24,7 +24,7 @@ func (cli *Client) postHijacked(ctx context.Context, path string, query url.Valu } apiPath := cli.getAPIPath(ctx, path, query) - req, err := http.NewRequest("POST", apiPath, bodyEncoded) + req, err := http.NewRequest(http.MethodPost, apiPath, bodyEncoded) if err != nil { return types.HijackedResponse{}, err } @@ -40,7 +40,7 @@ func (cli *Client) postHijacked(ctx context.Context, path string, query url.Valu // DialHijack returns a hijacked connection with negotiated protocol proto. func (cli *Client) DialHijack(ctx context.Context, url, proto string, meta map[string][]string) (net.Conn, error) { - req, err := http.NewRequest("POST", url, nil) + req, err := http.NewRequest(http.MethodPost, url, nil) if err != nil { return nil, err } @@ -88,7 +88,7 @@ func (cli *Client) setupHijackConn(ctx context.Context, req *http.Request, proto // Server hijacks the connection, error 'connection closed' expected resp, err := clientconn.Do(req) - //lint:ignore SA1019 for connecting to old (pre go1.8) daemons + //nolint:staticcheck // ignore SA1019 for connecting to old (pre go1.8) daemons if err != httputil.ErrPersistEOF { if err != nil { return nil, err diff --git a/vendor/github.com/docker/docker/client/image_list.go b/vendor/github.com/docker/docker/client/image_list.go index a5bc4b095..a4d750509 100644 --- a/vendor/github.com/docker/docker/client/image_list.go +++ b/vendor/github.com/docker/docker/client/image_list.go @@ -24,7 +24,7 @@ func (cli *Client) ImageList(ctx context.Context, options types.ImageListOptions } } if optionFilters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, optionFilters) if err != nil { return images, err diff --git a/vendor/github.com/docker/docker/client/network_list.go b/vendor/github.com/docker/docker/client/network_list.go index 8ca7eb612..ed2acb557 100644 --- a/vendor/github.com/docker/docker/client/network_list.go +++ b/vendor/github.com/docker/docker/client/network_list.go @@ -13,7 +13,7 @@ import ( func (cli *Client) NetworkList(ctx context.Context, options types.NetworkListOptions) ([]types.NetworkResource, error) { query := url.Values{} if options.Filters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, options.Filters) if err != nil { return nil, err diff --git a/vendor/github.com/docker/docker/client/ping.go b/vendor/github.com/docker/docker/client/ping.go index 90f39ec14..1cfc48a25 100644 --- a/vendor/github.com/docker/docker/client/ping.go +++ b/vendor/github.com/docker/docker/client/ping.go @@ -19,7 +19,7 @@ func (cli *Client) Ping(ctx context.Context) (types.Ping, error) { // Using cli.buildRequest() + cli.doRequest() instead of cli.sendRequest() // because ping requests are used during API version negotiation, so we want // to hit the non-versioned /_ping endpoint, not /v1.xx/_ping - req, err := cli.buildRequest("HEAD", path.Join(cli.basePath, "/_ping"), nil, nil) + req, err := cli.buildRequest(http.MethodHead, path.Join(cli.basePath, "/_ping"), nil, nil) if err != nil { return ping, err } @@ -35,7 +35,7 @@ func (cli *Client) Ping(ctx context.Context) (types.Ping, error) { return ping, err } - req, err = cli.buildRequest("GET", path.Join(cli.basePath, "/_ping"), nil, nil) + req, err = cli.buildRequest(http.MethodGet, path.Join(cli.basePath, "/_ping"), nil, nil) if err != nil { return ping, err } diff --git a/vendor/github.com/docker/docker/client/plugin_list.go b/vendor/github.com/docker/docker/client/plugin_list.go index a51c930e6..cf1935e2f 100644 --- a/vendor/github.com/docker/docker/client/plugin_list.go +++ b/vendor/github.com/docker/docker/client/plugin_list.go @@ -15,7 +15,7 @@ func (cli *Client) PluginList(ctx context.Context, filter filters.Args) (types.P query := url.Values{} if filter.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, filter) if err != nil { return plugins, err diff --git a/vendor/github.com/docker/docker/client/request.go b/vendor/github.com/docker/docker/client/request.go index 144c41636..ee15a46ed 100644 --- a/vendor/github.com/docker/docker/client/request.go +++ b/vendor/github.com/docker/docker/client/request.go @@ -29,12 +29,12 @@ type serverResponse struct { // head sends an http request to the docker API using the method HEAD. func (cli *Client) head(ctx context.Context, path string, query url.Values, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "HEAD", path, query, nil, headers) + return cli.sendRequest(ctx, http.MethodHead, path, query, nil, headers) } // get sends an http request to the docker API using the method GET with a specific Go context. func (cli *Client) get(ctx context.Context, path string, query url.Values, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "GET", path, query, nil, headers) + return cli.sendRequest(ctx, http.MethodGet, path, query, nil, headers) } // post sends an http request to the docker API using the method POST with a specific Go context. @@ -43,21 +43,21 @@ func (cli *Client) post(ctx context.Context, path string, query url.Values, obj if err != nil { return serverResponse{}, err } - return cli.sendRequest(ctx, "POST", path, query, body, headers) + return cli.sendRequest(ctx, http.MethodPost, path, query, body, headers) } func (cli *Client) postRaw(ctx context.Context, path string, query url.Values, body io.Reader, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "POST", path, query, body, headers) + return cli.sendRequest(ctx, http.MethodPost, path, query, body, headers) } // putRaw sends an http request to the docker API using the method PUT. func (cli *Client) putRaw(ctx context.Context, path string, query url.Values, body io.Reader, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "PUT", path, query, body, headers) + return cli.sendRequest(ctx, http.MethodPut, path, query, body, headers) } // delete sends an http request to the docker API using the method DELETE. func (cli *Client) delete(ctx context.Context, path string, query url.Values, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "DELETE", path, query, nil, headers) + return cli.sendRequest(ctx, http.MethodDelete, path, query, nil, headers) } type headers map[string][]string @@ -79,7 +79,7 @@ func encodeBody(obj interface{}, headers headers) (io.Reader, headers, error) { } func (cli *Client) buildRequest(method, path string, body io.Reader, headers headers) (*http.Request, error) { - expectedPayload := (method == "POST" || method == "PUT") + expectedPayload := (method == http.MethodPost || method == http.MethodPut) if expectedPayload && body == nil { body = bytes.NewReader([]byte{}) } diff --git a/vendor/github.com/docker/docker/client/service_list.go b/vendor/github.com/docker/docker/client/service_list.go index 64d35e715..f97ec75a5 100644 --- a/vendor/github.com/docker/docker/client/service_list.go +++ b/vendor/github.com/docker/docker/client/service_list.go @@ -23,6 +23,10 @@ func (cli *Client) ServiceList(ctx context.Context, options types.ServiceListOpt query.Set("filters", filterJSON) } + if options.Status { + query.Set("status", "true") + } + resp, err := cli.get(ctx, "/services", query, nil) defer ensureReaderClosed(resp) if err != nil { diff --git a/vendor/github.com/docker/docker/client/volume_list.go b/vendor/github.com/docker/docker/client/volume_list.go index d68fc2b98..942498dde 100644 --- a/vendor/github.com/docker/docker/client/volume_list.go +++ b/vendor/github.com/docker/docker/client/volume_list.go @@ -15,7 +15,7 @@ func (cli *Client) VolumeList(ctx context.Context, filter filters.Args) (volumet query := url.Values{} if filter.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, filter) if err != nil { return volumes, err diff --git a/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go b/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go index 284e8be7c..441bd727b 100644 --- a/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go +++ b/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go @@ -16,8 +16,11 @@ func Key() string { // Get returns the home directory of the current user with the help of // environment variables depending on the target operating system. // Returned path should be used with "path/filepath" to form new paths. -// If compiling statically, ensure the osusergo build tag is used. -// If needing to do nss lookups, do not compile statically. +// +// If linking statically with cgo enabled against glibc, ensure the +// osusergo build tag is used. +// +// If needing to do nss lookups, do not disable cgo or set osusergo. func Get() string { home := os.Getenv(Key()) if home == "" { diff --git a/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go b/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go index 6d6640898..814993ec3 100644 --- a/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go +++ b/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go @@ -139,13 +139,13 @@ type JSONMessage struct { Stream string `json:"stream,omitempty"` Status string `json:"status,omitempty"` Progress *JSONProgress `json:"progressDetail,omitempty"` - ProgressMessage string `json:"progress,omitempty"` //deprecated + ProgressMessage string `json:"progress,omitempty"` // deprecated ID string `json:"id,omitempty"` From string `json:"from,omitempty"` Time int64 `json:"time,omitempty"` TimeNano int64 `json:"timeNano,omitempty"` Error *JSONError `json:"errorDetail,omitempty"` - ErrorMessage string `json:"error,omitempty"` //deprecated + ErrorMessage string `json:"error,omitempty"` // deprecated // Aux contains out-of-band data, such as digests for push signing and image id after building. Aux *json.RawMessage `json:"aux,omitempty"` } @@ -177,7 +177,7 @@ func (jm *JSONMessage) Display(out io.Writer, isTerminal bool) error { if isTerminal && jm.Stream == "" && jm.Progress != nil { clearLine(out) endl = "\r" - fmt.Fprintf(out, endl) + fmt.Fprint(out, endl) } else if jm.Progress != nil && jm.Progress.String() != "" { //disable progressbar in non-terminal return nil } @@ -194,7 +194,7 @@ func (jm *JSONMessage) Display(out io.Writer, isTerminal bool) error { } if jm.Progress != nil && isTerminal { fmt.Fprintf(out, "%s %s%s", jm.Status, jm.Progress.String(), endl) - } else if jm.ProgressMessage != "" { //deprecated + } else if jm.ProgressMessage != "" { // deprecated fmt.Fprintf(out, "%s %s%s", jm.Status, jm.ProgressMessage, endl) } else if jm.Stream != "" { fmt.Fprintf(out, "%s%s", jm.Stream, endl) diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go b/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go index fe6e3ddba..58ca61f3f 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go +++ b/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go @@ -90,7 +90,6 @@ func parseInfoFile(r io.Reader, filter FilterFunc) ([]*Info, error) { mount propagation flags in fields[6]. The correct behavior is to ignore any unknown optional fields. */ - break } } if i == numFields { diff --git a/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go b/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go index f3f46055e..3c42cff5e 100644 --- a/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go +++ b/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go @@ -153,7 +153,7 @@ var ( // Stefan Banach - Polish mathematician, was one of the founders of modern functional analysis. https://en.wikipedia.org/wiki/Stefan_Banach "banach", - // Buckaroo Banzai and his mentor Dr. Hikita perfectd the "oscillation overthruster", a device that allows one to pass through solid matter. - https://en.wikipedia.org/wiki/The_Adventures_of_Buckaroo_Banzai_Across_the_8th_Dimension + // Buckaroo Banzai and his mentor Dr. Hikita perfected the "oscillation overthruster", a device that allows one to pass through solid matter. - https://en.wikipedia.org/wiki/The_Adventures_of_Buckaroo_Banzai_Across_the_8th_Dimension "banzai", // John Bardeen co-invented the transistor - https://en.wikipedia.org/wiki/John_Bardeen diff --git a/vendor/github.com/docker/docker/pkg/pools/pools.go b/vendor/github.com/docker/docker/pkg/pools/pools.go index 3b978fd3b..3792c67a9 100644 --- a/vendor/github.com/docker/docker/pkg/pools/pools.go +++ b/vendor/github.com/docker/docker/pkg/pools/pools.go @@ -62,24 +62,23 @@ type bufferPool struct { func newBufferPoolWithSize(size int) *bufferPool { return &bufferPool{ pool: sync.Pool{ - New: func() interface{} { return make([]byte, size) }, + New: func() interface{} { s := make([]byte, size); return &s }, }, } } -func (bp *bufferPool) Get() []byte { - return bp.pool.Get().([]byte) +func (bp *bufferPool) Get() *[]byte { + return bp.pool.Get().(*[]byte) } -func (bp *bufferPool) Put(b []byte) { - //nolint:staticcheck // TODO changing this to a pointer makes tests fail. Investigate if we should change or not (otherwise remove this TODO) +func (bp *bufferPool) Put(b *[]byte) { bp.pool.Put(b) } // Copy is a convenience wrapper which uses a buffer to avoid allocation in io.Copy. func Copy(dst io.Writer, src io.Reader) (written int64, err error) { buf := buffer32KPool.Get() - written, err = io.CopyBuffer(dst, src, buf) + written, err = io.CopyBuffer(dst, src, *buf) buffer32KPool.Put(buf) return } diff --git a/vendor/github.com/docker/docker/pkg/system/init_windows.go b/vendor/github.com/docker/docker/pkg/system/init_windows.go index f303aa906..7e4ac55d7 100644 --- a/vendor/github.com/docker/docker/pkg/system/init_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/init_windows.go @@ -18,8 +18,7 @@ var ( // InitLCOW sets whether LCOW is supported or not. Requires RS5+ func InitLCOW(experimental bool) { - v := GetOSVersion() - if experimental && v.Build >= osversion.RS5 { + if experimental && osversion.Build() >= osversion.RS5 { lcowSupported = true } } diff --git a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go index eb19f9c85..67bec7e30 100644 --- a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go @@ -5,6 +5,7 @@ import ( "syscall" "unsafe" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" "golang.org/x/sys/windows" ) @@ -61,12 +62,7 @@ var ( // OSVersion is a wrapper for Windows version information // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx -type OSVersion struct { - Version uint32 - MajorVersion uint8 - MinorVersion uint8 - Build uint16 -} +type OSVersion osversion.OSVersion // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724833(v=vs.85).aspx type osVersionInfoEx struct { @@ -85,18 +81,9 @@ type osVersionInfoEx struct { // GetOSVersion gets the operating system version on Windows. Note that // dockerd.exe must be manifested to get the correct version information. +// Deprecated: use github.com/Microsoft/hcsshim/osversion.Get() instead func GetOSVersion() OSVersion { - var err error - osv := OSVersion{} - osv.Version, err = windows.GetVersion() - if err != nil { - // GetVersion never fails. - panic(err) - } - osv.MajorVersion = uint8(osv.Version & 0xFF) - osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) - osv.Build = uint16(osv.Version >> 16) - return osv + return OSVersion(osversion.Get()) } func (osv OSVersion) ToString() string { diff --git a/vendor/github.com/fsouza/go-dockerclient/Makefile b/vendor/github.com/fsouza/go-dockerclient/Makefile index e0880ff67..84e1bfaba 100644 --- a/vendor/github.com/fsouza/go-dockerclient/Makefile +++ b/vendor/github.com/fsouza/go-dockerclient/Makefile @@ -1,7 +1,6 @@ .PHONY: \ all \ lint \ - fmt \ pretest \ test \ integration @@ -12,10 +11,6 @@ lint: cd /tmp && GO111MODULE=on go get github.com/golangci/golangci-lint/cmd/golangci-lint@latest golangci-lint run -fmt: - GO111MODULE=off go get mvdan.cc/gofumpt - gofumpt -s -w . - pretest: lint gotest: diff --git a/vendor/github.com/fsouza/go-dockerclient/README.md b/vendor/github.com/fsouza/go-dockerclient/README.md index b7af7d0b9..f4ad8ca62 100644 --- a/vendor/github.com/fsouza/go-dockerclient/README.md +++ b/vendor/github.com/fsouza/go-dockerclient/README.md @@ -18,10 +18,10 @@ documentation](https://docs.docker.com/engine/api/latest/). Link for the official SDK: https://docs.docker.com/develop/sdk/ go-dockerclient was created before Docker had an official Go SDK and is -still maintained and relatively active because it's still used out there. New -features in the Docker API do not get automatically implemented here: it's -based on demand, if someone wants it, they can file an issue or a PR and the -feature may get implemented/merged. +still maintained and active because it's still used out there. New features in +the Docker API do not get automatically implemented here: it's based on demand, +if someone wants it, they can file an issue or a PR and the feature may get +implemented/merged. For new projects, using the official SDK is probably more appropriate as go-dockerclient lags behind the official SDK. @@ -105,7 +105,10 @@ import ( ) func main() { - client, _ := docker.NewClientFromEnv() + client, err := docker.NewClientFromEnv() + if err != nil { + // handle err + } // use client } ``` @@ -118,12 +121,11 @@ All development commands can be seen in the [Makefile](Makefile). Commited code must pass: -* [golangci-lint](integration_unix_test.go) -* [gofumpt](https://github.com/mvdan/gofumpt) +* [golangci-lint](https://github.com/golangci/golangci-lint) * [go test](https://golang.org/cmd/go/#hdr-Test_packages) -Running ``make test`` will check all of these. You can reformat the code with -``make fmt``. +Running ``make test`` will run all checks, as well as install any required +dependencies. ## Modules @@ -133,7 +135,7 @@ If you're using dep, you can check the [releases page](https://github.com/fsouza/go-dockerclient/releases) for the latest release fully compatible with dep. -With other vendoring tools, users might need to specify go-dockerclient's +With other vendoring tools, users need to specify go-dockerclient's dependencies manually. ## Using with Docker 1.9 and Go 1.4 diff --git a/vendor/github.com/fsouza/go-dockerclient/appveyor.yml b/vendor/github.com/fsouza/go-dockerclient/appveyor.yml index d9f374f50..e1574cfc2 100644 --- a/vendor/github.com/fsouza/go-dockerclient/appveyor.yml +++ b/vendor/github.com/fsouza/go-dockerclient/appveyor.yml @@ -7,8 +7,8 @@ environment: GOPROXY: https://proxy.golang.org GO111MODULE: on matrix: - - GOVERSION: "1.12.10" - - GOVERSION: "1.13.1" + - GOVERSION: "1.12.13" + - GOVERSION: "1.13.4" install: - choco install make - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% diff --git a/vendor/github.com/fsouza/go-dockerclient/container.go b/vendor/github.com/fsouza/go-dockerclient/container.go index 0a8ab361c..f6bfb59dc 100644 --- a/vendor/github.com/fsouza/go-dockerclient/container.go +++ b/vendor/github.com/fsouza/go-dockerclient/container.go @@ -546,26 +546,31 @@ func (c *Client) RenameContainer(opts RenameContainerOptions) error { // InspectContainer returns information about a container by its ID. // -// See https://goo.gl/FaI5JT for more details. +// Deprecated: Use InspectContainerWithOptions instead. func (c *Client) InspectContainer(id string) (*Container, error) { - return c.inspectContainer(id, doOptions{}) + return c.InspectContainerWithOptions(InspectContainerOptions{ID: id}) } // InspectContainerWithContext returns information about a container by its ID. // The context object can be used to cancel the inspect request. // -// See https://goo.gl/FaI5JT for more details. +// Deprecated: Use InspectContainerWithOptions instead. //nolint:golint func (c *Client) InspectContainerWithContext(id string, ctx context.Context) (*Container, error) { - return c.inspectContainer(id, doOptions{context: ctx}) + return c.InspectContainerWithOptions(InspectContainerOptions{ID: id, Context: ctx}) } -func (c *Client) inspectContainer(id string, opts doOptions) (*Container, error) { - path := "/containers/" + id + "/json" - resp, err := c.do(http.MethodGet, path, opts) +// InspectContainerWithOptions returns information about a container by its ID. +// +// See https://goo.gl/FaI5JT for more details. +func (c *Client) InspectContainerWithOptions(opts InspectContainerOptions) (*Container, error) { + path := "/containers/" + opts.ID + "/json?" + queryString(opts) + resp, err := c.do(http.MethodGet, path, doOptions{ + context: opts.Context, + }) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { - return nil, &NoSuchContainer{ID: id} + return nil, &NoSuchContainer{ID: opts.ID} } return nil, err } @@ -577,6 +582,15 @@ func (c *Client) inspectContainer(id string, opts doOptions) (*Container, error) return &container, nil } +// InspectContainerOptions specifies parameters for InspectContainerWithOptions. +// +// See https://goo.gl/FaI5JT for more details. +type InspectContainerOptions struct { + Context context.Context + ID string `qs:"-"` + Size bool +} + // ContainerChanges returns changes in the filesystem of the given container. // // See https://goo.gl/15KKzh for more details. diff --git a/vendor/github.com/fsouza/go-dockerclient/go.mod b/vendor/github.com/fsouza/go-dockerclient/go.mod index cb0ef690c..7bb88972c 100644 --- a/vendor/github.com/fsouza/go-dockerclient/go.mod +++ b/vendor/github.com/fsouza/go-dockerclient/go.mod @@ -4,16 +4,13 @@ go 1.12 require ( github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 // indirect - github.com/Microsoft/go-winio v0.4.14 - github.com/Microsoft/hcsshim v0.8.6 // indirect + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c // indirect github.com/containerd/containerd v1.3.0 // indirect - github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 // indirect github.com/docker/distribution v2.7.1+incompatible // indirect - github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce + github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 github.com/docker/go-connections v0.4.0 // indirect github.com/docker/go-units v0.4.0 - github.com/gogo/protobuf v1.2.1 // indirect - github.com/golang/protobuf v1.3.0 // indirect github.com/google/go-cmp v0.3.1 github.com/gorilla/mux v1.7.3 github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c // indirect @@ -22,5 +19,4 @@ require ( github.com/opencontainers/runc v0.1.1 // indirect golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad google.golang.org/grpc v1.22.0 // indirect - gotest.tools v2.2.0+incompatible // indirect ) diff --git a/vendor/github.com/fsouza/go-dockerclient/go.sum b/vendor/github.com/fsouza/go-dockerclient/go.sum index c4df2e956..ce78fee7a 100644 --- a/vendor/github.com/fsouza/go-dockerclient/go.sum +++ b/vendor/github.com/fsouza/go-dockerclient/go.sum @@ -2,85 +2,134 @@ cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMT github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 h1:w+iIsaOQNcT7OZ575w+acHgRric5iCyQh+xv+KJ4HB8= github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= -github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= -github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= -github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= -github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c h1:YMP6olTU903X3gxQJckdmiP8/zkSMq4kN3uipsU9XjU= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c/go.mod h1:7xhjOwRV2+0HXGmM0jxaEu+ZiXJFoVZOTfL/dmqbrD8= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY= github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= -github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882bXEDKfWIf0wa8HRvpnBoPszJJXL+TVbBw4M= -github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/docker/distribution v2.7.1+incompatible h1:a5mlkVzth6W5A4fOsS3D2EO5BUmsJpcB+cRlLU7cSug= github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= -github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce h1:H3csZuxZESJeeEiOxq4YXPNmLFbjl7u2qVBrAAGX/sA= -github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ= github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec= github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/golang/protobuf v1.3.0 h1:kbxbvI4Un1LUWKxufD+BiE6AEExYYgkQLQmLFqA1LFk= -github.com/golang/protobuf v1.3.0/go.mod h1:Qd/q+1AKNOZr9uGQzbzCmRO6sUih6GTPZv6a1/R87v0= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/google/go-cmp v0.3.1 h1:Xye71clBPdm5HgqGwUkwhbynsUJZhDbS20FvLhQ2izg= github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c h1:nXxl5PrvVm2L/wCy8dQu6DMTwH4oIuGN8GJDAlqDdVE= github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.1.1 h1:GlxAyO6x8rfZYN9Tt0Kti5a/cP41iuiO2yYT0IJGY8Y= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad h1:5E5raQxcv+6CZ11RrBYQe5WRbUIWpScjh0kvHZkZIrQ= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= -golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= -golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= -google.golang.org/genproto v0.0.0-20180831171423-11092d34479b h1:lohp5blsw53GBXtLyLNaTXPXS9pJ1tiTw61ZHUoE9Qw= -google.golang.org/genproto v0.0.0-20180831171423-11092d34479b/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.22.0 h1:J0UbZOIrCAl+fpTOf8YLs4dJo8L/owV4LYVtAXQoPkw= google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/godbus/dbus/conn.go b/vendor/github.com/godbus/dbus/conn.go index b38920baf..9dced0cc4 100644 --- a/vendor/github.com/godbus/dbus/conn.go +++ b/vendor/github.com/godbus/dbus/conn.go @@ -134,6 +134,8 @@ func SystemBus() (conn *Conn, err error) { } // SystemBusPrivate returns a new private connection to the system bus. +// Note: this connection is not ready to use. One must perform Auth and Hello +// on the connection before it is useable. func SystemBusPrivate(opts ...ConnOption) (*Conn, error) { return Dial(getSystemBusPlatformAddress(), opts...) } @@ -267,7 +269,7 @@ func (conn *Conn) Eavesdrop(ch chan<- *Message) { conn.eavesdroppedLck.Unlock() } -// GetSerial returns an unused serial. +// getSerial returns an unused serial. func (conn *Conn) getSerial() uint32 { return conn.serialGen.GetSerial() } @@ -381,8 +383,6 @@ func (conn *Conn) Object(dest string, path ObjectPath) BusObject { return &Object{conn, dest, path} } -// outWorker runs in an own goroutine, encoding and sending messages that are -// sent to conn.out. func (conn *Conn) sendMessage(msg *Message) { conn.sendMessageAndIfClosed(msg, func() {}) } diff --git a/vendor/github.com/godbus/dbus/conn_other.go b/vendor/github.com/godbus/dbus/conn_other.go index 289044a44..616dcf664 100644 --- a/vendor/github.com/godbus/dbus/conn_other.go +++ b/vendor/github.com/godbus/dbus/conn_other.go @@ -14,8 +14,10 @@ import ( "strings" ) +var execCommand = exec.Command + func getSessionBusPlatformAddress() (string, error) { - cmd := exec.Command("dbus-launch") + cmd := execCommand("dbus-launch") b, err := cmd.CombinedOutput() if err != nil { @@ -25,7 +27,7 @@ func getSessionBusPlatformAddress() (string, error) { i := bytes.IndexByte(b, '=') j := bytes.IndexByte(b, '\n') - if i == -1 || j == -1 { + if i == -1 || j == -1 || i > j { return "", errors.New("dbus: couldn't determine address of session bus") } diff --git a/vendor/github.com/godbus/dbus/decoder.go b/vendor/github.com/godbus/dbus/decoder.go index 5c27d3b51..ede91575b 100644 --- a/vendor/github.com/godbus/dbus/decoder.go +++ b/vendor/github.com/godbus/dbus/decoder.go @@ -188,8 +188,14 @@ func (dec *decoder) decode(s string, depth int) interface{} { if depth >= 64 { panic(FormatError("input exceeds container depth limit")) } + sig := s[1:] length := dec.decode("u", depth).(uint32) - v := reflect.MakeSlice(reflect.SliceOf(typeFor(s[1:])), 0, int(length)) + // capacity can be determined only for fixed-size element types + var capacity int + if s := sigByteSize(sig); s != 0 { + capacity = int(length) / s + } + v := reflect.MakeSlice(reflect.SliceOf(typeFor(sig)), 0, capacity) // Even for empty arrays, the correct padding must be included align := alignment(typeFor(s[1:])) if len(s) > 1 && s[1] == '(' { @@ -227,6 +233,51 @@ func (dec *decoder) decode(s string, depth int) interface{} { } } +// sigByteSize tries to calculates size of the given signature in bytes. +// +// It returns zero when it can't, for example when it contains non-fixed size +// types such as strings, maps and arrays that require reading of the transmitted +// data, for that we would need to implement the unread method for Decoder first. +func sigByteSize(sig string) int { + var total int + for offset := 0; offset < len(sig); { + switch sig[offset] { + case 'y': + total += 1 + offset += 1 + case 'n', 'q': + total += 2 + offset += 1 + case 'b', 'i', 'u', 'h': + total += 4 + offset += 1 + case 'x', 't', 'd': + total += 8 + offset += 1 + case '(': + i := 1 + depth := 1 + for i < len(sig[offset:]) && depth != 0 { + if sig[offset+i] == '(' { + depth++ + } else if sig[offset+i] == ')' { + depth-- + } + i++ + } + s := sigByteSize(sig[offset+1 : offset+i-1]) + if s == 0 { + return 0 + } + total += s + offset += i + default: + return 0 + } + } + return total +} + // A FormatError is an error in the wire format. type FormatError string diff --git a/vendor/github.com/godbus/dbus/default_handler.go b/vendor/github.com/godbus/dbus/default_handler.go index 81dbcc7e4..890b6f4e0 100644 --- a/vendor/github.com/godbus/dbus/default_handler.go +++ b/vendor/github.com/godbus/dbus/default_handler.go @@ -263,13 +263,13 @@ func (sh *defaultSignalHandler) DeliverSignal(intf, name string, signal *Signal) case <-sh.closeChan: return default: - go func() { + go func(ch chan<- *Signal) { select { case ch <- signal: case <-sh.closeChan: return } - }() + }(ch) } } } diff --git a/vendor/github.com/godbus/dbus/go.mod b/vendor/github.com/godbus/dbus/go.mod index bdcd12598..57014e4ac 100644 --- a/vendor/github.com/godbus/dbus/go.mod +++ b/vendor/github.com/godbus/dbus/go.mod @@ -1 +1,3 @@ module github.com/godbus/dbus + +go 1.12 diff --git a/vendor/github.com/godbus/dbus/object.go b/vendor/github.com/godbus/dbus/object.go index f27ffe144..9309b9b40 100644 --- a/vendor/github.com/godbus/dbus/object.go +++ b/vendor/github.com/godbus/dbus/object.go @@ -16,6 +16,7 @@ type BusObject interface { AddMatchSignal(iface, member string, options ...MatchOption) *Call RemoveMatchSignal(iface, member string, options ...MatchOption) *Call GetProperty(p string) (Variant, error) + SetProperty(p string, v interface{}) error Destination() string Path() ObjectPath } @@ -146,7 +147,7 @@ func (o *Object) createCall(ctx context.Context, method string, flags Flags, ch } if msg.Flags&FlagNoReplyExpected == 0 { if ch == nil { - ch = make(chan *Call, 10) + ch = make(chan *Call, 1) } else if cap(ch) == 0 { panic("dbus: unbuffered channel passed to (*Object).Go") } @@ -187,7 +188,7 @@ func (o *Object) createCall(ctx context.Context, method string, flags Flags, ch return call } -// GetProperty calls org.freedesktop.DBus.Properties.GetProperty on the given +// GetProperty calls org.freedesktop.DBus.Properties.Get on the given // object. The property name must be given in interface.member notation. func (o *Object) GetProperty(p string) (Variant, error) { idx := strings.LastIndex(p, ".") @@ -208,6 +209,20 @@ func (o *Object) GetProperty(p string) (Variant, error) { return result, nil } +// SetProperty calls org.freedesktop.DBus.Properties.Set on the given +// object. The property name must be given in interface.member notation. +func (o *Object) SetProperty(p string, v interface{}) error { + idx := strings.LastIndex(p, ".") + if idx == -1 || idx+1 == len(p) { + return errors.New("dbus: invalid property " + p) + } + + iface := p[:idx] + prop := p[idx+1:] + + return o.Call("org.freedesktop.DBus.Properties.Set", 0, iface, prop, v).Err +} + // Destination returns the destination that calls on (o *Object) are sent to. func (o *Object) Destination() string { return o.dest diff --git a/vendor/github.com/godbus/dbus/transport_tcp.go b/vendor/github.com/godbus/dbus/transport_tcp.go index dd1c8e59c..f91c9b7d7 100644 --- a/vendor/github.com/godbus/dbus/transport_tcp.go +++ b/vendor/github.com/godbus/dbus/transport_tcp.go @@ -1,5 +1,3 @@ -//+build !windows - package dbus import ( diff --git a/vendor/github.com/godbus/dbus/transport_unix.go b/vendor/github.com/godbus/dbus/transport_unix.go index f000c6b5d..c7cd02f97 100644 --- a/vendor/github.com/godbus/dbus/transport_unix.go +++ b/vendor/github.com/godbus/dbus/transport_unix.go @@ -203,7 +203,7 @@ func (t *unixTransport) SendMessage(msg *Message) error { } } else { if err := msg.EncodeTo(t, nativeEndian); err != nil { - return nil + return err } } return nil diff --git a/vendor/github.com/gogo/protobuf/gogoproto/Makefile b/vendor/github.com/gogo/protobuf/gogoproto/Makefile new file mode 100644 index 000000000..0b4659b73 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/Makefile @@ -0,0 +1,37 @@ +# Protocol Buffers for Go with Gadgets +# +# Copyright (c) 2013, The GoGo Authors. All rights reserved. +# http://github.com/gogo/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + protoc --gogo_out=Mgoogle/protobuf/descriptor.proto=github.com/gogo/protobuf/protoc-gen-gogo/descriptor:../../../../ --proto_path=../../../../:../protobuf/:. *.proto + +restore: + cp gogo.pb.golden gogo.pb.go + +preserve: + cp gogo.pb.go gogo.pb.golden diff --git a/vendor/github.com/gogo/protobuf/gogoproto/doc.go b/vendor/github.com/gogo/protobuf/gogoproto/doc.go new file mode 100644 index 000000000..081c86fa8 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/doc.go @@ -0,0 +1,169 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package gogoproto provides extensions for protocol buffers to achieve: + + - fast marshalling and unmarshalling. + - peace of mind by optionally generating test and benchmark code. + - more canonical Go structures. + - less typing by optionally generating extra helper code. + - goprotobuf compatibility + +More Canonical Go Structures + +A lot of time working with a goprotobuf struct will lead you to a place where you create another struct that is easier to work with and then have a function to copy the values between the two structs. +You might also find that basic structs that started their life as part of an API need to be sent over the wire. With gob, you could just send it. With goprotobuf, you need to make a parallel struct. +Gogoprotobuf tries to fix these problems with the nullable, embed, customtype and customname field extensions. + + - nullable, if false, a field is generated without a pointer (see warning below). + - embed, if true, the field is generated as an embedded field. + - customtype, It works with the Marshal and Unmarshal methods, to allow you to have your own types in your struct, but marshal to bytes. For example, custom.Uuid or custom.Fixed128 + - customname (beta), Changes the generated fieldname. This is especially useful when generated methods conflict with fieldnames. + - casttype (beta), Changes the generated fieldtype. All generated code assumes that this type is castable to the protocol buffer field type. It does not work for structs or enums. + - castkey (beta), Changes the generated fieldtype for a map key. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + - castvalue (beta), Changes the generated fieldtype for a map value. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + +Warning about nullable: According to the Protocol Buffer specification, you should be able to tell whether a field is set or unset. With the option nullable=false this feature is lost, since your non-nullable fields will always be set. It can be seen as a layer on top of Protocol Buffers, where before and after marshalling all non-nullable fields are set and they cannot be unset. + +Let us look at: + + github.com/gogo/protobuf/test/example/example.proto + +for a quicker overview. + +The following message: + + package test; + + import "github.com/gogo/protobuf/gogoproto/gogo.proto"; + + message A { + optional string Description = 1 [(gogoproto.nullable) = false]; + optional int64 Number = 2 [(gogoproto.nullable) = false]; + optional bytes Id = 3 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uuid", (gogoproto.nullable) = false]; + } + +Will generate a go struct which looks a lot like this: + + type A struct { + Description string + Number int64 + Id github_com_gogo_protobuf_test_custom.Uuid + } + +You will see there are no pointers, since all fields are non-nullable. +You will also see a custom type which marshals to a string. +Be warned it is your responsibility to test your custom types thoroughly. +You should think of every possible empty and nil case for your marshaling, unmarshaling and size methods. + +Next we will embed the message A in message B. + + message B { + optional A A = 1 [(gogoproto.nullable) = false, (gogoproto.embed) = true]; + repeated bytes G = 2 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uint128", (gogoproto.nullable) = false]; + } + +See below that A is embedded in B. + + type B struct { + A + G []github_com_gogo_protobuf_test_custom.Uint128 + } + +Also see the repeated custom type. + + type Uint128 [2]uint64 + +Next we will create a custom name for one of our fields. + + message C { + optional int64 size = 1 [(gogoproto.customname) = "MySize"]; + } + +See below that the field's name is MySize and not Size. + + type C struct { + MySize *int64 + } + +The is useful when having a protocol buffer message with a field name which conflicts with a generated method. +As an example, having a field name size and using the sizer plugin to generate a Size method will cause a go compiler error. +Using customname you can fix this error without changing the field name. +This is typically useful when working with a protocol buffer that was designed before these methods and/or the go language were avialable. + +Gogoprotobuf also has some more subtle changes, these could be changed back: + + - the generated package name for imports do not have the extra /filename.pb, + but are actually the imports specified in the .proto file. + +Gogoprotobuf also has lost some features which should be brought back with time: + + - Marshalling and unmarshalling with reflect and without the unsafe package, + this requires work in pointer_reflect.go + +Why does nullable break protocol buffer specifications: + +The protocol buffer specification states, somewhere, that you should be able to tell whether a +field is set or unset. With the option nullable=false this feature is lost, +since your non-nullable fields will always be set. It can be seen as a layer on top of +protocol buffers, where before and after marshalling all non-nullable fields are set +and they cannot be unset. + +Goprotobuf Compatibility: + +Gogoprotobuf is compatible with Goprotobuf, because it is compatible with protocol buffers. +Gogoprotobuf generates the same code as goprotobuf if no extensions are used. +The enumprefix, getters and stringer extensions can be used to remove some of the unnecessary code generated by goprotobuf: + + - gogoproto_import, if false, the generated code imports github.com/golang/protobuf/proto instead of github.com/gogo/protobuf/proto. + - goproto_enum_prefix, if false, generates the enum constant names without the messagetype prefix + - goproto_enum_stringer (experimental), if false, the enum is generated without the default string method, this is useful for rather using enum_stringer, or allowing you to write your own string method. + - goproto_getters, if false, the message is generated without get methods, this is useful when you would rather want to use face + - goproto_stringer, if false, the message is generated without the default string method, this is useful for rather using stringer, or allowing you to write your own string method. + - goproto_extensions_map (beta), if false, the extensions field is generated as type []byte instead of type map[int32]proto.Extension + - goproto_unrecognized (beta), if false, XXX_unrecognized field is not generated. This is useful in conjunction with gogoproto.nullable=false, to generate structures completely devoid of pointers and reduce GC pressure at the cost of losing information about unrecognized fields. + - goproto_registration (beta), if true, the generated files will register all messages and types against both gogo/protobuf and golang/protobuf. This is necessary when using third-party packages which read registrations from golang/protobuf (such as the grpc-gateway). + +Less Typing and Peace of Mind is explained in their specific plugin folders godoc: + + - github.com/gogo/protobuf/plugin/<extension_name> + +If you do not use any of these extension the code that is generated +will be the same as if goprotobuf has generated it. + +The most complete way to see examples is to look at + + github.com/gogo/protobuf/test/thetest.proto + +Gogoprototest is a seperate project, +because we want to keep gogoprotobuf independent of goprotobuf, +but we still want to test it thoroughly. + +*/ +package gogoproto diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go new file mode 100644 index 000000000..e352808b9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go @@ -0,0 +1,874 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: gogo.proto + +package gogoproto + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + descriptor "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +var E_GoprotoEnumPrefix = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62001, + Name: "gogoproto.goproto_enum_prefix", + Tag: "varint,62001,opt,name=goproto_enum_prefix", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62021, + Name: "gogoproto.goproto_enum_stringer", + Tag: "varint,62021,opt,name=goproto_enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62022, + Name: "gogoproto.enum_stringer", + Tag: "varint,62022,opt,name=enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*string)(nil), + Field: 62023, + Name: "gogoproto.enum_customname", + Tag: "bytes,62023,opt,name=enum_customname", + Filename: "gogo.proto", +} + +var E_Enumdecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62024, + Name: "gogoproto.enumdecl", + Tag: "varint,62024,opt,name=enumdecl", + Filename: "gogo.proto", +} + +var E_EnumvalueCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumValueOptions)(nil), + ExtensionType: (*string)(nil), + Field: 66001, + Name: "gogoproto.enumvalue_customname", + Tag: "bytes,66001,opt,name=enumvalue_customname", + Filename: "gogo.proto", +} + +var E_GoprotoGettersAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63001, + Name: "gogoproto.goproto_getters_all", + Tag: "varint,63001,opt,name=goproto_getters_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumPrefixAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63002, + Name: "gogoproto.goproto_enum_prefix_all", + Tag: "varint,63002,opt,name=goproto_enum_prefix_all", + Filename: "gogo.proto", +} + +var E_GoprotoStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63003, + Name: "gogoproto.goproto_stringer_all", + Tag: "varint,63003,opt,name=goproto_stringer_all", + Filename: "gogo.proto", +} + +var E_VerboseEqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63004, + Name: "gogoproto.verbose_equal_all", + Tag: "varint,63004,opt,name=verbose_equal_all", + Filename: "gogo.proto", +} + +var E_FaceAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63005, + Name: "gogoproto.face_all", + Tag: "varint,63005,opt,name=face_all", + Filename: "gogo.proto", +} + +var E_GostringAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63006, + Name: "gogoproto.gostring_all", + Tag: "varint,63006,opt,name=gostring_all", + Filename: "gogo.proto", +} + +var E_PopulateAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63007, + Name: "gogoproto.populate_all", + Tag: "varint,63007,opt,name=populate_all", + Filename: "gogo.proto", +} + +var E_StringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63008, + Name: "gogoproto.stringer_all", + Tag: "varint,63008,opt,name=stringer_all", + Filename: "gogo.proto", +} + +var E_OnlyoneAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63009, + Name: "gogoproto.onlyone_all", + Tag: "varint,63009,opt,name=onlyone_all", + Filename: "gogo.proto", +} + +var E_EqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63013, + Name: "gogoproto.equal_all", + Tag: "varint,63013,opt,name=equal_all", + Filename: "gogo.proto", +} + +var E_DescriptionAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63014, + Name: "gogoproto.description_all", + Tag: "varint,63014,opt,name=description_all", + Filename: "gogo.proto", +} + +var E_TestgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63015, + Name: "gogoproto.testgen_all", + Tag: "varint,63015,opt,name=testgen_all", + Filename: "gogo.proto", +} + +var E_BenchgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63016, + Name: "gogoproto.benchgen_all", + Tag: "varint,63016,opt,name=benchgen_all", + Filename: "gogo.proto", +} + +var E_MarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63017, + Name: "gogoproto.marshaler_all", + Tag: "varint,63017,opt,name=marshaler_all", + Filename: "gogo.proto", +} + +var E_UnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63018, + Name: "gogoproto.unmarshaler_all", + Tag: "varint,63018,opt,name=unmarshaler_all", + Filename: "gogo.proto", +} + +var E_StableMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63019, + Name: "gogoproto.stable_marshaler_all", + Tag: "varint,63019,opt,name=stable_marshaler_all", + Filename: "gogo.proto", +} + +var E_SizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63020, + Name: "gogoproto.sizer_all", + Tag: "varint,63020,opt,name=sizer_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63021, + Name: "gogoproto.goproto_enum_stringer_all", + Tag: "varint,63021,opt,name=goproto_enum_stringer_all", + Filename: "gogo.proto", +} + +var E_EnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63022, + Name: "gogoproto.enum_stringer_all", + Tag: "varint,63022,opt,name=enum_stringer_all", + Filename: "gogo.proto", +} + +var E_UnsafeMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63023, + Name: "gogoproto.unsafe_marshaler_all", + Tag: "varint,63023,opt,name=unsafe_marshaler_all", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63024, + Name: "gogoproto.unsafe_unmarshaler_all", + Tag: "varint,63024,opt,name=unsafe_unmarshaler_all", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMapAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63025, + Name: "gogoproto.goproto_extensions_map_all", + Tag: "varint,63025,opt,name=goproto_extensions_map_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognizedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63026, + Name: "gogoproto.goproto_unrecognized_all", + Tag: "varint,63026,opt,name=goproto_unrecognized_all", + Filename: "gogo.proto", +} + +var E_GogoprotoImport = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63027, + Name: "gogoproto.gogoproto_import", + Tag: "varint,63027,opt,name=gogoproto_import", + Filename: "gogo.proto", +} + +var E_ProtosizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63028, + Name: "gogoproto.protosizer_all", + Tag: "varint,63028,opt,name=protosizer_all", + Filename: "gogo.proto", +} + +var E_CompareAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63029, + Name: "gogoproto.compare_all", + Tag: "varint,63029,opt,name=compare_all", + Filename: "gogo.proto", +} + +var E_TypedeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63030, + Name: "gogoproto.typedecl_all", + Tag: "varint,63030,opt,name=typedecl_all", + Filename: "gogo.proto", +} + +var E_EnumdeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63031, + Name: "gogoproto.enumdecl_all", + Tag: "varint,63031,opt,name=enumdecl_all", + Filename: "gogo.proto", +} + +var E_GoprotoRegistration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63032, + Name: "gogoproto.goproto_registration", + Tag: "varint,63032,opt,name=goproto_registration", + Filename: "gogo.proto", +} + +var E_MessagenameAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63033, + Name: "gogoproto.messagename_all", + Tag: "varint,63033,opt,name=messagename_all", + Filename: "gogo.proto", +} + +var E_GoprotoSizecacheAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63034, + Name: "gogoproto.goproto_sizecache_all", + Tag: "varint,63034,opt,name=goproto_sizecache_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63035, + Name: "gogoproto.goproto_unkeyed_all", + Tag: "varint,63035,opt,name=goproto_unkeyed_all", + Filename: "gogo.proto", +} + +var E_GoprotoGetters = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64001, + Name: "gogoproto.goproto_getters", + Tag: "varint,64001,opt,name=goproto_getters", + Filename: "gogo.proto", +} + +var E_GoprotoStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64003, + Name: "gogoproto.goproto_stringer", + Tag: "varint,64003,opt,name=goproto_stringer", + Filename: "gogo.proto", +} + +var E_VerboseEqual = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64004, + Name: "gogoproto.verbose_equal", + Tag: "varint,64004,opt,name=verbose_equal", + Filename: "gogo.proto", +} + +var E_Face = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64005, + Name: "gogoproto.face", + Tag: "varint,64005,opt,name=face", + Filename: "gogo.proto", +} + +var E_Gostring = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64006, + Name: "gogoproto.gostring", + Tag: "varint,64006,opt,name=gostring", + Filename: "gogo.proto", +} + +var E_Populate = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64007, + Name: "gogoproto.populate", + Tag: "varint,64007,opt,name=populate", + Filename: "gogo.proto", +} + +var E_Stringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 67008, + Name: "gogoproto.stringer", + Tag: "varint,67008,opt,name=stringer", + Filename: "gogo.proto", +} + +var E_Onlyone = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64009, + Name: "gogoproto.onlyone", + Tag: "varint,64009,opt,name=onlyone", + Filename: "gogo.proto", +} + +var E_Equal = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64013, + Name: "gogoproto.equal", + Tag: "varint,64013,opt,name=equal", + Filename: "gogo.proto", +} + +var E_Description = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64014, + Name: "gogoproto.description", + Tag: "varint,64014,opt,name=description", + Filename: "gogo.proto", +} + +var E_Testgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64015, + Name: "gogoproto.testgen", + Tag: "varint,64015,opt,name=testgen", + Filename: "gogo.proto", +} + +var E_Benchgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64016, + Name: "gogoproto.benchgen", + Tag: "varint,64016,opt,name=benchgen", + Filename: "gogo.proto", +} + +var E_Marshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64017, + Name: "gogoproto.marshaler", + Tag: "varint,64017,opt,name=marshaler", + Filename: "gogo.proto", +} + +var E_Unmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64018, + Name: "gogoproto.unmarshaler", + Tag: "varint,64018,opt,name=unmarshaler", + Filename: "gogo.proto", +} + +var E_StableMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64019, + Name: "gogoproto.stable_marshaler", + Tag: "varint,64019,opt,name=stable_marshaler", + Filename: "gogo.proto", +} + +var E_Sizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64020, + Name: "gogoproto.sizer", + Tag: "varint,64020,opt,name=sizer", + Filename: "gogo.proto", +} + +var E_UnsafeMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64023, + Name: "gogoproto.unsafe_marshaler", + Tag: "varint,64023,opt,name=unsafe_marshaler", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64024, + Name: "gogoproto.unsafe_unmarshaler", + Tag: "varint,64024,opt,name=unsafe_unmarshaler", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMap = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64025, + Name: "gogoproto.goproto_extensions_map", + Tag: "varint,64025,opt,name=goproto_extensions_map", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognized = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64026, + Name: "gogoproto.goproto_unrecognized", + Tag: "varint,64026,opt,name=goproto_unrecognized", + Filename: "gogo.proto", +} + +var E_Protosizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64028, + Name: "gogoproto.protosizer", + Tag: "varint,64028,opt,name=protosizer", + Filename: "gogo.proto", +} + +var E_Compare = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64029, + Name: "gogoproto.compare", + Tag: "varint,64029,opt,name=compare", + Filename: "gogo.proto", +} + +var E_Typedecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64030, + Name: "gogoproto.typedecl", + Tag: "varint,64030,opt,name=typedecl", + Filename: "gogo.proto", +} + +var E_Messagename = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64033, + Name: "gogoproto.messagename", + Tag: "varint,64033,opt,name=messagename", + Filename: "gogo.proto", +} + +var E_GoprotoSizecache = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64034, + Name: "gogoproto.goproto_sizecache", + Tag: "varint,64034,opt,name=goproto_sizecache", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64035, + Name: "gogoproto.goproto_unkeyed", + Tag: "varint,64035,opt,name=goproto_unkeyed", + Filename: "gogo.proto", +} + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65001, + Name: "gogoproto.nullable", + Tag: "varint,65001,opt,name=nullable", + Filename: "gogo.proto", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65002, + Name: "gogoproto.embed", + Tag: "varint,65002,opt,name=embed", + Filename: "gogo.proto", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65003, + Name: "gogoproto.customtype", + Tag: "bytes,65003,opt,name=customtype", + Filename: "gogo.proto", +} + +var E_Customname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65004, + Name: "gogoproto.customname", + Tag: "bytes,65004,opt,name=customname", + Filename: "gogo.proto", +} + +var E_Jsontag = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65005, + Name: "gogoproto.jsontag", + Tag: "bytes,65005,opt,name=jsontag", + Filename: "gogo.proto", +} + +var E_Moretags = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65006, + Name: "gogoproto.moretags", + Tag: "bytes,65006,opt,name=moretags", + Filename: "gogo.proto", +} + +var E_Casttype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65007, + Name: "gogoproto.casttype", + Tag: "bytes,65007,opt,name=casttype", + Filename: "gogo.proto", +} + +var E_Castkey = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65008, + Name: "gogoproto.castkey", + Tag: "bytes,65008,opt,name=castkey", + Filename: "gogo.proto", +} + +var E_Castvalue = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65009, + Name: "gogoproto.castvalue", + Tag: "bytes,65009,opt,name=castvalue", + Filename: "gogo.proto", +} + +var E_Stdtime = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65010, + Name: "gogoproto.stdtime", + Tag: "varint,65010,opt,name=stdtime", + Filename: "gogo.proto", +} + +var E_Stdduration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65011, + Name: "gogoproto.stdduration", + Tag: "varint,65011,opt,name=stdduration", + Filename: "gogo.proto", +} + +var E_Wktpointer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65012, + Name: "gogoproto.wktpointer", + Tag: "varint,65012,opt,name=wktpointer", + Filename: "gogo.proto", +} + +func init() { + proto.RegisterExtension(E_GoprotoEnumPrefix) + proto.RegisterExtension(E_GoprotoEnumStringer) + proto.RegisterExtension(E_EnumStringer) + proto.RegisterExtension(E_EnumCustomname) + proto.RegisterExtension(E_Enumdecl) + proto.RegisterExtension(E_EnumvalueCustomname) + proto.RegisterExtension(E_GoprotoGettersAll) + proto.RegisterExtension(E_GoprotoEnumPrefixAll) + proto.RegisterExtension(E_GoprotoStringerAll) + proto.RegisterExtension(E_VerboseEqualAll) + proto.RegisterExtension(E_FaceAll) + proto.RegisterExtension(E_GostringAll) + proto.RegisterExtension(E_PopulateAll) + proto.RegisterExtension(E_StringerAll) + proto.RegisterExtension(E_OnlyoneAll) + proto.RegisterExtension(E_EqualAll) + proto.RegisterExtension(E_DescriptionAll) + proto.RegisterExtension(E_TestgenAll) + proto.RegisterExtension(E_BenchgenAll) + proto.RegisterExtension(E_MarshalerAll) + proto.RegisterExtension(E_UnmarshalerAll) + proto.RegisterExtension(E_StableMarshalerAll) + proto.RegisterExtension(E_SizerAll) + proto.RegisterExtension(E_GoprotoEnumStringerAll) + proto.RegisterExtension(E_EnumStringerAll) + proto.RegisterExtension(E_UnsafeMarshalerAll) + proto.RegisterExtension(E_UnsafeUnmarshalerAll) + proto.RegisterExtension(E_GoprotoExtensionsMapAll) + proto.RegisterExtension(E_GoprotoUnrecognizedAll) + proto.RegisterExtension(E_GogoprotoImport) + proto.RegisterExtension(E_ProtosizerAll) + proto.RegisterExtension(E_CompareAll) + proto.RegisterExtension(E_TypedeclAll) + proto.RegisterExtension(E_EnumdeclAll) + proto.RegisterExtension(E_GoprotoRegistration) + proto.RegisterExtension(E_MessagenameAll) + proto.RegisterExtension(E_GoprotoSizecacheAll) + proto.RegisterExtension(E_GoprotoUnkeyedAll) + proto.RegisterExtension(E_GoprotoGetters) + proto.RegisterExtension(E_GoprotoStringer) + proto.RegisterExtension(E_VerboseEqual) + proto.RegisterExtension(E_Face) + proto.RegisterExtension(E_Gostring) + proto.RegisterExtension(E_Populate) + proto.RegisterExtension(E_Stringer) + proto.RegisterExtension(E_Onlyone) + proto.RegisterExtension(E_Equal) + proto.RegisterExtension(E_Description) + proto.RegisterExtension(E_Testgen) + proto.RegisterExtension(E_Benchgen) + proto.RegisterExtension(E_Marshaler) + proto.RegisterExtension(E_Unmarshaler) + proto.RegisterExtension(E_StableMarshaler) + proto.RegisterExtension(E_Sizer) + proto.RegisterExtension(E_UnsafeMarshaler) + proto.RegisterExtension(E_UnsafeUnmarshaler) + proto.RegisterExtension(E_GoprotoExtensionsMap) + proto.RegisterExtension(E_GoprotoUnrecognized) + proto.RegisterExtension(E_Protosizer) + proto.RegisterExtension(E_Compare) + proto.RegisterExtension(E_Typedecl) + proto.RegisterExtension(E_Messagename) + proto.RegisterExtension(E_GoprotoSizecache) + proto.RegisterExtension(E_GoprotoUnkeyed) + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) + proto.RegisterExtension(E_Customname) + proto.RegisterExtension(E_Jsontag) + proto.RegisterExtension(E_Moretags) + proto.RegisterExtension(E_Casttype) + proto.RegisterExtension(E_Castkey) + proto.RegisterExtension(E_Castvalue) + proto.RegisterExtension(E_Stdtime) + proto.RegisterExtension(E_Stdduration) + proto.RegisterExtension(E_Wktpointer) +} + +func init() { proto.RegisterFile("gogo.proto", fileDescriptor_592445b5231bc2b9) } + +var fileDescriptor_592445b5231bc2b9 = []byte{ + // 1328 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x98, 0x49, 0x6f, 0x1c, 0x45, + 0x14, 0x80, 0x85, 0x48, 0x64, 0x4f, 0x79, 0x8b, 0xc7, 0xc6, 0x84, 0x08, 0x44, 0xe0, 0xc4, 0xc9, + 0x3e, 0x45, 0x28, 0x65, 0x45, 0x96, 0x63, 0x39, 0x56, 0x10, 0x0e, 0xc6, 0x89, 0xc3, 0x76, 0x18, + 0xf5, 0xf4, 0x94, 0xdb, 0x8d, 0xbb, 0xbb, 0x9a, 0xee, 0xea, 0x10, 0xe7, 0x86, 0xc2, 0x22, 0x84, + 0xd8, 0x91, 0x20, 0x21, 0x09, 0x04, 0xc4, 0xbe, 0x86, 0x7d, 0xb9, 0x70, 0x61, 0xb9, 0xf2, 0x1f, + 0xb8, 0x00, 0x66, 0xf7, 0xcd, 0x17, 0xf4, 0xba, 0xdf, 0xeb, 0xa9, 0x69, 0x8f, 0x54, 0x35, 0xb7, + 0xf6, 0xb8, 0xbe, 0x6f, 0xaa, 0xdf, 0xeb, 0x7a, 0xef, 0x4d, 0x33, 0xe6, 0x49, 0x4f, 0x4e, 0xc6, + 0x89, 0x54, 0xb2, 0x5e, 0x83, 0xeb, 0xfc, 0x72, 0xdf, 0x7e, 0x4f, 0x4a, 0x2f, 0x10, 0x53, 0xf9, + 0x5f, 0xcd, 0x6c, 0x75, 0xaa, 0x25, 0x52, 0x37, 0xf1, 0x63, 0x25, 0x93, 0x62, 0x31, 0x3f, 0xc6, + 0xc6, 0x70, 0x71, 0x43, 0x44, 0x59, 0xd8, 0x88, 0x13, 0xb1, 0xea, 0x9f, 0xae, 0x5f, 0x3f, 0x59, + 0x90, 0x93, 0x44, 0x4e, 0xce, 0x47, 0x59, 0x78, 0x47, 0xac, 0x7c, 0x19, 0xa5, 0x7b, 0xaf, 0xfc, + 0x72, 0xf5, 0xfe, 0xab, 0x6e, 0xe9, 0x5f, 0x1e, 0x45, 0x14, 0xfe, 0xb7, 0x94, 0x83, 0x7c, 0x99, + 0x5d, 0xd3, 0xe1, 0x4b, 0x55, 0xe2, 0x47, 0x9e, 0x48, 0x0c, 0xc6, 0xef, 0xd1, 0x38, 0xa6, 0x19, + 0x8f, 0x23, 0xca, 0xe7, 0xd8, 0x50, 0x2f, 0xae, 0x1f, 0xd0, 0x35, 0x28, 0x74, 0xc9, 0x02, 0x1b, + 0xc9, 0x25, 0x6e, 0x96, 0x2a, 0x19, 0x46, 0x4e, 0x28, 0x0c, 0x9a, 0x1f, 0x73, 0x4d, 0x6d, 0x79, + 0x18, 0xb0, 0xb9, 0x92, 0xe2, 0x9c, 0xf5, 0xc3, 0x27, 0x2d, 0xe1, 0x06, 0x06, 0xc3, 0x4f, 0xb8, + 0x91, 0x72, 0x3d, 0x3f, 0xc9, 0xc6, 0xe1, 0xfa, 0x94, 0x13, 0x64, 0x42, 0xdf, 0xc9, 0x4d, 0x5d, + 0x3d, 0x27, 0x61, 0x19, 0xc9, 0x7e, 0x3e, 0xbb, 0x2b, 0xdf, 0xce, 0x58, 0x29, 0xd0, 0xf6, 0xa4, + 0x65, 0xd1, 0x13, 0x4a, 0x89, 0x24, 0x6d, 0x38, 0x41, 0xb7, 0xed, 0x1d, 0xf1, 0x83, 0xd2, 0x78, + 0x6e, 0xb3, 0x33, 0x8b, 0x0b, 0x05, 0x39, 0x1b, 0x04, 0x7c, 0x85, 0x5d, 0xdb, 0xe5, 0xa9, 0xb0, + 0x70, 0x9e, 0x47, 0xe7, 0xf8, 0x8e, 0x27, 0x03, 0xb4, 0x4b, 0x8c, 0x3e, 0x2f, 0x73, 0x69, 0xe1, + 0x7c, 0x19, 0x9d, 0x75, 0x64, 0x29, 0xa5, 0x60, 0xbc, 0x8d, 0x8d, 0x9e, 0x12, 0x49, 0x53, 0xa6, + 0xa2, 0x21, 0x1e, 0xc8, 0x9c, 0xc0, 0x42, 0x77, 0x01, 0x75, 0x23, 0x08, 0xce, 0x03, 0x07, 0xae, + 0x83, 0xac, 0x7f, 0xd5, 0x71, 0x85, 0x85, 0xe2, 0x22, 0x2a, 0xfa, 0x60, 0x3d, 0xa0, 0xb3, 0x6c, + 0xd0, 0x93, 0xc5, 0x2d, 0x59, 0xe0, 0x97, 0x10, 0x1f, 0x20, 0x06, 0x15, 0xb1, 0x8c, 0xb3, 0xc0, + 0x51, 0x36, 0x3b, 0x78, 0x85, 0x14, 0xc4, 0xa0, 0xa2, 0x87, 0xb0, 0xbe, 0x4a, 0x8a, 0x54, 0x8b, + 0xe7, 0x0c, 0x1b, 0x90, 0x51, 0xb0, 0x21, 0x23, 0x9b, 0x4d, 0x5c, 0x46, 0x03, 0x43, 0x04, 0x04, + 0xd3, 0xac, 0x66, 0x9b, 0x88, 0x37, 0x36, 0xe9, 0x78, 0x50, 0x06, 0x16, 0xd8, 0x08, 0x15, 0x28, + 0x5f, 0x46, 0x16, 0x8a, 0x37, 0x51, 0x31, 0xac, 0x61, 0x78, 0x1b, 0x4a, 0xa4, 0xca, 0x13, 0x36, + 0x92, 0xb7, 0xe8, 0x36, 0x10, 0xc1, 0x50, 0x36, 0x45, 0xe4, 0xae, 0xd9, 0x19, 0xde, 0xa6, 0x50, + 0x12, 0x03, 0x8a, 0x39, 0x36, 0x14, 0x3a, 0x49, 0xba, 0xe6, 0x04, 0x56, 0xe9, 0x78, 0x07, 0x1d, + 0x83, 0x25, 0x84, 0x11, 0xc9, 0xa2, 0x5e, 0x34, 0xef, 0x52, 0x44, 0x34, 0x0c, 0x8f, 0x5e, 0xaa, + 0x9c, 0x66, 0x20, 0x1a, 0xbd, 0xd8, 0xde, 0xa3, 0xa3, 0x57, 0xb0, 0x8b, 0xba, 0x71, 0x9a, 0xd5, + 0x52, 0xff, 0x8c, 0x95, 0xe6, 0x7d, 0xca, 0x74, 0x0e, 0x00, 0x7c, 0x0f, 0xbb, 0xae, 0x6b, 0x9b, + 0xb0, 0x90, 0x7d, 0x80, 0xb2, 0x89, 0x2e, 0xad, 0x02, 0x4b, 0x42, 0xaf, 0xca, 0x0f, 0xa9, 0x24, + 0x88, 0x8a, 0x6b, 0x89, 0x8d, 0x67, 0x51, 0xea, 0xac, 0xf6, 0x16, 0xb5, 0x8f, 0x28, 0x6a, 0x05, + 0xdb, 0x11, 0xb5, 0x13, 0x6c, 0x02, 0x8d, 0xbd, 0xe5, 0xf5, 0x63, 0x2a, 0xac, 0x05, 0xbd, 0xd2, + 0x99, 0xdd, 0xfb, 0xd8, 0xbe, 0x32, 0x9c, 0xa7, 0x95, 0x88, 0x52, 0x60, 0x1a, 0xa1, 0x13, 0x5b, + 0x98, 0xaf, 0xa0, 0x99, 0x2a, 0xfe, 0x7c, 0x29, 0x58, 0x74, 0x62, 0x90, 0xdf, 0xcd, 0xf6, 0x92, + 0x3c, 0x8b, 0x12, 0xe1, 0x4a, 0x2f, 0xf2, 0xcf, 0x88, 0x96, 0x85, 0xfa, 0x93, 0x4a, 0xaa, 0x56, + 0x34, 0x1c, 0xcc, 0x47, 0xd9, 0x9e, 0x72, 0x56, 0x69, 0xf8, 0x61, 0x2c, 0x13, 0x65, 0x30, 0x7e, + 0x4a, 0x99, 0x2a, 0xb9, 0xa3, 0x39, 0xc6, 0xe7, 0xd9, 0x70, 0xfe, 0xa7, 0xed, 0x23, 0xf9, 0x19, + 0x8a, 0x86, 0xda, 0x14, 0x16, 0x0e, 0x57, 0x86, 0xb1, 0x93, 0xd8, 0xd4, 0xbf, 0xcf, 0xa9, 0x70, + 0x20, 0x82, 0x85, 0x43, 0x6d, 0xc4, 0x02, 0xba, 0xbd, 0x85, 0xe1, 0x0b, 0x2a, 0x1c, 0xc4, 0xa0, + 0x82, 0x06, 0x06, 0x0b, 0xc5, 0x97, 0xa4, 0x20, 0x06, 0x14, 0x77, 0xb6, 0x1b, 0x6d, 0x22, 0x3c, + 0x3f, 0x55, 0x89, 0x03, 0xab, 0x0d, 0xaa, 0xaf, 0x36, 0x3b, 0x87, 0xb0, 0x65, 0x0d, 0x85, 0x4a, + 0x14, 0x8a, 0x34, 0x75, 0x3c, 0x01, 0x13, 0x87, 0xc5, 0xc6, 0xbe, 0xa6, 0x4a, 0xa4, 0x61, 0xb0, + 0x37, 0x6d, 0x42, 0x84, 0xb0, 0xbb, 0x8e, 0xbb, 0x66, 0xa3, 0xfb, 0xa6, 0xb2, 0xb9, 0xe3, 0xc4, + 0x82, 0x53, 0x9b, 0x7f, 0xb2, 0x68, 0x5d, 0x6c, 0x58, 0x3d, 0x9d, 0xdf, 0x56, 0xe6, 0x9f, 0x95, + 0x82, 0x2c, 0x6a, 0xc8, 0x48, 0x65, 0x9e, 0xaa, 0xdf, 0xb8, 0xc3, 0xb5, 0x58, 0xdc, 0x17, 0xe9, + 0x1e, 0xda, 0xc2, 0xfb, 0xed, 0x1c, 0xa7, 0xf8, 0xed, 0xf0, 0x90, 0x77, 0x0e, 0x3d, 0x66, 0xd9, + 0xd9, 0xad, 0xf2, 0x39, 0xef, 0x98, 0x79, 0xf8, 0x11, 0x36, 0xd4, 0x31, 0xf0, 0x98, 0x55, 0x0f, + 0xa3, 0x6a, 0x50, 0x9f, 0x77, 0xf8, 0x01, 0xb6, 0x0b, 0x86, 0x17, 0x33, 0xfe, 0x08, 0xe2, 0xf9, + 0x72, 0x7e, 0x88, 0xf5, 0xd3, 0xd0, 0x62, 0x46, 0x1f, 0x45, 0xb4, 0x44, 0x00, 0xa7, 0x81, 0xc5, + 0x8c, 0x3f, 0x46, 0x38, 0x21, 0x80, 0xdb, 0x87, 0xf0, 0xbb, 0x27, 0x76, 0x61, 0xd3, 0xa1, 0xd8, + 0x4d, 0xb3, 0x3e, 0x9c, 0x54, 0xcc, 0xf4, 0xe3, 0xf8, 0xe5, 0x44, 0xf0, 0x5b, 0xd9, 0x6e, 0xcb, + 0x80, 0x3f, 0x89, 0x68, 0xb1, 0x9e, 0xcf, 0xb1, 0x01, 0x6d, 0x3a, 0x31, 0xe3, 0x4f, 0x21, 0xae, + 0x53, 0xb0, 0x75, 0x9c, 0x4e, 0xcc, 0x82, 0xa7, 0x69, 0xeb, 0x48, 0x40, 0xd8, 0x68, 0x30, 0x31, + 0xd3, 0xcf, 0x50, 0xd4, 0x09, 0xe1, 0x33, 0xac, 0x56, 0x36, 0x1b, 0x33, 0xff, 0x2c, 0xf2, 0x6d, + 0x06, 0x22, 0xa0, 0x35, 0x3b, 0xb3, 0xe2, 0x39, 0x8a, 0x80, 0x46, 0xc1, 0x31, 0xaa, 0x0e, 0x30, + 0x66, 0xd3, 0xf3, 0x74, 0x8c, 0x2a, 0xf3, 0x0b, 0x64, 0x33, 0xaf, 0xf9, 0x66, 0xc5, 0x0b, 0x94, + 0xcd, 0x7c, 0x3d, 0x6c, 0xa3, 0x3a, 0x11, 0x98, 0x1d, 0x2f, 0xd2, 0x36, 0x2a, 0x03, 0x01, 0x5f, + 0x62, 0xf5, 0x9d, 0xd3, 0x80, 0xd9, 0xf7, 0x12, 0xfa, 0x46, 0x77, 0x0c, 0x03, 0xfc, 0x2e, 0x36, + 0xd1, 0x7d, 0x12, 0x30, 0x5b, 0xcf, 0x6d, 0x55, 0x7e, 0xbb, 0xe9, 0x83, 0x00, 0x3f, 0xd1, 0x6e, + 0x29, 0xfa, 0x14, 0x60, 0xd6, 0x9e, 0xdf, 0xea, 0x2c, 0xdc, 0xfa, 0x10, 0xc0, 0x67, 0x19, 0x6b, + 0x37, 0x60, 0xb3, 0xeb, 0x02, 0xba, 0x34, 0x08, 0x8e, 0x06, 0xf6, 0x5f, 0x33, 0x7f, 0x91, 0x8e, + 0x06, 0x12, 0x70, 0x34, 0xa8, 0xf5, 0x9a, 0xe9, 0x4b, 0x74, 0x34, 0x08, 0x81, 0x27, 0x5b, 0xeb, + 0x6e, 0x66, 0xc3, 0x65, 0x7a, 0xb2, 0x35, 0x8a, 0x1f, 0x63, 0xa3, 0x3b, 0x1a, 0xa2, 0x59, 0xf5, + 0x1a, 0xaa, 0xf6, 0x54, 0xfb, 0xa1, 0xde, 0xbc, 0xb0, 0x19, 0x9a, 0x6d, 0xaf, 0x57, 0x9a, 0x17, + 0xf6, 0x42, 0x3e, 0xcd, 0xfa, 0xa3, 0x2c, 0x08, 0xe0, 0xf0, 0xd4, 0x6f, 0xe8, 0xd2, 0x4d, 0x45, + 0xd0, 0x22, 0xc5, 0xaf, 0xdb, 0x18, 0x1d, 0x02, 0xf8, 0x01, 0xb6, 0x5b, 0x84, 0x4d, 0xd1, 0x32, + 0x91, 0xbf, 0x6d, 0x53, 0xc1, 0x84, 0xd5, 0x7c, 0x86, 0xb1, 0xe2, 0xd5, 0x08, 0x84, 0xd9, 0xc4, + 0xfe, 0xbe, 0x5d, 0xbc, 0xa5, 0xd1, 0x90, 0xb6, 0x20, 0x4f, 0x8a, 0x41, 0xb0, 0xd9, 0x29, 0xc8, + 0x33, 0x72, 0x90, 0xf5, 0xdd, 0x9f, 0xca, 0x48, 0x39, 0x9e, 0x89, 0xfe, 0x03, 0x69, 0x5a, 0x0f, + 0x01, 0x0b, 0x65, 0x22, 0x94, 0xe3, 0xa5, 0x26, 0xf6, 0x4f, 0x64, 0x4b, 0x00, 0x60, 0xd7, 0x49, + 0x95, 0xcd, 0x7d, 0xff, 0x45, 0x30, 0x01, 0xb0, 0x69, 0xb8, 0x5e, 0x17, 0x1b, 0x26, 0xf6, 0x6f, + 0xda, 0x34, 0xae, 0xe7, 0x87, 0x58, 0x0d, 0x2e, 0xf3, 0xb7, 0x4a, 0x26, 0xf8, 0x1f, 0x84, 0xdb, + 0x04, 0x7c, 0x73, 0xaa, 0x5a, 0xca, 0x37, 0x07, 0xfb, 0x5f, 0xcc, 0x34, 0xad, 0xe7, 0xb3, 0x6c, + 0x20, 0x55, 0xad, 0x56, 0x86, 0xf3, 0xa9, 0x01, 0xff, 0x6f, 0xbb, 0x7c, 0x65, 0x51, 0x32, 0x90, + 0xed, 0x07, 0xd7, 0x55, 0x2c, 0xfd, 0x48, 0x89, 0xc4, 0x64, 0xd8, 0x42, 0x83, 0x86, 0x1c, 0x9e, + 0x67, 0x63, 0xae, 0x0c, 0xab, 0xdc, 0x61, 0xb6, 0x20, 0x17, 0xe4, 0x52, 0x5e, 0x67, 0xee, 0xbd, + 0xd9, 0xf3, 0xd5, 0x5a, 0xd6, 0x9c, 0x74, 0x65, 0x38, 0x05, 0xbf, 0x3c, 0xda, 0x2f, 0x54, 0xcb, + 0xdf, 0x21, 0xff, 0x07, 0x00, 0x00, 0xff, 0xff, 0x9c, 0xaf, 0x70, 0x4e, 0x83, 0x15, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden new file mode 100644 index 000000000..f6502e4b9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden @@ -0,0 +1,45 @@ +// Code generated by protoc-gen-go. +// source: gogo.proto +// DO NOT EDIT! + +package gogoproto + +import proto "github.com/gogo/protobuf/proto" +import json "encoding/json" +import math "math" +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + +// Reference proto, json, and math imports to suppress error if they are not otherwise used. +var _ = proto.Marshal +var _ = &json.SyntaxError{} +var _ = math.Inf + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51235, + Name: "gogoproto.nullable", + Tag: "varint,51235,opt,name=nullable", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51236, + Name: "gogoproto.embed", + Tag: "varint,51236,opt,name=embed", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 51237, + Name: "gogoproto.customtype", + Tag: "bytes,51237,opt,name=customtype", +} + +func init() { + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto new file mode 100644 index 000000000..b80c85653 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto @@ -0,0 +1,144 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto2"; +package gogoproto; + +import "google/protobuf/descriptor.proto"; + +option java_package = "com.google.protobuf"; +option java_outer_classname = "GoGoProtos"; +option go_package = "github.com/gogo/protobuf/gogoproto"; + +extend google.protobuf.EnumOptions { + optional bool goproto_enum_prefix = 62001; + optional bool goproto_enum_stringer = 62021; + optional bool enum_stringer = 62022; + optional string enum_customname = 62023; + optional bool enumdecl = 62024; +} + +extend google.protobuf.EnumValueOptions { + optional string enumvalue_customname = 66001; +} + +extend google.protobuf.FileOptions { + optional bool goproto_getters_all = 63001; + optional bool goproto_enum_prefix_all = 63002; + optional bool goproto_stringer_all = 63003; + optional bool verbose_equal_all = 63004; + optional bool face_all = 63005; + optional bool gostring_all = 63006; + optional bool populate_all = 63007; + optional bool stringer_all = 63008; + optional bool onlyone_all = 63009; + + optional bool equal_all = 63013; + optional bool description_all = 63014; + optional bool testgen_all = 63015; + optional bool benchgen_all = 63016; + optional bool marshaler_all = 63017; + optional bool unmarshaler_all = 63018; + optional bool stable_marshaler_all = 63019; + + optional bool sizer_all = 63020; + + optional bool goproto_enum_stringer_all = 63021; + optional bool enum_stringer_all = 63022; + + optional bool unsafe_marshaler_all = 63023; + optional bool unsafe_unmarshaler_all = 63024; + + optional bool goproto_extensions_map_all = 63025; + optional bool goproto_unrecognized_all = 63026; + optional bool gogoproto_import = 63027; + optional bool protosizer_all = 63028; + optional bool compare_all = 63029; + optional bool typedecl_all = 63030; + optional bool enumdecl_all = 63031; + + optional bool goproto_registration = 63032; + optional bool messagename_all = 63033; + + optional bool goproto_sizecache_all = 63034; + optional bool goproto_unkeyed_all = 63035; +} + +extend google.protobuf.MessageOptions { + optional bool goproto_getters = 64001; + optional bool goproto_stringer = 64003; + optional bool verbose_equal = 64004; + optional bool face = 64005; + optional bool gostring = 64006; + optional bool populate = 64007; + optional bool stringer = 67008; + optional bool onlyone = 64009; + + optional bool equal = 64013; + optional bool description = 64014; + optional bool testgen = 64015; + optional bool benchgen = 64016; + optional bool marshaler = 64017; + optional bool unmarshaler = 64018; + optional bool stable_marshaler = 64019; + + optional bool sizer = 64020; + + optional bool unsafe_marshaler = 64023; + optional bool unsafe_unmarshaler = 64024; + + optional bool goproto_extensions_map = 64025; + optional bool goproto_unrecognized = 64026; + + optional bool protosizer = 64028; + optional bool compare = 64029; + + optional bool typedecl = 64030; + + optional bool messagename = 64033; + + optional bool goproto_sizecache = 64034; + optional bool goproto_unkeyed = 64035; +} + +extend google.protobuf.FieldOptions { + optional bool nullable = 65001; + optional bool embed = 65002; + optional string customtype = 65003; + optional string customname = 65004; + optional string jsontag = 65005; + optional string moretags = 65006; + optional string casttype = 65007; + optional string castkey = 65008; + optional string castvalue = 65009; + + optional bool stdtime = 65010; + optional bool stdduration = 65011; + optional bool wktpointer = 65012; + +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/helper.go b/vendor/github.com/gogo/protobuf/gogoproto/helper.go new file mode 100644 index 000000000..390d4e4be --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/helper.go @@ -0,0 +1,415 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package gogoproto + +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" +import proto "github.com/gogo/protobuf/proto" + +func IsEmbed(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Embed, false) +} + +func IsNullable(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Nullable, true) +} + +func IsStdTime(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdtime, false) +} + +func IsStdDuration(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdduration, false) +} + +func IsStdDouble(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.DoubleValue" +} + +func IsStdFloat(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.FloatValue" +} + +func IsStdInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int64Value" +} + +func IsStdUInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt64Value" +} + +func IsStdInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int32Value" +} + +func IsStdUInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt32Value" +} + +func IsStdBool(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BoolValue" +} + +func IsStdString(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.StringValue" +} + +func IsStdBytes(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BytesValue" +} + +func IsStdType(field *google_protobuf.FieldDescriptorProto) bool { + return (IsStdTime(field) || IsStdDuration(field) || + IsStdDouble(field) || IsStdFloat(field) || + IsStdInt64(field) || IsStdUInt64(field) || + IsStdInt32(field) || IsStdUInt32(field) || + IsStdBool(field) || + IsStdString(field) || IsStdBytes(field)) +} + +func IsWktPtr(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) +} + +func NeedsNilCheck(proto3 bool, field *google_protobuf.FieldDescriptorProto) bool { + nullable := IsNullable(field) + if field.IsMessage() || IsCustomType(field) { + return nullable + } + if proto3 { + return false + } + return nullable || *field.Type == google_protobuf.FieldDescriptorProto_TYPE_BYTES +} + +func IsCustomType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCustomType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastKey(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastKey(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastValue(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastValue(field) + if len(typ) > 0 { + return true + } + return false +} + +func HasEnumDecl(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_Enumdecl, proto.GetBoolExtension(file.Options, E_EnumdeclAll, true)) +} + +func HasTypeDecl(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Typedecl, proto.GetBoolExtension(file.Options, E_TypedeclAll, true)) +} + +func GetCustomType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customtype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Casttype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastKey(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castkey) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastValue(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castvalue) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func IsCustomName(field *google_protobuf.FieldDescriptorProto) bool { + name := GetCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumCustomName(field *google_protobuf.EnumDescriptorProto) bool { + name := GetEnumCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) bool { + name := GetEnumValueCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func GetCustomName(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumCustomName(field *google_protobuf.EnumDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumvalueCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetJsonTag(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Jsontag) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +func GetMoreTags(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Moretags) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +type EnableFunc func(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool + +func EnabledGoEnumPrefix(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumPrefix, proto.GetBoolExtension(file.Options, E_GoprotoEnumPrefixAll, true)) +} + +func EnabledGoStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoStringer, proto.GetBoolExtension(file.Options, E_GoprotoStringerAll, true)) +} + +func HasGoGetters(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoGetters, proto.GetBoolExtension(file.Options, E_GoprotoGettersAll, true)) +} + +func IsUnion(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Onlyone, proto.GetBoolExtension(file.Options, E_OnlyoneAll, false)) +} + +func HasGoString(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Gostring, proto.GetBoolExtension(file.Options, E_GostringAll, false)) +} + +func HasEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Equal, proto.GetBoolExtension(file.Options, E_EqualAll, false)) +} + +func HasVerboseEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_VerboseEqual, proto.GetBoolExtension(file.Options, E_VerboseEqualAll, false)) +} + +func IsStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Stringer, proto.GetBoolExtension(file.Options, E_StringerAll, false)) +} + +func IsFace(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Face, proto.GetBoolExtension(file.Options, E_FaceAll, false)) +} + +func HasDescription(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Description, proto.GetBoolExtension(file.Options, E_DescriptionAll, false)) +} + +func HasPopulate(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Populate, proto.GetBoolExtension(file.Options, E_PopulateAll, false)) +} + +func HasTestGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Testgen, proto.GetBoolExtension(file.Options, E_TestgenAll, false)) +} + +func HasBenchGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Benchgen, proto.GetBoolExtension(file.Options, E_BenchgenAll, false)) +} + +func IsMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Marshaler, proto.GetBoolExtension(file.Options, E_MarshalerAll, false)) +} + +func IsUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Unmarshaler, proto.GetBoolExtension(file.Options, E_UnmarshalerAll, false)) +} + +func IsStableMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_StableMarshaler, proto.GetBoolExtension(file.Options, E_StableMarshalerAll, false)) +} + +func IsSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Sizer, proto.GetBoolExtension(file.Options, E_SizerAll, false)) +} + +func IsProtoSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Protosizer, proto.GetBoolExtension(file.Options, E_ProtosizerAll, false)) +} + +func IsGoEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumStringer, proto.GetBoolExtension(file.Options, E_GoprotoEnumStringerAll, true)) +} + +func IsEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_EnumStringer, proto.GetBoolExtension(file.Options, E_EnumStringerAll, false)) +} + +func IsUnsafeMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeMarshaler, proto.GetBoolExtension(file.Options, E_UnsafeMarshalerAll, false)) +} + +func IsUnsafeUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeUnmarshaler, proto.GetBoolExtension(file.Options, E_UnsafeUnmarshalerAll, false)) +} + +func HasExtensionsMap(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoExtensionsMap, proto.GetBoolExtension(file.Options, E_GoprotoExtensionsMapAll, true)) +} + +func HasUnrecognized(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnrecognized, proto.GetBoolExtension(file.Options, E_GoprotoUnrecognizedAll, true)) +} + +func IsProto3(file *google_protobuf.FileDescriptorProto) bool { + return file.GetSyntax() == "proto3" +} + +func ImportsGoGoProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GogoprotoImport, true) +} + +func HasCompare(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Compare, proto.GetBoolExtension(file.Options, E_CompareAll, false)) +} + +func RegistersGolangProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GoprotoRegistration, false) +} + +func HasMessageName(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Messagename, proto.GetBoolExtension(file.Options, E_MessagenameAll, false)) +} + +func HasSizecache(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoSizecache, proto.GetBoolExtension(file.Options, E_GoprotoSizecacheAll, true)) +} + +func HasUnkeyed(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnkeyed, proto.GetBoolExtension(file.Options, E_GoprotoUnkeyedAll, true)) +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile new file mode 100644 index 000000000..3496dc99d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile @@ -0,0 +1,36 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + go install github.com/gogo/protobuf/protoc-gen-gostring + protoc --gogo_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto + protoc --gostring_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go new file mode 100644 index 000000000..a85bf1984 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go @@ -0,0 +1,118 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Package descriptor provides functions for obtaining protocol buffer +// descriptors for generated Go types. +// +// These functions cannot go in package proto because they depend on the +// generated protobuf descriptor messages, which themselves depend on proto. +package descriptor + +import ( + "bytes" + "compress/gzip" + "fmt" + "io/ioutil" + + "github.com/gogo/protobuf/proto" +) + +// extractFile extracts a FileDescriptorProto from a gzip'd buffer. +func extractFile(gz []byte) (*FileDescriptorProto, error) { + r, err := gzip.NewReader(bytes.NewReader(gz)) + if err != nil { + return nil, fmt.Errorf("failed to open gzip reader: %v", err) + } + defer r.Close() + + b, err := ioutil.ReadAll(r) + if err != nil { + return nil, fmt.Errorf("failed to uncompress descriptor: %v", err) + } + + fd := new(FileDescriptorProto) + if err := proto.Unmarshal(b, fd); err != nil { + return nil, fmt.Errorf("malformed FileDescriptorProto: %v", err) + } + + return fd, nil +} + +// Message is a proto.Message with a method to return its descriptor. +// +// Message types generated by the protocol compiler always satisfy +// the Message interface. +type Message interface { + proto.Message + Descriptor() ([]byte, []int) +} + +// ForMessage returns a FileDescriptorProto and a DescriptorProto from within it +// describing the given message. +func ForMessage(msg Message) (fd *FileDescriptorProto, md *DescriptorProto) { + gz, path := msg.Descriptor() + fd, err := extractFile(gz) + if err != nil { + panic(fmt.Sprintf("invalid FileDescriptorProto for %T: %v", msg, err)) + } + + md = fd.MessageType[path[0]] + for _, i := range path[1:] { + md = md.NestedType[i] + } + return fd, md +} + +// Is this field a scalar numeric type? +func (field *FieldDescriptorProto) IsScalar() bool { + if field.Type == nil { + return false + } + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE, + FieldDescriptorProto_TYPE_FLOAT, + FieldDescriptorProto_TYPE_INT64, + FieldDescriptorProto_TYPE_UINT64, + FieldDescriptorProto_TYPE_INT32, + FieldDescriptorProto_TYPE_FIXED64, + FieldDescriptorProto_TYPE_FIXED32, + FieldDescriptorProto_TYPE_BOOL, + FieldDescriptorProto_TYPE_UINT32, + FieldDescriptorProto_TYPE_ENUM, + FieldDescriptorProto_TYPE_SFIXED32, + FieldDescriptorProto_TYPE_SFIXED64, + FieldDescriptorProto_TYPE_SINT32, + FieldDescriptorProto_TYPE_SINT64: + return true + default: + return false + } +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go new file mode 100644 index 000000000..cacfa3923 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go @@ -0,0 +1,2865 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type FieldDescriptorProto_Type int32 + +const ( + // 0 is reserved for errors. + // Order is weird for historical reasons. + FieldDescriptorProto_TYPE_DOUBLE FieldDescriptorProto_Type = 1 + FieldDescriptorProto_TYPE_FLOAT FieldDescriptorProto_Type = 2 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT64 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT64 FieldDescriptorProto_Type = 3 + FieldDescriptorProto_TYPE_UINT64 FieldDescriptorProto_Type = 4 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT32 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT32 FieldDescriptorProto_Type = 5 + FieldDescriptorProto_TYPE_FIXED64 FieldDescriptorProto_Type = 6 + FieldDescriptorProto_TYPE_FIXED32 FieldDescriptorProto_Type = 7 + FieldDescriptorProto_TYPE_BOOL FieldDescriptorProto_Type = 8 + FieldDescriptorProto_TYPE_STRING FieldDescriptorProto_Type = 9 + // Tag-delimited aggregate. + // Group type is deprecated and not supported in proto3. However, Proto3 + // implementations should still be able to parse the group wire format and + // treat group fields as unknown fields. + FieldDescriptorProto_TYPE_GROUP FieldDescriptorProto_Type = 10 + FieldDescriptorProto_TYPE_MESSAGE FieldDescriptorProto_Type = 11 + // New in version 2. + FieldDescriptorProto_TYPE_BYTES FieldDescriptorProto_Type = 12 + FieldDescriptorProto_TYPE_UINT32 FieldDescriptorProto_Type = 13 + FieldDescriptorProto_TYPE_ENUM FieldDescriptorProto_Type = 14 + FieldDescriptorProto_TYPE_SFIXED32 FieldDescriptorProto_Type = 15 + FieldDescriptorProto_TYPE_SFIXED64 FieldDescriptorProto_Type = 16 + FieldDescriptorProto_TYPE_SINT32 FieldDescriptorProto_Type = 17 + FieldDescriptorProto_TYPE_SINT64 FieldDescriptorProto_Type = 18 +) + +var FieldDescriptorProto_Type_name = map[int32]string{ + 1: "TYPE_DOUBLE", + 2: "TYPE_FLOAT", + 3: "TYPE_INT64", + 4: "TYPE_UINT64", + 5: "TYPE_INT32", + 6: "TYPE_FIXED64", + 7: "TYPE_FIXED32", + 8: "TYPE_BOOL", + 9: "TYPE_STRING", + 10: "TYPE_GROUP", + 11: "TYPE_MESSAGE", + 12: "TYPE_BYTES", + 13: "TYPE_UINT32", + 14: "TYPE_ENUM", + 15: "TYPE_SFIXED32", + 16: "TYPE_SFIXED64", + 17: "TYPE_SINT32", + 18: "TYPE_SINT64", +} + +var FieldDescriptorProto_Type_value = map[string]int32{ + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18, +} + +func (x FieldDescriptorProto_Type) Enum() *FieldDescriptorProto_Type { + p := new(FieldDescriptorProto_Type) + *p = x + return p +} + +func (x FieldDescriptorProto_Type) String() string { + return proto.EnumName(FieldDescriptorProto_Type_name, int32(x)) +} + +func (x *FieldDescriptorProto_Type) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Type_value, data, "FieldDescriptorProto_Type") + if err != nil { + return err + } + *x = FieldDescriptorProto_Type(value) + return nil +} + +func (FieldDescriptorProto_Type) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 0} +} + +type FieldDescriptorProto_Label int32 + +const ( + // 0 is reserved for errors + FieldDescriptorProto_LABEL_OPTIONAL FieldDescriptorProto_Label = 1 + FieldDescriptorProto_LABEL_REQUIRED FieldDescriptorProto_Label = 2 + FieldDescriptorProto_LABEL_REPEATED FieldDescriptorProto_Label = 3 +) + +var FieldDescriptorProto_Label_name = map[int32]string{ + 1: "LABEL_OPTIONAL", + 2: "LABEL_REQUIRED", + 3: "LABEL_REPEATED", +} + +var FieldDescriptorProto_Label_value = map[string]int32{ + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3, +} + +func (x FieldDescriptorProto_Label) Enum() *FieldDescriptorProto_Label { + p := new(FieldDescriptorProto_Label) + *p = x + return p +} + +func (x FieldDescriptorProto_Label) String() string { + return proto.EnumName(FieldDescriptorProto_Label_name, int32(x)) +} + +func (x *FieldDescriptorProto_Label) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Label_value, data, "FieldDescriptorProto_Label") + if err != nil { + return err + } + *x = FieldDescriptorProto_Label(value) + return nil +} + +func (FieldDescriptorProto_Label) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 1} +} + +// Generated classes can be optimized for speed or code size. +type FileOptions_OptimizeMode int32 + +const ( + FileOptions_SPEED FileOptions_OptimizeMode = 1 + // etc. + FileOptions_CODE_SIZE FileOptions_OptimizeMode = 2 + FileOptions_LITE_RUNTIME FileOptions_OptimizeMode = 3 +) + +var FileOptions_OptimizeMode_name = map[int32]string{ + 1: "SPEED", + 2: "CODE_SIZE", + 3: "LITE_RUNTIME", +} + +var FileOptions_OptimizeMode_value = map[string]int32{ + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3, +} + +func (x FileOptions_OptimizeMode) Enum() *FileOptions_OptimizeMode { + p := new(FileOptions_OptimizeMode) + *p = x + return p +} + +func (x FileOptions_OptimizeMode) String() string { + return proto.EnumName(FileOptions_OptimizeMode_name, int32(x)) +} + +func (x *FileOptions_OptimizeMode) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FileOptions_OptimizeMode_value, data, "FileOptions_OptimizeMode") + if err != nil { + return err + } + *x = FileOptions_OptimizeMode(value) + return nil +} + +func (FileOptions_OptimizeMode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10, 0} +} + +type FieldOptions_CType int32 + +const ( + // Default mode. + FieldOptions_STRING FieldOptions_CType = 0 + FieldOptions_CORD FieldOptions_CType = 1 + FieldOptions_STRING_PIECE FieldOptions_CType = 2 +) + +var FieldOptions_CType_name = map[int32]string{ + 0: "STRING", + 1: "CORD", + 2: "STRING_PIECE", +} + +var FieldOptions_CType_value = map[string]int32{ + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2, +} + +func (x FieldOptions_CType) Enum() *FieldOptions_CType { + p := new(FieldOptions_CType) + *p = x + return p +} + +func (x FieldOptions_CType) String() string { + return proto.EnumName(FieldOptions_CType_name, int32(x)) +} + +func (x *FieldOptions_CType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_CType_value, data, "FieldOptions_CType") + if err != nil { + return err + } + *x = FieldOptions_CType(value) + return nil +} + +func (FieldOptions_CType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 0} +} + +type FieldOptions_JSType int32 + +const ( + // Use the default type. + FieldOptions_JS_NORMAL FieldOptions_JSType = 0 + // Use JavaScript strings. + FieldOptions_JS_STRING FieldOptions_JSType = 1 + // Use JavaScript numbers. + FieldOptions_JS_NUMBER FieldOptions_JSType = 2 +) + +var FieldOptions_JSType_name = map[int32]string{ + 0: "JS_NORMAL", + 1: "JS_STRING", + 2: "JS_NUMBER", +} + +var FieldOptions_JSType_value = map[string]int32{ + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2, +} + +func (x FieldOptions_JSType) Enum() *FieldOptions_JSType { + p := new(FieldOptions_JSType) + *p = x + return p +} + +func (x FieldOptions_JSType) String() string { + return proto.EnumName(FieldOptions_JSType_name, int32(x)) +} + +func (x *FieldOptions_JSType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_JSType_value, data, "FieldOptions_JSType") + if err != nil { + return err + } + *x = FieldOptions_JSType(value) + return nil +} + +func (FieldOptions_JSType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 1} +} + +// Is this method side-effect-free (or safe in HTTP parlance), or idempotent, +// or neither? HTTP based RPC implementation may choose GET verb for safe +// methods, and PUT verb for idempotent methods instead of the default POST. +type MethodOptions_IdempotencyLevel int32 + +const ( + MethodOptions_IDEMPOTENCY_UNKNOWN MethodOptions_IdempotencyLevel = 0 + MethodOptions_NO_SIDE_EFFECTS MethodOptions_IdempotencyLevel = 1 + MethodOptions_IDEMPOTENT MethodOptions_IdempotencyLevel = 2 +) + +var MethodOptions_IdempotencyLevel_name = map[int32]string{ + 0: "IDEMPOTENCY_UNKNOWN", + 1: "NO_SIDE_EFFECTS", + 2: "IDEMPOTENT", +} + +var MethodOptions_IdempotencyLevel_value = map[string]int32{ + "IDEMPOTENCY_UNKNOWN": 0, + "NO_SIDE_EFFECTS": 1, + "IDEMPOTENT": 2, +} + +func (x MethodOptions_IdempotencyLevel) Enum() *MethodOptions_IdempotencyLevel { + p := new(MethodOptions_IdempotencyLevel) + *p = x + return p +} + +func (x MethodOptions_IdempotencyLevel) String() string { + return proto.EnumName(MethodOptions_IdempotencyLevel_name, int32(x)) +} + +func (x *MethodOptions_IdempotencyLevel) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(MethodOptions_IdempotencyLevel_value, data, "MethodOptions_IdempotencyLevel") + if err != nil { + return err + } + *x = MethodOptions_IdempotencyLevel(value) + return nil +} + +func (MethodOptions_IdempotencyLevel) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17, 0} +} + +// The protocol compiler can output a FileDescriptorSet containing the .proto +// files it parses. +type FileDescriptorSet struct { + File []*FileDescriptorProto `protobuf:"bytes,1,rep,name=file" json:"file,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorSet) Reset() { *m = FileDescriptorSet{} } +func (m *FileDescriptorSet) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorSet) ProtoMessage() {} +func (*FileDescriptorSet) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{0} +} +func (m *FileDescriptorSet) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorSet.Unmarshal(m, b) +} +func (m *FileDescriptorSet) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorSet.Marshal(b, m, deterministic) +} +func (m *FileDescriptorSet) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorSet.Merge(m, src) +} +func (m *FileDescriptorSet) XXX_Size() int { + return xxx_messageInfo_FileDescriptorSet.Size(m) +} +func (m *FileDescriptorSet) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorSet.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorSet proto.InternalMessageInfo + +func (m *FileDescriptorSet) GetFile() []*FileDescriptorProto { + if m != nil { + return m.File + } + return nil +} + +// Describes a complete .proto file. +type FileDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Package *string `protobuf:"bytes,2,opt,name=package" json:"package,omitempty"` + // Names of files imported by this file. + Dependency []string `protobuf:"bytes,3,rep,name=dependency" json:"dependency,omitempty"` + // Indexes of the public imported files in the dependency list above. + PublicDependency []int32 `protobuf:"varint,10,rep,name=public_dependency,json=publicDependency" json:"public_dependency,omitempty"` + // Indexes of the weak imported files in the dependency list. + // For Google-internal migration only. Do not use. + WeakDependency []int32 `protobuf:"varint,11,rep,name=weak_dependency,json=weakDependency" json:"weak_dependency,omitempty"` + // All top-level definitions in this file. + MessageType []*DescriptorProto `protobuf:"bytes,4,rep,name=message_type,json=messageType" json:"message_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,5,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + Service []*ServiceDescriptorProto `protobuf:"bytes,6,rep,name=service" json:"service,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,7,rep,name=extension" json:"extension,omitempty"` + Options *FileOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + // This field contains optional information about the original source code. + // You may safely remove this entire field without harming runtime + // functionality of the descriptors -- the information is needed only by + // development tools. + SourceCodeInfo *SourceCodeInfo `protobuf:"bytes,9,opt,name=source_code_info,json=sourceCodeInfo" json:"source_code_info,omitempty"` + // The syntax of the proto file. + // The supported values are "proto2" and "proto3". + Syntax *string `protobuf:"bytes,12,opt,name=syntax" json:"syntax,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorProto) Reset() { *m = FileDescriptorProto{} } +func (m *FileDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorProto) ProtoMessage() {} +func (*FileDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{1} +} +func (m *FileDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorProto.Unmarshal(m, b) +} +func (m *FileDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FileDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorProto.Merge(m, src) +} +func (m *FileDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FileDescriptorProto.Size(m) +} +func (m *FileDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorProto proto.InternalMessageInfo + +func (m *FileDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FileDescriptorProto) GetPackage() string { + if m != nil && m.Package != nil { + return *m.Package + } + return "" +} + +func (m *FileDescriptorProto) GetDependency() []string { + if m != nil { + return m.Dependency + } + return nil +} + +func (m *FileDescriptorProto) GetPublicDependency() []int32 { + if m != nil { + return m.PublicDependency + } + return nil +} + +func (m *FileDescriptorProto) GetWeakDependency() []int32 { + if m != nil { + return m.WeakDependency + } + return nil +} + +func (m *FileDescriptorProto) GetMessageType() []*DescriptorProto { + if m != nil { + return m.MessageType + } + return nil +} + +func (m *FileDescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *FileDescriptorProto) GetService() []*ServiceDescriptorProto { + if m != nil { + return m.Service + } + return nil +} + +func (m *FileDescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *FileDescriptorProto) GetOptions() *FileOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *FileDescriptorProto) GetSourceCodeInfo() *SourceCodeInfo { + if m != nil { + return m.SourceCodeInfo + } + return nil +} + +func (m *FileDescriptorProto) GetSyntax() string { + if m != nil && m.Syntax != nil { + return *m.Syntax + } + return "" +} + +// Describes a message type. +type DescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Field []*FieldDescriptorProto `protobuf:"bytes,2,rep,name=field" json:"field,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,6,rep,name=extension" json:"extension,omitempty"` + NestedType []*DescriptorProto `protobuf:"bytes,3,rep,name=nested_type,json=nestedType" json:"nested_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,4,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + ExtensionRange []*DescriptorProto_ExtensionRange `protobuf:"bytes,5,rep,name=extension_range,json=extensionRange" json:"extension_range,omitempty"` + OneofDecl []*OneofDescriptorProto `protobuf:"bytes,8,rep,name=oneof_decl,json=oneofDecl" json:"oneof_decl,omitempty"` + Options *MessageOptions `protobuf:"bytes,7,opt,name=options" json:"options,omitempty"` + ReservedRange []*DescriptorProto_ReservedRange `protobuf:"bytes,9,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved field names, which may not be used by fields in the same message. + // A given name may only be reserved once. + ReservedName []string `protobuf:"bytes,10,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto) Reset() { *m = DescriptorProto{} } +func (m *DescriptorProto) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto) ProtoMessage() {} +func (*DescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2} +} +func (m *DescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto.Unmarshal(m, b) +} +func (m *DescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto.Marshal(b, m, deterministic) +} +func (m *DescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto.Merge(m, src) +} +func (m *DescriptorProto) XXX_Size() int { + return xxx_messageInfo_DescriptorProto.Size(m) +} +func (m *DescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto proto.InternalMessageInfo + +func (m *DescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *DescriptorProto) GetField() []*FieldDescriptorProto { + if m != nil { + return m.Field + } + return nil +} + +func (m *DescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *DescriptorProto) GetNestedType() []*DescriptorProto { + if m != nil { + return m.NestedType + } + return nil +} + +func (m *DescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *DescriptorProto) GetExtensionRange() []*DescriptorProto_ExtensionRange { + if m != nil { + return m.ExtensionRange + } + return nil +} + +func (m *DescriptorProto) GetOneofDecl() []*OneofDescriptorProto { + if m != nil { + return m.OneofDecl + } + return nil +} + +func (m *DescriptorProto) GetOptions() *MessageOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *DescriptorProto) GetReservedRange() []*DescriptorProto_ReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *DescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +type DescriptorProto_ExtensionRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + Options *ExtensionRangeOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ExtensionRange) Reset() { *m = DescriptorProto_ExtensionRange{} } +func (m *DescriptorProto_ExtensionRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ExtensionRange) ProtoMessage() {} +func (*DescriptorProto_ExtensionRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 0} +} +func (m *DescriptorProto_ExtensionRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ExtensionRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ExtensionRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ExtensionRange.Merge(m, src) +} +func (m *DescriptorProto_ExtensionRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Size(m) +} +func (m *DescriptorProto_ExtensionRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ExtensionRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ExtensionRange proto.InternalMessageInfo + +func (m *DescriptorProto_ExtensionRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetOptions() *ExtensionRangeOptions { + if m != nil { + return m.Options + } + return nil +} + +// Range of reserved tag numbers. Reserved tag numbers may not be used by +// fields or extension ranges in the same message. Reserved ranges may +// not overlap. +type DescriptorProto_ReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ReservedRange) Reset() { *m = DescriptorProto_ReservedRange{} } +func (m *DescriptorProto_ReservedRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ReservedRange) ProtoMessage() {} +func (*DescriptorProto_ReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 1} +} +func (m *DescriptorProto_ReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ReservedRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ReservedRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ReservedRange.Merge(m, src) +} +func (m *DescriptorProto_ReservedRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ReservedRange.Size(m) +} +func (m *DescriptorProto_ReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ReservedRange proto.InternalMessageInfo + +func (m *DescriptorProto_ReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +type ExtensionRangeOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ExtensionRangeOptions) Reset() { *m = ExtensionRangeOptions{} } +func (m *ExtensionRangeOptions) String() string { return proto.CompactTextString(m) } +func (*ExtensionRangeOptions) ProtoMessage() {} +func (*ExtensionRangeOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{3} +} + +var extRange_ExtensionRangeOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ExtensionRangeOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ExtensionRangeOptions +} + +func (m *ExtensionRangeOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ExtensionRangeOptions.Unmarshal(m, b) +} +func (m *ExtensionRangeOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ExtensionRangeOptions.Marshal(b, m, deterministic) +} +func (m *ExtensionRangeOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ExtensionRangeOptions.Merge(m, src) +} +func (m *ExtensionRangeOptions) XXX_Size() int { + return xxx_messageInfo_ExtensionRangeOptions.Size(m) +} +func (m *ExtensionRangeOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ExtensionRangeOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ExtensionRangeOptions proto.InternalMessageInfo + +func (m *ExtensionRangeOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// Describes a field within a message. +type FieldDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,3,opt,name=number" json:"number,omitempty"` + Label *FieldDescriptorProto_Label `protobuf:"varint,4,opt,name=label,enum=google.protobuf.FieldDescriptorProto_Label" json:"label,omitempty"` + // If type_name is set, this need not be set. If both this and type_name + // are set, this must be one of TYPE_ENUM, TYPE_MESSAGE or TYPE_GROUP. + Type *FieldDescriptorProto_Type `protobuf:"varint,5,opt,name=type,enum=google.protobuf.FieldDescriptorProto_Type" json:"type,omitempty"` + // For message and enum types, this is the name of the type. If the name + // starts with a '.', it is fully-qualified. Otherwise, C++-like scoping + // rules are used to find the type (i.e. first the nested types within this + // message are searched, then within the parent, on up to the root + // namespace). + TypeName *string `protobuf:"bytes,6,opt,name=type_name,json=typeName" json:"type_name,omitempty"` + // For extensions, this is the name of the type being extended. It is + // resolved in the same manner as type_name. + Extendee *string `protobuf:"bytes,2,opt,name=extendee" json:"extendee,omitempty"` + // For numeric types, contains the original text representation of the value. + // For booleans, "true" or "false". + // For strings, contains the default text contents (not escaped in any way). + // For bytes, contains the C escaped value. All bytes >= 128 are escaped. + // TODO(kenton): Base-64 encode? + DefaultValue *string `protobuf:"bytes,7,opt,name=default_value,json=defaultValue" json:"default_value,omitempty"` + // If set, gives the index of a oneof in the containing type's oneof_decl + // list. This field is a member of that oneof. + OneofIndex *int32 `protobuf:"varint,9,opt,name=oneof_index,json=oneofIndex" json:"oneof_index,omitempty"` + // JSON name of this field. The value is set by protocol compiler. If the + // user has set a "json_name" option on this field, that option's value + // will be used. Otherwise, it's deduced from the field's name by converting + // it to camelCase. + JsonName *string `protobuf:"bytes,10,opt,name=json_name,json=jsonName" json:"json_name,omitempty"` + Options *FieldOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldDescriptorProto) Reset() { *m = FieldDescriptorProto{} } +func (m *FieldDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FieldDescriptorProto) ProtoMessage() {} +func (*FieldDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4} +} +func (m *FieldDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldDescriptorProto.Unmarshal(m, b) +} +func (m *FieldDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FieldDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldDescriptorProto.Merge(m, src) +} +func (m *FieldDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FieldDescriptorProto.Size(m) +} +func (m *FieldDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FieldDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldDescriptorProto proto.InternalMessageInfo + +func (m *FieldDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FieldDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *FieldDescriptorProto) GetLabel() FieldDescriptorProto_Label { + if m != nil && m.Label != nil { + return *m.Label + } + return FieldDescriptorProto_LABEL_OPTIONAL +} + +func (m *FieldDescriptorProto) GetType() FieldDescriptorProto_Type { + if m != nil && m.Type != nil { + return *m.Type + } + return FieldDescriptorProto_TYPE_DOUBLE +} + +func (m *FieldDescriptorProto) GetTypeName() string { + if m != nil && m.TypeName != nil { + return *m.TypeName + } + return "" +} + +func (m *FieldDescriptorProto) GetExtendee() string { + if m != nil && m.Extendee != nil { + return *m.Extendee + } + return "" +} + +func (m *FieldDescriptorProto) GetDefaultValue() string { + if m != nil && m.DefaultValue != nil { + return *m.DefaultValue + } + return "" +} + +func (m *FieldDescriptorProto) GetOneofIndex() int32 { + if m != nil && m.OneofIndex != nil { + return *m.OneofIndex + } + return 0 +} + +func (m *FieldDescriptorProto) GetJsonName() string { + if m != nil && m.JsonName != nil { + return *m.JsonName + } + return "" +} + +func (m *FieldDescriptorProto) GetOptions() *FieldOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a oneof. +type OneofDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Options *OneofOptions `protobuf:"bytes,2,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofDescriptorProto) Reset() { *m = OneofDescriptorProto{} } +func (m *OneofDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*OneofDescriptorProto) ProtoMessage() {} +func (*OneofDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{5} +} +func (m *OneofDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofDescriptorProto.Unmarshal(m, b) +} +func (m *OneofDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofDescriptorProto.Marshal(b, m, deterministic) +} +func (m *OneofDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofDescriptorProto.Merge(m, src) +} +func (m *OneofDescriptorProto) XXX_Size() int { + return xxx_messageInfo_OneofDescriptorProto.Size(m) +} +func (m *OneofDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_OneofDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofDescriptorProto proto.InternalMessageInfo + +func (m *OneofDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *OneofDescriptorProto) GetOptions() *OneofOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes an enum type. +type EnumDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Value []*EnumValueDescriptorProto `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` + Options *EnumOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + // Range of reserved numeric values. Reserved numeric values may not be used + // by enum values in the same enum declaration. Reserved ranges may not + // overlap. + ReservedRange []*EnumDescriptorProto_EnumReservedRange `protobuf:"bytes,4,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved enum value names, which may not be reused. A given name may only + // be reserved once. + ReservedName []string `protobuf:"bytes,5,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto) Reset() { *m = EnumDescriptorProto{} } +func (m *EnumDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto) ProtoMessage() {} +func (*EnumDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6} +} +func (m *EnumDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto.Unmarshal(m, b) +} +func (m *EnumDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto.Merge(m, src) +} +func (m *EnumDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto.Size(m) +} +func (m *EnumDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto proto.InternalMessageInfo + +func (m *EnumDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumDescriptorProto) GetValue() []*EnumValueDescriptorProto { + if m != nil { + return m.Value + } + return nil +} + +func (m *EnumDescriptorProto) GetOptions() *EnumOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedRange() []*EnumDescriptorProto_EnumReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +// Range of reserved numeric values. Reserved values may not be used by +// entries in the same enum. Reserved ranges may not overlap. +// +// Note that this is distinct from DescriptorProto.ReservedRange in that it +// is inclusive such that it can appropriately represent the entire int32 +// domain. +type EnumDescriptorProto_EnumReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto_EnumReservedRange) Reset() { *m = EnumDescriptorProto_EnumReservedRange{} } +func (m *EnumDescriptorProto_EnumReservedRange) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto_EnumReservedRange) ProtoMessage() {} +func (*EnumDescriptorProto_EnumReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6, 0} +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Unmarshal(m, b) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Merge(m, src) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Size(m) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto_EnumReservedRange proto.InternalMessageInfo + +func (m *EnumDescriptorProto_EnumReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *EnumDescriptorProto_EnumReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +// Describes a value within an enum. +type EnumValueDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,2,opt,name=number" json:"number,omitempty"` + Options *EnumValueOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueDescriptorProto) Reset() { *m = EnumValueDescriptorProto{} } +func (m *EnumValueDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumValueDescriptorProto) ProtoMessage() {} +func (*EnumValueDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{7} +} +func (m *EnumValueDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueDescriptorProto.Unmarshal(m, b) +} +func (m *EnumValueDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumValueDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueDescriptorProto.Merge(m, src) +} +func (m *EnumValueDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumValueDescriptorProto.Size(m) +} +func (m *EnumValueDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueDescriptorProto proto.InternalMessageInfo + +func (m *EnumValueDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumValueDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *EnumValueDescriptorProto) GetOptions() *EnumValueOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a service. +type ServiceDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Method []*MethodDescriptorProto `protobuf:"bytes,2,rep,name=method" json:"method,omitempty"` + Options *ServiceOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceDescriptorProto) Reset() { *m = ServiceDescriptorProto{} } +func (m *ServiceDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*ServiceDescriptorProto) ProtoMessage() {} +func (*ServiceDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{8} +} +func (m *ServiceDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceDescriptorProto.Unmarshal(m, b) +} +func (m *ServiceDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceDescriptorProto.Marshal(b, m, deterministic) +} +func (m *ServiceDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceDescriptorProto.Merge(m, src) +} +func (m *ServiceDescriptorProto) XXX_Size() int { + return xxx_messageInfo_ServiceDescriptorProto.Size(m) +} +func (m *ServiceDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceDescriptorProto proto.InternalMessageInfo + +func (m *ServiceDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *ServiceDescriptorProto) GetMethod() []*MethodDescriptorProto { + if m != nil { + return m.Method + } + return nil +} + +func (m *ServiceDescriptorProto) GetOptions() *ServiceOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a method of a service. +type MethodDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + // Input and output type names. These are resolved in the same way as + // FieldDescriptorProto.type_name, but must refer to a message type. + InputType *string `protobuf:"bytes,2,opt,name=input_type,json=inputType" json:"input_type,omitempty"` + OutputType *string `protobuf:"bytes,3,opt,name=output_type,json=outputType" json:"output_type,omitempty"` + Options *MethodOptions `protobuf:"bytes,4,opt,name=options" json:"options,omitempty"` + // Identifies if client streams multiple client messages + ClientStreaming *bool `protobuf:"varint,5,opt,name=client_streaming,json=clientStreaming,def=0" json:"client_streaming,omitempty"` + // Identifies if server streams multiple server messages + ServerStreaming *bool `protobuf:"varint,6,opt,name=server_streaming,json=serverStreaming,def=0" json:"server_streaming,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodDescriptorProto) Reset() { *m = MethodDescriptorProto{} } +func (m *MethodDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*MethodDescriptorProto) ProtoMessage() {} +func (*MethodDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{9} +} +func (m *MethodDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodDescriptorProto.Unmarshal(m, b) +} +func (m *MethodDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodDescriptorProto.Marshal(b, m, deterministic) +} +func (m *MethodDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodDescriptorProto.Merge(m, src) +} +func (m *MethodDescriptorProto) XXX_Size() int { + return xxx_messageInfo_MethodDescriptorProto.Size(m) +} +func (m *MethodDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_MethodDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodDescriptorProto proto.InternalMessageInfo + +const Default_MethodDescriptorProto_ClientStreaming bool = false +const Default_MethodDescriptorProto_ServerStreaming bool = false + +func (m *MethodDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *MethodDescriptorProto) GetInputType() string { + if m != nil && m.InputType != nil { + return *m.InputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOutputType() string { + if m != nil && m.OutputType != nil { + return *m.OutputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOptions() *MethodOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *MethodDescriptorProto) GetClientStreaming() bool { + if m != nil && m.ClientStreaming != nil { + return *m.ClientStreaming + } + return Default_MethodDescriptorProto_ClientStreaming +} + +func (m *MethodDescriptorProto) GetServerStreaming() bool { + if m != nil && m.ServerStreaming != nil { + return *m.ServerStreaming + } + return Default_MethodDescriptorProto_ServerStreaming +} + +type FileOptions struct { + // Sets the Java package where classes generated from this .proto will be + // placed. By default, the proto package is used, but this is often + // inappropriate because proto packages do not normally start with backwards + // domain names. + JavaPackage *string `protobuf:"bytes,1,opt,name=java_package,json=javaPackage" json:"java_package,omitempty"` + // If set, all the classes from the .proto file are wrapped in a single + // outer class with the given name. This applies to both Proto1 + // (equivalent to the old "--one_java_file" option) and Proto2 (where + // a .proto always translates to a single class, but you may want to + // explicitly choose the class name). + JavaOuterClassname *string `protobuf:"bytes,8,opt,name=java_outer_classname,json=javaOuterClassname" json:"java_outer_classname,omitempty"` + // If set true, then the Java code generator will generate a separate .java + // file for each top-level message, enum, and service defined in the .proto + // file. Thus, these types will *not* be nested inside the outer class + // named by java_outer_classname. However, the outer class will still be + // generated to contain the file's getDescriptor() method as well as any + // top-level extensions defined in the file. + JavaMultipleFiles *bool `protobuf:"varint,10,opt,name=java_multiple_files,json=javaMultipleFiles,def=0" json:"java_multiple_files,omitempty"` + // This option does nothing. + JavaGenerateEqualsAndHash *bool `protobuf:"varint,20,opt,name=java_generate_equals_and_hash,json=javaGenerateEqualsAndHash" json:"java_generate_equals_and_hash,omitempty"` // Deprecated: Do not use. + // If set true, then the Java2 code generator will generate code that + // throws an exception whenever an attempt is made to assign a non-UTF-8 + // byte sequence to a string field. + // Message reflection will do the same. + // However, an extension field still accepts non-UTF-8 byte sequences. + // This option has no effect on when used with the lite runtime. + JavaStringCheckUtf8 *bool `protobuf:"varint,27,opt,name=java_string_check_utf8,json=javaStringCheckUtf8,def=0" json:"java_string_check_utf8,omitempty"` + OptimizeFor *FileOptions_OptimizeMode `protobuf:"varint,9,opt,name=optimize_for,json=optimizeFor,enum=google.protobuf.FileOptions_OptimizeMode,def=1" json:"optimize_for,omitempty"` + // Sets the Go package where structs generated from this .proto will be + // placed. If omitted, the Go package will be derived from the following: + // - The basename of the package import path, if provided. + // - Otherwise, the package statement in the .proto file, if present. + // - Otherwise, the basename of the .proto file, without extension. + GoPackage *string `protobuf:"bytes,11,opt,name=go_package,json=goPackage" json:"go_package,omitempty"` + // Should generic services be generated in each language? "Generic" services + // are not specific to any particular RPC system. They are generated by the + // main code generators in each language (without additional plugins). + // Generic services were the only kind of service generation supported by + // early versions of google.protobuf. + // + // Generic services are now considered deprecated in favor of using plugins + // that generate code specific to your particular RPC system. Therefore, + // these default to false. Old code which depends on generic services should + // explicitly set them to true. + CcGenericServices *bool `protobuf:"varint,16,opt,name=cc_generic_services,json=ccGenericServices,def=0" json:"cc_generic_services,omitempty"` + JavaGenericServices *bool `protobuf:"varint,17,opt,name=java_generic_services,json=javaGenericServices,def=0" json:"java_generic_services,omitempty"` + PyGenericServices *bool `protobuf:"varint,18,opt,name=py_generic_services,json=pyGenericServices,def=0" json:"py_generic_services,omitempty"` + PhpGenericServices *bool `protobuf:"varint,42,opt,name=php_generic_services,json=phpGenericServices,def=0" json:"php_generic_services,omitempty"` + // Is this file deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for everything in the file, or it will be completely ignored; in the very + // least, this is a formalization for deprecating files. + Deprecated *bool `protobuf:"varint,23,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Enables the use of arenas for the proto messages in this file. This applies + // only to generated classes for C++. + CcEnableArenas *bool `protobuf:"varint,31,opt,name=cc_enable_arenas,json=ccEnableArenas,def=0" json:"cc_enable_arenas,omitempty"` + // Sets the objective c class prefix which is prepended to all objective c + // generated classes from this .proto. There is no default. + ObjcClassPrefix *string `protobuf:"bytes,36,opt,name=objc_class_prefix,json=objcClassPrefix" json:"objc_class_prefix,omitempty"` + // Namespace for generated classes; defaults to the package. + CsharpNamespace *string `protobuf:"bytes,37,opt,name=csharp_namespace,json=csharpNamespace" json:"csharp_namespace,omitempty"` + // By default Swift generators will take the proto package and CamelCase it + // replacing '.' with underscore and use that to prefix the types/symbols + // defined. When this options is provided, they will use this value instead + // to prefix the types/symbols defined. + SwiftPrefix *string `protobuf:"bytes,39,opt,name=swift_prefix,json=swiftPrefix" json:"swift_prefix,omitempty"` + // Sets the php class prefix which is prepended to all php generated classes + // from this .proto. Default is empty. + PhpClassPrefix *string `protobuf:"bytes,40,opt,name=php_class_prefix,json=phpClassPrefix" json:"php_class_prefix,omitempty"` + // Use this option to change the namespace of php generated classes. Default + // is empty. When this option is empty, the package name will be used for + // determining the namespace. + PhpNamespace *string `protobuf:"bytes,41,opt,name=php_namespace,json=phpNamespace" json:"php_namespace,omitempty"` + // Use this option to change the namespace of php generated metadata classes. + // Default is empty. When this option is empty, the proto file name will be used + // for determining the namespace. + PhpMetadataNamespace *string `protobuf:"bytes,44,opt,name=php_metadata_namespace,json=phpMetadataNamespace" json:"php_metadata_namespace,omitempty"` + // Use this option to change the package of ruby generated classes. Default + // is empty. When this option is not set, the package name will be used for + // determining the ruby package. + RubyPackage *string `protobuf:"bytes,45,opt,name=ruby_package,json=rubyPackage" json:"ruby_package,omitempty"` + // The parser stores options it doesn't recognize here. + // See the documentation for the "Options" section above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileOptions) Reset() { *m = FileOptions{} } +func (m *FileOptions) String() string { return proto.CompactTextString(m) } +func (*FileOptions) ProtoMessage() {} +func (*FileOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10} +} + +var extRange_FileOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FileOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FileOptions +} + +func (m *FileOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileOptions.Unmarshal(m, b) +} +func (m *FileOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileOptions.Marshal(b, m, deterministic) +} +func (m *FileOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileOptions.Merge(m, src) +} +func (m *FileOptions) XXX_Size() int { + return xxx_messageInfo_FileOptions.Size(m) +} +func (m *FileOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FileOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FileOptions proto.InternalMessageInfo + +const Default_FileOptions_JavaMultipleFiles bool = false +const Default_FileOptions_JavaStringCheckUtf8 bool = false +const Default_FileOptions_OptimizeFor FileOptions_OptimizeMode = FileOptions_SPEED +const Default_FileOptions_CcGenericServices bool = false +const Default_FileOptions_JavaGenericServices bool = false +const Default_FileOptions_PyGenericServices bool = false +const Default_FileOptions_PhpGenericServices bool = false +const Default_FileOptions_Deprecated bool = false +const Default_FileOptions_CcEnableArenas bool = false + +func (m *FileOptions) GetJavaPackage() string { + if m != nil && m.JavaPackage != nil { + return *m.JavaPackage + } + return "" +} + +func (m *FileOptions) GetJavaOuterClassname() string { + if m != nil && m.JavaOuterClassname != nil { + return *m.JavaOuterClassname + } + return "" +} + +func (m *FileOptions) GetJavaMultipleFiles() bool { + if m != nil && m.JavaMultipleFiles != nil { + return *m.JavaMultipleFiles + } + return Default_FileOptions_JavaMultipleFiles +} + +// Deprecated: Do not use. +func (m *FileOptions) GetJavaGenerateEqualsAndHash() bool { + if m != nil && m.JavaGenerateEqualsAndHash != nil { + return *m.JavaGenerateEqualsAndHash + } + return false +} + +func (m *FileOptions) GetJavaStringCheckUtf8() bool { + if m != nil && m.JavaStringCheckUtf8 != nil { + return *m.JavaStringCheckUtf8 + } + return Default_FileOptions_JavaStringCheckUtf8 +} + +func (m *FileOptions) GetOptimizeFor() FileOptions_OptimizeMode { + if m != nil && m.OptimizeFor != nil { + return *m.OptimizeFor + } + return Default_FileOptions_OptimizeFor +} + +func (m *FileOptions) GetGoPackage() string { + if m != nil && m.GoPackage != nil { + return *m.GoPackage + } + return "" +} + +func (m *FileOptions) GetCcGenericServices() bool { + if m != nil && m.CcGenericServices != nil { + return *m.CcGenericServices + } + return Default_FileOptions_CcGenericServices +} + +func (m *FileOptions) GetJavaGenericServices() bool { + if m != nil && m.JavaGenericServices != nil { + return *m.JavaGenericServices + } + return Default_FileOptions_JavaGenericServices +} + +func (m *FileOptions) GetPyGenericServices() bool { + if m != nil && m.PyGenericServices != nil { + return *m.PyGenericServices + } + return Default_FileOptions_PyGenericServices +} + +func (m *FileOptions) GetPhpGenericServices() bool { + if m != nil && m.PhpGenericServices != nil { + return *m.PhpGenericServices + } + return Default_FileOptions_PhpGenericServices +} + +func (m *FileOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FileOptions_Deprecated +} + +func (m *FileOptions) GetCcEnableArenas() bool { + if m != nil && m.CcEnableArenas != nil { + return *m.CcEnableArenas + } + return Default_FileOptions_CcEnableArenas +} + +func (m *FileOptions) GetObjcClassPrefix() string { + if m != nil && m.ObjcClassPrefix != nil { + return *m.ObjcClassPrefix + } + return "" +} + +func (m *FileOptions) GetCsharpNamespace() string { + if m != nil && m.CsharpNamespace != nil { + return *m.CsharpNamespace + } + return "" +} + +func (m *FileOptions) GetSwiftPrefix() string { + if m != nil && m.SwiftPrefix != nil { + return *m.SwiftPrefix + } + return "" +} + +func (m *FileOptions) GetPhpClassPrefix() string { + if m != nil && m.PhpClassPrefix != nil { + return *m.PhpClassPrefix + } + return "" +} + +func (m *FileOptions) GetPhpNamespace() string { + if m != nil && m.PhpNamespace != nil { + return *m.PhpNamespace + } + return "" +} + +func (m *FileOptions) GetPhpMetadataNamespace() string { + if m != nil && m.PhpMetadataNamespace != nil { + return *m.PhpMetadataNamespace + } + return "" +} + +func (m *FileOptions) GetRubyPackage() string { + if m != nil && m.RubyPackage != nil { + return *m.RubyPackage + } + return "" +} + +func (m *FileOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MessageOptions struct { + // Set true to use the old proto1 MessageSet wire format for extensions. + // This is provided for backwards-compatibility with the MessageSet wire + // format. You should not use this for any other reason: It's less + // efficient, has fewer features, and is more complicated. + // + // The message must be defined exactly as follows: + // message Foo { + // option message_set_wire_format = true; + // extensions 4 to max; + // } + // Note that the message cannot have any defined fields; MessageSets only + // have extensions. + // + // All extensions of your type must be singular messages; e.g. they cannot + // be int32s, enums, or repeated messages. + // + // Because this is an option, the above two restrictions are not enforced by + // the protocol compiler. + MessageSetWireFormat *bool `protobuf:"varint,1,opt,name=message_set_wire_format,json=messageSetWireFormat,def=0" json:"message_set_wire_format,omitempty"` + // Disables the generation of the standard "descriptor()" accessor, which can + // conflict with a field of the same name. This is meant to make migration + // from proto1 easier; new code should avoid fields named "descriptor". + NoStandardDescriptorAccessor *bool `protobuf:"varint,2,opt,name=no_standard_descriptor_accessor,json=noStandardDescriptorAccessor,def=0" json:"no_standard_descriptor_accessor,omitempty"` + // Is this message deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the message, or it will be completely ignored; in the very least, + // this is a formalization for deprecating messages. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Whether the message is an automatically generated map entry type for the + // maps field. + // + // For maps fields: + // map<KeyType, ValueType> map_field = 1; + // The parsed descriptor looks like: + // message MapFieldEntry { + // option map_entry = true; + // optional KeyType key = 1; + // optional ValueType value = 2; + // } + // repeated MapFieldEntry map_field = 1; + // + // Implementations may choose not to generate the map_entry=true message, but + // use a native map in the target language to hold the keys and values. + // The reflection APIs in such implementions still need to work as + // if the field is a repeated message field. + // + // NOTE: Do not set the option in .proto files. Always use the maps syntax + // instead. The option should only be implicitly set by the proto compiler + // parser. + MapEntry *bool `protobuf:"varint,7,opt,name=map_entry,json=mapEntry" json:"map_entry,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MessageOptions) Reset() { *m = MessageOptions{} } +func (m *MessageOptions) String() string { return proto.CompactTextString(m) } +func (*MessageOptions) ProtoMessage() {} +func (*MessageOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{11} +} + +var extRange_MessageOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MessageOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MessageOptions +} + +func (m *MessageOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MessageOptions.Unmarshal(m, b) +} +func (m *MessageOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MessageOptions.Marshal(b, m, deterministic) +} +func (m *MessageOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MessageOptions.Merge(m, src) +} +func (m *MessageOptions) XXX_Size() int { + return xxx_messageInfo_MessageOptions.Size(m) +} +func (m *MessageOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MessageOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MessageOptions proto.InternalMessageInfo + +const Default_MessageOptions_MessageSetWireFormat bool = false +const Default_MessageOptions_NoStandardDescriptorAccessor bool = false +const Default_MessageOptions_Deprecated bool = false + +func (m *MessageOptions) GetMessageSetWireFormat() bool { + if m != nil && m.MessageSetWireFormat != nil { + return *m.MessageSetWireFormat + } + return Default_MessageOptions_MessageSetWireFormat +} + +func (m *MessageOptions) GetNoStandardDescriptorAccessor() bool { + if m != nil && m.NoStandardDescriptorAccessor != nil { + return *m.NoStandardDescriptorAccessor + } + return Default_MessageOptions_NoStandardDescriptorAccessor +} + +func (m *MessageOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MessageOptions_Deprecated +} + +func (m *MessageOptions) GetMapEntry() bool { + if m != nil && m.MapEntry != nil { + return *m.MapEntry + } + return false +} + +func (m *MessageOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type FieldOptions struct { + // The ctype option instructs the C++ code generator to use a different + // representation of the field than it normally would. See the specific + // options below. This option is not yet implemented in the open source + // release -- sorry, we'll try to include it in a future version! + Ctype *FieldOptions_CType `protobuf:"varint,1,opt,name=ctype,enum=google.protobuf.FieldOptions_CType,def=0" json:"ctype,omitempty"` + // The packed option can be enabled for repeated primitive fields to enable + // a more efficient representation on the wire. Rather than repeatedly + // writing the tag and type for each element, the entire array is encoded as + // a single length-delimited blob. In proto3, only explicit setting it to + // false will avoid using packed encoding. + Packed *bool `protobuf:"varint,2,opt,name=packed" json:"packed,omitempty"` + // The jstype option determines the JavaScript type used for values of the + // field. The option is permitted only for 64 bit integral and fixed types + // (int64, uint64, sint64, fixed64, sfixed64). A field with jstype JS_STRING + // is represented as JavaScript string, which avoids loss of precision that + // can happen when a large value is converted to a floating point JavaScript. + // Specifying JS_NUMBER for the jstype causes the generated JavaScript code to + // use the JavaScript "number" type. The behavior of the default option + // JS_NORMAL is implementation dependent. + // + // This option is an enum to permit additional types to be added, e.g. + // goog.math.Integer. + Jstype *FieldOptions_JSType `protobuf:"varint,6,opt,name=jstype,enum=google.protobuf.FieldOptions_JSType,def=0" json:"jstype,omitempty"` + // Should this field be parsed lazily? Lazy applies only to message-type + // fields. It means that when the outer message is initially parsed, the + // inner message's contents will not be parsed but instead stored in encoded + // form. The inner message will actually be parsed when it is first accessed. + // + // This is only a hint. Implementations are free to choose whether to use + // eager or lazy parsing regardless of the value of this option. However, + // setting this option true suggests that the protocol author believes that + // using lazy parsing on this field is worth the additional bookkeeping + // overhead typically needed to implement it. + // + // This option does not affect the public interface of any generated code; + // all method signatures remain the same. Furthermore, thread-safety of the + // interface is not affected by this option; const methods remain safe to + // call from multiple threads concurrently, while non-const methods continue + // to require exclusive access. + // + // + // Note that implementations may choose not to check required fields within + // a lazy sub-message. That is, calling IsInitialized() on the outer message + // may return true even if the inner message has missing required fields. + // This is necessary because otherwise the inner message would have to be + // parsed in order to perform the check, defeating the purpose of lazy + // parsing. An implementation which chooses not to check required fields + // must be consistent about it. That is, for any particular sub-message, the + // implementation must either *always* check its required fields, or *never* + // check its required fields, regardless of whether or not the message has + // been parsed. + Lazy *bool `protobuf:"varint,5,opt,name=lazy,def=0" json:"lazy,omitempty"` + // Is this field deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for accessors, or it will be completely ignored; in the very least, this + // is a formalization for deprecating fields. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // For Google-internal migration only. Do not use. + Weak *bool `protobuf:"varint,10,opt,name=weak,def=0" json:"weak,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldOptions) Reset() { *m = FieldOptions{} } +func (m *FieldOptions) String() string { return proto.CompactTextString(m) } +func (*FieldOptions) ProtoMessage() {} +func (*FieldOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12} +} + +var extRange_FieldOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FieldOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FieldOptions +} + +func (m *FieldOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldOptions.Unmarshal(m, b) +} +func (m *FieldOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldOptions.Marshal(b, m, deterministic) +} +func (m *FieldOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldOptions.Merge(m, src) +} +func (m *FieldOptions) XXX_Size() int { + return xxx_messageInfo_FieldOptions.Size(m) +} +func (m *FieldOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FieldOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldOptions proto.InternalMessageInfo + +const Default_FieldOptions_Ctype FieldOptions_CType = FieldOptions_STRING +const Default_FieldOptions_Jstype FieldOptions_JSType = FieldOptions_JS_NORMAL +const Default_FieldOptions_Lazy bool = false +const Default_FieldOptions_Deprecated bool = false +const Default_FieldOptions_Weak bool = false + +func (m *FieldOptions) GetCtype() FieldOptions_CType { + if m != nil && m.Ctype != nil { + return *m.Ctype + } + return Default_FieldOptions_Ctype +} + +func (m *FieldOptions) GetPacked() bool { + if m != nil && m.Packed != nil { + return *m.Packed + } + return false +} + +func (m *FieldOptions) GetJstype() FieldOptions_JSType { + if m != nil && m.Jstype != nil { + return *m.Jstype + } + return Default_FieldOptions_Jstype +} + +func (m *FieldOptions) GetLazy() bool { + if m != nil && m.Lazy != nil { + return *m.Lazy + } + return Default_FieldOptions_Lazy +} + +func (m *FieldOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FieldOptions_Deprecated +} + +func (m *FieldOptions) GetWeak() bool { + if m != nil && m.Weak != nil { + return *m.Weak + } + return Default_FieldOptions_Weak +} + +func (m *FieldOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type OneofOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofOptions) Reset() { *m = OneofOptions{} } +func (m *OneofOptions) String() string { return proto.CompactTextString(m) } +func (*OneofOptions) ProtoMessage() {} +func (*OneofOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{13} +} + +var extRange_OneofOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*OneofOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_OneofOptions +} + +func (m *OneofOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofOptions.Unmarshal(m, b) +} +func (m *OneofOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofOptions.Marshal(b, m, deterministic) +} +func (m *OneofOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofOptions.Merge(m, src) +} +func (m *OneofOptions) XXX_Size() int { + return xxx_messageInfo_OneofOptions.Size(m) +} +func (m *OneofOptions) XXX_DiscardUnknown() { + xxx_messageInfo_OneofOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofOptions proto.InternalMessageInfo + +func (m *OneofOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumOptions struct { + // Set this option to true to allow mapping different tag names to the same + // value. + AllowAlias *bool `protobuf:"varint,2,opt,name=allow_alias,json=allowAlias" json:"allow_alias,omitempty"` + // Is this enum deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum, or it will be completely ignored; in the very least, this + // is a formalization for deprecating enums. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumOptions) Reset() { *m = EnumOptions{} } +func (m *EnumOptions) String() string { return proto.CompactTextString(m) } +func (*EnumOptions) ProtoMessage() {} +func (*EnumOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{14} +} + +var extRange_EnumOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumOptions +} + +func (m *EnumOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumOptions.Unmarshal(m, b) +} +func (m *EnumOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumOptions.Marshal(b, m, deterministic) +} +func (m *EnumOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumOptions.Merge(m, src) +} +func (m *EnumOptions) XXX_Size() int { + return xxx_messageInfo_EnumOptions.Size(m) +} +func (m *EnumOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumOptions proto.InternalMessageInfo + +const Default_EnumOptions_Deprecated bool = false + +func (m *EnumOptions) GetAllowAlias() bool { + if m != nil && m.AllowAlias != nil { + return *m.AllowAlias + } + return false +} + +func (m *EnumOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumOptions_Deprecated +} + +func (m *EnumOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumValueOptions struct { + // Is this enum value deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum value, or it will be completely ignored; in the very least, + // this is a formalization for deprecating enum values. + Deprecated *bool `protobuf:"varint,1,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueOptions) Reset() { *m = EnumValueOptions{} } +func (m *EnumValueOptions) String() string { return proto.CompactTextString(m) } +func (*EnumValueOptions) ProtoMessage() {} +func (*EnumValueOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{15} +} + +var extRange_EnumValueOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumValueOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumValueOptions +} + +func (m *EnumValueOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueOptions.Unmarshal(m, b) +} +func (m *EnumValueOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueOptions.Marshal(b, m, deterministic) +} +func (m *EnumValueOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueOptions.Merge(m, src) +} +func (m *EnumValueOptions) XXX_Size() int { + return xxx_messageInfo_EnumValueOptions.Size(m) +} +func (m *EnumValueOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueOptions proto.InternalMessageInfo + +const Default_EnumValueOptions_Deprecated bool = false + +func (m *EnumValueOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumValueOptions_Deprecated +} + +func (m *EnumValueOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type ServiceOptions struct { + // Is this service deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the service, or it will be completely ignored; in the very least, + // this is a formalization for deprecating services. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceOptions) Reset() { *m = ServiceOptions{} } +func (m *ServiceOptions) String() string { return proto.CompactTextString(m) } +func (*ServiceOptions) ProtoMessage() {} +func (*ServiceOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{16} +} + +var extRange_ServiceOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ServiceOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ServiceOptions +} + +func (m *ServiceOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceOptions.Unmarshal(m, b) +} +func (m *ServiceOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceOptions.Marshal(b, m, deterministic) +} +func (m *ServiceOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceOptions.Merge(m, src) +} +func (m *ServiceOptions) XXX_Size() int { + return xxx_messageInfo_ServiceOptions.Size(m) +} +func (m *ServiceOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceOptions proto.InternalMessageInfo + +const Default_ServiceOptions_Deprecated bool = false + +func (m *ServiceOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_ServiceOptions_Deprecated +} + +func (m *ServiceOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MethodOptions struct { + // Is this method deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the method, or it will be completely ignored; in the very least, + // this is a formalization for deprecating methods. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + IdempotencyLevel *MethodOptions_IdempotencyLevel `protobuf:"varint,34,opt,name=idempotency_level,json=idempotencyLevel,enum=google.protobuf.MethodOptions_IdempotencyLevel,def=0" json:"idempotency_level,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodOptions) Reset() { *m = MethodOptions{} } +func (m *MethodOptions) String() string { return proto.CompactTextString(m) } +func (*MethodOptions) ProtoMessage() {} +func (*MethodOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17} +} + +var extRange_MethodOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MethodOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MethodOptions +} + +func (m *MethodOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodOptions.Unmarshal(m, b) +} +func (m *MethodOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodOptions.Marshal(b, m, deterministic) +} +func (m *MethodOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodOptions.Merge(m, src) +} +func (m *MethodOptions) XXX_Size() int { + return xxx_messageInfo_MethodOptions.Size(m) +} +func (m *MethodOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MethodOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodOptions proto.InternalMessageInfo + +const Default_MethodOptions_Deprecated bool = false +const Default_MethodOptions_IdempotencyLevel MethodOptions_IdempotencyLevel = MethodOptions_IDEMPOTENCY_UNKNOWN + +func (m *MethodOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MethodOptions_Deprecated +} + +func (m *MethodOptions) GetIdempotencyLevel() MethodOptions_IdempotencyLevel { + if m != nil && m.IdempotencyLevel != nil { + return *m.IdempotencyLevel + } + return Default_MethodOptions_IdempotencyLevel +} + +func (m *MethodOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// A message representing a option the parser does not recognize. This only +// appears in options protos created by the compiler::Parser class. +// DescriptorPool resolves these when building Descriptor objects. Therefore, +// options protos in descriptor objects (e.g. returned by Descriptor::options(), +// or produced by Descriptor::CopyTo()) will never have UninterpretedOptions +// in them. +type UninterpretedOption struct { + Name []*UninterpretedOption_NamePart `protobuf:"bytes,2,rep,name=name" json:"name,omitempty"` + // The value of the uninterpreted option, in whatever type the tokenizer + // identified it as during parsing. Exactly one of these should be set. + IdentifierValue *string `protobuf:"bytes,3,opt,name=identifier_value,json=identifierValue" json:"identifier_value,omitempty"` + PositiveIntValue *uint64 `protobuf:"varint,4,opt,name=positive_int_value,json=positiveIntValue" json:"positive_int_value,omitempty"` + NegativeIntValue *int64 `protobuf:"varint,5,opt,name=negative_int_value,json=negativeIntValue" json:"negative_int_value,omitempty"` + DoubleValue *float64 `protobuf:"fixed64,6,opt,name=double_value,json=doubleValue" json:"double_value,omitempty"` + StringValue []byte `protobuf:"bytes,7,opt,name=string_value,json=stringValue" json:"string_value,omitempty"` + AggregateValue *string `protobuf:"bytes,8,opt,name=aggregate_value,json=aggregateValue" json:"aggregate_value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption) Reset() { *m = UninterpretedOption{} } +func (m *UninterpretedOption) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption) ProtoMessage() {} +func (*UninterpretedOption) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18} +} +func (m *UninterpretedOption) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption.Unmarshal(m, b) +} +func (m *UninterpretedOption) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption.Merge(m, src) +} +func (m *UninterpretedOption) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption.Size(m) +} +func (m *UninterpretedOption) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption proto.InternalMessageInfo + +func (m *UninterpretedOption) GetName() []*UninterpretedOption_NamePart { + if m != nil { + return m.Name + } + return nil +} + +func (m *UninterpretedOption) GetIdentifierValue() string { + if m != nil && m.IdentifierValue != nil { + return *m.IdentifierValue + } + return "" +} + +func (m *UninterpretedOption) GetPositiveIntValue() uint64 { + if m != nil && m.PositiveIntValue != nil { + return *m.PositiveIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetNegativeIntValue() int64 { + if m != nil && m.NegativeIntValue != nil { + return *m.NegativeIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetDoubleValue() float64 { + if m != nil && m.DoubleValue != nil { + return *m.DoubleValue + } + return 0 +} + +func (m *UninterpretedOption) GetStringValue() []byte { + if m != nil { + return m.StringValue + } + return nil +} + +func (m *UninterpretedOption) GetAggregateValue() string { + if m != nil && m.AggregateValue != nil { + return *m.AggregateValue + } + return "" +} + +// The name of the uninterpreted option. Each string represents a segment in +// a dot-separated name. is_extension is true iff a segment represents an +// extension (denoted with parentheses in options specs in .proto files). +// E.g.,{ ["foo", false], ["bar.baz", true], ["qux", false] } represents +// "foo.(bar.baz).qux". +type UninterpretedOption_NamePart struct { + NamePart *string `protobuf:"bytes,1,req,name=name_part,json=namePart" json:"name_part,omitempty"` + IsExtension *bool `protobuf:"varint,2,req,name=is_extension,json=isExtension" json:"is_extension,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption_NamePart) Reset() { *m = UninterpretedOption_NamePart{} } +func (m *UninterpretedOption_NamePart) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption_NamePart) ProtoMessage() {} +func (*UninterpretedOption_NamePart) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18, 0} +} +func (m *UninterpretedOption_NamePart) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption_NamePart.Unmarshal(m, b) +} +func (m *UninterpretedOption_NamePart) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption_NamePart.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption_NamePart) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption_NamePart.Merge(m, src) +} +func (m *UninterpretedOption_NamePart) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption_NamePart.Size(m) +} +func (m *UninterpretedOption_NamePart) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption_NamePart.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption_NamePart proto.InternalMessageInfo + +func (m *UninterpretedOption_NamePart) GetNamePart() string { + if m != nil && m.NamePart != nil { + return *m.NamePart + } + return "" +} + +func (m *UninterpretedOption_NamePart) GetIsExtension() bool { + if m != nil && m.IsExtension != nil { + return *m.IsExtension + } + return false +} + +// Encapsulates information about the original source file from which a +// FileDescriptorProto was generated. +type SourceCodeInfo struct { + // A Location identifies a piece of source code in a .proto file which + // corresponds to a particular definition. This information is intended + // to be useful to IDEs, code indexers, documentation generators, and similar + // tools. + // + // For example, say we have a file like: + // message Foo { + // optional string foo = 1; + // } + // Let's look at just the field definition: + // optional string foo = 1; + // ^ ^^ ^^ ^ ^^^ + // a bc de f ghi + // We have the following locations: + // span path represents + // [a,i) [ 4, 0, 2, 0 ] The whole field definition. + // [a,b) [ 4, 0, 2, 0, 4 ] The label (optional). + // [c,d) [ 4, 0, 2, 0, 5 ] The type (string). + // [e,f) [ 4, 0, 2, 0, 1 ] The name (foo). + // [g,h) [ 4, 0, 2, 0, 3 ] The number (1). + // + // Notes: + // - A location may refer to a repeated field itself (i.e. not to any + // particular index within it). This is used whenever a set of elements are + // logically enclosed in a single code segment. For example, an entire + // extend block (possibly containing multiple extension definitions) will + // have an outer location whose path refers to the "extensions" repeated + // field without an index. + // - Multiple locations may have the same path. This happens when a single + // logical declaration is spread out across multiple places. The most + // obvious example is the "extend" block again -- there may be multiple + // extend blocks in the same scope, each of which will have the same path. + // - A location's span is not always a subset of its parent's span. For + // example, the "extendee" of an extension declaration appears at the + // beginning of the "extend" block and is shared by all extensions within + // the block. + // - Just because a location's span is a subset of some other location's span + // does not mean that it is a descendent. For example, a "group" defines + // both a type and a field in a single declaration. Thus, the locations + // corresponding to the type and field and their components will overlap. + // - Code which tries to interpret locations should probably be designed to + // ignore those that it doesn't understand, as more types of locations could + // be recorded in the future. + Location []*SourceCodeInfo_Location `protobuf:"bytes,1,rep,name=location" json:"location,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo) Reset() { *m = SourceCodeInfo{} } +func (m *SourceCodeInfo) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo) ProtoMessage() {} +func (*SourceCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19} +} +func (m *SourceCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo.Unmarshal(m, b) +} +func (m *SourceCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo.Merge(m, src) +} +func (m *SourceCodeInfo) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo.Size(m) +} +func (m *SourceCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo proto.InternalMessageInfo + +func (m *SourceCodeInfo) GetLocation() []*SourceCodeInfo_Location { + if m != nil { + return m.Location + } + return nil +} + +type SourceCodeInfo_Location struct { + // Identifies which part of the FileDescriptorProto was defined at this + // location. + // + // Each element is a field number or an index. They form a path from + // the root FileDescriptorProto to the place where the definition. For + // example, this path: + // [ 4, 3, 2, 7, 1 ] + // refers to: + // file.message_type(3) // 4, 3 + // .field(7) // 2, 7 + // .name() // 1 + // This is because FileDescriptorProto.message_type has field number 4: + // repeated DescriptorProto message_type = 4; + // and DescriptorProto.field has field number 2: + // repeated FieldDescriptorProto field = 2; + // and FieldDescriptorProto.name has field number 1: + // optional string name = 1; + // + // Thus, the above path gives the location of a field name. If we removed + // the last element: + // [ 4, 3, 2, 7 ] + // this path refers to the whole field declaration (from the beginning + // of the label to the terminating semicolon). + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Always has exactly three or four elements: start line, start column, + // end line (optional, otherwise assumed same as start line), end column. + // These are packed into a single field for efficiency. Note that line + // and column numbers are zero-based -- typically you will want to add + // 1 to each before displaying to a user. + Span []int32 `protobuf:"varint,2,rep,packed,name=span" json:"span,omitempty"` + // If this SourceCodeInfo represents a complete declaration, these are any + // comments appearing before and after the declaration which appear to be + // attached to the declaration. + // + // A series of line comments appearing on consecutive lines, with no other + // tokens appearing on those lines, will be treated as a single comment. + // + // leading_detached_comments will keep paragraphs of comments that appear + // before (but not connected to) the current element. Each paragraph, + // separated by empty lines, will be one comment element in the repeated + // field. + // + // Only the comment content is provided; comment markers (e.g. //) are + // stripped out. For block comments, leading whitespace and an asterisk + // will be stripped from the beginning of each line other than the first. + // Newlines are included in the output. + // + // Examples: + // + // optional int32 foo = 1; // Comment attached to foo. + // // Comment attached to bar. + // optional int32 bar = 2; + // + // optional string baz = 3; + // // Comment attached to baz. + // // Another line attached to baz. + // + // // Comment attached to qux. + // // + // // Another line attached to qux. + // optional double qux = 4; + // + // // Detached comment for corge. This is not leading or trailing comments + // // to qux or corge because there are blank lines separating it from + // // both. + // + // // Detached comment for corge paragraph 2. + // + // optional string corge = 5; + // /* Block comment attached + // * to corge. Leading asterisks + // * will be removed. */ + // /* Block comment attached to + // * grault. */ + // optional int32 grault = 6; + // + // // ignored detached comments. + LeadingComments *string `protobuf:"bytes,3,opt,name=leading_comments,json=leadingComments" json:"leading_comments,omitempty"` + TrailingComments *string `protobuf:"bytes,4,opt,name=trailing_comments,json=trailingComments" json:"trailing_comments,omitempty"` + LeadingDetachedComments []string `protobuf:"bytes,6,rep,name=leading_detached_comments,json=leadingDetachedComments" json:"leading_detached_comments,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo_Location) Reset() { *m = SourceCodeInfo_Location{} } +func (m *SourceCodeInfo_Location) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo_Location) ProtoMessage() {} +func (*SourceCodeInfo_Location) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19, 0} +} +func (m *SourceCodeInfo_Location) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo_Location.Unmarshal(m, b) +} +func (m *SourceCodeInfo_Location) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo_Location.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo_Location) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo_Location.Merge(m, src) +} +func (m *SourceCodeInfo_Location) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo_Location.Size(m) +} +func (m *SourceCodeInfo_Location) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo_Location.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo_Location proto.InternalMessageInfo + +func (m *SourceCodeInfo_Location) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *SourceCodeInfo_Location) GetSpan() []int32 { + if m != nil { + return m.Span + } + return nil +} + +func (m *SourceCodeInfo_Location) GetLeadingComments() string { + if m != nil && m.LeadingComments != nil { + return *m.LeadingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetTrailingComments() string { + if m != nil && m.TrailingComments != nil { + return *m.TrailingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetLeadingDetachedComments() []string { + if m != nil { + return m.LeadingDetachedComments + } + return nil +} + +// Describes the relationship between generated code and its original source +// file. A GeneratedCodeInfo message is associated with only one generated +// source file, but may contain references to different source .proto files. +type GeneratedCodeInfo struct { + // An Annotation connects some span of text in generated code to an element + // of its generating .proto file. + Annotation []*GeneratedCodeInfo_Annotation `protobuf:"bytes,1,rep,name=annotation" json:"annotation,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo) Reset() { *m = GeneratedCodeInfo{} } +func (m *GeneratedCodeInfo) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo) ProtoMessage() {} +func (*GeneratedCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20} +} +func (m *GeneratedCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo.Merge(m, src) +} +func (m *GeneratedCodeInfo) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo.Size(m) +} +func (m *GeneratedCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo proto.InternalMessageInfo + +func (m *GeneratedCodeInfo) GetAnnotation() []*GeneratedCodeInfo_Annotation { + if m != nil { + return m.Annotation + } + return nil +} + +type GeneratedCodeInfo_Annotation struct { + // Identifies the element in the original source .proto file. This field + // is formatted the same as SourceCodeInfo.Location.path. + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Identifies the filesystem path to the original source .proto. + SourceFile *string `protobuf:"bytes,2,opt,name=source_file,json=sourceFile" json:"source_file,omitempty"` + // Identifies the starting offset in bytes in the generated code + // that relates to the identified object. + Begin *int32 `protobuf:"varint,3,opt,name=begin" json:"begin,omitempty"` + // Identifies the ending offset in bytes in the generated code that + // relates to the identified offset. The end offset should be one past + // the last relevant byte (so the length of the text = end - begin). + End *int32 `protobuf:"varint,4,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo_Annotation) Reset() { *m = GeneratedCodeInfo_Annotation{} } +func (m *GeneratedCodeInfo_Annotation) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo_Annotation) ProtoMessage() {} +func (*GeneratedCodeInfo_Annotation) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20, 0} +} +func (m *GeneratedCodeInfo_Annotation) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo_Annotation.Merge(m, src) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Size(m) +} +func (m *GeneratedCodeInfo_Annotation) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo_Annotation.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo_Annotation proto.InternalMessageInfo + +func (m *GeneratedCodeInfo_Annotation) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *GeneratedCodeInfo_Annotation) GetSourceFile() string { + if m != nil && m.SourceFile != nil { + return *m.SourceFile + } + return "" +} + +func (m *GeneratedCodeInfo_Annotation) GetBegin() int32 { + if m != nil && m.Begin != nil { + return *m.Begin + } + return 0 +} + +func (m *GeneratedCodeInfo_Annotation) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func init() { + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Type", FieldDescriptorProto_Type_name, FieldDescriptorProto_Type_value) + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Label", FieldDescriptorProto_Label_name, FieldDescriptorProto_Label_value) + proto.RegisterEnum("google.protobuf.FileOptions_OptimizeMode", FileOptions_OptimizeMode_name, FileOptions_OptimizeMode_value) + proto.RegisterEnum("google.protobuf.FieldOptions_CType", FieldOptions_CType_name, FieldOptions_CType_value) + proto.RegisterEnum("google.protobuf.FieldOptions_JSType", FieldOptions_JSType_name, FieldOptions_JSType_value) + proto.RegisterEnum("google.protobuf.MethodOptions_IdempotencyLevel", MethodOptions_IdempotencyLevel_name, MethodOptions_IdempotencyLevel_value) + proto.RegisterType((*FileDescriptorSet)(nil), "google.protobuf.FileDescriptorSet") + proto.RegisterType((*FileDescriptorProto)(nil), "google.protobuf.FileDescriptorProto") + proto.RegisterType((*DescriptorProto)(nil), "google.protobuf.DescriptorProto") + proto.RegisterType((*DescriptorProto_ExtensionRange)(nil), "google.protobuf.DescriptorProto.ExtensionRange") + proto.RegisterType((*DescriptorProto_ReservedRange)(nil), "google.protobuf.DescriptorProto.ReservedRange") + proto.RegisterType((*ExtensionRangeOptions)(nil), "google.protobuf.ExtensionRangeOptions") + proto.RegisterType((*FieldDescriptorProto)(nil), "google.protobuf.FieldDescriptorProto") + proto.RegisterType((*OneofDescriptorProto)(nil), "google.protobuf.OneofDescriptorProto") + proto.RegisterType((*EnumDescriptorProto)(nil), "google.protobuf.EnumDescriptorProto") + proto.RegisterType((*EnumDescriptorProto_EnumReservedRange)(nil), "google.protobuf.EnumDescriptorProto.EnumReservedRange") + proto.RegisterType((*EnumValueDescriptorProto)(nil), "google.protobuf.EnumValueDescriptorProto") + proto.RegisterType((*ServiceDescriptorProto)(nil), "google.protobuf.ServiceDescriptorProto") + proto.RegisterType((*MethodDescriptorProto)(nil), "google.protobuf.MethodDescriptorProto") + proto.RegisterType((*FileOptions)(nil), "google.protobuf.FileOptions") + proto.RegisterType((*MessageOptions)(nil), "google.protobuf.MessageOptions") + proto.RegisterType((*FieldOptions)(nil), "google.protobuf.FieldOptions") + proto.RegisterType((*OneofOptions)(nil), "google.protobuf.OneofOptions") + proto.RegisterType((*EnumOptions)(nil), "google.protobuf.EnumOptions") + proto.RegisterType((*EnumValueOptions)(nil), "google.protobuf.EnumValueOptions") + proto.RegisterType((*ServiceOptions)(nil), "google.protobuf.ServiceOptions") + proto.RegisterType((*MethodOptions)(nil), "google.protobuf.MethodOptions") + proto.RegisterType((*UninterpretedOption)(nil), "google.protobuf.UninterpretedOption") + proto.RegisterType((*UninterpretedOption_NamePart)(nil), "google.protobuf.UninterpretedOption.NamePart") + proto.RegisterType((*SourceCodeInfo)(nil), "google.protobuf.SourceCodeInfo") + proto.RegisterType((*SourceCodeInfo_Location)(nil), "google.protobuf.SourceCodeInfo.Location") + proto.RegisterType((*GeneratedCodeInfo)(nil), "google.protobuf.GeneratedCodeInfo") + proto.RegisterType((*GeneratedCodeInfo_Annotation)(nil), "google.protobuf.GeneratedCodeInfo.Annotation") +} + +func init() { proto.RegisterFile("descriptor.proto", fileDescriptor_308767df5ffe18af) } + +var fileDescriptor_308767df5ffe18af = []byte{ + // 2522 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xc4, 0x59, 0xcd, 0x6f, 0xdb, 0xc8, + 0x15, 0x5f, 0x7d, 0x5a, 0x7a, 0x92, 0x65, 0x7a, 0xec, 0x75, 0x18, 0xef, 0x47, 0x1c, 0xed, 0x66, + 0xe3, 0x24, 0xbb, 0xca, 0xc2, 0x49, 0x9c, 0xac, 0x53, 0x6c, 0x2b, 0x4b, 0x8c, 0x57, 0xa9, 0xbe, + 0x4a, 0xc9, 0xdd, 0x64, 0x8b, 0x82, 0x18, 0x93, 0x23, 0x89, 0x09, 0x45, 0x72, 0x49, 0x2a, 0x89, + 0x83, 0x1e, 0x02, 0xf4, 0x54, 0xa0, 0x7f, 0x40, 0x51, 0x14, 0x3d, 0xf4, 0xb2, 0x40, 0xff, 0x80, + 0x02, 0xed, 0xbd, 0xd7, 0x02, 0xbd, 0xf7, 0x50, 0xa0, 0x05, 0xda, 0x3f, 0xa1, 0xc7, 0x62, 0x66, + 0x48, 0x8a, 0xd4, 0x47, 0xe2, 0x5d, 0x20, 0xd9, 0x93, 0x3d, 0xef, 0xfd, 0xde, 0x9b, 0x37, 0x8f, + 0xbf, 0x79, 0xf3, 0x66, 0x04, 0x82, 0x46, 0x5c, 0xd5, 0xd1, 0x6d, 0xcf, 0x72, 0x2a, 0xb6, 0x63, + 0x79, 0x16, 0x5a, 0x1b, 0x5a, 0xd6, 0xd0, 0x20, 0x7c, 0x74, 0x32, 0x19, 0x94, 0x5b, 0xb0, 0x7e, + 0x4f, 0x37, 0x48, 0x3d, 0x04, 0xf6, 0x88, 0x87, 0xee, 0x40, 0x7a, 0xa0, 0x1b, 0x44, 0x4c, 0xec, + 0xa4, 0x76, 0x0b, 0x7b, 0x1f, 0x56, 0x66, 0x8c, 0x2a, 0x71, 0x8b, 0x2e, 0x15, 0xcb, 0xcc, 0xa2, + 0xfc, 0xef, 0x34, 0x6c, 0x2c, 0xd0, 0x22, 0x04, 0x69, 0x13, 0x8f, 0xa9, 0xc7, 0xc4, 0x6e, 0x5e, + 0x66, 0xff, 0x23, 0x11, 0x56, 0x6c, 0xac, 0x3e, 0xc6, 0x43, 0x22, 0x26, 0x99, 0x38, 0x18, 0xa2, + 0xf7, 0x01, 0x34, 0x62, 0x13, 0x53, 0x23, 0xa6, 0x7a, 0x2a, 0xa6, 0x76, 0x52, 0xbb, 0x79, 0x39, + 0x22, 0x41, 0xd7, 0x60, 0xdd, 0x9e, 0x9c, 0x18, 0xba, 0xaa, 0x44, 0x60, 0xb0, 0x93, 0xda, 0xcd, + 0xc8, 0x02, 0x57, 0xd4, 0xa7, 0xe0, 0xcb, 0xb0, 0xf6, 0x94, 0xe0, 0xc7, 0x51, 0x68, 0x81, 0x41, + 0x4b, 0x54, 0x1c, 0x01, 0xd6, 0xa0, 0x38, 0x26, 0xae, 0x8b, 0x87, 0x44, 0xf1, 0x4e, 0x6d, 0x22, + 0xa6, 0xd9, 0xea, 0x77, 0xe6, 0x56, 0x3f, 0xbb, 0xf2, 0x82, 0x6f, 0xd5, 0x3f, 0xb5, 0x09, 0xaa, + 0x42, 0x9e, 0x98, 0x93, 0x31, 0xf7, 0x90, 0x59, 0x92, 0x3f, 0xc9, 0x9c, 0x8c, 0x67, 0xbd, 0xe4, + 0xa8, 0x99, 0xef, 0x62, 0xc5, 0x25, 0xce, 0x13, 0x5d, 0x25, 0x62, 0x96, 0x39, 0xb8, 0x3c, 0xe7, + 0xa0, 0xc7, 0xf5, 0xb3, 0x3e, 0x02, 0x3b, 0x54, 0x83, 0x3c, 0x79, 0xe6, 0x11, 0xd3, 0xd5, 0x2d, + 0x53, 0x5c, 0x61, 0x4e, 0x2e, 0x2d, 0xf8, 0x8a, 0xc4, 0xd0, 0x66, 0x5d, 0x4c, 0xed, 0xd0, 0x3e, + 0xac, 0x58, 0xb6, 0xa7, 0x5b, 0xa6, 0x2b, 0xe6, 0x76, 0x12, 0xbb, 0x85, 0xbd, 0x77, 0x17, 0x12, + 0xa1, 0xc3, 0x31, 0x72, 0x00, 0x46, 0x0d, 0x10, 0x5c, 0x6b, 0xe2, 0xa8, 0x44, 0x51, 0x2d, 0x8d, + 0x28, 0xba, 0x39, 0xb0, 0xc4, 0x3c, 0x73, 0x70, 0x61, 0x7e, 0x21, 0x0c, 0x58, 0xb3, 0x34, 0xd2, + 0x30, 0x07, 0x96, 0x5c, 0x72, 0x63, 0x63, 0xb4, 0x05, 0x59, 0xf7, 0xd4, 0xf4, 0xf0, 0x33, 0xb1, + 0xc8, 0x18, 0xe2, 0x8f, 0xca, 0x7f, 0xce, 0xc2, 0xda, 0x59, 0x28, 0x76, 0x17, 0x32, 0x03, 0xba, + 0x4a, 0x31, 0xf9, 0x6d, 0x72, 0xc0, 0x6d, 0xe2, 0x49, 0xcc, 0x7e, 0xc7, 0x24, 0x56, 0xa1, 0x60, + 0x12, 0xd7, 0x23, 0x1a, 0x67, 0x44, 0xea, 0x8c, 0x9c, 0x02, 0x6e, 0x34, 0x4f, 0xa9, 0xf4, 0x77, + 0xa2, 0xd4, 0x03, 0x58, 0x0b, 0x43, 0x52, 0x1c, 0x6c, 0x0e, 0x03, 0x6e, 0x5e, 0x7f, 0x55, 0x24, + 0x15, 0x29, 0xb0, 0x93, 0xa9, 0x99, 0x5c, 0x22, 0xb1, 0x31, 0xaa, 0x03, 0x58, 0x26, 0xb1, 0x06, + 0x8a, 0x46, 0x54, 0x43, 0xcc, 0x2d, 0xc9, 0x52, 0x87, 0x42, 0xe6, 0xb2, 0x64, 0x71, 0xa9, 0x6a, + 0xa0, 0xcf, 0xa6, 0x54, 0x5b, 0x59, 0xc2, 0x94, 0x16, 0xdf, 0x64, 0x73, 0x6c, 0x3b, 0x86, 0x92, + 0x43, 0x28, 0xef, 0x89, 0xe6, 0xaf, 0x2c, 0xcf, 0x82, 0xa8, 0xbc, 0x72, 0x65, 0xb2, 0x6f, 0xc6, + 0x17, 0xb6, 0xea, 0x44, 0x87, 0xe8, 0x03, 0x08, 0x05, 0x0a, 0xa3, 0x15, 0xb0, 0x2a, 0x54, 0x0c, + 0x84, 0x6d, 0x3c, 0x26, 0xdb, 0xcf, 0xa1, 0x14, 0x4f, 0x0f, 0xda, 0x84, 0x8c, 0xeb, 0x61, 0xc7, + 0x63, 0x2c, 0xcc, 0xc8, 0x7c, 0x80, 0x04, 0x48, 0x11, 0x53, 0x63, 0x55, 0x2e, 0x23, 0xd3, 0x7f, + 0xd1, 0x8f, 0xa6, 0x0b, 0x4e, 0xb1, 0x05, 0x7f, 0x34, 0xff, 0x45, 0x63, 0x9e, 0x67, 0xd7, 0xbd, + 0x7d, 0x1b, 0x56, 0x63, 0x0b, 0x38, 0xeb, 0xd4, 0xe5, 0x5f, 0xc0, 0xdb, 0x0b, 0x5d, 0xa3, 0x07, + 0xb0, 0x39, 0x31, 0x75, 0xd3, 0x23, 0x8e, 0xed, 0x10, 0xca, 0x58, 0x3e, 0x95, 0xf8, 0x9f, 0x95, + 0x25, 0x9c, 0x3b, 0x8e, 0xa2, 0xb9, 0x17, 0x79, 0x63, 0x32, 0x2f, 0xbc, 0x9a, 0xcf, 0xfd, 0x77, + 0x45, 0x78, 0xf1, 0xe2, 0xc5, 0x8b, 0x64, 0xf9, 0x37, 0x59, 0xd8, 0x5c, 0xb4, 0x67, 0x16, 0x6e, + 0xdf, 0x2d, 0xc8, 0x9a, 0x93, 0xf1, 0x09, 0x71, 0x58, 0x92, 0x32, 0xb2, 0x3f, 0x42, 0x55, 0xc8, + 0x18, 0xf8, 0x84, 0x18, 0x62, 0x7a, 0x27, 0xb1, 0x5b, 0xda, 0xbb, 0x76, 0xa6, 0x5d, 0x59, 0x69, + 0x52, 0x13, 0x99, 0x5b, 0xa2, 0xcf, 0x21, 0xed, 0x97, 0x68, 0xea, 0xe1, 0xea, 0xd9, 0x3c, 0xd0, + 0xbd, 0x24, 0x33, 0x3b, 0xf4, 0x0e, 0xe4, 0xe9, 0x5f, 0xce, 0x8d, 0x2c, 0x8b, 0x39, 0x47, 0x05, + 0x94, 0x17, 0x68, 0x1b, 0x72, 0x6c, 0x9b, 0x68, 0x24, 0x38, 0xda, 0xc2, 0x31, 0x25, 0x96, 0x46, + 0x06, 0x78, 0x62, 0x78, 0xca, 0x13, 0x6c, 0x4c, 0x08, 0x23, 0x7c, 0x5e, 0x2e, 0xfa, 0xc2, 0x9f, + 0x52, 0x19, 0xba, 0x00, 0x05, 0xbe, 0xab, 0x74, 0x53, 0x23, 0xcf, 0x58, 0xf5, 0xcc, 0xc8, 0x7c, + 0xa3, 0x35, 0xa8, 0x84, 0x4e, 0xff, 0xc8, 0xb5, 0xcc, 0x80, 0x9a, 0x6c, 0x0a, 0x2a, 0x60, 0xd3, + 0xdf, 0x9e, 0x2d, 0xdc, 0xef, 0x2d, 0x5e, 0xde, 0x2c, 0xa7, 0xca, 0x7f, 0x4a, 0x42, 0x9a, 0xd5, + 0x8b, 0x35, 0x28, 0xf4, 0x1f, 0x76, 0x25, 0xa5, 0xde, 0x39, 0x3e, 0x6c, 0x4a, 0x42, 0x02, 0x95, + 0x00, 0x98, 0xe0, 0x5e, 0xb3, 0x53, 0xed, 0x0b, 0xc9, 0x70, 0xdc, 0x68, 0xf7, 0xf7, 0x6f, 0x0a, + 0xa9, 0xd0, 0xe0, 0x98, 0x0b, 0xd2, 0x51, 0xc0, 0x8d, 0x3d, 0x21, 0x83, 0x04, 0x28, 0x72, 0x07, + 0x8d, 0x07, 0x52, 0x7d, 0xff, 0xa6, 0x90, 0x8d, 0x4b, 0x6e, 0xec, 0x09, 0x2b, 0x68, 0x15, 0xf2, + 0x4c, 0x72, 0xd8, 0xe9, 0x34, 0x85, 0x5c, 0xe8, 0xb3, 0xd7, 0x97, 0x1b, 0xed, 0x23, 0x21, 0x1f, + 0xfa, 0x3c, 0x92, 0x3b, 0xc7, 0x5d, 0x01, 0x42, 0x0f, 0x2d, 0xa9, 0xd7, 0xab, 0x1e, 0x49, 0x42, + 0x21, 0x44, 0x1c, 0x3e, 0xec, 0x4b, 0x3d, 0xa1, 0x18, 0x0b, 0xeb, 0xc6, 0x9e, 0xb0, 0x1a, 0x4e, + 0x21, 0xb5, 0x8f, 0x5b, 0x42, 0x09, 0xad, 0xc3, 0x2a, 0x9f, 0x22, 0x08, 0x62, 0x6d, 0x46, 0xb4, + 0x7f, 0x53, 0x10, 0xa6, 0x81, 0x70, 0x2f, 0xeb, 0x31, 0xc1, 0xfe, 0x4d, 0x01, 0x95, 0x6b, 0x90, + 0x61, 0xec, 0x42, 0x08, 0x4a, 0xcd, 0xea, 0xa1, 0xd4, 0x54, 0x3a, 0xdd, 0x7e, 0xa3, 0xd3, 0xae, + 0x36, 0x85, 0xc4, 0x54, 0x26, 0x4b, 0x3f, 0x39, 0x6e, 0xc8, 0x52, 0x5d, 0x48, 0x46, 0x65, 0x5d, + 0xa9, 0xda, 0x97, 0xea, 0x42, 0xaa, 0xac, 0xc2, 0xe6, 0xa2, 0x3a, 0xb9, 0x70, 0x67, 0x44, 0x3e, + 0x71, 0x72, 0xc9, 0x27, 0x66, 0xbe, 0xe6, 0x3e, 0xf1, 0xbf, 0x92, 0xb0, 0xb1, 0xe0, 0xac, 0x58, + 0x38, 0xc9, 0x0f, 0x21, 0xc3, 0x29, 0xca, 0x4f, 0xcf, 0x2b, 0x0b, 0x0f, 0x1d, 0x46, 0xd8, 0xb9, + 0x13, 0x94, 0xd9, 0x45, 0x3b, 0x88, 0xd4, 0x92, 0x0e, 0x82, 0xba, 0x98, 0xab, 0xe9, 0x3f, 0x9f, + 0xab, 0xe9, 0xfc, 0xd8, 0xdb, 0x3f, 0xcb, 0xb1, 0xc7, 0x64, 0xdf, 0xae, 0xb6, 0x67, 0x16, 0xd4, + 0xf6, 0xbb, 0xb0, 0x3e, 0xe7, 0xe8, 0xcc, 0x35, 0xf6, 0x97, 0x09, 0x10, 0x97, 0x25, 0xe7, 0x15, + 0x95, 0x2e, 0x19, 0xab, 0x74, 0x77, 0x67, 0x33, 0x78, 0x71, 0xf9, 0x47, 0x98, 0xfb, 0xd6, 0xdf, + 0x24, 0x60, 0x6b, 0x71, 0xa7, 0xb8, 0x30, 0x86, 0xcf, 0x21, 0x3b, 0x26, 0xde, 0xc8, 0x0a, 0xba, + 0xa5, 0x8f, 0x16, 0x9c, 0xc1, 0x54, 0x3d, 0xfb, 0xb1, 0x7d, 0xab, 0xe8, 0x21, 0x9e, 0x5a, 0xd6, + 0xee, 0xf1, 0x68, 0xe6, 0x22, 0xfd, 0x55, 0x12, 0xde, 0x5e, 0xe8, 0x7c, 0x61, 0xa0, 0xef, 0x01, + 0xe8, 0xa6, 0x3d, 0xf1, 0x78, 0x47, 0xc4, 0x0b, 0x6c, 0x9e, 0x49, 0x58, 0xf1, 0xa2, 0xc5, 0x73, + 0xe2, 0x85, 0xfa, 0x14, 0xd3, 0x03, 0x17, 0x31, 0xc0, 0x9d, 0x69, 0xa0, 0x69, 0x16, 0xe8, 0xfb, + 0x4b, 0x56, 0x3a, 0x47, 0xcc, 0x4f, 0x41, 0x50, 0x0d, 0x9d, 0x98, 0x9e, 0xe2, 0x7a, 0x0e, 0xc1, + 0x63, 0xdd, 0x1c, 0xb2, 0x13, 0x24, 0x77, 0x90, 0x19, 0x60, 0xc3, 0x25, 0xf2, 0x1a, 0x57, 0xf7, + 0x02, 0x2d, 0xb5, 0x60, 0x04, 0x72, 0x22, 0x16, 0xd9, 0x98, 0x05, 0x57, 0x87, 0x16, 0xe5, 0x5f, + 0xe7, 0xa1, 0x10, 0xe9, 0xab, 0xd1, 0x45, 0x28, 0x3e, 0xc2, 0x4f, 0xb0, 0x12, 0xdc, 0x95, 0x78, + 0x26, 0x0a, 0x54, 0xd6, 0xf5, 0xef, 0x4b, 0x9f, 0xc2, 0x26, 0x83, 0x58, 0x13, 0x8f, 0x38, 0x8a, + 0x6a, 0x60, 0xd7, 0x65, 0x49, 0xcb, 0x31, 0x28, 0xa2, 0xba, 0x0e, 0x55, 0xd5, 0x02, 0x0d, 0xba, + 0x05, 0x1b, 0xcc, 0x62, 0x3c, 0x31, 0x3c, 0xdd, 0x36, 0x88, 0x42, 0x6f, 0x6f, 0x2e, 0x3b, 0x49, + 0xc2, 0xc8, 0xd6, 0x29, 0xa2, 0xe5, 0x03, 0x68, 0x44, 0x2e, 0xaa, 0xc3, 0x7b, 0xcc, 0x6c, 0x48, + 0x4c, 0xe2, 0x60, 0x8f, 0x28, 0xe4, 0xeb, 0x09, 0x36, 0x5c, 0x05, 0x9b, 0x9a, 0x32, 0xc2, 0xee, + 0x48, 0xdc, 0xa4, 0x0e, 0x0e, 0x93, 0x62, 0x42, 0x3e, 0x4f, 0x81, 0x47, 0x3e, 0x4e, 0x62, 0xb0, + 0xaa, 0xa9, 0x7d, 0x81, 0xdd, 0x11, 0x3a, 0x80, 0x2d, 0xe6, 0xc5, 0xf5, 0x1c, 0xdd, 0x1c, 0x2a, + 0xea, 0x88, 0xa8, 0x8f, 0x95, 0x89, 0x37, 0xb8, 0x23, 0xbe, 0x13, 0x9d, 0x9f, 0x45, 0xd8, 0x63, + 0x98, 0x1a, 0x85, 0x1c, 0x7b, 0x83, 0x3b, 0xa8, 0x07, 0x45, 0xfa, 0x31, 0xc6, 0xfa, 0x73, 0xa2, + 0x0c, 0x2c, 0x87, 0x1d, 0x8d, 0xa5, 0x05, 0xa5, 0x29, 0x92, 0xc1, 0x4a, 0xc7, 0x37, 0x68, 0x59, + 0x1a, 0x39, 0xc8, 0xf4, 0xba, 0x92, 0x54, 0x97, 0x0b, 0x81, 0x97, 0x7b, 0x96, 0x43, 0x09, 0x35, + 0xb4, 0xc2, 0x04, 0x17, 0x38, 0xa1, 0x86, 0x56, 0x90, 0xde, 0x5b, 0xb0, 0xa1, 0xaa, 0x7c, 0xcd, + 0xba, 0xaa, 0xf8, 0x77, 0x2c, 0x57, 0x14, 0x62, 0xc9, 0x52, 0xd5, 0x23, 0x0e, 0xf0, 0x39, 0xee, + 0xa2, 0xcf, 0xe0, 0xed, 0x69, 0xb2, 0xa2, 0x86, 0xeb, 0x73, 0xab, 0x9c, 0x35, 0xbd, 0x05, 0x1b, + 0xf6, 0xe9, 0xbc, 0x21, 0x8a, 0xcd, 0x68, 0x9f, 0xce, 0x9a, 0xdd, 0x86, 0x4d, 0x7b, 0x64, 0xcf, + 0xdb, 0x5d, 0x8d, 0xda, 0x21, 0x7b, 0x64, 0xcf, 0x1a, 0x5e, 0x62, 0x17, 0x6e, 0x87, 0xa8, 0xd8, + 0x23, 0x9a, 0x78, 0x2e, 0x0a, 0x8f, 0x28, 0xd0, 0x75, 0x10, 0x54, 0x55, 0x21, 0x26, 0x3e, 0x31, + 0x88, 0x82, 0x1d, 0x62, 0x62, 0x57, 0xbc, 0x10, 0x05, 0x97, 0x54, 0x55, 0x62, 0xda, 0x2a, 0x53, + 0xa2, 0xab, 0xb0, 0x6e, 0x9d, 0x3c, 0x52, 0x39, 0x25, 0x15, 0xdb, 0x21, 0x03, 0xfd, 0x99, 0xf8, + 0x21, 0xcb, 0xef, 0x1a, 0x55, 0x30, 0x42, 0x76, 0x99, 0x18, 0x5d, 0x01, 0x41, 0x75, 0x47, 0xd8, + 0xb1, 0x59, 0x4d, 0x76, 0x6d, 0xac, 0x12, 0xf1, 0x12, 0x87, 0x72, 0x79, 0x3b, 0x10, 0xd3, 0x2d, + 0xe1, 0x3e, 0xd5, 0x07, 0x5e, 0xe0, 0xf1, 0x32, 0xdf, 0x12, 0x4c, 0xe6, 0x7b, 0xdb, 0x05, 0x81, + 0xa6, 0x22, 0x36, 0xf1, 0x2e, 0x83, 0x95, 0xec, 0x91, 0x1d, 0x9d, 0xf7, 0x03, 0x58, 0xa5, 0xc8, + 0xe9, 0xa4, 0x57, 0x78, 0x43, 0x66, 0x8f, 0x22, 0x33, 0xde, 0x84, 0x2d, 0x0a, 0x1a, 0x13, 0x0f, + 0x6b, 0xd8, 0xc3, 0x11, 0xf4, 0xc7, 0x0c, 0x4d, 0xf3, 0xde, 0xf2, 0x95, 0xb1, 0x38, 0x9d, 0xc9, + 0xc9, 0x69, 0xc8, 0xac, 0x4f, 0x78, 0x9c, 0x54, 0x16, 0x70, 0xeb, 0xb5, 0x35, 0xdd, 0xe5, 0x03, + 0x28, 0x46, 0x89, 0x8f, 0xf2, 0xc0, 0xa9, 0x2f, 0x24, 0x68, 0x17, 0x54, 0xeb, 0xd4, 0x69, 0xff, + 0xf2, 0x95, 0x24, 0x24, 0x69, 0x1f, 0xd5, 0x6c, 0xf4, 0x25, 0x45, 0x3e, 0x6e, 0xf7, 0x1b, 0x2d, + 0x49, 0x48, 0x45, 0x1b, 0xf6, 0xbf, 0x26, 0xa1, 0x14, 0xbf, 0x7b, 0xa1, 0x1f, 0xc0, 0xb9, 0xe0, + 0xa1, 0xc4, 0x25, 0x9e, 0xf2, 0x54, 0x77, 0xd8, 0x5e, 0x1c, 0x63, 0x7e, 0x2e, 0x86, 0x6c, 0xd8, + 0xf4, 0x51, 0x3d, 0xe2, 0x7d, 0xa9, 0x3b, 0x74, 0xa7, 0x8d, 0xb1, 0x87, 0x9a, 0x70, 0xc1, 0xb4, + 0x14, 0xd7, 0xc3, 0xa6, 0x86, 0x1d, 0x4d, 0x99, 0x3e, 0x51, 0x29, 0x58, 0x55, 0x89, 0xeb, 0x5a, + 0xfc, 0x0c, 0x0c, 0xbd, 0xbc, 0x6b, 0x5a, 0x3d, 0x1f, 0x3c, 0x3d, 0x1c, 0xaa, 0x3e, 0x74, 0x86, + 0xb9, 0xa9, 0x65, 0xcc, 0x7d, 0x07, 0xf2, 0x63, 0x6c, 0x2b, 0xc4, 0xf4, 0x9c, 0x53, 0xd6, 0x71, + 0xe7, 0xe4, 0xdc, 0x18, 0xdb, 0x12, 0x1d, 0xbf, 0x99, 0x8b, 0xcf, 0x3f, 0x52, 0x50, 0x8c, 0x76, + 0xdd, 0xf4, 0x12, 0xa3, 0xb2, 0x03, 0x2a, 0xc1, 0x4a, 0xd8, 0x07, 0x2f, 0xed, 0xd1, 0x2b, 0x35, + 0x7a, 0x72, 0x1d, 0x64, 0x79, 0x2f, 0x2c, 0x73, 0x4b, 0xda, 0x35, 0x50, 0x6a, 0x11, 0xde, 0x7b, + 0xe4, 0x64, 0x7f, 0x84, 0x8e, 0x20, 0xfb, 0xc8, 0x65, 0xbe, 0xb3, 0xcc, 0xf7, 0x87, 0x2f, 0xf7, + 0x7d, 0xbf, 0xc7, 0x9c, 0xe7, 0xef, 0xf7, 0x94, 0x76, 0x47, 0x6e, 0x55, 0x9b, 0xb2, 0x6f, 0x8e, + 0xce, 0x43, 0xda, 0xc0, 0xcf, 0x4f, 0xe3, 0x67, 0x1c, 0x13, 0x9d, 0x35, 0xf1, 0xe7, 0x21, 0xfd, + 0x94, 0xe0, 0xc7, 0xf1, 0x93, 0x85, 0x89, 0x5e, 0x23, 0xf5, 0xaf, 0x43, 0x86, 0xe5, 0x0b, 0x01, + 0xf8, 0x19, 0x13, 0xde, 0x42, 0x39, 0x48, 0xd7, 0x3a, 0x32, 