diff options
120 files changed, 2927 insertions, 2872 deletions
diff --git a/.cirrus.yml b/.cirrus.yml index bb2da0812..655fa3830 100644 --- a/.cirrus.yml +++ b/.cirrus.yml @@ -93,7 +93,6 @@ gating_task: CIRRUS_WORKING_DIR: "/usr/src/libpod" GOPATH: "/go" GOSRC: "/go/src/github.com/containers/libpod" - EPOCH_TEST_COMMIT: "${CIRRUS_BASE_SHA}" # Runs within Cirrus's "community cluster" container: @@ -103,6 +102,16 @@ gating_task: timeout_in: 20m + # Custom cloning is required to satisfy lint/validation needs + clone_script: | + git clone --recursive --branch=$DEST_BRANCH https://x-access-token:${CIRRUS_REPO_CLONE_TOKEN}@github.com/${CIRRUS_REPO_FULL_NAME}.git $CIRRUS_WORKING_DIR + git remote update origin + if [[ -n "$CIRRUS_PR" ]]; then # running for a PR + git fetch origin pull/$CIRRUS_PR/head:pull/$CIRRUS_PR + git checkout pull/$CIRRUS_PR + fi + git reset --hard $CIRRUS_CHANGE_IN_REPO + # Don't bother going further if something is down networking_script: '${CIRRUS_WORKING_DIR}/${SCRIPT_BASE}/networking.sh' @@ -674,9 +683,7 @@ docs_task: # Only run this for PRs on mention, and after merge only_if: >- - $CIRRUS_BRANCH == $DEST_BRANCH && - $CIRRUS_CHANGE_MESSAGE !=~ '.*CI:IMG.*' && - $CIRRUS_CHANGE_MESSAGE =~ '.*CI:DOCS.*' + $CIRRUS_BRANCH != $DEST_BRANCH depends_on: - "gating" @@ -3,7 +3,7 @@ export GOPROXY=https://proxy.golang.org GO ?= go DESTDIR ?= -EPOCH_TEST_COMMIT ?= $(shell git merge-base HEAD $${DEST_BRANCH:-master}) +EPOCH_TEST_COMMIT ?= $(shell git merge-base $${DEST_BRANCH:-master} HEAD) HEAD ?= HEAD CHANGELOG_BASE ?= HEAD~ CHANGELOG_TARGET ?= HEAD @@ -132,6 +132,9 @@ for cmd in sorted(cmds): endef export PRINT_HELP_PYSCRIPT +# Dereference variable $(1), return value if non-empty, otherwise raise an error. +err_if_empty = $(if $(strip $($(1))),$(strip $($(1))),$(error Required variable $(1) value is undefined, whitespace, or empty)) + .PHONY: help help: @$(PYTHON) -c "$$PRINT_HELP_PYSCRIPT" < $(MAKEFILE_LIST) @@ -146,6 +149,7 @@ endif .PHONY: lint lint: golangci-lint + @echo "Linting vs commit '$(call err_if_empty,EPOCH_TEST_COMMIT)'" ifeq ($(PRE_COMMIT),) @echo "FATAL: pre-commit was not found, check https://pre-commit.com/ about installing it." >&2 @exit 2 @@ -531,6 +535,7 @@ uninstall: .PHONY: .gitvalidation .gitvalidation: .gopathok + @echo "Validating vs commit '$(call err_if_empty,EPOCH_TEST_COMMIT)'" GIT_CHECK_EXCLUDE="./vendor:docs/make.bat" $(GOBIN)/git-validation -run DCO,short-subject,dangling-whitespace -range $(EPOCH_TEST_COMMIT)..$(HEAD) .PHONY: install.tools @@ -591,7 +596,7 @@ validate.completions: completions/bash/podman if [ -x /bin/zsh ]; then /bin/zsh completions/zsh/_podman; fi .PHONY: validate -validate: lint gofmt .gitvalidation validate.completions man-page-check +validate: gofmt lint .gitvalidation validate.completions man-page-check .PHONY: build-all-new-commits build-all-new-commits: diff --git a/cmd/podman/build.go b/cmd/podman/build.go index 885f2ac51..1fcb98a0e 100644 --- a/cmd/podman/build.go +++ b/cmd/podman/build.go @@ -234,10 +234,6 @@ func buildCmd(c *cliconfig.BuildValues) error { return errors.Wrapf(err, "error determining path to file %q", containerfiles[i]) } contextDir = filepath.Dir(absFile) - containerfiles[i], err = filepath.Rel(contextDir, absFile) - if err != nil { - return errors.Wrapf(err, "error determining path to file %q", containerfiles[i]) - } break } } diff --git a/cmd/podman/common.go b/cmd/podman/common.go index 46feae90d..7610edbc0 100644 --- a/cmd/podman/common.go +++ b/cmd/podman/common.go @@ -16,6 +16,7 @@ import ( jsoniter "github.com/json-iterator/go" "github.com/pkg/errors" "github.com/spf13/cobra" + "github.com/spf13/pflag" ) var ( @@ -116,14 +117,49 @@ func getDefaultNetwork() string { return "bridge" } -func getCreateFlags(c *cliconfig.PodmanCommand) { - - createFlags := c.Flags() - - createFlags.StringSlice( +func getNetFlags() *pflag.FlagSet { + netFlags := pflag.FlagSet{} + netFlags.StringSlice( "add-host", []string{}, "Add a custom host-to-IP mapping (host:ip) (default [])", ) + netFlags.StringSlice( + "dns", []string{}, + "Set custom DNS servers", + ) + netFlags.StringSlice( + "dns-opt", []string{}, + "Set custom DNS options", + ) + netFlags.StringSlice( + "dns-search", []string{}, + "Set custom DNS search domains", + ) + netFlags.String( + "ip", "", + "Specify a static IPv4 address for the container", + ) + netFlags.String( + "mac-address", "", + "Container MAC address (e.g. 92:d0:c6:0a:29:33)", + ) + netFlags.String( + "network", getDefaultNetwork(), + "Connect a container to a network", + ) + netFlags.StringSliceP( + "publish", "p", []string{}, + "Publish a container's port, or a range of ports, to the host (default [])", + ) + netFlags.Bool( + "no-hosts", false, + "Do not create /etc/hosts within the container, instead use the version from the image", + ) + return &netFlags +} + +func getCreateFlags(c *cliconfig.PodmanCommand) { + createFlags := c.Flags() createFlags.StringSlice( "annotation", []string{}, "Add annotations to container (key:value) (default [])", @@ -236,18 +272,6 @@ func getCreateFlags(c *cliconfig.PodmanCommand) { "device-write-iops", []string{}, "Limit write rate (IO per second) to a device (e.g. --device-write-iops=/dev/sda:1000)", ) - createFlags.StringSlice( - "dns", []string{}, - "Set custom DNS servers", - ) - createFlags.StringSlice( - "dns-opt", []string{}, - "Set custom DNS options", - ) - createFlags.StringSlice( - "dns-search", []string{}, - "Set custom DNS search domains", - ) createFlags.String( "entrypoint", "", "Overwrite the default ENTRYPOINT of the image", @@ -324,10 +348,6 @@ func getCreateFlags(c *cliconfig.PodmanCommand) { "Keep STDIN open even if not attached", ) createFlags.String( - "ip", "", - "Specify a static IPv4 address for the container", - ) - createFlags.String( "ipc", "", "IPC namespace to use", ) @@ -351,10 +371,6 @@ func getCreateFlags(c *cliconfig.PodmanCommand) { "log-opt", []string{}, "Logging driver options (default [])", ) - createFlags.String( - "mac-address", "", - "Container MAC address (e.g. 92:d0:c6:0a:29:33)", - ) createFlags.StringP( "memory", "m", "", "Memory limit "+sizeWithUnitFormat, @@ -375,14 +391,6 @@ func getCreateFlags(c *cliconfig.PodmanCommand) { "name", "", "Assign a name to the container", ) - createFlags.String( - "network", getDefaultNetwork(), - "Connect a container to a network", - ) - createFlags.Bool( - "no-hosts", false, - "Do not create /etc/hosts within the container, instead use the version from the image", - ) createFlags.Bool( "oom-kill-disable", false, "Disable OOM Killer", @@ -417,10 +425,6 @@ func getCreateFlags(c *cliconfig.PodmanCommand) { "privileged", false, "Give extended privileges to container", ) - createFlags.StringSliceP( - "publish", "p", []string{}, - "Publish a container's port, or a range of ports, to the host (default [])", - ) createFlags.BoolP( "publish-all", "P", false, "Publish all exposed ports to random ports on the host interface", diff --git a/cmd/podman/create.go b/cmd/podman/create.go index 01cad9765..73d62bddb 100644 --- a/cmd/podman/create.go +++ b/cmd/podman/create.go @@ -41,6 +41,7 @@ func init() { getCreateFlags(&createCommand.PodmanCommand) flags := createCommand.Flags() + flags.AddFlagSet(getNetFlags()) flags.SetInterspersed(false) flags.SetNormalizeFunc(aliasFlags) } diff --git a/cmd/podman/pod_create.go b/cmd/podman/pod_create.go index ad3c00aa8..cee6476ea 100644 --- a/cmd/podman/pod_create.go +++ b/cmd/podman/pod_create.go @@ -44,6 +44,18 @@ func init() { podCreateCommand.SetUsageTemplate(UsageTemplate()) flags := podCreateCommand.Flags() flags.SetInterspersed(false) + // When we are ready to add the network options to the create commmand, we need to uncomment + // the following + + //flags.AddFlagSet(getNetFlags()) + + // Once this is uncommented, then the publish option below needs to be removed because it + // conflicts with the publish in getNetFlags. Upon removal, the c.Publish will not work + // anymore and needs to be cleaned up. I suggest starting with removing the Publish attribute + // from PodCreateValues structure. Running make should then expose all areas that need to be + // addressed. To get the value of publish (and other flags in getNetFlags, use the syntax: + // c.