diff options
113 files changed, 5900 insertions, 14650 deletions
@@ -185,7 +185,7 @@ run-perftest: perftest vagrant-check: BOX=$(BOX) sh ./vagrant.sh -binaries: varlink_generate easyjson_generate podman +binaries: varlink_generate podman install.catatonit: ./hack/install_catatonit.sh @@ -265,7 +265,7 @@ uninstall: .PHONY: install.tools -install.tools: .install.gitvalidation .install.gometalinter .install.md2man .install.easyjson .install.ginkgo .install.gomega +install.tools: .install.gitvalidation .install.gometalinter .install.md2man .install.ginkgo .install.gomega .install.gomega: .gopathok $(GO) get github.com/onsi/gomega/... @@ -294,11 +294,6 @@ install.tools: .install.gitvalidation .install.gometalinter .install.md2man .ins $(GO) get -u github.com/cpuguy83/go-md2man; \ fi -.install.easyjson: .gopathok - if [ ! -x "$(GOBIN)/easyffjson" ]; then \ - $(GO) get -u github.com/mailru/easyjson/...; \ - fi - .install.ostree: .gopathok if ! pkg-config ostree-1 2> /dev/null ; then \ git clone https://github.com/ostreedev/ostree $(FIRST_GOPATH)/src/github.com/ostreedev/ostree ; \ @@ -310,16 +305,6 @@ install.tools: .install.gitvalidation .install.gometalinter .install.md2man .ins varlink_generate: .gopathok cmd/podman/varlink/iopodman.go varlink_api_generate: .gopathok API.md -easyjson_generate: .gopathok libpod/container_easyjson.go libpod/pod_easyjson.go - -libpod/container_easyjson.go: libpod/container.go - rm -f libpod/container_easyjson.go - cd "$(GOPKGDIR)" && easyjson -build_tags "$(BUILDTAGS)" ./libpod/container.go - -libpod/pod_easyjson.go: libpod/pod.go - rm -f libpod/pod_easyjson.go - cd "$(GOPKGDIR)" && easyjson -build_tags "$(BUILDTAGS)" ./libpod/pod.go - .PHONY: install.libseccomp.sudo install.libseccomp.sudo: rm -rf ../../seccomp/libseccomp diff --git a/libpod/boltdb_state.go b/libpod/boltdb_state.go index b154d8bda..e7a07a9a8 100644 --- a/libpod/boltdb_state.go +++ b/libpod/boltdb_state.go @@ -2,15 +2,17 @@ package libpod import ( "bytes" - "encoding/json" "strings" "sync" "github.com/boltdb/bolt" + jsoniter "github.com/json-iterator/go" "github.com/pkg/errors" "github.com/sirupsen/logrus" ) +var json = jsoniter.ConfigCompatibleWithStandardLibrary + // BoltState is a state implementation backed by a Bolt DB type BoltState struct { valid bool diff --git a/libpod/boltdb_state_internal.go b/libpod/boltdb_state_internal.go index 29a7184c9..ea150cfac 100644 --- a/libpod/boltdb_state_internal.go +++ b/libpod/boltdb_state_internal.go @@ -2,7 +2,6 @@ package libpod import ( "bytes" - "encoding/json" "runtime" "strings" diff --git a/libpod/common_test.go b/libpod/common_test.go index efbb5f404..4af68a040 100644 --- a/libpod/common_test.go +++ b/libpod/common_test.go @@ -1,7 +1,6 @@ package libpod import ( - "encoding/json" "net" "reflect" "strings" diff --git a/libpod/container.go b/libpod/container.go index 026eb1c4f..ca83bbffe 100644 --- a/libpod/container.go +++ b/libpod/container.go @@ -1,7 +1,6 @@ package libpod import ( - "encoding/json" "fmt" "io/ioutil" "net" diff --git a/libpod/container_easyjson.go b/libpod/container_easyjson.go deleted file mode 100644 index 50741df11..000000000 --- a/libpod/container_easyjson.go +++ /dev/null @@ -1,8203 +0,0 @@ -// +build seccomp ostree selinux varlink exclude_graphdriver_devicemapper - -// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. - -package libpod - -import ( - json "encoding/json" - types "github.com/containernetworking/cni/pkg/types" - current "github.com/containernetworking/cni/pkg/types/current" - namespaces "github.com/containers/libpod/pkg/namespaces" - storage "github.com/containers/storage" - idtools "github.com/containers/storage/pkg/idtools" - ocicni "github.com/cri-o/ocicni/pkg/ocicni" - easyjson "github.com/mailru/easyjson" - jlexer "github.com/mailru/easyjson/jlexer" - jwriter "github.com/mailru/easyjson/jwriter" - specs_go "github.com/opencontainers/runtime-spec/specs-go" - net "net" - os "os" -) - -// suppress unused package warning -var ( - _ *json.RawMessage - _ *jlexer.Lexer - _ *jwriter.Writer - _ easyjson.Marshaler -) - -func easyjson1dbef17bDecodeGithubComContainersLibpodLibpod(in *jlexer.Lexer, out *containerState) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "state": - out.State = ContainerStatus(in.Int()) - case "configPath": - out.ConfigPath = string(in.String()) - case "runDir": - out.RunDir = string(in.String()) - case "destinationRunDir": - out.DestinationRunDir = string(in.String()) - case "mounted": - out.Mounted = bool(in.Bool()) - case "mountPoint": - out.Mountpoint = string(in.String()) - case "realMountPoint": - out.RealMountpoint = string(in.String()) - case "startedTime": - if data := in.Raw(); in.Ok() { - in.AddError((out.StartedTime).UnmarshalJSON(data)) - } - case "finishedTime": - if data := in.Raw(); in.Ok() { - in.AddError((out.FinishedTime).UnmarshalJSON(data)) - } - case "exitCode": - out.ExitCode = int32(in.Int32()) - case "exited": - out.Exited = bool(in.Bool()) - case "oomKilled": - out.OOMKilled = bool(in.Bool()) - case "pid": - out.PID = int(in.Int()) - case "execSessions": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.ExecSessions = make(map[string]*ExecSession) - } else { - out.ExecSessions = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v1 *ExecSession - if in.IsNull() { - in.Skip() - v1 = nil - } else { - if v1 == nil { - v1 = new(ExecSession) - } - if data := in.Raw(); in.Ok() { - in.AddError((*v1).UnmarshalJSON(data)) - } - } - (out.ExecSessions)[key] = v1 - in.WantComma() - } - in.Delim('}') - } - case "networkResults": - if in.IsNull() { - in.Skip() - out.NetworkStatus = nil - } else { - in.Delim('[') - if out.NetworkStatus == nil { - if !in.IsDelim(']') { - out.NetworkStatus = make([]*current.Result, 0, 8) - } else { - out.NetworkStatus = []*current.Result{} - } - } else { - out.NetworkStatus = (out.NetworkStatus)[:0] - } - for !in.IsDelim(']') { - var v2 *current.Result - if in.IsNull() { - in.Skip() - v2 = nil - } else { - if v2 == nil { - v2 = new(current.Result) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent(in, &*v2) - } - out.NetworkStatus = append(out.NetworkStatus, v2) - in.WantComma() - } - in.Delim(']') - } - case "bindMounts": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.BindMounts = make(map[string]string) - } else { - out.BindMounts = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v3 string - v3 = string(in.String()) - (out.BindMounts)[key] = v3 - in.WantComma() - } - in.Delim('}') - } - case "userNSRoot": - out.UserNSRoot = string(in.String()) - case "extensionStageHooks": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.ExtensionStageHooks = make(map[string][]specs_go.Hook) - } else { - out.ExtensionStageHooks = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v4 []specs_go.Hook - if in.IsNull() { - in.Skip() - v4 = nil - } else { - in.Delim('[') - if v4 == nil { - if !in.IsDelim(']') { - v4 = make([]specs_go.Hook, 0, 1) - } else { - v4 = []specs_go.Hook{} - } - } else { - v4 = (v4)[:0] - } - for !in.IsDelim(']') { - var v5 specs_go.Hook - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(in, &v5) - v4 = append(v4, v5) - in.WantComma() - } - in.Delim(']') - } - (out.ExtensionStageHooks)[key] = v4 - in.WantComma() - } - in.Delim('}') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodLibpod(out *jwriter.Writer, in containerState) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"state\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(in.State)) - } - if in.ConfigPath != "" { - const prefix string = ",\"configPath\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ConfigPath)) - } - if in.RunDir != "" { - const prefix string = ",\"runDir\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.RunDir)) - } - if in.DestinationRunDir != "" { - const prefix string = ",\"destinationRunDir\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.DestinationRunDir)) - } - if in.Mounted { - const prefix string = ",\"mounted\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Mounted)) - } - if in.Mountpoint != "" { - const prefix string = ",\"mountPoint\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Mountpoint)) - } - if in.RealMountpoint != "" { - const prefix string = ",\"realMountPoint\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.RealMountpoint)) - } - if true { - const prefix string = ",\"startedTime\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Raw((in.StartedTime).MarshalJSON()) - } - if true { - const prefix string = ",\"finishedTime\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Raw((in.FinishedTime).MarshalJSON()) - } - if in.ExitCode != 0 { - const prefix string = ",\"exitCode\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int32(int32(in.ExitCode)) - } - if in.Exited { - const prefix string = ",\"exited\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Exited)) - } - if in.OOMKilled { - const prefix string = ",\"oomKilled\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.OOMKilled)) - } - if in.PID != 0 { - const prefix string = ",\"pid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(in.PID)) - } - if len(in.ExecSessions) != 0 { - const prefix string = ",\"execSessions\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v6First := true - for v6Name, v6Value := range in.ExecSessions { - if v6First { - v6First = false - } else { - out.RawByte(',') - } - out.String(string(v6Name)) - out.RawByte(':') - if v6Value == nil { - out.RawString("null") - } else { - out.Raw((*v6Value).MarshalJSON()) - } - } - out.RawByte('}') - } - } - if len(in.NetworkStatus) != 0 { - const prefix string = ",\"networkResults\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v7, v8 := range in.NetworkStatus { - if v7 > 0 { - out.RawByte(',') - } - if v8 == nil { - out.RawString("null") - } else { - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent(out, *v8) - } - } - out.RawByte(']') - } - } - if len(in.BindMounts) != 0 { - const prefix string = ",\"bindMounts\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v9First := true - for v9Name, v9Value := range in.BindMounts { - if v9First { - v9First = false - } else { - out.RawByte(',') - } - out.String(string(v9Name)) - out.RawByte(':') - out.String(string(v9Value)) - } - out.RawByte('}') - } - } - if in.UserNSRoot != "" { - const prefix string = ",\"userNSRoot\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.UserNSRoot)) - } - if len(in.ExtensionStageHooks) != 0 { - const prefix string = ",\"extensionStageHooks\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v10First := true - for v10Name, v10Value := range in.ExtensionStageHooks { - if v10First { - v10First = false - } else { - out.RawByte(',') - } - out.String(string(v10Name)) - out.RawByte(':') - if v10Value == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v11, v12 := range v10Value { - if v11 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(out, v12) - } - out.RawByte(']') - } - } - out.RawByte('}') - } - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v containerState) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjson1dbef17bEncodeGithubComContainersLibpodLibpod(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v containerState) MarshalEasyJSON(w *jwriter.Writer) { - easyjson1dbef17bEncodeGithubComContainersLibpodLibpod(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *containerState) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjson1dbef17bDecodeGithubComContainersLibpodLibpod(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *containerState) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjson1dbef17bDecodeGithubComContainersLibpodLibpod(l, v) -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(in *jlexer.Lexer, out *specs_go.Hook) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "path": - out.Path = string(in.String()) - case "args": - if in.IsNull() { - in.Skip() - out.Args = nil - } else { - in.Delim('[') - if out.Args == nil { - if !in.IsDelim(']') { - out.Args = make([]string, 0, 4) - } else { - out.Args = []string{} - } - } else { - out.Args = (out.Args)[:0] - } - for !in.IsDelim(']') { - var v13 string - v13 = string(in.String()) - out.Args = append(out.Args, v13) - in.WantComma() - } - in.Delim(']') - } - case "env": - if in.IsNull() { - in.Skip() - out.Env = nil - } else { - in.Delim('[') - if out.Env == nil { - if !in.IsDelim(']') { - out.Env = make([]string, 0, 4) - } else { - out.Env = []string{} - } - } else { - out.Env = (out.Env)[:0] - } - for !in.IsDelim(']') { - var v14 string - v14 = string(in.String()) - out.Env = append(out.Env, v14) - in.WantComma() - } - in.Delim(']') - } - case "timeout": - if in.IsNull() { - in.Skip() - out.Timeout = nil - } else { - if out.Timeout == nil { - out.Timeout = new(int) - } - *out.Timeout = int(in.Int()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(out *jwriter.Writer, in specs_go.Hook) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - if len(in.Args) != 0 { - const prefix string = ",\"args\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v15, v16 := range in.Args { - if v15 > 0 { - out.RawByte(',') - } - out.String(string(v16)) - } - out.RawByte(']') - } - } - if len(in.Env) != 0 { - const prefix string = ",\"env\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v17, v18 := range in.Env { - if v17 > 0 { - out.RawByte(',') - } - out.String(string(v18)) - } - out.RawByte(']') - } - } - if in.Timeout != nil { - const prefix string = ",\"timeout\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(*in.Timeout)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent(in *jlexer.Lexer, out *current.Result) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "cniVersion": - out.CNIVersion = string(in.String()) - case "interfaces": - if in.IsNull() { - in.Skip() - out.Interfaces = nil - } else { - in.Delim('[') - if out.Interfaces == nil { - if !in.IsDelim(']') { - out.Interfaces = make([]*current.Interface, 0, 8) - } else { - out.Interfaces = []*current.Interface{} - } - } else { - out.Interfaces = (out.Interfaces)[:0] - } - for !in.IsDelim(']') { - var v19 *current.Interface - if in.IsNull() { - in.Skip() - v19 = nil - } else { - if v19 == nil { - v19 = new(current.Interface) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent1(in, &*v19) - } - out.Interfaces = append(out.Interfaces, v19) - in.WantComma() - } - in.Delim(']') - } - case "ips": - if in.IsNull() { - in.Skip() - out.IPs = nil - } else { - in.Delim('[') - if out.IPs == nil { - if !in.IsDelim(']') { - out.IPs = make([]*current.IPConfig, 0, 8) - } else { - out.IPs = []*current.IPConfig{} - } - } else { - out.IPs = (out.IPs)[:0] - } - for !in.IsDelim(']') { - var v20 *current.IPConfig - if in.IsNull() { - in.Skip() - v20 = nil - } else { - if v20 == nil { - v20 = new(current.IPConfig) - } - if data := in.Raw(); in.Ok() { - in.AddError((*v20).UnmarshalJSON(data)) - } - } - out.IPs = append(out.IPs, v20) - in.WantComma() - } - in.Delim(']') - } - case "routes": - if in.IsNull() { - in.Skip() - out.Routes = nil - } else { - in.Delim('[') - if out.Routes == nil { - if !in.IsDelim(']') { - out.Routes = make([]*types.Route, 0, 8) - } else { - out.Routes = []*types.Route{} - } - } else { - out.Routes = (out.Routes)[:0] - } - for !in.IsDelim(']') { - var v21 *types.Route - if in.IsNull() { - in.Skip() - v21 = nil - } else { - if v21 == nil { - v21 = new(types.Route) - } - if data := in.Raw(); in.Ok() { - in.AddError((*v21).UnmarshalJSON(data)) - } - } - out.Routes = append(out.Routes, v21) - in.WantComma() - } - in.Delim(']') - } - case "dns": - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypes(in, &out.DNS) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent(out *jwriter.Writer, in current.Result) { - out.RawByte('{') - first := true - _ = first - if in.CNIVersion != "" { - const prefix string = ",\"cniVersion\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CNIVersion)) - } - if len(in.Interfaces) != 0 { - const prefix string = ",\"interfaces\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v22, v23 := range in.Interfaces { - if v22 > 0 { - out.RawByte(',') - } - if v23 == nil { - out.RawString("null") - } else { - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent1(out, *v23) - } - } - out.RawByte(']') - } - } - if len(in.IPs) != 0 { - const prefix string = ",\"ips\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v24, v25 := range in.IPs { - if v24 > 0 { - out.RawByte(',') - } - if v25 == nil { - out.RawString("null") - } else { - out.Raw((*v25).MarshalJSON()) - } - } - out.RawByte(']') - } - } - if len(in.Routes) != 0 { - const prefix string = ",\"routes\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v26, v27 := range in.Routes { - if v26 > 0 { - out.RawByte(',') - } - if v27 == nil { - out.RawString("null") - } else { - out.Raw((*v27).MarshalJSON()) - } - } - out.RawByte(']') - } - } - if true { - const prefix string = ",\"dns\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypes(out, in.DNS) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypes(in *jlexer.Lexer, out *types.DNS) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "nameservers": - if in.IsNull() { - in.Skip() - out.Nameservers = nil - } else { - in.Delim('[') - if out.Nameservers == nil { - if !in.IsDelim(']') { - out.Nameservers = make([]string, 0, 4) - } else { - out.Nameservers = []string{} - } - } else { - out.Nameservers = (out.Nameservers)[:0] - } - for !in.IsDelim(']') { - var v28 string - v28 = string(in.String()) - out.Nameservers = append(out.Nameservers, v28) - in.WantComma() - } - in.Delim(']') - } - case "domain": - out.Domain = string(in.String()) - case "search": - if in.IsNull() { - in.Skip() - out.Search = nil - } else { - in.Delim('[') - if out.Search == nil { - if !in.IsDelim(']') { - out.Search = make([]string, 0, 4) - } else { - out.Search = []string{} - } - } else { - out.Search = (out.Search)[:0] - } - for !in.IsDelim(']') { - var v29 string - v29 = string(in.String()) - out.Search = append(out.Search, v29) - in.WantComma() - } - in.Delim(']') - } - case "options": - if in.IsNull() { - in.Skip() - out.Options = nil - } else { - in.Delim('[') - if out.Options == nil { - if !in.IsDelim(']') { - out.Options = make([]string, 0, 4) - } else { - out.Options = []string{} - } - } else { - out.Options = (out.Options)[:0] - } - for !in.IsDelim(']') { - var v30 string - v30 = string(in.String()) - out.Options = append(out.Options, v30) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypes(out *jwriter.Writer, in types.DNS) { - out.RawByte('{') - first := true - _ = first - if len(in.Nameservers) != 0 { - const prefix string = ",\"nameservers\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v31, v32 := range in.Nameservers { - if v31 > 0 { - out.RawByte(',') - } - out.String(string(v32)) - } - out.RawByte(']') - } - } - if in.Domain != "" { - const prefix string = ",\"domain\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Domain)) - } - if len(in.Search) != 0 { - const prefix string = ",\"search\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v33, v34 := range in.Search { - if v33 > 0 { - out.RawByte(',') - } - out.String(string(v34)) - } - out.RawByte(']') - } - } - if len(in.Options) != 0 { - const prefix string = ",\"options\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v35, v36 := range in.Options { - if v35 > 0 { - out.RawByte(',') - } - out.String(string(v36)) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent1(in *jlexer.Lexer, out *current.Interface) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "name": - out.Name = string(in.String()) - case "mac": - out.Mac = string(in.String()) - case "sandbox": - out.Sandbox = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainernetworkingCniPkgTypesCurrent1(out *jwriter.Writer, in current.Interface) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"name\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Name)) - } - if in.Mac != "" { - const prefix string = ",\"mac\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Mac)) - } - if in.Sandbox != "" { - const prefix string = ",\"sandbox\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Sandbox)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodLibpod1(in *jlexer.Lexer, out *ExecSession) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "id": - out.ID = string(in.String()) - case "command": - if in.IsNull() { - in.Skip() - out.Command = nil - } else { - in.Delim('[') - if out.Command == nil { - if !in.IsDelim(']') { - out.Command = make([]string, 0, 4) - } else { - out.Command = []string{} - } - } else { - out.Command = (out.Command)[:0] - } - for !in.IsDelim(']') { - var v37 string - v37 = string(in.String()) - out.Command = append(out.Command, v37) - in.WantComma() - } - in.Delim(']') - } - case "pid": - out.PID = int(in.Int()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodLibpod1(out *jwriter.Writer, in ExecSession) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ID)) - } - { - const prefix string = ",\"command\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Command == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v38, v39 := range in.Command { - if v38 > 0 { - out.RawByte(',') - } - out.String(string(v39)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"pid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(in.PID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v ExecSession) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjson1dbef17bEncodeGithubComContainersLibpodLibpod1(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v ExecSession) MarshalEasyJSON(w *jwriter.Writer) { - easyjson1dbef17bEncodeGithubComContainersLibpodLibpod1(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *ExecSession) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjson1dbef17bDecodeGithubComContainersLibpodLibpod1(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *ExecSession) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjson1dbef17bDecodeGithubComContainersLibpodLibpod1(l, v) -} -func easyjson1dbef17bDecodeGithubComContainersLibpodLibpod2(in *jlexer.Lexer, out *ContainerConfig) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "spec": - if in.IsNull() { - in.Skip() - out.Spec = nil - } else { - if out.Spec == nil { - out.Spec = new(specs_go.Spec) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo1(in, &*out.Spec) - } - case "id": - out.ID = string(in.String()) - case "name": - out.Name = string(in.String()) - case "pod": - out.Pod = string(in.String()) - case "namespace": - out.Namespace = string(in.String()) - case "lockID": - out.LockID = uint32(in.Uint32()) - case "idMappingsOptions": - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainersStorage(in, &out.IDMappings) - case "rootfsImageID": - out.RootfsImageID = string(in.String()) - case "rootfsImageName": - out.RootfsImageName = string(in.String()) - case "rootfs": - out.Rootfs = string(in.String()) - case "imageVolumes": - out.ImageVolumes = bool(in.Bool()) - case "ShmDir": - out.ShmDir = string(in.String()) - case "shmSize": - out.ShmSize = int64(in.Int64()) - case "staticDir": - out.StaticDir = string(in.String()) - case "mounts": - if in.IsNull() { - in.Skip() - out.Mounts = nil - } else { - in.Delim('[') - if out.Mounts == nil { - if !in.IsDelim(']') { - out.Mounts = make([]string, 0, 4) - } else { - out.Mounts = []string{} - } - } else { - out.Mounts = (out.Mounts)[:0] - } - for !in.IsDelim(']') { - var v40 string - v40 = string(in.String()) - out.Mounts = append(out.Mounts, v40) - in.WantComma() - } - in.Delim(']') - } - case "privileged": - out.Privileged = bool(in.Bool()) - case "ProcessLabel": - out.ProcessLabel = string(in.String()) - case "MountLabel": - out.MountLabel = string(in.String()) - case "labelopts": - if in.IsNull() { - in.Skip() - out.LabelOpts = nil - } else { - in.Delim('[') - if out.LabelOpts == nil { - if !in.IsDelim(']') { - out.LabelOpts = make([]string, 0, 4) - } else { - out.LabelOpts = []string{} - } - } else { - out.LabelOpts = (out.LabelOpts)[:0] - } - for !in.IsDelim(']') { - var v41 string - v41 = string(in.String()) - out.LabelOpts = append(out.LabelOpts, v41) - in.WantComma() - } - in.Delim(']') - } - case "user": - out.User = string(in.String()) - case "groups": - if in.IsNull() { - in.Skip() - out.Groups = nil - } else { - in.Delim('[') - if out.Groups == nil { - if !in.IsDelim(']') { - out.Groups = make([]string, 0, 4) - } else { - out.Groups = []string{} - } - } else { - out.Groups = (out.Groups)[:0] - } - for !in.IsDelim(']') { - var v42 string - v42 = string(in.String()) - out.Groups = append(out.Groups, v42) - in.WantComma() - } - in.Delim(']') - } - case "ipcNsCtr": - out.IPCNsCtr = string(in.String()) - case "mountNsCtr": - out.MountNsCtr = string(in.String()) - case "netNsCtr": - out.NetNsCtr = string(in.String()) - case "pidNsCtr": - out.PIDNsCtr = string(in.String()) - case "userNsCtr": - out.UserNsCtr = string(in.String()) - case "utsNsCtr": - out.UTSNsCtr = string(in.String()) - case "cgroupNsCtr": - out.CgroupNsCtr = string(in.String()) - case "Dependencies": - if in.IsNull() { - in.Skip() - out.Dependencies = nil - } else { - in.Delim('[') - if out.Dependencies == nil { - if !in.IsDelim(']') { - out.Dependencies = make([]string, 0, 4) - } else { - out.Dependencies = []string{} - } - } else { - out.Dependencies = (out.Dependencies)[:0] - } - for !in.IsDelim(']') { - var v43 string - v43 = string(in.String()) - out.Dependencies = append(out.Dependencies, v43) - in.WantComma() - } - in.Delim(']') - } - case "createNetNS": - out.CreateNetNS = bool(in.Bool()) - case "staticIP": - if data := in.UnsafeBytes(); in.Ok() { - in.AddError((out.StaticIP).UnmarshalText(data)) - } - case "portMappings": - if in.IsNull() { - in.Skip() - out.PortMappings = nil - } else { - in.Delim('[') - if out.PortMappings == nil { - if !in.IsDelim(']') { - out.PortMappings = make([]ocicni.PortMapping, 0, 1) - } else { - out.PortMappings = []ocicni.PortMapping{} - } - } else { - out.PortMappings = (out.PortMappings)[:0] - } - for !in.IsDelim(']') { - var v44 ocicni.PortMapping - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(in, &v44) - out.PortMappings = append(out.PortMappings, v44) - in.WantComma() - } - in.Delim(']') - } - case "dnsServer": - if in.IsNull() { - in.Skip() - out.DNSServer = nil - } else { - in.Delim('[') - if out.DNSServer == nil { - if !in.IsDelim(']') { - out.DNSServer = make([]net.IP, 0, 2) - } else { - out.DNSServer = []net.IP{} - } - } else { - out.DNSServer = (out.DNSServer)[:0] - } - for !in.IsDelim(']') { - var v45 net.IP - if data := in.UnsafeBytes(); in.Ok() { - in.AddError((v45).UnmarshalText(data)) - } - out.DNSServer = append(out.DNSServer, v45) - in.WantComma() - } - in.Delim(']') - } - case "dnsSearch": - if in.IsNull() { - in.Skip() - out.DNSSearch = nil - } else { - in.Delim('[') - if out.DNSSearch == nil { - if !in.IsDelim(']') { - out.DNSSearch = make([]string, 0, 4) - } else { - out.DNSSearch = []string{} - } - } else { - out.DNSSearch = (out.DNSSearch)[:0] - } - for !in.IsDelim(']') { - var v46 string - v46 = string(in.String()) - out.DNSSearch = append(out.DNSSearch, v46) - in.WantComma() - } - in.Delim(']') - } - case "dnsOption": - if in.IsNull() { - in.Skip() - out.DNSOption = nil - } else { - in.Delim('[') - if out.DNSOption == nil { - if !in.IsDelim(']') { - out.DNSOption = make([]string, 0, 4) - } else { - out.DNSOption = []string{} - } - } else { - out.DNSOption = (out.DNSOption)[:0] - } - for !in.IsDelim(']') { - var v47 string - v47 = string(in.String()) - out.DNSOption = append(out.DNSOption, v47) - in.WantComma() - } - in.Delim(']') - } - case "hostsAdd": - if in.IsNull() { - in.Skip() - out.HostAdd = nil - } else { - in.Delim('[') - if out.HostAdd == nil { - if !in.IsDelim(']') { - out.HostAdd = make([]string, 0, 4) - } else { - out.HostAdd = []string{} - } - } else { - out.HostAdd = (out.HostAdd)[:0] - } - for !in.IsDelim(']') { - var v48 string - v48 = string(in.String()) - out.HostAdd = append(out.HostAdd, v48) - in.WantComma() - } - in.Delim(']') - } - case "networks": - if in.IsNull() { - in.Skip() - out.Networks = nil - } else { - in.Delim('[') - if out.Networks == nil { - if !in.IsDelim(']') { - out.Networks = make([]string, 0, 4) - } else { - out.Networks = []string{} - } - } else { - out.Networks = (out.Networks)[:0] - } - for !in.IsDelim(']') { - var v49 string - v49 = string(in.String()) - out.Networks = append(out.Networks, v49) - in.WantComma() - } - in.Delim(']') - } - case "networkMode": - out.NetMode = namespaces.NetworkMode(in.String()) - case "userVolumes": - if in.IsNull() { - in.Skip() - out.UserVolumes = nil - } else { - in.Delim('[') - if out.UserVolumes == nil { - if !in.IsDelim(']') { - out.UserVolumes = make([]string, 0, 4) - } else { - out.UserVolumes = []string{} - } - } else { - out.UserVolumes = (out.UserVolumes)[:0] - } - for !in.IsDelim(']') { - var v50 string - v50 = string(in.String()) - out.UserVolumes = append(out.UserVolumes, v50) - in.WantComma() - } - in.Delim(']') - } - case "entrypoint": - if in.IsNull() { - in.Skip() - out.Entrypoint = nil - } else { - in.Delim('[') - if out.Entrypoint == nil { - if !in.IsDelim(']') { - out.Entrypoint = make([]string, 0, 4) - } else { - out.Entrypoint = []string{} - } - } else { - out.Entrypoint = (out.Entrypoint)[:0] - } - for !in.IsDelim(']') { - var v51 string - v51 = string(in.String()) - out.Entrypoint = append(out.Entrypoint, v51) - in.WantComma() - } - in.Delim(']') - } - case "command": - if in.IsNull() { - in.Skip() - out.Command = nil - } else { - in.Delim('[') - if out.Command == nil { - if !in.IsDelim(']') { - out.Command = make([]string, 0, 4) - } else { - out.Command = []string{} - } - } else { - out.Command = (out.Command)[:0] - } - for !in.IsDelim(']') { - var v52 string - v52 = string(in.String()) - out.Command = append(out.Command, v52) - in.WantComma() - } - in.Delim(']') - } - case "stdin": - out.Stdin = bool(in.Bool()) - case "labels": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.Labels = make(map[string]string) - } else { - out.Labels = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v53 string - v53 = string(in.String()) - (out.Labels)[key] = v53 - in.WantComma() - } - in.Delim('}') - } - case "stopSignal": - out.StopSignal = uint(in.Uint()) - case "stopTimeout": - out.StopTimeout = uint(in.Uint()) - case "createdTime": - if data := in.Raw(); in.Ok() { - in.AddError((out.CreatedTime).UnmarshalJSON(data)) - } - case "cgroupParent": - out.CgroupParent = string(in.String()) - case "logPath": - out.LogPath = string(in.String()) - case "conmonPidFile": - out.ConmonPidFile = string(in.String()) - case "postConfigureNetNS": - out.PostConfigureNetNS = bool(in.Bool()) - case "exitCommand": - if in.IsNull() { - in.Skip() - out.ExitCommand = nil - } else { - in.Delim('[') - if out.ExitCommand == nil { - if !in.IsDelim(']') { - out.ExitCommand = make([]string, 0, 4) - } else { - out.ExitCommand = []string{} - } - } else { - out.ExitCommand = (out.ExitCommand)[:0] - } - for !in.IsDelim(']') { - var v54 string - v54 = string(in.String()) - out.ExitCommand = append(out.ExitCommand, v54) - in.WantComma() - } - in.Delim(']') - } - case "LocalVolumes": - if in.IsNull() { - in.Skip() - out.LocalVolumes = nil - } else { - in.Delim('[') - if out.LocalVolumes == nil { - if !in.IsDelim(']') { - out.LocalVolumes = make([]string, 0, 4) - } else { - out.LocalVolumes = []string{} - } - } else { - out.LocalVolumes = (out.LocalVolumes)[:0] - } - for !in.IsDelim(']') { - var v55 string - v55 = string(in.String()) - out.LocalVolumes = append(out.LocalVolumes, v55) - in.WantComma() - } - in.Delim(']') - } - case "pause": - out.IsInfra = bool(in.Bool()) - case "systemd": - out.Systemd = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodLibpod2(out *jwriter.Writer, in ContainerConfig) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"spec\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Spec == nil { - out.RawString("null") - } else { - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo1(out, *in.Spec) - } - } - { - const prefix string = ",\"id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ID)) - } - { - const prefix string = ",\"name\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Name)) - } - if in.Pod != "" { - const prefix string = ",\"pod\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Pod)) - } - if in.Namespace != "" { - const prefix string = ",\"namespace\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Namespace)) - } - { - const prefix string = ",\"lockID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.LockID)) - } - if true { - const prefix string = ",\"idMappingsOptions\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainersStorage(out, in.IDMappings) - } - if in.RootfsImageID != "" { - const prefix string = ",\"rootfsImageID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.RootfsImageID)) - } - if in.RootfsImageName != "" { - const prefix string = ",\"rootfsImageName\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.RootfsImageName)) - } - if in.Rootfs != "" { - const prefix string = ",\"rootfs\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Rootfs)) - } - { - const prefix string = ",\"imageVolumes\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.ImageVolumes)) - } - if in.ShmDir != "" { - const prefix string = ",\"ShmDir\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ShmDir)) - } - { - const prefix string = ",\"shmSize\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.ShmSize)) - } - { - const prefix string = ",\"staticDir\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.StaticDir)) - } - if len(in.Mounts) != 0 { - const prefix string = ",\"mounts\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v56, v57 := range in.Mounts { - if v56 > 0 { - out.RawByte(',') - } - out.String(string(v57)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"privileged\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Privileged)) - } - if in.ProcessLabel != "" { - const prefix string = ",\"ProcessLabel\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ProcessLabel)) - } - if in.MountLabel != "" { - const prefix string = ",\"MountLabel\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.MountLabel)) - } - if len(in.LabelOpts) != 0 { - const prefix string = ",\"labelopts\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v58, v59 := range in.LabelOpts { - if v58 > 0 { - out.RawByte(',') - } - out.String(string(v59)) - } - out.RawByte(']') - } - } - if in.User != "" { - const prefix string = ",\"user\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.User)) - } - if len(in.Groups) != 0 { - const prefix string = ",\"groups\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v60, v61 := range in.Groups { - if v60 > 0 { - out.RawByte(',') - } - out.String(string(v61)) - } - out.RawByte(']') - } - } - if in.IPCNsCtr != "" { - const prefix string = ",\"ipcNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.IPCNsCtr)) - } - if in.MountNsCtr != "" { - const prefix string = ",\"mountNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.MountNsCtr)) - } - if in.NetNsCtr != "" { - const prefix string = ",\"netNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.NetNsCtr)) - } - if in.PIDNsCtr != "" { - const prefix string = ",\"pidNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.PIDNsCtr)) - } - if in.UserNsCtr != "" { - const prefix string = ",\"userNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.UserNsCtr)) - } - if in.UTSNsCtr != "" { - const prefix string = ",\"utsNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.UTSNsCtr)) - } - if in.CgroupNsCtr != "" { - const prefix string = ",\"cgroupNsCtr\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CgroupNsCtr)) - } - { - const prefix string = ",\"Dependencies\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Dependencies == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v62, v63 := range in.Dependencies { - if v62 > 0 { - out.RawByte(',') - } - out.String(string(v63)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"createNetNS\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.CreateNetNS)) - } - { - const prefix string = ",\"staticIP\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.RawText((in.StaticIP).MarshalText()) - } - if len(in.PortMappings) != 0 { - const prefix string = ",\"portMappings\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v64, v65 := range in.PortMappings { - if v64 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(out, v65) - } - out.RawByte(']') - } - } - if len(in.DNSServer) != 0 { - const prefix string = ",\"dnsServer\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v66, v67 := range in.DNSServer { - if v66 > 0 { - out.RawByte(',') - } - out.RawText((v67).MarshalText()) - } - out.RawByte(']') - } - } - if len(in.DNSSearch) != 0 { - const prefix string = ",\"dnsSearch\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v68, v69 := range in.DNSSearch { - if v68 > 0 { - out.RawByte(',') - } - out.String(string(v69)) - } - out.RawByte(']') - } - } - if len(in.DNSOption) != 0 { - const prefix string = ",\"dnsOption\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v70, v71 := range in.DNSOption { - if v70 > 0 { - out.RawByte(',') - } - out.String(string(v71)) - } - out.RawByte(']') - } - } - if len(in.HostAdd) != 0 { - const prefix string = ",\"hostsAdd\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v72, v73 := range in.HostAdd { - if v72 > 0 { - out.RawByte(',') - } - out.String(string(v73)) - } - out.RawByte(']') - } - } - if len(in.Networks) != 0 { - const prefix string = ",\"networks\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v74, v75 := range in.Networks { - if v74 > 0 { - out.RawByte(',') - } - out.String(string(v75)) - } - out.RawByte(']') - } - } - if in.NetMode != "" { - const prefix string = ",\"networkMode\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.NetMode)) - } - if len(in.UserVolumes) != 0 { - const prefix string = ",\"userVolumes\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v76, v77 := range in.UserVolumes { - if v76 > 0 { - out.RawByte(',') - } - out.String(string(v77)) - } - out.RawByte(']') - } - } - if len(in.Entrypoint) != 0 { - const prefix string = ",\"entrypoint\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v78, v79 := range in.Entrypoint { - if v78 > 0 { - out.RawByte(',') - } - out.String(string(v79)) - } - out.RawByte(']') - } - } - if len(in.Command) != 0 { - const prefix string = ",\"command\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v80, v81 := range in.Command { - if v80 > 0 { - out.RawByte(',') - } - out.String(string(v81)) - } - out.RawByte(']') - } - } - if in.Stdin { - const prefix string = ",\"stdin\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Stdin)) - } - if len(in.Labels) != 0 { - const prefix string = ",\"labels\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v82First := true - for v82Name, v82Value := range in.Labels { - if v82First { - v82First = false - } else { - out.RawByte(',') - } - out.String(string(v82Name)) - out.RawByte(':') - out.String(string(v82Value)) - } - out.RawByte('}') - } - } - if in.StopSignal != 0 { - const prefix string = ",\"stopSignal\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint(uint(in.StopSignal)) - } - if in.StopTimeout != 0 { - const prefix string = ",\"stopTimeout\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint(uint(in.StopTimeout)) - } - { - const prefix string = ",\"createdTime\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Raw((in.CreatedTime).MarshalJSON()) - } - { - const prefix string = ",\"cgroupParent\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CgroupParent)) - } - { - const prefix string = ",\"logPath\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.LogPath)) - } - if in.ConmonPidFile != "" { - const prefix string = ",\"conmonPidFile\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ConmonPidFile)) - } - { - const prefix string = ",\"postConfigureNetNS\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.PostConfigureNetNS)) - } - if len(in.ExitCommand) != 0 { - const prefix string = ",\"exitCommand\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v83, v84 := range in.ExitCommand { - if v83 > 0 { - out.RawByte(',') - } - out.String(string(v84)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"LocalVolumes\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.LocalVolumes == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v85, v86 := range in.LocalVolumes { - if v85 > 0 { - out.RawByte(',') - } - out.String(string(v86)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"pause\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.IsInfra)) - } - { - const prefix string = ",\"systemd\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Systemd)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v ContainerConfig) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjson1dbef17bEncodeGithubComContainersLibpodLibpod2(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v ContainerConfig) MarshalEasyJSON(w *jwriter.Writer) { - easyjson1dbef17bEncodeGithubComContainersLibpodLibpod2(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *ContainerConfig) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjson1dbef17bDecodeGithubComContainersLibpodLibpod2(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *ContainerConfig) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjson1dbef17bDecodeGithubComContainersLibpodLibpod2(l, v) -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(in *jlexer.Lexer, out *ocicni.PortMapping) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "hostPort": - out.HostPort = int32(in.Int32()) - case "containerPort": - out.ContainerPort = int32(in.Int32()) - case "protocol": - out.Protocol = string(in.String()) - case "hostIP": - out.HostIP = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(out *jwriter.Writer, in ocicni.PortMapping) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"hostPort\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int32(int32(in.HostPort)) - } - { - const prefix string = ",\"containerPort\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int32(int32(in.ContainerPort)) - } - { - const prefix string = ",\"protocol\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Protocol)) - } - { - const prefix string = ",\"hostIP\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.HostIP)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainersStorage(in *jlexer.Lexer, out *storage.IDMappingOptions) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "HostUIDMapping": - out.HostUIDMapping = bool(in.Bool()) - case "HostGIDMapping": - out.HostGIDMapping = bool(in.Bool()) - case "UIDMap": - if in.IsNull() { - in.Skip() - out.UIDMap = nil - } else { - in.Delim('[') - if out.UIDMap == nil { - if !in.IsDelim(']') { - out.UIDMap = make([]idtools.IDMap, 0, 2) - } else { - out.UIDMap = []idtools.IDMap{} - } - } else { - out.UIDMap = (out.UIDMap)[:0] - } - for !in.IsDelim(']') { - var v87 idtools.IDMap - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainersStoragePkgIdtools(in, &v87) - out.UIDMap = append(out.UIDMap, v87) - in.WantComma() - } - in.Delim(']') - } - case "GIDMap": - if in.IsNull() { - in.Skip() - out.GIDMap = nil - } else { - in.Delim('[') - if out.GIDMap == nil { - if !in.IsDelim(']') { - out.GIDMap = make([]idtools.IDMap, 0, 2) - } else { - out.GIDMap = []idtools.IDMap{} - } - } else { - out.GIDMap = (out.GIDMap)[:0] - } - for !in.IsDelim(']') { - var v88 idtools.IDMap - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainersStoragePkgIdtools(in, &v88) - out.GIDMap = append(out.GIDMap, v88) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainersStorage(out *jwriter.Writer, in storage.IDMappingOptions) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"HostUIDMapping\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.HostUIDMapping)) - } - { - const prefix string = ",\"HostGIDMapping\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.HostGIDMapping)) - } - { - const prefix string = ",\"UIDMap\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.UIDMap == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v89, v90 := range in.UIDMap { - if v89 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainersStoragePkgIdtools(out, v90) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"GIDMap\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.GIDMap == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v91, v92 := range in.GIDMap { - if v91 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainersStoragePkgIdtools(out, v92) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComContainersStoragePkgIdtools(in *jlexer.Lexer, out *idtools.IDMap) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "container_id": - out.ContainerID = int(in.Int()) - case "host_id": - out.HostID = int(in.Int()) - case "size": - out.Size = int(in.Int()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComContainersStoragePkgIdtools(out *jwriter.Writer, in idtools.IDMap) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"container_id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(in.ContainerID)) - } - { - const prefix string = ",\"host_id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(in.HostID)) - } - { - const prefix string = ",\"size\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(in.Size)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo1(in *jlexer.Lexer, out *specs_go.Spec) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "ociVersion": - out.Version = string(in.String()) - case "process": - if in.IsNull() { - in.Skip() - out.Process = nil - } else { - if out.Process == nil { - out.Process = new(specs_go.Process) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo2(in, &*out.Process) - } - case "root": - if in.IsNull() { - in.Skip() - out.Root = nil - } else { - if out.Root == nil { - out.Root = new(specs_go.Root) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo3(in, &*out.Root) - } - case "hostname": - out.Hostname = string(in.String()) - case "mounts": - if in.IsNull() { - in.Skip() - out.Mounts = nil - } else { - in.Delim('[') - if out.Mounts == nil { - if !in.IsDelim(']') { - out.Mounts = make([]specs_go.Mount, 0, 1) - } else { - out.Mounts = []specs_go.Mount{} - } - } else { - out.Mounts = (out.Mounts)[:0] - } - for !in.IsDelim(']') { - var v93 specs_go.Mount - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo4(in, &v93) - out.Mounts = append(out.Mounts, v93) - in.WantComma() - } - in.Delim(']') - } - case "hooks": - if in.IsNull() { - in.Skip() - out.Hooks = nil - } else { - if out.Hooks == nil { - out.Hooks = new(specs_go.Hooks) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo5(in, &*out.Hooks) - } - case "annotations": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.Annotations = make(map[string]string) - } else { - out.Annotations = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v94 string - v94 = string(in.String()) - (out.Annotations)[key] = v94 - in.WantComma() - } - in.Delim('}') - } - case "linux": - if in.IsNull() { - in.Skip() - out.Linux = nil - } else { - if out.Linux == nil { - out.Linux = new(specs_go.Linux) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo6(in, &*out.Linux) - } - case "solaris": - if in.IsNull() { - in.Skip() - out.Solaris = nil - } else { - if out.Solaris == nil { - out.Solaris = new(specs_go.Solaris) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo7(in, &*out.Solaris) - } - case "windows": - if in.IsNull() { - in.Skip() - out.Windows = nil - } else { - if out.Windows == nil { - out.Windows = new(specs_go.Windows) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo8(in, &*out.Windows) - } - case "vm": - if in.IsNull() { - in.Skip() - out.VM = nil - } else { - if out.VM == nil { - out.VM = new(specs_go.VM) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo9(in, &*out.VM) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo1(out *jwriter.Writer, in specs_go.Spec) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"ociVersion\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Version)) - } - if in.Process != nil { - const prefix string = ",\"process\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo2(out, *in.Process) - } - if in.Root != nil { - const prefix string = ",\"root\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo3(out, *in.Root) - } - if in.Hostname != "" { - const prefix string = ",\"hostname\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Hostname)) - } - if len(in.Mounts) != 0 { - const prefix string = ",\"mounts\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v95, v96 := range in.Mounts { - if v95 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo4(out, v96) - } - out.RawByte(']') - } - } - if in.Hooks != nil { - const prefix string = ",\"hooks\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo5(out, *in.Hooks) - } - if len(in.Annotations) != 0 { - const prefix string = ",\"annotations\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v97First := true - for v97Name, v97Value := range in.Annotations { - if v97First { - v97First = false - } else { - out.RawByte(',') - } - out.String(string(v97Name)) - out.RawByte(':') - out.String(string(v97Value)) - } - out.RawByte('}') - } - } - if in.Linux != nil { - const prefix string = ",\"linux\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo6(out, *in.Linux) - } - if in.Solaris != nil { - const prefix string = ",\"solaris\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo7(out, *in.Solaris) - } - if in.Windows != nil { - const prefix string = ",\"windows\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo8(out, *in.Windows) - } - if in.VM != nil { - const prefix string = ",\"vm\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo9(out, *in.VM) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo9(in *jlexer.Lexer, out *specs_go.VM) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "hypervisor": - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo10(in, &out.Hypervisor) - case "kernel": - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo11(in, &out.Kernel) - case "image": - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo12(in, &out.Image) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo9(out *jwriter.Writer, in specs_go.VM) { - out.RawByte('{') - first := true - _ = first - if true { - const prefix string = ",\"hypervisor\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo10(out, in.Hypervisor) - } - { - const prefix string = ",\"kernel\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo11(out, in.Kernel) - } - if true { - const prefix string = ",\"image\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo12(out, in.Image) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo12(in *jlexer.Lexer, out *specs_go.VMImage) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "path": - out.Path = string(in.String()) - case "format": - out.Format = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo12(out *jwriter.Writer, in specs_go.VMImage) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - { - const prefix string = ",\"format\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Format)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo11(in *jlexer.Lexer, out *specs_go.VMKernel) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "path": - out.Path = string(in.String()) - case "parameters": - out.Parameters = string(in.String()) - case "initrd": - out.InitRD = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo11(out *jwriter.Writer, in specs_go.VMKernel) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - if in.Parameters != "" { - const prefix string = ",\"parameters\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Parameters)) - } - if in.InitRD != "" { - const prefix string = ",\"initrd\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.InitRD)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo10(in *jlexer.Lexer, out *specs_go.VMHypervisor) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "path": - out.Path = string(in.String()) - case "parameters": - out.Parameters = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo10(out *jwriter.Writer, in specs_go.VMHypervisor) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - if in.Parameters != "" { - const prefix string = ",\"parameters\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Parameters)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo8(in *jlexer.Lexer, out *specs_go.Windows) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "layerFolders": - if in.IsNull() { - in.Skip() - out.LayerFolders = nil - } else { - in.Delim('[') - if out.LayerFolders == nil { - if !in.IsDelim(']') { - out.LayerFolders = make([]string, 0, 4) - } else { - out.LayerFolders = []string{} - } - } else { - out.LayerFolders = (out.LayerFolders)[:0] - } - for !in.IsDelim(']') { - var v98 string - v98 = string(in.String()) - out.LayerFolders = append(out.LayerFolders, v98) - in.WantComma() - } - in.Delim(']') - } - case "devices": - if in.IsNull() { - in.Skip() - out.Devices = nil - } else { - in.Delim('[') - if out.Devices == nil { - if !in.IsDelim(']') { - out.Devices = make([]specs_go.WindowsDevice, 0, 2) - } else { - out.Devices = []specs_go.WindowsDevice{} - } - } else { - out.Devices = (out.Devices)[:0] - } - for !in.IsDelim(']') { - var v99 specs_go.WindowsDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo13(in, &v99) - out.Devices = append(out.Devices, v99) - in.WantComma() - } - in.Delim(']') - } - case "resources": - if in.IsNull() { - in.Skip() - out.Resources = nil - } else { - if out.Resources == nil { - out.Resources = new(specs_go.WindowsResources) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo14(in, &*out.Resources) - } - case "credentialSpec": - if m, ok := out.CredentialSpec.(easyjson.Unmarshaler); ok { - m.UnmarshalEasyJSON(in) - } else if m, ok := out.CredentialSpec.(json.Unmarshaler); ok { - _ = m.UnmarshalJSON(in.Raw()) - } else { - out.CredentialSpec = in.Interface() - } - case "servicing": - out.Servicing = bool(in.Bool()) - case "ignoreFlushesDuringBoot": - out.IgnoreFlushesDuringBoot = bool(in.Bool()) - case "hyperv": - if in.IsNull() { - in.Skip() - out.HyperV = nil - } else { - if out.HyperV == nil { - out.HyperV = new(specs_go.WindowsHyperV) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo15(in, &*out.HyperV) - } - case "network": - if in.IsNull() { - in.Skip() - out.Network = nil - } else { - if out.Network == nil { - out.Network = new(specs_go.WindowsNetwork) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo16(in, &*out.Network) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo8(out *jwriter.Writer, in specs_go.Windows) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"layerFolders\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.LayerFolders == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v100, v101 := range in.LayerFolders { - if v100 > 0 { - out.RawByte(',') - } - out.String(string(v101)) - } - out.RawByte(']') - } - } - if len(in.Devices) != 0 { - const prefix string = ",\"devices\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v102, v103 := range in.Devices { - if v102 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo13(out, v103) - } - out.RawByte(']') - } - } - if in.Resources != nil { - const prefix string = ",\"resources\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo14(out, *in.Resources) - } - if in.CredentialSpec != nil { - const prefix string = ",\"credentialSpec\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if m, ok := in.CredentialSpec.(easyjson.Marshaler); ok { - m.MarshalEasyJSON(out) - } else if m, ok := in.CredentialSpec.