0xa5, 0xbf, 0x00, 0x45, 0x2e, 0x55, + 0xba, 0x0d, 0xa9, 0x26, 0x09, 0xc9, 0xf2, 0x2d, 0xc8, 0xf2, 0x24, 0xd0, 0xad, 0x11, 0xa6, 0x41, + 0x78, 0xcb, 0x1f, 0xfa, 0x3e, 0x12, 0x81, 0xf6, 0xb8, 0x75, 0x28, 0xc9, 0x42, 0x32, 0xfa, 0x79, + 0x5d, 0x28, 0x46, 0x1b, 0xee, 0x37, 0xc3, 0xa9, 0xbf, 0x24, 0xa0, 0x10, 0x69, 0xa0, 0x69, 0xe7, + 0x83, 0x0d, 0xc3, 0x7a, 0xaa, 0x60, 0x43, 0xc7, 0xae, 0x4f, 0x0a, 0x60, 0xa2, 0x2a, 0x95, 0x9c, + 0xf5, 0xa3, 0xbd, 0x91, 0xe0, 0x7f, 0x9f, 0x00, 0x61, 0xb6, 0x77, 0x9d, 0x09, 0x30, 0xf1, 0xbd, + 0x06, 0xf8, 0xbb, 0x04, 0x94, 0xe2, 0x0d, 0xeb, 0x4c, 0x78, 0x17, 0xbf, 0xd7, 0xf0, 0xfe, 0x99, + 0x84, 0xd5, 0x58, 0x9b, 0x7a, 0xd6, 0xe8, 0xbe, 0x86, 0x75, 0x5d, 0x23, 0x63, 0xdb, 0xf2, 0x88, + 0xa9, 0x9e, 0x2a, 0x06, 0x79, 0x42, 0x0c, 0xb1, 0xcc, 0x0a, 0xc5, 0xf5, 0x97, 0x37, 0xc2, 0x95, + 0xc6, 0xd4, 0xae, 0x49, 0xcd, 0x0e, 0x36, 0x1a, 0x75, 0xa9, 0xd5, 0xed, 0xf4, 0xa5, 0x76, 0xed, + 0xa1, 0x72, 0xdc, 0xfe, 0x71, 0xbb, 0xf3, 0x65, 0x5b, 0x16, 0xf4, 0x19, 0xd8, 0x6b, 0xdc, 0xea, + 0x5d, 0x10, 0x66, 0x83, 0x42, 0xe7, 0x60, 0x51, 0x58, 0xc2, 0x5b, 0x68, 0x03, 0xd6, 0xda, 0x1d, + 0xa5, 0xd7, 0xa8, 0x4b, 0x8a, 0x74, 0xef, 0x9e, 0x54, 0xeb, 0xf7, 0xf8, 0xd3, 0x46, 0x88, 0xee, + 0xc7, 0x37, 0xf5, 0x6f, 0x53, 0xb0, 0xb1, 0x20, 0x12, 0x54, 0xf5, 0x2f, 0x25, 0xfc, 0x9e, 0xf4, + 0xc9, 0x59, 0xa2, 0xaf, 0xd0, 0xae, 0xa0, 0x8b, 0x1d, 0xcf, 0xbf, 0xc3, 0x5c, 0x01, 0x9a, 0x25, + 0xd3, 0xd3, 0x07, 0x3a, 0x71, 0xfc, 0x97, 0x20, 0x7e, 0x53, 0x59, 0x9b, 0xca, 0xf9, 0x63, 0xd0, + 0xc7, 0x80, 0x6c, 0xcb, 0xd5, 0x3d, 0xfd, 0x09, 0x51, 0x74, 0x33, 0x78, 0x36, 0xa2, 0x37, 0x97, + 0xb4, 0x2c, 0x04, 0x9a, 0x86, 0xe9, 0x85, 0x68, 0x93, 0x0c, 0xf1, 0x0c, 0x9a, 0x16, 0xf0, 0x94, + 0x2c, 0x04, 0x9a, 0x10, 0x7d, 0x11, 0x8a, 0x9a, 0x35, 0xa1, 0xed, 0x1c, 0xc7, 0xd1, 0xf3, 0x22, + 0x21, 0x17, 0xb8, 0x2c, 0x84, 0xf8, 0x8d, 0xfa, 0xf4, 0xbd, 0xaa, 0x28, 0x17, 0xb8, 0x8c, 0x43, + 0x2e, 0xc3, 0x1a, 0x1e, 0x0e, 0x1d, 0xea, 0x3c, 0x70, 0xc4, 0xaf, 0x1e, 0xa5, 0x50, 0xcc, 0x80, + 0xdb, 0xf7, 0x21, 0x17, 0xe4, 0x81, 0x1e, 0xc9, 0x34, 0x13, 0x8a, 0xcd, 0xef, 0xd3, 0xc9, 0xdd, + 0xbc, 0x9c, 0x33, 0x03, 0xe5, 0x45, 0x28, 0xea, 0xae, 0x32, 0x7d, 0x7e, 0x4f, 0xee, 0x24, 0x77, + 0x73, 0x72, 0x41, 0x77, 0xc3, 0xa7, 0xcb, 0xf2, 0x37, 0x49, 0x28, 0xc5, 0x7f, 0x3e, 0x40, 0x75, + 0xc8, 0x19, 0x96, 0x8a, 0x19, 0xb5, 0xf8, 0x6f, 0x57, 0xbb, 0xaf, 0xf8, 0xc5, 0xa1, 0xd2, 0xf4, + 0xf1, 0x72, 0x68, 0xb9, 0xfd, 0xb7, 0x04, 0xe4, 0x02, 0x31, 0xda, 0x82, 0xb4, 0x8d, 0xbd, 0x11, + 0x73, 0x97, 0x39, 0x4c, 0x0a, 0x09, 0x99, 0x8d, 0xa9, 0xdc, 0xb5, 0xb1, 0xc9, 0x28, 0xe0, 0xcb, + 0xe9, 0x98, 0x7e, 0x57, 0x83, 0x60, 0x8d, 0xdd, 0x6b, 0xac, 0xf1, 0x98, 0x98, 0x9e, 0x1b, 0x7c, + 0x57, 0x5f, 0x5e, 0xf3, 0xc5, 0xe8, 0x1a, 0xac, 0x7b, 0x0e, 0xd6, 0x8d, 0x18, 0x36, 0xcd, 0xb0, + 0x42, 0xa0, 0x08, 0xc1, 0x07, 0x70, 0x3e, 0xf0, 0xab, 0x11, 0x0f, 0xab, 0x23, 0xa2, 0x4d, 0x8d, + 0xb2, 0xec, 0xfd, 0xe2, 0x9c, 0x0f, 0xa8, 0xfb, 0xfa, 0xc0, 0xb6, 0xfc, 0xf7, 0x04, 0xac, 0x07, + 0x37, 0x31, 0x2d, 0x4c, 0x56, 0x0b, 0x00, 0x9b, 0xa6, 0xe5, 0x45, 0xd3, 0x35, 0x4f, 0xe5, 0x39, + 0xbb, 0x4a, 0x35, 0x34, 0x92, 0x23, 0x0e, 0xb6, 0xc7, 0x00, 0x53, 0xcd, 0xd2, 0xb4, 0x5d, 0x80, + 0x82, 0xff, 0xdb, 0x10, 0xfb, 0x81, 0x91, 0xdf, 0xdd, 0x81, 0x8b, 0xe8, 0x95, 0x0d, 0x6d, 0x42, + 0xe6, 0x84, 0x0c, 0x75, 0xd3, 0x7f, 0xf1, 0xe5, 0x83, 0xe0, 0x85, 0x25, 0x1d, 0xbe, 0xb0, 0x1c, + 0xfe, 0x0c, 0x36, 0x54, 0x6b, 0x3c, 0x1b, 0xee, 0xa1, 0x30, 0xf3, 0x7e, 0xe0, 0x7e, 0x91, 0xf8, + 0x0a, 0xa6, 0x2d, 0xe6, 0xff, 0x12, 0x89, 0x3f, 0x24, 0x53, 0x47, 0xdd, 0xc3, 0x3f, 0x26, 0xb7, + 0x8f, 0xb8, 0x69, 0x37, 0x58, 0xa9, 0x4c, 0x06, 0x06, 0x51, 0x69, 0xf4, 0xff, 0x0f, 0x00, 0x00, + 0xff, 0xff, 0x88, 0x17, 0xc1, 0xbe, 0x38, 0x1d, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go new file mode 100644 index 000000000..165b2110d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go @@ -0,0 +1,752 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + github_com_gogo_protobuf_proto "github.com/gogo/protobuf/proto" + proto "github.com/gogo/protobuf/proto" + math "math" + reflect "reflect" + sort "sort" + strconv "strconv" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +func (this *FileDescriptorSet) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.FileDescriptorSet{") + if this.File != nil { + s = append(s, "File: "+fmt.Sprintf("%#v", this.File)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 16) + s = append(s, "&descriptor.FileDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Package != nil { + s = append(s, "Package: "+valueToGoStringDescriptor(this.Package, "string")+",\n") + } + if this.Dependency != nil { + s = append(s, "Dependency: "+fmt.Sprintf("%#v", this.Dependency)+",\n") + } + if this.PublicDependency != nil { + s = append(s, "PublicDependency: "+fmt.Sprintf("%#v", this.PublicDependency)+",\n") + } + if this.WeakDependency != nil { + s = append(s, "WeakDependency: "+fmt.Sprintf("%#v", this.WeakDependency)+",\n") + } + if this.MessageType != nil { + s = append(s, "MessageType: "+fmt.Sprintf("%#v", this.MessageType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.Service != nil { + s = append(s, "Service: "+fmt.Sprintf("%#v", this.Service)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.SourceCodeInfo != nil { + s = append(s, "SourceCodeInfo: "+fmt.Sprintf("%#v", this.SourceCodeInfo)+",\n") + } + if this.Syntax != nil { + s = append(s, "Syntax: "+valueToGoStringDescriptor(this.Syntax, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.DescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Field != nil { + s = append(s, "Field: "+fmt.Sprintf("%#v", this.Field)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.NestedType != nil { + s = append(s, "NestedType: "+fmt.Sprintf("%#v", this.NestedType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.ExtensionRange != nil { + s = append(s, "ExtensionRange: "+fmt.Sprintf("%#v", this.ExtensionRange)+",\n") + } + if this.OneofDecl != nil { + s = append(s, "OneofDecl: "+fmt.Sprintf("%#v", this.OneofDecl)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ExtensionRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.DescriptorProto_ExtensionRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.DescriptorProto_ReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ExtensionRangeOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.ExtensionRangeOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.FieldDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Label != nil { + s = append(s, "Label: "+valueToGoStringDescriptor(this.Label, "FieldDescriptorProto_Label")+",\n") + } + if this.Type != nil { + s = append(s, "Type: "+valueToGoStringDescriptor(this.Type, "FieldDescriptorProto_Type")+",\n") + } + if this.TypeName != nil { + s = append(s, "TypeName: "+valueToGoStringDescriptor(this.TypeName, "string")+",\n") + } + if this.Extendee != nil { + s = append(s, "Extendee: "+valueToGoStringDescriptor(this.Extendee, "string")+",\n") + } + if this.DefaultValue != nil { + s = append(s, "DefaultValue: "+valueToGoStringDescriptor(this.DefaultValue, "string")+",\n") + } + if this.OneofIndex != nil { + s = append(s, "OneofIndex: "+valueToGoStringDescriptor(this.OneofIndex, "int32")+",\n") + } + if this.JsonName != nil { + s = append(s, "JsonName: "+valueToGoStringDescriptor(this.JsonName, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.OneofDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.EnumDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Value != nil { + s = append(s, "Value: "+fmt.Sprintf("%#v", this.Value)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto_EnumReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumDescriptorProto_EnumReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumValueDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.ServiceDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Method != nil { + s = append(s, "Method: "+fmt.Sprintf("%#v", this.Method)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 10) + s = append(s, "&descriptor.MethodDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.InputType != nil { + s = append(s, "InputType: "+valueToGoStringDescriptor(this.InputType, "string")+",\n") + } + if this.OutputType != nil { + s = append(s, "OutputType: "+valueToGoStringDescriptor(this.OutputType, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ClientStreaming != nil { + s = append(s, "ClientStreaming: "+valueToGoStringDescriptor(this.ClientStreaming, "bool")+",\n") + } + if this.ServerStreaming != nil { + s = append(s, "ServerStreaming: "+valueToGoStringDescriptor(this.ServerStreaming, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 25) + s = append(s, "&descriptor.FileOptions{") + if this.JavaPackage != nil { + s = append(s, "JavaPackage: "+valueToGoStringDescriptor(this.JavaPackage, "string")+",\n") + } + if this.JavaOuterClassname != nil { + s = append(s, "JavaOuterClassname: "+valueToGoStringDescriptor(this.JavaOuterClassname, "string")+",\n") + } + if this.JavaMultipleFiles != nil { + s = append(s, "JavaMultipleFiles: "+valueToGoStringDescriptor(this.JavaMultipleFiles, "bool")+",\n") + } + if this.JavaGenerateEqualsAndHash != nil { + s = append(s, "JavaGenerateEqualsAndHash: "+valueToGoStringDescriptor(this.JavaGenerateEqualsAndHash, "bool")+",\n") + } + if this.JavaStringCheckUtf8 != nil { + s = append(s, "JavaStringCheckUtf8: "+valueToGoStringDescriptor(this.JavaStringCheckUtf8, "bool")+",\n") + } + if this.OptimizeFor != nil { + s = append(s, "OptimizeFor: "+valueToGoStringDescriptor(this.OptimizeFor, "FileOptions_OptimizeMode")+",\n") + } + if this.GoPackage != nil { + s = append(s, "GoPackage: "+valueToGoStringDescriptor(this.GoPackage, "string")+",\n") + } + if this.CcGenericServices != nil { + s = append(s, "CcGenericServices: "+valueToGoStringDescriptor(this.CcGenericServices, "bool")+",\n") + } + if this.JavaGenericServices != nil { + s = append(s, "JavaGenericServices: "+valueToGoStringDescriptor(this.JavaGenericServices, "bool")+",\n") + } + if this.PyGenericServices != nil { + s = append(s, "PyGenericServices: "+valueToGoStringDescriptor(this.PyGenericServices, "bool")+",\n") + } + if this.PhpGenericServices != nil { + s = append(s, "PhpGenericServices: "+valueToGoStringDescriptor(this.PhpGenericServices, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.CcEnableArenas != nil { + s = append(s, "CcEnableArenas: "+valueToGoStringDescriptor(this.CcEnableArenas, "bool")+",\n") + } + if this.ObjcClassPrefix != nil { + s = append(s, "ObjcClassPrefix: "+valueToGoStringDescriptor(this.ObjcClassPrefix, "string")+",\n") + } + if this.CsharpNamespace != nil { + s = append(s, "CsharpNamespace: "+valueToGoStringDescriptor(this.CsharpNamespace, "string")+",\n") + } + if this.SwiftPrefix != nil { + s = append(s, "SwiftPrefix: "+valueToGoStringDescriptor(this.SwiftPrefix, "string")+",\n") + } + if this.PhpClassPrefix != nil { + s = append(s, "PhpClassPrefix: "+valueToGoStringDescriptor(this.PhpClassPrefix, "string")+",\n") + } + if this.PhpNamespace != nil { + s = append(s, "PhpNamespace: "+valueToGoStringDescriptor(this.PhpNamespace, "string")+",\n") + } + if this.PhpMetadataNamespace != nil { + s = append(s, "PhpMetadataNamespace: "+valueToGoStringDescriptor(this.PhpMetadataNamespace, "string")+",\n") + } + if this.RubyPackage != nil { + s = append(s, "RubyPackage: "+valueToGoStringDescriptor(this.RubyPackage, "string")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MessageOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.MessageOptions{") + if this.MessageSetWireFormat != nil { + s = append(s, "MessageSetWireFormat: "+valueToGoStringDescriptor(this.MessageSetWireFormat, "bool")+",\n") + } + if this.NoStandardDescriptorAccessor != nil { + s = append(s, "NoStandardDescriptorAccessor: "+valueToGoStringDescriptor(this.NoStandardDescriptorAccessor, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.MapEntry != nil { + s = append(s, "MapEntry: "+valueToGoStringDescriptor(this.MapEntry, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.FieldOptions{") + if this.Ctype != nil { + s = append(s, "Ctype: "+valueToGoStringDescriptor(this.Ctype, "FieldOptions_CType")+",\n") + } + if this.Packed != nil { + s = append(s, "Packed: "+valueToGoStringDescriptor(this.Packed, "bool")+",\n") + } + if this.Jstype != nil { + s = append(s, "Jstype: "+valueToGoStringDescriptor(this.Jstype, "FieldOptions_JSType")+",\n") + } + if this.Lazy != nil { + s = append(s, "Lazy: "+valueToGoStringDescriptor(this.Lazy, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.Weak != nil { + s = append(s, "Weak: "+valueToGoStringDescriptor(this.Weak, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.OneofOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumOptions{") + if this.AllowAlias != nil { + s = append(s, "AllowAlias: "+valueToGoStringDescriptor(this.AllowAlias, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumValueOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.ServiceOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.MethodOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.IdempotencyLevel != nil { + s = append(s, "IdempotencyLevel: "+valueToGoStringDescriptor(this.IdempotencyLevel, "MethodOptions_IdempotencyLevel")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.UninterpretedOption{") + if this.Name != nil { + s = append(s, "Name: "+fmt.Sprintf("%#v", this.Name)+",\n") + } + if this.IdentifierValue != nil { + s = append(s, "IdentifierValue: "+valueToGoStringDescriptor(this.IdentifierValue, "string")+",\n") + } + if this.PositiveIntValue != nil { + s = append(s, "PositiveIntValue: "+valueToGoStringDescriptor(this.PositiveIntValue, "uint64")+",\n") + } + if this.NegativeIntValue != nil { + s = append(s, "NegativeIntValue: "+valueToGoStringDescriptor(this.NegativeIntValue, "int64")+",\n") + } + if this.DoubleValue != nil { + s = append(s, "DoubleValue: "+valueToGoStringDescriptor(this.DoubleValue, "float64")+",\n") + } + if this.StringValue != nil { + s = append(s, "StringValue: "+valueToGoStringDescriptor(this.StringValue, "byte")+",\n") + } + if this.AggregateValue != nil { + s = append(s, "AggregateValue: "+valueToGoStringDescriptor(this.AggregateValue, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption_NamePart) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.UninterpretedOption_NamePart{") + if this.NamePart != nil { + s = append(s, "NamePart: "+valueToGoStringDescriptor(this.NamePart, "string")+",\n") + } + if this.IsExtension != nil { + s = append(s, "IsExtension: "+valueToGoStringDescriptor(this.IsExtension, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.SourceCodeInfo{") + if this.Location != nil { + s = append(s, "Location: "+fmt.Sprintf("%#v", this.Location)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo_Location) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.SourceCodeInfo_Location{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.Span != nil { + s = append(s, "Span: "+fmt.Sprintf("%#v", this.Span)+",\n") + } + if this.LeadingComments != nil { + s = append(s, "LeadingComments: "+valueToGoStringDescriptor(this.LeadingComments, "string")+",\n") + } + if this.TrailingComments != nil { + s = append(s, "TrailingComments: "+valueToGoStringDescriptor(this.TrailingComments, "string")+",\n") + } + if this.LeadingDetachedComments != nil { + s = append(s, "LeadingDetachedComments: "+fmt.Sprintf("%#v", this.LeadingDetachedComments)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.GeneratedCodeInfo{") + if this.Annotation != nil { + s = append(s, "Annotation: "+fmt.Sprintf("%#v", this.Annotation)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo_Annotation) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 8) + s = append(s, "&descriptor.GeneratedCodeInfo_Annotation{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.SourceFile != nil { + s = append(s, "SourceFile: "+valueToGoStringDescriptor(this.SourceFile, "string")+",\n") + } + if this.Begin != nil { + s = append(s, "Begin: "+valueToGoStringDescriptor(this.Begin, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func valueToGoStringDescriptor(v interface{}, typ string) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("func(v %v) *%v { return &v } ( %#v )", typ, typ, pv) +} +func extensionToGoStringDescriptor(m github_com_gogo_protobuf_proto.Message) string { + e := github_com_gogo_protobuf_proto.GetUnsafeExtensionsMap(m) + if e == nil { + return "nil" + } + s := "proto.NewUnsafeXXX_InternalExtensions(map[int32]proto.Extension{" + keys := make([]int, 0, len(e)) + for k := range e { + keys = append(keys, int(k)) + } + sort.Ints(keys) + ss := []string{} + for _, k := range keys { + ss = append(ss, strconv.Itoa(k)+": "+e[int32(k)].GoString()) + } + s += strings.Join(ss, ",") + "})" + return s +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go new file mode 100644 index 000000000..e0846a357 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go @@ -0,0 +1,390 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package descriptor + +import ( + "strings" +) + +func (msg *DescriptorProto) GetMapFields() (*FieldDescriptorProto, *FieldDescriptorProto) { + if !msg.GetOptions().GetMapEntry() { + return nil, nil + } + return msg.GetField()[0], msg.GetField()[1] +} + +func dotToUnderscore(r rune) rune { + if r == '.' { + return '_' + } + return r +} + +func (field *FieldDescriptorProto) WireType() (wire int) { + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE: + return 1 + case FieldDescriptorProto_TYPE_FLOAT: + return 5 + case FieldDescriptorProto_TYPE_INT64: + return 0 + case FieldDescriptorProto_TYPE_UINT64: + return 0 + case FieldDescriptorProto_TYPE_INT32: + return 0 + case FieldDescriptorProto_TYPE_UINT32: + return 0 + case FieldDescriptorProto_TYPE_FIXED64: + return 1 + case FieldDescriptorProto_TYPE_FIXED32: + return 5 + case FieldDescriptorProto_TYPE_BOOL: + return 0 + case FieldDescriptorProto_TYPE_STRING: + return 2 + case FieldDescriptorProto_TYPE_GROUP: + return 2 + case FieldDescriptorProto_TYPE_MESSAGE: + return 2 + case FieldDescriptorProto_TYPE_BYTES: + return 2 + case FieldDescriptorProto_TYPE_ENUM: + return 0 + case FieldDescriptorProto_TYPE_SFIXED32: + return 5 + case FieldDescriptorProto_TYPE_SFIXED64: + return 1 + case FieldDescriptorProto_TYPE_SINT32: + return 0 + case FieldDescriptorProto_TYPE_SINT64: + return 0 + } + panic("unreachable") +} + +func (field *FieldDescriptorProto) GetKeyUint64() (x uint64) { + packed := field.IsPacked() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey3Uint64() (x uint64) { + packed := field.IsPacked3() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey() []byte { + x := field.GetKeyUint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (field *FieldDescriptorProto) GetKey3() []byte { + x := field.GetKey3Uint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (desc *FileDescriptorSet) GetField(packageName, messageName, fieldName string) *FieldDescriptorProto { + msg := desc.GetMessage(packageName, messageName) + if msg == nil { + return nil + } + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (file *FileDescriptorProto) GetMessage(typeName string) *DescriptorProto { + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + nes := file.GetNestedMessage(msg, strings.TrimPrefix(typeName, msg.GetName()+".")) + if nes != nil { + return nes + } + } + return nil +} + +func (file *FileDescriptorProto) GetNestedMessage(msg *DescriptorProto, typeName string) *DescriptorProto { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + res := file.GetNestedMessage(nes, strings.TrimPrefix(typeName, nes.GetName()+".")) + if res != nil { + return res + } + } + return nil +} + +func (desc *FileDescriptorSet) GetMessage(packageName string, typeName string) *DescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + if msg.GetName()+"."+nes.GetName() == typeName { + return nes + } + } + } + } + return nil +} + +func (desc *FileDescriptorSet) IsProto3(packageName string, typeName string) bool { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + if msg.GetName()+"."+nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + } + } + return false +} + +func (msg *DescriptorProto) IsExtendable() bool { + return len(msg.GetExtensionRange()) > 0 +} + +func (desc *FileDescriptorSet) FindExtension(packageName string, typeName string, fieldName string) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetName() == fieldName { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindExtensionByFieldNumber(packageName string, typeName string, fieldNum int32) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetNumber() == fieldNum { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindMessage(packageName string, typeName string, fieldName string) (msgPackageName string, msgName string) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", "" + } + field := parent.GetFieldDescriptor(fieldName) + if field == nil { + var extPackageName string + extPackageName, field = desc.FindExtension(packageName, typeName, fieldName) + if field == nil { + return "", "" + } + packageName = extPackageName + } + typeNames := strings.Split(field.GetTypeName(), ".") + if len(typeNames) == 1 { + msg := desc.GetMessage(packageName, typeName) + if msg == nil { + return "", "" + } + return packageName, msg.GetName() + } + if len(typeNames) > 2 { + for i := 1; i < len(typeNames)-1; i++ { + packageName = strings.Join(typeNames[1:len(typeNames)-i], ".") + typeName = strings.Join(typeNames[len(typeNames)-i:], ".") + msg := desc.GetMessage(packageName, typeName) + if msg != nil { + typeNames := strings.Split(msg.GetName(), ".") + if len(typeNames) == 1 { + return packageName, msg.GetName() + } + return strings.Join(typeNames[1:len(typeNames)-1], "."), typeNames[len(typeNames)-1] + } + } + } + return "", "" +} + +func (msg *DescriptorProto) GetFieldDescriptor(fieldName string) *FieldDescriptorProto { + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (desc *FileDescriptorSet) GetEnum(packageName string, typeName string) *EnumDescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, enum := range file.GetEnumType() { + if enum.GetName() == typeName { + return enum + } + } + } + return nil +} + +func (f *FieldDescriptorProto) IsEnum() bool { + return *f.Type == FieldDescriptorProto_TYPE_ENUM +} + +func (f *FieldDescriptorProto) IsMessage() bool { + return *f.Type == FieldDescriptorProto_TYPE_MESSAGE +} + +func (f *FieldDescriptorProto) IsBytes() bool { + return *f.Type == FieldDescriptorProto_TYPE_BYTES +} + +func (f *FieldDescriptorProto) IsRepeated() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REPEATED +} + +func (f *FieldDescriptorProto) IsString() bool { + return *f.Type == FieldDescriptorProto_TYPE_STRING +} + +func (f *FieldDescriptorProto) IsBool() bool { + return *f.Type == FieldDescriptorProto_TYPE_BOOL +} + +func (f *FieldDescriptorProto) IsRequired() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REQUIRED +} + +func (f *FieldDescriptorProto) IsPacked() bool { + return f.Options != nil && f.GetOptions().GetPacked() +} + +func (f *FieldDescriptorProto) IsPacked3() bool { + if f.IsRepeated() && f.IsScalar() { + if f.Options == nil || f.GetOptions().Packed == nil { + return true + } + return f.Options != nil && f.GetOptions().GetPacked() + } + return false +} + +func (m *DescriptorProto) HasExtension() bool { + return len(m.ExtensionRange) > 0 +} diff --git a/vendor/github.com/hashicorp/golang-lru/LICENSE b/vendor/github.com/hashicorp/golang-lru/LICENSE new file mode 100644 index 000000000..be2cc4dfb --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/LICENSE @@ -0,0 +1,362 @@ +Mozilla Public License, version 2.0 + +1. Definitions + +1.1. "Contributor" + + means each individual or legal entity that creates, contributes to the + creation of, or owns Covered Software. + +1.2. "Contributor Version" + + means the combination of the Contributions of others (if any) used by a + Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + + means Source Code Form to which the initial Contributor has attached the + notice in Exhibit A, the Executable Form of such Source Code Form, and + Modifications of such Source Code Form, in each case including portions + thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + a. that the initial Contributor has attached the notice described in + Exhibit B to the Covered Software; or + + b. that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the terms of + a Secondary License. + +1.6. "Executable Form" + + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + + means a work that combines Covered Software with other material, in a + separate file or files, that is not Covered Software. + +1.8. "License" + + means this document. + +1.9. "Licensable" + + means having the right to grant, to the maximum extent possible, whether + at the time of the initial grant or subsequently, any and all of the + rights conveyed by this License. + +1.10. "Modifications" + + means any of the following: + + a. any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered Software; or + + b. any new file in Source Code Form that contains any Covered Software. + +1.11. "Patent Claims" of a Contributor + + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the License, + by the making, using, selling, offering for sale, having made, import, + or transfer of either its Contributions or its Contributor Version. + +1.12. "Secondary License" + + means either the GNU General Public License, Version 2.0, the GNU Lesser + General Public License, Version 2.1, the GNU Affero General Public + License, Version 3.0, or any later versions of those licenses. + +1.13. "Source Code Form" + + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that controls, is + controlled by, or is under common control with You. For purposes of this + definition, "control" means (a) the power, direct or indirect, to cause + the direction or management of such entity, whether by contract or + otherwise, or (b) ownership of more than fifty percent (50%) of the + outstanding shares or beneficial ownership of such entity. + + +2. License Grants and Conditions + +2.1. Grants + + Each Contributor hereby grants You a world-wide, royalty-free, + non-exclusive license: + + a. under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + + b. under Patent Claims of such Contributor to make, use, sell, offer for + sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + + The licenses granted in Section 2.1 with respect to any Contribution + become effective for each Contribution on the date the Contributor first + distributes such Contribution. + +2.3. Limitations on Grant Scope + + The licenses granted in this Section 2 are the only rights granted under + this License. No additional rights or licenses will be implied from the + distribution or licensing of Covered Software under this License. + Notwithstanding Section 2.1(b) above, no patent license is granted by a + Contributor: + + a. for any code that a Contributor has removed from Covered Software; or + + b. for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + + c. under Patent Claims infringed by Covered Software in the absence of + its Contributions. + + This License does not grant any rights in the trademarks, service marks, + or logos of any Contributor (except as may be necessary to comply with + the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + + No Contributor makes additional grants as a result of Your choice to + distribute the Covered Software under a subsequent version of this + License (see Section 10.2) or under the terms of a Secondary License (if + permitted under the terms of Section 3.3). + +2.5. Representation + + Each Contributor represents that the Contributor believes its + Contributions are its original creation(s) or it has sufficient rights to + grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + + This License is not intended to limit any rights You have under + applicable copyright doctrines of fair use, fair dealing, or other + equivalents. + +2.7. Conditions + + Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted in + Section 2.1. + + +3. Responsibilities + +3.1. Distribution of Source Form + + All distribution of Covered Software in Source Code Form, including any + Modifications that You create or to which You contribute, must be under + the terms of this License. You must inform recipients that the Source + Code Form of the Covered Software is governed by the terms of this + License, and how they can obtain a copy of this License. You may not + attempt to alter or restrict the recipients' rights in the Source Code + Form. + +3.2. Distribution of Executable Form + + If You distribute Covered Software in Executable Form then: + + a. such Covered Software must also be made available in Source Code Form, + as described in Section 3.1, and You must inform recipients of the + Executable Form how they can obtain a copy of such Source Code Form by + reasonable means in a timely manner, at a charge no more than the cost + of distribution to the recipient; and + + b. You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter the + recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + + You may create and distribute a Larger Work under terms of Your choice, + provided that You also comply with the requirements of this License for + the Covered Software. If the Larger Work is a combination of Covered + Software with a work governed by one or more Secondary Licenses, and the + Covered Software is not Incompatible With Secondary Licenses, this + License permits You to additionally distribute such Covered Software + under the terms of such Secondary License(s), so that the recipient of + the Larger Work may, at their option, further distribute the Covered + Software under the terms of either this License or such Secondary + License(s). + +3.4. Notices + + You may not remove or alter the substance of any license notices + (including copyright notices, patent notices, disclaimers of warranty, or + limitations of liability) contained within the Source Code Form of the + Covered Software, except that You may alter any license notices to the + extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + + You may choose to offer, and to charge a fee for, warranty, support, + indemnity or liability obligations to one or more recipients of Covered + Software. However, You may do so only on Your own behalf, and not on + behalf of any Contributor. You must make it absolutely clear that any + such warranty, support, indemnity, or liability obligation is offered by + You alone, and You hereby agree to indemnify every Contributor for any + liability incurred by such Contributor as a result of warranty, support, + indemnity or liability terms You offer. You may include additional + disclaimers of warranty and limitations of liability specific to any + jurisdiction. + +4. Inability to Comply Due to Statute or Regulation + + If it is impossible for You to comply with any of the terms of this License + with respect to some or all of the Covered Software due to statute, + judicial order, or regulation then You must: (a) comply with the terms of + this License to the maximum extent possible; and (b) describe the + limitations and the code they affect. Such description must be placed in a + text file included with all distributions of the Covered Software under + this License. Except to the extent prohibited by statute or regulation, + such description must be sufficiently detailed for a recipient of ordinary + skill to be able to understand it. + +5. Termination + +5.1. The rights granted under this License will terminate automatically if You + fail to comply with any of its terms. However, if You become compliant, + then the rights granted under this License from a particular Contributor + are reinstated (a) provisionally, unless and until such Contributor + explicitly and finally terminates Your grants, and (b) on an ongoing + basis, if such Contributor fails to notify You of the non-compliance by + some reasonable means prior to 60 days after You have come back into + compliance. Moreover, Your grants from a particular Contributor are + reinstated on an ongoing basis if such Contributor notifies You of the + non-compliance by some reasonable means, this is the first time You have + received notice of non-compliance with this License from such + Contributor, and You become compliant prior to 30 days after Your receipt + of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent + infringement claim (excluding declaratory judgment actions, + counter-claims, and cross-claims) alleging that a Contributor Version + directly or indirectly infringes any patent, then the rights granted to + You by any and all Contributors for the Covered Software under Section + 2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all end user + license agreements (excluding distributors and resellers) which have been + validly granted by You or Your distributors under this License prior to + termination shall survive termination. + +6. Disclaimer of Warranty + + Covered Software is provided under this License on an "as is" basis, + without warranty of any kind, either expressed, implied, or statutory, + including, without limitation, warranties that the Covered Software is free + of defects, merchantable, fit for a particular purpose or non-infringing. + The entire risk as to the quality and performance of the Covered Software + is with You. Should any Covered Software prove defective in any respect, + You (not any Contributor) assume the cost of any necessary servicing, + repair, or correction. This disclaimer of warranty constitutes an essential + part of this License. No use of any Covered Software is authorized under + this License except under this disclaimer. + +7. Limitation of Liability + + Under no circumstances and under no legal theory, whether tort (including + negligence), contract, or otherwise, shall any Contributor, or anyone who + distributes Covered Software as permitted above, be liable to You for any + direct, indirect, special, incidental, or consequential damages of any + character including, without limitation, damages for lost profits, loss of + goodwill, work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses, even if such party shall have been + informed of the possibility of such damages. This limitation of liability + shall not apply to liability for death or personal injury resulting from + such party's negligence to the extent applicable law prohibits such + limitation. Some jurisdictions do not allow the exclusion or limitation of + incidental or consequential damages, so this exclusion and limitation may + not apply to You. + +8. Litigation + + Any litigation relating to this License may be brought only in the courts + of a jurisdiction where the defendant maintains its principal place of + business and such litigation shall be governed by laws of that + jurisdiction, without reference to its conflict-of-law provisions. Nothing + in this Section shall prevent a party's ability to bring cross-claims or + counter-claims. + +9. Miscellaneous + + This License represents the complete agreement concerning the subject + matter hereof. If any provision of this License is held to be + unenforceable, such provision shall be reformed only to the extent + necessary to make it enforceable. Any law or regulation which provides that + the language of a contract shall be construed against the drafter shall not + be used to construe this License against a Contributor. + + +10. Versions of the License + +10.1. New Versions + + Mozilla Foundation is the license steward. Except as provided in Section + 10.3, no one other than the license steward has the right to modify or + publish new versions of this License. Each version will be given a + distinguishing version number. + +10.2. Effect of New Versions + + You may distribute the Covered Software under the terms of the version + of the License under which You originally received the Covered Software, + or under the terms of any subsequent version published by the license + steward. + +10.3. Modified Versions + + If you create software not governed by this License, and you want to + create a new license for such software, you may create and use a + modified version of this License if you rename the license and remove + any references to the name of the license steward (except to note that + such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary + Licenses If You choose to distribute Source Code Form that is + Incompatible With Secondary Licenses under the terms of this version of + the License, the notice described in Exhibit B of this License must be + attached. + +Exhibit A - Source Code Form License Notice + + This Source Code Form is subject to the + terms of the Mozilla Public License, v. + 2.0. If a copy of the MPL was not + distributed with this file, You can + obtain one at + http://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular file, +then You may include the notice in a location (such as a LICENSE file in a +relevant directory) where a recipient would be likely to look for such a +notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice + + This Source Code Form is "Incompatible + With Secondary Licenses", as defined by + the Mozilla Public License, v. 2.0. diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go new file mode 100644 index 000000000..5673773b2 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go @@ -0,0 +1,161 @@ +package simplelru + +import ( + "container/list" + "errors" +) + +// EvictCallback is used to get a callback when a cache entry is evicted +type EvictCallback func(key interface{}, value interface{}) + +// LRU implements a non-thread safe fixed size LRU cache +type LRU struct { + size int + evictList *list.List + items map[interface{}]*list.Element + onEvict EvictCallback +} + +// entry is used to hold a value in the evictList +type entry struct { + key interface{} + value interface{} +} + +// NewLRU constructs an LRU of the given size +func NewLRU(size int, onEvict EvictCallback) (*LRU, error) { + if size <= 0 { + return nil, errors.New("Must provide a positive size") + } + c := &LRU{ + size: size, + evictList: list.New(), + items: make(map[interface{}]*list.Element), + onEvict: onEvict, + } + return c, nil +} + +// Purge is used to completely clear the cache. +func (c *LRU) Purge() { + for k, v := range c.items { + if c.onEvict != nil { + c.onEvict(k, v.Value.(*entry).value) + } + delete(c.items, k) + } + c.evictList.Init() +} + +// Add adds a value to the cache. Returns true if an eviction occurred. +func (c *LRU) Add(key, value interface{}) (evicted bool) { + // Check for existing item + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + ent.Value.(*entry).value = value + return false + } + + // Add new item + ent := &entry{key, value} + entry := c.evictList.PushFront(ent) + c.items[key] = entry + + evict := c.evictList.Len() > c.size + // Verify size not exceeded + if evict { + c.removeOldest() + } + return evict +} + +// Get looks up a key's value from the cache. +func (c *LRU) Get(key interface{}) (value interface{}, ok bool) { + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + return ent.Value.(*entry).value, true + } + return +} + +// Contains checks if a key is in the cache, without updating the recent-ness +// or deleting it for being stale. +func (c *LRU) Contains(key interface{}) (ok bool) { + _, ok = c.items[key] + return ok +} + +// Peek returns the key value (or undefined if not found) without updating +// the "recently used"-ness of the key. +func (c *LRU) Peek(key interface{}) (value interface{}, ok bool) { + var ent *list.Element + if ent, ok = c.items[key]; ok { + return ent.Value.(*entry).value, true + } + return nil, ok +} + +// Remove removes the provided key from the cache, returning if the +// key was contained. +func (c *LRU) Remove(key interface{}) (present bool) { + if ent, ok := c.items[key]; ok { + c.removeElement(ent) + return true + } + return false +} + +// RemoveOldest removes the oldest item from the cache. +func (c *LRU) RemoveOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// GetOldest returns the oldest entry +func (c *LRU) GetOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// Keys returns a slice of the keys in the cache, from oldest to newest. +func (c *LRU) Keys() []interface{} { + keys := make([]interface{}, len(c.items)) + i := 0 + for ent := c.evictList.Back(); ent != nil; ent = ent.Prev() { + keys[i] = ent.Value.(*entry).key + i++ + } + return keys +} + +// Len returns the number of items in the cache. +func (c *LRU) Len() int { + return c.evictList.Len() +} + +// removeOldest removes the oldest item from the cache. +func (c *LRU) removeOldest() { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + } +} + +// removeElement is used to remove a given list element from the cache +func (c *LRU) removeElement(e *list.Element) { + c.evictList.Remove(e) + kv := e.Value.