<type>("<flag_name") or c.Bool("publish") + // Remember to do this safely by checking len, etc. flags.StringVar(&podCreateCommand.CgroupParent, "cgroup-parent", "", "Set parent cgroup for the pod") flags.BoolVar(&podCreateCommand.Infra, "infra", true, "Create an infra container associated with the pod to share namespaces with") diff --git a/cmd/podman/ps.go b/cmd/podman/ps.go index d2c5e19e2..d93ccc24c 100644 --- a/cmd/podman/ps.go +++ b/cmd/podman/ps.go @@ -205,6 +205,10 @@ func checkFlagsPassed(c *cliconfig.PsValues) error { if c.Last >= 0 && c.Latest { return errors.Errorf("last and latest are mutually exclusive") } + // Filter forces all + if len(c.Filter) > 0 { + c.All = true + } // Quiet conflicts with size and namespace and is overridden by a Go // template. if c.Quiet { diff --git a/cmd/podman/run.go b/cmd/podman/run.go index caa594682..219f057c3 100644 --- a/cmd/podman/run.go +++ b/cmd/podman/run.go @@ -38,6 +38,7 @@ func init() { flags.SetInterspersed(false) flags.SetNormalizeFunc(aliasFlags) flags.Bool("sig-proxy", true, "Proxy received signals to the process") + flags.AddFlagSet(getNetFlags()) getCreateFlags(&runCommand.PodmanCommand) markFlagHiddenForRemoteClient("authfile", flags) } diff --git a/contrib/msi/podman.wxs b/contrib/msi/podman.wxs index ec62a93c5..c2c2cea4f 100644 --- a/contrib/msi/podman.wxs +++ b/contrib/msi/podman.wxs @@ -33,7 +33,7 @@ </Directory> <Property Id="setx" Value="setx.exe"/> - <CustomAction Id="ChangePath" ExeCommand='PATH "%PATH%;[INSTALLDIR]"' Property="setx" Execute="deferred" Impersonate="yes" Return="check"/> + <CustomAction Id="ChangePath" ExeCommand="PATH "%PATH%;[INSTALLDIR] "" Property="setx" Execute="deferred" Impersonate="yes" Return="check"/> <Feature Id="Complete" Level="1"> <ComponentRef Id="INSTALLDIR_Component"/> diff --git a/docs/links-to-html.lua b/docs/links-to-html.lua index 74072a9e4..816c43353 100644 --- a/docs/links-to-html.lua +++ b/docs/links-to-html.lua @@ -1,4 +1,3 @@ -# links-to-html.lua function Link(el) el.target = string.gsub(el.target, "%.1.md", ".html") return el diff --git a/docs/source/markdown/podman-ps.1.md b/docs/source/markdown/podman-ps.1.md index 024b85ea5..23bf9f45d 100644 --- a/docs/source/markdown/podman-ps.1.md +++ b/docs/source/markdown/podman-ps.1.md @@ -96,6 +96,7 @@ Display namespace information Filter what containers are shown in the output. Multiple filters can be given with multiple uses of the --filter flag. If multiple filters are given, only containers which match all of the given filters will be shown. +Results will be drawn from all containers, regardless of whether --all was given. Valid filters are listed below: @@ -12,9 +12,9 @@ require ( github.com/containernetworking/plugins v0.8.5 github.com/containers/buildah v1.13.1 github.com/containers/conmon v2.0.10+incompatible - github.com/containers/image/v5 v5.1.0 + github.com/containers/image/v5 v5.2.0 github.com/containers/psgo v1.4.0 - github.com/containers/storage v1.15.7 + github.com/containers/storage v1.15.8 github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f // indirect github.com/cri-o/ocicni v0.1.1-0.20190920040751-deac903fd99b @@ -45,9 +45,10 @@ require ( github.com/json-iterator/go v1.1.9 github.com/mrtazz/checkmake v0.0.0-20191009095831-03dd76b964dd // indirect github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618 + github.com/mtrmac/gpgme v0.1.2 // indirect github.com/olekukonko/tablewriter v0.0.4 // indirect - github.com/onsi/ginkgo v1.11.0 - github.com/onsi/gomega v1.8.1 + github.com/onsi/ginkgo v1.12.0 + github.com/onsi/gomega v1.9.0 github.com/opencontainers/go-digest v1.0.0-rc1 github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 github.com/opencontainers/runc v1.0.0-rc9 @@ -30,6 +30,8 @@ github.com/PuerkitoBio/urlesc v0.0.0-20160726150825-5bd2802263f2/go.mod h1:uGdko github.com/PuerkitoBio/urlesc v0.0.0-20170810143723-de5bf2ad4578/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM= github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA= +github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d h1:licZJFw2RwpHMqeKTCYkitsPqHNxTmd4SNR5r94FGM8= +github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d/go.mod h1:asat636LX7Bqt5lYEZ27JNDcqxfjdBQuJ/MM4CN/Lzo= github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= github.com/alexflint/go-filemutex v0.0.0-20171022225611-72bdc8eae2ae/go.mod h1:CgnQgUtFrFz9mxFNtED3jI5tLDjKlOM+oUF/sTk6ps0= @@ -91,6 +93,8 @@ github.com/containers/image/v5 v5.0.0 h1:arnXgbt1ucsC/ndtSpiQY87rA0UjhF+/xQnPzqd github.com/containers/image/v5 v5.0.0/go.mod h1:MgiLzCfIeo8lrHi+4Lb8HP+rh513sm0Mlk6RrhjFOLY= github.com/containers/image/v5 v5.1.0 h1:5FjAvPJniamuNNIQHkh4PnsL+n+xzs6Aonzaz5dqTEo= github.com/containers/image/v5 v5.1.0/go.mod h1:BKlMD34WxRo1ruGHHEOrPQP0Qci7SWoPwU6fS7arsCU= +github.com/containers/image/v5 v5.2.0 h1:DowY5OII5x9Pb6Pt76vnHU79BgG4/jdwhZjeAj2R+t8= +github.com/containers/image/v5 v5.2.0/go.mod h1:IAub4gDGvXoxaIAdNy4e3FbVTDPVNMv9F0UfVVFbYCU= github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b h1:Q8ePgVfHDplZ7U33NwHZkrVELsZP5fYj9pM5WBZB2GE= github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b/go.mod h1:9rfv8iPl1ZP7aqh9YA68wnZv2NUDbXdcdPHVz0pFbPY= github.com/containers/ocicrypt v0.0.0-20190930154801-b87a4a69c741 h1:8tQkOcednLJtUcZgK7sPglscXtxvMOnFOa6wd09VWLM= @@ -109,6 +113,8 @@ github.com/containers/storage v1.15.5 h1:dBZx9yRFHod9c8FVaXlVtRqr2cmlAhpl+9rt87c github.com/containers/storage v1.15.5/go.mod h1:v0lq/3f+cXH3Y/HiDaFYRR0zilwDve7I4W7U5xQxvF8= github.com/containers/storage v1.15.7 h1:ecPmv2y/qpxeSTHZ147jQLO6to8wDn8yUPtDCZlz0H4= github.com/containers/storage v1.15.7/go.mod h1:gLZIp+/hP8nFn9tLS0uJlnk4h1tSoDu3oS2eFiaIqkE= +github.com/containers/storage v1.15.8 h1:ef7OfUMTpyq0PIVAhV7qfufEI92gAldk25nItrip+6Q= +github.com/containers/storage v1.15.8/go.mod h1:zhvjIIl/fR6wt/lgqQAC+xanHQ+8gUQ0GBVeXYN81qI= github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk= github.com/coreos/go-iptables v0.4.2 h1:KH0EwId05JwWIfb96gWvkiT2cbuOu8ygqUaB+yPAwIg= @@ -311,6 +317,8 @@ github.com/klauspost/compress v1.9.4 h1:xhvAeUPQ2drNUhKtrGdTGNvV9nNafHMUkRyLkzxJ github.com/klauspost/compress v1.9.4/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/compress v1.9.7 h1:hYW1gP94JUmAhBtJ+LNz5My+gBobDxPR1iVuKug26aA= github.com/klauspost/compress v1.9.7/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= +github.com/klauspost/compress v1.9.8 h1:VMAMUUOh+gaxKTMk+zqbjsSjsIcUcL/LF4o63i82QyA= +github.com/klauspost/compress v1.9.8/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/cpuid v1.2.1 h1:vJi+O/nMdFt0vqm8NZBI6wzALWdA2X+egi0ogNyrC/w= github.com/klauspost/cpuid v1.2.1/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek= github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM= @@ -341,6 +349,8 @@ github.com/mattn/go-shellwords v1.0.6 h1:9Jok5pILi5S1MnDirGVTufYGtksUs/V2BWUP3Zk github.com/mattn/go-shellwords v1.0.6/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= github.com/mattn/go-shellwords v1.0.7 h1:KqhVjVZomx2puPACkj9vrGFqnp42Htvo9SEAWePHKOs= github.com/mattn/go-shellwords v1.0.7/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= +github.com/mattn/go-shellwords v1.0.9 h1:eaB5JspOwiKKcHdqcjbfe5lA9cNn/4NRRtddXJCimqk= +github.com/mattn/go-shellwords v1.0.9/go.mod h1:EZzvwXDESEeg03EKmM+RmDnNOPKG4lLtQsUlTZDWQ8Y= github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU= github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/mistifyio/go-zfs v2.1.1+incompatible h1:gAMO1HM9xBRONLHHYnu5iFsOJUiJdNZo6oqSENd4eW8= @@ -364,6 +374,10 @@ github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618 h1:7InQ7/zrOh6Sl github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618/go.mod h1:x8F1gnqOkIEiO4rqoeEEEqQbo7HjGMTvyoq3gej4iT0= github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c h1:xa+eQWKuJ9MbB9FBL/eoNvDFvveAkz2LQoz8PzX7Q/4= github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c/go.mod h1:GhAqVMEWnTcW2dxoD/SO3n2enrgWl3y6Dnx4m59GvcA= +github.com/mtrmac/gpgme v0.1.1 h1:a5ISnvahzTzBH0m/klhehN68N+9+/jLwhpPFtH3oPAQ= +github.com/mtrmac/gpgme v0.1.1/go.mod h1:GYYHnGSuS7HK3zVS2n3y73y0okK/BeKzwnn5jgiVFNI= +github.com/mtrmac/gpgme v0.1.2 h1:dNOmvYmsrakgW7LcgiprD0yfRuQQe8/C8F6Z+zogO3s= +github.com/mtrmac/gpgme v0.1.2/go.mod h1:GYYHnGSuS7HK3zVS2n3y73y0okK/BeKzwnn5jgiVFNI= github.com/munnerz/goautoneg v0.0.0-20120707110453-a547fc61f48d/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U= github.com/mxk/go-flowrate v0.0.0-20140419014527-cca7078d478f/go.mod h1:ZdcZmHo+o7JKHSa8/e818NopupXU1YMK5fe1lsApnBw= @@ -380,6 +394,8 @@ github.com/onsi/ginkgo v1.10.3 h1:OoxbjfXVZyod1fmWYhI7SEyaD8B00ynP3T+D5GiyHOY= github.com/onsi/ginkgo v1.10.3/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.11.0 h1:JAKSXpt1YjtLA7YpPiqO9ss6sNXEsPfSGdwN0UHqzrw= github.com/onsi/ginkgo v1.11.