(json.Marshaler); ok { - out.Raw(m.MarshalJSON()) - } else { - out.Raw(json.Marshal(in.CredentialSpec)) - } - } - if in.Servicing { - const prefix string = ",\"servicing\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Servicing)) - } - if in.IgnoreFlushesDuringBoot { - const prefix string = ",\"ignoreFlushesDuringBoot\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.IgnoreFlushesDuringBoot)) - } - if in.HyperV != nil { - const prefix string = ",\"hyperv\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo15(out, *in.HyperV) - } - if in.Network != nil { - const prefix string = ",\"network\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo16(out, *in.Network) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo16(in *jlexer.Lexer, out *specs_go.WindowsNetwork) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "endpointList": - if in.IsNull() { - in.Skip() - out.EndpointList = nil - } else { - in.Delim('[') - if out.EndpointList == nil { - if !in.IsDelim(']') { - out.EndpointList = make([]string, 0, 4) - } else { - out.EndpointList = []string{} - } - } else { - out.EndpointList = (out.EndpointList)[:0] - } - for !in.IsDelim(']') { - var v104 string - v104 = string(in.String()) - out.EndpointList = append(out.EndpointList, v104) - in.WantComma() - } - in.Delim(']') - } - case "allowUnqualifiedDNSQuery": - out.AllowUnqualifiedDNSQuery = bool(in.Bool()) - case "DNSSearchList": - if in.IsNull() { - in.Skip() - out.DNSSearchList = nil - } else { - in.Delim('[') - if out.DNSSearchList == nil { - if !in.IsDelim(']') { - out.DNSSearchList = make([]string, 0, 4) - } else { - out.DNSSearchList = []string{} - } - } else { - out.DNSSearchList = (out.DNSSearchList)[:0] - } - for !in.IsDelim(']') { - var v105 string - v105 = string(in.String()) - out.DNSSearchList = append(out.DNSSearchList, v105) - in.WantComma() - } - in.Delim(']') - } - case "networkSharedContainerName": - out.NetworkSharedContainerName = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo16(out *jwriter.Writer, in specs_go.WindowsNetwork) { - out.RawByte('{') - first := true - _ = first - if len(in.EndpointList) != 0 { - const prefix string = ",\"endpointList\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v106, v107 := range in.EndpointList { - if v106 > 0 { - out.RawByte(',') - } - out.String(string(v107)) - } - out.RawByte(']') - } - } - if in.AllowUnqualifiedDNSQuery { - const prefix string = ",\"allowUnqualifiedDNSQuery\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.AllowUnqualifiedDNSQuery)) - } - if len(in.DNSSearchList) != 0 { - const prefix string = ",\"DNSSearchList\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v108, v109 := range in.DNSSearchList { - if v108 > 0 { - out.RawByte(',') - } - out.String(string(v109)) - } - out.RawByte(']') - } - } - if in.NetworkSharedContainerName != "" { - const prefix string = ",\"networkSharedContainerName\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.NetworkSharedContainerName)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo15(in *jlexer.Lexer, out *specs_go.WindowsHyperV) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "utilityVMPath": - out.UtilityVMPath = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo15(out *jwriter.Writer, in specs_go.WindowsHyperV) { - out.RawByte('{') - first := true - _ = first - if in.UtilityVMPath != "" { - const prefix string = ",\"utilityVMPath\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.UtilityVMPath)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo14(in *jlexer.Lexer, out *specs_go.WindowsResources) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "memory": - if in.IsNull() { - in.Skip() - out.Memory = nil - } else { - if out.Memory == nil { - out.Memory = new(specs_go.WindowsMemoryResources) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo17(in, &*out.Memory) - } - case "cpu": - if in.IsNull() { - in.Skip() - out.CPU = nil - } else { - if out.CPU == nil { - out.CPU = new(specs_go.WindowsCPUResources) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo18(in, &*out.CPU) - } - case "storage": - if in.IsNull() { - in.Skip() - out.Storage = nil - } else { - if out.Storage == nil { - out.Storage = new(specs_go.WindowsStorageResources) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo19(in, &*out.Storage) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo14(out *jwriter.Writer, in specs_go.WindowsResources) { - out.RawByte('{') - first := true - _ = first - if in.Memory != nil { - const prefix string = ",\"memory\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo17(out, *in.Memory) - } - if in.CPU != nil { - const prefix string = ",\"cpu\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo18(out, *in.CPU) - } - if in.Storage != nil { - const prefix string = ",\"storage\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo19(out, *in.Storage) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo19(in *jlexer.Lexer, out *specs_go.WindowsStorageResources) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "iops": - if in.IsNull() { - in.Skip() - out.Iops = nil - } else { - if out.Iops == nil { - out.Iops = new(uint64) - } - *out.Iops = uint64(in.Uint64()) - } - case "bps": - if in.IsNull() { - in.Skip() - out.Bps = nil - } else { - if out.Bps == nil { - out.Bps = new(uint64) - } - *out.Bps = uint64(in.Uint64()) - } - case "sandboxSize": - if in.IsNull() { - in.Skip() - out.SandboxSize = nil - } else { - if out.SandboxSize == nil { - out.SandboxSize = new(uint64) - } - *out.SandboxSize = uint64(in.Uint64()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo19(out *jwriter.Writer, in specs_go.WindowsStorageResources) { - out.RawByte('{') - first := true - _ = first - if in.Iops != nil { - const prefix string = ",\"iops\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Iops)) - } - if in.Bps != nil { - const prefix string = ",\"bps\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Bps)) - } - if in.SandboxSize != nil { - const prefix string = ",\"sandboxSize\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.SandboxSize)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo18(in *jlexer.Lexer, out *specs_go.WindowsCPUResources) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "count": - if in.IsNull() { - in.Skip() - out.Count = nil - } else { - if out.Count == nil { - out.Count = new(uint64) - } - *out.Count = uint64(in.Uint64()) - } - case "shares": - if in.IsNull() { - in.Skip() - out.Shares = nil - } else { - if out.Shares == nil { - out.Shares = new(uint16) - } - *out.Shares = uint16(in.Uint16()) - } - case "maximum": - if in.IsNull() { - in.Skip() - out.Maximum = nil - } else { - if out.Maximum == nil { - out.Maximum = new(uint16) - } - *out.Maximum = uint16(in.Uint16()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo18(out *jwriter.Writer, in specs_go.WindowsCPUResources) { - out.RawByte('{') - first := true - _ = first - if in.Count != nil { - const prefix string = ",\"count\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Count)) - } - if in.Shares != nil { - const prefix string = ",\"shares\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint16(uint16(*in.Shares)) - } - if in.Maximum != nil { - const prefix string = ",\"maximum\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint16(uint16(*in.Maximum)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo17(in *jlexer.Lexer, out *specs_go.WindowsMemoryResources) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "limit": - if in.IsNull() { - in.Skip() - out.Limit = nil - } else { - if out.Limit == nil { - out.Limit = new(uint64) - } - *out.Limit = uint64(in.Uint64()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo17(out *jwriter.Writer, in specs_go.WindowsMemoryResources) { - out.RawByte('{') - first := true - _ = first - if in.Limit != nil { - const prefix string = ",\"limit\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Limit)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo13(in *jlexer.Lexer, out *specs_go.WindowsDevice) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "id": - out.ID = string(in.String()) - case "idType": - out.IDType = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo13(out *jwriter.Writer, in specs_go.WindowsDevice) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ID)) - } - { - const prefix string = ",\"idType\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.IDType)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo7(in *jlexer.Lexer, out *specs_go.Solaris) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "milestone": - out.Milestone = string(in.String()) - case "limitpriv": - out.LimitPriv = string(in.String()) - case "maxShmMemory": - out.MaxShmMemory = string(in.String()) - case "anet": - if in.IsNull() { - in.Skip() - out.Anet = nil - } else { - in.Delim('[') - if out.Anet == nil { - if !in.IsDelim(']') { - out.Anet = make([]specs_go.SolarisAnet, 0, 1) - } else { - out.Anet = []specs_go.SolarisAnet{} - } - } else { - out.Anet = (out.Anet)[:0] - } - for !in.IsDelim(']') { - var v110 specs_go.SolarisAnet - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo20(in, &v110) - out.Anet = append(out.Anet, v110) - in.WantComma() - } - in.Delim(']') - } - case "cappedCPU": - if in.IsNull() { - in.Skip() - out.CappedCPU = nil - } else { - if out.CappedCPU == nil { - out.CappedCPU = new(specs_go.SolarisCappedCPU) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo21(in, &*out.CappedCPU) - } - case "cappedMemory": - if in.IsNull() { - in.Skip() - out.CappedMemory = nil - } else { - if out.CappedMemory == nil { - out.CappedMemory = new(specs_go.SolarisCappedMemory) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo22(in, &*out.CappedMemory) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo7(out *jwriter.Writer, in specs_go.Solaris) { - out.RawByte('{') - first := true - _ = first - if in.Milestone != "" { - const prefix string = ",\"milestone\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Milestone)) - } - if in.LimitPriv != "" { - const prefix string = ",\"limitpriv\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.LimitPriv)) - } - if in.MaxShmMemory != "" { - const prefix string = ",\"maxShmMemory\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.MaxShmMemory)) - } - if len(in.Anet) != 0 { - const prefix string = ",\"anet\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v111, v112 := range in.Anet { - if v111 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo20(out, v112) - } - out.RawByte(']') - } - } - if in.CappedCPU != nil { - const prefix string = ",\"cappedCPU\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo21(out, *in.CappedCPU) - } - if in.CappedMemory != nil { - const prefix string = ",\"cappedMemory\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo22(out, *in.CappedMemory) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo22(in *jlexer.Lexer, out *specs_go.SolarisCappedMemory) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "physical": - out.Physical = string(in.String()) - case "swap": - out.Swap = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo22(out *jwriter.Writer, in specs_go.SolarisCappedMemory) { - out.RawByte('{') - first := true - _ = first - if in.Physical != "" { - const prefix string = ",\"physical\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Physical)) - } - if in.Swap != "" { - const prefix string = ",\"swap\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Swap)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo21(in *jlexer.Lexer, out *specs_go.SolarisCappedCPU) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "ncpus": - out.Ncpus = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo21(out *jwriter.Writer, in specs_go.SolarisCappedCPU) { - out.RawByte('{') - first := true - _ = first - if in.Ncpus != "" { - const prefix string = ",\"ncpus\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Ncpus)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo20(in *jlexer.Lexer, out *specs_go.SolarisAnet) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "linkname": - out.Linkname = string(in.String()) - case "lowerLink": - out.Lowerlink = string(in.String()) - case "allowedAddress": - out.Allowedaddr = string(in.String()) - case "configureAllowedAddress": - out.Configallowedaddr = string(in.String()) - case "defrouter": - out.Defrouter = string(in.String()) - case "linkProtection": - out.Linkprotection = string(in.String()) - case "macAddress": - out.Macaddress = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo20(out *jwriter.Writer, in specs_go.SolarisAnet) { - out.RawByte('{') - first := true - _ = first - if in.Linkname != "" { - const prefix string = ",\"linkname\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Linkname)) - } - if in.Lowerlink != "" { - const prefix string = ",\"lowerLink\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Lowerlink)) - } - if in.Allowedaddr != "" { - const prefix string = ",\"allowedAddress\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Allowedaddr)) - } - if in.Configallowedaddr != "" { - const prefix string = ",\"configureAllowedAddress\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Configallowedaddr)) - } - if in.Defrouter != "" { - const prefix string = ",\"defrouter\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Defrouter)) - } - if in.Linkprotection != "" { - const prefix string = ",\"linkProtection\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Linkprotection)) - } - if in.Macaddress != "" { - const prefix string = ",\"macAddress\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Macaddress)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo6(in *jlexer.Lexer, out *specs_go.Linux) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "uidMappings": - if in.IsNull() { - in.Skip() - out.UIDMappings = nil - } else { - in.Delim('[') - if out.UIDMappings == nil { - if !in.IsDelim(']') { - out.UIDMappings = make([]specs_go.LinuxIDMapping, 0, 5) - } else { - out.UIDMappings = []specs_go.LinuxIDMapping{} - } - } else { - out.UIDMappings = (out.UIDMappings)[:0] - } - for !in.IsDelim(']') { - var v113 specs_go.LinuxIDMapping - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo23(in, &v113) - out.UIDMappings = append(out.UIDMappings, v113) - in.WantComma() - } - in.Delim(']') - } - case "gidMappings": - if in.IsNull() { - in.Skip() - out.GIDMappings = nil - } else { - in.Delim('[') - if out.GIDMappings == nil { - if !in.IsDelim(']') { - out.GIDMappings = make([]specs_go.LinuxIDMapping, 0, 5) - } else { - out.GIDMappings = []specs_go.LinuxIDMapping{} - } - } else { - out.GIDMappings = (out.GIDMappings)[:0] - } - for !in.IsDelim(']') { - var v114 specs_go.LinuxIDMapping - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo23(in, &v114) - out.GIDMappings = append(out.GIDMappings, v114) - in.WantComma() - } - in.Delim(']') - } - case "sysctl": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.Sysctl = make(map[string]string) - } else { - out.Sysctl = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v115 string - v115 = string(in.String()) - (out.Sysctl)[key] = v115 - in.WantComma() - } - in.Delim('}') - } - case "resources": - if in.IsNull() { - in.Skip() - out.Resources = nil - } else { - if out.Resources == nil { - out.Resources = new(specs_go.LinuxResources) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo24(in, &*out.Resources) - } - case "cgroupsPath": - out.CgroupsPath = string(in.String()) - case "namespaces": - if in.IsNull() { - in.Skip() - out.Namespaces = nil - } else { - in.Delim('[') - if out.Namespaces == nil { - if !in.IsDelim(']') { - out.Namespaces = make([]specs_go.LinuxNamespace, 0, 2) - } else { - out.Namespaces = []specs_go.LinuxNamespace{} - } - } else { - out.Namespaces = (out.Namespaces)[:0] - } - for !in.IsDelim(']') { - var v116 specs_go.LinuxNamespace - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo25(in, &v116) - out.Namespaces = append(out.Namespaces, v116) - in.WantComma() - } - in.Delim(']') - } - case "devices": - if in.IsNull() { - in.Skip() - out.Devices = nil - } else { - in.Delim('[') - if out.Devices == nil { - if !in.IsDelim(']') { - out.Devices = make([]specs_go.LinuxDevice, 0, 1) - } else { - out.Devices = []specs_go.LinuxDevice{} - } - } else { - out.Devices = (out.Devices)[:0] - } - for !in.IsDelim(']') { - var v117 specs_go.LinuxDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo26(in, &v117) - out.Devices = append(out.Devices, v117) - in.WantComma() - } - in.Delim(']') - } - case "seccomp": - if in.IsNull() { - in.Skip() - out.Seccomp = nil - } else { - if out.Seccomp == nil { - out.Seccomp = new(specs_go.LinuxSeccomp) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo27(in, &*out.Seccomp) - } - case "rootfsPropagation": - out.RootfsPropagation = string(in.String()) - case "maskedPaths": - if in.IsNull() { - in.Skip() - out.MaskedPaths = nil - } else { - in.Delim('[') - if out.MaskedPaths == nil { - if !in.IsDelim(']') { - out.MaskedPaths = make([]string, 0, 4) - } else { - out.MaskedPaths = []string{} - } - } else { - out.MaskedPaths = (out.MaskedPaths)[:0] - } - for !in.IsDelim(']') { - var v118 string - v118 = string(in.String()) - out.MaskedPaths = append(out.MaskedPaths, v118) - in.WantComma() - } - in.Delim(']') - } - case "readonlyPaths": - if in.IsNull() { - in.Skip() - out.ReadonlyPaths = nil - } else { - in.Delim('[') - if out.ReadonlyPaths == nil { - if !in.IsDelim(']') { - out.ReadonlyPaths = make([]string, 0, 4) - } else { - out.ReadonlyPaths = []string{} - } - } else { - out.ReadonlyPaths = (out.ReadonlyPaths)[:0] - } - for !in.IsDelim(']') { - var v119 string - v119 = string(in.String()) - out.ReadonlyPaths = append(out.ReadonlyPaths, v119) - in.WantComma() - } - in.Delim(']') - } - case "mountLabel": - out.MountLabel = string(in.String()) - case "intelRdt": - if in.IsNull() { - in.Skip() - out.IntelRdt = nil - } else { - if out.IntelRdt == nil { - out.IntelRdt = new(specs_go.LinuxIntelRdt) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo28(in, &*out.IntelRdt) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo6(out *jwriter.Writer, in specs_go.Linux) { - out.RawByte('{') - first := true - _ = first - if len(in.UIDMappings) != 0 { - const prefix string = ",\"uidMappings\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v120, v121 := range in.UIDMappings { - if v120 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo23(out, v121) - } - out.RawByte(']') - } - } - if len(in.GIDMappings) != 0 { - const prefix string = ",\"gidMappings\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v122, v123 := range in.GIDMappings { - if v122 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo23(out, v123) - } - out.RawByte(']') - } - } - if len(in.Sysctl) != 0 { - const prefix string = ",\"sysctl\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v124First := true - for v124Name, v124Value := range in.Sysctl { - if v124First { - v124First = false - } else { - out.RawByte(',') - } - out.String(string(v124Name)) - out.RawByte(':') - out.String(string(v124Value)) - } - out.RawByte('}') - } - } - if in.Resources != nil { - const prefix string = ",\"resources\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo24(out, *in.Resources) - } - if in.CgroupsPath != "" { - const prefix string = ",\"cgroupsPath\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CgroupsPath)) - } - if len(in.Namespaces) != 0 { - const prefix string = ",\"namespaces\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v125, v126 := range in.Namespaces { - if v125 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo25(out, v126) - } - out.RawByte(']') - } - } - if len(in.Devices) != 0 { - const prefix string = ",\"devices\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v127, v128 := range in.Devices { - if v127 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo26(out, v128) - } - out.RawByte(']') - } - } - if in.Seccomp != nil { - const prefix string = ",\"seccomp\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo27(out, *in.Seccomp) - } - if in.RootfsPropagation != "" { - const prefix string = ",\"rootfsPropagation\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.RootfsPropagation)) - } - if len(in.MaskedPaths) != 0 { - const prefix string = ",\"maskedPaths\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v129, v130 := range in.MaskedPaths { - if v129 > 0 { - out.RawByte(',') - } - out.String(string(v130)) - } - out.RawByte(']') - } - } - if len(in.ReadonlyPaths) != 0 { - const prefix string = ",\"readonlyPaths\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v131, v132 := range in.ReadonlyPaths { - if v131 > 0 { - out.RawByte(',') - } - out.String(string(v132)) - } - out.RawByte(']') - } - } - if in.MountLabel != "" { - const prefix string = ",\"mountLabel\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.MountLabel)) - } - if in.IntelRdt != nil { - const prefix string = ",\"intelRdt\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo28(out, *in.IntelRdt) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo28(in *jlexer.Lexer, out *specs_go.LinuxIntelRdt) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "l3CacheSchema": - out.L3CacheSchema = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo28(out *jwriter.Writer, in specs_go.LinuxIntelRdt) { - out.RawByte('{') - first := true - _ = first - if in.L3CacheSchema != "" { - const prefix string = ",\"l3CacheSchema\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.L3CacheSchema)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo27(in *jlexer.Lexer, out *specs_go.LinuxSeccomp) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "defaultAction": - out.DefaultAction = specs_go.LinuxSeccompAction(in.String()) - case "architectures": - if in.IsNull() { - in.Skip() - out.Architectures = nil - } else { - in.Delim('[') - if out.Architectures == nil { - if !in.IsDelim(']') { - out.Architectures = make([]specs_go.Arch, 0, 4) - } else { - out.Architectures = []specs_go.Arch{} - } - } else { - out.Architectures = (out.Architectures)[:0] - } - for !in.IsDelim(']') { - var v133 specs_go.Arch - v133 = specs_go.Arch(in.String()) - out.Architectures = append(out.Architectures, v133) - in.WantComma() - } - in.Delim(']') - } - case "syscalls": - if in.IsNull() { - in.Skip() - out.Syscalls = nil - } else { - in.Delim('[') - if out.Syscalls == nil { - if !in.IsDelim(']') { - out.Syscalls = make([]specs_go.LinuxSyscall, 0, 1) - } else { - out.Syscalls = []specs_go.LinuxSyscall{} - } - } else { - out.Syscalls = (out.Syscalls)[:0] - } - for !in.IsDelim(']') { - var v134 specs_go.LinuxSyscall - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo29(in, &v134) - out.Syscalls = append(out.Syscalls, v134) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo27(out *jwriter.Writer, in specs_go.LinuxSeccomp) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"defaultAction\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.DefaultAction)) - } - if len(in.Architectures) != 0 { - const prefix string = ",\"architectures\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v135, v136 := range in.Architectures { - if v135 > 0 { - out.RawByte(',') - } - out.String(string(v136)) - } - out.RawByte(']') - } - } - if len(in.Syscalls) != 0 { - const prefix string = ",\"syscalls\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v137, v138 := range in.Syscalls { - if v137 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo29(out, v138) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo29(in *jlexer.Lexer, out *specs_go.LinuxSyscall) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "names": - if in.IsNull() { - in.Skip() - out.Names = nil - } else { - in.Delim('[') - if out.Names == nil { - if !in.IsDelim(']') { - out.Names = make([]string, 0, 4) - } else { - out.Names = []string{} - } - } else { - out.Names = (out.Names)[:0] - } - for !in.IsDelim(']') { - var v139 string - v139 = string(in.String()) - out.Names = append(out.Names, v139) - in.WantComma() - } - in.Delim(']') - } - case "action": - out.Action = specs_go.LinuxSeccompAction(in.String()) - case "args": - if in.IsNull() { - in.Skip() - out.Args = nil - } else { - in.Delim('[') - if out.Args == nil { - if !in.IsDelim(']') { - out.Args = make([]specs_go.LinuxSeccompArg, 0, 1) - } else { - out.Args = []specs_go.LinuxSeccompArg{} - } - } else { - out.Args = (out.Args)[:0] - } - for !in.IsDelim(']') { - var v140 specs_go.LinuxSeccompArg - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo30(in, &v140) - out.Args = append(out.Args, v140) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo29(out *jwriter.Writer, in specs_go.LinuxSyscall) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"names\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Names == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v141, v142 := range in.Names { - if v141 > 0 { - out.RawByte(',') - } - out.String(string(v142)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"action\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Action)) - } - if len(in.Args) != 0 { - const prefix string = ",\"args\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v143, v144 := range in.Args { - if v143 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo30(out, v144) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo30(in *jlexer.Lexer, out *specs_go.LinuxSeccompArg) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "index": - out.Index = uint(in.Uint()) - case "value": - out.Value = uint64(in.Uint64()) - case "valueTwo": - out.ValueTwo = uint64(in.Uint64()) - case "op": - out.Op = specs_go.LinuxSeccompOperator(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo30(out *jwriter.Writer, in specs_go.LinuxSeccompArg) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"index\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint(uint(in.Index)) - } - { - const prefix string = ",\"value\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(in.Value)) - } - if in.ValueTwo != 0 { - const prefix string = ",\"valueTwo\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(in.ValueTwo)) - } - { - const prefix string = ",\"op\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Op)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo26(in *jlexer.Lexer, out *specs_go.LinuxDevice) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "path": - out.Path = string(in.String()) - case "type": - out.Type = string(in.String()) - case "major": - out.Major = int64(in.Int64()) - case "minor": - out.Minor = int64(in.Int64()) - case "fileMode": - if in.IsNull() { - in.Skip() - out.FileMode = nil - } else { - if out.FileMode == nil { - out.FileMode = new(os.FileMode) - } - *out.FileMode = os.FileMode(in.Uint32()) - } - case "uid": - if in.IsNull() { - in.Skip() - out.UID = nil - } else { - if out.UID == nil { - out.UID = new(uint32) - } - *out.UID = uint32(in.Uint32()) - } - case "gid": - if in.IsNull() { - in.Skip() - out.GID = nil - } else { - if out.GID == nil { - out.GID = new(uint32) - } - *out.GID = uint32(in.Uint32()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo26(out *jwriter.Writer, in specs_go.LinuxDevice) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - { - const prefix string = ",\"type\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Type)) - } - { - const prefix string = ",\"major\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Major)) - } - { - const prefix string = ",\"minor\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Minor)) - } - if in.FileMode != nil { - const prefix string = ",\"fileMode\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(*in.FileMode)) - } - if in.UID != nil { - const prefix string = ",\"uid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(*in.UID)) - } - if in.GID != nil { - const prefix string = ",\"gid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(*in.GID)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo25(in *jlexer.Lexer, out *specs_go.LinuxNamespace) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "type": - out.Type = specs_go.LinuxNamespaceType(in.String()) - case "path": - out.Path = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo25(out *jwriter.Writer, in specs_go.LinuxNamespace) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"type\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Type)) - } - if in.Path != "" { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo24(in *jlexer.Lexer, out *specs_go.LinuxResources) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "devices": - if in.IsNull() { - in.Skip() - out.Devices = nil - } else { - in.Delim('[') - if out.Devices == nil { - if !in.IsDelim(']') { - out.Devices = make([]specs_go.LinuxDeviceCgroup, 0, 1) - } else { - out.Devices = []specs_go.LinuxDeviceCgroup{} - } - } else { - out.Devices = (out.Devices)[:0] - } - for !in.IsDelim(']') { - var v145 specs_go.LinuxDeviceCgroup - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo31(in, &v145) - out.Devices = append(out.Devices, v145) - in.WantComma() - } - in.Delim(']') - } - case "memory": - if in.IsNull() { - in.Skip() - out.Memory = nil - } else { - if out.Memory == nil { - out.Memory = new(specs_go.LinuxMemory) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo32(in, &*out.Memory) - } - case "cpu": - if in.IsNull() { - in.Skip() - out.CPU = nil - } else { - if out.CPU == nil { - out.CPU = new(specs_go.LinuxCPU) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo33(in, &*out.CPU) - } - case "pids": - if in.IsNull() { - in.Skip() - out.Pids = nil - } else { - if out.Pids == nil { - out.Pids = new(specs_go.LinuxPids) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo34(in, &*out.Pids) - } - case "blockIO": - if in.IsNull() { - in.Skip() - out.BlockIO = nil - } else { - if out.BlockIO == nil { - out.BlockIO = new(specs_go.LinuxBlockIO) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo35(in, &*out.BlockIO) - } - case "hugepageLimits": - if in.IsNull() { - in.Skip() - out.HugepageLimits = nil - } else { - in.Delim('[') - if out.HugepageLimits == nil { - if !in.IsDelim(']') { - out.HugepageLimits = make([]specs_go.LinuxHugepageLimit, 0, 2) - } else { - out.HugepageLimits = []specs_go.LinuxHugepageLimit{} - } - } else { - out.HugepageLimits = (out.HugepageLimits)[:0] - } - for !in.IsDelim(']') { - var v146 specs_go.LinuxHugepageLimit - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo36(in, &v146) - out.HugepageLimits = append(out.HugepageLimits, v146) - in.WantComma() - } - in.Delim(']') - } - case "network": - if in.IsNull() { - in.Skip() - out.Network = nil - } else { - if out.Network == nil { - out.Network = new(specs_go.LinuxNetwork) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo37(in, &*out.Network) - } - case "rdma": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.Rdma = make(map[string]specs_go.LinuxRdma) - } else { - out.Rdma = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v147 specs_go.LinuxRdma - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo38(in, &v147) - (out.Rdma)[key] = v147 - in.WantComma() - } - in.Delim('}') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo24(out *jwriter.Writer, in specs_go.LinuxResources) { - out.RawByte('{') - first := true - _ = first - if len(in.Devices) != 0 { - const prefix string = ",\"devices\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v148, v149 := range in.Devices { - if v148 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo31(out, v149) - } - out.RawByte(']') - } - } - if in.Memory != nil { - const prefix string = ",\"memory\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo32(out, *in.Memory) - } - if in.CPU != nil { - const prefix string = ",\"cpu\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo33(out, *in.CPU) - } - if in.Pids != nil { - const prefix string = ",\"pids\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo34(out, *in.Pids) - } - if in.BlockIO != nil { - const prefix string = ",\"blockIO\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo35(out, *in.BlockIO) - } - if len(in.HugepageLimits) != 0 { - const prefix string = ",\"hugepageLimits\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v150, v151 := range in.HugepageLimits { - if v150 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo36(out, v151) - } - out.RawByte(']') - } - } - if in.Network != nil { - const prefix string = ",\"network\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo37(out, *in.Network) - } - if len(in.Rdma) != 0 { - const prefix string = ",\"rdma\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('{') - v152First := true - for v152Name, v152Value := range in.Rdma { - if v152First { - v152First = false - } else { - out.RawByte(',') - } - out.String(string(v152Name)) - out.RawByte(':') - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo38(out, v152Value) - } - out.RawByte('}') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo38(in *jlexer.Lexer, out *specs_go.LinuxRdma) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "hcaHandles": - if in.IsNull() { - in.Skip() - out.HcaHandles = nil - } else { - if out.HcaHandles == nil { - out.HcaHandles = new(uint32) - } - *out.HcaHandles = uint32(in.Uint32()) - } - case "hcaObjects": - if in.IsNull() { - in.Skip() - out.HcaObjects = nil - } else { - if out.HcaObjects == nil { - out.HcaObjects = new(uint32) - } - *out.HcaObjects = uint32(in.Uint32()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo38(out *jwriter.Writer, in specs_go.LinuxRdma) { - out.RawByte('{') - first := true - _ = first - if in.HcaHandles != nil { - const prefix string = ",\"hcaHandles\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(*in.HcaHandles)) - } - if in.HcaObjects != nil { - const prefix string = ",\"hcaObjects\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(*in.HcaObjects)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo37(in *jlexer.Lexer, out *specs_go.LinuxNetwork) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "classID": - if in.IsNull() { - in.Skip() - out.ClassID = nil - } else { - if out.ClassID == nil { - out.ClassID = new(uint32) - } - *out.ClassID = uint32(in.Uint32()) - } - case "priorities": - if in.IsNull() { - in.Skip() - out.Priorities = nil - } else { - in.Delim('[') - if out.Priorities == nil { - if !in.IsDelim(']') { - out.Priorities = make([]specs_go.LinuxInterfacePriority, 0, 2) - } else { - out.Priorities = []specs_go.LinuxInterfacePriority{} - } - } else { - out.Priorities = (out.Priorities)[:0] - } - for !in.IsDelim(']') { - var v153 specs_go.LinuxInterfacePriority - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo39(in, &v153) - out.Priorities = append(out.Priorities, v153) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo37(out *jwriter.Writer, in specs_go.LinuxNetwork) { - out.RawByte('{') - first := true - _ = first - if in.ClassID != nil { - const prefix string = ",\"classID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(*in.ClassID)) - } - if len(in.Priorities) != 0 { - const prefix string = ",\"priorities\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v154, v155 := range in.Priorities { - if v154 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo39(out, v155) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo39(in *jlexer.Lexer, out *specs_go.LinuxInterfacePriority) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "name": - out.Name = string(in.String()) - case "priority": - out.Priority = uint32(in.Uint32()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo39(out *jwriter.Writer, in specs_go.LinuxInterfacePriority) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"name\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Name)) - } - { - const prefix string = ",\"priority\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.Priority)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo36(in *jlexer.Lexer, out *specs_go.LinuxHugepageLimit) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "pageSize": - out.Pagesize = string(in.String()) - case "limit": - out.Limit = uint64(in.Uint64()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo36(out *jwriter.Writer, in specs_go.LinuxHugepageLimit) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"pageSize\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Pagesize)) - } - { - const prefix string = ",\"limit\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(in.Limit)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo35(in *jlexer.Lexer, out *specs_go.LinuxBlockIO) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "weight": - if in.IsNull() { - in.Skip() - out.Weight = nil - } else { - if out.Weight == nil { - out.Weight = new(uint16) - } - *out.Weight = uint16(in.Uint16()) - } - case "leafWeight": - if in.IsNull() { - in.Skip() - out.LeafWeight = nil - } else { - if out.LeafWeight == nil { - out.LeafWeight = new(uint16) - } - *out.LeafWeight = uint16(in.Uint16()) - } - case "weightDevice": - if in.IsNull() { - in.Skip() - out.WeightDevice = nil - } else { - in.Delim('[') - if out.WeightDevice == nil { - if !in.IsDelim(']') { - out.WeightDevice = make([]specs_go.LinuxWeightDevice, 0, 2) - } else { - out.WeightDevice = []specs_go.LinuxWeightDevice{} - } - } else { - out.WeightDevice = (out.WeightDevice)[:0] - } - for !in.IsDelim(']') { - var v156 specs_go.LinuxWeightDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo40(in, &v156) - out.WeightDevice = append(out.WeightDevice, v156) - in.WantComma() - } - in.Delim(']') - } - case "throttleReadBpsDevice": - if in.IsNull() { - in.Skip() - out.ThrottleReadBpsDevice = nil - } else { - in.Delim('[') - if out.ThrottleReadBpsDevice == nil { - if !in.IsDelim(']') { - out.ThrottleReadBpsDevice = make([]specs_go.LinuxThrottleDevice, 0, 2) - } else { - out.ThrottleReadBpsDevice = []specs_go.LinuxThrottleDevice{} - } - } else { - out.ThrottleReadBpsDevice = (out.ThrottleReadBpsDevice)[:0] - } - for !in.IsDelim(']') { - var v157 specs_go.LinuxThrottleDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(in, &v157) - out.ThrottleReadBpsDevice = append(out.ThrottleReadBpsDevice, v157) - in.WantComma() - } - in.Delim(']') - } - case "throttleWriteBpsDevice": - if in.IsNull() { - in.Skip() - out.ThrottleWriteBpsDevice = nil - } else { - in.Delim('[') - if out.ThrottleWriteBpsDevice == nil { - if !in.IsDelim(']') { - out.ThrottleWriteBpsDevice = make([]specs_go.LinuxThrottleDevice, 0, 2) - } else { - out.ThrottleWriteBpsDevice = []specs_go.LinuxThrottleDevice{} - } - } else { - out.ThrottleWriteBpsDevice = (out.ThrottleWriteBpsDevice)[:0] - } - for !in.IsDelim(']') { - var v158 specs_go.LinuxThrottleDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(in, &v158) - out.ThrottleWriteBpsDevice = append(out.ThrottleWriteBpsDevice, v158) - in.WantComma() - } - in.Delim(']') - } - case "throttleReadIOPSDevice": - if in.IsNull() { - in.Skip() - out.ThrottleReadIOPSDevice = nil - } else { - in.Delim('[') - if out.ThrottleReadIOPSDevice == nil { - if !in.IsDelim(']') { - out.ThrottleReadIOPSDevice = make([]specs_go.LinuxThrottleDevice, 0, 2) - } else { - out.ThrottleReadIOPSDevice = []specs_go.LinuxThrottleDevice{} - } - } else { - out.ThrottleReadIOPSDevice = (out.ThrottleReadIOPSDevice)[:0] - } - for !in.IsDelim(']') { - var v159 specs_go.LinuxThrottleDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(in, &v159) - out.ThrottleReadIOPSDevice = append(out.ThrottleReadIOPSDevice, v159) - in.WantComma() - } - in.Delim(']') - } - case "throttleWriteIOPSDevice": - if in.IsNull() { - in.Skip() - out.ThrottleWriteIOPSDevice = nil - } else { - in.Delim('[') - if out.ThrottleWriteIOPSDevice == nil { - if !in.IsDelim(']') { - out.ThrottleWriteIOPSDevice = make([]specs_go.LinuxThrottleDevice, 0, 2) - } else { - out.ThrottleWriteIOPSDevice = []specs_go.LinuxThrottleDevice{} - } - } else { - out.ThrottleWriteIOPSDevice = (out.ThrottleWriteIOPSDevice)[:0] - } - for !in.IsDelim(']') { - var v160 specs_go.LinuxThrottleDevice - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(in, &v160) - out.ThrottleWriteIOPSDevice = append(out.ThrottleWriteIOPSDevice, v160) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo35(out *jwriter.Writer, in specs_go.LinuxBlockIO) { - out.RawByte('{') - first := true - _ = first - if in.Weight != nil { - const prefix string = ",\"weight\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint16(uint16(*in.Weight)) - } - if in.LeafWeight != nil { - const prefix string = ",\"leafWeight\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint16(uint16(*in.LeafWeight)) - } - if len(in.WeightDevice) != 0 { - const prefix string = ",\"weightDevice\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v161, v162 := range in.WeightDevice { - if v161 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo40(out, v162) - } - out.RawByte(']') - } - } - if len(in.ThrottleReadBpsDevice) != 0 { - const prefix string = ",\"throttleReadBpsDevice\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v163, v164 := range in.ThrottleReadBpsDevice { - if v163 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(out, v164) - } - out.RawByte(']') - } - } - if len(in.ThrottleWriteBpsDevice) != 0 { - const prefix string = ",\"throttleWriteBpsDevice\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v165, v166 := range in.ThrottleWriteBpsDevice { - if v165 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(out, v166) - } - out.RawByte(']') - } - } - if len(in.ThrottleReadIOPSDevice) != 0 { - const prefix string = ",\"throttleReadIOPSDevice\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v167, v168 := range in.ThrottleReadIOPSDevice { - if v167 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(out, v168) - } - out.RawByte(']') - } - } - if len(in.ThrottleWriteIOPSDevice) != 0 { - const prefix string = ",\"throttleWriteIOPSDevice\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v169, v170 := range in.ThrottleWriteIOPSDevice { - if v169 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(out, v170) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(in *jlexer.Lexer, out *specs_go.LinuxThrottleDevice) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "rate": - out.Rate = uint64(in.Uint64()) - case "major": - out.Major = int64(in.Int64()) - case "minor": - out.Minor = int64(in.Int64()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo41(out *jwriter.Writer, in specs_go.LinuxThrottleDevice) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"rate\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(in.Rate)) - } - { - const prefix string = ",\"major\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Major)) - } - { - const prefix string = ",\"minor\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Minor)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo40(in *jlexer.Lexer, out *specs_go.LinuxWeightDevice) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "weight": - if in.IsNull() { - in.Skip() - out.Weight = nil - } else { - if out.Weight == nil { - out.Weight = new(uint16) - } - *out.Weight = uint16(in.Uint16()) - } - case "leafWeight": - if in.IsNull() { - in.Skip() - out.LeafWeight = nil - } else { - if out.LeafWeight == nil { - out.LeafWeight = new(uint16) - } - *out.LeafWeight = uint16(in.Uint16()) - } - case "major": - out.Major = int64(in.Int64()) - case "minor": - out.Minor = int64(in.Int64()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo40(out *jwriter.Writer, in specs_go.LinuxWeightDevice) { - out.RawByte('{') - first := true - _ = first - if in.Weight != nil { - const prefix string = ",\"weight\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint16(uint16(*in.Weight)) - } - if in.LeafWeight != nil { - const prefix string = ",\"leafWeight\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint16(uint16(*in.LeafWeight)) - } - { - const prefix string = ",\"major\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Major)) - } - { - const prefix string = ",\"minor\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Minor)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo34(in *jlexer.Lexer, out *specs_go.LinuxPids) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "limit": - out.Limit = int64(in.Int64()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo34(out *jwriter.Writer, in specs_go.LinuxPids) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"limit\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(in.Limit)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo33(in *jlexer.Lexer, out *specs_go.LinuxCPU) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "shares": - if in.IsNull() { - in.Skip() - out.Shares = nil - } else { - if out.Shares == nil { - out.Shares = new(uint64) - } - *out.Shares = uint64(in.Uint64()) - } - case "quota": - if in.IsNull() { - in.Skip() - out.Quota = nil - } else { - if out.Quota == nil { - out.Quota = new(int64) - } - *out.Quota = int64(in.Int64()) - } - case "period": - if in.IsNull() { - in.Skip() - out.Period = nil - } else { - if out.Period == nil { - out.Period = new(uint64) - } - *out.Period = uint64(in.Uint64()) - } - case "realtimeRuntime": - if in.IsNull() { - in.Skip() - out.RealtimeRuntime = nil - } else { - if out.RealtimeRuntime == nil { - out.RealtimeRuntime = new(int64) - } - *out.RealtimeRuntime = int64(in.Int64()) - } - case "realtimePeriod": - if in.IsNull() { - in.Skip() - out.RealtimePeriod = nil - } else { - if out.RealtimePeriod == nil { - out.RealtimePeriod = new(uint64) - } - *out.RealtimePeriod = uint64(in.Uint64()) - } - case "cpus": - out.Cpus = string(in.String()) - case "mems": - out.Mems = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo33(out *jwriter.Writer, in specs_go.LinuxCPU) { - out.RawByte('{') - first := true - _ = first - if in.Shares != nil { - const prefix string = ",\"shares\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Shares)) - } - if in.Quota != nil { - const prefix string = ",\"quota\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Quota)) - } - if in.Period != nil { - const prefix string = ",\"period\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Period)) - } - if in.RealtimeRuntime != nil { - const prefix string = ",\"realtimeRuntime\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.RealtimeRuntime)) - } - if in.RealtimePeriod != nil { - const prefix string = ",\"realtimePeriod\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.RealtimePeriod)) - } - if in.Cpus != "" { - const prefix string = ",\"cpus\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Cpus)) - } - if in.Mems != "" { - const prefix string = ",\"mems\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Mems)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo32(in *jlexer.Lexer, out *specs_go.LinuxMemory) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "limit": - if in.IsNull() { - in.Skip() - out.Limit = nil - } else { - if out.Limit == nil { - out.Limit = new(int64) - } - *out.Limit = int64(in.Int64()) - } - case "reservation": - if in.IsNull() { - in.Skip() - out.Reservation = nil - } else { - if out.Reservation == nil { - out.Reservation = new(int64) - } - *out.Reservation = int64(in.Int64()) - } - case "swap": - if in.IsNull() { - in.Skip() - out.Swap = nil - } else { - if out.Swap == nil { - out.Swap = new(int64) - } - *out.Swap = int64(in.Int64()) - } - case "kernel": - if in.IsNull() { - in.Skip() - out.Kernel = nil - } else { - if out.Kernel == nil { - out.Kernel = new(int64) - } - *out.Kernel = int64(in.Int64()) - } - case "kernelTCP": - if in.IsNull() { - in.Skip() - out.KernelTCP = nil - } else { - if out.KernelTCP == nil { - out.KernelTCP = new(int64) - } - *out.KernelTCP = int64(in.Int64()) - } - case "swappiness": - if in.IsNull() { - in.Skip() - out.Swappiness = nil - } else { - if out.Swappiness == nil { - out.Swappiness = new(uint64) - } - *out.Swappiness = uint64(in.Uint64()) - } - case "disableOOMKiller": - if in.IsNull() { - in.Skip() - out.DisableOOMKiller = nil - } else { - if out.DisableOOMKiller == nil { - out.DisableOOMKiller = new(bool) - } - *out.DisableOOMKiller = bool(in.Bool()) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo32(out *jwriter.Writer, in specs_go.LinuxMemory) { - out.RawByte('{') - first := true - _ = first - if in.Limit != nil { - const prefix string = ",\"limit\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Limit)) - } - if in.Reservation != nil { - const prefix string = ",\"reservation\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Reservation)) - } - if in.Swap != nil { - const prefix string = ",\"swap\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Swap)) - } - if in.Kernel != nil { - const prefix string = ",\"kernel\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Kernel)) - } - if in.KernelTCP != nil { - const prefix string = ",\"kernelTCP\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.KernelTCP)) - } - if in.Swappiness != nil { - const prefix string = ",\"swappiness\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(*in.Swappiness)) - } - if in.DisableOOMKiller != nil { - const prefix string = ",\"disableOOMKiller\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(*in.DisableOOMKiller)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo31(in *jlexer.Lexer, out *specs_go.LinuxDeviceCgroup) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "allow": - out.Allow = bool(in.Bool()) - case "type": - out.Type = string(in.String()) - case "major": - if in.IsNull() { - in.Skip() - out.Major = nil - } else { - if out.Major == nil { - out.Major = new(int64) - } - *out.Major = int64(in.Int64()) - } - case "minor": - if in.IsNull() { - in.Skip() - out.Minor = nil - } else { - if out.Minor == nil { - out.Minor = new(int64) - } - *out.Minor = int64(in.Int64()) - } - case "access": - out.Access = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo31(out *jwriter.Writer, in specs_go.LinuxDeviceCgroup) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"allow\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Allow)) - } - if in.Type != "" { - const prefix string = ",\"type\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Type)) - } - if in.Major != nil { - const prefix string = ",\"major\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Major)) - } - if in.Minor != nil { - const prefix string = ",\"minor\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int64(int64(*in.Minor)) - } - if in.Access != "" { - const prefix string = ",\"access\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Access)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo23(in *jlexer.Lexer, out *specs_go.LinuxIDMapping) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "containerID": - out.ContainerID = uint32(in.Uint32()) - case "hostID": - out.HostID = uint32(in.Uint32()) - case "size": - out.Size = uint32(in.Uint32()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo23(out *jwriter.Writer, in specs_go.LinuxIDMapping) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"containerID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.ContainerID)) - } - { - const prefix string = ",\"hostID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.HostID)) - } - { - const prefix string = ",\"size\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.Size)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo5(in *jlexer.Lexer, out *specs_go.Hooks) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "prestart": - if in.IsNull() { - in.Skip() - out.Prestart = nil - } else { - in.Delim('[') - if out.Prestart == nil { - if !in.IsDelim(']') { - out.Prestart = make([]specs_go.Hook, 0, 1) - } else { - out.Prestart = []specs_go.Hook{} - } - } else { - out.Prestart = (out.Prestart)[:0] - } - for !in.IsDelim(']') { - var v171 specs_go.Hook - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(in, &v171) - out.Prestart = append(out.Prestart, v171) - in.WantComma() - } - in.Delim(']') - } - case "poststart": - if in.IsNull() { - in.Skip() - out.Poststart = nil - } else { - in.Delim('[') - if out.Poststart == nil { - if !in.IsDelim(']') { - out.Poststart = make([]specs_go.Hook, 0, 1) - } else { - out.Poststart = []specs_go.Hook{} - } - } else { - out.Poststart = (out.Poststart)[:0] - } - for !in.IsDelim(']') { - var v172 specs_go.Hook - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(in, &v172) - out.Poststart = append(out.Poststart, v172) - in.WantComma() - } - in.Delim(']') - } - case "poststop": - if in.IsNull() { - in.Skip() - out.Poststop = nil - } else { - in.Delim('[') - if out.Poststop == nil { - if !in.IsDelim(']') { - out.Poststop = make([]specs_go.Hook, 0, 1) - } else { - out.Poststop = []specs_go.Hook{} - } - } else { - out.Poststop = (out.Poststop)[:0] - } - for !in.IsDelim(']') { - var v173 specs_go.Hook - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(in, &v173) - out.Poststop = append(out.Poststop, v173) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo5(out *jwriter.Writer, in specs_go.Hooks) { - out.RawByte('{') - first := true - _ = first - if len(in.Prestart) != 0 { - const prefix string = ",\"prestart\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v174, v175 := range in.Prestart { - if v174 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(out, v175) - } - out.RawByte(']') - } - } - if len(in.Poststart) != 0 { - const prefix string = ",\"poststart\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v176, v177 := range in.Poststart { - if v176 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(out, v177) - } - out.RawByte(']') - } - } - if len(in.Poststop) != 0 { - const prefix string = ",\"poststop\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v178, v179 := range in.Poststop { - if v178 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo(out, v179) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo4(in *jlexer.Lexer, out *specs_go.Mount) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "destination": - out.Destination = string(in.String()) - case "type": - out.Type = string(in.String()) - case "source": - out.Source = string(in.String()) - case "options": - if in.IsNull() { - in.Skip() - out.Options = nil - } else { - in.Delim('[') - if out.Options == nil { - if !in.IsDelim(']') { - out.Options = make([]string, 0, 4) - } else { - out.Options = []string{} - } - } else { - out.Options = (out.Options)[:0] - } - for !in.IsDelim(']') { - var v180 string - v180 = string(in.String()) - out.Options = append(out.Options, v180) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo4(out *jwriter.Writer, in specs_go.Mount) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"destination\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Destination)) - } - if in.Type != "" { - const prefix string = ",\"type\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Type)) - } - if in.Source != "" { - const prefix string = ",\"source\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Source)) - } - if len(in.Options) != 0 { - const prefix string = ",\"options\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v181, v182 := range in.Options { - if v181 > 0 { - out.RawByte(',') - } - out.String(string(v182)) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo3(in *jlexer.Lexer, out *specs_go.Root) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "path": - out.Path = string(in.String()) - case "readonly": - out.Readonly = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo3(out *jwriter.Writer, in specs_go.Root) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"path\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Path)) - } - if in.Readonly { - const prefix string = ",\"readonly\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Readonly)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo2(in *jlexer.Lexer, out *specs_go.Process) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "terminal": - out.Terminal = bool(in.Bool()) - case "consoleSize": - if in.IsNull() { - in.Skip() - out.ConsoleSize = nil - } else { - if out.ConsoleSize == nil { - out.ConsoleSize = new(specs_go.Box) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo42(in, &*out.ConsoleSize) - } - case "user": - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo43(in, &out.User) - case "args": - if in.IsNull() { - in.Skip() - out.Args = nil - } else { - in.Delim('[') - if out.Args == nil { - if !in.IsDelim(']') { - out.Args = make([]string, 0, 4) - } else { - out.Args = []string{} - } - } else { - out.Args = (out.Args)[:0] - } - for !in.IsDelim(']') { - var v183 string - v183 = string(in.String()) - out.Args = append(out.Args, v183) - in.WantComma() - } - in.Delim(']') - } - case "env": - if in.IsNull() { - in.Skip() - out.Env = nil - } else { - in.Delim('[') - if out.Env == nil { - if !in.IsDelim(']') { - out.Env = make([]string, 0, 4) - } else { - out.Env = []string{} - } - } else { - out.Env = (out.Env)[:0] - } - for !in.IsDelim(']') { - var v184 string - v184 = string(in.String()) - out.Env = append(out.Env, v184) - in.WantComma() - } - in.Delim(']') - } - case "cwd": - out.Cwd = string(in.String()) - case "capabilities": - if in.IsNull() { - in.Skip() - out.Capabilities = nil - } else { - if out.Capabilities == nil { - out.Capabilities = new(specs_go.LinuxCapabilities) - } - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo44(in, &*out.Capabilities) - } - case "rlimits": - if in.IsNull() { - in.Skip() - out.Rlimits = nil - } else { - in.Delim('[') - if out.Rlimits == nil { - if !in.IsDelim(']') { - out.Rlimits = make([]specs_go.POSIXRlimit, 0, 2) - } else { - out.Rlimits = []specs_go.POSIXRlimit{} - } - } else { - out.Rlimits = (out.Rlimits)[:0] - } - for !in.IsDelim(']') { - var v185 specs_go.POSIXRlimit - easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo45(in, &v185) - out.Rlimits = append(out.Rlimits, v185) - in.WantComma() - } - in.Delim(']') - } - case "noNewPrivileges": - out.NoNewPrivileges = bool(in.Bool()) - case "apparmorProfile": - out.ApparmorProfile = string(in.String()) - case "oomScoreAdj": - if in.IsNull() { - in.Skip() - out.OOMScoreAdj = nil - } else { - if out.OOMScoreAdj == nil { - out.OOMScoreAdj = new(int) - } - *out.OOMScoreAdj = int(in.Int()) - } - case "selinuxLabel": - out.SelinuxLabel = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo2(out *jwriter.Writer, in specs_go.Process) { - out.RawByte('{') - first := true - _ = first - if in.Terminal { - const prefix string = ",\"terminal\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.Terminal)) - } - if in.ConsoleSize != nil { - const prefix string = ",\"consoleSize\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo42(out, *in.ConsoleSize) - } - { - const prefix string = ",\"user\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo43(out, in.User) - } - { - const prefix string = ",\"args\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Args == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v186, v187 := range in.Args { - if v186 > 0 { - out.RawByte(',') - } - out.String(string(v187)) - } - out.RawByte(']') - } - } - if len(in.Env) != 0 { - const prefix string = ",\"env\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v188, v189 := range in.Env { - if v188 > 0 { - out.RawByte(',') - } - out.String(string(v189)) - } - out.RawByte(']') - } - } - { - const prefix string = ",\"cwd\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Cwd)) - } - if in.Capabilities != nil { - const prefix string = ",\"capabilities\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo44(out, *in.Capabilities) - } - if len(in.Rlimits) != 0 { - const prefix string = ",\"rlimits\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v190, v191 := range in.Rlimits { - if v190 > 0 { - out.RawByte(',') - } - easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo45(out, v191) - } - out.RawByte(']') - } - } - if in.NoNewPrivileges { - const prefix string = ",\"noNewPrivileges\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.NoNewPrivileges)) - } - if in.ApparmorProfile != "" { - const prefix string = ",\"apparmorProfile\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ApparmorProfile)) - } - if in.OOMScoreAdj != nil { - const prefix string = ",\"oomScoreAdj\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int(int(*in.OOMScoreAdj)) - } - if in.SelinuxLabel != "" { - const prefix string = ",\"selinuxLabel\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.SelinuxLabel)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo45(in *jlexer.Lexer, out *specs_go.POSIXRlimit) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "type": - out.Type = string(in.String()) - case "hard": - out.Hard = uint64(in.Uint64()) - case "soft": - out.Soft = uint64(in.Uint64()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo45(out *jwriter.Writer, in specs_go.POSIXRlimit) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"type\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Type)) - } - { - const prefix string = ",\"hard\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(in.Hard)) - } - { - const prefix string = ",\"soft\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint64(uint64(in.Soft)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo44(in *jlexer.Lexer, out *specs_go.LinuxCapabilities) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "bounding": - if in.IsNull() { - in.Skip() - out.Bounding = nil - } else { - in.Delim('[') - if out.Bounding == nil { - if !in.IsDelim(']') { - out.Bounding = make([]string, 0, 4) - } else { - out.Bounding = []string{} - } - } else { - out.Bounding = (out.Bounding)[:0] - } - for !in.IsDelim(']') { - var v192 string - v192 = string(in.String()) - out.Bounding = append(out.Bounding, v192) - in.WantComma() - } - in.Delim(']') - } - case "effective": - if in.IsNull() { - in.Skip() - out.Effective = nil - } else { - in.Delim('[') - if out.Effective == nil { - if !in.IsDelim(']') { - out.Effective = make([]string, 0, 4) - } else { - out.Effective = []string{} - } - } else { - out.Effective = (out.Effective)[:0] - } - for !in.IsDelim(']') { - var v193 string - v193 = string(in.String()) - out.Effective = append(out.Effective, v193) - in.WantComma() - } - in.Delim(']') - } - case "inheritable": - if in.IsNull() { - in.Skip() - out.Inheritable = nil - } else { - in.Delim('[') - if out.Inheritable == nil { - if !in.IsDelim(']') { - out.Inheritable = make([]string, 0, 4) - } else { - out.Inheritable = []string{} - } - } else { - out.Inheritable = (out.Inheritable)[:0] - } - for !in.IsDelim(']') { - var v194 string - v194 = string(in.String()) - out.Inheritable = append(out.Inheritable, v194) - in.WantComma() - } - in.Delim(']') - } - case "permitted": - if in.IsNull() { - in.Skip() - out.Permitted = nil - } else { - in.Delim('[') - if out.Permitted == nil { - if !in.IsDelim(']') { - out.Permitted = make([]string, 0, 4) - } else { - out.Permitted = []string{} - } - } else { - out.Permitted = (out.Permitted)[:0] - } - for !in.IsDelim(']') { - var v195 string - v195 = string(in.String()) - out.Permitted = append(out.Permitted, v195) - in.WantComma() - } - in.Delim(']') - } - case "ambient": - if in.IsNull() { - in.Skip() - out.Ambient = nil - } else { - in.Delim('[') - if out.Ambient == nil { - if !in.IsDelim(']') { - out.Ambient = make([]string, 0, 4) - } else { - out.Ambient = []string{} - } - } else { - out.Ambient = (out.Ambient)[:0] - } - for !in.IsDelim(']') { - var v196 string - v196 = string(in.String()) - out.Ambient = append(out.Ambient, v196) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo44(out *jwriter.Writer, in specs_go.LinuxCapabilities) { - out.RawByte('{') - first := true - _ = first - if len(in.Bounding) != 0 { - const prefix string = ",\"bounding\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v197, v198 := range in.Bounding { - if v197 > 0 { - out.RawByte(',') - } - out.String(string(v198)) - } - out.RawByte(']') - } - } - if len(in.Effective) != 0 { - const prefix string = ",\"effective\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v199, v200 := range in.Effective { - if v199 > 0 { - out.RawByte(',') - } - out.String(string(v200)) - } - out.RawByte(']') - } - } - if len(in.Inheritable) != 0 { - const prefix string = ",\"inheritable\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v201, v202 := range in.Inheritable { - if v201 > 0 { - out.RawByte(',') - } - out.String(string(v202)) - } - out.RawByte(']') - } - } - if len(in.Permitted) != 0 { - const prefix string = ",\"permitted\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v203, v204 := range in.Permitted { - if v203 > 0 { - out.RawByte(',') - } - out.String(string(v204)) - } - out.RawByte(']') - } - } - if len(in.Ambient) != 0 { - const prefix string = ",\"ambient\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v205, v206 := range in.Ambient { - if v205 > 0 { - out.RawByte(',') - } - out.String(string(v206)) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo43(in *jlexer.Lexer, out *specs_go.User) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "uid": - out.UID = uint32(in.Uint32()) - case "gid": - out.GID = uint32(in.Uint32()) - case "additionalGids": - if in.IsNull() { - in.Skip() - out.AdditionalGids = nil - } else { - in.Delim('[') - if out.AdditionalGids == nil { - if !in.IsDelim(']') { - out.AdditionalGids = make([]uint32, 0, 16) - } else { - out.AdditionalGids = []uint32{} - } - } else { - out.AdditionalGids = (out.AdditionalGids)[:0] - } - for !in.IsDelim(']') { - var v207 uint32 - v207 = uint32(in.Uint32()) - out.AdditionalGids = append(out.AdditionalGids, v207) - in.WantComma() - } - in.Delim(']') - } - case "username": - out.Username = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo43(out *jwriter.Writer, in specs_go.User) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"uid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.UID)) - } - { - const prefix string = ",\"gid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.GID)) - } - if len(in.AdditionalGids) != 0 { - const prefix string = ",\"additionalGids\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - { - out.RawByte('[') - for v208, v209 := range in.AdditionalGids { - if v208 > 0 { - out.RawByte(',') - } - out.Uint32(uint32(v209)) - } - out.RawByte(']') - } - } - if in.Username != "" { - const prefix string = ",\"username\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Username)) - } - out.RawByte('}') -} -func easyjson1dbef17bDecodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo42(in *jlexer.Lexer, out *specs_go.Box) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "height": - out.Height = uint(in.Uint()) - case "width": - out.Width = uint(in.Uint()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjson1dbef17bEncodeGithubComContainersLibpodVendorGithubComOpencontainersRuntimeSpecSpecsGo42(out *jwriter.Writer, in specs_go.Box) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"height\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint(uint(in.Height)) - } - { - const prefix string = ",\"width\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint(uint(in.Width)) - } - out.RawByte('}') -} diff --git a/libpod/container_internal.go b/libpod/container_internal.go index 69df33bc9..90f4659da 100644 --- a/libpod/container_internal.go +++ b/libpod/container_internal.go @@ -3,7 +3,6 @@ package libpod import ( "bytes" "context" - "encoding/json" "fmt" "io" "io/ioutil" diff --git a/libpod/container_internal_linux.go b/libpod/container_internal_linux.go index 2f03d45ea..4f490bb88 100644 --- a/libpod/container_internal_linux.go +++ b/libpod/container_internal_linux.go @@ -4,7 +4,6 @@ package libpod import ( "context" - "encoding/json" "fmt" "io/ioutil" "net" @@ -491,7 +490,7 @@ func (c *Container) checkpoint(ctx context.Context, options ContainerCheckpointO // Save network.status. This is needed to restore the container with // the same IP. Currently limited to one IP address in a container // with one interface. - formatJSON, err := json.MarshalIndent(c.state.NetworkStatus, "", " ") + formatJSON, err := json.MarshalIndent(c.state.NetworkStatus, "", " ") if err != nil { return err } diff --git a/libpod/oci.go b/libpod/oci.go index 31c1a7e85..7a908db2e 100644 --- a/libpod/oci.go +++ b/libpod/oci.go @@ -3,7 +3,6 @@ package libpod import ( "bufio" "bytes" - "encoding/json" "fmt" "io/ioutil" "net" diff --git a/libpod/pod_easyjson.go b/libpod/pod_easyjson.go deleted file mode 100644 index 71862dad0..000000000 --- a/libpod/pod_easyjson.go +++ /dev/null @@ -1,889 +0,0 @@ -// +build seccomp ostree selinux varlink exclude_graphdriver_devicemapper - -// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. - -package libpod - -import ( - json "encoding/json" - ocicni "github.com/cri-o/ocicni/pkg/ocicni" - easyjson "github.com/mailru/easyjson" - jlexer "github.com/mailru/easyjson/jlexer" - jwriter "github.com/mailru/easyjson/jwriter" -) - -// suppress unused package warning -var ( - _ *json.RawMessage - _ *jlexer.Lexer - _ *jwriter.Writer - _ easyjson.Marshaler -) - -func easyjsonBe091417DecodeGithubComContainersLibpodLibpod(in *jlexer.Lexer, out *podState) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "cgroupPath": - out.CgroupPath = string(in.String()) - case "InfraContainerID": - out.InfraContainerID = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodLibpod(out *jwriter.Writer, in podState) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"cgroupPath\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CgroupPath)) - } - { - const prefix string = ",\"InfraContainerID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.InfraContainerID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v podState) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonBe091417EncodeGithubComContainersLibpodLibpod(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v podState) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonBe091417EncodeGithubComContainersLibpodLibpod(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *podState) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonBe091417DecodeGithubComContainersLibpodLibpod(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *podState) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonBe091417DecodeGithubComContainersLibpodLibpod(l, v) -} -func easyjsonBe091417DecodeGithubComContainersLibpodLibpod1(in *jlexer.Lexer, out *PodInspectState) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "cgroupPath": - out.CgroupPath = string(in.String()) - case "infraContainerID": - out.InfraContainerID = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodLibpod1(out *jwriter.Writer, in PodInspectState) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"cgroupPath\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CgroupPath)) - } - { - const prefix string = ",\"infraContainerID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.InfraContainerID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v PodInspectState) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonBe091417EncodeGithubComContainersLibpodLibpod1(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v PodInspectState) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonBe091417EncodeGithubComContainersLibpodLibpod1(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *PodInspectState) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonBe091417DecodeGithubComContainersLibpodLibpod1(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *PodInspectState) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonBe091417DecodeGithubComContainersLibpodLibpod1(l, v) -} -func easyjsonBe091417DecodeGithubComContainersLibpodLibpod2(in *jlexer.Lexer, out *PodInspect) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "Config": - if in.IsNull() { - in.Skip() - out.Config = nil - } else { - if out.Config == nil { - out.Config = new(PodConfig) - } - if data := in.Raw(); in.Ok() { - in.AddError((*out.Config).UnmarshalJSON(data)) - } - } - case "State": - if in.IsNull() { - in.Skip() - out.State = nil - } else { - if out.State == nil { - out.State = new(PodInspectState) - } - if data := in.Raw(); in.Ok() { - in.AddError((*out.State).UnmarshalJSON(data)) - } - } - case "Containers": - if in.IsNull() { - in.Skip() - out.Containers = nil - } else { - in.Delim('[') - if out.Containers == nil { - if !in.IsDelim(']') { - out.Containers = make([]PodContainerInfo, 0, 2) - } else { - out.Containers = []PodContainerInfo{} - } - } else { - out.Containers = (out.Containers)[:0] - } - for !in.IsDelim(']') { - var v1 PodContainerInfo - if data := in.Raw(); in.Ok() { - in.AddError((v1).UnmarshalJSON(data)) - } - out.Containers = append(out.Containers, v1) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodLibpod2(out *jwriter.Writer, in PodInspect) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"Config\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Config == nil { - out.RawString("null") - } else { - out.Raw((*in.Config).MarshalJSON()) - } - } - { - const prefix string = ",\"State\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.State == nil { - out.RawString("null") - } else { - out.Raw((*in.State).MarshalJSON()) - } - } - { - const prefix string = ",\"Containers\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Containers == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v2, v3 := range in.Containers { - if v2 > 0 { - out.RawByte(',') - } - out.Raw((v3).MarshalJSON()) - } - out.RawByte(']') - } - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v PodInspect) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonBe091417EncodeGithubComContainersLibpodLibpod2(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v PodInspect) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonBe091417EncodeGithubComContainersLibpodLibpod2(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *PodInspect) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonBe091417DecodeGithubComContainersLibpodLibpod2(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *PodInspect) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonBe091417DecodeGithubComContainersLibpodLibpod2(l, v) -} -func easyjsonBe091417DecodeGithubComContainersLibpodLibpod3(in *jlexer.Lexer, out *PodContainerInfo) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "id": - out.ID = string(in.String()) - case "state": - out.State = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodLibpod3(out *jwriter.Writer, in PodContainerInfo) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ID)) - } - { - const prefix string = ",\"state\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.State)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v PodContainerInfo) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonBe091417EncodeGithubComContainersLibpodLibpod3(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v PodContainerInfo) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonBe091417EncodeGithubComContainersLibpodLibpod3(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *PodContainerInfo) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonBe091417DecodeGithubComContainersLibpodLibpod3(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *PodContainerInfo) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonBe091417DecodeGithubComContainersLibpodLibpod3(l, v) -} -func easyjsonBe091417DecodeGithubComContainersLibpodLibpod4(in *jlexer.Lexer, out *PodConfig) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "id": - out.ID = string(in.String()) - case "name": - out.Name = string(in.String()) - case "namespace": - out.Namespace = string(in.String()) - case "labels": - if in.IsNull() { - in.Skip() - } else { - in.Delim('{') - if !in.IsDelim('}') { - out.Labels = make(map[string]string) - } else { - out.Labels = nil - } - for !in.IsDelim('}') { - key := string(in.String()) - in.WantColon() - var v4 string - v4 = string(in.String()) - (out.Labels)[key] = v4 - in.WantComma() - } - in.Delim('}') - } - case "cgroupParent": - out.CgroupParent = string(in.String()) - case "sharesCgroup": - out.UsePodCgroup = bool(in.Bool()) - case "sharesPid": - out.UsePodPID = bool(in.Bool()) - case "sharesIpc": - out.UsePodIPC = bool(in.Bool()) - case "sharesNet": - out.UsePodNet = bool(in.Bool()) - case "sharesMnt": - out.UsePodMount = bool(in.Bool()) - case "sharesUser": - out.UsePodUser = bool(in.Bool()) - case "sharesUts": - out.UsePodUTS = bool(in.Bool()) - case "infraConfig": - if in.IsNull() { - in.Skip() - out.InfraContainer = nil - } else { - if out.InfraContainer == nil { - out.InfraContainer = new(InfraContainerConfig) - } - easyjsonBe091417DecodeGithubComContainersLibpodLibpod5(in, &*out.InfraContainer) - } - case "created": - if data := in.Raw(); in.Ok() { - in.AddError((out.CreatedTime).UnmarshalJSON(data)) - } - case "lockID": - out.LockID = uint32(in.Uint32()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodLibpod4(out *jwriter.Writer, in PodConfig) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"id\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.ID)) - } - { - const prefix string = ",\"name\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Name)) - } - if in.Namespace != "" { - const prefix string = ",\"namespace\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Namespace)) - } - { - const prefix string = ",\"labels\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.Labels == nil && (out.Flags&jwriter.NilMapAsEmpty) == 0 { - out.RawString(`null`) - } else { - out.RawByte('{') - v5First := true - for v5Name, v5Value := range in.Labels { - if v5First { - v5First = false - } else { - out.RawByte(',') - } - out.String(string(v5Name)) - out.RawByte(':') - out.String(string(v5Value)) - } - out.RawByte('}') - } - } - { - const prefix string = ",\"cgroupParent\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.CgroupParent)) - } - if in.UsePodCgroup { - const prefix string = ",\"sharesCgroup\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodCgroup)) - } - if in.UsePodPID { - const prefix string = ",\"sharesPid\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodPID)) - } - if in.UsePodIPC { - const prefix string = ",\"sharesIpc\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodIPC)) - } - if in.UsePodNet { - const prefix string = ",\"sharesNet\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodNet)) - } - if in.UsePodMount { - const prefix string = ",\"sharesMnt\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodMount)) - } - if in.UsePodUser { - const prefix string = ",\"sharesUser\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodUser)) - } - if in.UsePodUTS { - const prefix string = ",\"sharesUts\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.UsePodUTS)) - } - { - const prefix string = ",\"infraConfig\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.InfraContainer == nil { - out.RawString("null") - } else { - easyjsonBe091417EncodeGithubComContainersLibpodLibpod5(out, *in.InfraContainer) - } - } - { - const prefix string = ",\"created\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Raw((in.CreatedTime).MarshalJSON()) - } - { - const prefix string = ",\"lockID\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Uint32(uint32(in.LockID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v PodConfig) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonBe091417EncodeGithubComContainersLibpodLibpod4(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v PodConfig) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonBe091417EncodeGithubComContainersLibpodLibpod4(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *PodConfig) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonBe091417DecodeGithubComContainersLibpodLibpod4(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *PodConfig) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonBe091417DecodeGithubComContainersLibpodLibpod4(l, v) -} -func easyjsonBe091417DecodeGithubComContainersLibpodLibpod5(in *jlexer.Lexer, out *InfraContainerConfig) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "makeInfraContainer": - out.HasInfraContainer = bool(in.Bool()) - case "infraPortBindings": - if in.IsNull() { - in.Skip() - out.PortBindings = nil - } else { - in.Delim('[') - if out.PortBindings == nil { - if !in.IsDelim(']') { - out.PortBindings = make([]ocicni.PortMapping, 0, 1) - } else { - out.PortBindings = []ocicni.PortMapping{} - } - } else { - out.PortBindings = (out.PortBindings)[:0] - } - for !in.IsDelim(']') { - var v6 ocicni.PortMapping - easyjsonBe091417DecodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(in, &v6) - out.PortBindings = append(out.PortBindings, v6) - in.WantComma() - } - in.Delim(']') - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodLibpod5(out *jwriter.Writer, in InfraContainerConfig) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"makeInfraContainer\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Bool(bool(in.HasInfraContainer)) - } - { - const prefix string = ",\"infraPortBindings\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - if in.PortBindings == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v7, v8 := range in.PortBindings { - if v7 > 0 { - out.RawByte(',') - } - easyjsonBe091417EncodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(out, v8) - } - out.RawByte(']') - } - } - out.RawByte('}') -} -func easyjsonBe091417DecodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(in *jlexer.Lexer, out *ocicni.PortMapping) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "hostPort": - out.HostPort = int32(in.Int32()) - case "containerPort": - out.ContainerPort = int32(in.Int32()) - case "protocol": - out.Protocol = string(in.String()) - case "hostIP": - out.HostIP = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonBe091417EncodeGithubComContainersLibpodVendorGithubComCriOOcicniPkgOcicni(out *jwriter.Writer, in ocicni.PortMapping) { - out.RawByte('{') - first := true - _ = first - { - const prefix string = ",\"hostPort\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int32(int32(in.HostPort)) - } - { - const prefix string = ",\"containerPort\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.Int32(int32(in.ContainerPort)) - } - { - const prefix string = ",\"protocol\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.Protocol)) - } - { - const prefix string = ",\"hostIP\":" - if first { - first = false - out.RawString(prefix[1:]) - } else { - out.RawString(prefix) - } - out.String(string(in.HostIP)) - } - out.RawByte('}') -} diff --git a/libpod/storage.go b/libpod/storage.go index 10026efda..17d231171 100644 --- a/libpod/storage.go +++ b/libpod/storage.go @@ -2,7 +2,6 @@ package libpod import ( "context" - "encoding/json" "time" istorage "github.com/containers/image/storage" diff --git a/vendor.conf b/vendor.conf index 18283cae6..c2700c82c 100644 --- a/vendor.conf +++ b/vendor.conf @@ -41,7 +41,7 @@ github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 github.com/hashicorp/go-multierror 83588e72410abfbe4df460eeb6f30841ae47d4c4 github.com/hashicorp/golang-lru 0a025b7e63adc15a622f29b0b2c4c3848243bbf6 github.com/imdario/mergo 0.2.2 -github.com/json-iterator/go 1.0.0 +github.com/json-iterator/go 1.1.5 github.com/kr/pty v1.0.0 github.com/mattn/go-runewidth v0.0.1 github.com/mistifyio/go-zfs v2.1.1 @@ -97,10 +97,11 @@ github.com/Nvveen/Gotty master github.com/fsouza/go-dockerclient master github.com/openshift/imagebuilder master github.com/ulikunitz/xz v0.5.4 -github.com/mailru/easyjson 03f2033d19d5860aef995fe360ac7d395cd8ce65 github.com/coreos/go-iptables 25d087f3cffd9aedc0c2b7eff25f23cbf3c20fe1 github.com/google/shlex c34317bd91bf98fab745d77b03933cf8769299fe github.com/pkg/profile v1.2.1 github.com/klauspost/pgzip v1.2.1 github.com/klauspost/compress v1.4.1 github.com/klauspost/cpuid v1.2.0 +github.com/modern-go/reflect2 1.0.1 +github.com/modern-go/concurrent 1.0.3
\ No newline at end of file diff --git a/vendor/github.com/json-iterator/go/README.md b/vendor/github.com/json-iterator/go/README.md index 23a4b57c8..54d5afe95 100644 --- a/vendor/github.com/json-iterator/go/README.md +++ b/vendor/github.com/json-iterator/go/README.md @@ -8,6 +8,8 @@ A high-performance 100% compatible drop-in replacement of "encoding/json" +You can also use thrift like JSON using [thrift-iterator](https://github.com/thrift-iterator/go) + ``` Go开发者们请加入我们，滴滴出行平台技术部 taowen@didichuxing.com ``` @@ -29,6 +31,9 @@ Raw Result (easyjson requires static code generation) | easyjson encode | 883 ns/op | 576 B/op | 3 allocs/op | | jsoniter encode | 837 ns/op | 384 B/op | 4 allocs/op | +Always benchmark with your own workload. +The result depends heavily on the data input. + # Usage 100% compatibility with standard lib @@ -44,7 +49,9 @@ with ```go import "github.com/json-iterator/go" -jsoniter.Marshal(&data) + +var json = jsoniter.ConfigCompatibleWithStandardLibrary +json.Marshal(&data) ``` Replace @@ -58,7 +65,9 @@ with ```go import "github.com/json-iterator/go" -jsoniter.Unmarshal(input, &data) + +var json = jsoniter.ConfigCompatibleWithStandardLibrary +json.Unmarshal(input, &data) ``` [More documentation](http://jsoniter.com/migrate-from-go-std.html) @@ -76,5 +85,7 @@ Contributors * [thockin](https://github.com/thockin) * [mattn](https://github.com/mattn) * [cch123](https://github.com/cch123) +* [Oleg Shaldybin](https://github.com/olegshaldybin) +* [Jason Toffaletti](https://github.com/toffaletti) Report issue or pull request, or email taowen@gmail.com, or [](https://gitter.im/json-iterator/Lobby) diff --git a/vendor/github.com/json-iterator/go/feature_adapter.go b/vendor/github.com/json-iterator/go/adapter.go index edb477c4f..e674d0f39 100644 --- a/vendor/github.com/json-iterator/go/feature_adapter.go +++ b/vendor/github.com/json-iterator/go/adapter.go @@ -16,15 +16,6 @@ func Unmarshal(data []byte, v interface{}) error { return ConfigDefault.Unmarshal(data, v) } -func lastNotSpacePos(data []byte) int { - for i := len(data) - 1; i >= 0; i-- { - if data[i] != ' ' && data[i] != '\t' && data[i] != '\r' && data[i] != '\n' { - return i + 1 - } - } - return 0 -} - // UnmarshalFromString convenient method to read from string instead of []byte func UnmarshalFromString(str string, v interface{}) error { return ConfigDefault.UnmarshalFromString(str, v) @@ -71,6 +62,11 @@ type Decoder struct { // Decode decode JSON into interface{} func (adapter *Decoder) Decode(obj interface{}) error { + if adapter.iter.head == adapter.iter.tail && adapter.iter.reader != nil { + if !adapter.iter.loadMore() { + return io.EOF + } + } adapter.iter.ReadVal(obj) err := adapter.iter.Error if err == io.EOF { @@ -81,7 +77,16 @@ func (adapter *Decoder) Decode(obj interface{}) error { // More is there more? func (adapter *Decoder) More() bool { - return adapter.iter.head != adapter.iter.tail + iter := adapter.iter + if iter.Error != nil { + return false + } + c := iter.nextToken() + if c == 0 { + return false + } + iter.unreadByte() + return c != ']' && c != '}' } // Buffered remaining buffer @@ -90,11 +95,21 @@ func (adapter *Decoder) Buffered() io.Reader { return bytes.NewReader(remaining) } -// UseNumber for number JSON element, use float64 or json.NumberValue (alias of string) +// UseNumber causes the Decoder to unmarshal a number into an interface{} as a +// Number instead of as a float64. func (adapter *Decoder) UseNumber() { - origCfg := adapter.iter.cfg.configBeforeFrozen - origCfg.UseNumber = true - adapter.iter.cfg = origCfg.Froze().(*frozenConfig) + cfg := adapter.iter.cfg.configBeforeFrozen + cfg.UseNumber = true + adapter.iter.cfg = cfg.frozeWithCacheReuse(adapter.iter.cfg.extraExtensions) +} + +// DisallowUnknownFields causes the Decoder to return an error when the destination +// is a struct and the input contains object keys which do not match any +// non-ignored, exported fields in the destination. +func (adapter *Decoder) DisallowUnknownFields() { + cfg := adapter.iter.cfg.configBeforeFrozen + cfg.DisallowUnknownFields = true + adapter.iter.cfg = cfg.frozeWithCacheReuse(adapter.iter.cfg.extraExtensions) } // NewEncoder same as json.NewEncoder @@ -110,18 +125,26 @@ type Encoder struct { // Encode encode interface{} as JSON to io.Writer func (adapter *Encoder) Encode(val interface{}) error { adapter.stream.WriteVal(val) + adapter.stream.WriteRaw("\n") adapter.stream.Flush() return adapter.stream.Error } // SetIndent set the indention. Prefix is not supported func (adapter *Encoder) SetIndent(prefix, indent string) { - adapter.stream.cfg.indentionStep = len(indent) + config := adapter.stream.cfg.configBeforeFrozen + config.IndentionStep = len(indent) + adapter.stream.cfg = config.frozeWithCacheReuse(adapter.stream.cfg.extraExtensions) } // SetEscapeHTML escape html by default, set to false to disable func (adapter *Encoder) SetEscapeHTML(escapeHTML bool) { config := adapter.stream.cfg.configBeforeFrozen config.EscapeHTML = escapeHTML - adapter.stream.cfg = config.Froze().(*frozenConfig) + adapter.stream.cfg = config.frozeWithCacheReuse(adapter.stream.cfg.extraExtensions) +} + +// Valid reports whether data is a valid JSON encoding. +func Valid(data []byte) bool { + return ConfigDefault.Valid(data) } diff --git a/vendor/github.com/json-iterator/go/feature_any.go b/vendor/github.com/json-iterator/go/any.go index 6733dce4c..daecfed61 100644 --- a/vendor/github.com/json-iterator/go/feature_any.go +++ b/vendor/github.com/json-iterator/go/any.go @@ -1,9 +1,13 @@ package jsoniter import ( + "errors" "fmt" + "github.com/modern-go/reflect2" "io" "reflect" + "strconv" + "unsafe" ) // Any generic object representation. @@ -24,7 +28,6 @@ type Any interface { ToString() string ToVal(val interface{}) Get(path ...interface{}) Any - // TODO: add Set Size() int Keys() []string GetInterface() interface{} @@ -34,7 +37,7 @@ type Any interface { type baseAny struct{} func (any *baseAny) Get(path ...interface{}) Any { - return &invalidAny{baseAny{}, fmt.Errorf("Get %v from simple value", path)} + return &invalidAny{baseAny{}, fmt.Errorf("GetIndex %v from simple value", path)} } func (any *baseAny) Size() int { @@ -88,7 +91,7 @@ func Wrap(val interface{}) Any { if isAny { return asAny } - typ := reflect.TypeOf(val) + typ := reflect2.TypeOf(val) switch typ.Kind() { case reflect.Slice: return wrapArray(val) @@ -99,6 +102,9 @@ func Wrap(val interface{}) Any { case reflect.String: return WrapString(val.(string)) case reflect.Int: + if strconv.IntSize == 32 { + return WrapInt32(int32(val.(int))) + } return WrapInt64(int64(val.(int))) case reflect.Int8: return WrapInt32(int32(val.(int8))) @@ -109,7 +115,15 @@ func Wrap(val interface{}) Any { case reflect.Int64: return WrapInt64(val.(int64)) case reflect.Uint: + if strconv.IntSize == 32 { + return WrapUint32(uint32(val.(uint))) + } return WrapUint64(uint64(val.(uint))) + case reflect.Uintptr: + if ptrSize == 32 { + return WrapUint32(uint32(val.(uintptr))) + } + return WrapUint64(uint64(val.(uintptr))) case reflect.Uint8: return WrapUint32(uint32(val.(uint8))) case reflect.Uint16: @@ -157,6 +171,8 @@ func (iter *Iterator) readAny() Any { return iter.readArrayAny() case '-': return iter.readNumberAny(false) + case 0: + return &invalidAny{baseAny{}, errors.New("input is empty")} default: return iter.readNumberAny(true) } @@ -240,3 +256,66 @@ func locatePath(iter *Iterator, path []interface{}) Any { } return iter.readAny() } + +var anyType = reflect2.TypeOfPtr((*Any)(nil)).Elem() + +func createDecoderOfAny(ctx *ctx, typ reflect2.Type) ValDecoder { + if typ == anyType { + return &directAnyCodec{} + } + if typ.Implements(anyType) { + return &anyCodec{ + valType: typ, + } + } + return nil +} + +func createEncoderOfAny(ctx *ctx, typ reflect2.Type) ValEncoder { + if typ == anyType { + return &directAnyCodec{} + } + if typ.Implements(anyType) { + return &anyCodec{ + valType: typ, + } + } + return nil +} + +type anyCodec struct { + valType reflect2.Type +} + +func (codec *anyCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + panic("not implemented") +} + +func (codec *anyCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + obj := codec.valType.UnsafeIndirect(ptr) + any := obj.(Any) + any.WriteTo(stream) +} + +func (codec *anyCodec) IsEmpty(ptr unsafe.Pointer) bool { + obj := codec.valType.UnsafeIndirect(ptr) + any := obj.(Any) + return any.Size() == 0 +} + +type directAnyCodec struct { +} + +func (codec *directAnyCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + *(*Any)(ptr) = iter.readAny() +} + +func (codec *directAnyCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + any := *(*Any)(ptr) + any.WriteTo(stream) +} + +func (codec *directAnyCodec) IsEmpty(ptr unsafe.Pointer) bool { + any := *(*Any)(ptr) + return any.Size() == 0 +} diff --git a/vendor/github.com/json-iterator/go/feature_any_array.go b/vendor/github.com/json-iterator/go/any_array.go index 0449e9aa4..0449e9aa4 100644 --- a/vendor/github.com/json-iterator/go/feature_any_array.go +++ b/vendor/github.com/json-iterator/go/any_array.go diff --git a/vendor/github.com/json-iterator/go/feature_any_bool.go b/vendor/github.com/json-iterator/go/any_bool.go index 9452324af..9452324af 100644 --- a/vendor/github.com/json-iterator/go/feature_any_bool.go +++ b/vendor/github.com/json-iterator/go/any_bool.go diff --git a/vendor/github.com/json-iterator/go/feature_any_float.go b/vendor/github.com/json-iterator/go/any_float.go index 35fdb0949..35fdb0949 100644 --- a/vendor/github.com/json-iterator/go/feature_any_float.go +++ b/vendor/github.com/json-iterator/go/any_float.go diff --git a/vendor/github.com/json-iterator/go/feature_any_int32.go b/vendor/github.com/json-iterator/go/any_int32.go index 1b56f3991..1b56f3991 100644 --- a/vendor/github.com/json-iterator/go/feature_any_int32.go +++ b/vendor/github.com/json-iterator/go/any_int32.go diff --git a/vendor/github.com/json-iterator/go/feature_any_int64.go b/vendor/github.com/json-iterator/go/any_int64.go index c440d72b6..c440d72b6 100644 --- a/vendor/github.com/json-iterator/go/feature_any_int64.go +++ b/vendor/github.com/json-iterator/go/any_int64.go diff --git a/vendor/github.com/json-iterator/go/feature_any_invalid.go b/vendor/github.com/json-iterator/go/any_invalid.go index 1d859eac3..1d859eac3 100644 --- a/vendor/github.com/json-iterator/go/feature_any_invalid.go +++ b/vendor/github.com/json-iterator/go/any_invalid.go diff --git a/vendor/github.com/json-iterator/go/feature_any_nil.go b/vendor/github.com/json-iterator/go/any_nil.go index d04cb54c1..d04cb54c1 100644 --- a/vendor/github.com/json-iterator/go/feature_any_nil.go +++ b/vendor/github.com/json-iterator/go/any_nil.go diff --git a/vendor/github.com/json-iterator/go/feature_any_number.go b/vendor/github.com/json-iterator/go/any_number.go index 4e1c27641..9d1e901a6 100644 --- a/vendor/github.com/json-iterator/go/feature_any_number.go +++ b/vendor/github.com/json-iterator/go/any_number.go @@ -1,6 +1,9 @@ package jsoniter -import "unsafe" +import ( + "io" + "unsafe" +) type numberLazyAny struct { baseAny @@ -29,7 +32,9 @@ func (any *numberLazyAny) ToInt() int { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadInt() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -37,7 +42,9 @@ func (any *numberLazyAny) ToInt32() int32 { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadInt32() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -45,7 +52,9 @@ func (any *numberLazyAny) ToInt64() int64 { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadInt64() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -53,7 +62,9 @@ func (any *numberLazyAny) ToUint() uint { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadUint() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -61,7 +72,9 @@ func (any *numberLazyAny) ToUint32() uint32 { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadUint32() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -69,7 +82,9 @@ func (any *numberLazyAny) ToUint64() uint64 { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadUint64() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -77,7 +92,9 @@ func (any *numberLazyAny) ToFloat32() float32 { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadFloat32() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } @@ -85,7 +102,9 @@ func (any *numberLazyAny) ToFloat64() float64 { iter := any.cfg.BorrowIterator(any.buf) defer any.cfg.ReturnIterator(iter) val := iter.ReadFloat64() - any.err = iter.Error + if iter.Error != nil && iter.Error != io.EOF { + any.err = iter.Error + } return val } diff --git a/vendor/github.com/json-iterator/go/feature_any_object.go b/vendor/github.com/json-iterator/go/any_object.go index c44ef5c98..c44ef5c98 100644 --- a/vendor/github.com/json-iterator/go/feature_any_object.go +++ b/vendor/github.com/json-iterator/go/any_object.go diff --git a/vendor/github.com/json-iterator/go/feature_any_string.go b/vendor/github.com/json-iterator/go/any_str.go index abf060bd5..a4b93c78c 100644 --- a/vendor/github.com/json-iterator/go/feature_any_string.go +++ b/vendor/github.com/json-iterator/go/any_str.go @@ -14,7 +14,7 @@ func (any *stringAny) Get(path ...interface{}) Any { if len(path) == 0 { return any } - return &invalidAny{baseAny{}, fmt.Errorf("Get %v from simple value", path)} + return &invalidAny{baseAny{}, fmt.Errorf("GetIndex %v from simple value", path)} } func (any *stringAny) Parse() *Iterator { diff --git a/vendor/github.com/json-iterator/go/feature_any_uint32.go b/vendor/github.com/json-iterator/go/any_uint32.go index 656bbd33d..656bbd33d 100644 --- a/vendor/github.com/json-iterator/go/feature_any_uint32.go +++ b/vendor/github.com/json-iterator/go/any_uint32.go diff --git a/vendor/github.com/json-iterator/go/feature_any_uint64.go b/vendor/github.com/json-iterator/go/any_uint64.go index 7df2fce33..7df2fce33 100644 --- a/vendor/github.com/json-iterator/go/feature_any_uint64.go +++ b/vendor/github.com/json-iterator/go/any_uint64.go diff --git a/vendor/github.com/json-iterator/go/config.go b/vendor/github.com/json-iterator/go/config.go new file mode 100644 index 000000000..8c58fcba5 --- /dev/null +++ b/vendor/github.com/json-iterator/go/config.go @@ -0,0 +1,375 @@ +package jsoniter + +import ( + "encoding/json" + "io" + "reflect" + "sync" + "unsafe" + + "github.com/modern-go/concurrent" + "github.com/modern-go/reflect2" +) + +// Config customize how the API should behave. +// The API is created from Config by Froze. +type Config struct { + IndentionStep int + MarshalFloatWith6Digits bool + EscapeHTML bool + SortMapKeys bool + UseNumber bool + DisallowUnknownFields bool + TagKey string + OnlyTaggedField bool + ValidateJsonRawMessage bool + ObjectFieldMustBeSimpleString bool + CaseSensitive bool +} + +// API the public interface of this package. +// Primary Marshal and Unmarshal. +type API interface { + IteratorPool + StreamPool + MarshalToString(v interface{}) (string, error) + Marshal(v interface{}) ([]byte, error) + MarshalIndent(v interface{}, prefix, indent string) ([]byte, error) + UnmarshalFromString(str string, v interface{}) error + Unmarshal(data []byte, v interface{}) error + Get(data []byte, path ...interface{}) Any + NewEncoder(writer io.Writer) *Encoder + NewDecoder(reader io.Reader) *Decoder + Valid(data []byte) bool + RegisterExtension(extension Extension) + DecoderOf(typ reflect2.Type) ValDecoder + EncoderOf(typ reflect2.Type) ValEncoder +} + +// ConfigDefault the default API +var ConfigDefault = Config{ + EscapeHTML: true, +}.Froze() + +// ConfigCompatibleWithStandardLibrary tries to be 100% compatible with standard library behavior +var ConfigCompatibleWithStandardLibrary = Config{ + EscapeHTML: true, + SortMapKeys: true, + ValidateJsonRawMessage: true, +}.Froze() + +// ConfigFastest marshals float with only 6 digits precision +var ConfigFastest = Config{ + EscapeHTML: false, + MarshalFloatWith6Digits: true, // will lose precession + ObjectFieldMustBeSimpleString: true, // do not unescape object field +}.Froze() + +type frozenConfig struct { + configBeforeFrozen Config + sortMapKeys bool + indentionStep int + objectFieldMustBeSimpleString bool + onlyTaggedField bool + disallowUnknownFields bool + decoderCache *concurrent.Map + encoderCache *concurrent.Map + encoderExtension Extension + decoderExtension Extension + extraExtensions []Extension + streamPool *sync.Pool + iteratorPool *sync.Pool + caseSensitive bool +} + +func (cfg *frozenConfig) initCache() { + cfg.decoderCache = concurrent.NewMap() + cfg.encoderCache = concurrent.NewMap() +} + +func (cfg *frozenConfig) addDecoderToCache(cacheKey uintptr, decoder ValDecoder) { + cfg.decoderCache.Store(cacheKey, decoder) +} + +func (cfg *frozenConfig) addEncoderToCache(cacheKey uintptr, encoder ValEncoder) { + cfg.encoderCache.Store(cacheKey, encoder) +} + +func (cfg *frozenConfig) getDecoderFromCache(cacheKey uintptr) ValDecoder { + decoder, found := cfg.decoderCache.Load(cacheKey) + if found { + return decoder.(ValDecoder) + } + return nil +} + +func (cfg *frozenConfig) getEncoderFromCache(cacheKey uintptr) ValEncoder { + encoder, found := cfg.encoderCache.Load(cacheKey) + if found { + return encoder.(ValEncoder) + } + return nil +} + +var cfgCache = concurrent.NewMap() + +func getFrozenConfigFromCache(cfg Config) *frozenConfig { + obj, found := cfgCache.Load(cfg) + if found { + return obj.(*frozenConfig) + } + return nil +} + +func addFrozenConfigToCache(cfg Config, frozenConfig *frozenConfig) { + cfgCache.Store(cfg, frozenConfig) +} + +// Froze forge API from config +func (cfg Config) Froze() API { + api := &frozenConfig{ + sortMapKeys: cfg.SortMapKeys, + indentionStep: cfg.IndentionStep, + objectFieldMustBeSimpleString: cfg.ObjectFieldMustBeSimpleString, + onlyTaggedField: cfg.OnlyTaggedField, + disallowUnknownFields: cfg.DisallowUnknownFields, + caseSensitive: cfg.CaseSensitive, + } + api.streamPool = &sync.Pool{ + New: func() interface{} { + return NewStream(api, nil, 512) + }, + } + api.iteratorPool = &sync.Pool{ + New: func() interface{} { + return NewIterator(api) + }, + } + api.initCache() + encoderExtension := EncoderExtension{} + decoderExtension := DecoderExtension{} + if cfg.MarshalFloatWith6Digits { + api.marshalFloatWith6Digits(encoderExtension) + } + if cfg.EscapeHTML { + api.escapeHTML(encoderExtension) + } + if cfg.UseNumber { + api.useNumber(decoderExtension) + } + if cfg.ValidateJsonRawMessage { + api.validateJsonRawMessage(encoderExtension) + } + api.encoderExtension = encoderExtension + api.decoderExtension = decoderExtension + api.configBeforeFrozen = cfg + return api +} + +func (cfg Config) frozeWithCacheReuse(extraExtensions []Extension) *frozenConfig { + api := getFrozenConfigFromCache(cfg) + if api != nil { + return api + } + api = cfg.Froze().(*frozenConfig) + for _, extension := range extraExtensions { + api.RegisterExtension(extension) + } + addFrozenConfigToCache(cfg, api) + return api +} + +func (cfg *frozenConfig) validateJsonRawMessage(extension EncoderExtension) { + encoder := &funcEncoder{func(ptr unsafe.Pointer, stream *Stream) { + rawMessage := *(*json.RawMessage)(ptr) + iter := cfg.BorrowIterator([]byte(rawMessage)) + iter.Read() + if iter.Error != nil { + stream.WriteRaw("null") + } else { + cfg.ReturnIterator(iter) + stream.WriteRaw(string(rawMessage)) + } + }, func(ptr unsafe.Pointer) bool { + return len(*((*json.RawMessage)(ptr))) == 0 + }} + extension[reflect2.TypeOfPtr((*json.RawMessage)(nil)).Elem()] = encoder + extension[reflect2.TypeOfPtr((*RawMessage)(nil)).Elem()] = encoder +} + +func (cfg *frozenConfig) useNumber(extension DecoderExtension) { + extension[reflect2.TypeOfPtr((*interface{})(nil)).Elem()] = &funcDecoder{func(ptr unsafe.Pointer, iter *Iterator) { + exitingValue := *((*interface{})(ptr)) + if exitingValue != nil && reflect.TypeOf(exitingValue).Kind() == reflect.Ptr { + iter.ReadVal(exitingValue) + return + } + if iter.WhatIsNext() == NumberValue { + *((*interface{})(ptr)) = json.Number(iter.readNumberAsString()) + } else { + *((*interface{})(ptr)) = iter.Read() + } + }} +} +func (cfg *frozenConfig) getTagKey() string { + tagKey := cfg.configBeforeFrozen.TagKey + if tagKey == "" { + return "json" + } + return tagKey +} + +func (cfg *frozenConfig) RegisterExtension(extension Extension) { + cfg.extraExtensions = append(cfg.extraExtensions, extension) + copied := cfg.configBeforeFrozen + cfg.configBeforeFrozen = copied +} + +type lossyFloat32Encoder struct { +} + +func (encoder *lossyFloat32Encoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteFloat32Lossy(*((*float32)(ptr))) +} + +func (encoder *lossyFloat32Encoder) IsEmpty(ptr unsafe.Pointer) bool { + return *((*float32)(ptr)) == 0 +} + +type lossyFloat64Encoder struct { +} + +func (encoder *lossyFloat64Encoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteFloat64Lossy(*((*float64)(ptr))) +} + +func (encoder *lossyFloat64Encoder) IsEmpty(ptr unsafe.Pointer) bool { + return *((*float64)(ptr)) == 0 +} + +// EnableLossyFloatMarshalling keeps 10**(-6) precision +// for float variables for better performance. +func (cfg *frozenConfig) marshalFloatWith6Digits(extension EncoderExtension) { + // for better performance + extension[reflect2.TypeOfPtr((*float32)(nil)).Elem()] = &lossyFloat32Encoder{} + extension[reflect2.TypeOfPtr((*float64)(nil)).Elem()] = &lossyFloat64Encoder{} +} + +type htmlEscapedStringEncoder struct { +} + +func (encoder *htmlEscapedStringEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + str := *((*string)(ptr)) + stream.WriteStringWithHTMLEscaped(str) +} + +func (encoder *htmlEscapedStringEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return *((*string)(ptr)) == "" +} + +func (cfg *frozenConfig) escapeHTML(encoderExtension EncoderExtension) { + encoderExtension[reflect2.TypeOfPtr((*string)(nil)).Elem()] = &htmlEscapedStringEncoder{} +} + +func (cfg *frozenConfig) cleanDecoders() { + typeDecoders = map[string]ValDecoder{} + fieldDecoders = map[string]ValDecoder{} + *cfg = *(cfg.configBeforeFrozen.Froze().(*frozenConfig)) +} + +func (cfg *frozenConfig) cleanEncoders() { + typeEncoders = map[string]ValEncoder{} + fieldEncoders = map[string]ValEncoder{} + *cfg = *(cfg.configBeforeFrozen.Froze().(*frozenConfig)) +} + +func (cfg *frozenConfig) MarshalToString(v interface{}) (string, error) { + stream := cfg.BorrowStream(nil) + defer cfg.ReturnStream(stream) + stream.WriteVal(v) + if stream.Error != nil { + return "", stream.Error + } + return string(stream.Buffer()), nil +} + +func (cfg *frozenConfig) Marshal(v interface{}) ([]byte, error) { + stream := cfg.BorrowStream(nil) + defer cfg.ReturnStream(stream) + stream.WriteVal(v) + if stream.Error != nil { + return nil, stream.Error + } + result := stream.Buffer() + copied := make([]byte, len(result)) + copy(copied, result) + return copied, nil +} + +func (cfg *frozenConfig) MarshalIndent(v interface{}, prefix, indent string) ([]byte, error) { + if prefix != "" { + panic("prefix is not supported") + } + for _, r := range indent { + if r != ' ' { + panic("indent can only be space") + } + } + newCfg := cfg.configBeforeFrozen + newCfg.IndentionStep = len(indent) + return newCfg.frozeWithCacheReuse(cfg.extraExtensions).Marshal(v) +} + +func (cfg *frozenConfig) UnmarshalFromString(str string, v interface{}) error { + data := []byte(str) + iter := cfg.BorrowIterator(data) + defer cfg.ReturnIterator(iter) + iter.ReadVal(v) + c := iter.nextToken() + if c == 0 { + if iter.Error == io.EOF { + return nil + } + return iter.Error + } + iter.ReportError("Unmarshal", "there are bytes left after unmarshal") + return iter.Error +} + +func (cfg *frozenConfig) Get(data []byte, path ...interface{}) Any { + iter := cfg.BorrowIterator(data) + defer cfg.ReturnIterator(iter) + return locatePath(iter, path) +} + +func (cfg *frozenConfig) Unmarshal(data []byte, v interface{}) error { + iter := cfg.BorrowIterator(data) + defer cfg.ReturnIterator(iter) + iter.ReadVal(v) + c := iter.nextToken() + if c == 0 { + if iter.Error == io.EOF { + return nil + } + return iter.Error + } + iter.ReportError("Unmarshal", "there are bytes left after unmarshal") + return iter.Error +} + +func (cfg *frozenConfig) NewEncoder(writer io.Writer) *Encoder { + stream := NewStream(cfg, writer, 512) + return &Encoder{stream} +} + +func (cfg *frozenConfig) NewDecoder(reader io.Reader) *Decoder { + iter := Parse(cfg, reader, 512) + return &Decoder{iter} +} + +func (cfg *frozenConfig) Valid(data []byte) bool { + iter := cfg.BorrowIterator(data) + defer cfg.ReturnIterator(iter) + iter.Skip() + return iter.Error == nil +} diff --git a/vendor/github.com/json-iterator/go/feature_config.go b/vendor/github.com/json-iterator/go/feature_config.go deleted file mode 100644 index fc055d504..000000000 --- a/vendor/github.com/json-iterator/go/feature_config.go +++ /dev/null @@ -1,312 +0,0 @@ -package jsoniter - -import ( - "encoding/json" - "errors" - "io" - "reflect" - "sync/atomic" - "unsafe" -) - -// Config customize how the API should behave. -// The API is created from Config by Froze. -type Config struct { - IndentionStep int - MarshalFloatWith6Digits bool - EscapeHTML bool - SortMapKeys bool - UseNumber bool - TagKey string -} - -type frozenConfig struct { - configBeforeFrozen Config - sortMapKeys bool - indentionStep int - decoderCache unsafe.Pointer - encoderCache unsafe.Pointer - extensions []Extension - streamPool chan *Stream - iteratorPool chan *Iterator -} - -// API the public interface of this package. -// Primary Marshal and Unmarshal. -type API interface { - IteratorPool - StreamPool - MarshalToString(v interface{}) (string, error) - Marshal(v interface{}) ([]byte, error) - MarshalIndent(v interface{}, prefix, indent string) ([]byte, error) - UnmarshalFromString(str string, v interface{}) error - Unmarshal(data []byte, v interface{}) error - Get(data []byte, path ...interface{}) Any - NewEncoder(writer io.Writer) *Encoder - NewDecoder(reader io.Reader) *Decoder -} - -// ConfigDefault the default API -var ConfigDefault = Config{ - EscapeHTML: true, -}.Froze() - -// ConfigCompatibleWithStandardLibrary tries to be 100% compatible with standard library behavior -var ConfigCompatibleWithStandardLibrary = Config{ - EscapeHTML: true, - SortMapKeys: true, -}.Froze() - -// ConfigFastest marshals float with only 6 digits precision -var ConfigFastest = Config{ - EscapeHTML: false, - MarshalFloatWith6Digits: true, -}.Froze() - -// Froze forge API from config -func (cfg Config) Froze() API { - // TODO: cache frozen config - frozenConfig := &frozenConfig{ - sortMapKeys: cfg.SortMapKeys, - indentionStep: cfg.IndentionStep, - streamPool: make(chan *Stream, 16), - iteratorPool: make(chan *Iterator, 16), - } - atomic.StorePointer(&frozenConfig.decoderCache, unsafe.Pointer(&map[string]ValDecoder{})) - atomic.StorePointer(&frozenConfig.encoderCache, unsafe.Pointer(&map[string]ValEncoder{})) - if cfg.MarshalFloatWith6Digits { - frozenConfig.marshalFloatWith6Digits() - } - if cfg.EscapeHTML { - frozenConfig.escapeHTML() - } - if cfg.UseNumber { - frozenConfig.useNumber() - } - frozenConfig.configBeforeFrozen = cfg - return frozenConfig -} - -func (cfg *frozenConfig) useNumber() { - cfg.addDecoderToCache(reflect.TypeOf((*interface{})(nil)).Elem(), &funcDecoder{func(ptr unsafe.Pointer, iter *Iterator) { - if iter.WhatIsNext() == NumberValue { - *((*interface{})(ptr)) = json.Number(iter.readNumberAsString()) - } else { - *((*interface{})(ptr)) = iter.Read() - } - }}) -} -func (cfg *frozenConfig) getTagKey() string { - tagKey := cfg.configBeforeFrozen.TagKey - if tagKey == "" { - return "json" - } - return tagKey -} - -func (cfg *frozenConfig) registerExtension(extension Extension) { - cfg.extensions = append(cfg.extensions, extension) -} - -type lossyFloat32Encoder struct { -} - -func (encoder *lossyFloat32Encoder) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteFloat32Lossy(*((*float32)(ptr))) -} - -func (encoder *lossyFloat32Encoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *lossyFloat32Encoder) IsEmpty(ptr unsafe.Pointer) bool { - return *((*float32)(ptr)) == 0 -} - -type lossyFloat64Encoder struct { -} - -func (encoder *lossyFloat64Encoder) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteFloat64Lossy(*((*float64)(ptr))) -} - -func (encoder *lossyFloat64Encoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *lossyFloat64Encoder) IsEmpty(ptr unsafe.Pointer) bool { - return *((*float64)(ptr)) == 0 -} - -// EnableLossyFloatMarshalling keeps 10**(-6) precision -// for float variables for better performance. -func (cfg *frozenConfig) marshalFloatWith6Digits() { - // for better performance - cfg.addEncoderToCache(reflect.TypeOf((*float32)(nil)).Elem(), &lossyFloat32Encoder{}) - cfg.addEncoderToCache(reflect.TypeOf((*float64)(nil)).Elem(), &lossyFloat64Encoder{}) -} - -type htmlEscapedStringEncoder struct { -} - -func (encoder *htmlEscapedStringEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - str := *((*string)(ptr)) - stream.WriteStringWithHTMLEscaped(str) -} - -func (encoder *htmlEscapedStringEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *htmlEscapedStringEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return *((*string)(ptr)) == "" -} - -func (cfg *frozenConfig) escapeHTML() { - cfg.addEncoderToCache(reflect.TypeOf((*string)(nil)).Elem(), &htmlEscapedStringEncoder{}) -} - -func (cfg *frozenConfig) addDecoderToCache(cacheKey reflect.Type, decoder ValDecoder) { - done := false - for !done { - ptr := atomic.LoadPointer(&cfg.decoderCache) - cache := *(*map[reflect.Type]ValDecoder)(ptr) - copied := map[reflect.Type]ValDecoder{} - for k, v := range cache { - copied[k] = v - } - copied[cacheKey] = decoder - done = atomic.CompareAndSwapPointer(&cfg.decoderCache, ptr, unsafe.Pointer(&copied)) - } -} - -func (cfg *frozenConfig) addEncoderToCache(cacheKey reflect.Type, encoder ValEncoder) { - done := false - for !done { - ptr := atomic.LoadPointer(&cfg.encoderCache) - cache := *(*map[reflect.Type]ValEncoder)(ptr) - copied := map[reflect.Type]ValEncoder{} - for k, v := range cache { - copied[k] = v - } - copied[cacheKey] = encoder - done = atomic.CompareAndSwapPointer(&cfg.encoderCache, ptr, unsafe.Pointer(&copied)) - } -} - -func (cfg *frozenConfig) getDecoderFromCache(cacheKey reflect.Type) ValDecoder { - ptr := atomic.LoadPointer(&cfg.decoderCache) - cache := *(*map[reflect.Type]ValDecoder)(ptr) - return cache[cacheKey] -} - -func (cfg *frozenConfig) getEncoderFromCache(cacheKey reflect.Type) ValEncoder { - ptr := atomic.LoadPointer(&cfg.encoderCache) - cache := *(*map[reflect.Type]ValEncoder)(ptr) - return cache[cacheKey] -} - -func (cfg *frozenConfig) cleanDecoders() { - typeDecoders = map[string]ValDecoder{} - fieldDecoders = map[string]ValDecoder{} - *cfg = *(cfg.configBeforeFrozen.Froze().(*frozenConfig)) -} - -func (cfg *frozenConfig) cleanEncoders() { - typeEncoders = map[string]ValEncoder{} - fieldEncoders = map[string]ValEncoder{} - *cfg = *(cfg.configBeforeFrozen.Froze().(*frozenConfig)) -} - -func (cfg *frozenConfig) MarshalToString(v interface{}) (string, error) { - stream := cfg.BorrowStream(nil) - defer cfg.ReturnStream(stream) - stream.WriteVal(v) - if stream.Error != nil { - return "", stream.Error - } - return string(stream.Buffer()), nil -} - -func (cfg *frozenConfig) Marshal(v interface{}) ([]byte, error) { - stream := cfg.BorrowStream(nil) - defer cfg.ReturnStream(stream) - stream.WriteVal(v) - if stream.Error != nil { - return nil, stream.Error - } - result := stream.Buffer() - copied := make([]byte, len(result)) - copy(copied, result) - return copied, nil -} - -func (cfg *frozenConfig) MarshalIndent(v interface{}, prefix, indent string) ([]byte, error) { - if prefix != "" { - panic("prefix is not supported") - } - for _, r := range indent { - if r != ' ' { - panic("indent can only be space") - } - } - newCfg := cfg.configBeforeFrozen - newCfg.IndentionStep = len(indent) - return newCfg.Froze().Marshal(v) -} - -func (cfg *frozenConfig) UnmarshalFromString(str string, v interface{}) error { - data := []byte(str) - data = data[:lastNotSpacePos(data)] - iter := cfg.BorrowIterator(data) - defer cfg.ReturnIterator(iter) - iter.ReadVal(v) - if iter.head == iter.tail { - iter.loadMore() - } - if iter.Error == io.EOF { - return nil - } - if iter.Error == nil { - iter.ReportError("UnmarshalFromString", "there are bytes left after unmarshal") - } - return iter.Error -} - -func (cfg *frozenConfig) Get(data []byte, path ...interface{}) Any { - iter := cfg.BorrowIterator(data) - defer cfg.ReturnIterator(iter) - return locatePath(iter, path) -} - -func (cfg *frozenConfig) Unmarshal(data []byte, v interface{}) error { - data = data[:lastNotSpacePos(data)] - iter := cfg.BorrowIterator(data) - defer cfg.ReturnIterator(iter) - typ := reflect.TypeOf(v) - if typ.Kind() != reflect.Ptr { - // return non-pointer error - return errors.New("the second param must be ptr type") - } - iter.ReadVal(v) - if iter.head == iter.tail { - iter.loadMore() - } - if iter.Error == io.EOF { - return nil - } - if iter.Error == nil { - iter.ReportError("Unmarshal", "there are bytes left after unmarshal") - } - return iter.Error -} - -func (cfg *frozenConfig) NewEncoder(writer io.Writer) *Encoder { - stream := NewStream(cfg, writer, 512) - return &Encoder{stream} -} - -func (cfg *frozenConfig) NewDecoder(reader io.Reader) *Decoder { - iter := Parse(cfg, reader, 512) - return &Decoder{iter} -} diff --git a/vendor/github.com/json-iterator/go/feature_json_number.go b/vendor/github.com/json-iterator/go/feature_json_number.go deleted file mode 100644 index 0439f6725..000000000 --- a/vendor/github.com/json-iterator/go/feature_json_number.go +++ /dev/null @@ -1,15 +0,0 @@ -package jsoniter - -import "encoding/json" - -type Number string - -func CastJsonNumber(val interface{}) (string, bool) { - switch typedVal := val.(type) { - case json.Number: - return string(typedVal), true - case Number: - return string(typedVal), true - } - return "", false -} diff --git a/vendor/github.com/json-iterator/go/feature_reflect.go b/vendor/github.com/json-iterator/go/feature_reflect.go deleted file mode 100644 index 05d91b49c..000000000 --- a/vendor/github.com/json-iterator/go/feature_reflect.go +++ /dev/null @@ -1,691 +0,0 @@ -package jsoniter - -import ( - "encoding" - "encoding/json" - "fmt" - "reflect" - "time" - "unsafe" -) - -// ValDecoder is an internal type registered to cache as needed. -// Don't confuse jsoniter.ValDecoder with json.Decoder. -// For json.Decoder's adapter, refer to jsoniter.AdapterDecoder(todo link). -// -// Reflection on type to create decoders, which is then cached -// Reflection on value is avoided as we can, as the reflect.Value itself will allocate, with following exceptions -// 1. create instance of new value, for example *int will need a int to be allocated -// 2. append to slice, if the existing cap is not enough, allocate will be done using Reflect.New -// 3. assignment to map, both key and value will be reflect.Value -// For a simple struct binding, it will be reflect.Value free and allocation free -type ValDecoder interface { - Decode(ptr unsafe.Pointer, iter *Iterator) -} - -// ValEncoder is an internal type registered to cache as needed. -// Don't confuse jsoniter.ValEncoder with json.Encoder. -// For json.Encoder's adapter, refer to jsoniter.AdapterEncoder(todo godoc link). -type ValEncoder interface { - IsEmpty(ptr unsafe.Pointer) bool - Encode(ptr unsafe.Pointer, stream *Stream) - EncodeInterface(val interface{}, stream *Stream) -} - -type checkIsEmpty interface { - IsEmpty(ptr unsafe.Pointer) bool -} - -// WriteToStream the default implementation for TypeEncoder method EncodeInterface -func WriteToStream(val interface{}, stream *Stream, encoder ValEncoder) { - e := (*emptyInterface)(unsafe.Pointer(&val)) - if e.word == nil { - stream.WriteNil() - return - } - if reflect.TypeOf(val).Kind() == reflect.Ptr { - encoder.Encode(unsafe.Pointer(&e.word), stream) - } else { - encoder.Encode(e.word, stream) - } -} - -var jsonNumberType reflect.Type -var jsoniterNumberType reflect.Type -var jsonRawMessageType reflect.Type -var jsoniterRawMessageType reflect.Type -var anyType reflect.Type -var marshalerType reflect.Type -var unmarshalerType reflect.Type -var textMarshalerType reflect.Type -var textUnmarshalerType reflect.Type - -func init() { - jsonNumberType = reflect.TypeOf((*json.Number)(nil)).Elem() - jsoniterNumberType = reflect.TypeOf((*Number)(nil)).Elem() - jsonRawMessageType = reflect.TypeOf((*json.RawMessage)(nil)).Elem() - jsoniterRawMessageType = reflect.TypeOf((*RawMessage)(nil)).Elem() - anyType = reflect.TypeOf((*Any)(nil)).Elem() - marshalerType = reflect.TypeOf((*json.Marshaler)(nil)).Elem() - unmarshalerType = reflect.TypeOf((*json.Unmarshaler)(nil)).Elem() - textMarshalerType = reflect.TypeOf((*encoding.TextMarshaler)(nil)).Elem() - textUnmarshalerType = reflect.TypeOf((*encoding.TextUnmarshaler)(nil)).Elem() -} - -type optionalDecoder struct { - valueType reflect.Type - valueDecoder ValDecoder -} - -func (decoder *optionalDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - if iter.ReadNil() { - *((*unsafe.Pointer)(ptr)) = nil - } else { - if *((*unsafe.Pointer)(ptr)) == nil { - //pointer to null, we have to allocate memory to hold the value - value := reflect.New(decoder.valueType) - newPtr := extractInterface(value.Interface()).word - decoder.valueDecoder.Decode(newPtr, iter) - *((*uintptr)(ptr)) = uintptr(newPtr) - } else { - //reuse existing instance - decoder.valueDecoder.Decode(*((*unsafe.Pointer)(ptr)), iter) - } - } -} - -type deferenceDecoder struct { - // only to deference a pointer - valueType reflect.Type - valueDecoder ValDecoder -} - -func (decoder *deferenceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - if *((*unsafe.Pointer)(ptr)) == nil { - //pointer to null, we have to allocate memory to hold the value - value := reflect.New(decoder.valueType) - newPtr := extractInterface(value.Interface()).word - decoder.valueDecoder.Decode(newPtr, iter) - *((*uintptr)(ptr)) = uintptr(newPtr) - } else { - //reuse existing instance - decoder.valueDecoder.Decode(*((*unsafe.Pointer)(ptr)), iter) - } -} - -type optionalEncoder struct { - valueEncoder ValEncoder -} - -func (encoder *optionalEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - if *((*unsafe.Pointer)(ptr)) == nil { - stream.WriteNil() - } else { - encoder.valueEncoder.Encode(*((*unsafe.Pointer)(ptr)), stream) - } -} - -func (encoder *optionalEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *optionalEncoder) IsEmpty(ptr unsafe.Pointer) bool { - if *((*unsafe.Pointer)(ptr)) == nil { - return true - } - return false -} - -type placeholderEncoder struct { - cfg *frozenConfig - cacheKey reflect.Type -} - -func (encoder *placeholderEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - encoder.getRealEncoder().Encode(ptr, stream) -} - -func (encoder *placeholderEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *placeholderEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return encoder.getRealEncoder().IsEmpty(ptr) -} - -func (encoder *placeholderEncoder) getRealEncoder() ValEncoder { - for i := 0; i < 30; i++ { - realDecoder := encoder.cfg.getEncoderFromCache(encoder.cacheKey) - _, isPlaceholder := realDecoder.(*placeholderEncoder) - if isPlaceholder { - time.Sleep(time.Second) - } else { - return realDecoder - } - } - panic(fmt.Sprintf("real encoder not found for cache key: %v", encoder.cacheKey)) -} - -type placeholderDecoder struct { - cfg *frozenConfig - cacheKey reflect.Type -} - -func (decoder *placeholderDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - for i := 0; i < 30; i++ { - realDecoder := decoder.cfg.getDecoderFromCache(decoder.cacheKey) - _, isPlaceholder := realDecoder.