(*entry) + delete(c.items, kv.key) + if c.onEvict != nil { + c.onEvict(kv.key, kv.value) + } +} diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go new file mode 100644 index 000000000..74c707744 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go @@ -0,0 +1,36 @@ +package simplelru + +// LRUCache is the interface for simple LRU cache. +type LRUCache interface { + // Adds a value to the cache, returns true if an eviction occurred and + // updates the "recently used"-ness of the key. + Add(key, value interface{}) bool + + // Returns key's value from the cache and + // updates the "recently used"-ness of the key. #value, isFound + Get(key interface{}) (value interface{}, ok bool) + + // Check if a key exsists in cache without updating the recent-ness. + Contains(key interface{}) (ok bool) + + // Returns key's value without updating the "recently used"-ness of the key. + Peek(key interface{}) (value interface{}, ok bool) + + // Removes a key from the cache. + Remove(key interface{}) bool + + // Removes the oldest entry from cache. + RemoveOldest() (interface{}, interface{}, bool) + + // Returns the oldest entry from the cache. #key, value, isFound + GetOldest() (interface{}, interface{}, bool) + + // Returns a slice of the keys in the cache, from oldest to newest. + Keys() []interface{} + + // Returns the number of items in the cache. + Len() int + + // Clear all cache entries + Purge() +} diff --git a/vendor/github.com/prometheus/procfs/arp.go b/vendor/github.com/prometheus/procfs/arp.go new file mode 100644 index 000000000..916c9182a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/arp.go @@ -0,0 +1,85 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "fmt" + "io/ioutil" + "net" + "strings" +) + +// ARPEntry contains a single row of the columnar data represented in +// /proc/net/arp. +type ARPEntry struct { + // IP address + IPAddr net.IP + // MAC address + HWAddr net.HardwareAddr + // Name of the device + Device string +} + +// GatherARPEntries retrieves all the ARP entries, parse the relevant columns, +// and then return a slice of ARPEntry's. +func (fs FS) GatherARPEntries() ([]ARPEntry, error) { + data, err := ioutil.ReadFile(fs.proc.Path("net/arp")) + if err != nil { + return nil, fmt.Errorf("error reading arp %s: %s", fs.proc.Path("net/arp"), err) + } + + return parseARPEntries(data) +} + +func parseARPEntries(data []byte) ([]ARPEntry, error) { + lines := strings.Split(string(data), "\n") + entries := make([]ARPEntry, 0) + var err error + const ( + expectedDataWidth = 6 + expectedHeaderWidth = 9 + ) + for _, line := range lines { + columns := strings.Fields(line) + width := len(columns) + + if width == expectedHeaderWidth || width == 0 { + continue + } else if width == expectedDataWidth { + entry, err := parseARPEntry(columns) + if err != nil { + return []ARPEntry{}, fmt.Errorf("failed to parse ARP entry: %s", err) + } + entries = append(entries, entry) + } else { + return []ARPEntry{}, fmt.Errorf("%d columns were detected, but %d were expected", width, expectedDataWidth) + } + + } + + return entries, err +} + +func parseARPEntry(columns []string) (ARPEntry, error) { + ip := net.ParseIP(columns[0]) + mac := net.HardwareAddr(columns[3]) + + entry := ARPEntry{ + IPAddr: ip, + HWAddr: mac, + Device: columns[5], + } + + return entry, nil +} diff --git a/vendor/github.com/prometheus/procfs/buddyinfo.go b/vendor/github.com/prometheus/procfs/buddyinfo.go index 63d4229a4..10bd067a0 100644 --- a/vendor/github.com/prometheus/procfs/buddyinfo.go +++ b/vendor/github.com/prometheus/procfs/buddyinfo.go @@ -31,7 +31,7 @@ type BuddyInfo struct { Sizes []float64 } -// NewBuddyInfo reads the buddyinfo statistics from the specified `proc` filesystem. +// BuddyInfo reads the buddyinfo statistics from the specified `proc` filesystem. func (fs FS) BuddyInfo() ([]BuddyInfo, error) { file, err := os.Open(fs.proc.Path("buddyinfo")) if err != nil { diff --git a/vendor/github.com/prometheus/procfs/cpuinfo.go b/vendor/github.com/prometheus/procfs/cpuinfo.go new file mode 100644 index 000000000..16491d6ab --- /dev/null +++ b/vendor/github.com/prometheus/procfs/cpuinfo.go @@ -0,0 +1,166 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "bytes" + "io/ioutil" + "strconv" + "strings" +) + +// CPUInfo contains general information about a system CPU found in /proc/cpuinfo +type CPUInfo struct { + Processor uint + VendorID string + CPUFamily string + Model string + ModelName string + Stepping string + Microcode string + CPUMHz float64 + CacheSize string + PhysicalID string + Siblings uint + CoreID string + CPUCores uint + APICID string + InitialAPICID string + FPU string + FPUException string + CPUIDLevel uint + WP string + Flags []string + Bugs []string + BogoMips float64 + CLFlushSize uint + CacheAlignment uint + AddressSizes string + PowerManagement string +} + +// CPUInfo returns information about current system CPUs. +// See https://www.kernel.org/doc/Documentation/filesystems/proc.txt +func (fs FS) CPUInfo() ([]CPUInfo, error) { + data, err := ioutil.ReadFile(fs.proc.Path("cpuinfo")) + if err != nil { + return nil, err + } + return parseCPUInfo(data) +} + +// parseCPUInfo parses data from /proc/cpuinfo +func parseCPUInfo(info []byte) ([]CPUInfo, error) { + cpuinfo := []CPUInfo{} + i := -1 + scanner := bufio.NewScanner(bytes.NewReader(info)) + for scanner.Scan() { + line := scanner.Text() + if strings.TrimSpace(line) == "" { + continue + } + field := strings.SplitN(line, ": ", 2) + switch strings.TrimSpace(field[0]) { + case "processor": + cpuinfo = append(cpuinfo, CPUInfo{}) // start of the next processor + i++ + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].Processor = uint(v) + case "vendor_id": + cpuinfo[i].VendorID = field[1] + case "cpu family": + cpuinfo[i].CPUFamily = field[1] + case "model": + cpuinfo[i].Model = field[1] + case "model name": + cpuinfo[i].ModelName = field[1] + case "stepping": + cpuinfo[i].Stepping = field[1] + case "microcode": + cpuinfo[i].Microcode = field[1] + case "cpu MHz": + v, err := strconv.ParseFloat(field[1], 64) + if err != nil { + return nil, err + } + cpuinfo[i].CPUMHz = v + case "cache size": + cpuinfo[i].CacheSize = field[1] + case "physical id": + cpuinfo[i].PhysicalID = field[1] + case "siblings": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].Siblings = uint(v) + case "core id": + cpuinfo[i].CoreID = field[1] + case "cpu cores": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CPUCores = uint(v) + case "apicid": + cpuinfo[i].APICID = field[1] + case "initial apicid": + cpuinfo[i].InitialAPICID = field[1] + case "fpu": + cpuinfo[i].FPU = field[1] + case "fpu_exception": + cpuinfo[i].FPUException = field[1] + case "cpuid level": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CPUIDLevel = uint(v) + case "wp": + cpuinfo[i].WP = field[1] + case "flags": + cpuinfo[i].Flags = strings.Fields(field[1]) + case "bugs": + cpuinfo[i].Bugs = strings.Fields(field[1]) + case "bogomips": + v, err := strconv.ParseFloat(field[1], 64) + if err != nil { + return nil, err + } + cpuinfo[i].BogoMips = v + case "clflush size": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CLFlushSize = uint(v) + case "cache_alignment": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CacheAlignment = uint(v) + case "address sizes": + cpuinfo[i].AddressSizes = field[1] + case "power management": + cpuinfo[i].PowerManagement = field[1] + } + } + return cpuinfo, nil + +} diff --git a/vendor/github.com/prometheus/procfs/crypto.go b/vendor/github.com/prometheus/procfs/crypto.go new file mode 100644 index 000000000..19d4041b2 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/crypto.go @@ -0,0 +1,131 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bytes" + "fmt" + "io/ioutil" + "strconv" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// Crypto holds info parsed from /proc/crypto. +type Crypto struct { + Alignmask *uint64 + Async bool + Blocksize *uint64 + Chunksize *uint64 + Ctxsize *uint64 + Digestsize *uint64 + Driver string + Geniv string + Internal string + Ivsize *uint64 + Maxauthsize *uint64 + MaxKeysize *uint64 + MinKeysize *uint64 + Module string + Name string + Priority *int64 + Refcnt *int64 + Seedsize *uint64 + Selftest string + Type string + Walksize *uint64 +} + +// Crypto parses an crypto-file (/proc/crypto) and returns a slice of +// structs containing the relevant info. More information available here: +// https://kernel.readthedocs.io/en/sphinx-samples/crypto-API.html +func (fs FS) Crypto() ([]Crypto, error) { + data, err := ioutil.ReadFile(fs.proc.Path("crypto")) + if err != nil { + return nil, fmt.Errorf("error parsing crypto %s: %s", fs.proc.Path("crypto"), err) + } + crypto, err := parseCrypto(data) + if err != nil { + return nil, fmt.Errorf("error parsing crypto %s: %s", fs.proc.Path("crypto"), err) + } + return crypto, nil +} + +func parseCrypto(cryptoData []byte) ([]Crypto, error) { + crypto := []Crypto{} + + cryptoBlocks := bytes.Split(cryptoData, []byte("\n\n")) + + for _, block := range cryptoBlocks { + var newCryptoElem Crypto + + lines := strings.Split(string(block), "\n") + for _, line := range lines { + if strings.TrimSpace(line) == "" || line[0] == ' ' { + continue + } + fields := strings.Split(line, ":") + key := strings.TrimSpace(fields[0]) + value := strings.TrimSpace(fields[1]) + vp := util.NewValueParser(value) + + switch strings.TrimSpace(key) { + case "async": + b, err := strconv.ParseBool(value) + if err == nil { + newCryptoElem.Async = b + } + case "blocksize": + newCryptoElem.Blocksize = vp.PUInt64() + case "chunksize": + newCryptoElem.Chunksize = vp.PUInt64() + case "digestsize": + newCryptoElem.Digestsize = vp.PUInt64() + case "driver": + newCryptoElem.Driver = value + case "geniv": + newCryptoElem.Geniv = value + case "internal": + newCryptoElem.Internal = value + case "ivsize": + newCryptoElem.Ivsize = vp.PUInt64() + case "maxauthsize": + newCryptoElem.Maxauthsize = vp.PUInt64() + case "max keysize": + newCryptoElem.MaxKeysize = vp.PUInt64() + case "min keysize": + newCryptoElem.MinKeysize = vp.PUInt64() + case "module": + newCryptoElem.Module = value + case "name": + newCryptoElem.Name = value + case "priority": + newCryptoElem.Priority = vp.PInt64() + case "refcnt": + newCryptoElem.Refcnt = vp.PInt64() + case "seedsize": + newCryptoElem.Seedsize = vp.PUInt64() + case "selftest": + newCryptoElem.Selftest = value + case "type": + newCryptoElem.Type = value + case "walksize": + newCryptoElem.Walksize = vp.PUInt64() + } + } + crypto = append(crypto, newCryptoElem) + } + return crypto, nil +} diff --git a/vendor/github.com/prometheus/procfs/fixtures.ttar b/vendor/github.com/prometheus/procfs/fixtures.ttar index 6b42e7ba1..0b2905544 100644 --- a/vendor/github.com/prometheus/procfs/fixtures.ttar +++ b/vendor/github.com/prometheus/procfs/fixtures.ttar @@ -47,6 +47,48 @@ SymlinkTo: ../../symlinktargets/ghi Path: fixtures/proc/26231/fd/3 SymlinkTo: ../../symlinktargets/uvw # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/26231/fdinfo +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/0 +Lines: 6 +pos: 0 +flags: 02004000 +mnt_id: 13 +inotify wd:3 ino:1 sdev:34 mask:fce ignored_mask:0 fhandle-bytes:c fhandle-type:81 f_handle:000000000100000000000000 +inotify wd:2 ino:1300016 sdev:fd00002 mask:fce ignored_mask:0 fhandle-bytes:8 fhandle-type:1 f_handle:16003001ed3f022a +inotify wd:1 ino:2e0001 sdev:fd00000 mask:fce ignored_mask:0 fhandle-bytes:8 fhandle-type:1 f_handle:01002e00138e7c65 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/1 +Lines: 4 +pos: 0 +flags: 02004002 +mnt_id: 13 +eventfd-count: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/10 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/2 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/3 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/26231/io Lines: 7 rchar: 750339 @@ -126,6 +168,11 @@ SymlinkTo: net:[4026531993] Path: fixtures/proc/26231/root SymlinkTo: / # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/schedstat +Lines: 1 +411605849 93680043 79 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/26231/stat Lines: 1 26231 (vim) R 5392 7446 5392 34835 7446 4218880 32533 309516 26 82 1677 44 158 99 20 0 1 0 82375 56274944 1981 18446744073709551615 4194304 6294284 140736914091744 140736914087944 139965136429984 0 0 12288 1870679807 0 0 0 17 0 0 0 31 0 0 8391624 8481048 16420864 140736914093252 140736914093279 140736914093279 140736914096107 0 @@ -137,10 +184,10 @@ Lines: 53 Name: prometheus Umask: 0022 State: S (sleeping) -Tgid: 1 +Tgid: 26231 Ngid: 0 -Pid: 1 -PPid: 0 +Pid: 26231 +PPid: 1 TracerPid: 0 Uid: 0 0 0 0 Gid: 0 0 0 0 @@ -258,6 +305,18 @@ Lines: 1 com.github.uiautomatorNULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTEEOF Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26233/schedstat +Lines: 8 + ____________________________________ +< this is a malformed schedstat file > + ------------------------------------ + \ ^__^ + \ (oo)\_______ + (__)\ )\/\ + ||----w | + || || +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/proc/584 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -274,6 +333,1201 @@ Node 0, zone DMA32 759 572 791 475 194 45 12 0 Node 0, zone Normal 4381 1093 185 1530 567 102 4 0 0 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/cpuinfo +Lines: 216 +processor : 0 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 799.998 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 0 +cpu cores : 4 +apicid : 0 +initial apicid : 0 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 1 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.037 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 1 +cpu cores : 4 +apicid : 2 +initial apicid : 2 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 2 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.010 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 2 +cpu cores : 4 +apicid : 4 +initial apicid : 4 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 3 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.028 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 3 +cpu cores : 4 +apicid : 6 +initial apicid : 6 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 4 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 799.989 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 0 +cpu cores : 4 +apicid : 1 +initial apicid : 1 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 5 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.083 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 1 +cpu cores : 4 +apicid : 3 +initial apicid : 3 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 6 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.017 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 2 +cpu cores : 4 +apicid : 5 +initial apicid : 5 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 7 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.030 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 3 +cpu cores : 4 +apicid : 7 +initial apicid : 7 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/crypto +Lines: 971 +name : ccm(aes) +driver : ccm_base(ctr(aes-aesni),cbcmac(aes-aesni)) +module : ccm +priority : 300 +refcnt : 4 +selftest : passed +internal : no +type : aead +async : no +blocksize : 1 +ivsize : 16 +maxauthsize : 16 +geniv : <none> + +name : cbcmac(aes) +driver : cbcmac(aes-aesni) +module : ccm +priority : 300 +refcnt : 7 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 16 + +name : ecdh +driver : ecdh-generic +module : ecdh_generic +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : kpp + +name : ecb(arc4) +driver : ecb(arc4)-generic +module : arc4 +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 1 +max keysize : 256 +ivsize : 0 +chunksize : 1 +walksize : 1 + +name : arc4 +driver : arc4-generic +module : arc4 +priority : 0 +refcnt : 3 +selftest : passed +internal : no +type : cipher +blocksize : 1 +min keysize : 1 +max keysize : 256 + +name : crct10dif +driver : crct10dif-pclmul +module : crct10dif_pclmul +priority : 200 +refcnt : 2 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 2 + +name : crc32 +driver : crc32-pclmul +module : crc32_pclmul +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : __ghash +driver : cryptd(__ghash-pclmulqdqni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : ahash +async : yes +blocksize : 16 +digestsize : 16 + +name : ghash +driver : ghash-clmulni +module : ghash_clmulni_intel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : ahash +async : yes +blocksize : 16 +digestsize : 16 + +name : __ghash +driver : __ghash-pclmulqdqni +module : ghash_clmulni_intel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : shash +blocksize : 16 +digestsize : 16 + +name : crc32c +driver : crc32c-intel +module : crc32c_intel +priority : 200 +refcnt : 5 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : cbc(aes) +driver : cbc(aes-aesni) +module : kernel +priority : 300 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : ctr(aes) +driver : ctr(aes-aesni) +module : kernel +priority : 300 +refcnt : 5 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : pkcs1pad(rsa,sha256) +driver : pkcs1pad(rsa-generic,sha256) +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : akcipher + +name : __xts(aes) +driver : cryptd(__xts-aes-aesni) +module : kernel +priority : 451 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : xts(aes) +driver : xts-aes-aesni +module : kernel +priority : 401 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ctr(aes) +driver : cryptd(__ctr-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : ctr(aes) +driver : ctr-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __cbc(aes) +driver : cryptd(__cbc-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : cbc(aes) +driver : cbc-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ecb(aes) +driver : cryptd(__ecb-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : ecb(aes) +driver : ecb-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : __generic-gcm-aes-aesni +driver : cryptd(__driver-generic-gcm-aes-aesni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : yes +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : <none> + +name : gcm(aes) +driver : generic-gcm-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : aead +async : yes +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : <none> + +name : __generic-gcm-aes-aesni +driver : __driver-generic-gcm-aes-aesni +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : no +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : <none> + +name : __gcm-aes-aesni +driver : cryptd(__driver-gcm-aes-aesni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : yes +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : <none> + +name : rfc4106(gcm(aes)) +driver : rfc4106-gcm-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : aead +async : yes +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : <none> + +name : __gcm-aes-aesni +driver : __driver-gcm-aes-aesni +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : no +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : <none> + +name : __xts(aes) +driver : __xts-aes-aesni +module : kernel +priority : 401 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ctr(aes) +driver : __ctr-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __cbc(aes) +driver : __cbc-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ecb(aes) +driver : __ecb-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : __aes +driver : __aes-aesni +module : kernel +priority : 300 +refcnt : 1 +selftest : passed +internal : yes +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : aes +driver : aes-aesni +module : kernel +priority : 300 +refcnt : 8 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : hmac(sha1) +driver : hmac(sha1-generic) +module : kernel +priority : 100 +refcnt : 9 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 20 + +name : ghash +driver : ghash-generic +module : kernel +priority : 100 +refcnt : 3 +selftest : passed +internal : no +type : shash +blocksize : 16 +digestsize : 16 + +name : jitterentropy_rng +driver : jitterentropy_rng +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha256 +module : kernel +priority : 221 +refcnt : 2 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha512 +module : kernel +priority : 220 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha384 +module : kernel +priority : 219 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha1 +module : kernel +priority : 218 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha256 +module : kernel +priority : 217 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha512 +module : kernel +priority : 216 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha384 +module : kernel +priority : 215 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha1 +module : kernel +priority : 214 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes256 +module : kernel +priority : 213 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes192 +module : kernel +priority : 212 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes128 +module : kernel +priority : 211 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : hmac(sha256) +driver : hmac(sha256-generic) +module : kernel +priority : 100 +refcnt : 10 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 32 + +name : stdrng +driver : drbg_pr_hmac_sha256 +module : kernel +priority : 210 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha512 +module : kernel +priority : 209 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha384 +module : kernel +priority : 208 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha1 +module : kernel +priority : 207 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha256 +module : kernel +priority : 206 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha512 +module : kernel +priority : 205 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha384 +module : kernel +priority : 204 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha1 +module : kernel +priority : 203 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes256 +module : kernel +priority : 202 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes192 +module : kernel +priority : 201 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes128 +module : kernel +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : 842 +driver : 842-scomp +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : 842 +driver : 842-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : lzo-rle +driver : lzo-rle-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : lzo-rle +driver : lzo-rle-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : lzo +driver : lzo-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : lzo +driver : lzo-generic +module : kernel +priority : 0 +refcnt : 9 +selftest : passed +internal : no +type : compression + +name : crct10dif +driver : crct10dif-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 2 + +name : crc32c +driver : crc32c-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : zlib-deflate +driver : zlib-deflate-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : deflate +driver : deflate-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : deflate +driver : deflate-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : aes +driver : aes-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : sha224 +driver : sha224-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 28 + +name : sha256 +driver : sha256-generic +module : kernel +priority : 100 +refcnt : 11 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 32 + +name : sha1 +driver : sha1-generic +module : kernel +priority : 100 +refcnt : 11 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 20 + +name : md5 +driver : md5-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 16 + +name : ecb(cipher_null) +driver : ecb-cipher_null +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 0 +max keysize : 0 +ivsize : 0 +chunksize : 1 +walksize : 1 + +name : digest_null +driver : digest_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 0 + +name : compress_null +driver : compress_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : cipher_null +driver : cipher_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 1 +min keysize : 0 +max keysize : 0 + +name : rsa +driver : rsa-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : akcipher + +name : dh +driver : dh-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : kpp + +name : aes +driver : aes-asm +module : kernel +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/diskstats Lines: 49 1 0 ram0 0 0 0 0 0 0 0 0 0 0 0 @@ -423,6 +1677,12 @@ Mode: 644 Directory: fixtures/proc/net Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/net/arp +Lines: 2 +IP address HW type Flags HW address Mask Device +192.168.224.1 0x1 0x2 00:50:56:c0:00:08 * ens33 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/net/dev Lines: 6 Inter-| Receive | Transmit @@ -495,6 +1755,11 @@ proc4 2 2 10853 proc4ops 72 0 0 0 1098 2 0 0 0 0 8179 5896 0 0 0 0 5900 0 0 2 0 2 0 9609 0 2 150 1272 0 0 0 1236 0 0 0 0 3 3 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/net/softnet_stat +Lines: 1 +00015c73 00020e76 F0000769 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/net/unix Lines: 6 Num RefCount Protocol Flags Type St Inode Path @@ -567,6 +1832,16 @@ some avg10=0.10 avg60=2.00 avg300=3.85 total=15 full avg10=0.20 avg60=3.00 avg300=4.95 total=25 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/schedstat +Lines: 6 +version 15 +timestamp 15819019232 +cpu0 498494191 0 3533438552 2553969831 3853684107 2465731542 2045936778163039 343796328169361 4767485306 +domain0 00000000,00000003 212499247 210112015 1861015 1860405436 536440 369895 32599 210079416 25368550 24241256 384652 927363878 807233 6366 1647 24239609 2122447165 1886868564 121112060 2848625533 125678146 241025 1032026 1885836538 2545 12 2533 0 0 0 0 0 0 1387952561 21076581 0 +cpu1 518377256 0 4155211005 2778589869 10466382 2867629021 1904686152592476 364107263788241 5145567945 +domain0 00000000,00000003 217653037 215526982 1577949 1580427380 557469 393576 28538 215498444 28721913 27662819 371153 870843407 745912 5523 1639 27661180 2331056874 2107732788 111442342 652402556 123615235 196159 1045245 2106687543 2400 3 2397 0 0 0 0 0 0 1437804657 26220076 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/self SymlinkTo: 26231 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -619,6 +1894,493 @@ Path: fixtures/proc/symlinktargets/xyz Lines: 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/sys +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/sys/vm +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/admin_reserve_kbytes +Lines: 1 +8192 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/block_dump +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/compact_unevictable_allowed +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_background_bytes +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_background_ratio +Lines: 1 +10 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_bytes +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_expire_centisecs +Lines: 1 +3000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_ratio +Lines: 1 +20 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_writeback_centisecs +Lines: 1 +500 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirtytime_expire_seconds +Lines: 1 +43200 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/drop_caches +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/extfrag_threshold +Lines: 1 +500 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/hugetlb_shm_group +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/laptop_mode +Lines: 1 +5 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/legacy_va_layout +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/lowmem_reserve_ratio +Lines: 1 +256 256 32 0 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/max_map_count +Lines: 1 +65530 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/memory_failure_early_kill +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/memory_failure_recovery +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/min_free_kbytes +Lines: 1 +67584 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/min_slab_ratio +Lines: 1 +5 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/min_unmapped_ratio +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/mmap_min_addr +Lines: 1 +65536 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/nr_hugepages +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/nr_hugepages_mempolicy +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/nr_overcommit_hugepages +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/numa_stat +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/numa_zonelist_order +Lines: 1 +Node +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/oom_dump_tasks +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/oom_kill_allocating_task +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/overcommit_kbytes +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/overcommit_memory +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/overcommit_ratio +Lines: 1 +50 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/page-cluster +Lines: 1 +3 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/panic_on_oom +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/percpu_pagelist_fraction +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/stat_interval +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/swappiness +Lines: 1 +60 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/user_reserve_kbytes +Lines: 1 +131072 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/vfs_cache_pressure +Lines: 1 +100 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/watermark_boost_factor +Lines: 1 +15000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/watermark_scale_factor +Lines: 1 +10 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/zone_reclaim_mode +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/zoneinfo +Lines: 262 +Node 0, zone DMA + per-node stats + nr_inactive_anon 230981 + nr_active_anon 547580 + nr_inactive_file 316904 + nr_active_file 346282 + nr_unevictable 115467 + nr_slab_reclaimable 131220 + nr_slab_unreclaimable 47320 + nr_isolated_anon 0 + nr_isolated_file 0 + workingset_nodes 11627 + workingset_refault 466886 + workingset_activate 276925 + workingset_restore 84055 + workingset_nodereclaim 487 + nr_anon_pages 795576 + nr_mapped 215483 + nr_file_pages 761874 + nr_dirty 908 + nr_writeback 0 + nr_writeback_temp 0 + nr_shmem 224925 + nr_shmem_hugepages 0 + nr_shmem_pmdmapped 0 + nr_anon_transparent_hugepages 0 + nr_unstable 0 + nr_vmscan_write 12950 + nr_vmscan_immediate_reclaim 3033 + nr_dirtied 8007423 + nr_written 7752121 + nr_kernel_misc_reclaimable 0 + pages free 3952 + min 33 + low 41 + high 49 + spanned 4095 + present 3975 + managed 3956 + protection: (0, 2877, 7826, 7826, 7826) + nr_free_pages 3952 + nr_zone_inactive_anon 0 + nr_zone_active_anon 0 + nr_zone_inactive_file 0 + nr_zone_active_file 0 + nr_zone_unevictable 0 + nr_zone_write_pending 0 + nr_mlock 0 + nr_page_table_pages 0 + nr_kernel_stack 0 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 1 + numa_miss 0 + numa_foreign 0 + numa_interleave 0 + numa_local 1 + numa_other 0 + pagesets + cpu: 0 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 1 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 2 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 3 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 4 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 5 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 6 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 7 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + node_unreclaimable: 0 + start_pfn: 1 +Node 0, zone DMA32 + pages free 204252 + min 19510 + low 21059 + high 22608 + spanned 1044480 + present 759231 + managed 742806 + protection: (0, 0, 4949, 4949, 4949) + nr_free_pages 204252 + nr_zone_inactive_anon 118558 + nr_zone_active_anon 106598 + nr_zone_inactive_file 75475 + nr_zone_active_file 70293 + nr_zone_unevictable 66195 + nr_zone_write_pending 64 + nr_mlock 4 + nr_page_table_pages 1756 + nr_kernel_stack 2208 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 113952967 + numa_miss 0 + numa_foreign 0 + numa_interleave 0 + numa_local 113952967 + numa_other 0 + pagesets + cpu: 0 + count: 345 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 1 + count: 356 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 2 + count: 325 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 3 + count: 346 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 4 + count: 321 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 5 + count: 316 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 6 + count: 373 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 7 + count: 339 + high: 378 + batch: 63 + vm stats threshold: 48 + node_unreclaimable: 0 + start_pfn: 4096 +Node 0, zone Normal + pages free 18553 + min 11176 + low 13842 + high 16508 + spanned 1308160 + present 1308160 + managed 1268711 + protection: (0, 0, 0, 0, 0) + nr_free_pages 18553 + nr_zone_inactive_anon 112423 + nr_zone_active_anon 440982 + nr_zone_inactive_file 241429 + nr_zone_active_file 275989 + nr_zone_unevictable 49272 + nr_zone_write_pending 844 + nr_mlock 154 + nr_page_table_pages 9750 + nr_kernel_stack 15136 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 162718019 + numa_miss 0 + numa_foreign 0 + numa_interleave 26812 + numa_local 162718019 + numa_other 0 + pagesets + cpu: 0 + count: 316 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 1 + count: 366 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 2 + count: 60 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 3 + count: 256 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 4 + count: 253 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 5 + count: 159 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 6 + count: 311 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 7 + count: 264 + high: 378 + batch: 63 + vm stats threshold: 56 + node_unreclaimable: 0 + start_pfn: 1048576 +Node 0, zone Movable + pages free 0 + min 0 + low 0 + high 0 + spanned 0 + present 0 + managed 0 + protection: (0, 0, 0, 0, 0) +Node 0, zone Device + pages free 0 + min 0 + low 0 + high 0 + spanned 0 + present 0 + managed 0 + protection: (0, 0, 0, 0, 0) +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -921,6 +2683,9 @@ Lines: 1 0x20 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/net/eth0/device +SymlinkTo: ../../../devices/pci0000:00/0000:00:1f.6/ +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/sys/class/net/eth0/dormant Lines: 1 1 @@ -1005,114 +2770,391 @@ Mode: 644 Directory: fixtures/sys/class/power_supply Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply/AC +Path: fixtures/sys/class/power_supply/AC +SymlinkTo: ../../devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/power_supply/BAT0 +SymlinkTo: ../../devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/cooling_device0 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/online +Path: fixtures/sys/class/thermal/cooling_device0/cur_state +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/max_state +Lines: 1 +50 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/type +Lines: 1 +Processor +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/cooling_device1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/cur_state +Lines: 1 +-1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/max_state +Lines: 1 +27 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/type +Lines: 1 +intel_powerclamp +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/thermal_zone0 +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/policy +Lines: 1 +step_wise +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/temp +Lines: 1 +49925 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/type +Lines: 1 +bcm2835_thermal +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/thermal_zone1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/mode +Lines: 1 +enabled +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/passive +Lines: 1 +0 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/policy +Lines: 1 +step_wise +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/temp +Lines: 1 +44000 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/type +Lines: 1 +acpitz +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/device +SymlinkTo: ../../../ACPI0003:00 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/online +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/async +Lines: 1 +disabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/autosuspend_delay_ms +Lines: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/control +Lines: 1 +auto +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_active_kids +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_active_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_enabled +Lines: 1 +disabled +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_status +Lines: 1 +unsupported +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_suspended_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_usage +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup +Lines: 1 +enabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_abort_count +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_active +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_active_count +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_count +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_expire_count +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_last_time_ms +Lines: 1 +10598 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_max_time_ms +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_prevent_sleep_time_ms Lines: 1 0 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_total_time_ms +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/subsystem +SymlinkTo: ../../../../../../../../../class/power_supply +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/type Lines: 1 Mains Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/uevent +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/uevent Lines: 2 POWER_SUPPLY_NAME=AC POWER_SUPPLY_ONLINE=0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply/BAT0 +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/alarm +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/alarm Lines: 1 -2503000 +2369000 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/capacity +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/capacity Lines: 1 98 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/capacity_level +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/capacity_level Lines: 1 Normal Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/charge_start_threshold +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/charge_start_threshold Lines: 1 95 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/charge_stop_threshold +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/charge_stop_threshold Lines: 1 100 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/cycle_count +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/cycle_count Lines: 1 0 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_full +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/device +SymlinkTo: ../../../PNP0C0A:00 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_full Lines: 1 50060000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_full_design +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_full_design Lines: 1 47520000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_now +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_now Lines: 1 49450000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/manufacturer +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/manufacturer Lines: 1 LGC Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/model_name +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/model_name Lines: 1 LNV-45N1 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/power_now +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/async +Lines: 1 +disabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/autosuspend_delay_ms +Lines: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/control +Lines: 1 +auto +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_active_kids +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_active_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_enabled +Lines: 1 +disabled +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_status +Lines: 1 +unsupported +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_suspended_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_usage +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power_now Lines: 1 4830000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/present +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/present Lines: 1 1 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/serial_number +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/serial_number Lines: 1 38109 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/status +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/status Lines: 1 Discharging Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/technology +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/subsystem +SymlinkTo: ../../../../../../../../../class/power_supply +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/technology Lines: 1 Li-ion Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/type Lines: 1 Battery Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/uevent +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/uevent Lines: 16 POWER_SUPPLY_NAME=BAT0 POWER_SUPPLY_STATUS=Discharging @@ -1120,80 +3162,28 @@ POWER_SUPPLY_PRESENT=1 POWER_SUPPLY_TECHNOLOGY=Li-ion POWER_SUPPLY_CYCLE_COUNT=0 POWER_SUPPLY_VOLTAGE_MIN_DESIGN=10800000 -POWER_SUPPLY_VOLTAGE_NOW=12229000 -POWER_SUPPLY_POWER_NOW=4830000 +POWER_SUPPLY_VOLTAGE_NOW=11750000 +POWER_SUPPLY_POWER_NOW=5064000 POWER_SUPPLY_ENERGY_FULL_DESIGN=47520000 -POWER_SUPPLY_ENERGY_FULL=50060000 -POWER_SUPPLY_ENERGY_NOW=49450000 -POWER_SUPPLY_CAPACITY=98 +POWER_SUPPLY_ENERGY_FULL=47390000 +POWER_SUPPLY_ENERGY_NOW=40730000 +POWER_SUPPLY_CAPACITY=85 POWER_SUPPLY_CAPACITY_LEVEL=Normal POWER_SUPPLY_MODEL_NAME=LNV-45N1 POWER_SUPPLY_MANUFACTURER=LGC POWER_SUPPLY_SERIAL_NUMBER=38109 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/voltage_min_design +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/voltage_min_design Lines: 1 10800000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/voltage_now +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/voltage_now Lines: 1 12229000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal/thermal_zone0 -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/policy -Lines: 1 -step_wise -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/temp -Lines: 1 -49925 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/type -Lines: 1 -bcm2835_thermal -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal/thermal_zone1 -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/mode -Lines: 1 -enabled -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/passive -Lines: 1 -0 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/policy -Lines: 1 -step_wise -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/temp -Lines: 1 -44000 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/type -Lines: 1 -acpitz -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/devices -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/pci0000:00 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1443,6 +3433,131 @@ Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/pci0000:00/0000:00:1f.6 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/ari_enabled +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/broken_parity_status +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/class +Lines: 1 +0x020000 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/consistent_dma_mask_bits +Lines: 1 +64 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/d3cold_allowed +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/device +Lines: 1 +0x15d7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/dma_mask_bits +Lines: 1 +64 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/driver_override +Lines: 1 +(null) +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/enable +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/irq +Lines: 1 +140 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/local_cpulist +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/local_cpus +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/modalias +Lines: 1 +pci:v00008086d000015D7sv000017AAsd0000225Abc02sc00i00 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/msi_bus +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/numa_node +Lines: 1 +-1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/resource +Lines: 13 +0x00000000ec200000 0x00000000ec21ffff 0x0000000000040200 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/revision +Lines: 1 +0x21 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/subsystem_device +Lines: 1 +0x225a +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/subsystem_vendor +Lines: 1 +0x17aa +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/uevent +Lines: 6 +DRIVER=e1000e +PCI_CLASS=20000 +PCI_ID=8086:15D7 +PCI_SUBSYS_ID=17AA:225A +PCI_SLOT_NAME=0000:00:1f.6 +MODALIAS=pci:v00008086d000015D7sv000017AAsd0000225Abc02sc00i00 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/vendor +Lines: 1 +0x8086 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/rbd Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1500,6 +3615,52 @@ Mode: 775 Path: fixtures/sys/devices/system/cpu/cpu0/cpufreq SymlinkTo: ../cpufreq/policy0 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle/core_throttle_count +Lines: 1 +10084 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle/package_throttle_count +Lines: 1 +34818 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu0/topology +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_siblings +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_siblings_list +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/physical_package_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/thread_siblings +Lines: 1 +11 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/thread_siblings_list +Lines: 1 +0,4 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/system/cpu/cpu1 Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1561,6 +3722,52 @@ Lines: 1 <unsupported> Mode: 664 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle/core_throttle_count +Lines: 1 +523 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle/package_throttle_count +Lines: 1 +34818 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu1/topology +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_id +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_siblings +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_siblings_list +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/physical_package_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/thread_siblings +Lines: 1 +22 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/thread_siblings_list +Lines: 1 +1,5 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/system/cpu/cpufreq Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - diff --git a/vendor/github.com/prometheus/procfs/internal/util/parse.go