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.12.0 h1:Iw5WCbBcaAAd0fpRb1c9r5YCylv4XDoCSigm1zLevwU= +github.com/onsi/ginkgo v1.12.0/go.mod h1:oUhWkIvk5aDxtKvDDuw8gItl8pKl42LzjC9KZE0HfGg= github.com/onsi/gomega v0.0.0-20151007035656-2152b45fa28a/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= github.com/onsi/gomega v0.0.0-20170829124025-dcabb60a477c/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= github.com/onsi/gomega v0.0.0-20190113212917-5533ce8a0da3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= @@ -390,6 +406,8 @@ github.com/onsi/gomega v1.7.1 h1:K0jcRCwNQM3vFGh1ppMtDh/+7ApJrjldlX8fA0jDTLQ= github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= github.com/onsi/gomega v1.8.1 h1:C5Dqfs/LeauYDX0jJXIe2SWmwCbGzx9yF8C8xy3Lh34= github.com/onsi/gomega v1.8.1/go.mod h1:Ho0h+IUsWyvy1OpqCwxlQ/21gkhVunqlU8fDGcoTdcA= +github.com/onsi/gomega v1.9.0 h1:R1uwffexN6Pr340GtYRIdZmAiN4J+iw6WG4wog1DUXg= +github.com/onsi/gomega v1.9.0/go.mod h1:Ho0h+IUsWyvy1OpqCwxlQ/21gkhVunqlU8fDGcoTdcA= github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= @@ -536,6 +554,8 @@ github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tL github.com/vbauerster/mpb v3.4.0+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU= github.com/vbauerster/mpb/v4 v4.11.1 h1:ZOYQSVHgmeanXsbyC44aDg76tBGCS/54Rk8VkL8dJGA= github.com/vbauerster/mpb/v4 v4.11.1/go.mod h1:vMLa1J/ZKC83G2lB/52XpqT+ZZtFG4aZOdKhmpRL1uM= +github.com/vbauerster/mpb/v4 v4.11.2 h1:ynkUoKzi65DZ1UsQPx7sgi/KN6G9f7br+Us2nKm35AM= +github.com/vbauerster/mpb/v4 v4.11.2/go.mod h1:jIuIRCltGJUnm6DCyPVkwjlLUk4nHTH+m4eD14CdFF0= github.com/vishvananda/netlink v0.0.0-20181108222139-023a6dafdcdf/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= github.com/vishvananda/netlink v1.0.0 h1:bqNY2lgheFIu1meHUFSH3d7vG93AFyqg3oGbJCOJgSM= github.com/vishvananda/netlink v1.0.0/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= @@ -644,6 +664,7 @@ golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1 golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191113165036-4c7a9d0fe056/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191127021746-63cb32ae39b2 h1:/J2nHFg1MTqaRLFO7M+J78ASNsJoz3r0cvHBPQ77fsE= golang.org/x/sys v0.0.0-20191127021746-63cb32ae39b2/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= diff --git a/libpod/container.go b/libpod/container.go index f29cebf20..5e5c8ab26 100644 --- a/libpod/container.go +++ b/libpod/container.go @@ -244,7 +244,7 @@ type ContainerConfig struct { // UID/GID mappings used by the storage IDMappings storage.IDMappingOptions `json:"idMappingsOptions,omitempty"` - // Information on the image used for the root filesystem/ + // Information on the image used for the root filesystem RootfsImageID string `json:"rootfsImageID,omitempty"` RootfsImageName string `json:"rootfsImageName,omitempty"` // Rootfs to use for the container, this conflicts with RootfsImageID diff --git a/libpod/container_internal.go b/libpod/container_internal.go index 0e883588c..78ec09f29 100644 --- a/libpod/container_internal.go +++ b/libpod/container_internal.go @@ -1254,6 +1254,12 @@ func (c *Container) restartWithTimeout(ctx context.Context, timeout uint) (err e } } } + // Ensure we tear down the container network so it will be + // recreated - otherwise, behavior of restart differs from stop + // and start + if err := c.cleanupNetwork(); err != nil { + return err + } } defer func() { if err != nil { diff --git a/libpod/image/image.go b/libpod/image/image.go index 355249b12..ba1080a71 100644 --- a/libpod/image/image.go +++ b/libpod/image/image.go @@ -709,11 +709,12 @@ func (i *Image) Size(ctx context.Context) (*uint64, error) { } i.image = localImage } - if sum, err := i.imageruntime.store.ImageSize(i.ID()); err == nil && sum >= 0 { + sum, err := i.imageruntime.store.ImageSize(i.ID()) + if err == nil && sum >= 0 { usum := uint64(sum) return &usum, nil } - return nil, errors.Errorf("unable to determine size") + return nil, errors.Wrap(err, "unable to determine size") } // toImageRef returns an Image Reference type from an image diff --git a/libpod/image/pull.go b/libpod/image/pull.go index 76294ba06..fd359d593 100644 --- a/libpod/image/pull.go +++ b/libpod/image/pull.go @@ -126,6 +126,7 @@ func (ir *Runtime) pullGoalFromImageReference(ctx context.Context, srcRef types. if err != nil { return nil, err } + defer tarSource.Close() manifest, err := tarSource.LoadTarManifest() if err != nil { diff --git a/pkg/api/handlers/exec.go b/pkg/api/handlers/exec.go new file mode 100644 index 000000000..8a7b2ae26 --- /dev/null +++ b/pkg/api/handlers/exec.go @@ -0,0 +1,25 @@ +package handlers + +import ( + "net/http" + + "github.com/containers/libpod/libpod/define" + "github.com/containers/libpod/pkg/api/handlers/utils" +) + +func CreateExec(w http.ResponseWriter, r *http.Request) { + utils.Error(w, "function not implemented", http.StatusInternalServerError, define.ErrNotImplemented) +} + +func StartExec(w http.ResponseWriter, r *http.Request) { + utils.Error(w, "function not implemented", http.StatusInternalServerError, define.ErrNotImplemented) +} + +func ResizeExec(w http.ResponseWriter, r *http.Request) { + utils.Error(w, "function not implemented", http.StatusInternalServerError, define.ErrNotImplemented) + +} + +func InspectExec(w http.ResponseWriter, r *http.Request) { + utils.Error(w, "function not implemented", http.StatusInternalServerError, define.ErrNotImplemented) +} diff --git a/pkg/api/handlers/generic/images.go b/pkg/api/handlers/generic/images.go index 20dd84456..c65db7575 100644 --- a/pkg/api/handlers/generic/images.go +++ b/pkg/api/handlers/generic/images.go @@ -3,6 +3,7 @@ package generic import ( "encoding/json" "fmt" + "io" "io/ioutil" "net/http" "os" @@ -315,3 +316,47 @@ func GetImages(w http.ResponseWriter, r *http.Request) { } utils.WriteResponse(w, http.StatusOK, summaries) } + +func LoadImages(w http.ResponseWriter, r *http.Request) { + // TODO this is basically wrong + decoder := r.Context().Value("decoder").(*schema.Decoder) + runtime := r.Context().Value("runtime").(*libpod.Runtime) + + query := struct { + Changes map[string]string `json:"changes"` + Message string `json:"message"` + Quiet bool `json:"quiet"` + }{ + // This is where you can override the golang default value for one of fields + } + + if err := decoder.Decode(&query, r.URL.Query()); err != nil { + utils.Error(w, "Something went wrong.", http.StatusBadRequest, errors.Wrapf(err, "Failed to parse parameters for %s", r.URL.String())) + return + } + + var ( + err error + writer io.Writer + ) + f, err := ioutil.TempFile("", "api_load.tar") + if err != nil { + utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.Wrap(err, "failed to create tempfile")) + return + } + if err := handlers.SaveFromBody(f, r); err != nil { + utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.Wrap(err, "failed to write temporary file")) + return + } + id, err := runtime.LoadImage(r.Context(), "", f.Name(), writer, "") + //id, err := runtime.Import(r.Context()) + if err != nil { + utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.Wrap(err, "failed to load image")) + return + } + utils.WriteResponse(w, http.StatusOK, struct { + Stream string `json:"stream"` + }{ + Stream: fmt.Sprintf("Loaded image: %s\n", id), + }) +} diff --git a/pkg/api/handlers/generic/ping.go b/pkg/api/handlers/generic/ping.go deleted file mode 100644 index 00afd86bc..000000000 --- a/pkg/api/handlers/generic/ping.go +++ /dev/null @@ -1,27 +0,0 @@ -package generic - -import ( - "fmt" - "net/http" - - "github.com/containers/libpod/pkg/api/handlers" -) - -func PingGET(w http.ResponseWriter, _ *http.Request) { - setHeaders(w) - fmt.Fprintln(w, "OK") -} - -func PingHEAD(w http.ResponseWriter, _ *http.Request) { - setHeaders(w) - fmt.Fprintln(w, "") -} - -func setHeaders(w http.ResponseWriter) { - w.Header().Set("API-Version", handlers.DefaultApiVersion) - w.Header().Set("BuildKit-Version", "") - w.Header().Set("Docker-Experimental", "true") - w.Header().Set("Cache-Control", "no-cache") - w.Header().Set("Pragma", "no-cache") - w.WriteHeader(http.StatusOK) -} diff --git a/pkg/api/handlers/libpod/images.go b/pkg/api/handlers/libpod/images.go index 202ed5eaa..6c926c45b 100644 --- a/pkg/api/handlers/libpod/images.go +++ b/pkg/api/handlers/libpod/images.go @@ -2,7 +2,6 @@ package libpod import ( "fmt" - "io" "io/ioutil" "net/http" "os" @@ -176,46 +175,17 @@ func ExportImage(w http.ResponseWriter, r *http.Request) { utils.WriteResponse(w, http.StatusOK, rdr) } -func ImportImage(w http.ResponseWriter, r *http.Request) { - // TODO this is basically wrong - decoder := r.Context().Value("decoder").(*schema.Decoder) - runtime := r.Context().Value("runtime").