(*placeholderDecoder) - if isPlaceholder { - time.Sleep(time.Second) - } else { - realDecoder.Decode(ptr, iter) - return - } - } - panic(fmt.Sprintf("real decoder not found for cache key: %v", decoder.cacheKey)) -} - -// emptyInterface is the header for an interface{} value. -type emptyInterface struct { - typ unsafe.Pointer - word unsafe.Pointer -} - -// emptyInterface is the header for an interface with method (not interface{}) -type nonEmptyInterface struct { - // see ../runtime/iface.go:/Itab - itab *struct { - ityp unsafe.Pointer // static interface type - typ unsafe.Pointer // dynamic concrete type - link unsafe.Pointer - bad int32 - unused int32 - fun [100000]unsafe.Pointer // method table - } - word unsafe.Pointer -} - -// ReadVal copy the underlying JSON into go interface, same as json.Unmarshal -func (iter *Iterator) ReadVal(obj interface{}) { - typ := reflect.TypeOf(obj) - cacheKey := typ.Elem() - decoder, err := decoderOfType(iter.cfg, cacheKey) - if err != nil { - iter.Error = err - return - } - e := (*emptyInterface)(unsafe.Pointer(&obj)) - decoder.Decode(e.word, iter) -} - -// WriteVal copy the go interface into underlying JSON, same as json.Marshal -func (stream *Stream) WriteVal(val interface{}) { - if nil == val { - stream.WriteNil() - return - } - typ := reflect.TypeOf(val) - cacheKey := typ - encoder, err := encoderOfType(stream.cfg, cacheKey) - if err != nil { - stream.Error = err - return - } - encoder.EncodeInterface(val, stream) -} - -type prefix string - -func (p prefix) addToDecoder(decoder ValDecoder, err error) (ValDecoder, error) { - if err != nil { - return nil, fmt.Errorf("%s: %s", p, err.Error()) - } - return decoder, err -} - -func (p prefix) addToEncoder(encoder ValEncoder, err error) (ValEncoder, error) { - if err != nil { - return nil, fmt.Errorf("%s: %s", p, err.Error()) - } - return encoder, err -} - -func decoderOfType(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - cacheKey := typ - decoder := cfg.getDecoderFromCache(cacheKey) - if decoder != nil { - return decoder, nil - } - decoder = getTypeDecoderFromExtension(typ) - if decoder != nil { - cfg.addDecoderToCache(cacheKey, decoder) - return decoder, nil - } - decoder = &placeholderDecoder{cfg: cfg, cacheKey: cacheKey} - cfg.addDecoderToCache(cacheKey, decoder) - decoder, err := createDecoderOfType(cfg, typ) - for _, extension := range extensions { - decoder = extension.DecorateDecoder(typ, decoder) - } - cfg.addDecoderToCache(cacheKey, decoder) - return decoder, err -} - -func createDecoderOfType(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - typeName := typ.String() - if typ == jsonRawMessageType { - return &jsonRawMessageCodec{}, nil - } - if typ == jsoniterRawMessageType { - return &jsoniterRawMessageCodec{}, nil - } - if typ.AssignableTo(jsonNumberType) { - return &jsonNumberCodec{}, nil - } - if typ.AssignableTo(jsoniterNumberType) { - return &jsoniterNumberCodec{}, nil - } - if typ.Implements(unmarshalerType) { - templateInterface := reflect.New(typ).Elem().Interface() - var decoder ValDecoder = &unmarshalerDecoder{extractInterface(templateInterface)} - if typ.Kind() == reflect.Ptr { - decoder = &optionalDecoder{typ.Elem(), decoder} - } - return decoder, nil - } - if reflect.PtrTo(typ).Implements(unmarshalerType) { - templateInterface := reflect.New(typ).Interface() - var decoder ValDecoder = &unmarshalerDecoder{extractInterface(templateInterface)} - return decoder, nil - } - if typ.Implements(textUnmarshalerType) { - templateInterface := reflect.New(typ).Elem().Interface() - var decoder ValDecoder = &textUnmarshalerDecoder{extractInterface(templateInterface)} - if typ.Kind() == reflect.Ptr { - decoder = &optionalDecoder{typ.Elem(), decoder} - } - return decoder, nil - } - if reflect.PtrTo(typ).Implements(textUnmarshalerType) { - templateInterface := reflect.New(typ).Interface() - var decoder ValDecoder = &textUnmarshalerDecoder{extractInterface(templateInterface)} - return decoder, nil - } - if typ.Kind() == reflect.Slice && typ.Elem().Kind() == reflect.Uint8 { - sliceDecoder, err := prefix("[slice]").addToDecoder(decoderOfSlice(cfg, typ)) - if err != nil { - return nil, err - } - return &base64Codec{sliceDecoder: sliceDecoder}, nil - } - if typ.Implements(anyType) { - return &anyCodec{}, nil - } - switch typ.Kind() { - case reflect.String: - if typeName != "string" { - return decoderOfType(cfg, reflect.TypeOf((*string)(nil)).Elem()) - } - return &stringCodec{}, nil - case reflect.Int: - if typeName != "int" { - return decoderOfType(cfg, reflect.TypeOf((*int)(nil)).Elem()) - } - return &intCodec{}, nil - case reflect.Int8: - if typeName != "int8" { - return decoderOfType(cfg, reflect.TypeOf((*int8)(nil)).Elem()) - } - return &int8Codec{}, nil - case reflect.Int16: - if typeName != "int16" { - return decoderOfType(cfg, reflect.TypeOf((*int16)(nil)).Elem()) - } - return &int16Codec{}, nil - case reflect.Int32: - if typeName != "int32" { - return decoderOfType(cfg, reflect.TypeOf((*int32)(nil)).Elem()) - } - return &int32Codec{}, nil - case reflect.Int64: - if typeName != "int64" { - return decoderOfType(cfg, reflect.TypeOf((*int64)(nil)).Elem()) - } - return &int64Codec{}, nil - case reflect.Uint: - if typeName != "uint" { - return decoderOfType(cfg, reflect.TypeOf((*uint)(nil)).Elem()) - } - return &uintCodec{}, nil - case reflect.Uint8: - if typeName != "uint8" { - return decoderOfType(cfg, reflect.TypeOf((*uint8)(nil)).Elem()) - } - return &uint8Codec{}, nil - case reflect.Uint16: - if typeName != "uint16" { - return decoderOfType(cfg, reflect.TypeOf((*uint16)(nil)).Elem()) - } - return &uint16Codec{}, nil - case reflect.Uint32: - if typeName != "uint32" { - return decoderOfType(cfg, reflect.TypeOf((*uint32)(nil)).Elem()) - } - return &uint32Codec{}, nil - case reflect.Uintptr: - if typeName != "uintptr" { - return decoderOfType(cfg, reflect.TypeOf((*uintptr)(nil)).Elem()) - } - return &uintptrCodec{}, nil - case reflect.Uint64: - if typeName != "uint64" { - return decoderOfType(cfg, reflect.TypeOf((*uint64)(nil)).Elem()) - } - return &uint64Codec{}, nil - case reflect.Float32: - if typeName != "float32" { - return decoderOfType(cfg, reflect.TypeOf((*float32)(nil)).Elem()) - } - return &float32Codec{}, nil - case reflect.Float64: - if typeName != "float64" { - return decoderOfType(cfg, reflect.TypeOf((*float64)(nil)).Elem()) - } - return &float64Codec{}, nil - case reflect.Bool: - if typeName != "bool" { - return decoderOfType(cfg, reflect.TypeOf((*bool)(nil)).Elem()) - } - return &boolCodec{}, nil - case reflect.Interface: - if typ.NumMethod() == 0 { - return &emptyInterfaceCodec{}, nil - } - return &nonEmptyInterfaceCodec{}, nil - case reflect.Struct: - return prefix(fmt.Sprintf("[%s]", typeName)).addToDecoder(decoderOfStruct(cfg, typ)) - case reflect.Array: - return prefix("[array]").addToDecoder(decoderOfArray(cfg, typ)) - case reflect.Slice: - return prefix("[slice]").addToDecoder(decoderOfSlice(cfg, typ)) - case reflect.Map: - return prefix("[map]").addToDecoder(decoderOfMap(cfg, typ)) - case reflect.Ptr: - return prefix("[optional]").addToDecoder(decoderOfOptional(cfg, typ)) - default: - return nil, fmt.Errorf("unsupported type: %v", typ) - } -} - -func encoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - cacheKey := typ - encoder := cfg.getEncoderFromCache(cacheKey) - if encoder != nil { - return encoder, nil - } - encoder = getTypeEncoderFromExtension(typ) - if encoder != nil { - cfg.addEncoderToCache(cacheKey, encoder) - return encoder, nil - } - encoder = &placeholderEncoder{cfg: cfg, cacheKey: cacheKey} - cfg.addEncoderToCache(cacheKey, encoder) - encoder, err := createEncoderOfType(cfg, typ) - for _, extension := range extensions { - encoder = extension.DecorateEncoder(typ, encoder) - } - cfg.addEncoderToCache(cacheKey, encoder) - return encoder, err -} - -func createEncoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - if typ == jsonRawMessageType { - return &jsonRawMessageCodec{}, nil - } - if typ == jsoniterRawMessageType { - return &jsoniterRawMessageCodec{}, nil - } - if typ.AssignableTo(jsonNumberType) { - return &jsonNumberCodec{}, nil - } - if typ.AssignableTo(jsoniterNumberType) { - return &jsoniterNumberCodec{}, nil - } - if typ.Implements(marshalerType) { - checkIsEmpty, err := createCheckIsEmpty(typ) - if err != nil { - return nil, err - } - templateInterface := reflect.New(typ).Elem().Interface() - var encoder ValEncoder = &marshalerEncoder{ - templateInterface: extractInterface(templateInterface), - checkIsEmpty: checkIsEmpty, - } - if typ.Kind() == reflect.Ptr { - encoder = &optionalEncoder{encoder} - } - return encoder, nil - } - if typ.Implements(textMarshalerType) { - checkIsEmpty, err := createCheckIsEmpty(typ) - if err != nil { - return nil, err - } - templateInterface := reflect.New(typ).Elem().Interface() - var encoder ValEncoder = &textMarshalerEncoder{ - templateInterface: extractInterface(templateInterface), - checkIsEmpty: checkIsEmpty, - } - if typ.Kind() == reflect.Ptr { - encoder = &optionalEncoder{encoder} - } - return encoder, nil - } - if typ.Kind() == reflect.Slice && typ.Elem().Kind() == reflect.Uint8 { - return &base64Codec{}, nil - } - if typ.Implements(anyType) { - return &anyCodec{}, nil - } - return createEncoderOfSimpleType(cfg, typ) -} - -func createCheckIsEmpty(typ reflect.Type) (checkIsEmpty, error) { - kind := typ.Kind() - switch kind { - case reflect.String: - return &stringCodec{}, nil - case reflect.Int: - return &intCodec{}, nil - case reflect.Int8: - return &int8Codec{}, nil - case reflect.Int16: - return &int16Codec{}, nil - case reflect.Int32: - return &int32Codec{}, nil - case reflect.Int64: - return &int64Codec{}, nil - case reflect.Uint: - return &uintCodec{}, nil - case reflect.Uint8: - return &uint8Codec{}, nil - case reflect.Uint16: - return &uint16Codec{}, nil - case reflect.Uint32: - return &uint32Codec{}, nil - case reflect.Uintptr: - return &uintptrCodec{}, nil - case reflect.Uint64: - return &uint64Codec{}, nil - case reflect.Float32: - return &float32Codec{}, nil - case reflect.Float64: - return &float64Codec{}, nil - case reflect.Bool: - return &boolCodec{}, nil - case reflect.Interface: - if typ.NumMethod() == 0 { - return &emptyInterfaceCodec{}, nil - } - return &nonEmptyInterfaceCodec{}, nil - case reflect.Struct: - return &structEncoder{}, nil - case reflect.Array: - return &arrayEncoder{}, nil - case reflect.Slice: - return &sliceEncoder{}, nil - case reflect.Map: - return &mapEncoder{}, nil - case reflect.Ptr: - return &optionalEncoder{}, nil - default: - return nil, fmt.Errorf("unsupported type: %v", typ) - } -} - -func createEncoderOfSimpleType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - typeName := typ.String() - kind := typ.Kind() - switch kind { - case reflect.String: - if typeName != "string" { - return encoderOfType(cfg, reflect.TypeOf((*string)(nil)).Elem()) - } - return &stringCodec{}, nil - case reflect.Int: - if typeName != "int" { - return encoderOfType(cfg, reflect.TypeOf((*int)(nil)).Elem()) - } - return &intCodec{}, nil - case reflect.Int8: - if typeName != "int8" { - return encoderOfType(cfg, reflect.TypeOf((*int8)(nil)).Elem()) - } - return &int8Codec{}, nil - case reflect.Int16: - if typeName != "int16" { - return encoderOfType(cfg, reflect.TypeOf((*int16)(nil)).Elem()) - } - return &int16Codec{}, nil - case reflect.Int32: - if typeName != "int32" { - return encoderOfType(cfg, reflect.TypeOf((*int32)(nil)).Elem()) - } - return &int32Codec{}, nil - case reflect.Int64: - if typeName != "int64" { - return encoderOfType(cfg, reflect.TypeOf((*int64)(nil)).Elem()) - } - return &int64Codec{}, nil - case reflect.Uint: - if typeName != "uint" { - return encoderOfType(cfg, reflect.TypeOf((*uint)(nil)).Elem()) - } - return &uintCodec{}, nil - case reflect.Uint8: - if typeName != "uint8" { - return encoderOfType(cfg, reflect.TypeOf((*uint8)(nil)).Elem()) - } - return &uint8Codec{}, nil - case reflect.Uint16: - if typeName != "uint16" { - return encoderOfType(cfg, reflect.TypeOf((*uint16)(nil)).Elem()) - } - return &uint16Codec{}, nil - case reflect.Uint32: - if typeName != "uint32" { - return encoderOfType(cfg, reflect.TypeOf((*uint32)(nil)).Elem()) - } - return &uint32Codec{}, nil - case reflect.Uintptr: - if typeName != "uintptr" { - return encoderOfType(cfg, reflect.TypeOf((*uintptr)(nil)).Elem()) - } - return &uintptrCodec{}, nil - case reflect.Uint64: - if typeName != "uint64" { - return encoderOfType(cfg, reflect.TypeOf((*uint64)(nil)).Elem()) - } - return &uint64Codec{}, nil - case reflect.Float32: - if typeName != "float32" { - return encoderOfType(cfg, reflect.TypeOf((*float32)(nil)).Elem()) - } - return &float32Codec{}, nil - case reflect.Float64: - if typeName != "float64" { - return encoderOfType(cfg, reflect.TypeOf((*float64)(nil)).Elem()) - } - return &float64Codec{}, nil - case reflect.Bool: - if typeName != "bool" { - return encoderOfType(cfg, reflect.TypeOf((*bool)(nil)).Elem()) - } - return &boolCodec{}, nil - case reflect.Interface: - if typ.NumMethod() == 0 { - return &emptyInterfaceCodec{}, nil - } - return &nonEmptyInterfaceCodec{}, nil - case reflect.Struct: - return prefix(fmt.Sprintf("[%s]", typeName)).addToEncoder(encoderOfStruct(cfg, typ)) - case reflect.Array: - return prefix("[array]").addToEncoder(encoderOfArray(cfg, typ)) - case reflect.Slice: - return prefix("[slice]").addToEncoder(encoderOfSlice(cfg, typ)) - case reflect.Map: - return prefix("[map]").addToEncoder(encoderOfMap(cfg, typ)) - case reflect.Ptr: - return prefix("[optional]").addToEncoder(encoderOfOptional(cfg, typ)) - default: - return nil, fmt.Errorf("unsupported type: %v", typ) - } -} - -func decoderOfOptional(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - elemType := typ.Elem() - decoder, err := decoderOfType(cfg, elemType) - if err != nil { - return nil, err - } - return &optionalDecoder{elemType, decoder}, nil -} - -func encoderOfOptional(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - elemType := typ.Elem() - elemEncoder, err := encoderOfType(cfg, elemType) - if err != nil { - return nil, err - } - encoder := &optionalEncoder{elemEncoder} - if elemType.Kind() == reflect.Map { - encoder = &optionalEncoder{encoder} - } - return encoder, nil -} - -func decoderOfMap(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - decoder, err := decoderOfType(cfg, typ.Elem()) - if err != nil { - return nil, err - } - mapInterface := reflect.New(typ).Interface() - return &mapDecoder{typ, typ.Key(), typ.Elem(), decoder, extractInterface(mapInterface)}, nil -} - -func extractInterface(val interface{}) emptyInterface { - return *((*emptyInterface)(unsafe.Pointer(&val))) -} - -func encoderOfMap(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - elemType := typ.Elem() - encoder, err := encoderOfType(cfg, elemType) - if err != nil { - return nil, err - } - mapInterface := reflect.New(typ).Elem().Interface() - if cfg.sortMapKeys { - return &sortKeysMapEncoder{typ, elemType, encoder, *((*emptyInterface)(unsafe.Pointer(&mapInterface)))}, nil - } - return &mapEncoder{typ, elemType, encoder, *((*emptyInterface)(unsafe.Pointer(&mapInterface)))}, nil -} diff --git a/vendor/github.com/json-iterator/go/feature_reflect_array.go b/vendor/github.com/json-iterator/go/feature_reflect_array.go deleted file mode 100644 index e23f187b7..000000000 --- a/vendor/github.com/json-iterator/go/feature_reflect_array.go +++ /dev/null @@ -1,99 +0,0 @@ -package jsoniter - -import ( - "fmt" - "io" - "reflect" - "unsafe" -) - -func decoderOfArray(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - decoder, err := decoderOfType(cfg, typ.Elem()) - if err != nil { - return nil, err - } - return &arrayDecoder{typ, typ.Elem(), decoder}, nil -} - -func encoderOfArray(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - encoder, err := encoderOfType(cfg, typ.Elem()) - if err != nil { - return nil, err - } - if typ.Elem().Kind() == reflect.Map { - encoder = &optionalEncoder{encoder} - } - return &arrayEncoder{typ, typ.Elem(), encoder}, nil -} - -type arrayEncoder struct { - arrayType reflect.Type - elemType reflect.Type - elemEncoder ValEncoder -} - -func (encoder *arrayEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteArrayStart() - elemPtr := unsafe.Pointer(ptr) - encoder.elemEncoder.Encode(elemPtr, stream) - for i := 1; i < encoder.arrayType.Len(); i++ { - stream.WriteMore() - elemPtr = unsafe.Pointer(uintptr(elemPtr) + encoder.elemType.Size()) - encoder.elemEncoder.Encode(unsafe.Pointer(elemPtr), stream) - } - stream.WriteArrayEnd() - if stream.Error != nil && stream.Error != io.EOF { - stream.Error = fmt.Errorf("%v: %s", encoder.arrayType, stream.Error.Error()) - } -} - -func (encoder *arrayEncoder) EncodeInterface(val interface{}, stream *Stream) { - // special optimization for interface{} - e := (*emptyInterface)(unsafe.Pointer(&val)) - if e.word == nil { - stream.WriteArrayStart() - stream.WriteNil() - stream.WriteArrayEnd() - return - } - elemType := encoder.arrayType.Elem() - if encoder.arrayType.Len() == 1 && (elemType.Kind() == reflect.Ptr || elemType.Kind() == reflect.Map) { - ptr := uintptr(e.word) - e.word = unsafe.Pointer(&ptr) - } - if reflect.TypeOf(val).Kind() == reflect.Ptr { - encoder.Encode(unsafe.Pointer(&e.word), stream) - } else { - encoder.Encode(e.word, stream) - } -} - -func (encoder *arrayEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return false -} - -type arrayDecoder struct { - arrayType reflect.Type - elemType reflect.Type - elemDecoder ValDecoder -} - -func (decoder *arrayDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - decoder.doDecode(ptr, iter) - if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.arrayType, iter.Error.Error()) - } -} - -func (decoder *arrayDecoder) doDecode(ptr unsafe.Pointer, iter *Iterator) { - offset := uintptr(0) - iter.ReadArrayCB(func(iter *Iterator) bool { - if offset < decoder.arrayType.Size() { - decoder.elemDecoder.Decode(unsafe.Pointer(uintptr(ptr)+offset), iter) - offset += decoder.elemType.Size() - } else { - iter.Skip() - } - return true - }) -} diff --git a/vendor/github.com/json-iterator/go/feature_reflect_map.go b/vendor/github.com/json-iterator/go/feature_reflect_map.go deleted file mode 100644 index 005671e01..000000000 --- a/vendor/github.com/json-iterator/go/feature_reflect_map.go +++ /dev/null @@ -1,244 +0,0 @@ -package jsoniter - -import ( - "encoding" - "encoding/json" - "reflect" - "sort" - "strconv" - "unsafe" -) - -type mapDecoder struct { - mapType reflect.Type - keyType reflect.Type - elemType reflect.Type - elemDecoder ValDecoder - mapInterface emptyInterface -} - -func (decoder *mapDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - // dark magic to cast unsafe.Pointer back to interface{} using reflect.Type - mapInterface := decoder.mapInterface - mapInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&mapInterface)) - realVal := reflect.ValueOf(*realInterface).Elem() - if iter.ReadNil() { - realVal.Set(reflect.Zero(decoder.mapType)) - return - } - if realVal.IsNil() { - realVal.Set(reflect.MakeMap(realVal.Type())) - } - iter.ReadMapCB(func(iter *Iterator, keyStr string) bool { - elem := reflect.New(decoder.elemType) - decoder.elemDecoder.Decode(unsafe.Pointer(elem.Pointer()), iter) - // to put into map, we have to use reflection - keyType := decoder.keyType - // TODO: remove this from loop - switch { - case keyType.Kind() == reflect.String: - realVal.SetMapIndex(reflect.ValueOf(keyStr).Convert(keyType), elem.Elem()) - return true - case keyType.Implements(textUnmarshalerType): - textUnmarshaler := reflect.New(keyType.Elem()).Interface().(encoding.TextUnmarshaler) - err := textUnmarshaler.UnmarshalText([]byte(keyStr)) - if err != nil { - iter.ReportError("read map key as TextUnmarshaler", err.Error()) - return false - } - realVal.SetMapIndex(reflect.ValueOf(textUnmarshaler), elem.Elem()) - return true - case reflect.PtrTo(keyType).Implements(textUnmarshalerType): - textUnmarshaler := reflect.New(keyType).Interface().(encoding.TextUnmarshaler) - err := textUnmarshaler.UnmarshalText([]byte(keyStr)) - if err != nil { - iter.ReportError("read map key as TextUnmarshaler", err.Error()) - return false - } - realVal.SetMapIndex(reflect.ValueOf(textUnmarshaler).Elem(), elem.Elem()) - return true - default: - switch keyType.Kind() { - case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: - n, err := strconv.ParseInt(keyStr, 10, 64) - if err != nil || reflect.Zero(keyType).OverflowInt(n) { - iter.ReportError("read map key as int64", "read int64 failed") - return false - } - realVal.SetMapIndex(reflect.ValueOf(n).Convert(keyType), elem.Elem()) - return true - case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: - n, err := strconv.ParseUint(keyStr, 10, 64) - if err != nil || reflect.Zero(keyType).OverflowUint(n) { - iter.ReportError("read map key as uint64", "read uint64 failed") - return false - } - realVal.SetMapIndex(reflect.ValueOf(n).Convert(keyType), elem.Elem()) - return true - } - } - iter.ReportError("read map key", "unexpected map key type "+keyType.String()) - return true - }) -} - -type mapEncoder struct { - mapType reflect.Type - elemType reflect.Type - elemEncoder ValEncoder - mapInterface emptyInterface -} - -func (encoder *mapEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - mapInterface := encoder.mapInterface - mapInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&mapInterface)) - realVal := reflect.ValueOf(*realInterface) - stream.WriteObjectStart() - for i, key := range realVal.MapKeys() { - if i != 0 { - stream.WriteMore() - } - encodeMapKey(key, stream) - if stream.indention > 0 { - stream.writeTwoBytes(byte(':'), byte(' ')) - } else { - stream.writeByte(':') - } - val := realVal.MapIndex(key).Interface() - encoder.elemEncoder.EncodeInterface(val, stream) - } - stream.WriteObjectEnd() -} - -func encodeMapKey(key reflect.Value, stream *Stream) { - if key.Kind() == reflect.String { - stream.WriteString(key.String()) - return - } - if tm, ok := key.Interface().(encoding.TextMarshaler); ok { - buf, err := tm.MarshalText() - if err != nil { - stream.Error = err - return - } - stream.writeByte('"') - stream.Write(buf) - stream.writeByte('"') - return - } - switch key.Kind() { - case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: - stream.writeByte('"') - stream.WriteInt64(key.Int()) - stream.writeByte('"') - return - case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: - stream.writeByte('"') - stream.WriteUint64(key.Uint()) - stream.writeByte('"') - return - } - stream.Error = &json.UnsupportedTypeError{Type: key.Type()} -} - -func (encoder *mapEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *mapEncoder) IsEmpty(ptr unsafe.Pointer) bool { - mapInterface := encoder.mapInterface - mapInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&mapInterface)) - realVal := reflect.ValueOf(*realInterface) - return realVal.Len() == 0 -} - -type sortKeysMapEncoder struct { - mapType reflect.Type - elemType reflect.Type - elemEncoder ValEncoder - mapInterface emptyInterface -} - -func (encoder *sortKeysMapEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - mapInterface := encoder.mapInterface - mapInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&mapInterface)) - realVal := reflect.ValueOf(*realInterface) - - // Extract and sort the keys. - keys := realVal.MapKeys() - sv := stringValues(make([]reflectWithString, len(keys))) - for i, v := range keys { - sv[i].v = v - if err := sv[i].resolve(); err != nil { - stream.Error = err - return - } - } - sort.Sort(sv) - - stream.WriteObjectStart() - for i, key := range sv { - if i != 0 { - stream.WriteMore() - } - stream.WriteVal(key.s) // might need html escape, so can not WriteString directly - if stream.indention > 0 { - stream.writeTwoBytes(byte(':'), byte(' ')) - } else { - stream.writeByte(':') - } - val := realVal.MapIndex(key.v).Interface() - encoder.elemEncoder.EncodeInterface(val, stream) - } - stream.WriteObjectEnd() -} - -// stringValues is a slice of reflect.Value holding *reflect.StringValue. -// It implements the methods to sort by string. -type stringValues []reflectWithString - -type reflectWithString struct { - v reflect.Value - s string -} - -func (w *reflectWithString) resolve() error { - if w.v.Kind() == reflect.String { - w.s = w.v.String() - return nil - } - if tm, ok := w.v.Interface().(encoding.TextMarshaler); ok { - buf, err := tm.MarshalText() - w.s = string(buf) - return err - } - switch w.v.Kind() { - case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: - w.s = strconv.FormatInt(w.v.Int(), 10) - return nil - case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: - w.s = strconv.FormatUint(w.v.Uint(), 10) - return nil - } - return &json.UnsupportedTypeError{Type: w.v.Type()} -} - -func (sv stringValues) Len() int { return len(sv) } -func (sv stringValues) Swap(i, j int) { sv[i], sv[j] = sv[j], sv[i] } -func (sv stringValues) Less(i, j int) bool { return sv[i].s < sv[j].s } - -func (encoder *sortKeysMapEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *sortKeysMapEncoder) IsEmpty(ptr unsafe.Pointer) bool { - mapInterface := encoder.mapInterface - mapInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&mapInterface)) - realVal := reflect.ValueOf(*realInterface) - return realVal.Len() == 0 -} diff --git a/vendor/github.com/json-iterator/go/feature_reflect_native.go b/vendor/github.com/json-iterator/go/feature_reflect_native.go deleted file mode 100644 index b37dab3d8..000000000 --- a/vendor/github.com/json-iterator/go/feature_reflect_native.go +++ /dev/null @@ -1,672 +0,0 @@ -package jsoniter - -import ( - "encoding" - "encoding/base64" - "encoding/json" - "unsafe" -) - -type stringCodec struct { -} - -func (codec *stringCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*string)(ptr)) = iter.ReadString() -} - -func (codec *stringCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - str := *((*string)(ptr)) - stream.WriteString(str) -} - -func (codec *stringCodec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *stringCodec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*string)(ptr)) == "" -} - -type intCodec struct { -} - -func (codec *intCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*int)(ptr)) = iter.ReadInt() -} - -func (codec *intCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteInt(*((*int)(ptr))) -} - -func (codec *intCodec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *intCodec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*int)(ptr)) == 0 -} - -type uintptrCodec struct { -} - -func (codec *uintptrCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*uintptr)(ptr)) = uintptr(iter.ReadUint64()) -} - -func (codec *uintptrCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteUint64(uint64(*((*uintptr)(ptr)))) -} - -func (codec *uintptrCodec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *uintptrCodec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*uintptr)(ptr)) == 0 -} - -type int8Codec struct { -} - -func (codec *int8Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*int8)(ptr)) = iter.ReadInt8() -} - -func (codec *int8Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteInt8(*((*int8)(ptr))) -} - -func (codec *int8Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *int8Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*int8)(ptr)) == 0 -} - -type int16Codec struct { -} - -func (codec *int16Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*int16)(ptr)) = iter.ReadInt16() -} - -func (codec *int16Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteInt16(*((*int16)(ptr))) -} - -func (codec *int16Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *int16Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*int16)(ptr)) == 0 -} - -type int32Codec struct { -} - -func (codec *int32Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*int32)(ptr)) = iter.ReadInt32() -} - -func (codec *int32Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteInt32(*((*int32)(ptr))) -} - -func (codec *int32Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *int32Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*int32)(ptr)) == 0 -} - -type int64Codec struct { -} - -func (codec *int64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*int64)(ptr)) = iter.ReadInt64() -} - -func (codec *int64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteInt64(*((*int64)(ptr))) -} - -func (codec *int64Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *int64Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*int64)(ptr)) == 0 -} - -type uintCodec struct { -} - -func (codec *uintCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*uint)(ptr)) = iter.ReadUint() -} - -func (codec *uintCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteUint(*((*uint)(ptr))) -} - -func (codec *uintCodec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *uintCodec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*uint)(ptr)) == 0 -} - -type uint8Codec struct { -} - -func (codec *uint8Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*uint8)(ptr)) = iter.ReadUint8() -} - -func (codec *uint8Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteUint8(*((*uint8)(ptr))) -} - -func (codec *uint8Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *uint8Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*uint8)(ptr)) == 0 -} - -type uint16Codec struct { -} - -func (codec *uint16Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*uint16)(ptr)) = iter.ReadUint16() -} - -func (codec *uint16Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteUint16(*((*uint16)(ptr))) -} - -func (codec *uint16Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *uint16Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*uint16)(ptr)) == 0 -} - -type uint32Codec struct { -} - -func (codec *uint32Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*uint32)(ptr)) = iter.ReadUint32() -} - -func (codec *uint32Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteUint32(*((*uint32)(ptr))) -} - -func (codec *uint32Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *uint32Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*uint32)(ptr)) == 0 -} - -type uint64Codec struct { -} - -func (codec *uint64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*uint64)(ptr)) = iter.ReadUint64() -} - -func (codec *uint64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteUint64(*((*uint64)(ptr))) -} - -func (codec *uint64Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *uint64Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*uint64)(ptr)) == 0 -} - -type float32Codec struct { -} - -func (codec *float32Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*float32)(ptr)) = iter.ReadFloat32() -} - -func (codec *float32Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteFloat32(*((*float32)(ptr))) -} - -func (codec *float32Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *float32Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*float32)(ptr)) == 0 -} - -type float64Codec struct { -} - -func (codec *float64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*float64)(ptr)) = iter.ReadFloat64() -} - -func (codec *float64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteFloat64(*((*float64)(ptr))) -} - -func (codec *float64Codec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *float64Codec) IsEmpty(ptr unsafe.Pointer) bool { - return *((*float64)(ptr)) == 0 -} - -type boolCodec struct { -} - -func (codec *boolCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*bool)(ptr)) = iter.ReadBool() -} - -func (codec *boolCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteBool(*((*bool)(ptr))) -} - -func (codec *boolCodec) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, codec) -} - -func (codec *boolCodec) IsEmpty(ptr unsafe.Pointer) bool { - return !(*((*bool)(ptr))) -} - -type emptyInterfaceCodec struct { -} - -func (codec *emptyInterfaceCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*interface{})(ptr)) = iter.Read() -} - -func (codec *emptyInterfaceCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteVal(*((*interface{})(ptr))) -} - -func (codec *emptyInterfaceCodec) EncodeInterface(val interface{}, stream *Stream) { - stream.WriteVal(val) -} - -func (codec *emptyInterfaceCodec) IsEmpty(ptr unsafe.Pointer) bool { - return ptr == nil -} - -type nonEmptyInterfaceCodec struct { -} - -func (codec *nonEmptyInterfaceCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - nonEmptyInterface := (*nonEmptyInterface)(ptr) - if nonEmptyInterface.itab == nil { - iter.ReportError("read non-empty interface", "do not know which concrete type to decode to") - return - } - var i interface{} - e := (*emptyInterface)(unsafe.Pointer(&i)) - e.typ = nonEmptyInterface.itab.typ - e.word = nonEmptyInterface.word - iter.ReadVal(&i) - nonEmptyInterface.word = e.word -} - -func (codec *nonEmptyInterfaceCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - nonEmptyInterface := (*nonEmptyInterface)(ptr) - var i interface{} - e := (*emptyInterface)(unsafe.Pointer(&i)) - e.typ = nonEmptyInterface.itab.typ - e.word = nonEmptyInterface.word - stream.WriteVal(i) -} - -func (codec *nonEmptyInterfaceCodec) EncodeInterface(val interface{}, stream *Stream) { - stream.WriteVal(val) -} - -func (codec *nonEmptyInterfaceCodec) IsEmpty(ptr unsafe.Pointer) bool { - nonEmptyInterface := (*nonEmptyInterface)(ptr) - return nonEmptyInterface.word == nil -} - -type anyCodec struct { -} - -func (codec *anyCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*Any)(ptr)) = iter.ReadAny() -} - -func (codec *anyCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - (*((*Any)(ptr))).WriteTo(stream) -} - -func (codec *anyCodec) EncodeInterface(val interface{}, stream *Stream) { - (val.(Any)).WriteTo(stream) -} - -func (codec *anyCodec) IsEmpty(ptr unsafe.Pointer) bool { - return (*((*Any)(ptr))).Size() == 0 -} - -type jsonNumberCodec struct { -} - -func (codec *jsonNumberCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*json.Number)(ptr)) = json.Number([]byte(iter.readNumberAsString())) -} - -func (codec *jsonNumberCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteRaw(string(*((*json.Number)(ptr)))) -} - -func (codec *jsonNumberCodec) EncodeInterface(val interface{}, stream *Stream) { - stream.WriteRaw(string(val.(json.Number))) -} - -func (codec *jsonNumberCodec) IsEmpty(ptr unsafe.Pointer) bool { - return len(*((*json.Number)(ptr))) == 0 -} - -type jsoniterNumberCodec struct { -} - -func (codec *jsoniterNumberCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*Number)(ptr)) = Number([]byte(iter.readNumberAsString())) -} - -func (codec *jsoniterNumberCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteRaw(string(*((*Number)(ptr)))) -} - -func (codec *jsoniterNumberCodec) EncodeInterface(val interface{}, stream *Stream) { - stream.WriteRaw(string(val.(Number))) -} - -func (codec *jsoniterNumberCodec) IsEmpty(ptr unsafe.Pointer) bool { - return len(*((*Number)(ptr))) == 0 -} - -type jsonRawMessageCodec struct { -} - -func (codec *jsonRawMessageCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*json.RawMessage)(ptr)) = json.RawMessage(iter.SkipAndReturnBytes()) -} - -func (codec *jsonRawMessageCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteRaw(string(*((*json.RawMessage)(ptr)))) -} - -func (codec *jsonRawMessageCodec) EncodeInterface(val interface{}, stream *Stream) { - stream.WriteRaw(string(val.(json.RawMessage))) -} - -func (codec *jsonRawMessageCodec) IsEmpty(ptr unsafe.Pointer) bool { - return len(*((*json.RawMessage)(ptr))) == 0 -} - -type jsoniterRawMessageCodec struct { -} - -func (codec *jsoniterRawMessageCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { - *((*RawMessage)(ptr)) = RawMessage(iter.SkipAndReturnBytes()) -} - -func (codec *jsoniterRawMessageCodec) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.WriteRaw(string(*((*RawMessage)(ptr)))) -} - -func (codec *jsoniterRawMessageCodec) EncodeInterface(val interface{}, stream *Stream) { - stream.WriteRaw(string(val.(RawMessage))) -} - -func (codec *jsoniterRawMessageCodec) IsEmpty(ptr unsafe.Pointer) bool { - return len(*((*RawMessage)(ptr))) == 0 -} - -type base64Codec struct { - sliceDecoder ValDecoder -} - -func (codec *base64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { - if iter.ReadNil() { - ptrSlice := (*sliceHeader)(ptr) - ptrSlice.Len = 0 - ptrSlice.Cap = 0 - ptrSlice.Data = nil - return - } - switch iter.WhatIsNext() { - case StringValue: - encoding := base64.StdEncoding - src := iter.SkipAndReturnBytes() - src = src[1 : len(src)-1] - decodedLen := encoding.DecodedLen(len(src)) - dst := make([]byte, decodedLen) - len, err := encoding.Decode(dst, src) - if err != nil { - iter.ReportError("decode base64", err.Error()) - } else { - dst = dst[:len] - dstSlice := (*sliceHeader)(unsafe.Pointer(&dst)) - ptrSlice := (*sliceHeader)(ptr) - ptrSlice.Data = dstSlice.Data - ptrSlice.Cap = dstSlice.Cap - ptrSlice.Len = dstSlice.Len - } - case ArrayValue: - codec.sliceDecoder.Decode(ptr, iter) - default: - iter.ReportError("base64Codec", "invalid input") - } -} - -func (codec *base64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { - src := *((*[]byte)(ptr)) - if len(src) == 0 { - stream.WriteNil() - return - } - encoding := base64.StdEncoding - stream.writeByte('"') - toGrow := encoding.EncodedLen(len(src)) - stream.ensure(toGrow) - encoding.Encode(stream.buf[stream.n:], src) - stream.n += toGrow - stream.writeByte('"') -} - -func (codec *base64Codec) EncodeInterface(val interface{}, stream *Stream) { - ptr := extractInterface(val).word - src := *((*[]byte)(ptr)) - if len(src) == 0 { - stream.WriteNil() - return - } - encoding := base64.StdEncoding - stream.writeByte('"') - toGrow := encoding.EncodedLen(len(src)) - stream.ensure(toGrow) - encoding.Encode(stream.buf[stream.n:], src) - stream.n += toGrow - stream.writeByte('"') -} - -func (codec *base64Codec) IsEmpty(ptr unsafe.Pointer) bool { - return len(*((*[]byte)(ptr))) == 0 -} - -type stringModeNumberDecoder struct { - elemDecoder ValDecoder -} - -func (decoder *stringModeNumberDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - c := iter.nextToken() - if c != '"' { - iter.ReportError("stringModeNumberDecoder", `expect "`) - return - } - decoder.elemDecoder.Decode(ptr, iter) - if iter.Error != nil { - return - } - c = iter.readByte() - if c != '"' { - iter.ReportError("stringModeNumberDecoder", `expect "`) - return - } -} - -type stringModeStringDecoder struct { - elemDecoder ValDecoder - cfg *frozenConfig -} - -func (decoder *stringModeStringDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - decoder.elemDecoder.Decode(ptr, iter) - str := *((*string)(ptr)) - tempIter := decoder.cfg.BorrowIterator([]byte(str)) - defer decoder.cfg.ReturnIterator(tempIter) - *((*string)(ptr)) = tempIter.ReadString() -} - -type stringModeNumberEncoder struct { - elemEncoder ValEncoder -} - -func (encoder *stringModeNumberEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - stream.writeByte('"') - encoder.elemEncoder.Encode(ptr, stream) - stream.writeByte('"') -} - -func (encoder *stringModeNumberEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *stringModeNumberEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return encoder.elemEncoder.IsEmpty(ptr) -} - -type stringModeStringEncoder struct { - elemEncoder ValEncoder - cfg *frozenConfig -} - -func (encoder *stringModeStringEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - tempStream := encoder.cfg.BorrowStream(nil) - defer encoder.cfg.ReturnStream(tempStream) - encoder.elemEncoder.Encode(ptr, tempStream) - stream.WriteString(string(tempStream.Buffer())) -} - -func (encoder *stringModeStringEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *stringModeStringEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return encoder.elemEncoder.IsEmpty(ptr) -} - -type marshalerEncoder struct { - templateInterface emptyInterface - checkIsEmpty checkIsEmpty -} - -func (encoder *marshalerEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - templateInterface := encoder.templateInterface - templateInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&templateInterface)) - marshaler := (*realInterface).(json.Marshaler) - bytes, err := marshaler.MarshalJSON() - if err != nil { - stream.Error = err - } else { - stream.Write(bytes) - } -} -func (encoder *marshalerEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *marshalerEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return encoder.checkIsEmpty.IsEmpty(ptr) -} - -type textMarshalerEncoder struct { - templateInterface emptyInterface - checkIsEmpty checkIsEmpty -} - -func (encoder *textMarshalerEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - templateInterface := encoder.templateInterface - templateInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&templateInterface)) - marshaler := (*realInterface).(encoding.TextMarshaler) - bytes, err := marshaler.MarshalText() - if err != nil { - stream.Error = err - } else { - stream.WriteString(string(bytes)) - } -} - -func (encoder *textMarshalerEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *textMarshalerEncoder) IsEmpty(ptr unsafe.Pointer) bool { - return encoder.checkIsEmpty.IsEmpty(ptr) -} - -type unmarshalerDecoder struct { - templateInterface emptyInterface -} - -func (decoder *unmarshalerDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - templateInterface := decoder.templateInterface - templateInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&templateInterface)) - unmarshaler := (*realInterface).(json.Unmarshaler) - iter.nextToken() - iter.unreadByte() // skip spaces - bytes := iter.SkipAndReturnBytes() - err := unmarshaler.UnmarshalJSON(bytes) - if err != nil { - iter.ReportError("unmarshalerDecoder", err.Error()) - } -} - -type textUnmarshalerDecoder struct { - templateInterface emptyInterface -} - -func (decoder *textUnmarshalerDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - templateInterface := decoder.templateInterface - templateInterface.word = ptr - realInterface := (*interface{})(unsafe.Pointer(&templateInterface)) - unmarshaler := (*realInterface).(encoding.TextUnmarshaler) - str := iter.ReadString() - err := unmarshaler.UnmarshalText([]byte(str)) - if err != nil { - iter.ReportError("textUnmarshalerDecoder", err.Error()) - } -} diff --git a/vendor/github.com/json-iterator/go/feature_reflect_slice.go b/vendor/github.com/json-iterator/go/feature_reflect_slice.go deleted file mode 100644 index 7377eec7b..000000000 --- a/vendor/github.com/json-iterator/go/feature_reflect_slice.go +++ /dev/null @@ -1,149 +0,0 @@ -package jsoniter - -import ( - "fmt" - "io" - "reflect" - "unsafe" -) - -func decoderOfSlice(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - decoder, err := decoderOfType(cfg, typ.Elem()) - if err != nil { - return nil, err - } - return &sliceDecoder{typ, typ.Elem(), decoder}, nil -} - -func encoderOfSlice(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { - encoder, err := encoderOfType(cfg, typ.Elem()) - if err != nil { - return nil, err - } - if typ.Elem().Kind() == reflect.Map { - encoder = &optionalEncoder{encoder} - } - return &sliceEncoder{typ, typ.Elem(), encoder}, nil -} - -type sliceEncoder struct { - sliceType reflect.Type - elemType reflect.Type - elemEncoder ValEncoder -} - -func (encoder *sliceEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - slice := (*sliceHeader)(ptr) - if slice.Data == nil { - stream.WriteNil() - return - } - if slice.Len == 0 { - stream.WriteEmptyArray() - return - } - stream.WriteArrayStart() - elemPtr := unsafe.Pointer(slice.Data) - encoder.elemEncoder.Encode(unsafe.Pointer(elemPtr), stream) - for i := 1; i < slice.Len; i++ { - stream.WriteMore() - elemPtr = unsafe.Pointer(uintptr(elemPtr) + encoder.elemType.Size()) - encoder.elemEncoder.Encode(unsafe.Pointer(elemPtr), stream) - } - stream.WriteArrayEnd() - if stream.Error != nil && stream.Error != io.EOF { - stream.Error = fmt.Errorf("%v: %s", encoder.sliceType, stream.Error.Error()) - } -} - -func (encoder *sliceEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - -func (encoder *sliceEncoder) IsEmpty(ptr unsafe.Pointer) bool { - slice := (*sliceHeader)(ptr) - return slice.Len == 0 -} - -type sliceDecoder struct { - sliceType reflect.Type - elemType reflect.Type - elemDecoder ValDecoder -} - -// sliceHeader is a safe version of SliceHeader used within this package. -type sliceHeader struct { - Data unsafe.Pointer - Len int - Cap int -} - -func (decoder *sliceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - decoder.doDecode(ptr, iter) - if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.sliceType, iter.Error.Error()) - } -} - -func (decoder *sliceDecoder) doDecode(ptr unsafe.Pointer, iter *Iterator) { - slice := (*sliceHeader)(ptr) - if iter.ReadNil() { - slice.Len = 0 - slice.Cap = 0 - slice.Data = nil - return - } - reuseSlice(slice, decoder.sliceType, 4) - slice.Len = 0 - offset := uintptr(0) - iter.ReadArrayCB(func(iter *Iterator) bool { - growOne(slice, decoder.sliceType, decoder.elemType) - decoder.elemDecoder.Decode(unsafe.Pointer(uintptr(slice.Data)+offset), iter) - offset += decoder.elemType.Size() - return true - }) -} - -// grow grows the slice s so that it can hold extra more values, allocating -// more capacity if needed. It also returns the old and new slice lengths. -func growOne(slice *sliceHeader, sliceType reflect.Type, elementType reflect.Type) { - newLen := slice.Len + 1 - if newLen <= slice.Cap { - slice.Len = newLen - return - } - newCap := slice.Cap - if newCap == 0 { - newCap = 1 - } else { - for newCap < newLen { - if slice.Len < 1024 { - newCap += newCap - } else { - newCap += newCap / 4 - } - } - } - newVal := reflect.MakeSlice(sliceType, newLen, newCap) - dst := unsafe.Pointer(newVal.Pointer()) - // copy old array into new array - originalBytesCount := uintptr(slice.Len) * elementType.Size() - srcPtr := (*[1 << 30]byte)(slice.Data) - dstPtr := (*[1 << 30]byte)(dst) - for i := uintptr(0); i < originalBytesCount; i++ { - dstPtr[i] = srcPtr[i] - } - slice.Data = dst - slice.Len = newLen - slice.Cap = newCap -} - -func reuseSlice(slice *sliceHeader, sliceType reflect.Type, expectedCap int) { - if expectedCap <= slice.Cap { - return - } - newVal := reflect.MakeSlice(sliceType, 0, expectedCap) - dst := unsafe.Pointer(newVal.Pointer()) - slice.Data = dst - slice.Cap = expectedCap -} diff --git a/vendor/github.com/json-iterator/go/feature_stream_int.go b/vendor/github.com/json-iterator/go/feature_stream_int.go deleted file mode 100644 index 7cfd522c1..000000000 --- a/vendor/github.com/json-iterator/go/feature_stream_int.go +++ /dev/null @@ -1,320 +0,0 @@ -package jsoniter - -var digits []uint32 - -func init() { - digits = make([]uint32, 1000) - for i := uint32(0); i < 1000; i++ { - digits[i] = (((i / 100) + '0') << 16) + ((((i / 10) % 10) + '0') << 8) + i%10 + '0' - if i < 10 { - digits[i] += 2 << 24 - } else if i < 100 { - digits[i] += 1 << 24 - } - } -} - -func writeFirstBuf(buf []byte, v uint32, n int) int { - start := v >> 24 - if start == 0 { - buf[n] = byte(v >> 16) - n++ - buf[n] = byte(v >> 8) - n++ - } else if start == 1 { - buf[n] = byte(v >> 8) - n++ - } - buf[n] = byte(v) - n++ - return n -} - -func writeBuf(buf []byte, v uint32, n int) { - buf[n] = byte(v >> 16) - buf[n+1] = byte(v >> 8) - buf[n+2] = byte(v) -} - -// WriteUint8 write uint8 to stream -func (stream *Stream) WriteUint8(val uint8) { - stream.ensure(3) - stream.n = writeFirstBuf(stream.buf, digits[val], stream.n) -} - -// WriteInt8 write int8 to stream -func (stream *Stream) WriteInt8(nval int8) { - stream.ensure(4) - n := stream.n - var val uint8 - if nval < 0 { - val = uint8(-nval) - stream.buf[n] = '-' - n++ - } else { - val = uint8(nval) - } - stream.n = writeFirstBuf(stream.buf, digits[val], n) -} - -// WriteUint16 write uint16 to stream -func (stream *Stream) WriteUint16(val uint16) { - stream.ensure(5) - q1 := val / 1000 - if q1 == 0 { - stream.n = writeFirstBuf(stream.buf, digits[val], stream.n) - return - } - r1 := val - q1*1000 - n := writeFirstBuf(stream.buf, digits[q1], stream.n) - writeBuf(stream.buf, digits[r1], n) - stream.n = n + 3 - return -} - -// WriteInt16 write int16 to stream -func (stream *Stream) WriteInt16(nval int16) { - stream.ensure(6) - n := stream.n - var val uint16 - if nval < 0 { - val = uint16(-nval) - stream.buf[n] = '-' - n++ - } else { - val = uint16(nval) - } - q1 := val / 1000 - if q1 == 0 { - stream.n = writeFirstBuf(stream.buf, digits[val], n) - return - } - r1 := val - q1*1000 - n = writeFirstBuf(stream.buf, digits[q1], n) - writeBuf(stream.buf, digits[r1], n) - stream.n = n + 3 - return -} - -// WriteUint32 write uint32 to stream -func (stream *Stream) WriteUint32(val uint32) { - stream.ensure(10) - n := stream.n - q1 := val / 1000 - if q1 == 0 { - stream.n = writeFirstBuf(stream.buf, digits[val], n) - return - } - r1 := val - q1*1000 - q2 := q1 / 1000 - if q2 == 0 { - n := writeFirstBuf(stream.buf, digits[q1], n) - writeBuf(stream.buf, digits[r1], n) - stream.n = n + 3 - return - } - r2 := q1 - q2*1000 - q3 := q2 / 1000 - if q3 == 0 { - n = writeFirstBuf(stream.buf, digits[q2], n) - } else { - r3 := q2 - q3*1000 - stream.buf[n] = byte(q3 + '0') - n++ - writeBuf(stream.buf, digits[r3], n) - n += 3 - } - writeBuf(stream.buf, digits[r2], n) - writeBuf(stream.buf, digits[r1], n+3) - stream.n = n + 6 -} - -// WriteInt32 write int32 to stream -func (stream *Stream) WriteInt32(nval int32) { - stream.ensure(11) - n := stream.n - var val uint32 - if nval < 0 { - val = uint32(-nval) - stream.buf[n] = '-' - n++ - } else { - val = uint32(nval) - } - q1 := val / 1000 - if q1 == 0 { - stream.n = writeFirstBuf(stream.buf, digits[val], n) - return - } - r1 := val - q1*1000 - q2 := q1 / 1000 - if q2 == 0 { - n := writeFirstBuf(stream.buf, digits[q1], n) - writeBuf(stream.buf, digits[r1], n) - stream.n = n + 3 - return - } - r2 := q1 - q2*1000 - q3 := q2 / 1000 - if q3 == 0 { - n = writeFirstBuf(stream.buf, digits[q2], n) - } else { - r3 := q2 - q3*1000 - stream.buf[n] = byte(q3 + '0') - n++ - writeBuf(stream.buf, digits[r3], n) - n += 3 - } - writeBuf(stream.buf, digits[r2], n) - writeBuf(stream.buf, digits[r1], n+3) - stream.n = n + 6 -} - -// WriteUint64 write uint64 to stream -func (stream *Stream) WriteUint64(val uint64) { - stream.ensure(20) - n := stream.n - q1 := val / 1000 - if q1 == 0 { - stream.n = writeFirstBuf(stream.buf, digits[val], n) - return - } - r1 := val - q1*1000 - q2 := q1 / 1000 - if q2 == 0 { - n := writeFirstBuf(stream.buf, digits[q1], n) - writeBuf(stream.buf, digits[r1], n) - stream.n = n + 3 - return - } - r2 := q1 - q2*1000 - q3 := q2 / 1000 - if q3 == 0 { - n = writeFirstBuf(stream.buf, digits[q2], n) - writeBuf(stream.buf, digits[r2], n) - writeBuf(stream.buf, digits[r1], n+3) - stream.n = n + 6 - return - } - r3 := q2 - q3*1000 - q4 := q3 / 1000 - if q4 == 0 { - n = writeFirstBuf(stream.buf, digits[q3], n) - writeBuf(stream.buf, digits[r3], n) - writeBuf(stream.buf, digits[r2], n+3) - writeBuf(stream.buf, digits[r1], n+6) - stream.n = n + 9 - return - } - r4 := q3 - q4*1000 - q5 := q4 / 1000 - if q5 == 0 { - n = writeFirstBuf(stream.buf, digits[q4], n) - writeBuf(stream.buf, digits[r4], n) - writeBuf(stream.buf, digits[r3], n+3) - writeBuf(stream.buf, digits[r2], n+6) - writeBuf(stream.buf, digits[r1], n+9) - stream.n = n + 12 - return - } - r5 := q4 - q5*1000 - q6 := q5 / 1000 - if q6 == 0 { - n = writeFirstBuf(stream.buf, digits[q5], n) - } else { - n = writeFirstBuf(stream.buf, digits[q6], n) - r6 := q5 - q6*1000 - writeBuf(stream.buf, digits[r6], n) - n += 3 - } - writeBuf(stream.buf, digits[r5], n) - writeBuf(stream.buf, digits[r4], n+3) - writeBuf(stream.buf, digits[r3], n+6) - writeBuf(stream.buf, digits[r2], n+9) - writeBuf(stream.buf, digits[r1], n+12) - stream.n = n + 15 -} - -// WriteInt64 write int64 to stream -func (stream *Stream) WriteInt64(nval int64) { - stream.ensure(20) - n := stream.n - var val uint64 - if nval < 0 { - val = uint64(-nval) - stream.buf[n] = '-' - n++ - } else { - val = uint64(nval) - } - q1 := val / 1000 - if q1 == 0 { - stream.n = writeFirstBuf(stream.buf, digits[val], n) - return - } - r1 := val - q1*1000 - q2 := q1 / 1000 - if q2 == 0 { - n := writeFirstBuf(stream.buf, digits[q1], n) - writeBuf(stream.buf, digits[r1], n) - stream.n = n + 3 - return - } - r2 := q1 - q2*1000 - q3 := q2 / 1000 - if q3 == 0 { - n = writeFirstBuf(stream.buf, digits[q2], n) - writeBuf(stream.buf, digits[r2], n) - writeBuf(stream.buf, digits[r1], n+3) - stream.n = n + 6 - return - } - r3 := q2 - q3*1000 - q4 := q3 / 1000 - if q4 == 0 { - n = writeFirstBuf(stream.buf, digits[q3], n) - writeBuf(stream.buf, digits[r3], n) - writeBuf(stream.buf, digits[r2], n+3) - writeBuf(stream.buf, digits[r1], n+6) - stream.n = n + 9 - return - } - r4 := q3 - q4*1000 - q5 := q4 / 1000 - if q5 == 0 { - n = writeFirstBuf(stream.buf, digits[q4], n) - writeBuf(stream.buf, digits[r4], n) - writeBuf(stream.buf, digits[r3], n+3) - writeBuf(stream.buf, digits[r2], n+6) - writeBuf(stream.buf, digits[r1], n+9) - stream.n = n + 12 - return - } - r5 := q4 - q5*1000 - q6 := q5 / 1000 - if q6 == 0 { - n = writeFirstBuf(stream.buf, digits[q5], n) - } else { - stream.buf[n] = byte(q6 + '0') - n++ - r6 := q5 - q6*1000 - writeBuf(stream.buf, digits[r6], n) - n += 3 - } - writeBuf(stream.buf, digits[r5], n) - writeBuf(stream.buf, digits[r4], n+3) - writeBuf(stream.buf, digits[r3], n+6) - writeBuf(stream.buf, digits[r2], n+9) - writeBuf(stream.buf, digits[r1], n+12) - stream.n = n + 15 -} - -// WriteInt write int to stream -func (stream *Stream) WriteInt(val int) { - stream.WriteInt64(int64(val)) -} - -// WriteUint write uint to stream -func (stream *Stream) WriteUint(val uint) { - stream.WriteUint64(uint64(val)) -} diff --git a/vendor/github.com/json-iterator/go/feature_iter.go b/vendor/github.com/json-iterator/go/iter.go index 4357d69ba..95ae54fbf 100644 --- a/vendor/github.com/json-iterator/go/feature_iter.go +++ b/vendor/github.com/json-iterator/go/iter.go @@ -77,6 +77,7 @@ type Iterator struct { captureStartedAt int captured []byte Error error + Attachment interface{} // open for customized decoder } // NewIterator creates an empty Iterator instance @@ -167,7 +168,7 @@ func (iter *Iterator) isObjectEnd() bool { if c == '}' { return true } - iter.ReportError("isObjectEnd", "object ended prematurely") + iter.ReportError("isObjectEnd", "object ended prematurely, unexpected char "+string([]byte{c})) return true } @@ -200,8 +201,22 @@ func (iter *Iterator) ReportError(operation string, msg string) { if peekStart < 0 { peekStart = 0 } - iter.Error = fmt.Errorf("%s: %s, parsing %v ...%s... at %s", operation, msg, iter.head, - string(iter.buf[peekStart:iter.head]), string(iter.buf[0:iter.tail])) + peekEnd := iter.head + 10 + if peekEnd > iter.tail { + peekEnd = iter.tail + } + parsing := string(iter.buf[peekStart:peekEnd]) + contextStart := iter.head - 50 + if contextStart < 0 { + contextStart = 0 + } + contextEnd := iter.head + 50 + if contextEnd > iter.tail { + contextEnd = iter.tail + } + context := string(iter.buf[contextStart:contextEnd]) + iter.Error = fmt.Errorf("%s: %s, error found in #%v byte of ...|%s|..., bigger context ...|%s|...", + operation, msg, iter.head-peekStart, parsing, context) } // CurrentBuffer gets current buffer as string for debugging purpose @@ -210,7 +225,7 @@ func (iter *Iterator) CurrentBuffer() string { if peekStart < 0 { peekStart = 0 } - return fmt.Sprintf("parsing %v ...|%s|... at %s", iter.head, + return fmt.Sprintf("parsing #%v byte, around ...|%s|..., whole buffer ...