b/vendor/github.com/prometheus/procfs/internal/util/parse.go new file mode 100644 index 000000000..755591d9a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/parse.go @@ -0,0 +1,88 @@ +// Copyright 2018 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package util + +import ( + "io/ioutil" + "strconv" + "strings" +) + +// ParseUint32s parses a slice of strings into a slice of uint32s. +func ParseUint32s(ss []string) ([]uint32, error) { + us := make([]uint32, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseUint(s, 10, 32) + if err != nil { + return nil, err + } + + us = append(us, uint32(u)) + } + + return us, nil +} + +// ParseUint64s parses a slice of strings into a slice of uint64s. +func ParseUint64s(ss []string) ([]uint64, error) { + us := make([]uint64, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseUint(s, 10, 64) + if err != nil { + return nil, err + } + + us = append(us, u) + } + + return us, nil +} + +// ParsePInt64s parses a slice of strings into a slice of int64 pointers. +func ParsePInt64s(ss []string) ([]*int64, error) { + us := make([]*int64, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseInt(s, 10, 64) + if err != nil { + return nil, err + } + + us = append(us, &u) + } + + return us, nil +} + +// ReadUintFromFile reads a file and attempts to parse a uint64 from it. +func ReadUintFromFile(path string) (uint64, error) { + data, err := ioutil.ReadFile(path) + if err != nil { + return 0, err + } + return strconv.ParseUint(strings.TrimSpace(string(data)), 10, 64) +} + +// ParseBool parses a string into a boolean pointer. +func ParseBool(b string) *bool { + var truth bool + switch b { + case "enabled": + truth = true + case "disabled": + truth = false + default: + return nil + } + return &truth +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go new file mode 100644 index 000000000..68b37c4b3 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go @@ -0,0 +1,45 @@ +// Copyright 2018 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build linux,!appengine + +package util + +import ( + "bytes" + "os" + "syscall" +) + +// SysReadFile is a simplified ioutil.ReadFile that invokes syscall.Read directly. +// https://github.com/prometheus/node_exporter/pull/728/files +func SysReadFile(file string) (string, error) { + f, err := os.Open(file) + if err != nil { + return "", err + } + defer f.Close() + + // On some machines, hwmon drivers are broken and return EAGAIN. This causes + // Go's ioutil.ReadFile implementation to poll forever. + // + // Since we either want to read data or bail immediately, do the simplest + // possible read using syscall directly. + b := make([]byte, 128) + n, err := syscall.Read(int(f.Fd()), b) + if err != nil { + return "", err + } + + return string(bytes.TrimSpace(b[:n])), nil +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go new file mode 100644 index 000000000..bd55b4537 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go @@ -0,0 +1,26 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build linux,appengine !linux + +package util + +import ( + "fmt" +) + +// SysReadFile is here implemented as a noop for builds that do not support +// the read syscall. For example Windows, or Linux on Google App Engine. +func SysReadFile(file string) (string, error) { + return "", fmt.Errorf("not supported on this platform") +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/valueparser.go b/vendor/github.com/prometheus/procfs/internal/util/valueparser.go new file mode 100644 index 000000000..ac93cb42d --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/valueparser.go @@ -0,0 +1,77 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package util + +import ( + "strconv" +) + +// TODO(mdlayher): util packages are an anti-pattern and this should be moved +// somewhere else that is more focused in the future. + +// A ValueParser enables parsing a single string into a variety of data types +// in a concise and safe way. The Err method must be invoked after invoking +// any other methods to ensure a value was successfully parsed. +type ValueParser struct { + v string + err error +} + +// NewValueParser creates a ValueParser using the input string. +func NewValueParser(v string) *ValueParser { + return &ValueParser{v: v} +} + +// PInt64 interprets the underlying value as an int64 and returns a pointer to +// that value. +func (vp *ValueParser) PInt64() *int64 { + if vp.err != nil { + return nil + } + + // A base value of zero makes ParseInt infer the correct base using the + // string's prefix, if any. + const base = 0 + v, err := strconv.ParseInt(vp.v, base, 64) + if err != nil { + vp.err = err + return nil + } + + return &v +} + +// PUInt64 interprets the underlying value as an uint64 and returns a pointer to +// that value. +func (vp *ValueParser) PUInt64() *uint64 { + if vp.err != nil { + return nil + } + + // A base value of zero makes ParseInt infer the correct base using the + // string's prefix, if any. + const base = 0 + v, err := strconv.ParseUint(vp.v, base, 64) + if err != nil { + vp.err = err + return nil + } + + return &v +} + +// Err returns the last error, if any, encountered by the ValueParser. +func (vp *ValueParser) Err() error { + return vp.err +} diff --git a/vendor/github.com/prometheus/procfs/net_softnet.go b/vendor/github.com/prometheus/procfs/net_softnet.go new file mode 100644 index 000000000..6fcad20af --- /dev/null +++ b/vendor/github.com/prometheus/procfs/net_softnet.go @@ -0,0 +1,91 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "fmt" + "io/ioutil" + "strconv" + "strings" +) + +// For the proc file format details, +// see https://elixir.bootlin.com/linux/v4.17/source/net/core/net-procfs.c#L162 +// and https://elixir.bootlin.com/linux/v4.17/source/include/linux/netdevice.h#L2810. + +// SoftnetEntry contains a single row of data from /proc/net/softnet_stat +type SoftnetEntry struct { + // Number of processed packets + Processed uint + // Number of dropped packets + Dropped uint + // Number of times processing packets ran out of quota + TimeSqueezed uint +} + +// GatherSoftnetStats reads /proc/net/softnet_stat, parse the relevant columns, +// and then return a slice of SoftnetEntry's. +func (fs FS) GatherSoftnetStats() ([]SoftnetEntry, error) { + data, err := ioutil.ReadFile(fs.proc.Path("net/softnet_stat")) + if err != nil { + return nil, fmt.Errorf("error reading softnet %s: %s", fs.proc.Path("net/softnet_stat"), err) + } + + return parseSoftnetEntries(data) +} + +func parseSoftnetEntries(data []byte) ([]SoftnetEntry, error) { + lines := strings.Split(string(data), "\n") + entries := make([]SoftnetEntry, 0) + var err error + const ( + expectedColumns = 11 + ) + for _, line := range lines { + columns := strings.Fields(line) + width := len(columns) + if width == 0 { + continue + } + if width != expectedColumns { + return []SoftnetEntry{}, fmt.Errorf("%d columns were detected, but %d were expected", width, expectedColumns) + } + var entry SoftnetEntry + if entry, err = parseSoftnetEntry(columns); err != nil { + return []SoftnetEntry{}, err + } + entries = append(entries, entry) + } + + return entries, nil +} + +func parseSoftnetEntry(columns []string) (SoftnetEntry, error) { + var err error + var processed, dropped, timeSqueezed uint64 + if processed, err = strconv.ParseUint(columns[0], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 0: %s", err) + } + if dropped, err = strconv.ParseUint(columns[1], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 1: %s", err) + } + if timeSqueezed, err = strconv.ParseUint(columns[2], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 2: %s", err) + } + return SoftnetEntry{ + Processed: uint(processed), + Dropped: uint(dropped), + TimeSqueezed: uint(timeSqueezed), + }, nil +} diff --git a/vendor/github.com/prometheus/procfs/proc.go b/vendor/github.com/prometheus/procfs/proc.go index 41c148d06..b7c79cf77 100644 --- a/vendor/github.com/prometheus/procfs/proc.go +++ b/vendor/github.com/prometheus/procfs/proc.go @@ -279,3 +279,33 @@ func (p Proc) fileDescriptors() ([]string, error) { func (p Proc) path(pa ...string) string { return p.fs.Path(append([]string{strconv.Itoa(p.PID)}, pa...)...) } + +// FileDescriptorsInfo retrieves information about all file descriptors of +// the process. +func (p Proc) FileDescriptorsInfo() (ProcFDInfos, error) { + names, err := p.fileDescriptors() + if err != nil { + return nil, err + } + + var fdinfos ProcFDInfos + + for _, n := range names { + fdinfo, err := p.FDInfo(n) + if err != nil { + continue + } + fdinfos = append(fdinfos, *fdinfo) + } + + return fdinfos, nil +} + +// Schedstat returns task scheduling information for the process. +func (p Proc) Schedstat() (ProcSchedstat, error) { + contents, err := ioutil.ReadFile(p.path("schedstat")) + if err != nil { + return ProcSchedstat{}, err + } + return parseProcSchedstat(string(contents)) +} diff --git a/vendor/github.com/prometheus/procfs/proc_fdinfo.go b/vendor/github.com/prometheus/procfs/proc_fdinfo.go new file mode 100644 index 000000000..83b67d1bd --- /dev/null +++ b/vendor/github.com/prometheus/procfs/proc_fdinfo.go @@ -0,0 +1,132 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "fmt" + "io/ioutil" + "os" + "regexp" + "strings" +) + +// Regexp variables +var ( + rPos = regexp.MustCompile(`^pos:\s+(\d+)$`) + rFlags = regexp.MustCompile(`^flags:\s+(\d+)$`) + rMntID = regexp.MustCompile(`^mnt_id:\s+(\d+)$`) + rInotify = regexp.MustCompile(`^inotify`) +) + +// ProcFDInfo contains represents file descriptor information. +type ProcFDInfo struct { + // File descriptor + FD string + // File offset + Pos string + // File access mode and status flags + Flags string + // Mount point ID + MntID string + // List of inotify lines (structed) in the fdinfo file (kernel 3.8+ only) + InotifyInfos []InotifyInfo +} + +// FDInfo constructor. On kernels older than 3.8, InotifyInfos will always be empty. +func (p Proc) FDInfo(fd string) (*ProcFDInfo, error) { + f, err := os.Open(p.path("fdinfo", fd)) + if err != nil { + return nil, err + } + defer f.Close() + + fdinfo, err := ioutil.ReadAll(f) + if err != nil { + return nil, fmt.Errorf("could not read %s: %s", f.Name(), err) + } + + var text, pos, flags, mntid string + var inotify []InotifyInfo + + scanner := bufio.NewScanner(strings.NewReader(string(fdinfo))) + for scanner.Scan() { + text = scanner.Text() + if rPos.MatchString(text) { + pos = rPos.FindStringSubmatch(text)[1] + } else if rFlags.MatchString(text) { + flags = rFlags.FindStringSubmatch(text)[1] + } else if rMntID.MatchString(text) { + mntid = rMntID.FindStringSubmatch(text)[1] + } else if rInotify.MatchString(text) { + newInotify, err := parseInotifyInfo(text) + if err != nil { + return nil, err + } + inotify = append(inotify, *newInotify) + } + } + + i := &ProcFDInfo{ + FD: fd, + Pos: pos, + Flags: flags, + MntID: mntid, + InotifyInfos: inotify, + } + + return i, nil +} + +// InotifyInfo represents a single inotify line in the fdinfo file. +type InotifyInfo struct { + // Watch descriptor number + WD string + // Inode number + Ino string + // Device ID + Sdev string + // Mask of events being monitored + Mask string +} + +// InotifyInfo constructor. Only available on kernel 3.8+. +func parseInotifyInfo(line string) (*InotifyInfo, error) { + r := regexp.MustCompile(`^inotify\s+wd:([0-9a-f]+)\s+ino:([0-9a-f]+)\s+sdev:([0-9a-f]+)\s+mask:([0-9a-f]+)`) + m := r.FindStringSubmatch(line) + i := &InotifyInfo{ + WD: m[1], + Ino: m[2], + Sdev: m[3], + Mask: m[4], + } + return i, nil +} + +// ProcFDInfos represents a list of ProcFDInfo structs. +type ProcFDInfos []ProcFDInfo + +func (p ProcFDInfos) Len() int { return len(p) } +func (p ProcFDInfos) Swap(i, j int) { p[i], p[j] = p[j], p[i] } +func (p ProcFDInfos) Less(i, j int) bool { return p[i].FD < p[j].FD } + +// InotifyWatchLen returns the total number of inotify watches +func (p ProcFDInfos) InotifyWatchLen() (int, error) { + length := 0 + for _, f := range p { + length += len(f.InotifyInfos) + } + + return length, nil +} diff --git a/vendor/github.com/prometheus/procfs/proc_status.go b/vendor/github.com/prometheus/procfs/proc_status.go index 6b4b61f71..ad290fae7 100644 --- a/vendor/github.com/prometheus/procfs/proc_status.go +++ b/vendor/github.com/prometheus/procfs/proc_status.go @@ -21,7 +21,7 @@ import ( "strings" ) -// ProcStat provides status information about the process, +// ProcStatus provides status information about the process, // read from /proc/[pid]/stat. type ProcStatus struct { // The process ID. @@ -29,6 +29,9 @@ type ProcStatus struct { // The process name. Name string + // Thread group ID. + TGID int + // Peak virtual memory size. VmPeak uint64 // Virtual memory size. @@ -113,6 +116,8 @@ func (p Proc) NewStatus() (ProcStatus, error) { func (s *ProcStatus) fillStatus(k string, vString string, vUint uint64, vUintBytes uint64) { switch k { + case "Tgid": + s.TGID = int(vUint) case "Name": s.Name = vString case "VmPeak": diff --git a/vendor/github.com/prometheus/procfs/schedstat.go b/vendor/github.com/prometheus/procfs/schedstat.go new file mode 100644 index 000000000..a4c4089ac --- /dev/null +++ b/vendor/github.com/prometheus/procfs/schedstat.go @@ -0,0 +1,118 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "errors" + "os" + "regexp" + "strconv" +) + +var ( + cpuLineRE = regexp.MustCompile(`cpu(\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+)`) + procLineRE = regexp.MustCompile(`(\d+) (\d+) (\d+)`) +) + +// Schedstat contains scheduler statistics from /proc/schedstat +// +// See +// https://www.kernel.org/doc/Documentation/scheduler/sched-stats.txt +// for a detailed description of what these numbers mean. +// +// Note the current kernel documentation claims some of the time units are in +// jiffies when they are actually in nanoseconds since 2.6.23 with the +// introduction of CFS. A fix to the documentation is pending. See +// https://lore.kernel.org/patchwork/project/lkml/list/?series=403473 +type Schedstat struct { + CPUs []*SchedstatCPU +} + +// SchedstatCPU contains the values from one "cpu<N>" line +type SchedstatCPU struct { + CPUNum string + + RunningNanoseconds uint64 + WaitingNanoseconds uint64 + RunTimeslices uint64 +} + +// ProcSchedstat contains the values from /proc/<pid>/schedstat +type ProcSchedstat struct { + RunningNanoseconds uint64 + WaitingNanoseconds uint64 + RunTimeslices uint64 +} + +// Schedstat reads data from /proc/schedstat +func (fs FS) Schedstat() (*Schedstat, error) { + file, err := os.Open(fs.proc.Path("schedstat")) + if err != nil { + return nil, err + } + defer file.Close() + + stats := &Schedstat{} + scanner := bufio.NewScanner(file) + + for scanner.Scan() { + match := cpuLineRE.FindStringSubmatch(scanner.Text()) + if match != nil { + cpu := &SchedstatCPU{} + cpu.CPUNum = match[1] + + cpu.RunningNanoseconds, err = strconv.ParseUint(match[8], 10, 64) + if err != nil { + continue + } + + cpu.WaitingNanoseconds, err = strconv.ParseUint(match[9], 10, 64) + if err != nil { + continue + } + + cpu.RunTimeslices, err = strconv.ParseUint(match[10], 10, 64) + if err != nil { + continue + } + + stats.CPUs = append(stats.CPUs, cpu) + } + } + + return stats, nil +} + +func parseProcSchedstat(contents string) (stats ProcSchedstat, err error) { + match := procLineRE.FindStringSubmatch(contents) + + if match != nil { + stats.RunningNanoseconds, err = strconv.ParseUint(match[1], 10, 64) + if err != nil { + return + } + + stats.WaitingNanoseconds, err = strconv.ParseUint(match[2], 10, 64) + if err != nil { + return + } + + stats.RunTimeslices, err = strconv.ParseUint(match[3], 10, 64) + return + } + + err = errors.New("could not parse schedstat") + return +} diff --git a/vendor/github.com/prometheus/procfs/vm.go b/vendor/github.com/prometheus/procfs/vm.go new file mode 100644 index 000000000..cb1389141 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/vm.go @@ -0,0 +1,210 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !windows + +package procfs + +import ( + "fmt" + "io/ioutil" + "os" + "path/filepath" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// The VM interface is described at +// https://www.kernel.org/doc/Documentation/sysctl/vm.txt +// Each setting is exposed as a single file. +// Each file contains one line with a single numerical value, except lowmem_reserve_ratio which holds an array +// and numa_zonelist_order (deprecated) which is a string +type VM struct { + AdminReserveKbytes *int64 // /proc/sys/vm/admin_reserve_kbytes + BlockDump *int64 // /proc/sys/vm/block_dump + CompactUnevictableAllowed *int64 // /proc/sys/vm/compact_unevictable_allowed + DirtyBackgroundBytes *int64 // /proc/sys/vm/dirty_background_bytes + DirtyBackgroundRatio *int64 // /proc/sys/vm/dirty_background_ratio + DirtyBytes *int64 // /proc/sys/vm/dirty_bytes + DirtyExpireCentisecs *int64 // /proc/sys/vm/dirty_expire_centisecs + DirtyRatio *int64 // /proc/sys/vm/dirty_ratio + DirtytimeExpireSeconds *int64 // /proc/sys/vm/dirtytime_expire_seconds + DirtyWritebackCentisecs *int64 // /proc/sys/vm/dirty_writeback_centisecs + DropCaches *int64 // /proc/sys/vm/drop_caches + ExtfragThreshold *int64 // /proc/sys/vm/extfrag_threshold + HugetlbShmGroup *int64 // /proc/sys/vm/hugetlb_shm_group + LaptopMode *int64 // /proc/sys/vm/laptop_mode + LegacyVaLayout *int64 // /proc/sys/vm/legacy_va_layout + LowmemReserveRatio []*int64 // /proc/sys/vm/lowmem_reserve_ratio + MaxMapCount *int64 // /proc/sys/vm/max_map_count + MemoryFailureEarlyKill *int64 // /proc/sys/vm/memory_failure_early_kill + MemoryFailureRecovery *int64 // /proc/sys/vm/memory_failure_recovery + MinFreeKbytes *int64 // /proc/sys/vm/min_free_kbytes + MinSlabRatio *int64 // /proc/sys/vm/min_slab_ratio + MinUnmappedRatio *int64 // /proc/sys/vm/min_unmapped_ratio + MmapMinAddr *int64 // /proc/sys/vm/mmap_min_addr + NrHugepages *int64 // /proc/sys/vm/nr_hugepages + NrHugepagesMempolicy *int64 // /proc/sys/vm/nr_hugepages_mempolicy + NrOvercommitHugepages *int64 // /proc/sys/vm/nr_overcommit_hugepages + NumaStat *int64 // /proc/sys/vm/numa_stat + NumaZonelistOrder string // /proc/sys/vm/numa_zonelist_order + OomDumpTasks *int64 // /proc/sys/vm/oom_dump_tasks + OomKillAllocatingTask *int64 // /proc/sys/vm/oom_kill_allocating_task + OvercommitKbytes *int64 // /proc/sys/vm/overcommit_kbytes + OvercommitMemory *int64 // /proc/sys/vm/overcommit_memory + OvercommitRatio *int64 // /proc/sys/vm/overcommit_ratio + PageCluster *int64 // /proc/sys/vm/page-cluster + PanicOnOom *int64 // /proc/sys/vm/panic_on_oom + PercpuPagelistFraction *int64 // /proc/sys/vm/percpu_pagelist_fraction + StatInterval *int64 // /proc/sys/vm/stat_interval + Swappiness *int64 // /proc/sys/vm/swappiness + UserReserveKbytes *int64 // /proc/sys/vm/user_reserve_kbytes + VfsCachePressure *int64 // /proc/sys/vm/vfs_cache_pressure + WatermarkBoostFactor *int64 // /proc/sys/vm/watermark_boost_factor + WatermarkScaleFactor *int64 // /proc/sys/vm/watermark_scale_factor + ZoneReclaimMode *int64 // /proc/sys/vm/zone_reclaim_mode +} + +// VM reads the VM statistics from the specified `proc` filesystem. +func (fs FS) VM() (*VM, error) { + path := fs.proc.Path("sys/vm") + file, err := os.Stat(path) + if err != nil { + return nil, err + } + if !file.Mode().IsDir() { + return nil, fmt.Errorf("%s is not a directory", path) + } + + files, err := ioutil.ReadDir(path) + if err != nil { + return nil, err + } + + var vm VM + for _, f := range files { + if f.IsDir() { + continue + } + + name := filepath.Join(path, f.Name()) + // ignore errors on read, as there are some write only + // in /proc/sys/vm + value, err := util.SysReadFile(name) + if err != nil { + continue + } + vp := util.NewValueParser(value) + + switch f.Name() { + case "admin_reserve_kbytes": + vm.AdminReserveKbytes = vp.PInt64() + case "block_dump": + vm.BlockDump = vp.PInt64() + case "compact_unevictable_allowed": + vm.CompactUnevictableAllowed = vp.PInt64() + case "dirty_background_bytes": + vm.DirtyBackgroundBytes = vp.PInt64() + case "dirty_background_ratio": + vm.DirtyBackgroundRatio = vp.PInt64() + case "dirty_bytes": + vm.DirtyBytes = vp.PInt64() + case "dirty_expire_centisecs": + vm.DirtyExpireCentisecs = vp.PInt64() + case "dirty_ratio": + vm.DirtyRatio = vp.PInt64() + case "dirtytime_expire_seconds": + vm.DirtytimeExpireSeconds = vp.PInt64() + case "dirty_writeback_centisecs": + vm.DirtyWritebackCentisecs = vp.PInt64() + case "drop_caches": + vm.DropCaches = vp.PInt64() + case "extfrag_threshold": + vm.ExtfragThreshold = vp.PInt64() + case "hugetlb_shm_group": + vm.HugetlbShmGroup = vp.PInt64() + case "laptop_mode": + vm.LaptopMode = vp.PInt64() + case "legacy_va_layout": + vm.LegacyVaLayout = vp.PInt64() + case "lowmem_reserve_ratio": + stringSlice := strings.Fields(value) + pint64Slice := make([]*int64, 0, len(stringSlice)) + for _, value := range stringSlice { + vp := util.NewValueParser(value) + pint64Slice = append(pint64Slice, vp.PInt64()) + } + vm.LowmemReserveRatio = pint64Slice + case "max_map_count": + vm.MaxMapCount = vp.PInt64() + case "memory_failure_early_kill": + vm.MemoryFailureEarlyKill = vp.PInt64() + case "memory_failure_recovery": + vm.MemoryFailureRecovery = vp.PInt64() + case "min_free_kbytes": + vm.MinFreeKbytes = vp.PInt64() + case "min_slab_ratio": + vm.MinSlabRatio = vp.PInt64() + case "min_unmapped_ratio": + vm.MinUnmappedRatio = vp.PInt64() + case "mmap_min_addr": + vm.MmapMinAddr = vp.PInt64() + case "nr_hugepages": + vm.NrHugepages = vp.PInt64() + case "nr_hugepages_mempolicy": + vm.NrHugepagesMempolicy = vp.PInt64() + case "nr_overcommit_hugepages": + vm.NrOvercommitHugepages = vp.PInt64() + case "numa_stat": + vm.NumaStat = vp.PInt64() + case "numa_zonelist_order": + vm.NumaZonelistOrder = value + case "oom_dump_tasks": + vm.OomDumpTasks = vp.PInt64() + case "oom_kill_allocating_task": + vm.OomKillAllocatingTask = vp.PInt64() + case "overcommit_kbytes": + vm.OvercommitKbytes = vp.PInt64() + case "overcommit_memory": + vm.OvercommitMemory = vp.PInt64() + case "overcommit_ratio": + vm.OvercommitRatio = vp.PInt64() + case "page-cluster": + vm.PageCluster = vp.PInt64() + case "panic_on_oom": + vm.PanicOnOom = vp.PInt64() + case "percpu_pagelist_fraction": + vm.PercpuPagelistFraction = vp.PInt64() + case "stat_interval": + vm.StatInterval = vp.PInt64() + case "swappiness": + vm.Swappiness = vp.PInt64() + case "user_reserve_kbytes": + vm.UserReserveKbytes = vp.PInt64() + case "vfs_cache_pressure": + vm.VfsCachePressure = vp.PInt64() + case "watermark_boost_factor": + vm.WatermarkBoostFactor = vp.PInt64() + case "watermark_scale_factor": + vm.WatermarkScaleFactor = vp.PInt64() + case "zone_reclaim_mode": + vm.ZoneReclaimMode = vp.PInt64() + } + if err := vp.Err(); err != nil { + return nil, err + } + } + + return &vm, nil +} diff --git a/vendor/github.com/prometheus/procfs/zoneinfo.go b/vendor/github.com/prometheus/procfs/zoneinfo.go new file mode 100644 index 000000000..e941503d5 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/zoneinfo.go @@ -0,0 +1,196 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !windows + +package procfs + +import ( + "bytes" + "fmt" + "io/ioutil" + "regexp" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// Zoneinfo holds info parsed from /proc/zoneinfo. +type Zoneinfo struct { + Node string + Zone string + NrFreePages *int64 + Min *int64 + Low *int64 + High *int64 + Scanned *int64 + Spanned *int64 + Present *int64 + Managed *int64 + NrActiveAnon *int64 + NrInactiveAnon *int64 + NrIsolatedAnon *int64 + NrAnonPages *int64 + NrAnonTransparentHugepages *int64 + NrActiveFile *int64 + NrInactiveFile *int64 + NrIsolatedFile *int64 + NrFilePages *int64 + NrSlabReclaimable *int64 + NrSlabUnreclaimable *int64 + NrMlockStack *int64 + NrKernelStack *int64 + NrMapped *int64 + NrDirty *int64 + NrWriteback *int64 + NrUnevictable *int64 + NrShmem *int64 + NrDirtied *int64 + NrWritten *int64 + NumaHit *int64 + NumaMiss *int64 + NumaForeign *int64 + NumaInterleave *int64 + NumaLocal *int64 + NumaOther *int64 + Protection []*int64 +} + +var nodeZoneRE = regexp.MustCompile(`(\d+), zone\s+(\w+)`) + +// Zoneinfo parses an zoneinfo-file (/proc/zoneinfo) and returns a slice of +// structs containing the relevant info. More information available here: +// https://www.kernel.org/doc/Documentation/sysctl/vm.txt +func (fs FS) Zoneinfo() ([]Zoneinfo, error) { + data, err := ioutil.ReadFile(fs.proc.Path("zoneinfo")) + if err != nil { + return nil, fmt.Errorf("error reading zoneinfo %s: %s", fs.proc.Path("zoneinfo"), err) + } + zoneinfo, err := parseZoneinfo(data) + if err != nil { + return nil, fmt.Errorf("error parsing zoneinfo %s: %s", fs.proc.Path("zoneinfo"), err) + } + return zoneinfo, nil +} + +func parseZoneinfo(zoneinfoData []byte) ([]Zoneinfo, error) { + + zoneinfo := []Zoneinfo{} + + zoneinfoBlocks := bytes.Split(zoneinfoData, []byte("\nNode")) + for _, block := range zoneinfoBlocks { + var zoneinfoElement Zoneinfo + lines := strings.Split(string(block), "\n") + for _, line := range lines { + + if nodeZone := nodeZoneRE.FindStringSubmatch(line); nodeZone != nil { + zoneinfoElement.Node = nodeZone[1] + zoneinfoElement.Zone = nodeZone[2] + continue + } + if strings.HasPrefix(strings.TrimSpace(line), "per-node stats") { + zoneinfoElement.Zone = "" + continue + } + parts := strings.Fields(strings.TrimSpace(line)) + if len(parts) < 2 { + continue + } + vp := util.NewValueParser(parts[1]) + switch parts[0] { + case "nr_free_pages": + zoneinfoElement.NrFreePages = vp.PInt64() + case "min": + zoneinfoElement.Min = vp.PInt64() + case "low": + zoneinfoElement.Low = vp.PInt64() + case "high": + zoneinfoElement.High = vp.PInt64() + case "scanned": + zoneinfoElement.Scanned = vp.PInt64() + case "spanned": + zoneinfoElement.Spanned = vp.PInt64() + case "present": + zoneinfoElement.Present = vp.PInt64() + case "managed": + zoneinfoElement.Managed = vp.PInt64() + case "nr_active_anon": + zoneinfoElement.NrActiveAnon = vp.PInt64() + case "nr_inactive_anon": + zoneinfoElement.NrInactiveAnon = vp.PInt64() + case "nr_isolated_anon": + zoneinfoElement.NrIsolatedAnon = vp.PInt64() + case "nr_anon_pages": + zoneinfoElement.NrAnonPages = vp.PInt64() + case "nr_anon_transparent_hugepages": + zoneinfoElement.NrAnonTransparentHugepages = vp.PInt64() + case "nr_active_file": + zoneinfoElement.NrActiveFile = vp.PInt64() + case "nr_inactive_file": + zoneinfoElement.NrInactiveFile = vp.PInt64() + case "nr_isolated_file": + zoneinfoElement.NrIsolatedFile = vp.PInt64() + case "nr_file_pages": + zoneinfoElement.NrFilePages = vp.PInt64() + case "nr_slab_reclaimable": + zoneinfoElement.NrSlabReclaimable = vp.PInt64() + case "nr_slab_unreclaimable": + zoneinfoElement.NrSlabUnreclaimable = vp.PInt64() + case "nr_mlock_stack": + zoneinfoElement.NrMlockStack = vp.PInt64() + case "nr_kernel_stack": + zoneinfoElement.NrKernelStack = vp.PInt64() + case "nr_mapped": + zoneinfoElement.NrMapped = vp.PInt64() + case "nr_dirty": + zoneinfoElement.NrDirty = vp.PInt64() + case "nr_writeback": + zoneinfoElement.NrWriteback = vp.PInt64() + case "nr_unevictable": + zoneinfoElement.NrUnevictable = vp.PInt64() + case "nr_shmem": + zoneinfoElement.NrShmem = vp.PInt64() + case "nr_dirtied": + zoneinfoElement.NrDirtied = vp.PInt64() + case "nr_written": + zoneinfoElement.NrWritten = vp.PInt64() + case "numa_hit": + zoneinfoElement.NumaHit = vp.PInt64() + case "numa_miss": + zoneinfoElement.NumaMiss = vp.PInt64() + case "numa_foreign": + zoneinfoElement.NumaForeign = vp.PInt64() + case "numa_interleave": + zoneinfoElement.NumaInterleave = vp.PInt64() + case "numa_local": + zoneinfoElement.NumaLocal = vp.PInt64() + case "numa_other": + zoneinfoElement.NumaOther = vp.PInt64() + case "protection:": + protectionParts := strings.Split(line, ":") + protectionValues := strings.Replace(protectionParts[1], "(", "", 1) + protectionValues = strings.Replace(protectionValues, ")", "", 1) + protectionValues = strings.TrimSpace(protectionValues) + protectionStringMap := strings.Split(protectionValues, ", ") + val, err := util.ParsePInt64s(protectionStringMap) + if err == nil { + zoneinfoElement.Protection = val + } + } + + } + + zoneinfo = append(zoneinfo, zoneinfoElement) + } + return zoneinfo, nil +} diff --git a/vendor/go.opencensus.io/.gitignore b/vendor/go.opencensus.io/.gitignore new file mode 100644 index 000000000..74a6db472 --- /dev/null +++ b/vendor/go.opencensus.io/.gitignore @@ -0,0 +1,9 @@ +/.idea/ + +# go.opencensus.io/exporter/aws +/exporter/aws/ + +# Exclude vendor, use dep ensure after checkout: +/vendor/github.com/ +/vendor/golang.org/ +/vendor/google.golang.org/ diff --git a/vendor/go.opencensus.io/.travis.yml b/vendor/go.opencensus.io/.travis.yml new file mode 100644 index 000000000..bd6b66ee8 --- /dev/null +++ b/vendor/go.opencensus.io/.travis.yml @@ -0,0 +1,17 @@ +language: go + +go_import_path: go.opencensus.io + +go: + - 1.11.x + +env: + global: + GO111MODULE=on + +before_script: + - make install-tools + +script: + - make travis-ci + - go run internal/check/version.go # TODO move this to makefile diff --git a/vendor/go.opencensus.io/AUTHORS b/vendor/go.opencensus.io/AUTHORS new file mode 100644 index 000000000..e491a9e7f --- /dev/null +++ b/vendor/go.opencensus.io/AUTHORS @@ -0,0 +1 @@ +Google Inc. diff --git a/vendor/go.opencensus.io/CONTRIBUTING.md b/vendor/go.opencensus.io/CONTRIBUTING.md new file mode 100644 index 000000000..1ba3962c8 --- /dev/null +++ b/vendor/go.opencensus.io/CONTRIBUTING.md @@ -0,0 +1,63 @@ +# How to contribute + +We'd love to accept your patches and contributions to this project. There are +just a few small guidelines you need to follow. + +## Contributor License Agreement + +Contributions to this project must be accompanied by a Contributor License +Agreement. You (or your employer) retain the copyright to your contribution, +this simply gives us permission to use and redistribute your contributions as +part of the project. Head over to <https://cla.developers.google.com/> to see +your current agreements on file or to sign a new one. + +You generally only need to submit a CLA once, so if you've already submitted one +(even if it was for a different project), you probably don't need to do it +again. + +## Code reviews + +All submissions, including submissions by project members, require review. We +use GitHub pull requests for this purpose. Consult [GitHub Help] for more +information on using pull requests. + +[GitHub Help]: https://help.github.com/articles/about-pull-requests/ + +## Instructions + +Fork the repo, checkout the upstream repo to your GOPATH by: + +``` +$ go get -d go.opencensus.io +``` + +Add your fork as an origin: + +``` +cd $(go env GOPATH)/src/go.opencensus.io +git remote add fork git@github.com:YOUR_GITHUB_USERNAME/opencensus-go.git +``` + +Run tests: + +``` +$ make install-tools # Only first time. +$ make +``` + +Checkout a new branch, make modifications and push the branch to your fork: + +``` +$ git checkout -b feature +# edit files +$ git commit +$ git push fork feature +``` + +Open a pull request against the main opencensus-go repo. + +## General Notes +This project uses Appveyor and Travis for CI. + +The dependencies are managed with `go mod` if you work with the sources under your +`$GOPATH` you need to set the environment variable `GO111MODULE=on`.
\ No newline at end of file diff --git a/vendor/go.opencensus.io/Gopkg.lock b/vendor/go.opencensus.io/Gopkg.lock new file mode 100644 index 000000000..3be12ac8f --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.lock @@ -0,0 +1,231 @@ +# This file is autogenerated, do not edit; changes may be undone by the next 'dep ensure'. + + +[[projects]] + branch = "master" + digest = "1:eee9386329f4fcdf8d6c0def0c9771b634bdd5ba460d888aa98c17d59b37a76c" + name = "git.apache.org/thrift.git" + packages = ["lib/go/thrift"] + pruneopts = "UT" + revision = "6e67faa92827ece022380b211c2caaadd6145bf5" + source = "github.com/apache/thrift" + +[[projects]] + branch = "master" + digest = "1:d6afaeed1502aa28e80a4ed0981d570ad91b2579193404256ce672ed0a609e0d" + name = "github.com/beorn7/perks" + packages = ["quantile"] + pruneopts = "UT" + revision = "3a771d992973f24aa725d07868b467d1ddfceafb" + +[[projects]] + digest = "1:4c0989ca0bcd10799064318923b9bc2db6b4d6338dd75f3f2d86c3511aaaf5cf" + name = "github.com/golang/protobuf" + packages = [ + "proto", + "ptypes", + "ptypes/any", + "ptypes/duration", + "ptypes/timestamp", + ] + pruneopts = "UT" + revision = "aa810b61a9c79d51363740d207bb46cf8e620ed5" + version = "v1.2.0" + +[[projects]] + digest = "1:ff5ebae34cfbf047d505ee150de27e60570e8c394b3b8fdbb720ff6ac71985fc" + name = "github.com/matttproud/golang_protobuf_extensions" + packages = ["pbutil"] + pruneopts = "UT" + revision = "c12348ce28de40eed0136aa2b644d0ee0650e56c" + version = "v1.0.1" + +[[projects]] + digest = "1:824c8f3aa4c5f23928fa84ebbd5ed2e9443b3f0cb958a40c1f2fbed5cf5e64b1" + name = "github.com/openzipkin/zipkin-go" + packages = [ + ".", + "idgenerator", + "model", + "propagation", + "reporter", + "reporter/http", + ] + pruneopts = "UT" + revision = "d455a5674050831c1e187644faa4046d653433c2" + version = "v0.1.1" + +[[projects]] + digest = "1:d14a5f4bfecf017cb780bdde1b6483e5deb87e12c332544d2c430eda58734bcb" + name = "github.com/prometheus/client_golang" + packages = [ + "prometheus", + "prometheus/promhttp", + ] + pruneopts = "UT" + revision = "c5b7fccd204277076155f10851dad72b76a49317" + version = "v0.8.0" + +[[projects]] + branch = "master" + digest = "1:2d5cd61daa5565187e1d96bae64dbbc6080dacf741448e9629c64fd93203b0d4" + name = "github.com/prometheus/client_model" + packages = ["go"] + pruneopts = "UT" + revision = "5c3871d89910bfb32f5fcab2aa4b9ec68e65a99f" + +[[projects]] + branch = "master" + digest = "1:63b68062b8968092eb86bedc4e68894bd096ea6b24920faca8b9dcf451f54bb5" + name = "github.com/prometheus/common" + packages = [ + "expfmt", + "internal/bitbucket.org/ww/goautoneg", + "model", + ] + pruneopts = "UT" + revision = "c7de2306084e37d54b8be01f3541a8464345e9a5" + +[[projects]] + branch = "master" + digest = "1:8c49953a1414305f2ff5465147ee576dd705487c35b15918fcd4efdc0cb7a290" + name = "github.com/prometheus/procfs" + packages = [ + ".", + "internal/util", + "nfs", + "xfs", + ] + pruneopts = "UT" + revision = "05ee40e3a273f7245e8777337fc7b46e533a9a92" + +[[projects]] + branch = "master" + digest = "1:deafe4ab271911fec7de5b693d7faae3f38796d9eb8622e2b9e7df42bb3dfea9" + name = "golang.org/x/net" + packages = [ + "context", + "http/httpguts", + "http2", + "http2/hpack", + "idna", + "internal/timeseries", + "trace", + ] + pruneopts = "UT" + revision = "922f4815f713f213882e8ef45e0d315b164d705c" + +[[projects]] + branch = "master" + digest = "1:e0140c0c868c6e0f01c0380865194592c011fe521d6e12d78bfd33e756fe018a" + name = "golang.org/x/sync" + packages = ["semaphore"] + pruneopts = "UT" + revision = "1d60e4601c6fd243af51cc01ddf169918a5407ca" + +[[projects]] + branch = "master" + digest = "1:a3f00ac457c955fe86a41e1495e8f4c54cb5399d609374c5cc26aa7d72e542c8" + name = "golang.org/x/sys" + packages = ["unix"] + pruneopts = "UT" + revision = "3b58ed4ad3395d483fc92d5d14123ce2c3581fec" + +[[projects]] + digest = "1:a2ab62866c75542dd18d2b069fec854577a20211d7c0ea6ae746072a1dccdd18" + name = "golang.org/x/text" + packages = [ + "collate", + "collate/build", + "internal/colltab", + "internal/gen", + "internal/tag", + "internal/triegen", + "internal/ucd", + "language", + "secure/bidirule", + "transform", + "unicode/bidi", + "unicode/cldr", + "unicode/norm", + "unicode/rangetable", + ] + pruneopts = "UT" + revision = "f21a4dfb5e38f5895301dc265a8def02365cc3d0" + version = "v0.3.0" + +[[projects]] + branch = "master" + digest = "1:c0c17c94fe8bc1ab34e7f586a4a8b788c5e1f4f9f750ff23395b8b2f5a523530" + name = "google.golang.org/api" + packages = ["support/bundler"] + pruneopts = "UT" + revision = "e21acd801f91da814261b938941d193bb036441a" + +[[projects]] + branch = "master" + digest = "1:077c1c599507b3b3e9156d17d36e1e61928ee9b53a5b420f10f28ebd4a0b275c" + name = "google.golang.org/genproto" + packages = ["googleapis/rpc/status"] + pruneopts = "UT" + revision = "c66870c02cf823ceb633bcd05be3c7cda29976f4" + +[[projects]] + digest = "1:3dd7996ce6bf52dec6a2f69fa43e7c4cefea1d4dfa3c8ab7a5f8a9f7434e239d" + name = "google.golang.org/grpc" + packages = [ + ".", + "balancer", + "balancer/base", + "balancer/roundrobin", + "codes", + "connectivity", + "credentials", + "encoding", + "encoding/proto", + "grpclog", + "internal", + "internal/backoff", + "internal/channelz", + "internal/envconfig", + "internal/grpcrand", + "internal/transport", + "keepalive", + "metadata", + "naming", + "peer", + "resolver", + "resolver/dns", + "resolver/passthrough", + "stats", + "status", + "tap", + ] + pruneopts = "UT" + revision = "32fb0ac620c32ba40a4626ddf94d90d12cce3455" + version = "v1.14.0" + +[solve-meta] + analyzer-name = "dep" + analyzer-version = 1 + input-imports = [ + "git.apache.org/thrift.git/lib/go/thrift", + "github.com/golang/protobuf/proto", + "github.com/openzipkin/zipkin-go", + "github.com/openzipkin/zipkin-go/model", + "github.com/openzipkin/zipkin-go/reporter", + "github.com/openzipkin/zipkin-go/reporter/http", + "github.com/prometheus/client_golang/prometheus", + "github.com/prometheus/client_golang/prometheus/promhttp", + "golang.org/x/net/context", + "golang.org/x/net/http2", + "google.golang.org/api/support/bundler", + "google.golang.org/grpc", + "google.golang.org/grpc/codes", + "google.golang.org/grpc/grpclog", + "google.golang.org/grpc/metadata", + "google.golang.org/grpc/stats", + "google.golang.org/grpc/status", + ] + solver-name = "gps-cdcl" + solver-version = 1 diff --git a/vendor/go.opencensus.io/Gopkg.toml b/vendor/go.opencensus.io/Gopkg.toml new file mode 100644 index 000000000..a9f3cd68e --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.toml @@ -0,0 +1,36 @@ +# For v0.x.y dependencies, prefer adding a constraints of the form: version=">= 0.x.y" +# to avoid locking to a particular minor version which can cause dep to not be +# able to find a satisfying dependency graph. + +[[constraint]] + branch = "master" + name = "git.apache.org/thrift.git" + source = "github.com/apache/thrift" + +[[constraint]] + name = "github.com/golang/protobuf" + version = "1.0.0" + +[[constraint]] + name = "github.com/openzipkin/zipkin-go" + version = ">=0.1.0" + +[[constraint]] + name = "github.com/prometheus/client_golang" + version = ">=0.8.0" + +[[constraint]] + branch = "master" + name = "golang.org/x/net" + +[[constraint]] + branch = "master" + name = "google.golang.org/api" + +[[constraint]] + name = "google.golang.org/grpc" + version = "1.11.3" + +[prune] + go-tests = true + unused-packages = true diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 000000000..7a4a3ea24 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License.