(*libpod.Runtime) - - query := struct { - Changes map[string]string `json:"changes"` - Message string `json:"message"` - Quiet bool `json:"quiet"` - }{ - // This is where you can override the golang default value for one of fields - } +func ImagesLoad(w http.ResponseWriter, r *http.Request) { + //TODO ... + utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.New("/libpod/images/load is not yet implemented")) +} - if err := decoder.Decode(&query, r.URL.Query()); err != nil { - utils.Error(w, "Something went wrong.", http.StatusBadRequest, errors.Wrapf(err, "Failed to parse parameters for %s", r.URL.String())) - return - } +func ImagesImport(w http.ResponseWriter, r *http.Request) { + //TODO ... + utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.New("/libpod/images/import is not yet implemented")) +} - var ( - err error - writer io.Writer - ) - f, err := ioutil.TempFile("", "api_load.tar") - if err != nil { - utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.Wrap(err, "failed to create tempfile")) - return - } - if err := handlers.SaveFromBody(f, r); err != nil { - utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.Wrap(err, "failed to write temporary file")) - return - } - id, err := runtime.LoadImage(r.Context(), "", f.Name(), writer, "") - //id, err := runtime.Import(r.Context()) - if err != nil { - utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.Wrap(err, "failed to load image")) - return - } - utils.WriteResponse(w, http.StatusOK, struct { - Stream string `json:"stream"` - }{ - Stream: fmt.Sprintf("Loaded image: %s\n", id), - }) +func ImagesPull(w http.ResponseWriter, r *http.Request) { + //TODO ... + utils.Error(w, "Something went wrong.", http.StatusInternalServerError, errors.New("/libpod/images/pull is not yet implemented")) } diff --git a/pkg/api/handlers/ping.go b/pkg/api/handlers/ping.go new file mode 100644 index 000000000..d41da60f3 --- /dev/null +++ b/pkg/api/handlers/ping.go @@ -0,0 +1,30 @@ +package handlers + +import ( + "fmt" + "net/http" + + "github.com/containers/buildah" +) + +// Ping returns headers to client about the service +// +// This handler must always be the same for the compatibility and libpod URL trees! +// Clients will use the Header availability to test which backend engine is in use. +func Ping(w http.ResponseWriter, r *http.Request) { + w.Header().Set("API-Version", DefaultApiVersion) + w.Header().Set("BuildKit-Version", "") + w.Header().Set("Docker-Experimental", "true") + w.Header().Set("Cache-Control", "no-cache") + w.Header().Set("Pragma", "no-cache") + + // API-Version and Libpod-API-Version may not always be equal + w.Header().Set("Libpod-API-Version", DefaultApiVersion) + w.Header().Set("Libpod-Buildha-Version", buildah.Version) + w.WriteHeader(http.StatusOK) + + if r.Method == http.MethodGet { + fmt.Fprint(w, "OK") + } + fmt.Fprint(w, "\n") +} diff --git a/pkg/api/handlers/swagger.go b/pkg/api/handlers/swagger.go index faae98798..bc75777aa 100644 --- a/pkg/api/handlers/swagger.go +++ b/pkg/api/handlers/swagger.go @@ -26,6 +26,27 @@ type swagImageInspect struct { } } +// Load response +// swagger:response DocsLibpodImagesLoadResponse +type swagLibpodImagesLoadResponse struct { + // in:body + Body []LibpodImagesLoadReport +} + +// Import response +// swagger:response DocsLibpodImagesImportResponse +type swagLibpodImagesImportResponse struct { + // in:body + Body LibpodImagesImportReport +} + +// Pull response +// swagger:response DocsLibpodImagesPullResponse +type swagLibpodImagesPullResponse struct { + // in:body + Body LibpodImagesPullReport +} + // Delete response // swagger:response DocsImageDeleteResponse type swagImageDeleteResponse struct { diff --git a/pkg/api/handlers/types.go b/pkg/api/handlers/types.go index 9c8562744..6169adb18 100644 --- a/pkg/api/handlers/types.go +++ b/pkg/api/handlers/types.go @@ -49,6 +49,21 @@ type LibpodContainersPruneReport struct { PruneError string `json:"error"` } +type LibpodImagesLoadReport struct { + ID string `json:"id"` + RepoTags []string `json:"repoTags"` +} + +type LibpodImagesImportReport struct { + ID string `json:"id"` + RepoTags []string `json:"repoTags"` +} + +type LibpodImagesPullReport struct { + ID string `json:"id"` + RepoTags []string `json:"repoTags"` +} + type Info struct { docker.Info BuildahVersion string @@ -70,10 +85,6 @@ type ContainerStats struct { docker.ContainerStats } -type Ping struct { - docker.Ping -} - type Version struct { docker.Version } diff --git a/pkg/api/server/register_exec.go b/pkg/api/server/register_exec.go new file mode 100644 index 000000000..dbf04dc19 --- /dev/null +++ b/pkg/api/server/register_exec.go @@ -0,0 +1,329 @@ +package server + +import ( + "net/http" + + "github.com/containers/libpod/pkg/api/handlers" + "github.com/gorilla/mux" +) + +func (s *APIServer) registerExecHandlers(r *mux.Router) error { + // swagger:operation POST /containers/{name}/create compat createExec + // --- + // tags: + // - exec (compat) + // summary: Create an exec instance + // description: Run a command inside a running container. + // parameters: + // - in: path + // name: name + // type: string + // required: true + // description: name of container + // - in: body + // name: control + // description: Attributes for create + // schema: + // type: object + // properties: + // AttachStdin: + // type: boolean + // description: Attach to stdin of the exec command + // AttachStdout: + // type: boolean + // description: Attach to stdout of the exec command + // AttachStderr: + // type: boolean + // description: Attach to stderr of the exec command + // DetachKeys: + // type: string + // description: | + // "Override the key sequence for detaching a container. Format is a single character [a-Z] or ctrl-<value> where <value> is one of: a-z, @, ^, [, , or _." + // Tty: + // type: boolean + // description: Allocate a pseudo-TTY + // Env: + // type: array + // description: A list of environment variables in the form ["VAR=value", ...] + // items: + // type: string + // Cmd: + // type: array + // description: Command to run, as a string or array of strings. + // items: + // type: string + // Privileged: + // type: boolean + // default: false + // description: Runs the exec process with extended privileges + // User: + // type: string + // description: | + // "The user, and optionally, group to run the exec process inside the container. Format is one of: user, user:group, uid, or uid:gid." + // WorkingDir: + // type: string + // description: The working directory for the exec process inside the container. + // produces: + // - application/json + // responses: + // 201: + // description: no error + // 404: + // $ref: "#/responses/NoSuchContainer" + // 409: + // description: container is paused + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/containers/{name}/create"), APIHandler(s.Context, handlers.CreateExec)).Methods(http.MethodPost) + // swagger:operation POST /exec/{id}/start compat startExec + // --- + // tags: + // - exec (compat) + // summary: Start an exec instance + // description: Starts a previously set up exec instance. If detach is true, this endpoint returns immediately after starting the command. Otherwise, it sets up an interactive session with the command. + // parameters: + // - in: path + // name: id + // type: string + // required: true + // description: Exec instance ID + // - in: body + // name: control + // description: Attributes for start + // schema: + // type: object + // properties: + // Detach: + // type: boolean + // description: Detach from the command + // Tty: + // type: boolean + // description: Allocate a pseudo-TTY + // produces: + // - application/json + // responses: + // 200: + // description: no error + // 404: + // $ref: "#/responses/NoSuchExecInstance" + // 409: + // description: container is stopped or paused + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/exec/{id}/start"), APIHandler(s.Context, handlers.StartExec)).Methods(http.MethodPost) + // swagger:operation POST /exec/{id}/resize compat resizeExec + // --- + // tags: + // - exec (compat) + // summary: Resize an exec instance + // description: | + // Resize the TTY session used by an exec instance. This endpoint only works if tty was specified as part of creating and starting the exec instance. + // parameters: + // - in: path + // name: id + // type: string + // required: true + // description: Exec instance ID + // - in: query + // name: h + // type: integer + // description: Height of the TTY session in characters + // - in: query + // name: w + // type: integer + // description: Width of the TTY session in characters + // produces: + // - application/json + // responses: + // 201: + // description: no error + // 404: + // $ref: "#/responses/NoSuchExecInstance" + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/exec/{id}/resize"), APIHandler(s.Context, handlers.ResizeExec)).Methods(http.MethodPost) + // swagger:operation GET /exec/{id}/inspect compat inspectExec + // --- + // tags: + // - exec (compat) + // summary: Inspect an exec instance + // description: Return low-level information about an exec instance. + // parameters: + // - in: path + // name: id + // type: string + // required: true + // description: Exec instance ID + // produces: + // - application/json + // responses: + // 200: + // description: no error + // 404: + // $ref: "#/responses/NoSuchExecInstance" + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/exec/{id}/json"), APIHandler(s.Context, handlers.InspectExec)).Methods(http.MethodGet) + + /* + libpod