|%s|...", iter.head, string(iter.buf[peekStart:iter.head]), string(iter.buf[0:iter.tail])) } diff --git a/vendor/github.com/json-iterator/go/feature_iter_array.go b/vendor/github.com/json-iterator/go/iter_array.go index cbc3ec8d1..6188cb457 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_array.go +++ b/vendor/github.com/json-iterator/go/iter_array.go @@ -19,7 +19,7 @@ func (iter *Iterator) ReadArray() (ret bool) { case ',': return true default: - iter.ReportError("ReadArray", "expect [ or , or ] or n, but found: "+string([]byte{c})) + iter.ReportError("ReadArray", "expect [ or , or ] or n, but found "+string([]byte{c})) return } } @@ -42,7 +42,7 @@ func (iter *Iterator) ReadArrayCB(callback func(*Iterator) bool) (ret bool) { c = iter.nextToken() } if c != ']' { - iter.ReportError("ReadArrayCB", "expect ] in the end") + iter.ReportError("ReadArrayCB", "expect ] in the end, but found "+string([]byte{c})) return false } return true @@ -53,6 +53,6 @@ func (iter *Iterator) ReadArrayCB(callback func(*Iterator) bool) (ret bool) { iter.skipThreeBytes('u', 'l', 'l') return true // null } - iter.ReportError("ReadArrayCB", "expect [ or n, but found: "+string([]byte{c})) + iter.ReportError("ReadArrayCB", "expect [ or n, but found "+string([]byte{c})) return false } diff --git a/vendor/github.com/json-iterator/go/feature_iter_float.go b/vendor/github.com/json-iterator/go/iter_float.go index 86f459912..4f883c095 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_float.go +++ b/vendor/github.com/json-iterator/go/iter_float.go @@ -1,6 +1,7 @@ package jsoniter import ( + "encoding/json" "io" "math/big" "strconv" @@ -339,3 +340,8 @@ func validateFloat(str string) string { } return "" } + +// ReadNumber read json.Number +func (iter *Iterator) ReadNumber() (ret json.Number) { + return json.Number(iter.readNumberAsString()) +} diff --git a/vendor/github.com/json-iterator/go/feature_iter_int.go b/vendor/github.com/json-iterator/go/iter_int.go index 886879efd..214232035 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_int.go +++ b/vendor/github.com/json-iterator/go/iter_int.go @@ -22,11 +22,17 @@ func init() { // ReadUint read uint func (iter *Iterator) ReadUint() uint { + if strconv.IntSize == 32 { + return uint(iter.ReadUint32()) + } return uint(iter.ReadUint64()) } // ReadInt read int func (iter *Iterator) ReadInt() int { + if strconv.IntSize == 32 { + return int(iter.ReadInt32()) + } return int(iter.ReadInt64()) } @@ -115,6 +121,7 @@ func (iter *Iterator) ReadUint32() (ret uint32) { func (iter *Iterator) readUint32(c byte) (ret uint32) { ind := intDigits[c] if ind == 0 { + iter.assertInteger() return 0 // single zero } if ind == invalidCharForNumber { @@ -127,12 +134,14 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { ind2 := intDigits[iter.buf[i]] if ind2 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value } i++ ind3 := intDigits[iter.buf[i]] if ind3 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value*10 + uint32(ind2) } //iter.head = i + 1 @@ -141,30 +150,35 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { ind4 := intDigits[iter.buf[i]] if ind4 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value*100 + uint32(ind2)*10 + uint32(ind3) } i++ ind5 := intDigits[iter.buf[i]] if ind5 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value*1000 + uint32(ind2)*100 + uint32(ind3)*10 + uint32(ind4) } i++ ind6 := intDigits[iter.buf[i]] if ind6 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value*10000 + uint32(ind2)*1000 + uint32(ind3)*100 + uint32(ind4)*10 + uint32(ind5) } i++ ind7 := intDigits[iter.buf[i]] if ind7 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value*100000 + uint32(ind2)*10000 + uint32(ind3)*1000 + uint32(ind4)*100 + uint32(ind5)*10 + uint32(ind6) } i++ ind8 := intDigits[iter.buf[i]] if ind8 == invalidCharForNumber { iter.head = i + iter.assertInteger() return value*1000000 + uint32(ind2)*100000 + uint32(ind3)*10000 + uint32(ind4)*1000 + uint32(ind5)*100 + uint32(ind6)*10 + uint32(ind7) } i++ @@ -172,6 +186,7 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { value = value*10000000 + uint32(ind2)*1000000 + uint32(ind3)*100000 + uint32(ind4)*10000 + uint32(ind5)*1000 + uint32(ind6)*100 + uint32(ind7)*10 + uint32(ind8) iter.head = i if ind9 == invalidCharForNumber { + iter.assertInteger() return value } } @@ -180,6 +195,7 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { ind = intDigits[iter.buf[i]] if ind == invalidCharForNumber { iter.head = i + iter.assertInteger() return value } if value > uint32SafeToMultiply10 { @@ -194,6 +210,7 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { value = (value << 3) + (value << 1) + uint32(ind) } if !iter.loadMore() { + iter.assertInteger() return value } } @@ -226,6 +243,7 @@ func (iter *Iterator) ReadUint64() uint64 { func (iter *Iterator) readUint64(c byte) (ret uint64) { ind := intDigits[c] if ind == 0 { + iter.assertInteger() return 0 // single zero } if ind == invalidCharForNumber { @@ -233,11 +251,73 @@ func (iter *Iterator) readUint64(c byte) (ret uint64) { return } value := uint64(ind) + if iter.tail-iter.head > 10 { + i := iter.head + ind2 := intDigits[iter.buf[i]] + if ind2 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value + } + i++ + ind3 := intDigits[iter.buf[i]] + if ind3 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value*10 + uint64(ind2) + } + //iter.head = i + 1 + //value = value * 100 + uint32(ind2) * 10 + uint32(ind3) + i++ + ind4 := intDigits[iter.buf[i]] + if ind4 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value*100 + uint64(ind2)*10 + uint64(ind3) + } + i++ + ind5 := intDigits[iter.buf[i]] + if ind5 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value*1000 + uint64(ind2)*100 + uint64(ind3)*10 + uint64(ind4) + } + i++ + ind6 := intDigits[iter.buf[i]] + if ind6 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value*10000 + uint64(ind2)*1000 + uint64(ind3)*100 + uint64(ind4)*10 + uint64(ind5) + } + i++ + ind7 := intDigits[iter.buf[i]] + if ind7 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value*100000 + uint64(ind2)*10000 + uint64(ind3)*1000 + uint64(ind4)*100 + uint64(ind5)*10 + uint64(ind6) + } + i++ + ind8 := intDigits[iter.buf[i]] + if ind8 == invalidCharForNumber { + iter.head = i + iter.assertInteger() + return value*1000000 + uint64(ind2)*100000 + uint64(ind3)*10000 + uint64(ind4)*1000 + uint64(ind5)*100 + uint64(ind6)*10 + uint64(ind7) + } + i++ + ind9 := intDigits[iter.buf[i]] + value = value*10000000 + uint64(ind2)*1000000 + uint64(ind3)*100000 + uint64(ind4)*10000 + uint64(ind5)*1000 + uint64(ind6)*100 + uint64(ind7)*10 + uint64(ind8) + iter.head = i + if ind9 == invalidCharForNumber { + iter.assertInteger() + return value + } + } for { for i := iter.head; i < iter.tail; i++ { ind = intDigits[iter.buf[i]] if ind == invalidCharForNumber { iter.head = i + iter.assertInteger() return value } if value > uint64SafeToMultiple10 { @@ -252,7 +332,14 @@ func (iter *Iterator) readUint64(c byte) (ret uint64) { value = (value << 3) + (value << 1) + uint64(ind) } if !iter.loadMore() { + iter.assertInteger() return value } } } + +func (iter *Iterator) assertInteger() { + if iter.head < len(iter.buf) && iter.buf[iter.head] == '.' { + iter.ReportError("assertInteger", "can not decode float as int") + } +} diff --git a/vendor/github.com/json-iterator/go/feature_iter_object.go b/vendor/github.com/json-iterator/go/iter_object.go index 3bdb5576e..1c5757671 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_object.go +++ b/vendor/github.com/json-iterator/go/iter_object.go @@ -2,8 +2,7 @@ package jsoniter import ( "fmt" - "unicode" - "unsafe" + "strings" ) // ReadObject read one field from object. @@ -19,15 +18,25 @@ func (iter *Iterator) ReadObject() (ret string) { c = iter.nextToken() if c == '"' { iter.unreadByte() - return string(iter.readObjectFieldAsBytes()) + field := iter.ReadString() + c = iter.nextToken() + if c != ':' { + iter.ReportError("ReadObject", "expect : after object field, but found "+string([]byte{c})) + } + return field } if c == '}' { return "" // end of object } - iter.ReportError("ReadObject", `expect " after {`) + iter.ReportError("ReadObject", `expect " after {, but found `+string([]byte{c})) return case ',': - return string(iter.readObjectFieldAsBytes()) + field := iter.ReadString() + c = iter.nextToken() + if c != ':' { + iter.ReportError("ReadObject", "expect : after object field, but found "+string([]byte{c})) + } + return field case '}': return "" // end of object default: @@ -36,62 +45,92 @@ func (iter *Iterator) ReadObject() (ret string) { } } -func (iter *Iterator) readFieldHash() int32 { +// CaseInsensitive +func (iter *Iterator) readFieldHash() int64 { hash := int64(0x811c9dc5) c := iter.nextToken() - if c == '"' { - for { - for i := iter.head; i < iter.tail; i++ { - // require ascii string and no escape - b := iter.buf[i] - if 'A' <= b && b <= 'Z' { - b += 'a' - 'A' - } - if b == '"' { - iter.head = i + 1 - c = iter.nextToken() - if c != ':' { - iter.ReportError("readFieldHash", `expect :, but found `+string([]byte{c})) + if c != '"' { + iter.ReportError("readFieldHash", `expect ", but found `+string([]byte{c})) + return 0 + } + for { + for i := iter.head; i < iter.tail; i++ { + // require ascii string and no escape + b := iter.buf[i] + if b == '\\' { + iter.head = i + for _, b := range iter.readStringSlowPath() { + if 'A' <= b && b <= 'Z' && !iter.cfg.caseSensitive { + b += 'a' - 'A' } - return int32(hash) + hash ^= int64(b) + hash *= 0x1000193 + } + c = iter.nextToken() + if c != ':' { + iter.ReportError("readFieldHash", `expect :, but found `+string([]byte{c})) + return 0 + } + return hash + } + if b == '"' { + iter.head = i + 1 + c = iter.nextToken() + if c != ':' { + iter.ReportError("readFieldHash", `expect :, but found `+string([]byte{c})) + return 0 } - hash ^= int64(b) - hash *= 0x1000193 + return hash } - if !iter.loadMore() { - iter.ReportError("readFieldHash", `incomplete field name`) - return 0 + if 'A' <= b && b <= 'Z' && !iter.cfg.caseSensitive { + b += 'a' - 'A' } + hash ^= int64(b) + hash *= 0x1000193 + } + if !iter.loadMore() { + iter.ReportError("readFieldHash", `incomplete field name`) + return 0 } } - iter.ReportError("readFieldHash", `expect ", but found `+string([]byte{c})) - return 0 } -func calcHash(str string) int32 { +func calcHash(str string, caseSensitive bool) int64 { + if !caseSensitive { + str = strings.ToLower(str) + } hash := int64(0x811c9dc5) - for _, b := range str { - hash ^= int64(unicode.ToLower(b)) + for _, b := range []byte(str) { + hash ^= int64(b) hash *= 0x1000193 } - return int32(hash) + return int64(hash) } // ReadObjectCB read object with callback, the key is ascii only and field name not copied func (iter *Iterator) ReadObjectCB(callback func(*Iterator, string) bool) bool { c := iter.nextToken() + var field string if c == '{' { c = iter.nextToken() if c == '"' { iter.unreadByte() - field := iter.readObjectFieldAsBytes() - if !callback(iter, *(*string)(unsafe.Pointer(&field))) { + field = iter.ReadString() + c = iter.nextToken() + if c != ':' { + iter.ReportError("ReadObject", "expect : after object field, but found "+string([]byte{c})) + } + if !callback(iter, field) { return false } c = iter.nextToken() for c == ',' { - field = iter.readObjectFieldAsBytes() - if !callback(iter, *(*string)(unsafe.Pointer(&field))) { + field = iter.ReadString() + c = iter.nextToken() + if c != ':' { + iter.ReportError("ReadObject", "expect : after object field, but found "+string([]byte{c})) + } + if !callback(iter, field) { return false } c = iter.nextToken() @@ -105,14 +144,14 @@ func (iter *Iterator) ReadObjectCB(callback func(*Iterator, string) bool) bool { if c == '}' { return true } - iter.ReportError("ReadObjectCB", `expect " after }`) + iter.ReportError("ReadObjectCB", `expect " after }, but found `+string([]byte{c})) return false } if c == 'n' { iter.skipThreeBytes('u', 'l', 'l') return true // null } - iter.ReportError("ReadObjectCB", `expect { or n`) + iter.ReportError("ReadObjectCB", `expect { or n, but found `+string([]byte{c})) return false } @@ -125,7 +164,7 @@ func (iter *Iterator) ReadMapCB(callback func(*Iterator, string) bool) bool { iter.unreadByte() field := iter.ReadString() if iter.nextToken() != ':' { - iter.ReportError("ReadMapCB", "expect : after object field") + iter.ReportError("ReadMapCB", "expect : after object field, but found "+string([]byte{c})) return false } if !callback(iter, field) { @@ -135,7 +174,7 @@ func (iter *Iterator) ReadMapCB(callback func(*Iterator, string) bool) bool { for c == ',' { field = iter.ReadString() if iter.nextToken() != ':' { - iter.ReportError("ReadMapCB", "expect : after object field") + iter.ReportError("ReadMapCB", "expect : after object field, but found "+string([]byte{c})) return false } if !callback(iter, field) { @@ -152,14 +191,14 @@ func (iter *Iterator) ReadMapCB(callback func(*Iterator, string) bool) bool { if c == '}' { return true } - iter.ReportError("ReadMapCB", `expect " after }`) + iter.ReportError("ReadMapCB", `expect " after }, but found `+string([]byte{c})) return false } if c == 'n' { iter.skipThreeBytes('u', 'l', 'l') return true // null } - iter.ReportError("ReadMapCB", `expect { or n`) + iter.ReportError("ReadMapCB", `expect { or n, but found `+string([]byte{c})) return false } @@ -176,7 +215,7 @@ func (iter *Iterator) readObjectStart() bool { iter.skipThreeBytes('u', 'l', 'l') return false } - iter.ReportError("readObjectStart", "expect { or n") + iter.ReportError("readObjectStart", "expect { or n, but found "+string([]byte{c})) return false } @@ -192,7 +231,7 @@ func (iter *Iterator) readObjectFieldAsBytes() (ret []byte) { } } if iter.buf[iter.head] != ':' { - iter.ReportError("readObjectFieldAsBytes", "expect : after object field") + iter.ReportError("readObjectFieldAsBytes", "expect : after object field, but found "+string([]byte{iter.buf[iter.head]})) return } iter.head++ diff --git a/vendor/github.com/json-iterator/go/feature_iter_skip.go b/vendor/github.com/json-iterator/go/iter_skip.go index b008d98c9..f58beb913 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_skip.go +++ b/vendor/github.com/json-iterator/go/iter_skip.go @@ -25,7 +25,7 @@ func (iter *Iterator) ReadBool() (ret bool) { iter.skipFourBytes('a', 'l', 's', 'e') return false } - iter.ReportError("ReadBool", "expect t or f") + iter.ReportError("ReadBool", "expect t or f, but found "+string([]byte{c})) return } @@ -59,7 +59,9 @@ func (iter *Iterator) stopCapture() []byte { iter.captureStartedAt = -1 iter.captured = nil if len(captured) == 0 { - return remaining + copied := make([]byte, len(remaining)) + copy(copied, remaining) + return copied } captured = append(captured, remaining...) return captured diff --git a/vendor/github.com/json-iterator/go/feature_iter_skip_sloppy.go b/vendor/github.com/json-iterator/go/iter_skip_sloppy.go index 047d58a4b..8fcdc3b69 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_skip_sloppy.go +++ b/vendor/github.com/json-iterator/go/iter_skip_sloppy.go @@ -1,4 +1,4 @@ -//+build jsoniter-sloppy +//+build jsoniter_sloppy package jsoniter diff --git a/vendor/github.com/json-iterator/go/feature_iter_skip_strict.go b/vendor/github.com/json-iterator/go/iter_skip_strict.go index d26763825..f67bc2e83 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_skip_strict.go +++ b/vendor/github.com/json-iterator/go/iter_skip_strict.go @@ -1,4 +1,4 @@ -//+build !jsoniter-sloppy +//+build !jsoniter_sloppy package jsoniter @@ -64,7 +64,7 @@ func (iter *Iterator) trySkipString() bool { } else if c == '\\' { return false } else if c < ' ' { - iter.ReportError("ReadString", + iter.ReportError("trySkipString", fmt.Sprintf(`invalid control character found: %d`, c)) return true // already failed } diff --git a/vendor/github.com/json-iterator/go/feature_iter_string.go b/vendor/github.com/json-iterator/go/iter_str.go index b76460046..adc487ea8 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_string.go +++ b/vendor/github.com/json-iterator/go/iter_str.go @@ -28,7 +28,7 @@ func (iter *Iterator) ReadString() (ret string) { iter.skipThreeBytes('u', 'l', 'l') return "" } - iter.ReportError("ReadString", `expects " or n`) + iter.ReportError("ReadString", `expects " or n, but found `+string([]byte{c})) return } @@ -47,7 +47,7 @@ func (iter *Iterator) readStringSlowPath() (ret string) { str = append(str, c) } } - iter.ReportError("ReadString", "unexpected end of input") + iter.ReportError("readStringSlowPath", "unexpected end of input") return } @@ -104,7 +104,7 @@ func (iter *Iterator) readEscapedChar(c byte, str []byte) []byte { case 't': str = append(str, '\t') default: - iter.ReportError("ReadString", + iter.ReportError("readEscapedChar", `invalid escape char after \`) return nil } @@ -139,7 +139,7 @@ func (iter *Iterator) ReadStringAsSlice() (ret []byte) { } return copied } - iter.ReportError("ReadString", `expects " or n`) + iter.ReportError("ReadStringAsSlice", `expects " or n, but found `+string([]byte{c})) return } @@ -156,7 +156,7 @@ func (iter *Iterator) readU4() (ret rune) { } else if c >= 'A' && c <= 'F' { ret = ret*16 + rune(c-'A'+10) } else { - iter.ReportError("readU4", "expects 0~9 or a~f") + iter.ReportError("readU4", "expects 0~9 or a~f, but found "+string([]byte{c})) return } } diff --git a/vendor/github.com/json-iterator/go/feature_pool.go b/vendor/github.com/json-iterator/go/pool.go index 73962bc6f..e2389b56c 100644 --- a/vendor/github.com/json-iterator/go/feature_pool.go +++ b/vendor/github.com/json-iterator/go/pool.go @@ -17,41 +17,26 @@ type StreamPool interface { } func (cfg *frozenConfig) BorrowStream(writer io.Writer) *Stream { - select { - case stream := <-cfg.streamPool: - stream.Reset(writer) - return stream - default: - return NewStream(cfg, writer, 512) - } + stream := cfg.streamPool.Get().(*Stream) + stream.Reset(writer) + return stream } func (cfg *frozenConfig) ReturnStream(stream *Stream) { + stream.out = nil stream.Error = nil - select { - case cfg.streamPool <- stream: - return - default: - return - } + stream.Attachment = nil + cfg.streamPool.Put(stream) } func (cfg *frozenConfig) BorrowIterator(data []byte) *Iterator { - select { - case iter := <-cfg.iteratorPool: - iter.ResetBytes(data) - return iter - default: - return ParseBytes(cfg, data) - } + iter := cfg.iteratorPool.Get().(*Iterator) + iter.ResetBytes(data) + return iter } func (cfg *frozenConfig) ReturnIterator(iter *Iterator) { iter.Error = nil - select { - case cfg.iteratorPool <- iter: - return - default: - return - } + iter.Attachment = nil + cfg.iteratorPool.Put(iter) } diff --git a/vendor/github.com/json-iterator/go/reflect.go b/vendor/github.com/json-iterator/go/reflect.go new file mode 100644 index 000000000..4459e203f --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect.go @@ -0,0 +1,332 @@ +package jsoniter + +import ( + "fmt" + "reflect" + "unsafe" + + "github.com/modern-go/reflect2" +) + +// ValDecoder is an internal type registered to cache as needed. +// Don't confuse jsoniter.ValDecoder with json.Decoder. +// For json.Decoder's adapter, refer to jsoniter.AdapterDecoder(todo link). +// +// Reflection on type to create decoders, which is then cached +// Reflection on value is avoided as we can, as the reflect.Value itself will allocate, with following exceptions +// 1. create instance of new value, for example *int will need a int to be allocated +// 2. append to slice, if the existing cap is not enough, allocate will be done using Reflect.New +// 3. assignment to map, both key and value will be reflect.Value +// For a simple struct binding, it will be reflect.Value free and allocation free +type ValDecoder interface { + Decode(ptr unsafe.Pointer, iter *Iterator) +} + +// ValEncoder is an internal type registered to cache as needed. +// Don't confuse jsoniter.ValEncoder with json.Encoder. +// For json.Encoder's adapter, refer to jsoniter.AdapterEncoder(todo godoc link). +type ValEncoder interface { + IsEmpty(ptr unsafe.Pointer) bool + Encode(ptr unsafe.Pointer, stream *Stream) +} + +type checkIsEmpty interface { + IsEmpty(ptr unsafe.Pointer) bool +} + +type ctx struct { + *frozenConfig + prefix string + encoders map[reflect2.Type]ValEncoder + decoders map[reflect2.Type]ValDecoder +} + +func (b *ctx) caseSensitive() bool { + if b.frozenConfig == nil { + // default is case-insensitive + return false + } + return b.frozenConfig.caseSensitive +} + +func (b *ctx) append(prefix string) *ctx { + return &ctx{ + frozenConfig: b.frozenConfig, + prefix: b.prefix + " " + prefix, + encoders: b.encoders, + decoders: b.decoders, + } +} + +// ReadVal copy the underlying JSON into go interface, same as json.Unmarshal +func (iter *Iterator) ReadVal(obj interface{}) { + cacheKey := reflect2.RTypeOf(obj) + decoder := iter.cfg.getDecoderFromCache(cacheKey) + if decoder == nil { + typ := reflect2.TypeOf(obj) + if typ.Kind() != reflect.Ptr { + iter.ReportError("ReadVal", "can only unmarshal into pointer") + return + } + decoder = iter.cfg.DecoderOf(typ) + } + ptr := reflect2.PtrOf(obj) + if ptr == nil { + iter.ReportError("ReadVal", "can not read into nil pointer") + return + } + decoder.Decode(ptr, iter) +} + +// WriteVal copy the go interface into underlying JSON, same as json.Marshal +func (stream *Stream) WriteVal(val interface{}) { + if nil == val { + stream.WriteNil() + return + } + cacheKey := reflect2.RTypeOf(val) + encoder := stream.cfg.getEncoderFromCache(cacheKey) + if encoder == nil { + typ := reflect2.TypeOf(val) + encoder = stream.cfg.EncoderOf(typ) + } + encoder.Encode(reflect2.PtrOf(val), stream) +} + +func (cfg *frozenConfig) DecoderOf(typ reflect2.Type) ValDecoder { + cacheKey := typ.RType() + decoder := cfg.getDecoderFromCache(cacheKey) + if decoder != nil { + return decoder + } + ctx := &ctx{ + frozenConfig: cfg, + prefix: "", + decoders: map[reflect2.Type]ValDecoder{}, + encoders: map[reflect2.Type]ValEncoder{}, + } + ptrType := typ.(*reflect2.UnsafePtrType) + decoder = decoderOfType(ctx, ptrType.Elem()) + cfg.addDecoderToCache(cacheKey, decoder) + return decoder +} + +func decoderOfType(ctx *ctx, typ reflect2.Type) ValDecoder { + decoder := getTypeDecoderFromExtension(ctx, typ) + if decoder != nil { + return decoder + } + decoder = createDecoderOfType(ctx, typ) + for _, extension := range extensions { + decoder = extension.DecorateDecoder(typ, decoder) + } + decoder = ctx.decoderExtension.DecorateDecoder(typ, decoder) + for _, extension := range ctx.extraExtensions { + decoder = extension.DecorateDecoder(typ, decoder) + } + return decoder +} + +func createDecoderOfType(ctx *ctx, typ reflect2.Type) ValDecoder { + decoder := ctx.decoders[typ] + if decoder != nil { + return decoder + } + placeholder := &placeholderDecoder{} + ctx.decoders[typ] = placeholder + decoder = _createDecoderOfType(ctx, typ) + placeholder.decoder = decoder + return decoder +} + +func _createDecoderOfType(ctx *ctx, typ reflect2.Type) ValDecoder { + decoder := createDecoderOfJsonRawMessage(ctx, typ) + if decoder != nil { + return decoder + } + decoder = createDecoderOfJsonNumber(ctx, typ) + if decoder != nil { + return decoder + } + decoder = createDecoderOfMarshaler(ctx, typ) + if decoder != nil { + return decoder + } + decoder = createDecoderOfAny(ctx, typ) + if decoder != nil { + return decoder + } + decoder = createDecoderOfNative(ctx, typ) + if decoder != nil { + return decoder + } + switch typ.Kind() { + case reflect.Interface: + ifaceType, isIFace := typ.(*reflect2.UnsafeIFaceType) + if isIFace { + return &ifaceDecoder{valType: ifaceType} + } + return &efaceDecoder{} + case reflect.Struct: + return decoderOfStruct(ctx, typ) + case reflect.Array: + return decoderOfArray(ctx, typ) + case reflect.Slice: + return decoderOfSlice(ctx, typ) + case reflect.Map: + return decoderOfMap(ctx, typ) + case reflect.Ptr: + return decoderOfOptional(ctx, typ) + default: + return &lazyErrorDecoder{err: fmt.Errorf("%s%s is unsupported type", ctx.prefix, typ.String())} + } +} + +func (cfg *frozenConfig) EncoderOf(typ reflect2.Type) ValEncoder { + cacheKey := typ.RType() + encoder := cfg.getEncoderFromCache(cacheKey) + if encoder != nil { + return encoder + } + ctx := &ctx{ + frozenConfig: cfg, + prefix: "", + decoders: map[reflect2.Type]ValDecoder{}, + encoders: map[reflect2.Type]ValEncoder{}, + } + encoder = encoderOfType(ctx, typ) + if typ.LikePtr() { + encoder = &onePtrEncoder{encoder} + } + cfg.addEncoderToCache(cacheKey, encoder) + return encoder +} + +type onePtrEncoder struct { + encoder ValEncoder +} + +func (encoder *onePtrEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.encoder.IsEmpty(unsafe.Pointer(&ptr)) +} + +func (encoder *onePtrEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + encoder.encoder.Encode(unsafe.Pointer(&ptr), stream) +} + +func encoderOfType(ctx *ctx, typ reflect2.Type) ValEncoder { + encoder := getTypeEncoderFromExtension(ctx, typ) + if encoder != nil { + return encoder + } + encoder = createEncoderOfType(ctx, typ) + for _, extension := range extensions { + encoder = extension.DecorateEncoder(typ, encoder) + } + encoder = ctx.encoderExtension.DecorateEncoder(typ, encoder) + for _, extension := range ctx.extraExtensions { + encoder = extension.DecorateEncoder(typ, encoder) + } + return encoder +} + +func createEncoderOfType(ctx *ctx, typ reflect2.Type) ValEncoder { + encoder := ctx.encoders[typ] + if encoder != nil { + return encoder + } + placeholder := &placeholderEncoder{} + ctx.encoders[typ] = placeholder + encoder = _createEncoderOfType(ctx, typ) + placeholder.encoder = encoder + return encoder +} +func _createEncoderOfType(ctx *ctx, typ reflect2.Type) ValEncoder { + encoder := createEncoderOfJsonRawMessage(ctx, typ) + if encoder != nil { + return encoder + } + encoder = createEncoderOfJsonNumber(ctx, typ) + if encoder != nil { + return encoder + } + encoder = createEncoderOfMarshaler(ctx, typ) + if encoder != nil { + return encoder + } + encoder = createEncoderOfAny(ctx, typ) + if encoder != nil { + return encoder + } + encoder = createEncoderOfNative(ctx, typ) + if encoder != nil { + return encoder + } + kind := typ.Kind() + switch kind { + case reflect.Interface: + return &dynamicEncoder{typ} + case reflect.Struct: + return encoderOfStruct(ctx, typ) + case reflect.Array: + return encoderOfArray(ctx, typ) + case reflect.Slice: + return encoderOfSlice(ctx, typ) + case reflect.Map: + return encoderOfMap(ctx, typ) + case reflect.Ptr: + return encoderOfOptional(ctx, typ) + default: + return &lazyErrorEncoder{err: fmt.Errorf("%s%s is unsupported type", ctx.prefix, typ.String())} + } +} + +type lazyErrorDecoder struct { + err error +} + +func (decoder *lazyErrorDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + if iter.WhatIsNext() != NilValue { + if iter.Error == nil { + iter.Error = decoder.err + } + } else { + iter.Skip() + } +} + +type lazyErrorEncoder struct { + err error +} + +func (encoder *lazyErrorEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + if ptr == nil { + stream.WriteNil() + } else if stream.Error == nil { + stream.Error = encoder.err + } +} + +func (encoder *lazyErrorEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return false +} + +type placeholderDecoder struct { + decoder ValDecoder +} + +func (decoder *placeholderDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + decoder.decoder.Decode(ptr, iter) +} + +type placeholderEncoder struct { + encoder ValEncoder +} + +func (encoder *placeholderEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + encoder.encoder.Encode(ptr, stream) +} + +func (encoder *placeholderEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.encoder.IsEmpty(ptr) +} diff --git a/vendor/github.com/json-iterator/go/reflect_array.go b/vendor/github.com/json-iterator/go/reflect_array.go new file mode 100644 index 000000000..13a0b7b08 --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_array.go @@ -0,0 +1,104 @@ +package jsoniter + +import ( + "fmt" + "github.com/modern-go/reflect2" + "io" + "unsafe" +) + +func decoderOfArray(ctx *ctx, typ reflect2.Type) ValDecoder { + arrayType := typ.(*reflect2.UnsafeArrayType) + decoder := decoderOfType(ctx.append("[arrayElem]"), arrayType.Elem()) + return &arrayDecoder{arrayType, decoder} +} + +func encoderOfArray(ctx *ctx, typ reflect2.Type) ValEncoder { + arrayType := typ.(*reflect2.UnsafeArrayType) + if arrayType.Len() == 0 { + return emptyArrayEncoder{} + } + encoder := encoderOfType(ctx.append("[arrayElem]"), arrayType.Elem()) + return &arrayEncoder{arrayType, encoder} +} + +type emptyArrayEncoder struct{} + +func (encoder emptyArrayEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteEmptyArray() +} + +func (encoder emptyArrayEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return true +} + +type arrayEncoder struct { + arrayType *reflect2.UnsafeArrayType + elemEncoder ValEncoder +} + +func (encoder *arrayEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteArrayStart() + elemPtr := unsafe.Pointer(ptr) + encoder.elemEncoder.Encode(elemPtr, stream) + for i := 1; i < encoder.arrayType.Len(); i++ { + stream.WriteMore() + elemPtr = encoder.arrayType.UnsafeGetIndex(ptr, i) + encoder.elemEncoder.Encode(elemPtr, stream) + } + stream.WriteArrayEnd() + if stream.Error != nil && stream.Error != io.EOF { + stream.Error = fmt.Errorf("%v: %s", encoder.arrayType, stream.Error.Error()) + } +} + +func (encoder *arrayEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return false +} + +type arrayDecoder struct { + arrayType *reflect2.UnsafeArrayType + elemDecoder ValDecoder +} + +func (decoder *arrayDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + decoder.doDecode(ptr, iter) + if iter.Error != nil && iter.Error != io.EOF { + iter.Error = fmt.Errorf("%v: %s", decoder.arrayType, iter.Error.Error()) + } +} + +func (decoder *arrayDecoder) doDecode(ptr unsafe.Pointer, iter *Iterator) { + c := iter.nextToken() + arrayType := decoder.arrayType + if c == 'n' { + iter.skipThreeBytes('u', 'l', 'l') + return + } + if c != '[' { + iter.ReportError("decode array", "expect [ or n, but found "+string([]byte{c})) + return + } + c = iter.nextToken() + if c == ']' { + return + } + iter.unreadByte() + elemPtr := arrayType.UnsafeGetIndex(ptr, 0) + decoder.elemDecoder.Decode(elemPtr, iter) + length := 1 + for c = iter.nextToken(); c == ','; c = iter.nextToken() { + if length >= arrayType.Len() { + iter.Skip() + continue + } + idx := length + length += 1 + elemPtr = arrayType.UnsafeGetIndex(ptr, idx) + decoder.elemDecoder.Decode(elemPtr, iter) + } + if c != ']' { + iter.ReportError("decode array", "expect ], but found "+string([]byte{c})) + return + } +} diff --git a/vendor/github.com/json-iterator/go/reflect_dynamic.go b/vendor/github.com/json-iterator/go/reflect_dynamic.go new file mode 100644 index 000000000..8b6bc8b43 --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_dynamic.go @@ -0,0 +1,70 @@ +package jsoniter + +import ( + "github.com/modern-go/reflect2" + "reflect" + "unsafe" +) + +type dynamicEncoder struct { + valType reflect2.Type +} + +func (encoder *dynamicEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + obj := encoder.valType.UnsafeIndirect(ptr) + stream.WriteVal(obj) +} + +func (encoder *dynamicEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.valType.UnsafeIndirect(ptr) == nil +} + +type efaceDecoder struct { +} + +func (decoder *efaceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + pObj := (*interface{})(ptr) + obj := *pObj + if obj == nil { + *pObj = iter.Read() + return + } + typ := reflect2.TypeOf(obj) + if typ.Kind() != reflect.Ptr { + *pObj = iter.Read() + return + } + ptrType := typ.(*reflect2.UnsafePtrType) + ptrElemType := ptrType.Elem() + if iter.WhatIsNext() == NilValue { + if ptrElemType.Kind() != reflect.Ptr { + iter.skipFourBytes('n', 'u', 'l', 'l') + *pObj = nil + return + } + } + if reflect2.IsNil(obj) { + obj := ptrElemType.New() + iter.ReadVal(obj) + *pObj = obj + return + } + iter.ReadVal(obj) +} + +type ifaceDecoder struct { + valType *reflect2.UnsafeIFaceType +} + +func (decoder *ifaceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + if iter.ReadNil() { + decoder.valType.UnsafeSet(ptr, decoder.valType.UnsafeNew()) + return + } + obj := decoder.valType.UnsafeIndirect(ptr) + if reflect2.IsNil(obj) { + iter.ReportError("decode non empty interface", "can not unmarshal into nil") + return + } + iter.ReadVal(obj) +} diff --git a/vendor/github.com/json-iterator/go/feature_reflect_extension.go b/vendor/github.com/json-iterator/go/reflect_extension.go index 3dd38299d..04f68756b 100644 --- a/vendor/github.com/json-iterator/go/feature_reflect_extension.go +++ b/vendor/github.com/json-iterator/go/reflect_extension.go @@ -2,6 +2,7 @@ package jsoniter import ( "fmt" + "github.com/modern-go/reflect2" "reflect" "sort" "strings" @@ -17,17 +18,15 @@ var extensions = []Extension{} // StructDescriptor describe how should we encode/decode the struct type StructDescriptor struct { - onePtrEmbedded bool - onePtrOptimization bool - Type reflect.Type - Fields []*Binding + Type reflect2.Type + Fields []*Binding } // GetField get one field from the descriptor by its name. // Can not use map here to keep field orders. func (structDescriptor *StructDescriptor) GetField(fieldName string) *Binding { for _, binding := range structDescriptor.Fields { - if binding.Field.Name == fieldName { + if binding.Field.Name() == fieldName { return binding } } @@ -37,7 +36,7 @@ func (structDescriptor *StructDescriptor) GetField(fieldName string) *Binding { // Binding describe how should we encode/decode the struct field type Binding struct { levels []int - Field *reflect.StructField + Field reflect2.StructField FromNames []string ToNames []string Encoder ValEncoder @@ -48,10 +47,12 @@ type Binding struct { // Can also rename fields by UpdateStructDescriptor. type Extension interface { UpdateStructDescriptor(structDescriptor *StructDescriptor) - CreateDecoder(typ reflect.Type) ValDecoder - CreateEncoder(typ reflect.Type) ValEncoder - DecorateDecoder(typ reflect.Type, decoder ValDecoder) ValDecoder - DecorateEncoder(typ reflect.Type, encoder ValEncoder) ValEncoder + CreateMapKeyDecoder(typ reflect2.Type) ValDecoder + CreateMapKeyEncoder(typ reflect2.Type) ValEncoder + CreateDecoder(typ reflect2.Type) ValDecoder + CreateEncoder(typ reflect2.Type) ValEncoder + DecorateDecoder(typ reflect2.Type, decoder ValDecoder) ValDecoder + DecorateEncoder(typ reflect2.Type, encoder ValEncoder) ValEncoder } // DummyExtension embed this type get dummy implementation for all methods of Extension @@ -62,23 +63,105 @@ type DummyExtension struct { func (extension *DummyExtension) UpdateStructDescriptor(structDescriptor *StructDescriptor) { } +// CreateMapKeyDecoder No-op +func (extension *DummyExtension) CreateMapKeyDecoder(typ reflect2.Type) ValDecoder { + return nil +} + +// CreateMapKeyEncoder No-op +func (extension *DummyExtension) CreateMapKeyEncoder(typ reflect2.Type) ValEncoder { + return nil +} + +// CreateDecoder No-op +func (extension *DummyExtension) CreateDecoder(typ reflect2.Type) ValDecoder { + return nil +} + +// CreateEncoder No-op +func (extension *DummyExtension) CreateEncoder(typ reflect2.Type) ValEncoder { + return nil +} + +// DecorateDecoder No-op +func (extension *DummyExtension) DecorateDecoder(typ reflect2.Type, decoder ValDecoder) ValDecoder { + return decoder +} + +// DecorateEncoder No-op +func (extension *DummyExtension) DecorateEncoder(typ reflect2.Type, encoder ValEncoder) ValEncoder { + return encoder +} + +type EncoderExtension map[reflect2.Type]ValEncoder + +// UpdateStructDescriptor No-op +func (extension EncoderExtension) UpdateStructDescriptor(structDescriptor *StructDescriptor) { +} + // CreateDecoder No-op -func (extension *DummyExtension) CreateDecoder(typ reflect.Type) ValDecoder { +func (extension EncoderExtension) CreateDecoder(typ reflect2.Type) ValDecoder { + return nil +} + +// CreateEncoder get encoder from map +func (extension EncoderExtension) CreateEncoder(typ reflect2.Type) ValEncoder { + return extension[typ] +} + +// CreateMapKeyDecoder No-op +func (extension EncoderExtension) CreateMapKeyDecoder(typ reflect2.Type) ValDecoder { + return nil +} + +// CreateMapKeyEncoder No-op +func (extension EncoderExtension) CreateMapKeyEncoder(typ reflect2.Type) ValEncoder { + return nil +} + +// DecorateDecoder No-op +func (extension EncoderExtension) DecorateDecoder(typ reflect2.Type, decoder ValDecoder) ValDecoder { + return decoder +} + +// DecorateEncoder No-op +func (extension EncoderExtension) DecorateEncoder(typ reflect2.Type, encoder ValEncoder) ValEncoder { + return encoder +} + +type DecoderExtension map[reflect2.Type]ValDecoder + +// UpdateStructDescriptor No-op +func (extension DecoderExtension) UpdateStructDescriptor(structDescriptor *StructDescriptor) { +} + +// CreateMapKeyDecoder No-op +func (extension DecoderExtension) CreateMapKeyDecoder(typ reflect2.Type) ValDecoder { + return nil +} + +// CreateMapKeyEncoder No-op +func (extension DecoderExtension) CreateMapKeyEncoder(typ reflect2.Type) ValEncoder { return nil } +// CreateDecoder get decoder from map +func (extension DecoderExtension) CreateDecoder(typ reflect2.Type) ValDecoder { + return extension[typ] +} + // CreateEncoder No-op -func (extension *DummyExtension) CreateEncoder(typ reflect.Type) ValEncoder { +func (extension DecoderExtension) CreateEncoder(typ reflect2.Type) ValEncoder { return nil } // DecorateDecoder No-op -func (extension *DummyExtension) DecorateDecoder(typ reflect.Type, decoder ValDecoder) ValDecoder { +func (extension DecoderExtension) DecorateDecoder(typ reflect2.Type, decoder ValDecoder) ValDecoder { return decoder } // DecorateEncoder No-op -func (extension *DummyExtension) DecorateEncoder(typ reflect.Type, encoder ValEncoder) ValEncoder { +func (extension DecoderExtension) DecorateEncoder(typ reflect2.Type, encoder ValEncoder) ValEncoder { return encoder } @@ -99,10 +182,6 @@ func (encoder *funcEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { encoder.fun(ptr, stream) } -func (encoder *funcEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - func (encoder *funcEncoder) IsEmpty(ptr unsafe.Pointer) bool { if encoder.isEmptyFunc == nil { return false @@ -161,132 +240,151 @@ func RegisterExtension(extension Extension) { extensions = append(extensions, extension) } -func getTypeDecoderFromExtension(typ reflect.Type) ValDecoder { - decoder := _getTypeDecoderFromExtension(typ) +func getTypeDecoderFromExtension(ctx *ctx, typ reflect2.Type) ValDecoder { + decoder := _getTypeDecoderFromExtension(ctx, typ) if decoder != nil { for _, extension := range extensions { decoder = extension.DecorateDecoder(typ, decoder) } + decoder = ctx.decoderExtension.DecorateDecoder(typ, decoder) + for _, extension := range ctx.extraExtensions { + decoder = extension.DecorateDecoder(typ, decoder) + } } return decoder } -func _getTypeDecoderFromExtension(typ reflect.Type) ValDecoder { +func _getTypeDecoderFromExtension(ctx *ctx, typ reflect2.Type) ValDecoder { for _, extension := range extensions { decoder := extension.CreateDecoder(typ) if decoder != nil { return decoder } } + decoder := ctx.decoderExtension.CreateDecoder(typ) + if decoder != nil { + return decoder + } + for _, extension := range ctx.extraExtensions { + decoder := extension.CreateDecoder(typ) + if decoder != nil { + return decoder + } + } typeName := typ.String() - decoder := typeDecoders[typeName] + decoder = typeDecoders[typeName] if decoder != nil { return decoder } if typ.Kind() == reflect.Ptr { - decoder := typeDecoders[typ.Elem().String()] + ptrType := typ.(*reflect2.UnsafePtrType) + decoder := typeDecoders[ptrType.Elem().String()] if decoder != nil { - return &optionalDecoder{typ.Elem(), decoder} + return &OptionalDecoder{ptrType.Elem(), decoder} } } return nil } -func getTypeEncoderFromExtension(typ reflect.Type) ValEncoder { - encoder := _getTypeEncoderFromExtension(typ) +func getTypeEncoderFromExtension(ctx *ctx, typ reflect2.Type) ValEncoder { + encoder := _getTypeEncoderFromExtension(ctx, typ) if encoder != nil { for _, extension := range extensions { encoder = extension.DecorateEncoder(typ, encoder) } + encoder = ctx.encoderExtension.DecorateEncoder(typ, encoder) + for _, extension := range ctx.extraExtensions { + encoder = extension.DecorateEncoder(typ, encoder) + } } return encoder } -func _getTypeEncoderFromExtension(typ reflect.Type) ValEncoder { +func _getTypeEncoderFromExtension(ctx *ctx, typ reflect2.Type) ValEncoder { for _, extension := range extensions { encoder := extension.CreateEncoder(typ) if encoder != nil { return encoder } } + encoder := ctx.encoderExtension.CreateEncoder(typ) + if encoder != nil { + return encoder + } + for _, extension := range ctx.extraExtensions { + encoder := extension.CreateEncoder(typ) + if encoder != nil { + return encoder + } + } typeName := typ.String() - encoder := typeEncoders[typeName] + encoder = typeEncoders[typeName] if encoder != nil { return encoder } if typ.Kind() == reflect.Ptr { - encoder := typeEncoders[typ.Elem().String()] + typePtr := typ.(*reflect2.UnsafePtrType) + encoder := typeEncoders[typePtr.Elem().String()] if encoder != nil { - return &optionalEncoder{encoder} + return &OptionalEncoder{encoder} } } return nil } -func describeStruct(cfg *frozenConfig, typ reflect.Type) (*StructDescriptor, error) { +func describeStruct(ctx *ctx, typ reflect2.Type) *StructDescriptor { + structType := typ.(*reflect2.UnsafeStructType) embeddedBindings := []*Binding{} bindings := []*Binding{} - for i := 0; i < typ.NumField(); i++ { - field := typ.Field(i) - tag := field.Tag.Get(cfg.getTagKey()) + for i := 0; i < structType.NumField(); i++ { + field := structType.Field(i) + tag, hastag := field.Tag().Lookup(ctx.getTagKey()) + if ctx.onlyTaggedField && !hastag { + continue + } tagParts := strings.Split(tag, ",") if tag == "-" { continue } - if field.Anonymous && (tag == "" || tagParts[0] == "") { - if field.Type.Kind() == reflect.Struct { - structDescriptor, err := describeStruct(cfg, field.Type) - if err != nil { - return nil, err - } + if field.Anonymous() && (tag == "" || tagParts[0] == "") { + if field.Type().Kind() == reflect.Struct { + structDescriptor := describeStruct(ctx, field.Type()) for _, binding := range structDescriptor.Fields { binding.levels = append([]int{i}, binding.levels...) omitempty := binding.Encoder.(*structFieldEncoder).omitempty - binding.Encoder = &structFieldEncoder{&field, binding.Encoder, omitempty} - binding.Decoder = &structFieldDecoder{&field, binding.Decoder} + binding.Encoder = &structFieldEncoder{field, binding.Encoder, omitempty} + binding.Decoder = &structFieldDecoder{field, binding.Decoder} embeddedBindings = append(embeddedBindings, binding) } continue - } else if field.Type.Kind() == reflect.Ptr && field.Type.Elem().Kind() == reflect.Struct { - structDescriptor, err := describeStruct(cfg, field.Type.Elem()) - if err != nil { - return nil, err + } else if field.Type().Kind() == reflect.Ptr { + ptrType := field.Type().(*reflect2.UnsafePtrType) + if ptrType.Elem().Kind() == reflect.Struct { + structDescriptor := describeStruct(ctx, ptrType.Elem()) + for _, binding := range structDescriptor.Fields { + binding.levels = append([]int{i}, binding.levels...) + omitempty := binding.Encoder.(*structFieldEncoder).omitempty + binding.Encoder = &dereferenceEncoder{binding.Encoder} + binding.Encoder = &structFieldEncoder{field, binding.Encoder, omitempty} + binding.Decoder = &dereferenceDecoder{ptrType.Elem(), binding.Decoder} + binding.Decoder = &structFieldDecoder{field, binding.Decoder} + embeddedBindings = append(embeddedBindings, binding) + } + continue } - for _, binding := range structDescriptor.Fields { - binding.levels = append([]int{i}, binding.levels...) - omitempty := binding.Encoder.(*structFieldEncoder).omitempty - binding.Encoder = &optionalEncoder{binding.Encoder} - binding.Encoder = &structFieldEncoder{&field, binding.Encoder, omitempty} - binding.Decoder = &deferenceDecoder{field.Type.Elem(), binding.Decoder} - binding.Decoder = &structFieldDecoder{&field, binding.Decoder} - embeddedBindings = append(embeddedBindings, binding) - } - continue } } - fieldNames := calcFieldNames(field.Name, tagParts[0], tag) - fieldCacheKey := fmt.Sprintf("%s/%s", typ.String(), field.Name) + fieldNames := calcFieldNames(field.Name(), tagParts[0], tag) + fieldCacheKey := fmt.Sprintf("%s/%s", typ.String(), field.Name()) decoder := fieldDecoders[fieldCacheKey] if decoder == nil { - var err error - decoder, err = decoderOfType(cfg, field.Type) - if err != nil { - return nil, err - } + decoder = decoderOfType(ctx.append(field.Name()), field.Type()) } encoder := fieldEncoders[fieldCacheKey] if encoder == nil { - var err error - encoder, err = encoderOfType(cfg, field.Type) - if err != nil { - return nil, err - } - // map is stored as pointer in the struct - if field.Type.Kind() == reflect.Map { - encoder = &optionalEncoder{encoder} - } + encoder = encoderOfType(ctx.append(field.Name()), field.Type()) } binding := &Binding{ - Field: &field, + Field: field, FromNames: fieldNames, ToNames: fieldNames, Decoder: decoder, @@ -295,35 +393,22 @@ func describeStruct(cfg *frozenConfig, typ reflect.Type) (*StructDescriptor, err binding.levels = []int{i} bindings = append(bindings, binding) } - return createStructDescriptor(cfg, typ, bindings, embeddedBindings), nil -} -func createStructDescriptor(cfg *frozenConfig, typ reflect.Type, bindings []*Binding, embeddedBindings []*Binding) *StructDescriptor { - onePtrEmbedded := false - onePtrOptimization := false - if typ.NumField() == 1 { - firstField := typ.Field(0) - switch firstField.Type.Kind() { - case reflect.Ptr: - if firstField.Anonymous && firstField.Type.Elem().Kind() == reflect.Struct { - onePtrEmbedded = true - } - fallthrough - case reflect.Map: - onePtrOptimization = true - case reflect.Struct: - onePtrOptimization = isStructOnePtr(firstField.Type) - } - } + return createStructDescriptor(ctx, typ, bindings, embeddedBindings) +} +func createStructDescriptor(ctx *ctx, typ reflect2.Type, bindings []*Binding, embeddedBindings []*Binding) *StructDescriptor { structDescriptor := &StructDescriptor{ - onePtrEmbedded: onePtrEmbedded, - onePtrOptimization: onePtrOptimization, - Type: typ, - Fields: bindings, + Type: typ, + Fields: bindings, } for _, extension := range extensions { extension.UpdateStructDescriptor(structDescriptor) } - processTags(structDescriptor, cfg) + ctx.encoderExtension.UpdateStructDescriptor(structDescriptor) + ctx.decoderExtension.UpdateStructDescriptor(structDescriptor) + for _, extension := range ctx.extraExtensions { + extension.UpdateStructDescriptor(structDescriptor) + } + processTags(structDescriptor, ctx.frozenConfig) // merge normal & embedded bindings & sort with original order allBindings := sortableBindings(append(embeddedBindings, structDescriptor.Fields...)) sort.Sort(allBindings) @@ -331,21 +416,6 @@ func createStructDescriptor(cfg *frozenConfig, typ reflect.Type, bindings []*Bin return structDescriptor } -func isStructOnePtr(typ reflect.Type) bool { - if typ.NumField() == 1 { - firstField := typ.Field(0) - switch firstField.Type.Kind() { - case reflect.Ptr: - return true - case reflect.Map: - return true - case reflect.Struct: - return isStructOnePtr(firstField.Type) - } - } - return false -} - type sortableBindings []*Binding func (bindings sortableBindings) Len() int { @@ -373,12 +443,12 @@ func (bindings sortableBindings) Swap(i, j int) { func processTags(structDescriptor *StructDescriptor, cfg *frozenConfig) { for _, binding := range structDescriptor.Fields { shouldOmitEmpty := false - tagParts := strings.Split(binding.Field.Tag.Get(cfg.getTagKey()), ",") + tagParts := strings.Split(binding.Field.Tag().Get(cfg.getTagKey()), ",") for _, tagPart := range tagParts[1:] { if tagPart == "omitempty" { shouldOmitEmpty = true } else if tagPart == "string" { - if binding.Field.Type.Kind() == reflect.String { + if binding.Field.Type().Kind() == reflect.String { binding.Decoder = &stringModeStringDecoder{binding.Decoder, cfg} binding.Encoder = &stringModeStringEncoder{binding.Encoder, cfg} } else { diff --git a/vendor/github.com/json-iterator/go/reflect_json_number.go b/vendor/github.com/json-iterator/go/reflect_json_number.go new file mode 100644 index 000000000..98d45c1ec --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_json_number.go @@ -0,0 +1,112 @@ +package jsoniter + +import ( + "encoding/json" + "github.com/modern-go/reflect2" + "strconv" + "unsafe" +) + +type Number string + +// String returns the literal text of the number. +func (n Number) String() string { return string(n) } + +// Float64 returns the number as a float64. +func (n Number) Float64() (float64, error) { + return strconv.ParseFloat(string(n), 64) +} + +// Int64 returns the number as an int64. +func (n Number) Int64() (int64, error) { + return strconv.ParseInt(string(n), 10, 64) +} + +func CastJsonNumber(val interface{}) (string, bool) { + switch typedVal := val.(type) { + case json.Number: + return string(typedVal), true + case Number: + return string(typedVal), true + } + return "", false +} + +var jsonNumberType = reflect2.TypeOfPtr((*json.Number)(nil)).Elem() +var jsoniterNumberType = reflect2.TypeOfPtr((*Number)(nil)).Elem() + +func createDecoderOfJsonNumber(ctx *ctx, typ reflect2.Type) ValDecoder { + if typ.AssignableTo(jsonNumberType) { + return &jsonNumberCodec{} + } + if typ.AssignableTo(jsoniterNumberType) { + return &jsoniterNumberCodec{} + } + return nil +} + +func createEncoderOfJsonNumber(ctx *ctx, typ reflect2.Type) ValEncoder { + if typ.AssignableTo(jsonNumberType) { + return &jsonNumberCodec{} + } + if typ.AssignableTo(jsoniterNumberType) { + return &jsoniterNumberCodec{} + } + return nil +} + +type jsonNumberCodec struct { +} + +func (codec *jsonNumberCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + switch iter.WhatIsNext() { + case StringValue: + *((*json.Number)(ptr)) = json.Number(iter.ReadString()) + case NilValue: + iter.skipFourBytes('n', 'u', 'l', 'l') + *((*json.Number)(ptr)) = "" + default: + *((*json.Number)(ptr)) = json.Number([]byte(iter.readNumberAsString())) + } +} + +func (codec *jsonNumberCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + number := *((*json.Number)(ptr)) + if len(number) == 0 { + stream.writeByte('0') + } else { + stream.WriteRaw(string(number)) + } +} + +func (codec *jsonNumberCodec) IsEmpty(ptr unsafe.Pointer) bool { + return len(*((*json.Number)(ptr))) == 0 +} + +type jsoniterNumberCodec struct { +} + +func (codec *jsoniterNumberCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + switch iter.WhatIsNext() { + case StringValue: + *((*Number)(ptr)) = Number(iter.ReadString()) + case NilValue: + iter.skipFourBytes('n', 'u', 'l', 'l') + *((*Number)(ptr)) = "" + default: + *((*Number)(ptr)) = Number([]byte(iter.readNumberAsString())) + } +} + +func (codec *jsoniterNumberCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + number := *((*Number)(ptr)) + if len(number) == 0 { + stream.writeByte('0') + } else { + stream.WriteRaw(string(number)) + } +} + +func (codec *jsoniterNumberCodec) IsEmpty(ptr unsafe.Pointer) bool { + return len(*((*Number)(ptr))) == 0 +} diff --git a/vendor/github.com/json-iterator/go/reflect_json_raw_message.go b/vendor/github.com/json-iterator/go/reflect_json_raw_message.go new file mode 100644 index 000000000..f2619936c --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_json_raw_message.go @@ -0,0 +1,60 @@ +package jsoniter + +import ( + "encoding/json" + "github.com/modern-go/reflect2" + "unsafe" +) + +var jsonRawMessageType = reflect2.TypeOfPtr((*json.RawMessage)(nil)).Elem() +var jsoniterRawMessageType = reflect2.TypeOfPtr((*RawMessage)(nil)).Elem() + +func createEncoderOfJsonRawMessage(ctx *ctx, typ reflect2.Type) ValEncoder { + if typ == jsonRawMessageType { + return &jsonRawMessageCodec{} + } + if typ == jsoniterRawMessageType { + return &jsoniterRawMessageCodec{} + } + return nil +} + +func createDecoderOfJsonRawMessage(ctx *ctx, typ reflect2.Type) ValDecoder { + if typ == jsonRawMessageType { + return &jsonRawMessageCodec{} + } + if typ == jsoniterRawMessageType { + return &jsoniterRawMessageCodec{} + } + return nil +} + +type jsonRawMessageCodec struct { +} + +func (codec *jsonRawMessageCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + *((*json.RawMessage)(ptr)) = json.RawMessage(iter.SkipAndReturnBytes()) +} + +func (codec *jsonRawMessageCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteRaw(string(*((*json.RawMessage)(ptr)))) +} + +func (codec *jsonRawMessageCodec) IsEmpty(ptr unsafe.Pointer) bool { + return len(*((*json.RawMessage)(ptr))) == 0 +} + +type jsoniterRawMessageCodec struct { +} + +func (codec *jsoniterRawMessageCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + *((*RawMessage)(ptr)) = RawMessage(iter.SkipAndReturnBytes()) +} + +func (codec *jsoniterRawMessageCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteRaw(string(*((*RawMessage)(ptr)))) +} + +func (codec *jsoniterRawMessageCodec) IsEmpty(ptr unsafe.Pointer) bool { + return len(*((*RawMessage)(ptr))) == 0 +} diff --git a/vendor/github.com/json-iterator/go/reflect_map.go b/vendor/github.com/json-iterator/go/reflect_map.go new file mode 100644 index 000000000..7f66a88b0 --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_map.go @@ -0,0 +1,326 @@ +package jsoniter + +import ( + "fmt" + "github.com/modern-go/reflect2" + "io" + "reflect" + "sort" + "unsafe" +) + +func decoderOfMap(ctx *ctx, typ reflect2.Type) ValDecoder { + mapType := typ.(*reflect2.UnsafeMapType) + keyDecoder := decoderOfMapKey(ctx.append("[mapKey]"), mapType.Key()) + elemDecoder := decoderOfType(ctx.append("[mapElem]"), mapType.Elem()) + return &mapDecoder{ + mapType: mapType, + keyType: mapType.Key(), + elemType: mapType.Elem(), + keyDecoder: keyDecoder, + elemDecoder: elemDecoder, + } +} + +func encoderOfMap(ctx *ctx, typ reflect2.Type) ValEncoder { + mapType := typ.(*reflect2.UnsafeMapType) + if ctx.sortMapKeys { + return &sortKeysMapEncoder{ + mapType: mapType, + keyEncoder: encoderOfMapKey(ctx.append("[mapKey]"), mapType.Key()), + elemEncoder: encoderOfType(ctx.append("[mapElem]"), mapType.Elem()), + } + } + return &mapEncoder{ + mapType: mapType, + keyEncoder: encoderOfMapKey(ctx.append("[mapKey]"), mapType.Key()), + elemEncoder: encoderOfType(ctx.append("[mapElem]"), mapType.Elem()), + } +} + +func decoderOfMapKey(ctx *ctx, typ reflect2.Type) ValDecoder { + decoder := ctx.decoderExtension.CreateMapKeyDecoder(typ) + if decoder != nil { + return decoder + } + for _, extension := range ctx.extraExtensions { + decoder := extension.CreateMapKeyDecoder(typ) + if decoder != nil { + return decoder + } + } + switch typ.Kind() { + case reflect.String: + return decoderOfType(ctx, reflect2.DefaultTypeOfKind(reflect.String)) + case reflect.Bool, + reflect.Uint8, reflect.Int8, + reflect.Uint16, reflect.Int16, + reflect.Uint32, reflect.Int32, + reflect.Uint64, reflect.Int64, + reflect.Uint, reflect.Int, + reflect.Float32, reflect.Float64, + reflect.Uintptr: + typ = reflect2.DefaultTypeOfKind(typ.Kind()) + return &numericMapKeyDecoder{decoderOfType(ctx, typ)} + default: + ptrType := reflect2.PtrTo(typ) + if ptrType.Implements(textMarshalerType) { + return &referenceDecoder{ + &textUnmarshalerDecoder{ + valType: ptrType, + }, + } + } + if typ.Implements(textMarshalerType) { + return &textUnmarshalerDecoder{ + valType: typ, + } + } + return &lazyErrorDecoder{err: fmt.Errorf("unsupported map key type: %v", typ)} + } +} + +func encoderOfMapKey(ctx *ctx, typ reflect2.Type) ValEncoder { + encoder := ctx.encoderExtension.CreateMapKeyEncoder(typ) + if encoder != nil { + return encoder + } + for _, extension := range ctx.extraExtensions { + encoder := extension.CreateMapKeyEncoder(typ) + if encoder != nil { + return encoder + } + } + switch typ.Kind() { + case reflect.String: + return encoderOfType(ctx, reflect2.DefaultTypeOfKind(reflect.String)) + case reflect.Bool, + reflect.Uint8, reflect.Int8, + reflect.Uint16, reflect.Int16, + reflect.Uint32, reflect.Int32, + reflect.Uint64, reflect.Int64, + reflect.Uint, reflect.Int, + reflect.Float32, reflect.Float64, + reflect.Uintptr: + typ = reflect2.DefaultTypeOfKind(typ.Kind()) + return &numericMapKeyEncoder{encoderOfType(ctx, typ)} + default: + if typ == textMarshalerType { + return &directTextMarshalerEncoder{ + stringEncoder: ctx.EncoderOf(reflect2.TypeOf("")), + } + } + if typ.Implements(textMarshalerType) { + return &textMarshalerEncoder{ + valType: typ, + stringEncoder: ctx.EncoderOf(reflect2.TypeOf("")), + } + } + if typ.Kind() == reflect.Interface { + return &dynamicMapKeyEncoder{ctx, typ} + } + return &lazyErrorEncoder{err: fmt.Errorf("unsupported map key type: %v", typ)} + } +} + +type mapDecoder struct { + mapType *reflect2.UnsafeMapType + keyType reflect2.Type + elemType reflect2.Type + keyDecoder ValDecoder + elemDecoder ValDecoder +} + +func (decoder *mapDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + mapType := decoder.mapType + c := iter.nextToken() + if c == 'n' { + iter.skipThreeBytes('u', 'l', 'l') + *(*unsafe.Pointer)(ptr) = nil + mapType.UnsafeSet(ptr, mapType.UnsafeNew()) + return + } + if mapType.UnsafeIsNil(ptr) { + mapType.UnsafeSet(ptr, mapType.UnsafeMakeMap(0)) + } + if c != '{' { + iter.ReportError("ReadMapCB", `expect { or n, but found `+string([]byte{c})) + return + } + c = iter.nextToken() + if c == '}' { + return + } + if c != '"' { + iter.ReportError("ReadMapCB", `expect " after }, but found `+string([]byte{c})) + return + } + iter.unreadByte() + key := decoder.keyType.UnsafeNew() + decoder.keyDecoder.Decode(key, iter) + c = iter.nextToken() + if c != ':' { + iter.ReportError("ReadMapCB", "expect : after object field, but found "+string([]byte{c})) + return + } + elem := decoder.elemType.UnsafeNew() + decoder.elemDecoder.Decode(elem, iter) + decoder.mapType.UnsafeSetIndex(ptr, key, elem) + for c = iter.nextToken(); c == ','; c = iter.nextToken() { + key := decoder.keyType.UnsafeNew() + decoder.keyDecoder.Decode(key, iter) + c = iter.nextToken() + if c != ':' { + iter.ReportError("ReadMapCB", "expect : after object field, but found "+string([]byte{c})) + return + } + elem := decoder.elemType.UnsafeNew() + decoder.elemDecoder.Decode(elem, iter) + decoder.mapType.UnsafeSetIndex(ptr, key, elem) + } + if c != '}' { + iter.ReportError("ReadMapCB", `expect }, but found `+string([]byte{c})) + } +} + +type numericMapKeyDecoder struct { + decoder ValDecoder +} + +func (decoder *numericMapKeyDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + c := iter.nextToken() + if c != '"' { + iter.ReportError("ReadMapCB", `expect ", but found `+string([]byte{c})) + return + } + decoder.decoder.Decode(ptr, iter) + c = iter.nextToken() + if c != '"' { + iter.ReportError("ReadMapCB", `expect ", but found `+string([]byte{c})) + return + } +} + +type numericMapKeyEncoder struct { + encoder ValEncoder +} + +func (encoder *numericMapKeyEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.writeByte('"') + encoder.encoder.Encode(ptr, stream) + stream.writeByte('"') +} + +func (encoder *numericMapKeyEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return false +} + +type dynamicMapKeyEncoder struct { + ctx *ctx + valType reflect2.Type +} + +func (encoder *dynamicMapKeyEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + obj := encoder.valType.UnsafeIndirect(ptr) + encoderOfMapKey(encoder.ctx, reflect2.TypeOf(obj)).Encode(reflect2.PtrOf(obj), stream) +} + +func (encoder *dynamicMapKeyEncoder) IsEmpty(ptr unsafe.Pointer) bool { + obj := encoder.valType.UnsafeIndirect(ptr) + return encoderOfMapKey(encoder.ctx, reflect2.TypeOf(obj)).IsEmpty(reflect2.PtrOf(obj)) +} + +type mapEncoder struct { + mapType *reflect2.UnsafeMapType + keyEncoder ValEncoder + elemEncoder ValEncoder +} + +func (encoder *mapEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteObjectStart() + iter := encoder.mapType.UnsafeIterate(ptr) + for i := 0; iter.HasNext(); i++ { + if i != 0 { + stream.WriteMore() + } + key, elem := iter.UnsafeNext() + encoder.keyEncoder.Encode(key, stream) + if stream.indention > 0 { + stream.writeTwoBytes(byte(':'), byte(' ')) + } else { + stream.writeByte(':') + } + encoder.elemEncoder.Encode(elem, stream) + } + stream.WriteObjectEnd() +} + +func (encoder *mapEncoder) IsEmpty(ptr unsafe.Pointer) bool { + iter := encoder.mapType.UnsafeIterate(ptr) + return !iter.HasNext() +} + +type sortKeysMapEncoder struct { + mapType *reflect2.UnsafeMapType + keyEncoder ValEncoder + elemEncoder ValEncoder +} + +func (encoder *sortKeysMapEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + if *(*unsafe.Pointer)(ptr) == nil { + stream.WriteNil() + return + } + stream.WriteObjectStart() + mapIter := encoder.mapType.UnsafeIterate(ptr) + subStream := stream.cfg.BorrowStream(nil) + subIter := stream.cfg.BorrowIterator(nil) + keyValues := encodedKeyValues{} + for mapIter.HasNext() { + subStream.buf = make([]byte, 0, 64) + key, elem := mapIter.UnsafeNext() + encoder.keyEncoder.Encode(key, subStream) + if subStream.Error != nil && subStream.Error != io.EOF && stream.Error == nil { + stream.Error = subStream.Error + } + encodedKey := subStream.Buffer() + subIter.ResetBytes(encodedKey) + decodedKey := subIter.ReadString() + if stream.indention > 0 { + subStream.writeTwoBytes(byte(':'), byte(' ')) + } else { + subStream.writeByte(':') + } + encoder.elemEncoder.Encode(elem, subStream) + keyValues = append(keyValues, encodedKV{ + key: decodedKey, + keyValue: subStream.Buffer(), + }) + } + sort.Sort(keyValues) + for i, keyValue := range keyValues { + if i != 0 { + stream.WriteMore() + } + stream.Write(keyValue.keyValue) + } + stream.WriteObjectEnd() + stream.cfg.ReturnStream(subStream) + stream.cfg.ReturnIterator(subIter) +} + +func (encoder *sortKeysMapEncoder) IsEmpty(ptr unsafe.Pointer) bool { + iter := encoder.mapType.UnsafeIterate(ptr) + return !iter.HasNext() +} + +type encodedKeyValues []encodedKV + +type encodedKV struct { + key string + keyValue []byte +} + +func (sv encodedKeyValues) Len() int { return len(sv) } +func (sv encodedKeyValues) Swap(i, j int) { sv[i], sv[j] = sv[j], sv[i] } +func (sv encodedKeyValues) Less(i, j int) bool { return sv[i].key < sv[j].key } diff --git a/vendor/github.com/json-iterator/go/reflect_marshaler.go b/vendor/github.com/json-iterator/go/reflect_marshaler.go new file mode 100644 index 000000000..58ac959ad --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_marshaler.go @@ -0,0 +1,218 @@ +package jsoniter + +import ( + "encoding" + "encoding/json" + "github.com/modern-go/reflect2" + "unsafe" +) + +var marshalerType = reflect2.TypeOfPtr((*json.Marshaler)(nil)).Elem() +var unmarshalerType = reflect2.TypeOfPtr((*json.Unmarshaler)(nil)).Elem() +var textMarshalerType = reflect2.TypeOfPtr((*encoding.TextMarshaler)(nil)).Elem() +var textUnmarshalerType = reflect2.TypeOfPtr((*encoding.TextUnmarshaler)(nil)).Elem() + +func createDecoderOfMarshaler(ctx *ctx, typ reflect2.Type) ValDecoder { + ptrType := reflect2.PtrTo(typ) + if ptrType.Implements(unmarshalerType) { + return &referenceDecoder{ + &unmarshalerDecoder{ptrType}, + } + } + if ptrType.Implements(textUnmarshalerType) { + return &referenceDecoder{ + &textUnmarshalerDecoder{ptrType}, + } + } + return nil +} + +func createEncoderOfMarshaler(ctx *ctx, typ reflect2.Type) ValEncoder { + if typ == marshalerType { + checkIsEmpty := createCheckIsEmpty(ctx, typ) + var encoder ValEncoder = &directMarshalerEncoder{ + checkIsEmpty: checkIsEmpty, + } + return encoder + } + if typ.Implements(marshalerType) { + checkIsEmpty := createCheckIsEmpty(ctx, typ) + var encoder ValEncoder = &marshalerEncoder{ + valType: typ, + checkIsEmpty: checkIsEmpty, + } + return encoder + } + ptrType := reflect2.PtrTo(typ) + if ctx.prefix != "" && ptrType.Implements(marshalerType) { + checkIsEmpty := createCheckIsEmpty(ctx, ptrType) + var encoder ValEncoder = &marshalerEncoder{ + valType: ptrType, + checkIsEmpty: checkIsEmpty, + } + return &referenceEncoder{encoder} + } + if typ == textMarshalerType { + checkIsEmpty := createCheckIsEmpty(ctx, typ) + var encoder ValEncoder = &directTextMarshalerEncoder{ + checkIsEmpty: checkIsEmpty, + stringEncoder: ctx.EncoderOf(reflect2.TypeOf("")), + } + return encoder + } + if typ.Implements(textMarshalerType) { + checkIsEmpty := createCheckIsEmpty(ctx, typ) + var encoder ValEncoder = &textMarshalerEncoder{ + valType: typ, + stringEncoder: ctx.EncoderOf(reflect2.TypeOf("")), + checkIsEmpty: checkIsEmpty, + } + return encoder + } + // if prefix is empty, the type is the root type + if ctx.prefix != "" && ptrType.Implements(textMarshalerType) { + checkIsEmpty := createCheckIsEmpty(ctx, ptrType) + var encoder ValEncoder = &textMarshalerEncoder{ + valType: ptrType, + stringEncoder: ctx.EncoderOf(reflect2.TypeOf("")), + checkIsEmpty: checkIsEmpty, + } + return &referenceEncoder{encoder} + } + return nil +} + +type marshalerEncoder struct { + checkIsEmpty checkIsEmpty + valType reflect2.Type +} + +func (encoder *marshalerEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + obj := encoder.valType.UnsafeIndirect(ptr) + if encoder.valType.IsNullable() && reflect2.IsNil(obj) { + stream.WriteNil() + return + } + marshaler := obj.(json.Marshaler) + bytes, err := marshaler.MarshalJSON() + if err != nil { + stream.Error = err + } else { + stream.Write(bytes) + } +} + +func (encoder *marshalerEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.checkIsEmpty.IsEmpty(ptr) +} + +type directMarshalerEncoder struct { + checkIsEmpty checkIsEmpty +} + +func (encoder *directMarshalerEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + marshaler := *(*json.Marshaler)(ptr) + if marshaler == nil { + stream.WriteNil() + return + } + bytes, err := marshaler.MarshalJSON() + if err != nil { + stream.Error = err + } else { + stream.Write(bytes) + } +} + +func (encoder *directMarshalerEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.checkIsEmpty.IsEmpty(ptr) +} + +type textMarshalerEncoder struct { + valType reflect2.Type + stringEncoder ValEncoder + checkIsEmpty checkIsEmpty +} + +func (encoder *textMarshalerEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + obj := encoder.valType.UnsafeIndirect(ptr) + if encoder.valType.IsNullable() && reflect2.IsNil(obj) { + stream.WriteNil() + return + } + marshaler := (obj).