\ No newline at end of file diff --git a/vendor/go.opencensus.io/Makefile b/vendor/go.opencensus.io/Makefile new file mode 100644 index 000000000..457866cb1 --- /dev/null +++ b/vendor/go.opencensus.io/Makefile @@ -0,0 +1,96 @@ +# TODO: Fix this on windows. +ALL_SRC := $(shell find . -name '*.go' \ + -not -path './vendor/*' \ + -not -path '*/gen-go/*' \ + -type f | sort) +ALL_PKGS := $(shell go list $(sort $(dir $(ALL_SRC)))) + +GOTEST_OPT?=-v -race -timeout 30s +GOTEST_OPT_WITH_COVERAGE = $(GOTEST_OPT) -coverprofile=coverage.txt -covermode=atomic +GOTEST=go test +GOFMT=gofmt +GOLINT=golint +GOVET=go vet +EMBEDMD=embedmd +# TODO decide if we need to change these names. +TRACE_ID_LINT_EXCEPTION="type name will be used as trace.TraceID by other packages" +TRACE_OPTION_LINT_EXCEPTION="type name will be used as trace.TraceOptions by other packages" +README_FILES := $(shell find . -name '*README.md' | sort | tr '\n' ' ') + +.DEFAULT_GOAL := fmt-lint-vet-embedmd-test + +.PHONY: fmt-lint-vet-embedmd-test +fmt-lint-vet-embedmd-test: fmt lint vet embedmd test + +# TODO enable test-with-coverage in tavis +.PHONY: travis-ci +travis-ci: fmt lint vet embedmd test test-386 + +all-pkgs: + @echo $(ALL_PKGS) | tr ' ' '\n' | sort + +all-srcs: + @echo $(ALL_SRC) | tr ' ' '\n' | sort + +.PHONY: test +test: + $(GOTEST) $(GOTEST_OPT) $(ALL_PKGS) + +.PHONY: test-386 +test-386: + GOARCH=386 $(GOTEST) -v -timeout 30s $(ALL_PKGS) + +.PHONY: test-with-coverage +test-with-coverage: + $(GOTEST) $(GOTEST_OPT_WITH_COVERAGE) $(ALL_PKGS) + +.PHONY: fmt +fmt: + @FMTOUT=`$(GOFMT) -s -l $(ALL_SRC) 2>&1`; \ + if [ "$$FMTOUT" ]; then \ + echo "$(GOFMT) FAILED => gofmt the following files:\n"; \ + echo "$$FMTOUT\n"; \ + exit 1; \ + else \ + echo "Fmt finished successfully"; \ + fi + +.PHONY: lint +lint: + @LINTOUT=`$(GOLINT) $(ALL_PKGS) | grep -v $(TRACE_ID_LINT_EXCEPTION) | grep -v $(TRACE_OPTION_LINT_EXCEPTION) 2>&1`; \ + if [ "$$LINTOUT" ]; then \ + echo "$(GOLINT) FAILED => clean the following lint errors:\n"; \ + echo "$$LINTOUT\n"; \ + exit 1; \ + else \ + echo "Lint finished successfully"; \ + fi + +.PHONY: vet +vet: + # TODO: Understand why go vet downloads "github.com/google/go-cmp v0.2.0" + @VETOUT=`$(GOVET) ./... | grep -v "go: downloading" 2>&1`; \ + if [ "$$VETOUT" ]; then \ + echo "$(GOVET) FAILED => go vet the following files:\n"; \ + echo "$$VETOUT\n"; \ + exit 1; \ + else \ + echo "Vet finished successfully"; \ + fi + +.PHONY: embedmd +embedmd: + @EMBEDMDOUT=`$(EMBEDMD) -d $(README_FILES) 2>&1`; \ + if [ "$$EMBEDMDOUT" ]; then \ + echo "$(EMBEDMD) FAILED => embedmd the following files:\n"; \ + echo "$$EMBEDMDOUT\n"; \ + exit 1; \ + else \ + echo "Embedmd finished successfully"; \ + fi + +.PHONY: install-tools +install-tools: + go get -u golang.org/x/tools/cmd/cover + go get -u golang.org/x/lint/golint + go get -u github.com/rakyll/embedmd diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 000000000..fabab2e06 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,263 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces + +## Overview + + + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + + + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + + + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter diff --git a/vendor/go.opencensus.io/appveyor.yml b/vendor/go.opencensus.io/appveyor.yml new file mode 100644 index 000000000..12bd7c4c7 --- /dev/null +++ b/vendor/go.opencensus.io/appveyor.yml @@ -0,0 +1,25 @@ +version: "{build}" + +platform: x64 + +clone_folder: c:\gopath\src\go.opencensus.io + +environment: + GOPATH: 'c:\gopath' + GOVERSION: '1.11' + GO111MODULE: 'on' + CGO_ENABLED: '0' # See: https://github.com/appveyor/ci/issues/2613 + +install: + - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% + - choco upgrade golang --version 1.11.5 # Temporary fix because of a go.sum bug in 1.11 + - go version + - go env + +build: false +deploy: false + +test_script: + - cd %APPVEYOR_BUILD_FOLDER% + - go build -v .\... + - go test -v .\... # No -race because cgo is disabled diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 000000000..cb4de80f3 --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,12 @@ +module go.opencensus.io + +require ( + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) diff --git a/vendor/go.opencensus.io/go.sum b/vendor/go.opencensus.io/go.sum new file mode 100644 index 000000000..0b948c2b4 --- /dev/null +++ b/vendor/go.opencensus.io/go.sum @@ -0,0 +1,61 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a h1:1BGLXjeY4akVXGgbC9HugT3Jv3hCI0z56oJR5vAMgBU= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd h1:r7DufRZuZbWB7j439YfAzP8RPDa9unLkpwQKUYbIMPI= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 000000000..9a638781c --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Now().Sub(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 000000000..de8ccf236 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 000000000..073af7b47 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 000000000..626d73645 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.22.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 000000000..0c54492a2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 000000000..775f8274f --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 000000000..04b1ee4f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 000000000..ffc264f23 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 000000000..e0d9a4b99 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 000000000..7e808d8f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 000000000..3f80a3368 --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,37 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/hashicorp/golang-lru/simplelru" +) + +type lruMap struct { + simpleLruMap *simplelru.LRU + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{} + lm.simpleLruMap, _ = simplelru.NewLRU(size, nil) + return lm +} + +func (lm *lruMap) add(key, value interface{}) { + evicted := lm.simpleLruMap.Add(key, value) + if evicted { + lm.droppedCount++ + } +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 000000000..71c10f9e3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 000000000..fbabad34c --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 000000000..c442d9902 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 000000000..ec60effd1 --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 000000000..38ead7bf0 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.simpleLruMap.Len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.simpleLruMap.Keys() { + value, ok := s.lruAttributes.simpleLruMap.Get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "<nil>" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 000000000..b7d8aaf28 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 000000000..e25419859 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 000000000..2d6c713eb --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +} diff --git a/vendor/golang.org/x/sys/unix/mkerrors.sh b/vendor/golang.org/x/sys/unix/mkerrors.sh index 85cfbd049..8a2dcfa51 100644 --- a/vendor/golang.org/x/sys/unix/mkerrors.sh +++ b/vendor/golang.org/x/sys/unix/mkerrors.sh @@ -183,20 +183,26 @@ struct ltchars { #include <sys/socket.h> #include <sys/xattr.h> #include <linux/bpf.h> +#include <linux/can.h> #include <linux/capability.h> +#include <linux/cryptouser.h> #include <linux/errqueue.h> +#include <linux/falloc.h> +#include <linux/fanotify.h> +#include <linux/filter.h> +#include <linux/fs.h> +#include <linux/genetlink.h> +#include <linux/hdreg.h> +#include <linux/icmpv6.h> #include <linux/if.h> +#include <linux/if_addr.h> #include <linux/if_alg.h> #include <linux/if_arp.h> #include <linux/if_ether.h> #include <linux/if_ppp.h> #include <linux/if_tun.h> #include <linux/if_packet.h> -#include <linux/if_addr.h> -#include <linux/falloc.h> -#include <linux/fanotify.h> -#include <linux/filter.h> -#include <linux/fs.h> +#include <linux/if_xdp.h> #include <linux/kexec.h> #include <linux/keyctl.h> #include <linux/loop.h> @@ -208,25 +214,21 @@ struct ltchars { #include <linux/net_namespace.h> #include <linux/nsfs.h> #include <linux/perf_event.h> +#include <linux/ptrace.h> #include <linux/random.h> #include <linux/reboot.h> +#include <linux/rtc.h> #include <linux/rtnetlink.h> -#include <linux/ptrace.h> #include <linux/sched.h> #include <linux/seccomp.h> -#include <linux/sockios.h> -#include <linux/wait.h> -#include <linux/icmpv6.h> #include <linux/serial.h> -#include <linux/can.h> -#include <linux/vm_sockets.h> +#include <linux/sockios.h> #include <linux/taskstats.h> -#include <linux/genetlink.h> +#include <linux/tipc.h> +#include <linux/vm_sockets.h> +#include <linux/wait.h> #include <linux/watchdog.h> -#include <linux/hdreg.h> -#include <linux/rtc.h> -#include <linux/if_xdp.h> -#include <linux/cryptouser.h> + #include <mtd/ubi-user.h> #include <net/route.h> @@ -265,6 +267,11 @@ struct ltchars { #define FS_KEY_DESC_PREFIX "fscrypt:" #define FS_KEY_DESC_PREFIX_SIZE 8 #define FS_MAX_KEY_SIZE 64 + +// The code generator produces -0x1 for (~0), but an unsigned value is necessary +// for the tipc_subscr timeout __u32 field. +#undef TIPC_WAIT_FOREVER +#define TIPC_WAIT_FOREVER 0xffffffff ' includes_NetBSD=' @@ -508,6 +515,7 @@ ccflags="$@" $2 ~ /^XDP_/ || $2 ~ /^(HDIO|WIN|SMART)_/ || $2 ~ /^CRYPTO_/ || + $2 ~ /^TIPC_/ || $2 !~ "WMESGLEN" && $2 ~ /^W[A-Z0-9]+$/ || $2 ~/^PPPIOC/ || diff --git a/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go b/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go index bf05603f1..b3c8e3301 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go @@ -29,6 +29,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go b/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go index 13d4321f4..9a6e02417 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go @@ -29,6 +29,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index 97a8eef6f..3e6671426 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -413,8 +413,6 @@ func Kevent(kq int, changes, events []Kevent_t, timeout *Timespec) (n int, err e return kevent(kq, change, len(changes), event, len(events), timeout) } -//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL - // sysctlmib translates name to mib number and appends any additional args. func sysctlmib(name string, args ...int) ([]_C_int, error) { // Translate name to mib number. diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go index cd8be182a..cf1bec6a3 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go @@ -10,6 +10,7 @@ import ( "syscall" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL //sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) func setTimespec(sec, nsec int64) Timespec { @@ -45,6 +46,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go index d0d07243c..5867ed00b 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go @@ -10,6 +10,7 @@ import ( "syscall" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL //sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) func setTimespec(sec, nsec int64) Timespec { @@ -45,6 +46,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go index 01e8a38a9..e199e12a5 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go @@ -12,6 +12,10 @@ func ptrace(request int, pid int, addr uintptr, data uintptr) error { return ENOTSUP } +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: int32(sec), Nsec: int32(nsec)} } @@ -45,6 +49,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go index e674f81da..2c50ca901 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go @@ -14,6 +14,10 @@ func ptrace(request int, pid int, addr uintptr, data uintptr) error { return ENOTSUP } +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} } @@ -47,6 +51,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go index 474181c02..99d875624 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go @@ -14,6 +14,8 @@ package unix import "unsafe" +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go index 9babb31ea..a6b4830ac 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd.go b/vendor/golang.org/x/sys/unix/syscall_freebsd.go index d95c4436f..b62231bca 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd.go @@ -36,6 +36,8 @@ var ( // INO64_FIRST from /usr/src/lib/libc/sys/compat-ino64.h const _ino64First = 1200031 +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + func supportsABI(ver uint32) bool { osreldateOnce.Do(func() { osreldate, _ = SysctlUint32("kern.osreldate") }) return osreldate >= ver diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go index 21e03958c..dcc56457a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go index 9c945a657..321c3bace 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go index 5cd6243f2..697700831 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go index a31805487..dbbbfd603 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index fe30b9544..e538bb567 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -775,6 +775,70 @@ func (sa *SockaddrPPPoE) sockaddr() (unsafe.Pointer, _Socklen, error) { return unsafe.Pointer(&sa.raw), SizeofSockaddrPPPoX, nil } +// SockaddrTIPC implements the Sockaddr interface for AF_TIPC type sockets. +// For more information on TIPC, see: http://tipc.sourceforge.net/. +type SockaddrTIPC struct { + // Scope is the publication scopes when binding service/service range. + // Should be set to TIPC_CLUSTER_SCOPE or TIPC_NODE_SCOPE. + Scope int + + // Addr is the type of address used to manipulate a socket. Addr must be + // one of: + // - *TIPCSocketAddr: "id" variant in the C addr union + // - *TIPCServiceRange: "nameseq" variant in the C addr union + // - *TIPCServiceName: "name" variant in the C addr union + // + // If nil, EINVAL will be returned when the structure is used. + Addr TIPCAddr + + raw RawSockaddrTIPC +} + +// TIPCAddr is implemented by types that can be used as an address for +// SockaddrTIPC. It is only implemented by *TIPCSocketAddr, *TIPCServiceRange, +// and *TIPCServiceName. +type TIPCAddr interface { + tipcAddrtype() uint8 + tipcAddr() [12]byte +} + +func (sa *TIPCSocketAddr) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCSocketAddr{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCSocketAddr) tipcAddrtype() uint8 { return TIPC_SOCKET_ADDR } + +func (sa *TIPCServiceRange) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCServiceRange{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCServiceRange) tipcAddrtype() uint8 { return TIPC_SERVICE_RANGE } + +func (sa *TIPCServiceName) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCServiceName{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCServiceName) tipcAddrtype() uint8 { return TIPC_SERVICE_ADDR } + +func (sa *SockaddrTIPC) sockaddr() (unsafe.Pointer, _Socklen, error) { + if sa.Addr == nil { + return nil, 0, EINVAL + } + + sa.raw.Family = AF_TIPC + sa.raw.Scope = int8(sa.Scope) + sa.raw.Addrtype = sa.Addr.tipcAddrtype() + sa.raw.Addr = sa.Addr.tipcAddr() + + return unsafe.Pointer(&sa.raw), SizeofSockaddrTIPC, nil +} + func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { switch rsa.Addr.Family { case AF_NETLINK: @@ -901,6 +965,27 @@ func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { } } return sa, nil + case AF_TIPC: + pp := (*RawSockaddrTIPC)(unsafe.Pointer(rsa)) + + sa := &SockaddrTIPC{ + Scope: int(pp.Scope), + } + + // Determine which union variant is present in pp.Addr by checking + // pp.Addrtype. + switch pp.Addrtype { + case TIPC_SERVICE_RANGE: + sa.Addr = (*TIPCServiceRange)(unsafe.Pointer(&pp.Addr)) + case TIPC_SERVICE_ADDR: + sa.Addr = (*TIPCServiceName)(unsafe.Pointer(&pp.Addr)) + case TIPC_SOCKET_ADDR: + sa.Addr = (*TIPCSocketAddr)(unsafe.Pointer(&pp.Addr)) + default: + return nil, EINVAL + } + + return sa, nil } return nil, EAFNOSUPPORT } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_386.go index e2f8cf6e5..e7fa665e6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_386.go @@ -372,6 +372,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go index 87a30744d..088ce0f93 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go @@ -163,6 +163,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go index f62679443..11930fc8f 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go @@ -252,6 +252,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go index cb20b15d5..251e2d971 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go @@ -180,6 +180,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go index b3b21ec1e..7562fe97b 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go @@ -208,6 +208,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go index 5144d4e13..a939ff8f2 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go @@ -220,6 +220,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go index 0a100b66a..28d6d0f22 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go @@ -91,6 +91,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go index 6230f6405..6798c2625 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go @@ -179,6 +179,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go index f81dbdc9c..eb5cb1a71 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go @@ -120,6 +120,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go index b69565616..37321c12e 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go @@ -107,6 +107,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd.go b/vendor/golang.org/x/sys/unix/syscall_netbsd.go index 7f9812b4f..3e3f07507 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd.go @@ -18,6 +18,8 @@ import ( "unsafe" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go index 24f74e58c..24da8b524 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go index 6878bf7ff..25a0ac825 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go index dbbfcf71d..21591ecd4 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go index f3434465a..804749635 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index 9a26768f6..035c043a7 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -18,6 +18,8 @@ import ( "unsafe" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go index d62da60d1..42b5a0e51 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go index 9a35334cb..6ea4b4883 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go index 5d812aaea..1c3d26fa2 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go index 0fb39cf5e..a8c458cb0 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go index 91c32ddf0..b22a34d7a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go @@ -18,6 +18,10 @@ func (iov *Iovec) SetLen(length int) { iov.Len = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go index 2839b3df2..1875f4595 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1087,6 +1091,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1099,6 +1114,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1692,6 +1711,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1730,6 +1750,10 @@ const ( PTRACE_SINGLEBLOCK = 0x21 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2438,6 +2468,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2451,7 +2546,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2650,6 +2745,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2666,6 +2763,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go index 99e3a3de2..4af5477da 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1087,6 +1091,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1099,6 +1114,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1678,6 +1695,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1693,6 +1712,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1731,6 +1751,10 @@ const ( PTRACE_SINGLEBLOCK = 0x21 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 @@ -1791,7 +1815,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1864,6 +1888,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1888,6 +1913,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1895,7 +1921,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1907,6 +1933,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1915,8 +1942,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2001,6 +2028,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2139,6 +2168,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2439,6 +2469,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2452,7 +2547,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2650,6 +2745,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2666,6 +2763,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go index f5f5ee562..eb2191994 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETSIGMASK = 0x420a PTRACE_GETVFPREGS = 0x1b PTRACE_GETWMMXREGS = 0x12 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x16 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1736,6 +1756,10 @@ const ( PTRACE_SET_SYSCALL = 0x17 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 PT_DATA_ADDR = 0x10004 PT_TEXT_ADDR = 0x10000 @@ -1797,7 +1821,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1870,6 +1894,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1894,6 +1919,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1901,7 +1927,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1913,6 +1939,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1921,8 +1948,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2007,6 +2034,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2145,6 +2174,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2445,6 +2475,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2458,7 +2553,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2656,6 +2751,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2672,6 +2769,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go index 64573bdb7..fba8ad48e 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -561,6 +564,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1089,6 +1093,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1101,6 +1116,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1678,6 +1695,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1691,6 +1710,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1723,6 +1743,12 @@ const ( PTRACE_SETSIGMASK = 0x420b PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 + PTRACE_SYSEMU = 0x1f + PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1781,7 +1807,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1854,6 +1880,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1878,6 +1905,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1885,7 +1913,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1897,6 +1925,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1905,8 +1934,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1991,6 +2020,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2129,6 +2160,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2430,6 +2462,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2443,7 +2540,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2641,6 +2738,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2657,6 +2756,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go index 3e948be30..995a7645a 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go index 8ac128bbd..2a38e1034 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go index e8845a7d4..d1df93831 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go index 338c044eb..b92e3a589 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go index a696532fc..72fd7995f 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETVRREGS = 0x12 PTRACE_GETVSRREGS = 0x1b PTRACE_GET_DEBUGREG = 0x19 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1735,6 +1755,10 @@ const ( PTRACE_SINGLEBLOCK = 0x100 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1d PTRACE_SYSEMU_SINGLESTEP = 0x1e PTRACE_TRACEME = 0x0 @@ -1848,7 +1872,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1921,6 +1945,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1945,6 +1970,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1952,7 +1978,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1964,6 +1990,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1972,8 +1999,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2058,6 +2085,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2196,6 +2225,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2500,6 +2530,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 TPACKET_ALIGNMENT = 0x10 @@ -2513,7 +2608,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2711,6 +2806,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2727,6 +2824,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0xc00 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go index 9197b3353..d9d5837eb 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETVRREGS = 0x12 PTRACE_GETVSRREGS = 0x1b PTRACE_GET_DEBUGREG = 0x19 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1735,6 +1755,10 @@ const ( PTRACE_SINGLEBLOCK = 0x100 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1d PTRACE_SYSEMU_SINGLESTEP = 0x1e PTRACE_TRACEME = 0x0 @@ -1848,7 +1872,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1921,6 +1945,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1945,6 +1970,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1952,7 +1978,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1964,6 +1990,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1972,8 +1999,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2058,6 +2085,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2196,6 +2225,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2500,6 +2530,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 TPACKET_ALIGNMENT = 0x10 @@ -2513,7 +2608,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2711,6 +2806,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2727,6 +2824,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0xc00 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go index d1e023ed7..11810c85b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1688,6 +1707,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1720,6 +1740,10 @@ const ( PTRACE_SETSIGMASK = 0x420b PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1778,7 +1802,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1851,6 +1875,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1875,6 +1900,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1882,7 +1908,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1894,6 +1920,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1902,8 +1929,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1988,6 +2015,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2126,6 +2155,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2426,6 +2456,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2439,7 +2534,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2637,6 +2732,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2653,6 +2750,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go index 1dfacf183..70090835c 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_DETACH = 0x11 PTRACE_DISABLE_TE = 0x5010 PTRACE_ENABLE_TE = 0x5009 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1691,6 +1710,7 @@ const ( PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a PTRACE_GET_LAST_BREAK = 0x5006 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1734,6 +1754,10 @@ const ( PTRACE_SINGLEBLOCK = 0xc PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TE_ABORT_RAND = 0x5011 PTRACE_TRACEME = 0x0 PT_ACR0 = 0x90 @@ -1851,7 +1875,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1924,6 +1948,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1948,6 +1973,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1955,7 +1981,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1967,6 +1993,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1975,8 +2002,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2061,6 +2088,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2199,6 +2228,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2499,6 +2529,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2512,7 +2607,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2710,6 +2805,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2726,6 +2823,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go index b78e49fcf..99b5e165b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go @@ -256,6 +256,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -307,9 +308,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -463,6 +465,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -564,6 +567,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1090,6 +1094,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1102,6 +1117,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1679,6 +1696,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1735,6 +1755,10 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SPARC_DETACH = 0xb PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 PTRACE_WRITEDATA = 0x11 PTRACE_WRITETEXT = 0x13 @@ -1843,7 +1867,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1916,6 +1940,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1940,6 +1965,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1947,7 +1973,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1959,6 +1985,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1967,8 +1994,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2053,6 +2080,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2191,6 +2220,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x47 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2488,6 +2518,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x20005437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2501,7 +2596,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2699,6 +2794,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2715,6 +2812,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 __TIOCFLUSH = 0x80047410 ) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go index 78ca92339..5ab9a8277 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -928,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { @@ -2326,6 +2320,27 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc___sysctl_trampoline() + +//go:linkname libc___sysctl libc___sysctl +//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s index f40465ca8..c6557b135 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -106,6 +104,8 @@ TEXT ·libc_chown_trampoline(SB),NOSPLIT,$0-0 JMP libc_chown(SB) TEXT ·libc_chroot_trampoline(SB),NOSPLIT,$0-0 JMP libc_chroot(SB) +TEXT ·libc_clock_gettime_trampoline(SB),NOSPLIT,$0-0 + JMP libc_clock_gettime(SB) TEXT ·libc_close_trampoline(SB),NOSPLIT,$0-0 JMP libc_close(SB) TEXT ·libc_dup_trampoline(SB),NOSPLIT,$0-0 @@ -262,6 +262,8 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 + JMP libc___sysctl(SB) TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go index 2581e8960..985f33888 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -1691,6 +1665,32 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int64, usec int32, err error) { r0, r1, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tp)), 0, 0) sec = int64(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go index 64df03c45..22163ef40 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -2341,6 +2320,27 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc___sysctl_trampoline() + +//go:linkname libc___sysctl libc___sysctl +//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s index debcb8ed3..ad410cfbc 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -264,6 +262,8 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 + JMP libc___sysctl(SB) TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go index f8caecef0..0e47deb78 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go index ed3306239..bbc18c4f6 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -928,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go index 3fd0f3c85..3f4cc0f34 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go index 5258a7328..43356c832 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -928,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s index f57f48f82..96ab9877e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -106,6 +104,8 @@ TEXT ·libc_chown_trampoline(SB),NOSPLIT,$0-0 JMP libc_chown(SB) TEXT ·libc_chroot_trampoline(SB),NOSPLIT,$0-0 JMP libc_chroot(SB) +TEXT ·libc_clock_gettime_trampoline(SB),NOSPLIT,$0-0 + JMP libc_clock_gettime(SB) TEXT ·libc_close_trampoline(SB),NOSPLIT,$0-0 JMP libc_close(SB) TEXT ·libc_dup_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go index e869c0603..7aae554f2 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go @@ -429,4 +429,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go index 4917b8ab6..7968439a9 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go @@ -351,4 +351,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go index f85fcb4f8..3c663c69d 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go index 678a119bc..753def987 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go @@ -296,4 +296,5 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go index 222c9f9a2..ac86bd544 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go @@ -414,4 +414,5 @@ const ( SYS_FSCONFIG = 4431 SYS_FSMOUNT = 4432 SYS_FSPICK = 4433 + SYS_PIDFD_OPEN = 4434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go index 28e6d0e9d..1f5705b58 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go @@ -344,4 +344,5 @@ const ( SYS_FSCONFIG = 5431 SYS_FSMOUNT = 5432 SYS_FSPICK = 5433 + SYS_PIDFD_OPEN = 5434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go index e643c6f63..d9ed95326 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go @@ -344,4 +344,5 @@ const ( SYS_FSCONFIG = 5431 SYS_FSMOUNT = 5432 SYS_FSPICK = 5433 + SYS_PIDFD_OPEN = 5434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go index 01d93c420..94266b65a 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go @@ -414,4 +414,5 @@ const ( SYS_FSCONFIG = 4431 SYS_FSMOUNT = 4432 SYS_FSPICK = 4433 + SYS_PIDFD_OPEN = 4434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go index 5744149eb..52e3da649 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go index 21c832042..6141f90a8 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go index c1bb6d8f2..4f7261a88 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go @@ -295,4 +295,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go index bc3cc6b5b..f47014ac0 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go @@ -358,4 +358,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go index 0a2841ba8..dd78abb0d 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go @@ -373,4 +373,5 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go index 50bc4128f..d02a18350 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -425,6 +432,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -614,6 +622,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -664,6 +673,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2521,3 +2537,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go index 055eaa76a..f347457e9 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -426,6 +433,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -615,6 +623,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -665,6 +674,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2535,3 +2551,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go index 66019c9cf..d53d575b8 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go @@ -289,6 +289,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -429,6 +436,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -618,6 +626,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -668,6 +677,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2512,3 +2528,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go index 3104798c4..aa41189bd 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2514,3 +2530,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go index 46c86021b..913efd616 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go @@ -288,6 +288,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2518,3 +2534,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go index c2fe1a62a..860fb5dae 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2516,3 +2532,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go index f1eb0d397..12138089a 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2516,3 +2532,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go index 8759bc36b..2498796fd 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go @@ -288,6 +288,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2518,3 +2534,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go index a81200541..17b83f758 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go @@ -287,6 +287,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2524,3 +2540,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go index 74b7a9199..d289725b6 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go @@ -287,6 +287,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2524,3 +2540,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go index ccea3e638..7546c1340 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2542,3 +2558,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go index d8fc0bc1c..8907bc74b 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -426,6 +433,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -615,6 +623,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -665,6 +674,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2538,3 +2554,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go index 5e0ab9329..5efa151eb 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go @@ -289,6 +289,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -430,6 +437,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -619,6 +627,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -669,6 +678,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2519,3 +2535,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/windows/syscall_windows.go b/vendor/golang.org/x/sys/windows/syscall_windows.go index abdefc33c..ed36134b2 100644 --- a/vendor/golang.org/x/sys/windows/syscall_windows.go +++ b/vendor/golang.org/x/sys/windows/syscall_windows.go @@ -296,6 +296,10 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys SetVolumeLabel(rootPathName *uint16, volumeName *uint16) (err error) = SetVolumeLabelW //sys SetVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16) (err error) = SetVolumeMountPointW //sys MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret int32, err error) [failretval==0] = user32.MessageBoxW +//sys ExitWindowsEx(flags uint32, reason uint32) (err error) = user32.ExitWindowsEx +//sys InitiateSystemShutdownEx(machineName *uint16, message *uint16, timeout uint32, forceAppsClosed bool, rebootAfterShutdown bool, reason uint32) (err error) = advapi32.InitiateSystemShutdownExW +//sys SetProcessShutdownParameters(level uint32, flags uint32) (err error) = kernel32.SetProcessShutdownParameters +//sys GetProcessShutdownParameters(level *uint32, flags *uint32) (err error) = kernel32.GetProcessShutdownParameters //sys clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) = ole32.CLSIDFromString //sys stringFromGUID2(rguid *GUID, lpsz *uint16, cchMax int32) (chars int32) = ole32.StringFromGUID2 //sys coCreateGuid(pguid *GUID) (ret error) = ole32.CoCreateGuid diff --git a/vendor/golang.org/x/sys/windows/types_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go index 1ef80cd71..a9c1c506d 100644 --- a/vendor/golang.org/x/sys/windows/types_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -1688,3 +1688,68 @@ type OsVersionInfoEx struct { ProductType byte _ byte } + +const ( + EWX_LOGOFF = 0x00000000 + EWX_SHUTDOWN = 0x00000001 + EWX_REBOOT = 0x00000002 + EWX_FORCE = 0x00000004 + EWX_POWEROFF = 0x00000008 + EWX_FORCEIFHUNG = 0x00000010 + EWX_QUICKRESOLVE = 0x00000020 + EWX_RESTARTAPPS = 0x00000040 + EWX_HYBRID_SHUTDOWN = 0x00400000 + EWX_BOOTOPTIONS = 0x01000000 + + SHTDN_REASON_FLAG_COMMENT_REQUIRED = 0x01000000 + SHTDN_REASON_FLAG_DIRTY_PROBLEM_ID_REQUIRED = 0x02000000 + SHTDN_REASON_FLAG_CLEAN_UI = 0x04000000 + SHTDN_REASON_FLAG_DIRTY_UI = 0x08000000 + SHTDN_REASON_FLAG_USER_DEFINED = 0x40000000 + SHTDN_REASON_FLAG_PLANNED = 0x80000000 + SHTDN_REASON_MAJOR_OTHER = 0x00000000 + SHTDN_REASON_MAJOR_NONE = 0x00000000 + SHTDN_REASON_MAJOR_HARDWARE = 0x00010000 + SHTDN_REASON_MAJOR_OPERATINGSYSTEM = 0x00020000 + SHTDN_REASON_MAJOR_SOFTWARE = 0x00030000 + SHTDN_REASON_MAJOR_APPLICATION = 0x00040000 + SHTDN_REASON_MAJOR_SYSTEM = 0x00050000 + SHTDN_REASON_MAJOR_POWER = 0x00060000 + SHTDN_REASON_MAJOR_LEGACY_API = 0x00070000 + SHTDN_REASON_MINOR_OTHER = 0x00000000 + SHTDN_REASON_MINOR_NONE = 0x000000ff + SHTDN_REASON_MINOR_MAINTENANCE = 0x00000001 + SHTDN_REASON_MINOR_INSTALLATION = 0x00000002 + SHTDN_REASON_MINOR_UPGRADE = 0x00000003 + SHTDN_REASON_MINOR_RECONFIG = 0x00000004 + SHTDN_REASON_MINOR_HUNG = 0x00000005 + SHTDN_REASON_MINOR_UNSTABLE = 0x00000006 + SHTDN_REASON_MINOR_DISK = 0x00000007 + SHTDN_REASON_MINOR_PROCESSOR = 0x00000008 + SHTDN_REASON_MINOR_NETWORKCARD = 0x00000009 + SHTDN_REASON_MINOR_POWER_SUPPLY = 0x0000000a + SHTDN_REASON_MINOR_CORDUNPLUGGED = 0x0000000b + SHTDN_REASON_MINOR_ENVIRONMENT = 0x0000000c + SHTDN_REASON_MINOR_HARDWARE_DRIVER = 0x0000000d + SHTDN_REASON_MINOR_OTHERDRIVER = 0x0000000e + SHTDN_REASON_MINOR_BLUESCREEN = 0x0000000F + SHTDN_REASON_MINOR_SERVICEPACK = 0x00000010 + SHTDN_REASON_MINOR_HOTFIX = 0x00000011 + SHTDN_REASON_MINOR_SECURITYFIX = 0x00000012 + SHTDN_REASON_MINOR_SECURITY = 0x00000013 + SHTDN_REASON_MINOR_NETWORK_CONNECTIVITY = 0x00000014 + SHTDN_REASON_MINOR_WMI = 0x00000015 + SHTDN_REASON_MINOR_SERVICEPACK_UNINSTALL = 0x00000016 + SHTDN_REASON_MINOR_HOTFIX_UNINSTALL = 0x00000017 + SHTDN_REASON_MINOR_SECURITYFIX_UNINSTALL = 0x00000018 + SHTDN_REASON_MINOR_MMC = 0x00000019 + SHTDN_REASON_MINOR_SYSTEMRESTORE = 0x0000001a + SHTDN_REASON_MINOR_TERMSRV = 0x00000020 + SHTDN_REASON_MINOR_DC_PROMOTION = 0x00000021 + SHTDN_REASON_MINOR_DC_DEMOTION = 0x00000022 + SHTDN_REASON_UNKNOWN = SHTDN_REASON_MINOR_NONE + SHTDN_REASON_LEGACY_API = SHTDN_REASON_MAJOR_LEGACY_API | SHTDN_REASON_FLAG_PLANNED + SHTDN_REASON_VALID_BIT_MASK = 0xc0ffffff + + SHUTDOWN_NORETRY = 0x1 +) diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index 9c448be31..4a9893242 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -234,6 +234,10 @@ var ( procSetVolumeLabelW = modkernel32.NewProc("SetVolumeLabelW") procSetVolumeMountPointW = modkernel32.NewProc("SetVolumeMountPointW") procMessageBoxW = moduser32.NewProc("MessageBoxW") + procExitWindowsEx = moduser32.NewProc("ExitWindowsEx") + procInitiateSystemShutdownExW = modadvapi32.NewProc("InitiateSystemShutdownExW") + procSetProcessShutdownParameters = modkernel32.NewProc("SetProcessShutdownParameters") + procGetProcessShutdownParameters = modkernel32.NewProc("GetProcessShutdownParameters") procCLSIDFromString = modole32.NewProc("CLSIDFromString") procStringFromGUID2 = modole32.NewProc("StringFromGUID2") procCoCreateGuid = modole32.NewProc("CoCreateGuid") @@ -2584,6 +2588,66 @@ func MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret return } +func ExitWindowsEx(flags uint32, reason uint32) (err error) { + r1, _, e1 := syscall.Syscall(procExitWindowsEx.Addr(), 2, uintptr(flags), uintptr(reason), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func InitiateSystemShutdownEx(machineName *uint16, message *uint16, timeout uint32, forceAppsClosed bool, rebootAfterShutdown bool, reason uint32) (err error) { + var _p0 uint32 + if forceAppsClosed { + _p0 = 1 + } else { + _p0 = 0 + } + var _p1 uint32 + if rebootAfterShutdown { + _p1 = 1 + } else { + _p1 = 0 + } + r1, _, e1 := syscall.Syscall6(procInitiateSystemShutdownExW.Addr(), 6, uintptr(unsafe.Pointer(machineName)), uintptr(unsafe.Pointer(message)), uintptr(timeout), uintptr(_p0), uintptr(_p1), uintptr(reason)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetProcessShutdownParameters(level uint32, flags uint32) (err error) { + r1, _, e1 := syscall.Syscall(procSetProcessShutdownParameters.Addr(), 2, uintptr(level), uintptr(flags), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetProcessShutdownParameters(level *uint32, flags *uint32) (err error) { + r1, _, e1 := syscall.Syscall(procGetProcessShutdownParameters.Addr(), 2, uintptr(unsafe.Pointer(level)), uintptr(unsafe.Pointer(flags)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) { r0, _, _ := syscall.Syscall(procCLSIDFromString.Addr(), 2, uintptr(unsafe.Pointer(lpsz)), uintptr(unsafe.Pointer(pclsid)), 0) if r0 != 0 { diff --git a/vendor/modules.txt b/vendor/modules.txt index 71c50d78d..6584cea1f 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -3,26 +3,28 @@ github.com/Azure/go-ansiterm github.com/Azure/go-ansiterm/winterm # github.com/BurntSushi/toml v0.3.1 github.com/BurntSushi/toml -# github.com/Microsoft/go-winio v0.4.14 +# github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 github.com/Microsoft/go-winio github.com/Microsoft/go-winio/archive/tar github.com/Microsoft/go-winio/backuptar github.com/Microsoft/go-winio/pkg/guid -# github.com/Microsoft/hcsshim v0.8.6 +# github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c github.com/Microsoft/hcsshim -github.com/Microsoft/hcsshim/internal/guestrequest -github.com/Microsoft/hcsshim/internal/guid +github.com/Microsoft/hcsshim/internal/cow github.com/Microsoft/hcsshim/internal/hcs github.com/Microsoft/hcsshim/internal/hcserror github.com/Microsoft/hcsshim/internal/hns github.com/Microsoft/hcsshim/internal/interop +github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields github.com/Microsoft/hcsshim/internal/longpath github.com/Microsoft/hcsshim/internal/mergemaps +github.com/Microsoft/hcsshim/internal/oc github.com/Microsoft/hcsshim/internal/safefile github.com/Microsoft/hcsshim/internal/schema1 github.com/Microsoft/hcsshim/internal/schema2 github.com/Microsoft/hcsshim/internal/timeout +github.com/Microsoft/hcsshim/internal/vmcompute github.com/Microsoft/hcsshim/internal/wclayer github.com/Microsoft/hcsshim/osversion # github.com/VividCortex/ewma v1.1.1 @@ -36,6 +38,8 @@ github.com/buger/goterm # github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b github.com/checkpoint-restore/go-criu github.com/checkpoint-restore/go-criu/rpc +# github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f +github.com/containerd/cgroups/stats/v1 # github.com/containerd/containerd v1.3.0 github.com/containerd/containerd/errdefs # github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc @@ -56,7 +60,7 @@ github.com/containernetworking/plugins/pkg/ns github.com/containernetworking/plugins/pkg/utils/hwaddr github.com/containernetworking/plugins/plugins/ipam/host-local/backend github.com/containernetworking/plugins/plugins/ipam/host-local/backend/allocator -# github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982 +# github.com/containers/buildah v1.11.5 github.com/containers/buildah github.com/containers/buildah/bind github.com/containers/buildah/chroot @@ -188,7 +192,7 @@ github.com/docker/distribution/registry/client/auth/challenge github.com/docker/distribution/registry/client/transport github.com/docker/distribution/registry/storage/cache github.com/docker/distribution/registry/storage/cache/memory -# github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce +# github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 github.com/docker/docker/api github.com/docker/docker/api/types github.com/docker/docker/api/types/blkiodev @@ -248,14 +252,16 @@ github.com/etcd-io/bbolt github.com/fatih/camelcase # github.com/fsnotify/fsnotify v1.4.7 github.com/fsnotify/fsnotify -# github.com/fsouza/go-dockerclient v1.5.0 +# github.com/fsouza/go-dockerclient v1.6.0 github.com/fsouza/go-dockerclient # github.com/ghodss/yaml v1.0.0 github.com/ghodss/yaml -# github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f +# github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e github.com/godbus/dbus # github.com/gogo/protobuf v1.2.2-0.20190723190241-65acae22fc9d +github.com/gogo/protobuf/gogoproto github.com/gogo/protobuf/proto +github.com/gogo/protobuf/protoc-gen-gogo/descriptor github.com/gogo/protobuf/sortkeys # github.com/golang/protobuf v1.3.2 github.com/golang/protobuf/proto @@ -273,6 +279,8 @@ github.com/gorilla/mux github.com/hashicorp/errwrap # github.com/hashicorp/go-multierror v1.0.0 github.com/hashicorp/go-multierror +# github.com/hashicorp/golang-lru v0.5.1 +github.com/hashicorp/golang-lru/simplelru # github.com/hpcloud/tail v1.0.0 github.com/hpcloud/tail github.com/hpcloud/tail/ratelimiter @@ -420,9 +428,10 @@ github.com/prometheus/client_model/go github.com/prometheus/common/expfmt github.com/prometheus/common/internal/bitbucket.org/ww/goautoneg github.com/prometheus/common/model -# github.com/prometheus/procfs v0.0.3 +# github.com/prometheus/procfs v0.0.5 github.com/prometheus/procfs github.com/prometheus/procfs/internal/fs +github.com/prometheus/procfs/internal/util # github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8 github.com/safchain/ethtool # github.com/seccomp/containers-golang v0.0.0-20190312124753-8ca8945ccf5f @@ -492,6 +501,12 @@ github.com/xeipuuv/gojsonpointer github.com/xeipuuv/gojsonreference # github.com/xeipuuv/gojsonschema v1.1.0 github.com/xeipuuv/gojsonschema +# go.opencensus.io v0.22.0 +go.opencensus.io +go.opencensus.io/internal +go.opencensus.io/trace +go.opencensus.io/trace/internal +go.opencensus.io/trace/tracestate # go.uber.org/atomic v1.4.0 go.uber.org/atomic # golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad @@ -521,7 +536,7 @@ golang.org/x/oauth2/internal # golang.org/x/sync v0.0.0-20190423024810-112230192c58 golang.org/x/sync/errgroup golang.org/x/sync/semaphore -# golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 +# golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 golang.org/x/sys/unix golang.org/x/sys/windows # golang.org/x/text v0.3.2 |