api follows + */ + + // swagger:operation POST /libpod/containers/{name}/create libpod libpodCreateExec + // --- + // tags: + // - exec + // summary: Create an exec instance + // description: Run a command inside a running container. + // parameters: + // - in: path + // name: name + // type: string + // required: true + // description: name of container + // - in: body + // name: control + // description: Attributes for create + // schema: + // type: object + // properties: + // AttachStdin: + // type: boolean + // description: Attach to stdin of the exec command + // AttachStdout: + // type: boolean + // description: Attach to stdout of the exec command + // AttachStderr: + // type: boolean + // description: Attach to stderr of the exec command + // DetachKeys: + // type: string + // description: | + // "Override the key sequence for detaching a container. Format is a single character [a-Z] or ctrl-<value> where <value> is one of: a-z, @, ^, [, , or _." + // Tty: + // type: boolean + // description: Allocate a pseudo-TTY + // Env: + // type: array + // description: A list of environment variables in the form ["VAR=value", ...] + // items: + // type: string + // Cmd: + // type: array + // description: Command to run, as a string or array of strings. + // items: + // type: string + // Privileged: + // type: boolean + // default: false + // description: Runs the exec process with extended privileges + // User: + // type: string + // description: | + // "The user, and optionally, group to run the exec process inside the container. Format is one of: user, user:group, uid, or uid:gid." + // WorkingDir: + // type: string + // description: The working directory for the exec process inside the container. + // produces: + // - application/json + // responses: + // 201: + // description: no error + // 404: + // $ref: "#/responses/NoSuchContainer" + // 409: + // description: container is paused + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/libpod/containers/{name}/create"), APIHandler(s.Context, handlers.CreateExec)).Methods(http.MethodPost) + // swagger:operation POST /libpod/exec/{id}/start libpod libpodStartExec + // --- + // tags: + // - exec + // summary: Start an exec instance + // description: Starts a previously set up exec instance. If detach is true, this endpoint returns immediately after starting the command. Otherwise, it sets up an interactive session with the command. + // parameters: + // - in: path + // name: id + // type: string + // required: true + // description: Exec instance ID + // - in: body + // name: control + // description: Attributes for start + // schema: + // type: object + // properties: + // Detach: + // type: boolean + // description: Detach from the command + // Tty: + // type: boolean + // description: Allocate a pseudo-TTY + // produces: + // - application/json + // responses: + // 200: + // description: no error + // 404: + // $ref: "#/responses/NoSuchExecInstance" + // 409: + // description: container is stopped or paused + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/libpod/exec/{id}/start"), APIHandler(s.Context, handlers.StartExec)).Methods(http.MethodPost) + // swagger:operation POST /libpod/exec/{id}/resize libpod libpodResizeExec + // --- + // tags: + // - exec + // summary: Resize an exec instance + // description: | + // Resize the TTY session used by an exec instance. This endpoint only works if tty was specified as part of creating and starting the exec instance. + // parameters: + // - in: path + // name: id + // type: string + // required: true + // description: Exec instance ID + // - in: query + // name: h + // type: integer + // description: Height of the TTY session in characters + // - in: query + // name: w + // type: integer + // description: Width of the TTY session in characters + // produces: + // - application/json + // responses: + // 201: + // description: no error + // 404: + // $ref: "#/responses/NoSuchExecInstance" + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/libpod/exec/{id}/resize"), APIHandler(s.Context, handlers.ResizeExec)).Methods(http.MethodPost) + // swagger:operation GET /libpod/exec/{id}/inspect libpod libpodInspectExec + // --- + // tags: + // - exec + // summary: Inspect an exec instance + // description: Return low-level information about an exec instance. + // parameters: + // - in: path + // name: id + // type: string + // required: true + // description: Exec instance ID + // produces: + // - application/json + // responses: + // 200: + // description: no error + // 404: + // $ref: "#/responses/NoSuchExecInstance" + // 500: + // $ref: "#/responses/InternalError" + r.Handle(VersionedPath("/libpod/exec/{id}/json"), APIHandler(s.Context, handlers.InspectExec)).Methods(http.MethodGet) + return nil +} diff --git a/pkg/api/server/register_images.go b/pkg/api/server/register_images.go index f1cc0574c..4a46b6ee6 100644 --- a/pkg/api/server/register_images.go +++ b/pkg/api/server/register_images.go @@ -107,7 +107,7 @@ func (s *APIServer) registerImagesHandlers(r *mux.Router) error { // description: no error // 500: // $ref: '#/responses/InternalError' - r.Handle(VersionedPath("/images/load"), APIHandler(s.Context, libpod.ImportImage)).Methods(http.MethodPost) + r.Handle(VersionedPath("/images/load"), APIHandler(s.Context, generic.LoadImages)).Methods(http.MethodPost) // swagger:operation POST /images/prune compat pruneImages // --- // tags: @@ -300,8 +300,9 @@ func (s *APIServer) registerImagesHandlers(r *mux.Router) error { // swagger:operation POST /commit/ compat commitContainer // --- // tags: - // - commit (compat) - // summary: Create a new image from a container + // - containers (compat) + // summary: New Image + // description: Create a new image from a container // parameters: // - in: query // name: container @@ -630,39 +631,94 @@ func (s *APIServer) registerImagesHandlers(r *mux.Router) error { // 500: // $ref: '#/responses/InternalError' r.Handle(VersionedPath("/libpod/images/json"), APIHandler(s.Context, libpod.GetImages)).Methods(http.MethodGet) - // swagger:operation POST /libpod/images/load libpod libpodImportImage + // swagger:operation POST /libpod/images/load libpod libpodImagesLoad + // --- + // tags: + // - images + // summary: Load image + // description: Load an image (oci-archive or docker-archive) stream. + // parameters: + // - in: query + // name: change + // description: "Apply the following possible instructions to the created image (default []): CMD | ENTRYPOINT | ENV | EXPOSE | LABEL | STOPSIGNAL | USER | VOLUME | WORKDIR. JSON encoded string" + // type: string + // - in: query + // name: message + // description: Set commit message for imported image + // type: string + // - in: formData + // name: upload + // description: tarball of container image + // type: file + // required: true + // produces: + // - application/json + // responses: + // 200: + // $ref: "#/responses/DocsLibpodImagesLoadResponse" + // 500: + // $ref: '#/responses/InternalError' + r.Handle(VersionedPath("/libpod/images/load"), APIHandler(s.Context, libpod.ImagesLoad)).Methods(http.MethodPost) + // swagger:operation POST /libpod/images/import libpod libpodImagesImport // --- // tags: // - images // summary: Import image - // description: Load a set of images and tags into a repository. + // description: Import a previously exported tarball as an image. + // parameters: + // - in: query + // name: change + // description: "Apply the following possible instructions to the created image (default []): CMD | ENTRYPOINT | ENV | EXPOSE | LABEL | STOPSIGNAL | USER | VOLUME | WORKDIR. JSON encoded string" + // type: string + // - in: query + // name: message + // description: Set commit message for imported image + // type: string + // - in: query + // name: url + // description: Specify a URL instead of a tarball + // type: boolean + // - in: formData + // name: upload + // type: file + // required: true + // description: tarball for imported image + // produces: + // - application/json + // responses: + // 200: + // $ref: "#/responses/DocsLibpodImagesImportResponse" + // 500: + // $ref: '#/responses/InternalError' + r.Handle(VersionedPath("/libpod/images/import"), APIHandler(s.Context, libpod.ImagesImport)).Methods(http.MethodPost) + // swagger:operation GET /libpod/images/pull libpod libpodImagesPull + // --- + // tags: + // - images + // summary: Import image + // description: Import a previosly exported image as a tarball. // parameters: // - in: query - // name: quiet - // type: boolean - // description: not supported - // - in: query - // name: change - // description: "Apply the following possible instructions to the created image (default []): CMD | ENTRYPOINT | ENV | EXPOSE | LABEL | STOPSIGNAL | USER | VOLUME | WORKDIR. JSON encoded string" + // name: reference + // description: Mandatory reference to the image (e.g., quay.io/image/name:tag)/ // type: string // - in: query - // name: message - // description: Set commit message for imported image + // name: credentials + // description: username:password for the registry. // type: string - // - in: body - // name: request - // description: tarball of container image - // required: true - // schema: - // type: string + // - in: query + // name: tls-verify + // description: Require TLS verification. + // type: boolean + // default: true // produces: // - application/json // responses: // 200: - // description: no error + // $ref: "#/responses/DocsLibpodImagesPullResponse" // 500: // $ref: '#/responses/InternalError' - r.Handle(VersionedPath("/libpod/images/load"), APIHandler(s.Context, libpod.ImportImage)).Methods(http.MethodPost) + r.Handle(VersionedPath("/libpod/images/pull"), APIHandler(s.Context, libpod.ImagesPull)).Methods(http.MethodPost) // swagger:operation POST /libpod/images/prune libpod libpodPruneImages // --- // tags: diff --git a/pkg/api/server/register_ping.go b/pkg/api/server/register_ping.go index 4956f9822..086e674a1 100644 --- a/pkg/api/server/register_ping.go +++ b/pkg/api/server/register_ping.go @@ -3,15 +3,65 @@ package server import ( "net/http" - "github.com/containers/libpod/pkg/api/handlers/generic" + "github.com/containers/libpod/pkg/api/handlers" "github.com/gorilla/mux" ) func (s *APIServer) registerPingHandlers(r *mux.Router) error { - r.Handle("/_ping", APIHandler(s.Context, generic.PingGET)).Methods(http.MethodGet) - r.Handle("/_ping", APIHandler(s.Context, generic.PingHEAD)).Methods("HEAD") - // libpod - r.Handle("/libpod/_ping", APIHandler(s.Context, generic.PingGET)).Methods(http.MethodGet) + r.Handle("/_ping", APIHandler(s.Context, handlers.Ping)).Methods(http.MethodGet) + r.Handle("/_ping", APIHandler(s.Context, handlers.Ping)).Methods(http.MethodHead) + + // swagger:operation GET /libpod/_ping libpod libpodPingGet + // --- + // summary: Ping service + // description: | + // Return protocol information in response headers. + // `HEAD /libpod/_ping` is also supported. + // `/_ping` is available for compatibility with other engines. + // tags: + // - system (compat) + // - system + // produces: + // - text/plain + // responses: + // 200: + // description: Success + // schema: + // description: OK + // type: string + // example: "OK" + // headers: + // API-Version: + // type: string + // description: Max compatibility API Version the server supports + // BuildKit-Version: + // type: string + // description: Default version of docker image builder + // Docker-Experimental: + // type: boolean + // description: If the server is running with experimental mode enabled, always true + // Cache-Control: + // type: string + // description: always no-cache + // Pragma: + // type: string + // description: always no-cache + // Libpod-API-Version: + // type: string + // description: | + // Max Podman API Version the server supports. + // Available if service is backed by Podman, therefore may be used to + // determine if talking to Podman engine or another engine + // Libpod-Buildha-Version: + // type: string + // description: | + // Default version of libpod image builder. + // Available if service is backed by Podman, therefore may be used to + // determine if talking to Podman engine or another engine + // 500: + // $ref: "#/responses/InternalError" + r.Handle("/libpod/_ping", APIHandler(s.Context, handlers.Ping)).Methods(http.MethodGet) + r.Handle("/libpod/_ping", APIHandler(s.Context, handlers.Ping)).Methods(http.MethodHead) return nil } diff --git a/pkg/api/server/server.go b/pkg/api/server/server.go index d030961cb..7bb0f5481 100644 --- a/pkg/api/server/server.go +++ b/pkg/api/server/server.go @@ -105,6 +105,7 @@ func newServer(runtime *libpod.Runtime, duration time.Duration, listener *net.Li server.RegisterAuthHandlers, server.RegisterContainersHandlers, server.RegisterDistributionHandlers, + server.registerExecHandlers, server.registerHealthCheckHandlers, server.registerImagesHandlers, server.registerInfoHandlers, diff --git a/pkg/api/server/swagger.go b/pkg/api/server/swagger.go index 5098390bc..fc409d816 100644 --- a/pkg/api/server/swagger.go +++ b/pkg/api/server/swagger.go @@ -23,6 +23,15 @@ type swagErrNoSuchContainer struct { } } +// No such exec instance +// swagger:response NoSuchExecInstance +type swagErrNoSuchExecInstance struct { + // in:body + Body struct { + utils.ErrorModel + } +} + // No such volume // swagger:response NoSuchVolume type swagErrNoSuchVolume struct { diff --git a/pkg/api/tags.yaml b/pkg/api/tags.yaml index ad0de656f..3bf2bb64f 100644 --- a/pkg/api/tags.yaml +++ b/pkg/api/tags.yaml @@ -1,13 +1,21 @@ tags: - name: containers description: Actions related to containers + - name: exec + description: Actions related to exec - name: images description: Actions related to images - name: pods description: Actions related to pods - name: volumes description: Actions related to volumes + - name: system + description: Actions related to Podman engine - name: containers (compat) description: Actions related to containers for the compatibility endpoints + - name: exec (compat) + description: Actions related to exec for the compatibility endpoints - name: images (compat) description: Actions related to images for the compatibility endpoints + - name: system (compat) + description: Actions related to Podman and compatiblity engines diff --git a/pkg/bindings/errors.go b/pkg/bindings/errors.go index 8bd40f804..1bcaac3f0 100644 --- a/pkg/bindings/errors.go +++ b/pkg/bindings/errors.go @@ -3,7 +3,6 @@ package bindings import ( "encoding/json" "io/ioutil" - "net/http" "github.com/containers/libpod/pkg/api/handlers/utils" "github.com/pkg/errors" @@ -26,7 +25,7 @@ func (a APIResponse) Process(unmarshalInto interface{}) error { if err != nil { return errors.Wrap(err, "unable to process API response") } - if a.Response.StatusCode == http.StatusOK { + if a.IsSuccess() { if unmarshalInto != nil { return json.Unmarshal(data, unmarshalInto) } diff --git a/pkg/bindings/test/images_test.go b/pkg/bindings/test/images_test.go index 227f28d16..f2dc856b2 100644 --- a/pkg/bindings/test/images_test.go +++ b/pkg/bindings/test/images_test.go @@ -89,4 +89,39 @@ var _ = Describe("Podman images", func() { }) + //Tests to validate the image tag command. + It("tag image", func() { + // Validates if invalid image name is given a bad response is encountered. + err = images.Tag(connText, "dummy", "demo", "alpine") + Expect(err).ToNot(BeNil()) + code, _ := bindings.CheckResponseCode(err) + Expect(code).To(BeNumerically("==", 404)) + + // Validates if the image is tagged sucessfully. + err = images.Tag(connText, "alpine", "demo", "alpine") + Expect(err).To(BeNil()) + + //Validates if name updates when the image is retagged. + _, err := images.GetImage(connText, "alpine:demo", nil) + Expect(err).To(BeNil()) + + }) + + //Test to validate the List images command. + It("List image", func() { + //Array to hold the list of images returned + imageSummary, err := images.List(connText, nil, nil) + //There Should be no errors in the response. + Expect(err).To(BeNil()) + //Since in the begin context only one image is created the list context should have only one image + Expect(len(imageSummary)).To(Equal(1)) + + //To be written create a new image and check list count again + //imageSummary, err = images.List(connText, nil, nil) + + //Since in the begin context only one image adding one more image should + ///Expect(len(imageSummary)).To(Equal(2) + + }) + }) diff --git a/pkg/specgen/specgen.go b/pkg/specgen/specgen.go new file mode 100644 index 000000000..e22ee598f --- /dev/null +++ b/pkg/specgen/specgen.go @@ -0,0 +1,399 @@ +package specgen + +import ( + "net" + + "github.com/containers/image/v5/manifest" + "github.com/containers/libpod/libpod" + "github.com/containers/libpod/libpod/define" + "github.com/containers/storage" + "github.com/cri-o/ocicni/pkg/ocicni" + spec "github.com/opencontainers/runtime-spec/specs-go" +) + +// TODO +// mheon provided this an off the cuff suggestion. Adding it here to retain +// for history as we implement it. When this struct is implemented, we need +// to remove the nolints. +type Namespace struct { + isHost bool //nolint + isPath string //nolint + isContainer string //nolint + isPod bool //nolint +} + +// ContainerBasicConfig contains the basic parts of a container. +type ContainerBasicConfig struct { + // Name is the name the container will be given. + // If no name is provided, one will be randomly generated. + // Optional. + Name string `json:"name,omitempty"` + // Pod is the ID of the pod the container will join. + // Optional. + Pod