(encoding.TextMarshaler) + bytes, err := marshaler.MarshalText() + if err != nil { + stream.Error = err + } else { + str := string(bytes) + encoder.stringEncoder.Encode(unsafe.Pointer(&str), stream) + } +} + +func (encoder *textMarshalerEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.checkIsEmpty.IsEmpty(ptr) +} + +type directTextMarshalerEncoder struct { + stringEncoder ValEncoder + checkIsEmpty checkIsEmpty +} + +func (encoder *directTextMarshalerEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + marshaler := *(*encoding.TextMarshaler)(ptr) + if marshaler == nil { + stream.WriteNil() + return + } + bytes, err := marshaler.MarshalText() + if err != nil { + stream.Error = err + } else { + str := string(bytes) + encoder.stringEncoder.Encode(unsafe.Pointer(&str), stream) + } +} + +func (encoder *directTextMarshalerEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.checkIsEmpty.IsEmpty(ptr) +} + +type unmarshalerDecoder struct { + valType reflect2.Type +} + +func (decoder *unmarshalerDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + valType := decoder.valType + obj := valType.UnsafeIndirect(ptr) + unmarshaler := obj.(json.Unmarshaler) + iter.nextToken() + iter.unreadByte() // skip spaces + bytes := iter.SkipAndReturnBytes() + err := unmarshaler.UnmarshalJSON(bytes) + if err != nil { + iter.ReportError("unmarshalerDecoder", err.Error()) + } +} + +type textUnmarshalerDecoder struct { + valType reflect2.Type +} + +func (decoder *textUnmarshalerDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + valType := decoder.valType + obj := valType.UnsafeIndirect(ptr) + if reflect2.IsNil(obj) { + ptrType := valType.(*reflect2.UnsafePtrType) + elemType := ptrType.Elem() + elem := elemType.UnsafeNew() + ptrType.UnsafeSet(ptr, unsafe.Pointer(&elem)) + obj = valType.UnsafeIndirect(ptr) + } + unmarshaler := (obj).(encoding.TextUnmarshaler) + str := iter.ReadString() + err := unmarshaler.UnmarshalText([]byte(str)) + if err != nil { + iter.ReportError("textUnmarshalerDecoder", err.Error()) + } +} diff --git a/vendor/github.com/json-iterator/go/reflect_native.go b/vendor/github.com/json-iterator/go/reflect_native.go new file mode 100644 index 000000000..9042eb0cb --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_native.go @@ -0,0 +1,451 @@ +package jsoniter + +import ( + "encoding/base64" + "reflect" + "strconv" + "unsafe" + + "github.com/modern-go/reflect2" +) + +const ptrSize = 32 << uintptr(^uintptr(0)>>63) + +func createEncoderOfNative(ctx *ctx, typ reflect2.Type) ValEncoder { + if typ.Kind() == reflect.Slice && typ.(reflect2.SliceType).Elem().Kind() == reflect.Uint8 { + sliceDecoder := decoderOfSlice(ctx, typ) + return &base64Codec{sliceDecoder: sliceDecoder} + } + typeName := typ.String() + kind := typ.Kind() + switch kind { + case reflect.String: + if typeName != "string" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*string)(nil)).Elem()) + } + return &stringCodec{} + case reflect.Int: + if typeName != "int" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*int)(nil)).Elem()) + } + if strconv.IntSize == 32 { + return &int32Codec{} + } + return &int64Codec{} + case reflect.Int8: + if typeName != "int8" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*int8)(nil)).Elem()) + } + return &int8Codec{} + case reflect.Int16: + if typeName != "int16" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*int16)(nil)).Elem()) + } + return &int16Codec{} + case reflect.Int32: + if typeName != "int32" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*int32)(nil)).Elem()) + } + return &int32Codec{} + case reflect.Int64: + if typeName != "int64" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*int64)(nil)).Elem()) + } + return &int64Codec{} + case reflect.Uint: + if typeName != "uint" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*uint)(nil)).Elem()) + } + if strconv.IntSize == 32 { + return &uint32Codec{} + } + return &uint64Codec{} + case reflect.Uint8: + if typeName != "uint8" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*uint8)(nil)).Elem()) + } + return &uint8Codec{} + case reflect.Uint16: + if typeName != "uint16" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*uint16)(nil)).Elem()) + } + return &uint16Codec{} + case reflect.Uint32: + if typeName != "uint32" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*uint32)(nil)).Elem()) + } + return &uint32Codec{} + case reflect.Uintptr: + if typeName != "uintptr" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*uintptr)(nil)).Elem()) + } + if ptrSize == 32 { + return &uint32Codec{} + } + return &uint64Codec{} + case reflect.Uint64: + if typeName != "uint64" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*uint64)(nil)).Elem()) + } + return &uint64Codec{} + case reflect.Float32: + if typeName != "float32" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*float32)(nil)).Elem()) + } + return &float32Codec{} + case reflect.Float64: + if typeName != "float64" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*float64)(nil)).Elem()) + } + return &float64Codec{} + case reflect.Bool: + if typeName != "bool" { + return encoderOfType(ctx, reflect2.TypeOfPtr((*bool)(nil)).Elem()) + } + return &boolCodec{} + } + return nil +} + +func createDecoderOfNative(ctx *ctx, typ reflect2.Type) ValDecoder { + if typ.Kind() == reflect.Slice && typ.(reflect2.SliceType).Elem().Kind() == reflect.Uint8 { + sliceDecoder := decoderOfSlice(ctx, typ) + return &base64Codec{sliceDecoder: sliceDecoder} + } + typeName := typ.String() + switch typ.Kind() { + case reflect.String: + if typeName != "string" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*string)(nil)).Elem()) + } + return &stringCodec{} + case reflect.Int: + if typeName != "int" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*int)(nil)).Elem()) + } + if strconv.IntSize == 32 { + return &int32Codec{} + } + return &int64Codec{} + case reflect.Int8: + if typeName != "int8" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*int8)(nil)).Elem()) + } + return &int8Codec{} + case reflect.Int16: + if typeName != "int16" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*int16)(nil)).Elem()) + } + return &int16Codec{} + case reflect.Int32: + if typeName != "int32" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*int32)(nil)).Elem()) + } + return &int32Codec{} + case reflect.Int64: + if typeName != "int64" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*int64)(nil)).Elem()) + } + return &int64Codec{} + case reflect.Uint: + if typeName != "uint" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*uint)(nil)).Elem()) + } + if strconv.IntSize == 32 { + return &uint32Codec{} + } + return &uint64Codec{} + case reflect.Uint8: + if typeName != "uint8" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*uint8)(nil)).Elem()) + } + return &uint8Codec{} + case reflect.Uint16: + if typeName != "uint16" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*uint16)(nil)).Elem()) + } + return &uint16Codec{} + case reflect.Uint32: + if typeName != "uint32" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*uint32)(nil)).Elem()) + } + return &uint32Codec{} + case reflect.Uintptr: + if typeName != "uintptr" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*uintptr)(nil)).Elem()) + } + if ptrSize == 32 { + return &uint32Codec{} + } + return &uint64Codec{} + case reflect.Uint64: + if typeName != "uint64" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*uint64)(nil)).Elem()) + } + return &uint64Codec{} + case reflect.Float32: + if typeName != "float32" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*float32)(nil)).Elem()) + } + return &float32Codec{} + case reflect.Float64: + if typeName != "float64" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*float64)(nil)).Elem()) + } + return &float64Codec{} + case reflect.Bool: + if typeName != "bool" { + return decoderOfType(ctx, reflect2.TypeOfPtr((*bool)(nil)).Elem()) + } + return &boolCodec{} + } + return nil +} + +type stringCodec struct { +} + +func (codec *stringCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + *((*string)(ptr)) = iter.ReadString() +} + +func (codec *stringCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + str := *((*string)(ptr)) + stream.WriteString(str) +} + +func (codec *stringCodec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*string)(ptr)) == "" +} + +type int8Codec struct { +} + +func (codec *int8Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*int8)(ptr)) = iter.ReadInt8() + } +} + +func (codec *int8Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteInt8(*((*int8)(ptr))) +} + +func (codec *int8Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*int8)(ptr)) == 0 +} + +type int16Codec struct { +} + +func (codec *int16Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*int16)(ptr)) = iter.ReadInt16() + } +} + +func (codec *int16Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteInt16(*((*int16)(ptr))) +} + +func (codec *int16Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*int16)(ptr)) == 0 +} + +type int32Codec struct { +} + +func (codec *int32Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*int32)(ptr)) = iter.ReadInt32() + } +} + +func (codec *int32Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteInt32(*((*int32)(ptr))) +} + +func (codec *int32Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*int32)(ptr)) == 0 +} + +type int64Codec struct { +} + +func (codec *int64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*int64)(ptr)) = iter.ReadInt64() + } +} + +func (codec *int64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteInt64(*((*int64)(ptr))) +} + +func (codec *int64Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*int64)(ptr)) == 0 +} + +type uint8Codec struct { +} + +func (codec *uint8Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*uint8)(ptr)) = iter.ReadUint8() + } +} + +func (codec *uint8Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteUint8(*((*uint8)(ptr))) +} + +func (codec *uint8Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*uint8)(ptr)) == 0 +} + +type uint16Codec struct { +} + +func (codec *uint16Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*uint16)(ptr)) = iter.ReadUint16() + } +} + +func (codec *uint16Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteUint16(*((*uint16)(ptr))) +} + +func (codec *uint16Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*uint16)(ptr)) == 0 +} + +type uint32Codec struct { +} + +func (codec *uint32Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*uint32)(ptr)) = iter.ReadUint32() + } +} + +func (codec *uint32Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteUint32(*((*uint32)(ptr))) +} + +func (codec *uint32Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*uint32)(ptr)) == 0 +} + +type uint64Codec struct { +} + +func (codec *uint64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*uint64)(ptr)) = iter.ReadUint64() + } +} + +func (codec *uint64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteUint64(*((*uint64)(ptr))) +} + +func (codec *uint64Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*uint64)(ptr)) == 0 +} + +type float32Codec struct { +} + +func (codec *float32Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*float32)(ptr)) = iter.ReadFloat32() + } +} + +func (codec *float32Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteFloat32(*((*float32)(ptr))) +} + +func (codec *float32Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*float32)(ptr)) == 0 +} + +type float64Codec struct { +} + +func (codec *float64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*float64)(ptr)) = iter.ReadFloat64() + } +} + +func (codec *float64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteFloat64(*((*float64)(ptr))) +} + +func (codec *float64Codec) IsEmpty(ptr unsafe.Pointer) bool { + return *((*float64)(ptr)) == 0 +} + +type boolCodec struct { +} + +func (codec *boolCodec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if !iter.ReadNil() { + *((*bool)(ptr)) = iter.ReadBool() + } +} + +func (codec *boolCodec) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.WriteBool(*((*bool)(ptr))) +} + +func (codec *boolCodec) IsEmpty(ptr unsafe.Pointer) bool { + return !(*((*bool)(ptr))) +} + +type base64Codec struct { + sliceType *reflect2.UnsafeSliceType + sliceDecoder ValDecoder +} + +func (codec *base64Codec) Decode(ptr unsafe.Pointer, iter *Iterator) { + if iter.ReadNil() { + codec.sliceType.UnsafeSetNil(ptr) + return + } + switch iter.WhatIsNext() { + case StringValue: + src := iter.ReadString() + dst, err := base64.StdEncoding.DecodeString(src) + if err != nil { + iter.ReportError("decode base64", err.Error()) + } else { + codec.sliceType.UnsafeSet(ptr, unsafe.Pointer(&dst)) + } + case ArrayValue: + codec.sliceDecoder.Decode(ptr, iter) + default: + iter.ReportError("base64Codec", "invalid input") + } +} + +func (codec *base64Codec) Encode(ptr unsafe.Pointer, stream *Stream) { + src := *((*[]byte)(ptr)) + if len(src) == 0 { + stream.WriteNil() + return + } + encoding := base64.StdEncoding + stream.writeByte('"') + size := encoding.EncodedLen(len(src)) + buf := make([]byte, size) + encoding.Encode(buf, src) + stream.buf = append(stream.buf, buf...) + stream.writeByte('"') +} + +func (codec *base64Codec) IsEmpty(ptr unsafe.Pointer) bool { + return len(*((*[]byte)(ptr))) == 0 +} diff --git a/vendor/github.com/json-iterator/go/reflect_optional.go b/vendor/github.com/json-iterator/go/reflect_optional.go new file mode 100644 index 000000000..43ec71d6d --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_optional.go @@ -0,0 +1,133 @@ +package jsoniter + +import ( + "github.com/modern-go/reflect2" + "reflect" + "unsafe" +) + +func decoderOfOptional(ctx *ctx, typ reflect2.Type) ValDecoder { + ptrType := typ.(*reflect2.UnsafePtrType) + elemType := ptrType.Elem() + decoder := decoderOfType(ctx, elemType) + if ctx.prefix == "" && elemType.Kind() == reflect.Ptr { + return &dereferenceDecoder{elemType, decoder} + } + return &OptionalDecoder{elemType, decoder} +} + +func encoderOfOptional(ctx *ctx, typ reflect2.Type) ValEncoder { + ptrType := typ.(*reflect2.UnsafePtrType) + elemType := ptrType.Elem() + elemEncoder := encoderOfType(ctx, elemType) + encoder := &OptionalEncoder{elemEncoder} + return encoder +} + +type OptionalDecoder struct { + ValueType reflect2.Type + ValueDecoder ValDecoder +} + +func (decoder *OptionalDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + if iter.ReadNil() { + *((*unsafe.Pointer)(ptr)) = nil + } else { + if *((*unsafe.Pointer)(ptr)) == nil { + //pointer to null, we have to allocate memory to hold the value + newPtr := decoder.ValueType.UnsafeNew() + decoder.ValueDecoder.Decode(newPtr, iter) + *((*unsafe.Pointer)(ptr)) = newPtr + } else { + //reuse existing instance + decoder.ValueDecoder.Decode(*((*unsafe.Pointer)(ptr)), iter) + } + } +} + +type dereferenceDecoder struct { + // only to deference a pointer + valueType reflect2.Type + valueDecoder ValDecoder +} + +func (decoder *dereferenceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + if *((*unsafe.Pointer)(ptr)) == nil { + //pointer to null, we have to allocate memory to hold the value + newPtr := decoder.valueType.UnsafeNew() + decoder.valueDecoder.Decode(newPtr, iter) + *((*unsafe.Pointer)(ptr)) = newPtr + } else { + //reuse existing instance + decoder.valueDecoder.Decode(*((*unsafe.Pointer)(ptr)), iter) + } +} + +type OptionalEncoder struct { + ValueEncoder ValEncoder +} + +func (encoder *OptionalEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + if *((*unsafe.Pointer)(ptr)) == nil { + stream.WriteNil() + } else { + encoder.ValueEncoder.Encode(*((*unsafe.Pointer)(ptr)), stream) + } +} + +func (encoder *OptionalEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return *((*unsafe.Pointer)(ptr)) == nil +} + +type dereferenceEncoder struct { + ValueEncoder ValEncoder +} + +func (encoder *dereferenceEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + if *((*unsafe.Pointer)(ptr)) == nil { + stream.WriteNil() + } else { + encoder.ValueEncoder.Encode(*((*unsafe.Pointer)(ptr)), stream) + } +} + +func (encoder *dereferenceEncoder) IsEmpty(ptr unsafe.Pointer) bool { + dePtr := *((*unsafe.Pointer)(ptr)) + if dePtr == nil { + return true + } + return encoder.ValueEncoder.IsEmpty(dePtr) +} + +func (encoder *dereferenceEncoder) IsEmbeddedPtrNil(ptr unsafe.Pointer) bool { + deReferenced := *((*unsafe.Pointer)(ptr)) + if deReferenced == nil { + return true + } + isEmbeddedPtrNil, converted := encoder.ValueEncoder.(IsEmbeddedPtrNil) + if !converted { + return false + } + fieldPtr := unsafe.Pointer(deReferenced) + return isEmbeddedPtrNil.IsEmbeddedPtrNil(fieldPtr) +} + +type referenceEncoder struct { + encoder ValEncoder +} + +func (encoder *referenceEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + encoder.encoder.Encode(unsafe.Pointer(&ptr), stream) +} + +func (encoder *referenceEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.encoder.IsEmpty(unsafe.Pointer(&ptr)) +} + +type referenceDecoder struct { + decoder ValDecoder +} + +func (decoder *referenceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + decoder.decoder.Decode(unsafe.Pointer(&ptr), iter) +} diff --git a/vendor/github.com/json-iterator/go/reflect_slice.go b/vendor/github.com/json-iterator/go/reflect_slice.go new file mode 100644 index 000000000..9441d79df --- /dev/null +++ b/vendor/github.com/json-iterator/go/reflect_slice.go @@ -0,0 +1,99 @@ +package jsoniter + +import ( + "fmt" + "github.com/modern-go/reflect2" + "io" + "unsafe" +) + +func decoderOfSlice(ctx *ctx, typ reflect2.Type) ValDecoder { + sliceType := typ.(*reflect2.UnsafeSliceType) + decoder := decoderOfType(ctx.append("[sliceElem]"), sliceType.Elem()) + return &sliceDecoder{sliceType, decoder} +} + +func encoderOfSlice(ctx *ctx, typ reflect2.Type) ValEncoder { + sliceType := typ.(*reflect2.UnsafeSliceType) + encoder := encoderOfType(ctx.append("[sliceElem]"), sliceType.Elem()) + return &sliceEncoder{sliceType, encoder} +} + +type sliceEncoder struct { + sliceType *reflect2.UnsafeSliceType + elemEncoder ValEncoder +} + +func (encoder *sliceEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + if encoder.sliceType.UnsafeIsNil(ptr) { + stream.WriteNil() + return + } + length := encoder.sliceType.UnsafeLengthOf(ptr) + if length == 0 { + stream.WriteEmptyArray() + return + } + stream.WriteArrayStart() + encoder.elemEncoder.Encode(encoder.sliceType.UnsafeGetIndex(ptr, 0), stream) + for i := 1; i < length; i++ { + stream.WriteMore() + elemPtr := encoder.sliceType.UnsafeGetIndex(ptr, i) + encoder.elemEncoder.Encode(elemPtr, stream) + } + stream.WriteArrayEnd() + if stream.Error != nil && stream.Error != io.EOF { + stream.Error = fmt.Errorf("%v: %s", encoder.sliceType, stream.Error.Error()) + } +} + +func (encoder *sliceEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.sliceType.UnsafeLengthOf(ptr) == 0 +} + +type sliceDecoder struct { + sliceType *reflect2.UnsafeSliceType + elemDecoder ValDecoder +} + +func (decoder *sliceDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + decoder.doDecode(ptr, iter) + if iter.Error != nil && iter.Error != io.EOF { + iter.Error = fmt.Errorf("%v: %s", decoder.sliceType, iter.Error.Error()) + } +} + +func (decoder *sliceDecoder) doDecode(ptr unsafe.Pointer, iter *Iterator) { + c := iter.nextToken() + sliceType := decoder.sliceType + if c == 'n' { + iter.skipThreeBytes('u', 'l', 'l') + sliceType.UnsafeSetNil(ptr) + return + } + if c != '[' { + iter.ReportError("decode slice", "expect [ or n, but found "+string([]byte{c})) + return + } + c = iter.nextToken() + if c == ']' { + sliceType.UnsafeSet(ptr, sliceType.UnsafeMakeSlice(0, 0)) + return + } + iter.unreadByte() + sliceType.UnsafeGrow(ptr, 1) + elemPtr := sliceType.UnsafeGetIndex(ptr, 0) + decoder.elemDecoder.Decode(elemPtr, iter) + length := 1 + for c = iter.nextToken(); c == ','; c = iter.nextToken() { + idx := length + length += 1 + sliceType.UnsafeGrow(ptr, length) + elemPtr = sliceType.UnsafeGetIndex(ptr, idx) + decoder.elemDecoder.Decode(elemPtr, iter) + } + if c != ']' { + iter.ReportError("decode slice", "expect ], but found "+string([]byte{c})) + return + } +} diff --git a/vendor/github.com/json-iterator/go/feature_reflect_struct_decoder.go b/vendor/github.com/json-iterator/go/reflect_struct_decoder.go index b3417fd73..355d2d116 100644 --- a/vendor/github.com/json-iterator/go/feature_reflect_struct_decoder.go +++ b/vendor/github.com/json-iterator/go/reflect_struct_decoder.go @@ -3,38 +3,78 @@ package jsoniter import ( "fmt" "io" - "reflect" "strings" "unsafe" + + "github.com/modern-go/reflect2" ) -func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder) (ValDecoder, error) { - knownHash := map[int32]struct{}{ +func decoderOfStruct(ctx *ctx, typ reflect2.Type) ValDecoder { + bindings := map[string]*Binding{} + structDescriptor := describeStruct(ctx, typ) + for _, binding := range structDescriptor.Fields { + for _, fromName := range binding.FromNames { + old := bindings[fromName] + if old == nil { + bindings[fromName] = binding + continue + } + ignoreOld, ignoreNew := resolveConflictBinding(ctx.frozenConfig, old, binding) + if ignoreOld { + delete(bindings, fromName) + } + if !ignoreNew { + bindings[fromName] = binding + } + } + } + fields := map[string]*structFieldDecoder{} + for k, binding := range bindings { + fields[k] = binding.Decoder.(*structFieldDecoder) + } + + if !ctx.caseSensitive() { + for k, binding := range bindings { + if _, found := fields[strings.ToLower(k)]; !found { + fields[strings.ToLower(k)] = binding.Decoder.(*structFieldDecoder) + } + } + } + + return createStructDecoder(ctx, typ, fields) +} + +func createStructDecoder(ctx *ctx, typ reflect2.Type, fields map[string]*structFieldDecoder) ValDecoder { + if ctx.disallowUnknownFields { + return &generalStructDecoder{typ: typ, fields: fields, disallowUnknownFields: true} + } + knownHash := map[int64]struct{}{ 0: {}, } + switch len(fields) { case 0: - return &skipObjectDecoder{typ}, nil + return &skipObjectDecoder{typ} case 1: for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} - return &oneFieldStructDecoder{typ, fieldHash, fieldDecoder}, nil + return &oneFieldStructDecoder{typ, fieldHash, fieldDecoder} } case 2: - var fieldHash1 int32 - var fieldHash2 int32 + var fieldHash1 int64 + var fieldHash2 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldHash1 == 0 { @@ -45,19 +85,19 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder fieldDecoder2 = fieldDecoder } } - return &twoFieldsStructDecoder{typ, fieldHash1, fieldDecoder1, fieldHash2, fieldDecoder2}, nil + return &twoFieldsStructDecoder{typ, fieldHash1, fieldDecoder1, fieldHash2, fieldDecoder2} case 3: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -72,21 +112,23 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &threeFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3} case 4: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder var fieldDecoder4 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -104,24 +146,26 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &fourFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4} case 5: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 - var fieldName5 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 + var fieldName5 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder var fieldDecoder4 *structFieldDecoder var fieldDecoder5 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -142,15 +186,18 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &fiveFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4, fieldName5, fieldDecoder5}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4, + fieldName5, fieldDecoder5} case 6: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 - var fieldName5 int32 - var fieldName6 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 + var fieldName5 int64 + var fieldName6 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder @@ -158,10 +205,10 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder var fieldDecoder5 *structFieldDecoder var fieldDecoder6 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -185,16 +232,20 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &sixFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4, fieldName5, fieldDecoder5, fieldName6, fieldDecoder6}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4, + fieldName5, fieldDecoder5, + fieldName6, fieldDecoder6} case 7: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 - var fieldName5 int32 - var fieldName6 int32 - var fieldName7 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 + var fieldName5 int64 + var fieldName6 int64 + var fieldName7 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder @@ -203,10 +254,10 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder var fieldDecoder6 *structFieldDecoder var fieldDecoder7 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -233,18 +284,22 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &sevenFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4, fieldName5, fieldDecoder5, fieldName6, fieldDecoder6, - fieldName7, fieldDecoder7}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4, + fieldName5, fieldDecoder5, + fieldName6, fieldDecoder6, + fieldName7, fieldDecoder7} case 8: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 - var fieldName5 int32 - var fieldName6 int32 - var fieldName7 int32 - var fieldName8 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 + var fieldName5 int64 + var fieldName6 int64 + var fieldName7 int64 + var fieldName8 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder @@ -254,10 +309,10 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder var fieldDecoder7 *structFieldDecoder var fieldDecoder8 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -287,19 +342,24 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &eightFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4, fieldName5, fieldDecoder5, fieldName6, fieldDecoder6, - fieldName7, fieldDecoder7, fieldName8, fieldDecoder8}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4, + fieldName5, fieldDecoder5, + fieldName6, fieldDecoder6, + fieldName7, fieldDecoder7, + fieldName8, fieldDecoder8} case 9: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 - var fieldName5 int32 - var fieldName6 int32 - var fieldName7 int32 - var fieldName8 int32 - var fieldName9 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 + var fieldName5 int64 + var fieldName6 int64 + var fieldName7 int64 + var fieldName8 int64 + var fieldName9 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder @@ -310,10 +370,10 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder var fieldDecoder8 *structFieldDecoder var fieldDecoder9 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -346,20 +406,26 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &nineFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4, fieldName5, fieldDecoder5, fieldName6, fieldDecoder6, - fieldName7, fieldDecoder7, fieldName8, fieldDecoder8, fieldName9, fieldDecoder9}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4, + fieldName5, fieldDecoder5, + fieldName6, fieldDecoder6, + fieldName7, fieldDecoder7, + fieldName8, fieldDecoder8, + fieldName9, fieldDecoder9} case 10: - var fieldName1 int32 - var fieldName2 int32 - var fieldName3 int32 - var fieldName4 int32 - var fieldName5 int32 - var fieldName6 int32 - var fieldName7 int32 - var fieldName8 int32 - var fieldName9 int32 - var fieldName10 int32 + var fieldName1 int64 + var fieldName2 int64 + var fieldName3 int64 + var fieldName4 int64 + var fieldName5 int64 + var fieldName6 int64 + var fieldName7 int64 + var fieldName8 int64 + var fieldName9 int64 + var fieldName10 int64 var fieldDecoder1 *structFieldDecoder var fieldDecoder2 *structFieldDecoder var fieldDecoder3 *structFieldDecoder @@ -371,10 +437,10 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder var fieldDecoder9 *structFieldDecoder var fieldDecoder10 *structFieldDecoder for fieldName, fieldDecoder := range fields { - fieldHash := calcHash(fieldName) + fieldHash := calcHash(fieldName, ctx.caseSensitive()) _, known := knownHash[fieldHash] if known { - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } knownHash[fieldHash] = struct{}{} if fieldName1 == 0 { @@ -410,48 +476,80 @@ func createStructDecoder(typ reflect.Type, fields map[string]*structFieldDecoder } } return &tenFieldsStructDecoder{typ, - fieldName1, fieldDecoder1, fieldName2, fieldDecoder2, fieldName3, fieldDecoder3, - fieldName4, fieldDecoder4, fieldName5, fieldDecoder5, fieldName6, fieldDecoder6, - fieldName7, fieldDecoder7, fieldName8, fieldDecoder8, fieldName9, fieldDecoder9, - fieldName10, fieldDecoder10}, nil + fieldName1, fieldDecoder1, + fieldName2, fieldDecoder2, + fieldName3, fieldDecoder3, + fieldName4, fieldDecoder4, + fieldName5, fieldDecoder5, + fieldName6, fieldDecoder6, + fieldName7, fieldDecoder7, + fieldName8, fieldDecoder8, + fieldName9, fieldDecoder9, + fieldName10, fieldDecoder10} } - return &generalStructDecoder{typ, fields}, nil + return &generalStructDecoder{typ, fields, false} } type generalStructDecoder struct { - typ reflect.Type - fields map[string]*structFieldDecoder + typ reflect2.Type + fields map[string]*structFieldDecoder + disallowUnknownFields bool } func (decoder *generalStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { if !iter.readObjectStart() { return } - fieldBytes := iter.readObjectFieldAsBytes() - field := *(*string)(unsafe.Pointer(&fieldBytes)) - fieldDecoder := decoder.fields[strings.ToLower(field)] - if fieldDecoder == nil { - iter.Skip() - } else { - fieldDecoder.Decode(ptr, iter) + var c byte + for c = ','; c == ','; c = iter.nextToken() { + decoder.decodeOneField(ptr, iter) } - for iter.nextToken() == ',' { - fieldBytes = iter.readObjectFieldAsBytes() + if iter.Error != nil && iter.Error != io.EOF { + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) + } + if c != '}' { + iter.ReportError("struct Decode", `expect }, but found `+string([]byte{c})) + } +} + +func (decoder *generalStructDecoder) decodeOneField(ptr unsafe.Pointer, iter *Iterator) { + var field string + var fieldDecoder *structFieldDecoder + if iter.cfg.objectFieldMustBeSimpleString { + fieldBytes := iter.ReadStringAsSlice() field = *(*string)(unsafe.Pointer(&fieldBytes)) - fieldDecoder = decoder.fields[strings.ToLower(field)] - if fieldDecoder == nil { - iter.Skip() - } else { - fieldDecoder.Decode(ptr, iter) + fieldDecoder = decoder.fields[field] + if fieldDecoder == nil && !iter.cfg.caseSensitive { + fieldDecoder = decoder.fields[strings.ToLower(field)] + } + } else { + field = iter.ReadString() + fieldDecoder = decoder.fields[field] + if fieldDecoder == nil && !iter.cfg.caseSensitive { + fieldDecoder = decoder.fields[strings.ToLower(field)] } } - if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + if fieldDecoder == nil { + msg := "found unknown field: " + field + if decoder.disallowUnknownFields { + iter.ReportError("ReadObject", msg) + } + c := iter.nextToken() + if c != ':' { + iter.ReportError("ReadObject", "expect : after object field, but found "+string([]byte{c})) + } + iter.Skip() + return } + c := iter.nextToken() + if c != ':' { + iter.ReportError("ReadObject", "expect : after object field, but found "+string([]byte{c})) + } + fieldDecoder.Decode(ptr, iter) } type skipObjectDecoder struct { - typ reflect.Type + typ reflect2.Type } func (decoder *skipObjectDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { @@ -464,8 +562,8 @@ func (decoder *skipObjectDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { } type oneFieldStructDecoder struct { - typ reflect.Type - fieldHash int32 + typ reflect2.Type + fieldHash int64 fieldDecoder *structFieldDecoder } @@ -484,15 +582,15 @@ func (decoder *oneFieldStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type twoFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder } @@ -514,17 +612,17 @@ func (decoder *twoFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterator } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type threeFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder } @@ -548,19 +646,19 @@ func (decoder *threeFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterat } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type fourFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder } @@ -586,21 +684,21 @@ func (decoder *fourFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterato } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type fiveFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder - fieldHash5 int32 + fieldHash5 int64 fieldDecoder5 *structFieldDecoder } @@ -628,23 +726,23 @@ func (decoder *fiveFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterato } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type sixFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder - fieldHash5 int32 + fieldHash5 int64 fieldDecoder5 *structFieldDecoder - fieldHash6 int32 + fieldHash6 int64 fieldDecoder6 *structFieldDecoder } @@ -674,25 +772,25 @@ func (decoder *sixFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterator } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type sevenFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder - fieldHash5 int32 + fieldHash5 int64 fieldDecoder5 *structFieldDecoder - fieldHash6 int32 + fieldHash6 int64 fieldDecoder6 *structFieldDecoder - fieldHash7 int32 + fieldHash7 int64 fieldDecoder7 *structFieldDecoder } @@ -724,27 +822,27 @@ func (decoder *sevenFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterat } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type eightFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder - fieldHash5 int32 + fieldHash5 int64 fieldDecoder5 *structFieldDecoder - fieldHash6 int32 + fieldHash6 int64 fieldDecoder6 *structFieldDecoder - fieldHash7 int32 + fieldHash7 int64 fieldDecoder7 *structFieldDecoder - fieldHash8 int32 + fieldHash8 int64 fieldDecoder8 *structFieldDecoder } @@ -778,29 +876,29 @@ func (decoder *eightFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterat } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type nineFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder - fieldHash5 int32 + fieldHash5 int64 fieldDecoder5 *structFieldDecoder - fieldHash6 int32 + fieldHash6 int64 fieldDecoder6 *structFieldDecoder - fieldHash7 int32 + fieldHash7 int64 fieldDecoder7 *structFieldDecoder - fieldHash8 int32 + fieldHash8 int64 fieldDecoder8 *structFieldDecoder - fieldHash9 int32 + fieldHash9 int64 fieldDecoder9 *structFieldDecoder } @@ -836,31 +934,31 @@ func (decoder *nineFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterato } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type tenFieldsStructDecoder struct { - typ reflect.Type - fieldHash1 int32 + typ reflect2.Type + fieldHash1 int64 fieldDecoder1 *structFieldDecoder - fieldHash2 int32 + fieldHash2 int64 fieldDecoder2 *structFieldDecoder - fieldHash3 int32 + fieldHash3 int64 fieldDecoder3 *structFieldDecoder - fieldHash4 int32 + fieldHash4 int64 fieldDecoder4 *structFieldDecoder - fieldHash5 int32 + fieldHash5 int64 fieldDecoder5 *structFieldDecoder - fieldHash6 int32 + fieldHash6 int64 fieldDecoder6 *structFieldDecoder - fieldHash7 int32 + fieldHash7 int64 fieldDecoder7 *structFieldDecoder - fieldHash8 int32 + fieldHash8 int64 fieldDecoder8 *structFieldDecoder - fieldHash9 int32 + fieldHash9 int64 fieldDecoder9 *structFieldDecoder - fieldHash10 int32 + fieldHash10 int64 fieldDecoder10 *structFieldDecoder } @@ -898,19 +996,53 @@ func (decoder *tenFieldsStructDecoder) Decode(ptr unsafe.Pointer, iter *Iterator } } if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%v: %s", decoder.typ, iter.Error.Error()) + iter.Error = fmt.Errorf("%v.%s", decoder.typ, iter.Error.Error()) } } type structFieldDecoder struct { - field *reflect.StructField + field reflect2.StructField fieldDecoder ValDecoder } func (decoder *structFieldDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { - fieldPtr := unsafe.Pointer(uintptr(ptr) + decoder.field.Offset) + fieldPtr := decoder.field.UnsafeGet(ptr) decoder.fieldDecoder.Decode(fieldPtr, iter) if iter.Error != nil && iter.Error != io.EOF { - iter.Error = fmt.Errorf("%s: %s", decoder.field.Name, iter.Error.Error()) + iter.Error = fmt.Errorf("%s: %s", decoder.field.Name(), iter.Error.Error()) + } +} + +type stringModeStringDecoder struct { + elemDecoder ValDecoder + cfg *frozenConfig +} + +func (decoder *stringModeStringDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + decoder.elemDecoder.Decode(ptr, iter) + str := *((*string)(ptr)) + tempIter := decoder.cfg.BorrowIterator([]byte(str)) + defer decoder.cfg.ReturnIterator(tempIter) + *((*string)(ptr)) = tempIter.ReadString() +} + +type stringModeNumberDecoder struct { + elemDecoder ValDecoder +} + +func (decoder *stringModeNumberDecoder) Decode(ptr unsafe.Pointer, iter *Iterator) { + c := iter.nextToken() + if c != '"' { + iter.ReportError("stringModeNumberDecoder", `expect ", but found `+string([]byte{c})) + return + } + decoder.elemDecoder.Decode(ptr, iter) + if iter.Error != nil { + return + } + c = iter.readByte() + if c != '"' { + iter.ReportError("stringModeNumberDecoder", `expect ", but found `+string([]byte{c})) + return } } diff --git a/vendor/github.com/json-iterator/go/feature_reflect_object.go b/vendor/github.com/json-iterator/go/reflect_struct_encoder.go index 59b1235c0..d0759cf64 100644 --- a/vendor/github.com/json-iterator/go/feature_reflect_object.go +++ b/vendor/github.com/json-iterator/go/reflect_struct_encoder.go @@ -2,23 +2,20 @@ package jsoniter import ( "fmt" + "github.com/modern-go/reflect2" "io" "reflect" - "strings" "unsafe" ) -func encoderOfStruct(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { +func encoderOfStruct(ctx *ctx, typ reflect2.Type) ValEncoder { type bindingTo struct { binding *Binding toName string ignored bool } orderedBindings := []*bindingTo{} - structDescriptor, err := describeStruct(cfg, typ) - if err != nil { - return nil, err - } + structDescriptor := describeStruct(ctx, typ) for _, binding := range structDescriptor.Fields { for _, toName := range binding.ToNames { new := &bindingTo{ @@ -29,13 +26,13 @@ func encoderOfStruct(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { if old.toName != toName { continue } - old.ignored, new.ignored = resolveConflictBinding(cfg, old.binding, new.binding) + old.ignored, new.ignored = resolveConflictBinding(ctx.frozenConfig, old.binding, new.binding) } orderedBindings = append(orderedBindings, new) } } if len(orderedBindings) == 0 { - return &emptyStructEncoder{}, nil + return &emptyStructEncoder{} } finalOrderedFields := []structFieldTo{} for _, bindingTo := range orderedBindings { @@ -46,12 +43,36 @@ func encoderOfStruct(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { }) } } - return &structEncoder{structDescriptor.onePtrEmbedded, structDescriptor.onePtrOptimization, finalOrderedFields}, nil + return &structEncoder{typ, finalOrderedFields} +} + +func createCheckIsEmpty(ctx *ctx, typ reflect2.Type) checkIsEmpty { + encoder := createEncoderOfNative(ctx, typ) + if encoder != nil { + return encoder + } + kind := typ.Kind() + switch kind { + case reflect.Interface: + return &dynamicEncoder{typ} + case reflect.Struct: + return &structEncoder{typ: typ} + case reflect.Array: + return &arrayEncoder{} + case reflect.Slice: + return &sliceEncoder{} + case reflect.Map: + return encoderOfMap(ctx, typ) + case reflect.Ptr: + return &OptionalEncoder{} + default: + return &lazyErrorEncoder{err: fmt.Errorf("unsupported type: %v", typ)} + } } func resolveConflictBinding(cfg *frozenConfig, old, new *Binding) (ignoreOld, ignoreNew bool) { - newTagged := new.Field.Tag.Get(cfg.getTagKey()) != "" - oldTagged := old.Field.Tag.Get(cfg.getTagKey()) != "" + newTagged := new.Field.Tag().Get(cfg.getTagKey()) != "" + oldTagged := old.Field.Tag().Get(cfg.getTagKey()) != "" if newTagged { if oldTagged { if len(old.levels) > len(new.levels) { @@ -78,62 +99,41 @@ func resolveConflictBinding(cfg *frozenConfig, old, new *Binding) (ignoreOld, ig } } -func decoderOfStruct(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { - bindings := map[string]*Binding{} - structDescriptor, err := describeStruct(cfg, typ) - if err != nil { - return nil, err - } - for _, binding := range structDescriptor.Fields { - for _, fromName := range binding.FromNames { - old := bindings[fromName] - if old == nil { - bindings[fromName] = binding - continue - } - ignoreOld, ignoreNew := resolveConflictBinding(cfg, old, binding) - if ignoreOld { - delete(bindings, fromName) - } - if !ignoreNew { - bindings[fromName] = binding - } - } - } - fields := map[string]*structFieldDecoder{} - for k, binding := range bindings { - fields[strings.ToLower(k)] = binding.Decoder.(*structFieldDecoder) - } - return createStructDecoder(typ, fields) -} - type structFieldEncoder struct { - field *reflect.StructField + field reflect2.StructField fieldEncoder ValEncoder omitempty bool } func (encoder *structFieldEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { - fieldPtr := unsafe.Pointer(uintptr(ptr) + encoder.field.Offset) + fieldPtr := encoder.field.UnsafeGet(ptr) encoder.fieldEncoder.Encode(fieldPtr, stream) if stream.Error != nil && stream.Error != io.EOF { - stream.Error = fmt.Errorf("%s: %s", encoder.field.Name, stream.Error.Error()) + stream.Error = fmt.Errorf("%s: %s", encoder.field.Name(), stream.Error.Error()) } } -func (encoder *structFieldEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - func (encoder *structFieldEncoder) IsEmpty(ptr unsafe.Pointer) bool { - fieldPtr := unsafe.Pointer(uintptr(ptr) + encoder.field.Offset) + fieldPtr := encoder.field.UnsafeGet(ptr) return encoder.fieldEncoder.IsEmpty(fieldPtr) } +func (encoder *structFieldEncoder) IsEmbeddedPtrNil(ptr unsafe.Pointer) bool { + isEmbeddedPtrNil, converted := encoder.fieldEncoder.(IsEmbeddedPtrNil) + if !converted { + return false + } + fieldPtr := encoder.field.UnsafeGet(ptr) + return isEmbeddedPtrNil.IsEmbeddedPtrNil(fieldPtr) +} + +type IsEmbeddedPtrNil interface { + IsEmbeddedPtrNil(ptr unsafe.Pointer) bool +} + type structEncoder struct { - onePtrEmbedded bool - onePtrOptimization bool - fields []structFieldTo + typ reflect2.Type + fields []structFieldTo } type structFieldTo struct { @@ -148,6 +148,9 @@ func (encoder *structEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { if field.encoder.omitempty && field.encoder.IsEmpty(ptr) { continue } + if field.encoder.IsEmbeddedPtrNil(ptr) { + continue + } if isNotFirst { stream.WriteMore() } @@ -156,23 +159,8 @@ func (encoder *structEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { isNotFirst = true } stream.WriteObjectEnd() -} - -func (encoder *structEncoder) EncodeInterface(val interface{}, stream *Stream) { - e := (*emptyInterface)(unsafe.Pointer(&val)) - if encoder.onePtrOptimization { - if e.word == nil && encoder.onePtrEmbedded { - stream.WriteObjectStart() - stream.WriteObjectEnd() - return - } - ptr := uintptr(e.word) - e.word = unsafe.Pointer(&ptr) - } - if reflect.TypeOf(val).Kind() == reflect.Ptr { - encoder.Encode(unsafe.Pointer(&e.word), stream) - } else { - encoder.Encode(e.word, stream) + if stream.Error != nil && stream.Error != io.EOF { + stream.Error = fmt.Errorf("%v.%s", encoder.typ, stream.Error.Error()) } } @@ -187,10 +175,36 @@ func (encoder *emptyStructEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { stream.WriteEmptyObject() } -func (encoder *emptyStructEncoder) EncodeInterface(val interface{}, stream *Stream) { - WriteToStream(val, stream, encoder) -} - func (encoder *emptyStructEncoder) IsEmpty(ptr unsafe.Pointer) bool { return false } + +type stringModeNumberEncoder struct { + elemEncoder ValEncoder +} + +func (encoder *stringModeNumberEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + stream.writeByte('"') + encoder.elemEncoder.Encode(ptr, stream) + stream.writeByte('"') +} + +func (encoder *stringModeNumberEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.elemEncoder.IsEmpty(ptr) +} + +type stringModeStringEncoder struct { + elemEncoder ValEncoder + cfg *frozenConfig +} + +func (encoder *stringModeStringEncoder) Encode(ptr unsafe.Pointer, stream *Stream) { + tempStream := encoder.cfg.BorrowStream(nil) + defer encoder.cfg.ReturnStream(tempStream) + encoder.elemEncoder.Encode(ptr, tempStream) + stream.WriteString(string(tempStream.Buffer())) +} + +func (encoder *stringModeStringEncoder) IsEmpty(ptr unsafe.Pointer) bool { + return encoder.elemEncoder.IsEmpty(ptr) +} diff --git a/vendor/github.com/json-iterator/go/feature_stream.go b/vendor/github.com/json-iterator/go/stream.go index 9c8470a03..17662fded 100644 --- a/vendor/github.com/json-iterator/go/feature_stream.go +++ b/vendor/github.com/json-iterator/go/stream.go @@ -4,15 +4,15 @@ import ( "io" ) -// Stream is a io.Writer like object, with JSON specific write functions. +// stream is a io.Writer like object, with JSON specific write functions. // Error is not returned as return value, but stored as Error member on this stream instance. type Stream struct { - cfg *frozenConfig - out io.Writer - buf []byte - n int - Error error - indention int + cfg *frozenConfig + out io.Writer + buf []byte + Error error + indention int + Attachment interface{} // open for customized encoder } // NewStream create new stream instance. @@ -23,8 +23,7 @@ func NewStream(cfg API, out io.Writer, bufSize int) *Stream { return &Stream{ cfg: cfg.(*frozenConfig), out: out, - buf: make([]byte, bufSize), - n: 0, + buf: make([]byte, 0, bufSize), Error: nil, indention: 0, } @@ -38,22 +37,27 @@ func (stream *Stream) Pool() StreamPool { // Reset reuse this stream instance by assign a new writer func (stream *Stream) Reset(out io.Writer) { stream.out = out - stream.n = 0 + stream.buf = stream.buf[:0] } // Available returns how many bytes are unused in the buffer. func (stream *Stream) Available() int { - return len(stream.buf) - stream.n + return cap(stream.buf) - len(stream.buf) } // Buffered returns the number of bytes that have been written into the current buffer. func (stream *Stream) Buffered() int { - return stream.n + return len(stream.buf) } // Buffer if writer is nil, use this method to take the result func (stream *Stream) Buffer() []byte { - return stream.buf[:stream.n] + return stream.buf +} + +// SetBuffer allows to append to the internal buffer directly +func (stream *Stream) SetBuffer(buf []byte) { + stream.buf = buf } // Write writes the contents of p into the buffer. @@ -61,97 +65,34 @@ func (stream *Stream) Buffer() []byte { // If nn < len(p), it also returns an error explaining // why the write is short. func (stream *Stream) Write(p []byte) (nn int, err error) { - for len(p) > stream.Available() && stream.Error == nil { - if stream.out == nil { - stream.growAtLeast(len(p)) - } else { - var n int - if stream.Buffered() == 0 { - // Large write, empty buffer. - // Write directly from p to avoid copy. - n, stream.Error = stream.out.Write(p) - } else { - n = copy(stream.buf[stream.n:], p) - stream.n += n - stream.Flush() - } - nn += n - p = p[n:] - } - } - if stream.Error != nil { - return nn, stream.Error + stream.buf = append(stream.buf, p...) + if stream.out != nil { + nn, err = stream.out.Write(stream.buf) + stream.buf = stream.buf[nn:] + return } - n := copy(stream.buf[stream.n:], p) - stream.n += n - nn += n - return nn, nil + return len(p), nil } // WriteByte writes a single byte. func (stream *Stream) writeByte(c byte) { - if stream.Error != nil { - return - } - if stream.Available() < 1 { - stream.growAtLeast(1) - } - stream.buf[stream.n] = c - stream.n++ + stream.buf = append(stream.buf, c) } func (stream *Stream) writeTwoBytes(c1 byte, c2 byte) { - if stream.Error != nil { - return - } - if stream.Available() < 2 { - stream.growAtLeast(2) - } - stream.buf[stream.n] = c1 - stream.buf[stream.n+1] = c2 - stream.n += 2 + stream.buf = append(stream.buf, c1, c2) } func (stream *Stream) writeThreeBytes(c1 byte, c2 byte, c3 byte) { - if stream.Error != nil { - return - } - if stream.Available() < 3 { - stream.growAtLeast(3) - } - stream.buf[stream.n] = c1 - stream.buf[stream.n+1] = c2 - stream.buf[stream.n+2] = c3 - stream.n += 3 + stream.buf = append(stream.buf, c1, c2, c3) } func (stream *Stream) writeFourBytes(c1 byte, c2 byte, c3 byte, c4 byte) { - if stream.Error != nil { - return - } - if stream.Available() < 4 { - stream.growAtLeast(4) - } - stream.buf[stream.n] = c1 - stream.buf[stream.n+1] = c2 - stream.buf[stream.n+2] = c3 - stream.buf[stream.n+3] = c4 - stream.n += 4 + stream.buf = append(stream.buf, c1, c2, c3, c4) } func (stream *Stream) writeFiveBytes(c1 byte, c2 byte, c3 byte, c4 byte, c5 byte) { - if stream.Error != nil { - return - } - if stream.Available() < 5 { - stream.growAtLeast(5) - } - stream.buf[stream.n] = c1 - stream.buf[stream.n+1] = c2 - stream.buf[stream.n+2] = c3 - stream.buf[stream.n+3] = c4 - stream.buf[stream.n+4] = c5 - stream.n += 5 + stream.buf = append(stream.buf, c1, c2, c3, c4, c5) } // Flush writes any buffered data to the underlying io.Writer. @@ -162,53 +103,20 @@ func (stream *Stream) Flush() error { if stream.Error != nil { return stream.Error } - if stream.n == 0 { - return nil - } - n, err := stream.out.Write(stream.buf[0:stream.n]) - if n < stream.n && err == nil { - err = io.ErrShortWrite - } + n, err := stream.out.Write(stream.buf) if err != nil { - if n > 0 && n < stream.n { - copy(stream.buf[0:stream.n-n], stream.buf[n:stream.n]) + if stream.Error == nil { + stream.Error = err } - stream.n -= n - stream.Error = err return err } - stream.n = 0 + stream.buf = stream.buf[n:] return nil } -func (stream *Stream) ensure(minimal int) { - available := stream.Available() - if available < minimal { - stream.growAtLeast(minimal) - } -} - -func (stream *Stream) growAtLeast(minimal int) { - if stream.out != nil { - stream.Flush() - } - toGrow := len(stream.buf) - if toGrow < minimal { - toGrow = minimal - } - newBuf := make([]byte, len(stream.buf)+toGrow) - copy(newBuf, stream.Buffer()) - stream.buf = newBuf -} - // WriteRaw write string out without quotes, just like []byte func (stream *Stream) WriteRaw(s string) { - stream.ensure(len(s)) - if stream.Error != nil { - return - } - n := copy(stream.buf[stream.n:], s) - stream.n += n + stream.buf = append(stream.buf, s...) } // WriteNil write null to stream @@ -269,6 +177,7 @@ func (stream *Stream) WriteEmptyObject() { func (stream *Stream) WriteMore() { stream.writeByte(',') stream.writeIndention(0) + stream.Flush() } // WriteArrayStart write [ with possible indention @@ -280,8 +189,7 @@ func (stream *Stream) WriteArrayStart() { // WriteEmptyArray write [] func (stream *Stream) WriteEmptyArray() { - stream.writeByte('[') - stream.writeByte(']') + stream.writeTwoBytes('[', ']') } // WriteArrayEnd write ] with possible indention @@ -297,9 +205,7 @@ func (stream *Stream) writeIndention(delta int) { } stream.writeByte('\n') toWrite := stream.indention - delta - stream.ensure(toWrite) - for i := 0; i < toWrite && stream.n < len(stream.buf); i++ { - stream.buf[stream.n] = ' ' - stream.n++ + for i := 0; i < toWrite; i++ { + stream.buf = append(stream.buf, ' ') } } diff --git a/vendor/github.com/json-iterator/go/feature_stream_float.go b/vendor/github.com/json-iterator/go/stream_float.go index 9a404e11d..f318d2c59 100644 --- a/vendor/github.com/json-iterator/go/feature_stream_float.go +++ b/vendor/github.com/json-iterator/go/stream_float.go @@ -21,7 +21,7 @@ func (stream *Stream) WriteFloat32(val float32) { fmt = 'e' } } - stream.WriteRaw(strconv.FormatFloat(float64(val), fmt, -1, 32)) + stream.buf = strconv.AppendFloat(stream.buf, float64(val), fmt, -1, 32) } // WriteFloat32Lossy write float32 to stream with ONLY 6 digits precision although much much faster @@ -43,13 +43,12 @@ func (stream *Stream) WriteFloat32Lossy(val float32) { return } stream.writeByte('.') - stream.ensure(10) for p := precision - 1; p > 0 && fval < pow10[p]; p-- { stream.writeByte('0') } stream.WriteUint64(fval) - for stream.buf[stream.n-1] == '0' { - stream.n-- + for stream.buf[len(stream.buf)-1] == '0' { + stream.buf = stream.buf[:len(stream.buf)-1] } } @@ -63,7 +62,7 @@ func (stream *Stream) WriteFloat64(val float64) { fmt = 'e' } } - stream.WriteRaw(strconv.FormatFloat(float64(val), fmt, -1, 64)) + stream.buf = strconv.AppendFloat(stream.buf, float64(val), fmt, -1, 64) } // WriteFloat64Lossy write float64 to stream with ONLY 6 digits precision although much much faster @@ -85,12 +84,11 @@ func (stream *Stream) WriteFloat64Lossy(val float64) { return } stream.writeByte('.') - stream.ensure(10) for p := precision - 1; p > 0 && fval < pow10[p]; p-- { stream.writeByte('0') } stream.WriteUint64(fval) - for stream.buf[stream.n-1] == '0' { - stream.n-- + for stream.buf[len(stream.buf)-1] == '0' { + stream.buf = stream.buf[:len(stream.buf)-1] } } diff --git a/vendor/github.com/json-iterator/go/stream_int.go b/vendor/github.com/json-iterator/go/stream_int.go new file mode 100644 index 000000000..d1059ee4c --- /dev/null +++ b/vendor/github.com/json-iterator/go/stream_int.go @@ -0,0 +1,190 @@ +package jsoniter + +var digits []uint32 + +func init() { + digits = make([]uint32, 1000) + for i := uint32(0); i < 1000; i++ { + digits[i] = (((i / 100) + '0') << 16) + ((((i / 10) % 10) + '0') << 8) + i%10 + '0' + if i < 10 { + digits[i] += 2 << 24 + } else if i < 100 { + digits[i] += 1 << 24 + } + } +} + +func writeFirstBuf(space []byte, v uint32) []byte { + start := v >> 24 + if start == 0 { + space = append(space, byte(v>>16), byte(v>>8)) + } else if start == 1 { + space = append(space, byte(v>>8)) + } + space = append(space, byte(v)) + return space +} + +func writeBuf(buf []byte, v uint32) []byte { + return append(buf, byte(v>>16), byte(v>>8), byte(v)) +} + +// WriteUint8 write uint8 to stream +func (stream *Stream) WriteUint8(val uint8) { + stream.buf = writeFirstBuf(stream.buf, digits[val]) +} + +// WriteInt8 write int8 to stream +func (stream *Stream) WriteInt8(nval int8) { + var val uint8 + if nval < 0 { + val = uint8(-nval) + stream.buf = append(stream.buf, '-') + } else { + val = uint8(nval) + } + stream.buf = writeFirstBuf(stream.buf, digits[val]) +} + +// WriteUint16 write uint16 to stream +func (stream *Stream) WriteUint16(val uint16) { + q1 := val / 1000 + if q1 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[val]) + return + } + r1 := val - q1*1000 + stream.buf = writeFirstBuf(stream.buf, digits[q1]) + stream.buf = writeBuf(stream.buf, digits[r1]) + return +} + +// WriteInt16 write int16 to stream +func (stream *Stream) WriteInt16(nval int16) { + var val uint16 + if nval < 0 { + val = uint16(-nval) + stream.buf = append(stream.buf, '-') + } else { + val = uint16(nval) + } + stream.WriteUint16(val) +} + +// WriteUint32 write uint32 to stream +func (stream *Stream) WriteUint32(val uint32) { + q1 := val / 1000 + if q1 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[val]) + return + } + r1 := val - q1*1000 + q2 := q1 / 1000 + if q2 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q1]) + stream.buf = writeBuf(stream.buf, digits[r1]) + return + } + r2 := q1 - q2*1000 + q3 := q2 / 1000 + if q3 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q2]) + } else { + r3 := q2 - q3*1000 + stream.buf = append(stream.buf, byte(q3+'0')) + stream.buf = writeBuf(stream.buf, digits[r3]) + } + stream.buf = writeBuf(stream.buf, digits[r2]) + stream.buf = writeBuf(stream.buf, digits[r1]) +} + +// WriteInt32 write int32 to stream +func (stream *Stream) WriteInt32(nval int32) { + var val uint32 + if nval < 0 { + val = uint32(-nval) + stream.buf = append(stream.buf, '-') + } else { + val = uint32(nval) + } + stream.WriteUint32(val) +} + +// WriteUint64 write uint64 to stream +func (stream *Stream) WriteUint64(val uint64) { + q1 := val / 1000 + if q1 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[val]) + return + } + r1 := val - q1*1000 + q2 := q1 / 1000 + if q2 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q1]) + stream.buf = writeBuf(stream.buf, digits[r1]) + return + } + r2 := q1 - q2*1000 + q3 := q2 / 1000 + if q3 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q2]) + stream.buf = writeBuf(stream.buf, digits[r2]) + stream.buf = writeBuf(stream.buf, digits[r1]) + return + } + r3 := q2 - q3*1000 + q4 := q3 / 1000 + if q4 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q3]) + stream.buf = writeBuf(stream.buf, digits[r3]) + stream.buf = writeBuf(stream.buf, digits[r2]) + stream.buf = writeBuf(stream.buf, digits[r1]) + return + } + r4 := q3 - q4*1000 + q5 := q4 / 1000 + if q5 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q4]) + stream.buf = writeBuf(stream.buf, digits[r4]) + stream.buf = writeBuf(stream.buf, digits[r3]) + stream.buf = writeBuf(stream.buf, digits[r2]) + stream.buf = writeBuf(stream.buf, digits[r1]) + return + } + r5 := q4 - q5*1000 + q6 := q5 / 1000 + if q6 == 0 { + stream.buf = writeFirstBuf(stream.buf, digits[q5]) + } else { + stream.buf = writeFirstBuf(stream.buf, digits[q6]) + r6 := q5 - q6*1000 + stream.buf = writeBuf(stream.buf, digits[r6]) + } + stream.buf = writeBuf(stream.buf, digits[r5]) + stream.buf = writeBuf(stream.buf, digits[r4]) + stream.buf = writeBuf(stream.buf, digits[r3]) + stream.buf = writeBuf(stream.buf, digits[r2]) + stream.buf = writeBuf(stream.buf, digits[r1]) +} + +// WriteInt64 write int64 to stream +func (stream *Stream) WriteInt64(nval int64) { + var val uint64 + if nval < 0 { + val = uint64(-nval) + stream.buf = append(stream.buf, '-') + } else { + val = uint64(nval) + } + stream.WriteUint64(val) +} + +// WriteInt write int to stream +func (stream *Stream) WriteInt(val int) { + stream.WriteInt64(int64(val)) +} + +// WriteUint write uint to stream +func (stream *Stream) WriteUint(val uint) { + stream.WriteUint64(uint64(val)) +} diff --git a/vendor/github.com/json-iterator/go/feature_stream_string.go b/vendor/github.com/json-iterator/go/stream_str.go index 334282f05..54c2ba0b3 100644 --- a/vendor/github.com/json-iterator/go/feature_stream_string.go +++ b/vendor/github.com/json-iterator/go/stream_str.go @@ -219,34 +219,22 @@ var hex = "0123456789abcdef" // WriteStringWithHTMLEscaped write string to stream with html special characters escaped func (stream *Stream) WriteStringWithHTMLEscaped(s string) { - stream.ensure(32) valLen := len(s) - toWriteLen := valLen - bufLengthMinusTwo := len(stream.buf) - 2 // make room for the quotes - if stream.n+toWriteLen > bufLengthMinusTwo { - toWriteLen = bufLengthMinusTwo - stream.n - } - n := stream.n - stream.buf[n] = '"' - n++ + stream.buf = append(stream.buf, '"') // write string, the fast path, without utf8 and escape support i := 0 - for ; i < toWriteLen; i++ { + for ; i < valLen; i++ { c := s[i] if c < utf8.RuneSelf && htmlSafeSet[c] { - stream.buf[n] = c - n++ + stream.buf = append(stream.buf, c) } else { break } } if i == valLen { - stream.buf[n] = '"' - n++ - stream.n = n + stream.buf = append(stream.buf, '"') return } - stream.n = n writeStringSlowPathWithHTMLEscaped(stream, i, s, valLen) } @@ -321,34 +309,22 @@ func writeStringSlowPathWithHTMLEscaped(stream *Stream, i int, s string, valLen // WriteString write string to stream without html escape func (stream *Stream) WriteString(s string) { - stream.ensure(32) valLen := len(s) - toWriteLen := valLen - bufLengthMinusTwo := len(stream.buf) - 2 // make room for the quotes - if stream.n+toWriteLen > bufLengthMinusTwo { - toWriteLen = bufLengthMinusTwo - stream.n - } - n := stream.n - stream.buf[n] = '"' - n++ + stream.buf = append(stream.buf, '"') // write string, the fast path, without utf8 and escape support i := 0 - for ; i < toWriteLen; i++ { + for ; i < valLen; i++ { c := s[i] if c > 31 && c != '"' && c != '\\' { - stream.buf[n] = c - n++ + stream.buf = append(stream.buf, c) } else { break } } if i == valLen { - stream.buf[n] = '"' - n++ - stream.n = n + stream.buf = append(stream.buf, '"') return } - stream.n = n writeStringSlowPath(stream, i, s, valLen) } diff --git a/vendor/github.com/mailru/easyjson/LICENSE b/vendor/github.com/mailru/easyjson/LICENSE deleted file mode 100644 index fbff658f7..000000000 --- a/vendor/github.com/mailru/easyjson/LICENSE +++ /dev/null @@ -1,7 +0,0 @@ -Copyright (c) 2016 Mail.Ru Group - -Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/vendor/github.com/mailru/easyjson/README.md