string `json:"pod,omitempty"` + // Entrypoint is the container's entrypoint. + // If not given and Image is specified, this will be populated by the + // image's configuration. + // Optional. + Entrypoint []string `json:"entrypoint,omitempty"` + // Command is the container's command. + // If not given and Image is specified, this will be populated by the + // image's configuration. + // Optional. + Command []string `json:"command,omitempty"` + // Env is a set of environment variables that will be set in the + // container. + // Optional. + Env map[string]string `json:"env,omitempty"` + // Terminal is whether the container will create a PTY. + Terminal bool `json:"terminal,omitempty"` + // Stdin is whether the container will keep its STDIN open. + Stdin bool `json:"stdin,omitempty"` + // Labels are key-valid labels that are used to add metadata to + // containers. + // Optional. + Labels map[string]string `json:"labels,omitempty"` + // Annotations are key-value options passed into the container runtime + // that can be used to trigger special behavior. + // Optional. + Annotations map[string]string `json:"annotations,omitempty"` + // StopSignal is the signal that will be used to stop the container. + // Must be a non-zero integer below SIGRTMAX. + // If not provided, the default, SIGTERM, will be used. + // Will conflict with Systemd if Systemd is set to "true" or "always". + // Optional. + StopSignal *uint `json:"stop_signal,omitempty"` + // StopTimeout is a timeout between the container's stop signal being + // sent and SIGKILL being sent. + // If not provided, the default will be used. + // If 0 is used, stop signal will not be sent, and SIGKILL will be sent + // instead. + // Optional. + StopTimeout *uint `json:"stop_timeout,omitempty"` + // LogDriver is the container's log driver. + // Optional. + LogDriver string `json:"log_driver,omitempty"` + // LogPath is the path the container's logs will be stored at. + // Only available if LogDriver is set to "json-file" or "k8s-file". + // Optional. + LogPath string `json:"log_path,omitempty"` + // ConmonPidFile is a path at which a PID file for Conmon will be + // placed. + // If not given, a default location will be used. + // Optional. + ConmonPidFile string `json:"conmon_pid_file,omitempty"` + // RestartPolicy is the container's restart policy - an action which + // will be taken when the container exits. + // If not given, the default policy, which does nothing, will be used. + // Optional. + RestartPolicy string `json:"restart_policy,omitempty"` + // RestartRetries is the number of attempts that will be made to restart + // the container. + // Only available when RestartPolicy is set to "on-failure". + // Optional. + RestartRetries *uint `json:"restart_tries,omitempty"` + // OCIRuntime is the name of the OCI runtime that will be used to create + // the container. + // If not specified, the default will be used. + // Optional. + OCIRuntime string `json:"oci_runtime,omitempty"` + // Systemd is whether the container will be started in systemd mode. + // Valid options are "true", "false", and "always". + // "true" enables this mode only if the binary run in the container is + // /sbin/init or systemd. "always" unconditionally enables systemd mode. + // "false" unconditionally disables systemd mode. + // If enabled, mounts and stop signal will be modified. + // If set to "always" or set to "true" and conditionally triggered, + // conflicts with StopSignal. + // If not specified, "false" will be assumed. + // Optional. + Systemd string `json:"systemd,omitempty"` + // Namespace is the libpod namespace the container will be placed in. + // Optional. + Namespace string `json:"namespace,omitempty"` + + // PidNS is the container's PID namespace. + // It defaults to private. + // Mandatory. + PidNS Namespace `json:"pidns,omitempty"` + + // UtsNS is the container's UTS namespace. + // It defaults to private. + // Must be set to Private to set Hostname. + // Mandatory. + UtsNS Namespace `json:"utsns,omitempty"` + // Hostname is the container's hostname. If not set, the hostname will + // not be modified (if UtsNS is not private) or will be set to the + // container ID (if UtsNS is private). + // Conflicts with UtsNS if UtsNS is not set to private. + // Optional. + Hostname string `json:"hostname,omitempty"` +} + +// ContainerStorageConfig contains information on the storage configuration of a +// container. +type ContainerStorageConfig struct { + // Image is the image the container will be based on. The image will be + // used as the container's root filesystem, and its environment vars, + // volumes, and other configuration will be applied to the container. + // Conflicts with Rootfs. + // At least one of Image or Rootfs must be specified. + Image string `json:"image"` + // Rootfs is the path to a directory that will be used as the + // container's root filesystem. No modification will be made to the + // directory, it will be directly mounted into the container as root. + // Conflicts with Image. + // At least one of Image or Rootfs must be specified. + Rootfs string `json:"rootfs,omitempty"` + // ImageVolumeMode indicates how image volumes will be created. + // Supported modes are "ignore" (do not create), "tmpfs" (create as + // tmpfs), and "anonymous" (create as anonymous volumes). + // The default is anonymous. + // Optional. + ImageVolumeMode string `json:"image_volume_mode,omitempty"` + // VolumesFrom is a list of containers whose volumes will be added to + // this container. Supported mount options may be added after the + // container name with a : and include "ro" and "rw". + // Optional. + VolumesFrom []string `json:"volumes_from,omitempty"` + // Mounts are mounts that will be added to the container. + // These will supersede Image Volumes and VolumesFrom volumes where + // there are conflicts. + // Optional. + Mounts []spec.Mount `json:"mounts,omitempty"` + // Volumes are named volumes that will be added to the container. + // These will supersede Image Volumes and VolumesFrom volumes where + // there are conflicts. + // Optional. + Volumes []*libpod.ContainerNamedVolume `json:"volumes,omitempty"` + // Devices are devices that will be added to the container. + // Optional. + Devices []spec.LinuxDevice `json:"devices,omitempty"` + // IpcNS is the container's IPC namespace. + // Default is private. + // Conflicts with ShmSize if not set to private. + // Mandatory. + IpcNS Namespace `json:"ipcns,omitempty"` + // ShmSize is the size of the tmpfs to mount in at /dev/shm, in bytes. + // Conflicts with ShmSize if ShmSize is not private. + // Optional. + ShmSize *int64 `json:"shm_size,omitempty"` + // WorkDir is the container's working directory. + // If unset, the default, /, will be used. + // Optional. + WorkDir string `json:"work_dir,omitempty"` + // RootfsPropagation is the rootfs propagation mode for the container. + // If not set, the default of rslave will be used. + // Optional. + RootfsPropagation string `json:"rootfs_propagation,omitempty"` +} + +// ContainerSecurityConfig is a container's security features, including +// SELinux, Apparmor, and Seccomp. +type ContainerSecurityConfig struct { + // Privileged is whether the container is privileged. + // Privileged does the following: + // - Adds all devices on the system to the container. + // - Adds all capabilities to the container. + // - Disables Seccomp, SELinux, and Apparmor confinement. + // TODO: this conflicts with things. + // TODO: this does more. + Privileged bool `json:"privileged,omitempty"` + // User is the user the container will be run as. + // Can be given as a UID or a username; if a username, it will be + // resolved within the container, using the container's /etc/passwd. + // If unset, the container will be run as root. + // Optional. + User string `json:"user,omitempty"` + // Groups are a list of supplemental groups the container's user will + // be granted access to. + // Optional. + Groups []string `json:"groups,omitempty"` + // CapAdd are capabilities which will be added to the container. + // Conflicts with Privileged. + // Optional. + CapAdd []string `json:"cap_add,omitempty"` + // CapDrop are capabilities which will be removed from the container. + // Conflicts with Privileged. + // Optional. + CapDrop []string `json:"cap_drop,omitempty"` + // SelinuxProcessLabel is the process label the container will use. + // If SELinux is enabled and this is not specified, a label will be + // automatically generated if not specified. + // Optional. + SelinuxProcessLabel string `json:"selinux_process_label,omitempty"` + // SelinuxMountLabel is the mount label the container will use. + // If SELinux is enabled and this is not specified, a label will be + // automatically generated if not specified. + // Optional. + SelinuxMountLabel