b/vendor/github.com/mailru/easyjson/README.md deleted file mode 100644 index 7fd768654..000000000 --- a/vendor/github.com/mailru/easyjson/README.md +++ /dev/null @@ -1,333 +0,0 @@ -# easyjson [](https://travis-ci.org/mailru/easyjson) [](https://goreportcard.com/report/github.com/mailru/easyjson) - -Package easyjson provides a fast and easy way to marshal/unmarshal Go structs -to/from JSON without the use of reflection. In performance tests, easyjson -outperforms the standard `encoding/json` package by a factor of 4-5x, and other -JSON encoding packages by a factor of 2-3x. - -easyjson aims to keep generated Go code simple enough so that it can be easily -optimized or fixed. Another goal is to provide users with the ability to -customize the generated code by providing options not available with the -standard `encoding/json` package, such as generating "snake_case" names or -enabling `omitempty` behavior by default. - -## Usage -```sh -# install -go get -u github.com/mailru/easyjson/... - -# run -easyjson -all <file>.go -``` - -The above will generate `<file>_easyjson.go` containing the appropriate marshaler and -unmarshaler funcs for all structs contained in `<file>.go`. - -Please note that easyjson requires a full Go build environment and the `GOPATH` -environment variable to be set. This is because easyjson code generation -invokes `go run` on a temporary file (an approach to code generation borrowed -from [ffjson](https://github.com/pquerna/ffjson)). - -## Options -```txt -Usage of easyjson: - -all - generate marshaler/unmarshalers for all structs in a file - -build_tags string - build tags to add to generated file - -leave_temps - do not delete temporary files - -no_std_marshalers - don't generate MarshalJSON/UnmarshalJSON funcs - -noformat - do not run 'gofmt -w' on output file - -omit_empty - omit empty fields by default - -output_filename string - specify the filename of the output - -pkg - process the whole package instead of just the given file - -snake_case - use snake_case names instead of CamelCase by default - -lower_camel_case - use lowerCamelCase instead of CamelCase by default - -stubs - only generate stubs for marshaler/unmarshaler funcs - -disallow_unknown_fields - return error if some unknown field in json appeared -``` - -Using `-all` will generate marshalers/unmarshalers for all Go structs in the -file. If `-all` is not provided, then only those structs whose preceding -comment starts with `easyjson:json` will have marshalers/unmarshalers -generated. For example: - -```go -//easyjson:json -type A struct {} -``` - -Additional option notes: - -* `-snake_case` tells easyjson to generate snake\_case field names by default - (unless overridden by a field tag). The CamelCase to snake\_case conversion - algorithm should work in most cases (ie, HTTPVersion will be converted to - "http_version"). - -* `-build_tags` will add the specified build tags to generated Go sources. - -## Generated Marshaler/Unmarshaler Funcs - -For Go struct types, easyjson generates the funcs `MarshalEasyJSON` / -`UnmarshalEasyJSON` for marshaling/unmarshaling JSON. In turn, these satisify -the `easyjson.Marshaler` and `easyjson.Unmarshaler` interfaces and when used in -conjunction with `easyjson.Marshal` / `easyjson.Unmarshal` avoid unnecessary -reflection / type assertions during marshaling/unmarshaling to/from JSON for Go -structs. - -easyjson also generates `MarshalJSON` and `UnmarshalJSON` funcs for Go struct -types compatible with the standard `json.Marshaler` and `json.Unmarshaler` -interfaces. Please be aware that using the standard `json.Marshal` / -`json.Unmarshal` for marshaling/unmarshaling will incur a significant -performance penalty when compared to using `easyjson.Marshal` / -`easyjson.Unmarshal`. - -Additionally, easyjson exposes utility funcs that use the `MarshalEasyJSON` and -`UnmarshalEasyJSON` for marshaling/unmarshaling to and from standard readers -and writers. For example, easyjson provides `easyjson.MarshalToHTTPResponseWriter` -which marshals to the standard `http.ResponseWriter`. Please see the [GoDoc -listing](https://godoc.org/github.com/mailru/easyjson) for the full listing of -utility funcs that are available. - -## Controlling easyjson Marshaling and Unmarshaling Behavior - -Go types can provide their own `MarshalEasyJSON` and `UnmarshalEasyJSON` funcs -that satisify the `easyjson.Marshaler` / `easyjson.Unmarshaler` interfaces. -These will be used by `easyjson.Marshal` and `easyjson.Unmarshal` when defined -for a Go type. - -Go types can also satisify the `easyjson.Optional` interface, which allows the -type to define its own `omitempty` logic. - -## Type Wrappers - -easyjson provides additional type wrappers defined in the `easyjson/opt` -package. These wrap the standard Go primitives and in turn satisify the -easyjson interfaces. - -The `easyjson/opt` type wrappers are useful when needing to distinguish between -a missing value and/or when needing to specifying a default value. Type -wrappers allow easyjson to avoid additional pointers and heap allocations and -can significantly increase performance when used properly. - -## Memory Pooling - -easyjson uses a buffer pool that allocates data in increasing chunks from 128 -to 32768 bytes. Chunks of 512 bytes and larger will be reused with the help of -`sync.Pool`. The maximum size of a chunk is bounded to reduce redundant memory -allocation and to allow larger reusable buffers. - -easyjson's custom allocation buffer pool is defined in the `easyjson/buffer` -package, and the default behavior pool behavior can be modified (if necessary) -through a call to `buffer.Init()` prior to any marshaling or unmarshaling. -Please see the [GoDoc listing](https://godoc.org/github.com/mailru/easyjson/buffer) -for more information. - -## Issues, Notes, and Limitations - -* easyjson is still early in its development. As such, there are likely to be - bugs and missing features when compared to `encoding/json`. In the case of a - missing feature or bug, please create a GitHub issue. Pull requests are - welcome! - -* Unlike `encoding/json`, object keys are case-sensitive. Case-insensitive - matching is not currently provided due to the significant performance hit - when doing case-insensitive key matching. In the future, case-insensitive - object key matching may be provided via an option to the generator. - -* easyjson makes use of `unsafe`, which simplifies the code and - provides significant performance benefits by allowing no-copy - conversion from `[]byte` to `string`. That said, `unsafe` is used - only when unmarshaling and parsing JSON, and any `unsafe` operations - / memory allocations done will be safely deallocated by - easyjson. Set the build tag `easyjson_nounsafe` to compile it - without `unsafe`. - -* easyjson is compatible with Google App Engine. The `appengine` build - tag (set by App Engine's environment) will automatically disable the - use of `unsafe`, which is not allowed in App Engine's Standard - Environment. Note that the use with App Engine is still experimental. - -* Floats are formatted using the default precision from Go's `strconv` package. - As such, easyjson will not correctly handle high precision floats when - marshaling/unmarshaling JSON. Note, however, that there are very few/limited - uses where this behavior is not sufficient for general use. That said, a - different package may be needed if precise marshaling/unmarshaling of high - precision floats to/from JSON is required. - -* While unmarshaling, the JSON parser does the minimal amount of work needed to - skip over unmatching parens, and as such full validation is not done for the - entire JSON value being unmarshaled/parsed. - -* Currently there is no true streaming support for encoding/decoding as - typically for many uses/protocols the final, marshaled length of the JSON - needs to be known prior to sending the data. Currently this is not possible - with easyjson's architecture. - -## Benchmarks - -Most benchmarks were done using the example -[13kB example JSON](https://dev.twitter.com/rest/reference/get/search/tweets) -(9k after eliminating whitespace). This example is similar to real-world data, -is well-structured, and contains a healthy variety of different types, making -it ideal for JSON serialization benchmarks. - -Note: - -* For small request benchmarks, an 80 byte portion of the above example was - used. - -* For large request marshaling benchmarks, a struct containing 50 regular - samples was used, making a ~500kB output JSON. - -* Benchmarks are showing the results of easyjson's default behaviour, - which makes use of `unsafe`. - -Benchmarks are available in the repository and can be run by invoking `make`. - -### easyjson vs. encoding/json - -easyjson is roughly 5-6 times faster than the standard `encoding/json` for -unmarshaling, and 3-4 times faster for non-concurrent marshaling. Concurrent -marshaling is 6-7x faster if marshaling to a writer. - -### easyjson vs. ffjson - -easyjson uses the same approach for JSON marshaling as -[ffjson](https://github.com/pquerna/ffjson), but takes a significantly -different approach to lexing and parsing JSON during unmarshaling. This means -easyjson is roughly 2-3x faster for unmarshaling and 1.5-2x faster for -non-concurrent unmarshaling. - -As of this writing, `ffjson` seems to have issues when used concurrently: -specifically, large request pooling hurts `ffjson`'s performance and causes -scalability issues. These issues with `ffjson` can likely be fixed, but as of -writing remain outstanding/known issues with `ffjson`. - -easyjson and `ffjson` have similar performance for small requests, however -easyjson outperforms `ffjson` by roughly 2-5x times for large requests when -used with a writer. - -### easyjson vs. go/codec - -[go/codec](https://github.com/ugorji/go) provides -compile-time helpers for JSON generation. In this case, helpers do not work -like marshalers as they are encoding-independent. - -easyjson is generally 2x faster than `go/codec` for non-concurrent benchmarks -and about 3x faster for concurrent encoding (without marshaling to a writer). - -In an attempt to measure marshaling performance of `go/codec` (as opposed to -allocations/memcpy/writer interface invocations), a benchmark was done with -resetting length of a byte slice rather than resetting the whole slice to nil. -However, the optimization in this exact form may not be applicable in practice, -since the memory is not freed between marshaling operations. - -### easyjson vs 'ujson' python module - -[ujson](https://github.com/esnme/ultrajson) is using C code for parsing, so it -is interesting to see how plain golang compares to that. It is imporant to note -that the resulting object for python is slower to access, since the library -parses JSON object into dictionaries. - -easyjson is slightly faster for unmarshaling and 2-3x faster than `ujson` for -marshaling. - -### Benchmark Results - -`ffjson` results are from February 4th, 2016, using the latest `ffjson` and go1.6. -`go/codec` results are from March 4th, 2016, using the latest `go/codec` and go1.6. - -#### Unmarshaling - -| lib | json size | MB/s | allocs/op | B/op | -|:---------|:----------|-----:|----------:|------:| -| standard | regular | 22 | 218 | 10229 | -| standard | small | 9.7 | 14 | 720 | -| | | | | | -| easyjson | regular | 125 | 128 | 9794 | -| easyjson | small | 67 | 3 | 128 | -| | | | | | -| ffjson | regular | 66 | 141 | 9985 | -| ffjson | small | 17.6 | 10 | 488 | -| | | | | | -| codec | regular | 55 | 434 | 19299 | -| codec | small | 29 | 7 | 336 | -| | | | | | -| ujson | regular | 103 | N/A | N/A | - -#### Marshaling, one goroutine. - -| lib | json size | MB/s | allocs/op | B/op | -|:----------|:----------|-----:|----------:|------:| -| standard | regular | 75 | 9 | 23256 | -| standard | small | 32 | 3 | 328 | -| standard | large | 80 | 17 | 1.2M | -| | | | | | -| easyjson | regular | 213 | 9 | 10260 | -| easyjson* | regular | 263 | 8 | 742 | -| easyjson | small | 125 | 1 | 128 | -| easyjson | large | 212 | 33 | 490k | -| easyjson* | large | 262 | 25 | 2879 | -| | | | | | -| ffjson | regular | 122 | 153 | 21340 | -| ffjson** | regular | 146 | 152 | 4897 | -| ffjson | small | 36 | 5 | 384 | -| ffjson** | small | 64 | 4 | 128 | -| ffjson | large | 134 | 7317 | 818k | -| ffjson** | large | 125 | 7320 | 827k | -| | | | | | -| codec | regular | 80 | 17 | 33601 | -| codec*** | regular | 108 | 9 | 1153 | -| codec | small | 42 | 3 | 304 | -| codec*** | small | 56 | 1 | 48 | -| codec | large | 73 | 483 | 2.5M | -| codec*** | large | 103 | 451 | 66007 | -| | | | | | -| ujson | regular | 92 | N/A | N/A | - -\* marshaling to a writer, -\*\* using `ffjson.Pool()`, -\*\*\* reusing output slice instead of resetting it to nil - -#### Marshaling, concurrent. - -| lib | json size | MB/s | allocs/op | B/op | -|:----------|:----------|-----:|----------:|------:| -| standard | regular | 252 | 9 | 23257 | -| standard | small | 124 | 3 | 328 | -| standard | large | 289 | 17 | 1.2M | -| | | | | | -| easyjson | regular | 792 | 9 | 10597 | -| easyjson* | regular | 1748 | 8 | 779 | -| easyjson | small | 333 | 1 | 128 | -| easyjson | large | 718 | 36 | 548k | -| easyjson* | large | 2134 | 25 | 4957 | -| | | | | | -| ffjson | regular | 301 | 153 | 21629 | -| ffjson** | regular | 707 | 152 | 5148 | -| ffjson | small | 62 | 5 | 384 | -| ffjson** | small | 282 | 4 | 128 | -| ffjson | large | 438 | 7330 | 1.0M | -| ffjson** | large | 131 | 7319 | 820k | -| | | | | | -| codec | regular | 183 | 17 | 33603 | -| codec*** | regular | 671 | 9 | 1157 | -| codec | small | 147 | 3 | 304 | -| codec*** | small | 299 | 1 | 48 | -| codec | large | 190 | 483 | 2.5M | -| codec*** | large | 752 | 451 | 77574 | - -\* marshaling to a writer, -\*\* using `ffjson.Pool()`, -\*\*\* reusing output slice instead of resetting it to nil diff --git a/vendor/github.com/mailru/easyjson/buffer/pool.go b/vendor/github.com/mailru/easyjson/buffer/pool.go deleted file mode 100644 index 07fb4bc1f..000000000 --- a/vendor/github.com/mailru/easyjson/buffer/pool.go +++ /dev/null @@ -1,270 +0,0 @@ -// Package buffer implements a buffer for serialization, consisting of a chain of []byte-s to -// reduce copying and to allow reuse of individual chunks. -package buffer - -import ( - "io" - "sync" -) - -// PoolConfig contains configuration for the allocation and reuse strategy. -type PoolConfig struct { - StartSize int // Minimum chunk size that is allocated. - PooledSize int // Minimum chunk size that is reused, reusing chunks too small will result in overhead. - MaxSize int // Maximum chunk size that will be allocated. -} - -var config = PoolConfig{ - StartSize: 128, - PooledSize: 512, - MaxSize: 32768, -} - -// Reuse pool: chunk size -> pool. -var buffers = map[int]*sync.Pool{} - -func initBuffers() { - for l := config.PooledSize; l <= config.MaxSize; l *= 2 { - buffers[l] = new(sync.Pool) - } -} - -func init() { - initBuffers() -} - -// Init sets up a non-default pooling and allocation strategy. Should be run before serialization is done. -func Init(cfg PoolConfig) { - config = cfg - initBuffers() -} - -// putBuf puts a chunk to reuse pool if it can be reused. -func putBuf(buf []byte) { - size := cap(buf) - if size < config.PooledSize { - return - } - if c := buffers[size]; c != nil { - c.Put(buf[:0]) - } -} - -// getBuf gets a chunk from reuse pool or creates a new one if reuse failed. -func getBuf(size int) []byte { - if size < config.PooledSize { - return make([]byte, 0, size) - } - - if c := buffers[size]; c != nil { - v := c.Get() - if v != nil { - return v.([]byte) - } - } - return make([]byte, 0, size) -} - -// Buffer is a buffer optimized for serialization without extra copying. -type Buffer struct { - - // Buf is the current chunk that can be used for serialization. - Buf []byte - - toPool []byte - bufs [][]byte -} - -// EnsureSpace makes sure that the current chunk contains at least s free bytes, -// possibly creating a new chunk. -func (b *Buffer) EnsureSpace(s int) { - if cap(b.Buf)-len(b.Buf) >= s { - return - } - l := len(b.Buf) - if l > 0 { - if cap(b.toPool) != cap(b.Buf) { - // Chunk was reallocated, toPool can be pooled. - putBuf(b.toPool) - } - if cap(b.bufs) == 0 { - b.bufs = make([][]byte, 0, 8) - } - b.bufs = append(b.bufs, b.Buf) - l = cap(b.toPool) * 2 - } else { - l = config.StartSize - } - - if l > config.MaxSize { - l = config.MaxSize - } - b.Buf = getBuf(l) - b.toPool = b.Buf -} - -// AppendByte appends a single byte to buffer. -func (b *Buffer) AppendByte(data byte) { - if cap(b.Buf) == len(b.Buf) { // EnsureSpace won't be inlined. - b.EnsureSpace(1) - } - b.Buf = append(b.Buf, data) -} - -// AppendBytes appends a byte slice to buffer. -func (b *Buffer) AppendBytes(data []byte) { - for len(data) > 0 { - if cap(b.Buf) == len(b.Buf) { // EnsureSpace won't be inlined. - b.EnsureSpace(1) - } - - sz := cap(b.Buf) - len(b.Buf) - if sz > len(data) { - sz = len(data) - } - - b.Buf = append(b.Buf, data[:sz]...) - data = data[sz:] - } -} - -// AppendBytes appends a string to buffer. -func (b *Buffer) AppendString(data string) { - for len(data) > 0 { - if cap(b.Buf) == len(b.Buf) { // EnsureSpace won't be inlined. - b.EnsureSpace(1) - } - - sz := cap(b.Buf) - len(b.Buf) - if sz > len(data) { - sz = len(data) - } - - b.Buf = append(b.Buf, data[:sz]...) - data = data[sz:] - } -} - -// Size computes the size of a buffer by adding sizes of every chunk. -func (b *Buffer) Size() int { - size := len(b.Buf) - for _, buf := range b.bufs { - size += len(buf) - } - return size -} - -// DumpTo outputs the contents of a buffer to a writer and resets the buffer. -func (b *Buffer) DumpTo(w io.Writer) (written int, err error) { - var n int - for _, buf := range b.bufs { - if err == nil { - n, err = w.Write(buf) - written += n - } - putBuf(buf) - } - - if err == nil { - n, err = w.Write(b.Buf) - written += n - } - putBuf(b.toPool) - - b.bufs = nil - b.Buf = nil - b.toPool = nil - - return -} - -// BuildBytes creates a single byte slice with all the contents of the buffer. Data is -// copied if it does not fit in a single chunk. You can optionally provide one byte -// slice as argument that it will try to reuse. -func (b *Buffer) BuildBytes(reuse ...[]byte) []byte { - if len(b.bufs) == 0 { - ret := b.Buf - b.toPool = nil - b.Buf = nil - return ret - } - - var ret []byte - size := b.Size() - - // If we got a buffer as argument and it is big enought, reuse it. - if len(reuse) == 1 && cap(reuse[0]) >= size { - ret = reuse[0][:0] - } else { - ret = make([]byte, 0, size) - } - for _, buf := range b.bufs { - ret = append(ret, buf...) - putBuf(buf) - } - - ret = append(ret, b.Buf...) - putBuf(b.toPool) - - b.bufs = nil - b.toPool = nil - b.Buf = nil - - return ret -} - -type readCloser struct { - offset int - bufs [][]byte -} - -func (r *readCloser) Read(p []byte) (n int, err error) { - for _, buf := range r.bufs { - // Copy as much as we can. - x := copy(p[n:], buf[r.offset:]) - n += x // Increment how much we filled. - - // Did we empty the whole buffer? - if r.offset+x == len(buf) { - // On to the next buffer. - r.offset = 0 - r.bufs = r.bufs[1:] - - // We can release this buffer. - putBuf(buf) - } else { - r.offset += x - } - - if n == len(p) { - break - } - } - // No buffers left or nothing read? - if len(r.bufs) == 0 { - err = io.EOF - } - return -} - -func (r *readCloser) Close() error { - // Release all remaining buffers. - for _, buf := range r.bufs { - putBuf(buf) - } - // In case Close gets called multiple times. - r.bufs = nil - - return nil -} - -// ReadCloser creates an io.ReadCloser with all the contents of the buffer. -func (b *Buffer) ReadCloser() io.ReadCloser { - ret := &readCloser{0, append(b.bufs, b.Buf)} - - b.bufs = nil - b.toPool = nil - b.Buf = nil - - return ret -} diff --git a/vendor/github.com/mailru/easyjson/helpers.go b/vendor/github.com/mailru/easyjson/helpers.go deleted file mode 100644 index b86b87d22..000000000 --- a/vendor/github.com/mailru/easyjson/helpers.go +++ /dev/null @@ -1,78 +0,0 @@ -// Package easyjson contains marshaler/unmarshaler interfaces and helper functions. -package easyjson - -import ( - "io" - "io/ioutil" - "net/http" - "strconv" - - "github.com/mailru/easyjson/jlexer" - "github.com/mailru/easyjson/jwriter" -) - -// Marshaler is an easyjson-compatible marshaler interface. -type Marshaler interface { - MarshalEasyJSON(w *jwriter.Writer) -} - -// Marshaler is an easyjson-compatible unmarshaler interface. -type Unmarshaler interface { - UnmarshalEasyJSON(w *jlexer.Lexer) -} - -// Optional defines an undefined-test method for a type to integrate with 'omitempty' logic. -type Optional interface { - IsDefined() bool -} - -// Marshal returns data as a single byte slice. Method is suboptimal as the data is likely to be copied -// from a chain of smaller chunks. -func Marshal(v Marshaler) ([]byte, error) { - w := jwriter.Writer{} - v.MarshalEasyJSON(&w) - return w.BuildBytes() -} - -// MarshalToWriter marshals the data to an io.Writer. -func MarshalToWriter(v Marshaler, w io.Writer) (written int, err error) { - jw := jwriter.Writer{} - v.MarshalEasyJSON(&jw) - return jw.DumpTo(w) -} - -// MarshalToHTTPResponseWriter sets Content-Length and Content-Type headers for the -// http.ResponseWriter, and send the data to the writer. started will be equal to -// false if an error occurred before any http.ResponseWriter methods were actually -// invoked (in this case a 500 reply is possible). -func MarshalToHTTPResponseWriter(v Marshaler, w http.ResponseWriter) (started bool, written int, err error) { - jw := jwriter.Writer{} - v.MarshalEasyJSON(&jw) - if jw.Error != nil { - return false, 0, jw.Error - } - w.Header().Set("Content-Type", "application/json") - w.Header().Set("Content-Length", strconv.Itoa(jw.Size())) - - started = true - written, err = jw.DumpTo(w) - return -} - -// Unmarshal decodes the JSON in data into the object. -func Unmarshal(data []byte, v Unmarshaler) error { - l := jlexer.Lexer{Data: data} - v.UnmarshalEasyJSON(&l) - return l.Error() -} - -// UnmarshalFromReader reads all the data in the reader and decodes as JSON into the object. -func UnmarshalFromReader(r io.Reader, v Unmarshaler) error { - data, err := ioutil.ReadAll(r) - if err != nil { - return err - } - l := jlexer.Lexer{Data: data} - v.UnmarshalEasyJSON(&l) - return l.Error() -} diff --git a/vendor/github.com/mailru/easyjson/jlexer/bytestostr.go b/vendor/github.com/mailru/easyjson/jlexer/bytestostr.go deleted file mode 100644 index ff7b27c5b..000000000 --- a/vendor/github.com/mailru/easyjson/jlexer/bytestostr.go +++ /dev/null @@ -1,24 +0,0 @@ -// This file will only be included to the build if neither -// easyjson_nounsafe nor appengine build tag is set. See README notes -// for more details. - -//+build !easyjson_nounsafe -//+build !appengine - -package jlexer - -import ( - "reflect" - "unsafe" -) - -// bytesToStr creates a string pointing at the slice to avoid copying. -// -// Warning: the string returned by the function should be used with care, as the whole input data -// chunk may be either blocked from being freed by GC because of a single string or the buffer.Data -// may be garbage-collected even when the string exists. -func bytesToStr(data []byte) string { - h := (*reflect.SliceHeader)(unsafe.Pointer(&data)) - shdr := reflect.StringHeader{Data: h.Data, Len: h.Len} - return *(*string)(unsafe.Pointer(&shdr)) -} diff --git a/vendor/github.com/mailru/easyjson/jlexer/bytestostr_nounsafe.go b/vendor/github.com/mailru/easyjson/jlexer/bytestostr_nounsafe.go deleted file mode 100644 index 864d1be67..000000000 --- a/vendor/github.com/mailru/easyjson/jlexer/bytestostr_nounsafe.go +++ /dev/null @@ -1,13 +0,0 @@ -// This file is included to the build if any of the buildtags below -// are defined. Refer to README notes for more details. - -//+build easyjson_nounsafe appengine - -package jlexer - -// bytesToStr creates a string normally from []byte -// -// Note that this method is roughly 1.5x slower than using the 'unsafe' method. -func bytesToStr(data []byte) string { - return string(data) -} diff --git a/vendor/github.com/mailru/easyjson/jlexer/error.go b/vendor/github.com/mailru/easyjson/jlexer/error.go deleted file mode 100644 index e90ec40d0..000000000 --- a/vendor/github.com/mailru/easyjson/jlexer/error.go +++ /dev/null @@ -1,15 +0,0 @@ -package jlexer - -import "fmt" - -// LexerError implements the error interface and represents all possible errors that can be -// generated during parsing the JSON data. -type LexerError struct { - Reason string - Offset int - Data string -} - -func (l *LexerError) Error() string { - return fmt.Sprintf("parse error: %s near offset %d of '%s'", l.Reason, l.Offset, l.Data) -} diff --git a/vendor/github.com/mailru/easyjson/jlexer/lexer.go b/vendor/github.com/mailru/easyjson/jlexer/lexer.go deleted file mode 100644 index 51f056615..000000000 --- a/vendor/github.com/mailru/easyjson/jlexer/lexer.go +++ /dev/null @@ -1,1181 +0,0 @@ -// Package jlexer contains a JSON lexer implementation. -// -// It is expected that it is mostly used with generated parser code, so the interface is tuned -// for a parser that knows what kind of data is expected. -package jlexer - -import ( - "encoding/base64" - "encoding/json" - "errors" - "fmt" - "io" - "strconv" - "unicode" - "unicode/utf16" - "unicode/utf8" -) - -// tokenKind determines type of a token. -type tokenKind byte - -const ( - tokenUndef tokenKind = iota // No token. - tokenDelim // Delimiter: one of '{', '}', '[' or ']'. - tokenString // A string literal, e.g. "abc\u1234" - tokenNumber // Number literal, e.g. 1.5e5 - tokenBool // Boolean literal: true or false. - tokenNull // null keyword. -) - -// token describes a single token: type, position in the input and value. -type token struct { - kind tokenKind // Type of a token. - - boolValue bool // Value if a boolean literal token. - byteValue []byte // Raw value of a token. - delimValue byte -} - -// Lexer is a JSON lexer: it iterates over JSON tokens in a byte slice. -type Lexer struct { - Data []byte // Input data given to the lexer. - - start int // Start of the current token. - pos int // Current unscanned position in the input stream. - token token // Last scanned token, if token.kind != tokenUndef. - - firstElement bool // Whether current element is the first in array or an object. - wantSep byte // A comma or a colon character, which need to occur before a token. - - UseMultipleErrors bool // If we want to use multiple errors. - fatalError error // Fatal error occurred during lexing. It is usually a syntax error. - multipleErrors []*LexerError // Semantic errors occurred during lexing. Marshalling will be continued after finding this errors. -} - -// FetchToken scans the input for the next token. -func (r *Lexer) FetchToken() { - r.token.kind = tokenUndef - r.start = r.pos - - // Check if r.Data has r.pos element - // If it doesn't, it mean corrupted input data - if len(r.Data) < r.pos { - r.errParse("Unexpected end of data") - return - } - // Determine the type of a token by skipping whitespace and reading the - // first character. - for _, c := range r.Data[r.pos:] { - switch c { - case ':', ',': - if r.wantSep == c { - r.pos++ - r.start++ - r.wantSep = 0 - } else { - r.errSyntax() - } - - case ' ', '\t', '\r', '\n': - r.pos++ - r.start++ - - case '"': - if r.wantSep != 0 { - r.errSyntax() - } - - r.token.kind = tokenString - r.fetchString() - return - - case '{', '[': - if r.wantSep != 0 { - r.errSyntax() - } - r.firstElement = true - r.token.kind = tokenDelim - r.token.delimValue = r.Data[r.pos] - r.pos++ - return - - case '}', ']': - if !r.firstElement && (r.wantSep != ',') { - r.errSyntax() - } - r.wantSep = 0 - r.token.kind = tokenDelim - r.token.delimValue = r.Data[r.pos] - r.pos++ - return - - case '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', '-': - if r.wantSep != 0 { - r.errSyntax() - } - r.token.kind = tokenNumber - r.fetchNumber() - return - - case 'n': - if r.wantSep != 0 { - r.errSyntax() - } - - r.token.kind = tokenNull - r.fetchNull() - return - - case 't': - if r.wantSep != 0 { - r.errSyntax() - } - - r.token.kind = tokenBool - r.token.boolValue = true - r.fetchTrue() - return - - case 'f': - if r.wantSep != 0 { - r.errSyntax() - } - - r.token.kind = tokenBool - r.token.boolValue = false - r.fetchFalse() - return - - default: - r.errSyntax() - return - } - } - r.fatalError = io.EOF - return -} - -// isTokenEnd returns true if the char can follow a non-delimiter token -func isTokenEnd(c byte) bool { - return c == ' ' || c == '\t' || c == '\r' || c == '\n' || c == '[' || c == ']' || c == '{' || c == '}' || c == ',' || c == ':' -} - -// fetchNull fetches and checks remaining bytes of null keyword. -func (r *Lexer) fetchNull() { - r.pos += 4 - if r.pos > len(r.Data) || - r.Data[r.pos-3] != 'u' || - r.Data[r.pos-2] != 'l' || - r.Data[r.pos-1] != 'l' || - (r.pos != len(r.Data) && !isTokenEnd(r.Data[r.pos])) { - - r.pos -= 4 - r.errSyntax() - } -} - -// fetchTrue fetches and checks remaining bytes of true keyword. -func (r *Lexer) fetchTrue() { - r.pos += 4 - if r.pos > len(r.Data) || - r.Data[r.pos-3] != 'r' || - r.Data[r.pos-2] != 'u' || - r.Data[r.pos-1] != 'e' || - (r.pos != len(r.Data) && !isTokenEnd(r.Data[r.pos])) { - - r.pos -= 4 - r.errSyntax() - } -} - -// fetchFalse fetches and checks remaining bytes of false keyword. -func (r *Lexer) fetchFalse() { - r.pos += 5 - if r.pos > len(r.Data) || - r.Data[r.pos-4] != 'a' || - r.Data[r.pos-3] != 'l' || - r.Data[r.pos-2] != 's' || - r.Data[r.pos-1] != 'e' || - (r.pos != len(r.Data) && !isTokenEnd(r.Data[r.pos])) { - - r.pos -= 5 - r.errSyntax() - } -} - -// fetchNumber scans a number literal token. -func (r *Lexer) fetchNumber() { - hasE := false - afterE := false - hasDot := false - - r.pos++ - for i, c := range r.Data[r.pos:] { - switch { - case c >= '0' && c <= '9': - afterE = false - case c == '.' && !hasDot: - hasDot = true - case (c == 'e' || c == 'E') && !hasE: - hasE = true - hasDot = true - afterE = true - case (c == '+' || c == '-') && afterE: - afterE = false - default: - r.pos += i - if !isTokenEnd(c) { - r.errSyntax() - } else { - r.token.byteValue = r.Data[r.start:r.pos] - } - return - } - } - - r.pos = len(r.Data) - r.token.byteValue = r.Data[r.start:] -} - -// findStringLen tries to scan into the string literal for ending quote char to determine required size. -// The size will be exact if no escapes are present and may be inexact if there are escaped chars. -func findStringLen(data []byte) (isValid, hasEscapes bool, length int) { - delta := 0 - - for i := 0; i < len(data); i++ { - switch data[i] { - case '\\': - i++ - delta++ - if i < len(data) && data[i] == 'u' { - delta++ - } - case '"': - return true, (delta > 0), (i - delta) - } - } - - return false, false, len(data) -} - -// getu4 decodes \uXXXX from the beginning of s, returning the hex value, -// or it returns -1. -func getu4(s []byte) rune { - if len(s) < 6 || s[0] != '\\' || s[1] != 'u' { - return -1 - } - var val rune - for i := 2; i < len(s) && i < 6; i++ { - var v byte - c := s[i] - switch c { - case '0', '1', '2', '3', '4', '5', '6', '7', '8', '9': - v = c - '0' - case 'a', 'b', 'c', 'd', 'e', 'f': - v = c - 'a' + 10 - case 'A', 'B', 'C', 'D', 'E', 'F': - v = c - 'A' + 10 - default: - return -1 - } - - val <<= 4 - val |= rune(v) - } - return val -} - -// processEscape processes a single escape sequence and returns number of bytes processed. -func (r *Lexer) processEscape(data []byte) (int, error) { - if len(data) < 2 { - return 0, fmt.Errorf("syntax error at %v", string(data)) - } - - c := data[1] - switch c { - case '"', '/', '\\': - r.token.byteValue = append(r.token.byteValue, c) - return 2, nil - case 'b': - r.token.byteValue = append(r.token.byteValue, '\b') - return 2, nil - case 'f': - r.token.byteValue = append(r.token.byteValue, '\f') - return 2, nil - case 'n': - r.token.byteValue = append(r.token.byteValue, '\n') - return 2, nil - case 'r': - r.token.byteValue = append(r.token.byteValue, '\r') - return 2, nil - case 't': - r.token.byteValue = append(r.token.byteValue, '\t') - return 2, nil - case 'u': - rr := getu4(data) - if rr < 0 { - return 0, errors.New("syntax error") - } - - read := 6 - if utf16.IsSurrogate(rr) { - rr1 := getu4(data[read:]) - if dec := utf16.DecodeRune(rr, rr1); dec != unicode.ReplacementChar { - read += 6 - rr = dec - } else { - rr = unicode.ReplacementChar - } - } - var d [4]byte - s := utf8.EncodeRune(d[:], rr) - r.token.byteValue = append(r.token.byteValue, d[:s]...) - return read, nil - } - - return 0, errors.New("syntax error") -} - -// fetchString scans a string literal token. -func (r *Lexer) fetchString() { - r.pos++ - data := r.Data[r.pos:] - - isValid, hasEscapes, length := findStringLen(data) - if !isValid { - r.pos += length - r.errParse("unterminated string literal") - return - } - if !hasEscapes { - r.token.byteValue = data[:length] - r.pos += length + 1 - return - } - - r.token.byteValue = make([]byte, 0, length) - p := 0 - for i := 0; i < len(data); { - switch data[i] { - case '"': - r.pos += i + 1 - r.token.byteValue = append(r.token.byteValue, data[p:i]...) - i++ - return - - case '\\': - r.token.byteValue = append(r.token.byteValue, data[p:i]...) - off, err := r.processEscape(data[i:]) - if err != nil { - r.errParse(err.Error()) - return - } - i += off - p = i - - default: - i++ - } - } - r.errParse("unterminated string literal") -} - -// scanToken scans the next token if no token is currently available in the lexer. -func (r *Lexer) scanToken() { - if r.token.kind != tokenUndef || r.fatalError != nil { - return - } - - r.FetchToken() -} - -// consume resets the current token to allow scanning the next one. -func (r *Lexer) consume() { - r.token.kind = tokenUndef - r.token.delimValue = 0 -} - -// Ok returns true if no error (including io.EOF) was encountered during scanning. -func (r *Lexer) Ok() bool { - return r.fatalError == nil -} - -const maxErrorContextLen = 13 - -func (r *Lexer) errParse(what string) { - if r.fatalError == nil { - var str string - if len(r.Data)-r.pos <= maxErrorContextLen { - str = string(r.Data) - } else { - str = string(r.Data[r.pos:r.pos+maxErrorContextLen-3]) + "..." - } - r.fatalError = &LexerError{ - Reason: what, - Offset: r.pos, - Data: str, - } - } -} - -func (r *Lexer) errSyntax() { - r.errParse("syntax error") -} - -func (r *Lexer) errInvalidToken(expected string) { - if r.fatalError != nil { - return - } - if r.UseMultipleErrors { - r.pos = r.start - r.consume() - r.SkipRecursive() - switch expected { - case "[": - r.token.delimValue = ']' - r.token.kind = tokenDelim - case "{": - r.token.delimValue = '}' - r.token.kind = tokenDelim - } - r.addNonfatalError(&LexerError{ - Reason: fmt.Sprintf("expected %s", expected), - Offset: r.start, - Data: string(r.Data[r.start:r.pos]), - }) - return - } - - var str string - if len(r.token.byteValue) <= maxErrorContextLen { - str = string(r.token.byteValue) - } else { - str = string(r.token.byteValue[:maxErrorContextLen-3]) + "..." - } - r.fatalError = &LexerError{ - Reason: fmt.Sprintf("expected %s", expected), - Offset: r.pos, - Data: str, - } -} - -func (r *Lexer) GetPos() int { - return r.pos -} - -// Delim consumes a token and verifies that it is the given delimiter. -func (r *Lexer) Delim(c byte) { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - - if !r.Ok() || r.token.delimValue != c { - r.consume() // errInvalidToken can change token if UseMultipleErrors is enabled. - r.errInvalidToken(string([]byte{c})) - } else { - r.consume() - } -} - -// IsDelim returns true if there was no scanning error and next token is the given delimiter. -func (r *Lexer) IsDelim(c byte) bool { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - return !r.Ok() || r.token.delimValue == c -} - -// Null verifies that the next token is null and consumes it. -func (r *Lexer) Null() { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() || r.token.kind != tokenNull { - r.errInvalidToken("null") - } - r.consume() -} - -// IsNull returns true if the next token is a null keyword. -func (r *Lexer) IsNull() bool { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - return r.Ok() && r.token.kind == tokenNull -} - -// Skip skips a single token. -func (r *Lexer) Skip() { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - r.consume() -} - -// SkipRecursive skips next array or object completely, or just skips a single token if not -// an array/object. -// -// Note: no syntax validation is performed on the skipped data. -func (r *Lexer) SkipRecursive() { - r.scanToken() - var start, end byte - - if r.token.delimValue == '{' { - start, end = '{', '}' - } else if r.token.delimValue == '[' { - start, end = '[', ']' - } else { - r.consume() - return - } - - r.consume() - - level := 1 - inQuotes := false - wasEscape := false - - for i, c := range r.Data[r.pos:] { - switch { - case c == start && !inQuotes: - level++ - case c == end && !inQuotes: - level-- - if level == 0 { - r.pos += i + 1 - return - } - case c == '\\' && inQuotes: - wasEscape = !wasEscape - continue - case c == '"' && inQuotes: - inQuotes = wasEscape - case c == '"': - inQuotes = true - } - wasEscape = false - } - r.pos = len(r.Data) - r.fatalError = &LexerError{ - Reason: "EOF reached while skipping array/object or token", - Offset: r.pos, - Data: string(r.Data[r.pos:]), - } -} - -// Raw fetches the next item recursively as a data slice -func (r *Lexer) Raw() []byte { - r.SkipRecursive() - if !r.Ok() { - return nil - } - return r.Data[r.start:r.pos] -} - -// IsStart returns whether the lexer is positioned at the start -// of an input string. -func (r *Lexer) IsStart() bool { - return r.pos == 0 -} - -// Consumed reads all remaining bytes from the input, publishing an error if -// there is anything but whitespace remaining. -func (r *Lexer) Consumed() { - if r.pos > len(r.Data) || !r.Ok() { - return - } - - for _, c := range r.Data[r.pos:] { - if c != ' ' && c != '\t' && c != '\r' && c != '\n' { - r.AddError(&LexerError{ - Reason: "invalid character '" + string(c) + "' after top-level value", - Offset: r.pos, - Data: string(r.Data[r.pos:]), - }) - return - } - - r.pos++ - r.start++ - } -} - -func (r *Lexer) unsafeString() (string, []byte) { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() || r.token.kind != tokenString { - r.errInvalidToken("string") - return "", nil - } - bytes := r.token.byteValue - ret := bytesToStr(r.token.byteValue) - r.consume() - return ret, bytes -} - -// UnsafeString returns the string value if the token is a string literal. -// -// Warning: returned string may point to the input buffer, so the string should not outlive -// the input buffer. Intended pattern of usage is as an argument to a switch statement. -func (r *Lexer) UnsafeString() string { - ret, _ := r.unsafeString() - return ret -} - -// UnsafeBytes returns the byte slice if the token is a string literal. -func (r *Lexer) UnsafeBytes() []byte { - _, ret := r.unsafeString() - return ret -} - -// String reads a string literal. -func (r *Lexer) String() string { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() || r.token.kind != tokenString { - r.errInvalidToken("string") - return "" - } - ret := string(r.token.byteValue) - r.consume() - return ret -} - -// Bytes reads a string literal and base64 decodes it into a byte slice. -func (r *Lexer) Bytes() []byte { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() || r.token.kind != tokenString { - r.errInvalidToken("string") - return nil - } - ret := make([]byte, base64.StdEncoding.DecodedLen(len(r.token.byteValue))) - n, err := base64.StdEncoding.Decode(ret, r.token.byteValue) - if err != nil { - r.fatalError = &LexerError{ - Reason: err.Error(), - } - return nil - } - - r.consume() - return ret[:n] -} - -// Bool reads a true or false boolean keyword. -func (r *Lexer) Bool() bool { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() || r.token.kind != tokenBool { - r.errInvalidToken("bool") - return false - } - ret := r.token.boolValue - r.consume() - return ret -} - -func (r *Lexer) number() string { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() || r.token.kind != tokenNumber { - r.errInvalidToken("number") - return "" - } - ret := bytesToStr(r.token.byteValue) - r.consume() - return ret -} - -func (r *Lexer) Uint8() uint8 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 8) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return uint8(n) -} - -func (r *Lexer) Uint16() uint16 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 16) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return uint16(n) -} - -func (r *Lexer) Uint32() uint32 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 32) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return uint32(n) -} - -func (r *Lexer) Uint64() uint64 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 64) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return n -} - -func (r *Lexer) Uint() uint { - return uint(r.Uint64()) -} - -func (r *Lexer) Int8() int8 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 8) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return int8(n) -} - -func (r *Lexer) Int16() int16 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 16) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return int16(n) -} - -func (r *Lexer) Int32() int32 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 32) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return int32(n) -} - -func (r *Lexer) Int64() int64 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 64) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return n -} - -func (r *Lexer) Int() int { - return int(r.Int64()) -} - -func (r *Lexer) Uint8Str() uint8 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 8) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return uint8(n) -} - -func (r *Lexer) Uint16Str() uint16 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 16) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return uint16(n) -} - -func (r *Lexer) Uint32Str() uint32 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 32) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return uint32(n) -} - -func (r *Lexer) Uint64Str() uint64 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseUint(s, 10, 64) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return n -} - -func (r *Lexer) UintStr() uint { - return uint(r.Uint64Str()) -} - -func (r *Lexer) UintptrStr() uintptr { - return uintptr(r.Uint64Str()) -} - -func (r *Lexer) Int8Str() int8 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 8) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return int8(n) -} - -func (r *Lexer) Int16Str() int16 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 16) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return int16(n) -} - -func (r *Lexer) Int32Str() int32 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 32) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return int32(n) -} - -func (r *Lexer) Int64Str() int64 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseInt(s, 10, 64) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return n -} - -func (r *Lexer) IntStr() int { - return int(r.Int64Str()) -} - -func (r *Lexer) Float32() float32 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseFloat(s, 32) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return float32(n) -} - -func (r *Lexer) Float32Str() float32 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - n, err := strconv.ParseFloat(s, 32) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return float32(n) -} - -func (r *Lexer) Float64() float64 { - s := r.number() - if !r.Ok() { - return 0 - } - - n, err := strconv.ParseFloat(s, 64) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: s, - }) - } - return n -} - -func (r *Lexer) Float64Str() float64 { - s, b := r.unsafeString() - if !r.Ok() { - return 0 - } - n, err := strconv.ParseFloat(s, 64) - if err != nil { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Reason: err.Error(), - Data: string(b), - }) - } - return n -} - -func (r *Lexer) Error() error { - return r.fatalError -} - -func (r *Lexer) AddError(e error) { - if r.fatalError == nil { - r.fatalError = e - } -} - -func (r *Lexer) AddNonFatalError(e error) { - r.addNonfatalError(&LexerError{ - Offset: r.start, - Data: string(r.Data[r.start:r.pos]), - Reason: e.Error(), - }) -} - -func (r *Lexer) addNonfatalError(err *LexerError) { - if r.UseMultipleErrors { - // We don't want to add errors with the same offset. - if len(r.multipleErrors) != 0 && r.multipleErrors[len(r.multipleErrors)-1].Offset == err.Offset { - return - } - r.multipleErrors = append(r.multipleErrors, err) - return - } - r.fatalError = err -} - -func (r *Lexer) GetNonFatalErrors() []*LexerError { - return r.multipleErrors -} - -// JsonNumber fetches and json.Number from 'encoding/json' package. -// Both int, float or string, contains them are valid values -func (r *Lexer) JsonNumber() json.Number { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - if !r.Ok() { - r.errInvalidToken("json.Number") - return json.Number("") - } - - switch r.token.kind { - case tokenString: - return json.Number(r.String()) - case tokenNumber: - return json.Number(r.Raw()) - case tokenNull: - r.Null() - return json.Number("") - default: - r.errSyntax() - return json.Number("") - } -} - -// Interface fetches an interface{} analogous to the 'encoding/json' package. -func (r *Lexer) Interface() interface{} { - if r.token.kind == tokenUndef && r.Ok() { - r.FetchToken() - } - - if !r.Ok() { - return nil - } - switch r.token.kind { - case tokenString: - return r.String() - case tokenNumber: - return r.Float64() - case tokenBool: - return r.Bool() - case tokenNull: - r.Null() - return nil - } - - if r.token.delimValue == '{' { - r.consume() - - ret := map[string]interface{}{} - for !r.IsDelim('}') { - key := r.String() - r.WantColon() - ret[key] = r.Interface() - r.WantComma() - } - r.Delim('}') - - if r.Ok() { - return ret - } else { - return nil - } - } else if r.token.delimValue == '[' { - r.consume() - - var ret []interface{} - for !r.IsDelim(']') { - ret = append(ret, r.Interface()) - r.WantComma() - } - r.Delim(']') - - if r.Ok() { - return ret - } else { - return nil - } - } - r.errSyntax() - return nil -} - -// WantComma requires a comma to be present before fetching next token. -func (r *Lexer) WantComma() { - r.wantSep = ',' - r.firstElement = false -} - -// WantColon requires a colon to be present before fetching next token. -func (r *Lexer) WantColon() { - r.wantSep = ':' - r.firstElement = false -} diff --git a/vendor/github.com/mailru/easyjson/jwriter/writer.go b/vendor/github.com/mailru/easyjson/jwriter/writer.go deleted file mode 100644 index b9ed7ccaa..000000000 --- a/vendor/github.com/mailru/easyjson/jwriter/writer.go +++ /dev/null @@ -1,390 +0,0 @@ -// Package jwriter contains a JSON writer. -package jwriter - -import ( - "io" - "strconv" - "unicode/utf8" - - "github.com/mailru/easyjson/buffer" -) - -// Flags describe various encoding options. The behavior may be actually implemented in the encoder, but -// Flags field in Writer is used to set and pass them around. -type Flags int - -const ( - NilMapAsEmpty Flags = 1 << iota // Encode nil map as '{}' rather than 'null'. - NilSliceAsEmpty // Encode nil slice as '[]' rather than 'null'. -) - -// Writer is a JSON writer. -type Writer struct { - Flags Flags - - Error error - Buffer buffer.Buffer - NoEscapeHTML bool -} - -// Size returns the size of the data that was written out. -func (w *Writer) Size() int { - return w.Buffer.Size() -} - -// DumpTo outputs the data to given io.Writer, resetting the buffer. -func (w *Writer) DumpTo(out io.Writer) (written int, err error) { - return w.Buffer.DumpTo(out) -} - -// BuildBytes returns writer data as a single byte slice. You can optionally provide one byte slice -// as argument that it will try to reuse. -func (w *Writer) BuildBytes(reuse ...[]byte) ([]byte, error) { - if w.Error != nil { - return nil, w.Error - } - - return w.Buffer.BuildBytes(reuse...), nil -} - -// ReadCloser returns an io.ReadCloser that can be used to read the data. -// ReadCloser also resets the buffer. -func (w *Writer) ReadCloser() (io.ReadCloser, error) { - if w.Error != nil { - return nil, w.Error - } - - return w.Buffer.ReadCloser(), nil -} - -// RawByte appends raw binary data to the buffer. -func (w *Writer) RawByte(c byte) { - w.Buffer.AppendByte(c) -} - -// RawByte appends raw binary data to the buffer. -func (w *Writer) RawString(s string) { - w.Buffer.AppendString(s) -} - -// Raw appends raw binary data to the buffer or sets the error if it is given. Useful for -// calling with results of MarshalJSON-like functions. -func (w *Writer) Raw(data []byte, err error) { - switch { - case w.Error != nil: - return - case err != nil: - w.Error = err - case len(data) > 0: - w.Buffer.AppendBytes(data) - default: - w.RawString("null") - } -} - -// RawText encloses raw binary data in quotes and appends in to the buffer. -// Useful for calling with results of MarshalText-like functions. -func (w *Writer) RawText(data []byte, err error) { - switch { - case w.Error != nil: - return - case err != nil: - w.Error = err - case len(data) > 0: - w.String(string(data)) - default: - w.RawString("null") - } -} - -// Base64Bytes appends data to the buffer after base64 encoding it -func (w *Writer) Base64Bytes(data []byte) { - if data == nil { - w.Buffer.AppendString("null") - return - } - w.Buffer.AppendByte('"') - w.base64(data) - w.Buffer.AppendByte('"') -} - -func (w *Writer) Uint8(n uint8) { - w.Buffer.EnsureSpace(3) - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) -} - -func (w *Writer) Uint16(n uint16) { - w.Buffer.EnsureSpace(5) - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) -} - -func (w *Writer) Uint32(n uint32) { - w.Buffer.EnsureSpace(10) - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) -} - -func (w *Writer) Uint(n uint) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) -} - -func (w *Writer) Uint64(n uint64) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, n, 10) -} - -func (w *Writer) Int8(n int8) { - w.Buffer.EnsureSpace(4) - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) -} - -func (w *Writer) Int16(n int16) { - w.Buffer.EnsureSpace(6) - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) -} - -func (w *Writer) Int32(n int32) { - w.Buffer.EnsureSpace(11) - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) -} - -func (w *Writer) Int(n int) { - w.Buffer.EnsureSpace(21) - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) -} - -func (w *Writer) Int64(n int64) { - w.Buffer.EnsureSpace(21) - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, n, 10) -} - -func (w *Writer) Uint8Str(n uint8) { - w.Buffer.EnsureSpace(3) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Uint16Str(n uint16) { - w.Buffer.EnsureSpace(5) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Uint32Str(n uint32) { - w.Buffer.EnsureSpace(10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) UintStr(n uint) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Uint64Str(n uint64) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, n, 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) UintptrStr(n uintptr) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendUint(w.Buffer.Buf, uint64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Int8Str(n int8) { - w.Buffer.EnsureSpace(4) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Int16Str(n int16) { - w.Buffer.EnsureSpace(6) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Int32Str(n int32) { - w.Buffer.EnsureSpace(11) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) IntStr(n int) { - w.Buffer.EnsureSpace(21) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, int64(n), 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Int64Str(n int64) { - w.Buffer.EnsureSpace(21) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendInt(w.Buffer.Buf, n, 10) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Float32(n float32) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = strconv.AppendFloat(w.Buffer.Buf, float64(n), 'g', -1, 32) -} - -func (w *Writer) Float32Str(n float32) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendFloat(w.Buffer.Buf, float64(n), 'g', -1, 32) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Float64(n float64) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = strconv.AppendFloat(w.Buffer.Buf, n, 'g', -1, 64) -} - -func (w *Writer) Float64Str(n float64) { - w.Buffer.EnsureSpace(20) - w.Buffer.Buf = append(w.Buffer.Buf, '"') - w.Buffer.Buf = strconv.AppendFloat(w.Buffer.Buf, float64(n), 'g', -1, 64) - w.Buffer.Buf = append(w.Buffer.Buf, '"') -} - -func (w *Writer) Bool(v bool) { - w.Buffer.EnsureSpace(5) - if v { - w.Buffer.Buf = append(w.Buffer.Buf, "true"...) - } else { - w.Buffer.Buf = append(w.Buffer.Buf, "false"...) - } -} - -const chars = "0123456789abcdef" - -func isNotEscapedSingleChar(c byte, escapeHTML bool) bool { - // Note: might make sense to use a table if there are more chars to escape. With 4 chars - // it benchmarks the same. - if escapeHTML { - return c != '<' && c != '>' && c != '&' && c != '\\' && c != '"' && c >= 0x20 && c < utf8.RuneSelf - } else { - return c != '\\' && c != '"' && c >= 0x20 && c < utf8.RuneSelf - } -} - -func (w *Writer) String(s string) { - w.Buffer.AppendByte('"') - - // Portions of the string that contain no escapes are appended as - // byte slices. - - p := 0 // last non-escape symbol - - for i := 0; i < len(s); { - c := s[i] - - if isNotEscapedSingleChar(c, !w.NoEscapeHTML) { - // single-width character, no escaping is required - i++ - continue - } else if c < utf8.RuneSelf { - // single-with character, need to escape - w.Buffer.AppendString(s[p:i]) - switch c { - case '\t': - w.Buffer.AppendString(`\t`) - case '\r': - w.Buffer.AppendString(`\r`) - case '\n': - w.Buffer.AppendString(`\n`) - case '\\': - w.Buffer.AppendString(`\\`) - case '"': - w.Buffer.AppendString(`\"`) - default: - w.Buffer.AppendString(`\u00`) - w.Buffer.AppendByte(chars[c>>4]) - w.Buffer.AppendByte(chars[c&0xf]) - } - - i++ - p = i - continue - } - - // broken utf - runeValue, runeWidth := utf8.DecodeRuneInString(s[i:]) - if runeValue == utf8.RuneError && runeWidth == 1 { - w.Buffer.AppendString(s[p:i]) - w.Buffer.AppendString(`\ufffd`) - i++ - p = i - continue - } - - // jsonp stuff - tab separator and line separator - if runeValue == '\u2028' || runeValue == '\u2029' { - w.Buffer.AppendString(s[p:i]) - w.Buffer.AppendString(`\u202`) - w.Buffer.AppendByte(chars[runeValue&0xf]) - i += runeWidth - p = i - continue - } - i += runeWidth - } - w.Buffer.AppendString(s[p:]) - w.Buffer.AppendByte('"') -} - -const encode = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/" -const padChar = '=' - -func (w *Writer) base64(in []byte) { - - if len(in) == 0 { - return - } - - w.Buffer.EnsureSpace(((len(in)-1)/3 + 1) * 4) - - si := 0 - n := (len(in) / 3) * 3 - - for si < n { - // Convert 3x 8bit source bytes into 4 bytes - val := uint(in[si+0])<<16 | uint(in[si+1])<<8 | uint(in[si+2]) - - w.Buffer.Buf = append(w.Buffer.Buf, encode[val>>18&0x3F], encode[val>>12&0x3F], encode[val>>6&0x3F], encode[val&0x3F]) - - si += 3 - } - - remain := len(in) - si - if remain == 0 { - return - } - - // Add the remaining small block - val := uint(in[si+0]) << 16 - if remain == 2 { - val |= uint(in[si+1]) << 8 - } - - w.Buffer.Buf = append(w.Buffer.Buf, encode[val>>18&0x3F], encode[val>>12&0x3F]) - - switch remain { - case 2: - w.Buffer.Buf = append(w.Buffer.Buf, encode[val>>6&0x3F], byte(padChar)) - case 1: - w.Buffer.Buf = append(w.Buffer.Buf, byte(padChar), byte(padChar)) - } -} diff --git a/vendor/github.com/mailru/easyjson/raw.go b/vendor/github.com/mailru/easyjson/raw.go deleted file mode 100644 index 81bd002e1..000000000 --- a/vendor/github.com/mailru/easyjson/raw.go +++ /dev/null @@ -1,45 +0,0 @@ -package easyjson - -import ( - "github.com/mailru/easyjson/jlexer" - "github.com/mailru/easyjson/jwriter" -) - -// RawMessage is a raw piece of JSON (number, string, bool, object, array or -// null) that is extracted without parsing and output as is during marshaling. -type RawMessage []byte - -// MarshalEasyJSON does JSON marshaling using easyjson interface. -func (v *RawMessage) MarshalEasyJSON(w *jwriter.Writer) { - if len(*v) == 0 { - w.RawString("null") - } else { - w.Raw(*v, nil) - } -} - -// UnmarshalEasyJSON does JSON unmarshaling using easyjson interface. -func (v *RawMessage) UnmarshalEasyJSON(l *jlexer.Lexer) { - *v = RawMessage(l.Raw()) -} - -// UnmarshalJSON implements encoding/json.Unmarshaler interface. -func (v *RawMessage) UnmarshalJSON(data []byte) error { - *v = data - return nil -} - -var nullBytes = []byte("null") - -// MarshalJSON implements encoding/json.Marshaler interface. -func (v RawMessage) MarshalJSON() ([]byte, error) { - if len(v) == 0 { - return nullBytes, nil - } - return v, nil -} - -// IsDefined is required for integration with omitempty easyjson logic. -func (v *RawMessage) IsDefined() bool { - return len(*v) > 0 -} diff --git a/vendor/github.com/modern-go/concurrent/LICENSE b/vendor/github.com/modern-go/concurrent/LICENSE new file mode 100644 index 000000000..261eeb9e9 --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/modern-go/concurrent/README.md b/vendor/github.com/modern-go/concurrent/README.md new file mode 100644 index 000000000..acab3200a --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/README.md @@ -0,0 +1,49 @@ +# concurrent + +[](https://sourcegraph.com/github.com/modern-go/concurrent?badge) +[](http://godoc.org/github.com/modern-go/concurrent) +[](https://travis-ci.org/modern-go/concurrent) +[](https://codecov.io/gh/modern-go/concurrent) +[](https://goreportcard.com/report/github.com/modern-go/concurrent) +[](https://raw.githubusercontent.com/modern-go/concurrent/master/LICENSE) + +* concurrent.Map: backport sync.Map for go below 1.9 +* concurrent.Executor: goroutine with explicit ownership and cancellable + +# concurrent.Map + +because sync.Map is only available in go 1.9, we can use concurrent.Map to make code portable + +```go +m := concurrent.NewMap() +m.Store("hello", "world") +elem, found := m.Load("hello") +// elem will be "world" +// found will be true +``` + +# concurrent.Executor + +```go +executor := concurrent.NewUnboundedExecutor() +executor.Go(func(ctx context.Context) { + everyMillisecond := time.NewTicker(time.Millisecond) + for { + select { + case <-ctx.Done(): + fmt.Println("goroutine exited") + return + case <-everyMillisecond.C: + // do something + } + } +}) +time.Sleep(time.Second) +executor.StopAndWaitForever() +fmt.Println("executor stopped") +``` + +attach goroutine to executor instance, so that we can + +* cancel it by stop the executor with Stop/StopAndWait/StopAndWaitForever +* handle panic by callback: the default behavior will no longer crash your application
\ No newline at end of file diff --git a/vendor/github.com/modern-go/concurrent/executor.go b/vendor/github.com/modern-go/concurrent/executor.go new file mode 100644 index 000000000..623dba1ac --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/executor.go @@ -0,0 +1,14 @@ +package concurrent + +import "context" + +// Executor replace go keyword to start a new goroutine +// the goroutine should cancel itself if the context passed in has been cancelled +// the goroutine started by the executor, is owned by the executor +// we can cancel all executors owned by the executor just by stop the executor itself +// however Executor interface does not Stop method, the one starting and owning executor +// should use the concrete type of executor, instead of this interface. +type Executor interface { + // Go starts a new goroutine controlled by the context + Go(handler func(ctx context.Context)) +} diff --git a/vendor/github.com/modern-go/concurrent/go_above_19.go b/vendor/github.com/modern-go/concurrent/go_above_19.go new file mode 100644 index 000000000..aeabf8c4f --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/go_above_19.go @@ -0,0 +1,15 @@ +//+build go1.9 + +package concurrent + +import "sync" + +// Map is a wrapper for sync.Map introduced in go1.9 +type Map struct { + sync.Map +} + +// NewMap creates a thread safe Map +func NewMap() *Map { + return &Map{} +} diff --git a/vendor/github.com/modern-go/concurrent/go_below_19.go b/vendor/github.com/modern-go/concurrent/go_below_19.go new file mode 100644 index 000000000..b9c8df7f4 --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/go_below_19.go @@ -0,0 +1,33 @@ +//+build !go1.9 + +package concurrent + +import "sync" + +// Map implements a thread safe map for go version below 1.9 using mutex +type Map struct { + lock sync.RWMutex + data map[interface{}]interface{} +} + +// NewMap creates a thread safe map +func NewMap() *Map { + return &Map{ + data: make(map[interface{}]interface{}, 32), + } +} + +// Load is same as sync.Map Load +func (m *Map) Load(key interface{}) (elem interface{}, found bool) { + m.lock.RLock() + elem, found = m.data[key] + m.lock.RUnlock() + return +} + +// Load is same as sync.Map Store +func (m *Map) Store(key interface{}, elem interface{}) { + m.lock.Lock() + m.data[key] = elem + m.lock.Unlock() +} diff --git a/vendor/github.com/modern-go/concurrent/log.go b/vendor/github.com/modern-go/concurrent/log.go new file mode 100644 index 000000000..9756fcc75 --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/log.go @@ -0,0 +1,13 @@ +package concurrent + +import ( + "os" + "log" + "io/ioutil" +) + +// ErrorLogger is used to print out error, can be set to writer other than stderr +var ErrorLogger = log.New(os.Stderr, "", 0) + +// InfoLogger is used to print informational message, default to off +var InfoLogger = log.New(ioutil.Discard, "", 0)
\ No newline at end of file diff --git a/vendor/github.com/modern-go/concurrent/unbounded_executor.go b/vendor/github.com/modern-go/concurrent/unbounded_executor.go new file mode 100644 index 000000000..05a77dceb --- /dev/null +++ b/vendor/github.com/modern-go/concurrent/unbounded_executor.go @@ -0,0 +1,119 @@ +package concurrent + +import ( + "context" + "fmt" + "runtime" + "runtime/debug" + "sync" + "time" + "reflect" +) + +// HandlePanic logs goroutine panic by default +var HandlePanic = func(recovered interface{}, funcName string) { + ErrorLogger.Println(fmt.Sprintf("%s panic: %v", funcName, recovered)) + ErrorLogger.Println(string(debug.Stack())) +} + +// UnboundedExecutor is a executor without limits on counts of alive goroutines +// it tracks the goroutine started by it, and can cancel them when shutdown +type UnboundedExecutor struct { + ctx context.Context + cancel context.CancelFunc + activeGoroutinesMutex *sync.Mutex + activeGoroutines map[string]int + HandlePanic func(recovered interface{}, funcName string) +} + +// GlobalUnboundedExecutor has the life cycle of the program itself +// any goroutine want to be shutdown before main exit can be started from this executor +// GlobalUnboundedExecutor expects the main function to call stop +// it does not magically knows the main function exits +var GlobalUnboundedExecutor = NewUnboundedExecutor() + +// NewUnboundedExecutor creates a new UnboundedExecutor, +// UnboundedExecutor can not be created by &UnboundedExecutor{} +// HandlePanic can be set with a callback to override global HandlePanic +func NewUnboundedExecutor() *UnboundedExecutor { + ctx, cancel := context.WithCancel(context.TODO()) + return &UnboundedExecutor{ + ctx: ctx, + cancel: cancel, + activeGoroutinesMutex: &sync.Mutex{}, + activeGoroutines: map[string]int{}, + } +} + +// Go starts a new goroutine and tracks its lifecycle. +// Panic will be recovered and logged automatically, except for StopSignal +func (executor *UnboundedExecutor) Go(handler func(ctx context.Context)) { + pc := reflect.ValueOf(handler).Pointer() + f := runtime.FuncForPC(pc) + funcName := f.Name() + file, line := f.FileLine(pc) + executor.activeGoroutinesMutex.Lock() + defer executor.activeGoroutinesMutex.Unlock() + startFrom := fmt.Sprintf("%s:%d", file, line) + executor.activeGoroutines[startFrom] += 1 + go func() { + defer func() { + recovered := recover() + // if you want to quit a goroutine without trigger HandlePanic + // use runtime.Goexit() to quit + if recovered != nil { + if executor.HandlePanic == nil { + HandlePanic(recovered, funcName) + } else { + executor.HandlePanic(recovered, funcName) + } + } + executor.activeGoroutinesMutex.Lock() + executor.activeGoroutines[startFrom] -= 1 + executor.activeGoroutinesMutex.Unlock() + }() + handler(executor.ctx) + }() +} + +// Stop cancel all goroutines started by this executor without wait +func (executor *UnboundedExecutor) Stop() { + executor.cancel() +} + +// StopAndWaitForever cancel all goroutines started by this executor and +// wait until all goroutines exited +func (executor *UnboundedExecutor) StopAndWaitForever() { + executor.StopAndWait(context.Background()) +} + +// StopAndWait cancel all goroutines started by this executor and wait. +// Wait can be cancelled by the context passed in. +func (executor *UnboundedExecutor) StopAndWait(ctx context.Context) { + executor.cancel() + for { + oneHundredMilliseconds := time.NewTimer(time.Millisecond * 100) + select { + case <-oneHundredMilliseconds.C: + if executor.checkNoActiveGoroutines() { + return + } + case <-ctx.Done(): + return + } + } +} + +func (executor *UnboundedExecutor) checkNoActiveGoroutines() bool { + executor.activeGoroutinesMutex.Lock() + defer executor.activeGoroutinesMutex.Unlock() + for startFrom, count := range executor.activeGoroutines { + if count > 0 { + InfoLogger.Println("UnboundedExecutor is still waiting goroutines to quit", + "startFrom", startFrom, + "count", count) + return false + } + } + return true +} diff --git a/vendor/github.com/modern-go/reflect2/LICENSE b/vendor/github.com/modern-go/reflect2/LICENSE new file mode 100644 index 000000000..261eeb9e9 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/modern-go/reflect2/README.md b/vendor/github.com/modern-go/reflect2/README.md new file mode 100644 index 000000000..6f968aab9 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/README.md @@ -0,0 +1,71 @@ +# reflect2 + +[](https://sourcegraph.com/github.com/modern-go/reflect2?badge) +[](http://godoc.org/github.com/modern-go/reflect2) +[](https://travis-ci.org/modern-go/reflect2) +[](https://codecov.io/gh/modern-go/reflect2) +[](https://goreportcard.com/report/github.com/modern-go/reflect2) +[](https://raw.githubusercontent.com/modern-go/reflect2/master/LICENSE) + +reflect api that avoids runtime reflect.Value cost + +* reflect get/set interface{}, with type checking +* reflect get/set unsafe.Pointer, without type checking +* `reflect2.TypeByName` works like `Class.forName` found in java + +[json-iterator](https://github.com/json-iterator/go) use this package to save runtime dispatching cost. +This package is designed for low level libraries to optimize reflection performance. +General application should still use reflect standard library. + +# reflect2.TypeByName + +```go +// given package is github.com/your/awesome-package +type MyStruct struct { + // ... +} + +// will return the type +reflect2.TypeByName("awesome-package.MyStruct") +// however, if the type has not been used +// it will be eliminated by compiler, so we can not get it in runtime +``` + +# reflect2 get/set interface{} + +```go +valType := reflect2.TypeOf(1) +i := 1 +j := 10 +valType.Set(&i, &j) +// i will be 10 +``` + +to get set `type`, always use its pointer `*type` + +# reflect2 get/set unsafe.Pointer + +```go +valType := reflect2.TypeOf(1) +i := 1 +j := 10 +valType.UnsafeSet(unsafe.Pointer(&i), unsafe.Pointer(&j)) +// i will be 10 +``` + +to get set `type`, always use its pointer `*type` + +# benchmark + +Benchmark is not necessary for this package. It does nothing actually. +As it is just a thin wrapper to make go runtime public. +Both `reflect2` and `reflect` call same function +provided by `runtime` package exposed by go language. + +# unsafe safety + +Instead of casting `[]byte` to `sliceHeader` in your application using unsafe. +We can use reflect2 instead. This way, if `sliceHeader` changes in the future, +only reflect2 need to be upgraded. + +reflect2 tries its best to keep the implementation same as reflect (by testing).
\ No newline at end of file diff --git a/vendor/github.com/modern-go/reflect2/go_above_17.go b/vendor/github.com/modern-go/reflect2/go_above_17.go new file mode 100644 index 000000000..5c1cea868 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/go_above_17.go @@ -0,0 +1,8 @@ +//+build go1.7 + +package reflect2 + +import "unsafe" + +//go:linkname resolveTypeOff reflect.resolveTypeOff +func resolveTypeOff(rtype unsafe.Pointer, off int32) unsafe.Pointer diff --git a/vendor/github.com/modern-go/reflect2/go_above_19.go b/vendor/github.com/modern-go/reflect2/go_above_19.go new file mode 100644 index 000000000..c7e3b7801 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/go_above_19.go @@ -0,0 +1,14 @@ +//+build go1.9 + +package reflect2 + +import ( + "unsafe" +) + +//go:linkname makemap reflect.makemap +func makemap(rtype unsafe.Pointer, cap int) (m unsafe.Pointer) + +func makeMapWithSize(rtype unsafe.Pointer, cap int) unsafe.Pointer { + return makemap(rtype, cap) +} diff --git a/vendor/github.com/modern-go/reflect2/go_below_17.go b/vendor/github.com/modern-go/reflect2/go_below_17.go new file mode 100644 index 000000000..65a93c889 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/go_below_17.go @@ -0,0 +1,9 @@ +//+build !go1.7 + +package reflect2 + +import "unsafe" + +func resolveTypeOff(rtype unsafe.Pointer, off int32) unsafe.Pointer { + return nil +} diff --git a/vendor/github.com/modern-go/reflect2/go_below_19.go b/vendor/github.com/modern-go/reflect2/go_below_19.go new file mode 100644 index 000000000..b050ef70c --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/go_below_19.go @@ -0,0 +1,14 @@ +//+build !go1.9 + +package reflect2 + +import ( + "unsafe" +) + +//go:linkname makemap reflect.makemap +func makemap(rtype unsafe.Pointer) (m unsafe.Pointer) + +func makeMapWithSize(rtype unsafe.Pointer, cap int) unsafe.Pointer { + return makemap(rtype) +} diff --git a/vendor/github.com/modern-go/reflect2/reflect2.go b/vendor/github.com/modern-go/reflect2/reflect2.go new file mode 100644 index 000000000..63b49c799 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/reflect2.go @@ -0,0 +1,298 @@ +package reflect2 + +import ( + "github.com/modern-go/concurrent" + "reflect" + "unsafe" +) + +type Type interface { + Kind() reflect.Kind + // New return pointer to data of this type + New() interface{} + // UnsafeNew return the allocated space pointed by unsafe.Pointer + UnsafeNew() unsafe.Pointer + // PackEFace cast a unsafe pointer to object represented pointer + PackEFace(ptr unsafe.Pointer) interface{} + // Indirect dereference object represented pointer to this type + Indirect(obj interface{}) interface{} + // UnsafeIndirect dereference pointer to this type + UnsafeIndirect(ptr unsafe.Pointer) interface{} + // Type1 returns reflect.Type + Type1() reflect.Type + Implements(thatType Type) bool + String() string + RType() uintptr + // interface{} of this type has pointer like behavior + LikePtr() bool + IsNullable() bool + IsNil(obj interface{}) bool + UnsafeIsNil(ptr unsafe.Pointer) bool + Set(obj interface{}, val interface{}) + UnsafeSet(ptr unsafe.Pointer, val unsafe.Pointer) + AssignableTo(anotherType Type) bool +} + +type ListType interface { + Type + Elem() Type + SetIndex(obj interface{}, index int, elem interface{}) + UnsafeSetIndex(obj unsafe.Pointer, index int, elem unsafe.Pointer) + GetIndex(obj interface{}, index int) interface{} + UnsafeGetIndex(obj unsafe.Pointer, index int) unsafe.Pointer +} + +type ArrayType interface { + ListType + Len() int +} + +type SliceType interface { + ListType + MakeSlice(length int, cap int) interface{} + UnsafeMakeSlice(length int, cap int) unsafe.Pointer + Grow(obj interface{}, newLength int) + UnsafeGrow(ptr unsafe.Pointer, newLength int) + Append(obj interface{}, elem interface{}) + UnsafeAppend(obj unsafe.Pointer, elem unsafe.Pointer) + LengthOf(obj interface{}) int + UnsafeLengthOf(ptr unsafe.Pointer) int + SetNil(obj interface{}) + UnsafeSetNil(ptr unsafe.Pointer) + Cap(obj interface{}) int + UnsafeCap(ptr unsafe.Pointer) int +} + +type StructType interface { + Type + NumField() int + Field(i int) StructField + FieldByName(name string) StructField + FieldByIndex(index []int) StructField + FieldByNameFunc(match func(string) bool) StructField +} + +type StructField interface { + Offset() uintptr + Name() string + PkgPath() string + Type() Type + Tag() reflect.StructTag + Index() []int + Anonymous() bool + Set(obj interface{}, value interface{}) + UnsafeSet(obj unsafe.Pointer, value unsafe.Pointer) + Get(obj interface{}) interface{} + UnsafeGet(obj unsafe.Pointer) unsafe.Pointer +} + +type MapType interface { + Type + Key() Type + Elem() Type + MakeMap(cap int) interface{} + UnsafeMakeMap(cap int) unsafe.Pointer + SetIndex(obj interface{}, key interface{}, elem interface{}) + UnsafeSetIndex(obj unsafe.Pointer, key unsafe.Pointer, elem unsafe.Pointer) + TryGetIndex(obj interface{}, key interface{}) (interface{}, bool) + GetIndex(obj interface{}, key interface{}) interface{} + UnsafeGetIndex(obj unsafe.Pointer, key unsafe.Pointer) unsafe.Pointer + Iterate(obj interface{}) MapIterator + UnsafeIterate(obj unsafe.Pointer) MapIterator +} + +type MapIterator interface { + HasNext() bool + Next() (key interface{}, elem interface{}) + UnsafeNext() (key unsafe.Pointer, elem unsafe.Pointer) +} + +type PtrType interface { + Type + Elem() Type +} + +type InterfaceType interface { + NumMethod() int +} + +type Config struct { + UseSafeImplementation bool +} + +type API interface { + TypeOf(obj interface{}) Type + Type2(type1 reflect.Type) Type +} + +var ConfigUnsafe = Config{UseSafeImplementation: false}.Froze() +var ConfigSafe = Config{UseSafeImplementation: true}.Froze() + +type frozenConfig struct { + useSafeImplementation bool + cache *concurrent.Map +} + +func (cfg Config) Froze() *frozenConfig { + return &frozenConfig{ + useSafeImplementation: cfg.UseSafeImplementation, + cache: concurrent.NewMap(), + } +} + +func (cfg *frozenConfig) TypeOf(obj interface{}) Type { + cacheKey := uintptr(unpackEFace(obj).rtype) + typeObj, found := cfg.cache.Load(cacheKey) + if found { + return typeObj.(Type) + } + return cfg.Type2(reflect.TypeOf(obj)) +} + +func (cfg *frozenConfig) Type2(type1 reflect.Type) Type { + if type1 == nil { + return nil + } + cacheKey := uintptr(unpackEFace(type1).data) + typeObj, found := cfg.cache.Load(cacheKey) + if found { + return typeObj.(Type) + } + type2 := cfg.wrapType(type1) + cfg.cache.Store(cacheKey, type2) + return type2 +} + +func (cfg *frozenConfig) wrapType(type1 reflect.Type) Type { + safeType := safeType{Type: type1, cfg: cfg} + switch type1.Kind() { + case reflect.Struct: + if cfg.useSafeImplementation { + return &safeStructType{safeType} + } + return newUnsafeStructType(cfg, type1) + case reflect.Array: + if cfg.useSafeImplementation { + return &safeSliceType{safeType} + } + return newUnsafeArrayType(cfg, type1) + case reflect.Slice: + if cfg.useSafeImplementation { + return &safeSliceType{safeType} + } + return newUnsafeSliceType(cfg, type1) + case reflect.Map: + if cfg.useSafeImplementation { + return &safeMapType{safeType} + } + return newUnsafeMapType(cfg, type1) + case reflect.Ptr, reflect.Chan, reflect.Func: + if cfg.useSafeImplementation { + return &safeMapType{safeType} + } + return newUnsafePtrType(cfg, type1) + case reflect.Interface: + if cfg.useSafeImplementation { + return &safeMapType{safeType} + } + if type1.NumMethod() == 0 { + return newUnsafeEFaceType(cfg, type1) + } + return newUnsafeIFaceType(cfg, type1) + default: + if cfg.useSafeImplementation { + return &safeType + } + return newUnsafeType(cfg, type1) + } +} + +func TypeOf(obj interface{}) Type { + return ConfigUnsafe.TypeOf(obj) +} + +func TypeOfPtr(obj interface{}) PtrType { + return TypeOf(obj).(PtrType) +} + +func Type2(type1 reflect.Type) Type { + if type1 == nil { + return nil + } + return ConfigUnsafe.Type2(type1) +} + +func PtrTo(typ Type) Type { + return Type2(reflect.PtrTo(typ.Type1())) +} + +func PtrOf(obj interface{}) unsafe.Pointer { + return unpackEFace(obj).data +} + +func RTypeOf(obj interface{}) uintptr { + return uintptr(unpackEFace(obj).rtype) +} + +func IsNil(obj interface{}) bool { + if obj == nil { + return true + } + return unpackEFace(obj).data == nil +} + +func IsNullable(kind reflect.Kind) bool { + switch kind { + case reflect.Ptr, reflect.Map, reflect.Chan, reflect.Func, reflect.Slice, reflect.Interface: + return true + } + return false +} + +func likePtrKind(kind reflect.Kind) bool { + switch kind { + case reflect.Ptr, reflect.Map, reflect.Chan, reflect.Func: + return true + } + return false +} + +func likePtrType(typ reflect.Type) bool { + if likePtrKind(typ.Kind()) { + return true + } + if typ.Kind() == reflect.Struct { + if typ.NumField() != 1 { + return false + } + return likePtrType(typ.Field(0).Type) + } + if typ.Kind() == reflect.Array { + if typ.Len() != 1 { + return false + } + return likePtrType(typ.Elem()) + } + return false +} + +// NoEscape hides a pointer from escape analysis. noescape is +// the identity function but escape analysis doesn't think the +// output depends on the input. noescape is inlined and currently +// compiles down to zero instructions. +// USE CAREFULLY! +//go:nosplit +func NoEscape(p unsafe.Pointer) unsafe.Pointer { + x := uintptr(p) + return unsafe.Pointer(x ^ 0) +} + +func UnsafeCastString(str string) []byte { + stringHeader := (*reflect.StringHeader)(unsafe.Pointer(&str)) + sliceHeader := &reflect.SliceHeader{ + Data: stringHeader.Data, + Cap: stringHeader.Len, + Len: stringHeader.Len, + } + return *(*[]byte)(unsafe.Pointer(sliceHeader)) +} diff --git a/vendor/github.com/modern-go/reflect2/reflect2_amd64.s b/vendor/github.com/modern-go/reflect2/reflect2_amd64.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/reflect2_amd64.s diff --git a/vendor/github.com/modern-go/reflect2/reflect2_kind.go b/vendor/github.com/modern-go/reflect2/reflect2_kind.go new file mode 100644 index 000000000..62f299e40 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/reflect2_kind.go @@ -0,0 +1,30 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +// DefaultTypeOfKind return the non aliased default type for the kind +func DefaultTypeOfKind(kind reflect.Kind) Type { + return kindTypes[kind] +} + +var kindTypes = map[reflect.Kind]Type{ + reflect.Bool: TypeOf(true), + reflect.Uint8: TypeOf(uint8(0)), + reflect.Int8: TypeOf(int8(0)), + reflect.Uint16: TypeOf(uint16(0)), + reflect.Int16: TypeOf(int16(0)), + reflect.Uint32: TypeOf(uint32(0)), + reflect.Int32: TypeOf(int32(0)), + reflect.Uint64: TypeOf(uint64(0)), + reflect.Int64: TypeOf(int64(0)), + reflect.Uint: TypeOf(uint(0)), + reflect.Int: TypeOf(int(0)), + reflect.Float32: TypeOf(float32(0)), + reflect.Float64: TypeOf(float64(0)), + reflect.Uintptr: TypeOf(uintptr(0)), + reflect.String: TypeOf(""), + reflect.UnsafePointer: TypeOf(unsafe.Pointer(nil)), +} diff --git a/vendor/github.com/modern-go/reflect2/relfect2_386.s b/vendor/github.com/modern-go/reflect2/relfect2_386.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_386.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_amd64p32.s b/vendor/github.com/modern-go/reflect2/relfect2_amd64p32.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_amd64p32.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_arm.s b/vendor/github.com/modern-go/reflect2/relfect2_arm.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_arm.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_arm64.s b/vendor/github.com/modern-go/reflect2/relfect2_arm64.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_arm64.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_mips64x.s b/vendor/github.com/modern-go/reflect2/relfect2_mips64x.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_mips64x.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_mipsx.s b/vendor/github.com/modern-go/reflect2/relfect2_mipsx.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_mipsx.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_ppc64x.s b/vendor/github.com/modern-go/reflect2/relfect2_ppc64x.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_ppc64x.s diff --git a/vendor/github.com/modern-go/reflect2/relfect2_s390x.s b/vendor/github.com/modern-go/reflect2/relfect2_s390x.s new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/relfect2_s390x.s diff --git a/vendor/github.com/modern-go/reflect2/safe_field.go b/vendor/github.com/modern-go/reflect2/safe_field.go new file mode 100644 index 000000000..d4ba1f4f8 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/safe_field.go @@ -0,0 +1,58 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type safeField struct { + reflect.StructField +} + +func (field *safeField) Offset() uintptr { + return field.StructField.Offset +} + +func (field *safeField) Name() string { + return field.StructField.Name +} + +func (field *safeField) PkgPath() string { + return field.StructField.PkgPath +} + +func (field *safeField) Type() Type { + panic("not implemented") +} + +func (field *safeField) Tag() reflect.StructTag { + return field.StructField.Tag +} + +func (field *safeField) Index() []int { + return field.StructField.Index +} + +func (field *safeField) Anonymous() bool { + return field.StructField.Anonymous +} + +func (field *safeField) Set(obj interface{}, value interface{}) { + val := reflect.ValueOf(obj).Elem() + val.FieldByIndex(field.Index()).Set(reflect.ValueOf(value).Elem()) +} + +func (field *safeField) UnsafeSet(obj unsafe.Pointer, value unsafe.Pointer) { + panic("unsafe operation is not supported") +} + +func (field *safeField) Get(obj interface{}) interface{} { + val := reflect.ValueOf(obj).Elem().FieldByIndex(field.Index()) + ptr := reflect.New(val.Type()) + ptr.Elem().Set(val) + return ptr.Interface() +} + +func (field *safeField) UnsafeGet(obj unsafe.Pointer) unsafe.Pointer { + panic("does not support unsafe operation") +} diff --git a/vendor/github.com/modern-go/reflect2/safe_map.go b/vendor/github.com/modern-go/reflect2/safe_map.go new file mode 100644 index 000000000..88362205a --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/safe_map.go @@ -0,0 +1,101 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type safeMapType struct { + safeType +} + +func (type2 *safeMapType) Key() Type { + return type2.safeType.cfg.Type2(type2.Type.Key()) +} + +func (type2 *safeMapType) MakeMap(cap int) interface{} { + ptr := reflect.New(type2.Type) + ptr.Elem().Set(reflect.MakeMap(type2.Type)) + return ptr.Interface() +} + +func (type2 *safeMapType) UnsafeMakeMap(cap int) unsafe.Pointer { + panic("does not support unsafe operation") +} + +func (type2 *safeMapType) SetIndex(obj interface{}, key interface{}, elem interface{}) { + keyVal := reflect.ValueOf(key) + elemVal := reflect.ValueOf(elem) + val := reflect.ValueOf(obj) + val.Elem().SetMapIndex(keyVal.Elem(), elemVal.Elem()) +} + +func (type2 *safeMapType) UnsafeSetIndex(obj unsafe.Pointer, key unsafe.Pointer, elem unsafe.Pointer) { + panic("does not support unsafe operation") +} + +func (type2 *safeMapType) TryGetIndex(obj interface{}, key interface{}) (interface{}, bool) { + keyVal := reflect.ValueOf(key) + if key == nil { + keyVal = reflect.New(type2.Type.Key()).Elem() + } + val := reflect.ValueOf(obj).MapIndex(keyVal) + if !val.IsValid() { + return nil, false + } + return val.Interface(), true +} + +func (type2 *safeMapType) GetIndex(obj interface{}, key interface{}) interface{} { + val := reflect.ValueOf(obj).Elem() + keyVal := reflect.ValueOf(key).Elem() + elemVal := val.MapIndex(keyVal) + if !elemVal.IsValid() { + ptr := reflect.New(reflect.PtrTo(val.Type().Elem())) + return ptr.Elem().Interface() + } + ptr := reflect.New(elemVal.Type()) + ptr.Elem().Set(elemVal) + return ptr.Interface() +} + +func (type2 *safeMapType) UnsafeGetIndex(obj unsafe.Pointer, key unsafe.Pointer) unsafe.Pointer { + panic("does not support unsafe operation") +} + +func (type2 *safeMapType) Iterate(obj interface{}) MapIterator { + m := reflect.ValueOf(obj).Elem() + return &safeMapIterator{ + m: m, + keys: m.MapKeys(), + } +} + +func (type2 *safeMapType) UnsafeIterate(obj unsafe.Pointer) MapIterator { + panic("does not support unsafe operation") +} + +type safeMapIterator struct { + i int + m reflect.Value + keys []reflect.Value +} + +func (iter *safeMapIterator) HasNext() bool { + return iter.i != len(iter.keys) +} + +func (iter *safeMapIterator) Next() (interface{}, interface{}) { + key := iter.keys[iter.i] + elem := iter.m.MapIndex(key) + iter.i += 1 + keyPtr := reflect.New(key.Type()) + keyPtr.Elem().Set(key) + elemPtr := reflect.New(elem.Type()) + elemPtr.Elem().Set(elem) + return keyPtr.Interface(), elemPtr.Interface() +} + +func (iter *safeMapIterator) UnsafeNext() (unsafe.Pointer, unsafe.Pointer) { + panic("does not support unsafe operation") +} diff --git a/vendor/github.com/modern-go/reflect2/safe_slice.go b/vendor/github.com/modern-go/reflect2/safe_slice.go new file mode 100644 index 000000000..bcce6fd20 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/safe_slice.go @@ -0,0 +1,92 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type safeSliceType struct { + safeType +} + +func (type2 *safeSliceType) SetIndex(obj interface{}, index int, value interface{}) { + val := reflect.ValueOf(obj).Elem() + elem := reflect.ValueOf(value).Elem() + val.Index(index).Set(elem) +} + +func (type2 *safeSliceType) UnsafeSetIndex(obj unsafe.Pointer, index int, value unsafe.Pointer) { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) GetIndex(obj interface{}, index int) interface{} { + val := reflect.ValueOf(obj).Elem() + elem := val.Index(index) + ptr := reflect.New(elem.Type()) + ptr.Elem().Set(elem) + return ptr.Interface() +} + +func (type2 *safeSliceType) UnsafeGetIndex(obj unsafe.Pointer, index int) unsafe.Pointer { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) MakeSlice(length int, cap int) interface{} { + val := reflect.MakeSlice(type2.Type, length, cap) + ptr := reflect.New(val.Type()) + ptr.Elem().Set(val) + return ptr.Interface() +} + +func (type2 *safeSliceType) UnsafeMakeSlice(length int, cap int) unsafe.Pointer { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) Grow(obj interface{}, newLength int) { + oldCap := type2.Cap(obj) + oldSlice := reflect.ValueOf(obj).Elem() + delta := newLength - oldCap + deltaVals := make([]reflect.Value, delta) + newSlice := reflect.Append(oldSlice, deltaVals...) + oldSlice.Set(newSlice) +} + +func (type2 *safeSliceType) UnsafeGrow(ptr unsafe.Pointer, newLength int) { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) Append(obj interface{}, elem interface{}) { + val := reflect.ValueOf(obj).Elem() + elemVal := reflect.ValueOf(elem).Elem() + newVal := reflect.Append(val, elemVal) + val.Set(newVal) +} + +func (type2 *safeSliceType) UnsafeAppend(obj unsafe.Pointer, elem unsafe.Pointer) { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) SetNil(obj interface{}) { + val := reflect.ValueOf(obj).Elem() + val.Set(reflect.Zero(val.Type())) +} + +func (type2 *safeSliceType) UnsafeSetNil(ptr unsafe.Pointer) { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) LengthOf(obj interface{}) int { + return reflect.ValueOf(obj).Elem().Len() +} + +func (type2 *safeSliceType) UnsafeLengthOf(ptr unsafe.Pointer) int { + panic("does not support unsafe operation") +} + +func (type2 *safeSliceType) Cap(obj interface{}) int { + return reflect.ValueOf(obj).Elem().Cap() +} + +func (type2 *safeSliceType) UnsafeCap(ptr unsafe.Pointer) int { + panic("does not support unsafe operation") +} diff --git a/vendor/github.com/modern-go/reflect2/safe_struct.go b/vendor/github.com/modern-go/reflect2/safe_struct.go new file mode 100644 index 000000000..e5fb9b313 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/safe_struct.go @@ -0,0 +1,29 @@ +package reflect2 + +type safeStructType struct { + safeType +} + +func (type2 *safeStructType) FieldByName(name string) StructField { + field, found := type2.Type.FieldByName(name) + if !found { + panic("field " + name + " not found") + } + return &safeField{StructField: field} +} + +func (type2 *safeStructType) Field(i int) StructField { + return &safeField{StructField: type2.Type.Field(i)} +} + +func (type2 *safeStructType) FieldByIndex(index []int) StructField { + return &safeField{StructField: type2.Type.FieldByIndex(index)} +} + +func (type2 *safeStructType) FieldByNameFunc(match func(string) bool) StructField { + field, found := type2.Type.FieldByNameFunc(match) + if !found { + panic("field match condition not found in " + type2.Type.String()) + } + return &safeField{StructField: field} +} diff --git a/vendor/github.com/modern-go/reflect2/safe_type.go b/vendor/github.com/modern-go/reflect2/safe_type.go new file mode 100644 index 000000000..ee4e7bb6e --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/safe_type.go @@ -0,0 +1,78 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type safeType struct { + reflect.Type + cfg *frozenConfig +} + +func (type2 *safeType) New() interface{} { + return reflect.New(type2.Type).Interface() +} + +func (type2 *safeType) UnsafeNew() unsafe.Pointer { + panic("does not support unsafe operation") +} + +func (type2 *safeType) Elem() Type { + return type2.cfg.Type2(type2.Type.Elem()) +} + +func (type2 *safeType) Type1() reflect.Type { + return type2.Type +} + +func (type2 *safeType) PackEFace(ptr unsafe.Pointer) interface{} { + panic("does not support unsafe operation") +} + +func (type2 *safeType) Implements(thatType Type) bool { + return type2.Type.Implements(thatType.Type1()) +} + +func (type2 *safeType) RType() uintptr { + panic("does not support unsafe operation") +} + +func (type2 *safeType) Indirect(obj interface{}) interface{} { + return reflect.Indirect(reflect.ValueOf(obj)).Interface() +} + +func (type2 *safeType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + panic("does not support unsafe operation") +} + +func (type2 *safeType) LikePtr() bool { + panic("does not support unsafe operation") +} + +func (type2 *safeType) IsNullable() bool { + return IsNullable(type2.Kind()) +} + +func (type2 *safeType) IsNil(obj interface{}) bool { + if obj == nil { + return true + } + return reflect.ValueOf(obj).Elem().IsNil() +} + +func (type2 *safeType) UnsafeIsNil(ptr unsafe.Pointer) bool { + panic("does not support unsafe operation") +} + +func (type2 *safeType) Set(obj interface{}, val interface{}) { + reflect.ValueOf(obj).Elem().Set(reflect.ValueOf(val).Elem()) +} + +func (type2 *safeType) UnsafeSet(ptr unsafe.Pointer, val unsafe.Pointer) { + panic("does not support unsafe operation") +} + +func (type2 *safeType) AssignableTo(anotherType Type) bool { + return type2.Type1().AssignableTo(anotherType.Type1()) +} diff --git a/vendor/github.com/modern-go/reflect2/type_map.go b/vendor/github.com/modern-go/reflect2/type_map.go new file mode 100644 index 000000000..6d489112f --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/type_map.go @@ -0,0 +1,103 @@ +package reflect2 + +import ( + "reflect" + "runtime" + "strings" + "unsafe" +) + +// typelinks1 for 1.5 ~ 1.6 +//go:linkname typelinks1 reflect.typelinks +func typelinks1() [][]unsafe.Pointer + +// typelinks2 for 1.7 ~ +//go:linkname typelinks2 reflect.typelinks +func typelinks2() (sections []unsafe.Pointer, offset [][]int32) + +var types = map[string]reflect.Type{} +var packages = map[string]map[string]reflect.Type{} + +func init() { + ver := runtime.Version() + if ver == "go1.5" || strings.HasPrefix(ver, "go1.5.") { + loadGo15Types() + } else if ver == "go1.6" || strings.HasPrefix(ver, "go1.6.") { + loadGo15Types() + } else { + loadGo17Types() + } +} + +func loadGo15Types() { + var obj interface{} = reflect.TypeOf(0) + typePtrss := typelinks1() + for _, typePtrs := range typePtrss { + for _, typePtr := range typePtrs { + (*emptyInterface)(unsafe.Pointer(&obj)).word = typePtr + typ := obj.(reflect.Type) + if typ.Kind() == reflect.Ptr && typ.Elem().Kind() == reflect.Struct { + loadedType := typ.Elem() + pkgTypes := packages[loadedType.PkgPath()] + if pkgTypes == nil { + pkgTypes = map[string]reflect.Type{} + packages[loadedType.PkgPath()] = pkgTypes + } + types[loadedType.String()] = loadedType + pkgTypes[loadedType.Name()] = loadedType + } + if typ.Kind() == reflect.Slice && typ.Elem().Kind() == reflect.Ptr && + typ.Elem().Elem().Kind() == reflect.Struct { + loadedType := typ.Elem().Elem() + pkgTypes := packages[loadedType.PkgPath()] + if pkgTypes == nil { + pkgTypes = map[string]reflect.Type{} + packages[loadedType.PkgPath()] = pkgTypes + } + types[loadedType.String()] = loadedType + pkgTypes[loadedType.Name()] = loadedType + } + } + } +} + +func loadGo17Types() { + var obj interface{} = reflect.TypeOf(0) + sections, offset := typelinks2() + for i, offs := range offset { + rodata := sections[i] + for _, off := range offs { + (*emptyInterface)(unsafe.Pointer(&obj)).word = resolveTypeOff(unsafe.Pointer(rodata), off) + typ := obj.(reflect.Type) + if typ.Kind() == reflect.Ptr && typ.Elem().Kind() == reflect.Struct { + loadedType := typ.Elem() + pkgTypes := packages[loadedType.PkgPath()] + if pkgTypes == nil { + pkgTypes = map[string]reflect.Type{} + packages[loadedType.PkgPath()] = pkgTypes + } + types[loadedType.String()] = loadedType + pkgTypes[loadedType.Name()] = loadedType + } + } + } +} + +type emptyInterface struct { + typ unsafe.Pointer + word unsafe.Pointer +} + +// TypeByName return the type by its name, just like Class.forName in java +func TypeByName(typeName string) Type { + return Type2(types[typeName]) +} + +// TypeByPackageName return the type by its package and name +func TypeByPackageName(pkgPath string, name string) Type { + pkgTypes := packages[pkgPath] + if pkgTypes == nil { + return nil + } + return Type2(pkgTypes[name]) +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_array.go b/vendor/github.com/modern-go/reflect2/unsafe_array.go new file mode 100644 index 000000000..76cbdba6e --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_array.go @@ -0,0 +1,65 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type UnsafeArrayType struct { + unsafeType + elemRType unsafe.Pointer + pElemRType unsafe.Pointer + elemSize uintptr + likePtr bool +} + +func newUnsafeArrayType(cfg *frozenConfig, type1 reflect.Type) *UnsafeArrayType { + return &UnsafeArrayType{ + unsafeType: *newUnsafeType(cfg, type1), + elemRType: unpackEFace(type1.Elem()).data, + pElemRType: unpackEFace(reflect.PtrTo(type1.Elem())).data, + elemSize: type1.Elem().Size(), + likePtr: likePtrType(type1), + } +} + +func (type2 *UnsafeArrayType) LikePtr() bool { + return type2.likePtr +} + +func (type2 *UnsafeArrayType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("Type.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *UnsafeArrayType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + if type2.likePtr { + return packEFace(type2.rtype, *(*unsafe.Pointer)(ptr)) + } + return packEFace(type2.rtype, ptr) +} + +func (type2 *UnsafeArrayType) SetIndex(obj interface{}, index int, elem interface{}) { + objEFace := unpackEFace(obj) + assertType("ArrayType.SetIndex argument 1", type2.ptrRType, objEFace.rtype) + elemEFace := unpackEFace(elem) + assertType("ArrayType.SetIndex argument 3", type2.pElemRType, elemEFace.rtype) + type2.UnsafeSetIndex(objEFace.data, index, elemEFace.data) +} + +func (type2 *UnsafeArrayType) UnsafeSetIndex(obj unsafe.Pointer, index int, elem unsafe.Pointer) { + elemPtr := arrayAt(obj, index, type2.elemSize, "i < s.Len") + typedmemmove(type2.elemRType, elemPtr, elem) +} + +func (type2 *UnsafeArrayType) GetIndex(obj interface{}, index int) interface{} { + objEFace := unpackEFace(obj) + assertType("ArrayType.GetIndex argument 1", type2.ptrRType, objEFace.rtype) + elemPtr := type2.UnsafeGetIndex(objEFace.data, index) + return packEFace(type2.pElemRType, elemPtr) +} + +func (type2 *UnsafeArrayType) UnsafeGetIndex(obj unsafe.Pointer, index int) unsafe.Pointer { + return arrayAt(obj, index, type2.elemSize, "i < s.Len") +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_eface.go b/vendor/github.com/modern-go/reflect2/unsafe_eface.go new file mode 100644 index 000000000..805010f3a --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_eface.go @@ -0,0 +1,59 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type eface struct { + rtype unsafe.Pointer + data unsafe.Pointer +} + +func unpackEFace(obj interface{}) *eface { + return (*eface)(unsafe.Pointer(&obj)) +} + +func packEFace(rtype unsafe.Pointer, data unsafe.Pointer) interface{} { + var i interface{} + e := (*eface)(unsafe.Pointer(&i)) + e.rtype = rtype + e.data = data + return i +} + +type UnsafeEFaceType struct { + unsafeType +} + +func newUnsafeEFaceType(cfg *frozenConfig, type1 reflect.Type) *UnsafeEFaceType { + return &UnsafeEFaceType{ + unsafeType: *newUnsafeType(cfg, type1), + } +} + +func (type2 *UnsafeEFaceType) IsNil(obj interface{}) bool { + if obj == nil { + return true + } + objEFace := unpackEFace(obj) + assertType("Type.IsNil argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIsNil(objEFace.data) +} + +func (type2 *UnsafeEFaceType) UnsafeIsNil(ptr unsafe.Pointer) bool { + if ptr == nil { + return true + } + return unpackEFace(*(*interface{})(ptr)).data == nil +} + +func (type2 *UnsafeEFaceType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("Type.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *UnsafeEFaceType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + return *(*interface{})(ptr) +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_field.go b/vendor/github.com/modern-go/reflect2/unsafe_field.go new file mode 100644 index 000000000..5eb53130a --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_field.go @@ -0,0 +1,74 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type UnsafeStructField struct { + reflect.StructField + structType *UnsafeStructType + rtype unsafe.Pointer + ptrRType unsafe.Pointer +} + +func newUnsafeStructField(structType *UnsafeStructType, structField reflect.StructField) *UnsafeStructField { + return &UnsafeStructField{ + StructField: structField, + rtype: unpackEFace(structField.Type).data, + ptrRType: unpackEFace(reflect.PtrTo(structField.Type)).data, + structType: structType, + } +} + +func (field *UnsafeStructField) Offset() uintptr { + return field.StructField.Offset +} + +func (field *UnsafeStructField) Name() string { + return field.StructField.Name +} + +func (field *UnsafeStructField) PkgPath() string { + return field.StructField.PkgPath +} + +func (field *UnsafeStructField) Type() Type { + return field.structType.cfg.Type2(field.StructField.Type) +} + +func (field *UnsafeStructField) Tag() reflect.StructTag { + return field.StructField.Tag +} + +func (field *UnsafeStructField) Index() []int { + return field.StructField.Index +} + +func (field *UnsafeStructField) Anonymous() bool { + return field.StructField.Anonymous +} + +func (field *UnsafeStructField) Set(obj interface{}, value interface{}) { + objEFace := unpackEFace(obj) + assertType("StructField.SetIndex argument 1", field.structType.ptrRType, objEFace.rtype) + valueEFace := unpackEFace(value) + assertType("StructField.SetIndex argument 2", field.ptrRType, valueEFace.rtype) + field.UnsafeSet(objEFace.data, valueEFace.data) +} + +func (field *UnsafeStructField) UnsafeSet(obj unsafe.Pointer, value unsafe.Pointer) { + fieldPtr := add(obj, field.StructField.Offset, "same as non-reflect &v.field") + typedmemmove(field.rtype, fieldPtr, value) +} + +func (field *UnsafeStructField) Get(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("StructField.GetIndex argument 1", field.structType.ptrRType, objEFace.rtype) + value := field.UnsafeGet(objEFace.data) + return packEFace(field.ptrRType, value) +} + +func (field *UnsafeStructField) UnsafeGet(obj unsafe.Pointer) unsafe.Pointer { + return add(obj, field.StructField.Offset, "same as non-reflect &v.field") +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_iface.go b/vendor/github.com/modern-go/reflect2/unsafe_iface.go new file mode 100644 index 000000000..b60195533 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_iface.go @@ -0,0 +1,64 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type iface struct { + itab *itab + data unsafe.Pointer +} + +type itab struct { + ignore unsafe.Pointer + rtype unsafe.Pointer +} + +func IFaceToEFace(ptr unsafe.Pointer) interface{} { + iface := (*iface)(ptr) + if iface.itab == nil { + return nil + } + return packEFace(iface.itab.rtype, iface.data) +} + +type UnsafeIFaceType struct { + unsafeType +} + +func newUnsafeIFaceType(cfg *frozenConfig, type1 reflect.Type) *UnsafeIFaceType { + return &UnsafeIFaceType{ + unsafeType: *newUnsafeType(cfg, type1), + } +} + +func (type2 *UnsafeIFaceType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("Type.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *UnsafeIFaceType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + return IFaceToEFace(ptr) +} + +func (type2 *UnsafeIFaceType) IsNil(obj interface{}) bool { + if obj == nil { + return true + } + objEFace := unpackEFace(obj) + assertType("Type.IsNil argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIsNil(objEFace.data) +} + +func (type2 *UnsafeIFaceType) UnsafeIsNil(ptr unsafe.Pointer) bool { + if ptr == nil { + return true + } + iface := (*iface)(ptr) + if iface.itab == nil { + return true + } + return false +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_link.go b/vendor/github.com/modern-go/reflect2/unsafe_link.go new file mode 100644 index 000000000..57229c8db --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_link.go @@ -0,0 +1,70 @@ +package reflect2 + +import "unsafe" + +//go:linkname unsafe_New reflect.unsafe_New +func unsafe_New(rtype unsafe.Pointer) unsafe.Pointer + +//go:linkname typedmemmove reflect.typedmemmove +func typedmemmove(rtype unsafe.Pointer, dst, src unsafe.Pointer) + +//go:linkname unsafe_NewArray reflect.unsafe_NewArray +func unsafe_NewArray(rtype unsafe.Pointer, length int) unsafe.Pointer + +// typedslicecopy copies a slice of elemType values from src to dst, +// returning the number of elements copied. +//go:linkname typedslicecopy reflect.typedslicecopy +//go:noescape +func typedslicecopy(elemType unsafe.Pointer, dst, src sliceHeader) int + +//go:linkname mapassign reflect.mapassign +//go:noescape +func mapassign(rtype unsafe.Pointer, m unsafe.Pointer, key, val unsafe.Pointer) + +//go:linkname mapaccess reflect.mapaccess +//go:noescape +func mapaccess(rtype unsafe.Pointer, m unsafe.Pointer, key unsafe.Pointer) (val unsafe.Pointer) + +// m escapes into the return value, but the caller of mapiterinit +// doesn't let the return value escape. +//go:noescape +//go:linkname mapiterinit reflect.mapiterinit +func mapiterinit(rtype unsafe.Pointer, m unsafe.Pointer) *hiter + +//go:noescape +//go:linkname mapiternext reflect.mapiternext +func mapiternext(it *hiter) + +//go:linkname ifaceE2I reflect.ifaceE2I +func ifaceE2I(rtype unsafe.Pointer, src interface{}, dst unsafe.Pointer) + +// A hash iteration structure. +// If you modify hiter, also change cmd/internal/gc/reflect.go to indicate +// the layout of this structure. +type hiter struct { + key unsafe.Pointer // Must be in first position. Write nil to indicate iteration end (see cmd/internal/gc/range.go). + value unsafe.Pointer // Must be in second position (see cmd/internal/gc/range.go). + // rest fields are ignored +} + +// add returns p+x. +// +// The whySafe string is ignored, so that the function still inlines +// as efficiently as p+x, but all call sites should use the string to +// record why the addition is safe, which is to say why the addition +// does not cause x to advance to the very end of p's allocation +// and therefore point incorrectly at the next block in memory. +func add(p unsafe.Pointer, x uintptr, whySafe string) unsafe.Pointer { + return unsafe.Pointer(uintptr(p) + x) +} + +// arrayAt returns the i-th element of p, +// an array whose elements are eltSize bytes wide. +// The array pointed at by p must have at least i+1 elements: +// it is invalid (but impossible to check here) to pass i >= len, +// because then the result will point outside the array. +// whySafe must explain why i < len. (Passing "i < len" is fine; +// the benefit is to surface this assumption at the call site.) +func arrayAt(p unsafe.Pointer, i int, eltSize uintptr, whySafe string) unsafe.Pointer { + return add(p, uintptr(i)*eltSize, "i < len") +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_map.go b/vendor/github.com/modern-go/reflect2/unsafe_map.go new file mode 100644 index 000000000..f2e76e6bb --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_map.go @@ -0,0 +1,138 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type UnsafeMapType struct { + unsafeType + pKeyRType unsafe.Pointer + pElemRType unsafe.Pointer +} + +func newUnsafeMapType(cfg *frozenConfig, type1 reflect.Type) MapType { + return &UnsafeMapType{ + unsafeType: *newUnsafeType(cfg, type1), + pKeyRType: unpackEFace(reflect.PtrTo(type1.Key())).data, + pElemRType: unpackEFace(reflect.PtrTo(type1.Elem())).data, + } +} + +func (type2 *UnsafeMapType) IsNil(obj interface{}) bool { + if obj == nil { + return true + } + objEFace := unpackEFace(obj) + assertType("Type.IsNil argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIsNil(objEFace.data) +} + +func (type2 *UnsafeMapType) UnsafeIsNil(ptr unsafe.Pointer) bool { + if ptr == nil { + return true + } + return *(*unsafe.Pointer)(ptr) == nil +} + +func (type2 *UnsafeMapType) LikePtr() bool { + return true +} + +func (type2 *UnsafeMapType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("MapType.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *UnsafeMapType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + return packEFace(type2.rtype, *(*unsafe.Pointer)(ptr)) +} + +func (type2 *UnsafeMapType) Key() Type { + return type2.cfg.Type2(type2.Type.Key()) +} + +func (type2 *UnsafeMapType) MakeMap(cap int) interface{} { + return packEFace(type2.ptrRType, type2.UnsafeMakeMap(cap)) +} + +func (type2 *UnsafeMapType) UnsafeMakeMap(cap int) unsafe.Pointer { + m := makeMapWithSize(type2.rtype, cap) + return unsafe.Pointer(&m) +} + +func (type2 *UnsafeMapType) SetIndex(obj interface{}, key interface{}, elem interface{}) { + objEFace := unpackEFace(obj) + assertType("MapType.SetIndex argument 1", type2.ptrRType, objEFace.rtype) + keyEFace := unpackEFace(key) + assertType("MapType.SetIndex argument 2", type2.pKeyRType, keyEFace.rtype) + elemEFace := unpackEFace(elem) + assertType("MapType.SetIndex argument 3", type2.pElemRType, elemEFace.rtype) + type2.UnsafeSetIndex(objEFace.data, keyEFace.data, elemEFace.data) +} + +func (type2 *UnsafeMapType) UnsafeSetIndex(obj unsafe.Pointer, key unsafe.Pointer, elem unsafe.Pointer) { + mapassign(type2.rtype, *(*unsafe.Pointer)(obj), key, elem) +} + +func (type2 *UnsafeMapType) TryGetIndex(obj interface{}, key interface{}) (interface{}, bool) { + objEFace := unpackEFace(obj) + assertType("MapType.TryGetIndex argument 1", type2.ptrRType, objEFace.rtype) + keyEFace := unpackEFace(key) + assertType("MapType.TryGetIndex argument 2", type2.pKeyRType, keyEFace.rtype) + elemPtr := type2.UnsafeGetIndex(objEFace.data, keyEFace.data) + if elemPtr == nil { + return nil, false + } + return packEFace(type2.pElemRType, elemPtr), true +} + +func (type2 *UnsafeMapType) GetIndex(obj interface{}, key interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("MapType.GetIndex argument 1", type2.ptrRType, objEFace.rtype) + keyEFace := unpackEFace(key) + assertType("MapType.GetIndex argument 2", type2.pKeyRType, keyEFace.rtype) + elemPtr := type2.UnsafeGetIndex(objEFace.data, keyEFace.data) + return packEFace(type2.pElemRType, elemPtr) +} + +func (type2 *UnsafeMapType) UnsafeGetIndex(obj unsafe.Pointer, key unsafe.Pointer) unsafe.Pointer { + return mapaccess(type2.rtype, *(*unsafe.Pointer)(obj), key) +} + +func (type2 *UnsafeMapType) Iterate(obj interface{}) MapIterator { + objEFace := unpackEFace(obj) + assertType("MapType.Iterate argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIterate(objEFace.data) +} + +func (type2 *UnsafeMapType) UnsafeIterate(obj unsafe.Pointer) MapIterator { + return &UnsafeMapIterator{ + hiter: mapiterinit(type2.rtype, *(*unsafe.Pointer)(obj)), + pKeyRType: type2.pKeyRType, + pElemRType: type2.pElemRType, + } +} + +type UnsafeMapIterator struct { + *hiter + pKeyRType unsafe.Pointer + pElemRType unsafe.Pointer +} + +func (iter *UnsafeMapIterator) HasNext() bool { + return iter.key != nil +} + +func (iter *UnsafeMapIterator) Next() (interface{}, interface{}) { + key, elem := iter.UnsafeNext() + return packEFace(iter.pKeyRType, key), packEFace(iter.pElemRType, elem) +} + +func (iter *UnsafeMapIterator) UnsafeNext() (unsafe.Pointer, unsafe.Pointer) { + key := iter.key + elem := iter.value + mapiternext(iter.hiter) + return key, elem +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_ptr.go b/vendor/github.com/modern-go/reflect2/unsafe_ptr.go new file mode 100644 index 000000000..8e5ec9cf4 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_ptr.go @@ -0,0 +1,46 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type UnsafePtrType struct { + unsafeType +} + +func newUnsafePtrType(cfg *frozenConfig, type1 reflect.Type) *UnsafePtrType { + return &UnsafePtrType{ + unsafeType: *newUnsafeType(cfg, type1), + } +} + +func (type2 *UnsafePtrType) IsNil(obj interface{}) bool { + if obj == nil { + return true + } + objEFace := unpackEFace(obj) + assertType("Type.IsNil argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIsNil(objEFace.data) +} + +func (type2 *UnsafePtrType) UnsafeIsNil(ptr unsafe.Pointer) bool { + if ptr == nil { + return true + } + return *(*unsafe.Pointer)(ptr) == nil +} + +func (type2 *UnsafePtrType) LikePtr() bool { + return true +} + +func (type2 *UnsafePtrType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("Type.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *UnsafePtrType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + return packEFace(type2.rtype, *(*unsafe.Pointer)(ptr)) +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_slice.go b/vendor/github.com/modern-go/reflect2/unsafe_slice.go new file mode 100644 index 000000000..1c6d876c7 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_slice.go @@ -0,0 +1,177 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +// sliceHeader is a safe version of SliceHeader used within this package. +type sliceHeader struct { + Data unsafe.Pointer + Len int + Cap int +} + +type UnsafeSliceType struct { + unsafeType + elemRType unsafe.Pointer + pElemRType unsafe.Pointer + elemSize uintptr +} + +func newUnsafeSliceType(cfg *frozenConfig, type1 reflect.Type) SliceType { + elemType := type1.Elem() + return &UnsafeSliceType{ + unsafeType: *newUnsafeType(cfg, type1), + pElemRType: unpackEFace(reflect.PtrTo(elemType)).data, + elemRType: unpackEFace(elemType).data, + elemSize: elemType.Size(), + } +} + +func (type2 *UnsafeSliceType) Set(obj interface{}, val interface{}) { + objEFace := unpackEFace(obj) + assertType("Type.Set argument 1", type2.ptrRType, objEFace.rtype) + valEFace := unpackEFace(val) + assertType("Type.Set argument 2", type2.ptrRType, valEFace.rtype) + type2.UnsafeSet(objEFace.data, valEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeSet(ptr unsafe.Pointer, val unsafe.Pointer) { + *(*sliceHeader)(ptr) = *(*sliceHeader)(val) +} + +func (type2 *UnsafeSliceType) IsNil(obj interface{}) bool { + if obj == nil { + return true + } + objEFace := unpackEFace(obj) + assertType("Type.IsNil argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIsNil(objEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeIsNil(ptr unsafe.Pointer) bool { + if ptr == nil { + return true + } + return (*sliceHeader)(ptr).Data == nil +} + +func (type2 *UnsafeSliceType) SetNil(obj interface{}) { + objEFace := unpackEFace(obj) + assertType("SliceType.SetNil argument 1", type2.ptrRType, objEFace.rtype) + type2.UnsafeSetNil(objEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeSetNil(ptr unsafe.Pointer) { + header := (*sliceHeader)(ptr) + header.Len = 0 + header.Cap = 0 + header.Data = nil +} + +func (type2 *UnsafeSliceType) MakeSlice(length int, cap int) interface{} { + return packEFace(type2.ptrRType, type2.UnsafeMakeSlice(length, cap)) +} + +func (type2 *UnsafeSliceType) UnsafeMakeSlice(length int, cap int) unsafe.Pointer { + header := &sliceHeader{unsafe_NewArray(type2.elemRType, cap), length, cap} + return unsafe.Pointer(header) +} + +func (type2 *UnsafeSliceType) LengthOf(obj interface{}) int { + objEFace := unpackEFace(obj) + assertType("SliceType.Len argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeLengthOf(objEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeLengthOf(obj unsafe.Pointer) int { + header := (*sliceHeader)(obj) + return header.Len +} + +func (type2 *UnsafeSliceType) SetIndex(obj interface{}, index int, elem interface{}) { + objEFace := unpackEFace(obj) + assertType("SliceType.SetIndex argument 1", type2.ptrRType, objEFace.rtype) + elemEFace := unpackEFace(elem) + assertType("SliceType.SetIndex argument 3", type2.pElemRType, elemEFace.rtype) + type2.UnsafeSetIndex(objEFace.data, index, elemEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeSetIndex(obj unsafe.Pointer, index int, elem unsafe.Pointer) { + header := (*sliceHeader)(obj) + elemPtr := arrayAt(header.Data, index, type2.elemSize, "i < s.Len") + typedmemmove(type2.elemRType, elemPtr, elem) +} + +func (type2 *UnsafeSliceType) GetIndex(obj interface{}, index int) interface{} { + objEFace := unpackEFace(obj) + assertType("SliceType.GetIndex argument 1", type2.ptrRType, objEFace.rtype) + elemPtr := type2.UnsafeGetIndex(objEFace.data, index) + return packEFace(type2.pElemRType, elemPtr) +} + +func (type2 *UnsafeSliceType) UnsafeGetIndex(obj unsafe.Pointer, index int) unsafe.Pointer { + header := (*sliceHeader)(obj) + return arrayAt(header.Data, index, type2.elemSize, "i < s.Len") +} + +func (type2 *UnsafeSliceType) Append(obj interface{}, elem interface{}) { + objEFace := unpackEFace(obj) + assertType("SliceType.Append argument 1", type2.ptrRType, objEFace.rtype) + elemEFace := unpackEFace(elem) + assertType("SliceType.Append argument 2", type2.pElemRType, elemEFace.rtype) + type2.UnsafeAppend(objEFace.data, elemEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeAppend(obj unsafe.Pointer, elem unsafe.Pointer) { + header := (*sliceHeader)(obj) + oldLen := header.Len + type2.UnsafeGrow(obj, oldLen+1) + type2.UnsafeSetIndex(obj, oldLen, elem) +} + +func (type2 *UnsafeSliceType) Cap(obj interface{}) int { + objEFace := unpackEFace(obj) + assertType("SliceType.Cap argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeCap(objEFace.data) +} + +func (type2 *UnsafeSliceType) UnsafeCap(ptr unsafe.Pointer) int { + return (*sliceHeader)(ptr).Cap +} + +func (type2 *UnsafeSliceType) Grow(obj interface{}, newLength int) { + objEFace := unpackEFace(obj) + assertType("SliceType.Grow argument 1", type2.ptrRType, objEFace.rtype) + type2.UnsafeGrow(objEFace.data, newLength) +} + +func (type2 *UnsafeSliceType) UnsafeGrow(obj unsafe.Pointer, newLength int) { + header := (*sliceHeader)(obj) + if newLength <= header.Cap { + header.Len = newLength + return + } + newCap := calcNewCap(header.Cap, newLength) + newHeader := (*sliceHeader)(type2.UnsafeMakeSlice(header.Len, newCap)) + typedslicecopy(type2.elemRType, *newHeader, *header) + header.Data = newHeader.Data + header.Cap = newHeader.Cap + header.Len = newLength +} + +func calcNewCap(cap int, expectedCap int) int { + if cap == 0 { + cap = expectedCap + } else { + for cap < expectedCap { + if cap < 1024 { + cap += cap + } else { + cap += cap / 4 + } + } + } + return cap +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_struct.go b/vendor/github.com/modern-go/reflect2/unsafe_struct.go new file mode 100644 index 000000000..804d91663 --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_struct.go @@ -0,0 +1,59 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type UnsafeStructType struct { + unsafeType + likePtr bool +} + +func newUnsafeStructType(cfg *frozenConfig, type1 reflect.Type) *UnsafeStructType { + return &UnsafeStructType{ + unsafeType: *newUnsafeType(cfg, type1), + likePtr: likePtrType(type1), + } +} + +func (type2 *UnsafeStructType) LikePtr() bool { + return type2.likePtr +} + +func (type2 *UnsafeStructType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("Type.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *UnsafeStructType) UnsafeIndirect(ptr unsafe.Pointer) interface{} { + if type2.likePtr { + return packEFace(type2.rtype, *(*unsafe.Pointer)(ptr)) + } + return packEFace(type2.rtype, ptr) +} + +func (type2 *UnsafeStructType) FieldByName(name string) StructField { + structField, found := type2.Type.FieldByName(name) + if !found { + return nil + } + return newUnsafeStructField(type2, structField) +} + +func (type2 *UnsafeStructType) Field(i int) StructField { + return newUnsafeStructField(type2, type2.Type.Field(i)) +} + +func (type2 *UnsafeStructType) FieldByIndex(index []int) StructField { + return newUnsafeStructField(type2, type2.Type.FieldByIndex(index)) +} + +func (type2 *UnsafeStructType) FieldByNameFunc(match func(string) bool) StructField { + structField, found := type2.Type.FieldByNameFunc(match) + if !found { + panic("field match condition not found in " + type2.Type.String()) + } + return newUnsafeStructField(type2, structField) +} diff --git a/vendor/github.com/modern-go/reflect2/unsafe_type.go b/vendor/github.com/modern-go/reflect2/unsafe_type.go new file mode 100644 index 000000000..13941716c --- /dev/null +++ b/vendor/github.com/modern-go/reflect2/unsafe_type.go @@ -0,0 +1,85 @@ +package reflect2 + +import ( + "reflect" + "unsafe" +) + +type unsafeType struct { + safeType + rtype unsafe.Pointer + ptrRType unsafe.Pointer +} + +func newUnsafeType(cfg *frozenConfig, type1 reflect.Type) *unsafeType { + return &unsafeType{ + safeType: safeType{ + Type: type1, + cfg: cfg, + }, + rtype: unpackEFace(type1).data, + ptrRType: unpackEFace(reflect.PtrTo(type1)).data, + } +} + +func (type2 *unsafeType) Set(obj interface{}, val interface{}) { + objEFace := unpackEFace(obj) + assertType("Type.Set argument 1", type2.ptrRType, objEFace.rtype) + valEFace := unpackEFace(val) + assertType("Type.Set argument 2", type2.ptrRType, valEFace.rtype) + type2.UnsafeSet(objEFace.data, valEFace.data) +} + +func (type2 *unsafeType) UnsafeSet(ptr unsafe.Pointer, val unsafe.Pointer) { + typedmemmove(type2.rtype, ptr, val) +} + +func (type2 *unsafeType) IsNil(obj interface{}) bool { + objEFace := unpackEFace(obj) + assertType("Type.IsNil argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIsNil(objEFace.data) +} + +func (type2 *unsafeType) UnsafeIsNil(ptr unsafe.Pointer) bool { + return ptr == nil +} + +func (type2 *unsafeType) UnsafeNew() unsafe.Pointer { + return unsafe_New(type2.rtype) +} + +func (type2 *unsafeType) New() interface{} { + return packEFace(type2.ptrRType, type2.UnsafeNew()) +} + +func (type2 *unsafeType) PackEFace(ptr unsafe.Pointer) interface{} { + return packEFace(type2.ptrRType, ptr) +} + +func (type2 *unsafeType) RType() uintptr { + return uintptr(type2.rtype) +} + +func (type2 *unsafeType) Indirect(obj interface{}) interface{} { + objEFace := unpackEFace(obj) + assertType("Type.Indirect argument 1", type2.ptrRType, objEFace.rtype) + return type2.UnsafeIndirect(objEFace.data) +} + +func (type2 *unsafeType) UnsafeIndirect(obj unsafe.Pointer) interface{} { + return packEFace(type2.rtype, obj) +} + +func (type2 *unsafeType) LikePtr() bool { + return false +} + +func assertType(where string, expectRType unsafe.Pointer, actualRType unsafe.Pointer) { + if expectRType != actualRType { + expectType := reflect.TypeOf(0) + (*iface)(unsafe.Pointer(&expectType)).data = expectRType + actualType := reflect.TypeOf(0) + (*iface)(unsafe.Pointer(&actualType)).data = actualRType + panic(where + ": expect " + expectType.String() + ", actual " + actualType.String()) + } +} |