string `json:"selinux_mount_label,omitempty"` + // SelinuxOpts are options for configuring SELinux. + // Optional. + SelinuxOpts []string `json:"selinux_opts,omitempty"` + // ApparmorProfile is the name of the Apparmor profile the container + // will use. + // Optional. + ApparmorProfile string `json:"apparmor_profile,omitempty"` + // SeccompProfilePath is the path to a JSON file containing the + // container's Seccomp profile. + // If not specified, no Seccomp profile will be used. + // Optional. + SeccompProfilePath string `json:"seccomp_profile_path,omitempty"` + // NoNewPrivileges is whether the container will set the no new + // privileges flag on create, which disables gaining additional + // privileges (e.g. via setuid) in the container. + NoNewPrivileges bool `json:"no_new_privileges,omitempty"` + // UserNS is the container's user namespace. + // It defaults to host, indicating that no user namespace will be + // created. + // If set to private, IDMappings must be set. + // Mandatory. + UserNS Namespace `json:"userns,omitempty"` + // IDMappings are UID and GID mappings that will be used by user + // namespaces. + // Required if UserNS is private. + IDMappings storage.IDMappingOptions `json:"idmappings,omitempty"` +} + +// ContainerCgroupConfig contains configuration information about a container's +// cgroups. +type ContainerCgroupConfig struct { + // CgroupNS is the container's cgroup namespace. + // It defaults to private. + // Conflicts with NoCgroups if not set to host. + // Mandatory. + CgroupNS Namespace `json:"cgroupns,omitempty"` + // NoCgroups indicates that the container should not create CGroups. + // Conflicts with CgroupParent and CgroupNS if CgroupNS is not set to + // host. + NoCgroups bool `json:"no_cgroups,omitempty"` + // CgroupParent is the container's CGroup parent. + // If not set, the default for the current cgroup driver will be used. + // Conflicts with NoCgroups. + // Optional. + CgroupParent string `json:"cgroup_parent,omitempty"` +} + +// ContainerNetworkConfig contains information on a container's network +// configuration. +type ContainerNetworkConfig struct { + // NetNS is the configuration to use for the container's network + // namespace. + // Mandatory. + NetNS Namespace `json:"netns,omitempty"` + // ConfigureNetNS is whether Libpod will configure the container's + // network namespace to send and receive traffic. + // Only available is NetNS is private - conflicts with other NetNS + // modes. + ConfigureNetNS bool `json:"configure_netns,omitempty"` + // StaticIP is the a IPv4 address of the container. + // Only available if ConfigureNetNS is true. + // Optional. + StaticIP *net.IP `json:"static_ip,omitempty"` + // StaticIPv6 is a static IPv6 address to set in the container. + // Only available if ConfigureNetNS is true. + // Optional. + StaticIPv6 *net.IP `json:"static_ipv6,omitempty"` + // StaticMAC is a static MAC address to set in the container. + // Only available if ConfigureNetNS is true. + // Optional. + StaticMAC *net.HardwareAddr `json:"static_mac,omitempty"` + // PortBindings is a set of ports to map into the container. + // Only available if ConfigureNetNS is true. + // Optional. + PortMappings []ocicni.PortMapping `json:"portmappings,omitempty"` + // PublishImagePorts will publish ports specified in the image to random + // ports outside. + // Requires Image to be set. + PublishImagePorts bool `json:"publish_image_ports,omitempty"` + // CNINetworks is a list of CNI networks to join the container to. + // If this list is empty, the default CNI network will be joined + // instead. If at least one entry is present, we will not join the + // default network (unless it is part of this list). + // Only available if ConfigureNetNS is true. + // Optional. + CNINetworks []string `json:"cni_networks,omitempty"` + // UseImageResolvConf indicates that resolv.conf should not be managed + // by Podman, but instead sourced from the image. + // Conflicts with DNSServer, DNSSearch, DNSOption. + UseImageResolvConf bool `json:"use_image_resolve_conf,omitempty"` + // DNSServer is a set of DNS servers that will be used in the + // container's resolv.conf, replacing the host's DNS Servers which are + // used by default. + // Conflicts with UseImageResolvConf. + // Optional. + DNSServer []net.IP `json:"dns_server,omitempty"` + // DNSSearch is a set of DNS search domains that will be used in the + // container's resolv.conf, replacing the host's DNS search domains + // which are used by default. + // Conflicts with UseImageResolvConf. + // Optional. + DNSSearch []string `json:"dns_search,omitempty"` + // DNSOption is a set of DNS options that will be used in the + // container's resolv.conf, replacing the host's DNS options which are + // used by default. + // Conflicts with UseImageResolvConf. + // Optional. + DNSOption []string `json:"dns_option,omitempty"` + // UseImageHosts indicates that /etc/hosts should not be managed by + // Podman, and instead sourced from the image. + // Conflicts with HostAdd. + UseImageHosts bool `json:"use_image_hosts,omitempty"` + // HostAdd is a set of hosts which will be added to the container's + // /etc/hosts file. + // Conflicts with UseImageHosts. + // Optional. + HostAdd []string `json:"hostadd,omitempty"` +} + +// ContainerResourceConfig contains information on container resource limits. +type ContainerResourceConfig struct { + // ResourceLimits are resource limits to apply to the container. + // Can only be set as root on cgroups v1 systems, but can be set as + // rootless as well for cgroups v2. + // Optional. + ResourceLimits *spec.LinuxResources `json:"resource_limits,omitempty"` + // Rlimits are POSIX rlimits to apply to the container. + // Optional. + Rlimits []spec.POSIXRlimit `json:"r_limits,omitempty"` + // OOMScoreAdj adjusts the score used by the OOM killer to determine + // processes to kill for the container's process. + // Optional. + OOMScoreAdj *int `json:"oom_score_adj,omitempty"` +} + +// ContainerHealthCheckConfig describes a container healthcheck with attributes +// like command, retries, interval, start period, and timeout. +type ContainerHealthCheckConfig struct { + HealthConfig manifest.Schema2HealthConfig `json:"healthconfig,omitempty"` +} + +// SpecGenerator creates an OCI spec and Libpod configuration options to create +// a container based on the given configuration. +type SpecGenerator struct { + ContainerBasicConfig + ContainerStorageConfig + ContainerSecurityConfig + ContainerCgroupConfig + ContainerNetworkConfig + ContainerResourceConfig + ContainerHealthCheckConfig +} + +// NewSpecGenerator returns a SpecGenerator struct given one of two mandatory inputs +func NewSpecGenerator(image, rootfs *string) (*SpecGenerator, error) { + _ = image + _ = rootfs + return &SpecGenerator{}, define.ErrNotImplemented +} + +// Validate verifies that the given SpecGenerator is valid and satisfies required +// input for creating a container. +func (s *SpecGenerator) Validate() error { + return define.ErrNotImplemented +} + +// MakeContainer creates a container based on the SpecGenerator +func (s *SpecGenerator) MakeContainer() (*libpod.Container, error) { + return nil, define.ErrNotImplemented +} diff --git a/test/e2e/build_test.go b/test/e2e/build_test.go index 71f5d1b02..b4e400549 100644 --- a/test/e2e/build_test.go +++ b/test/e2e/build_test.go @@ -3,7 +3,9 @@ package integration import ( + "io/ioutil" "os" + "path/filepath" "strings" . "github.com/containers/libpod/test/utils" @@ -105,4 +107,39 @@ var _ = Describe("Podman build", func() { session.WaitWithDefaultTimeout() Expect(session.ExitCode()).To(Equal(0)) }) + + It("podman build Containerfile locations", func() { + // Given + // Switch to temp dir and restore it afterwards + cwd, err := os.Getwd() + Expect(err).To(BeNil()) + Expect(os.Chdir(os.TempDir())).To(BeNil()) + defer Expect(os.Chdir(cwd)).To(BeNil()) + + // Write target and fake files + targetPath := filepath.Join(os.TempDir(), "dir") + Expect(os.MkdirAll(targetPath, 0755)).To(BeNil()) + + fakeFile := filepath.Join(os.TempDir(), "Containerfile") + Expect(ioutil.WriteFile(fakeFile, []byte("FROM alpine"), 0755)).To(BeNil()) + + targetFile := filepath.Join(targetPath, "Containerfile") + Expect(ioutil.WriteFile(targetFile, []byte("FROM scratch"), 0755)).To(BeNil()) + + defer func() { + Expect(os.RemoveAll(fakeFile)).To(BeNil()) + Expect(os.RemoveAll(targetFile)).To(BeNil()) + }() + + // When + session := podmanTest.PodmanNoCache([]string{ + "build", "-f", targetFile, "-t", "test-locations", + }) + session.WaitWithDefaultTimeout() + + // Then + Expect(session.ExitCode()).To(Equal(0)) + Expect(strings.Fields(session.OutputToString())). + To(ContainElement("scratch")) + }) }) diff --git a/test/e2e/ps_test.go b/test/e2e/ps_test.go index 12bfdfe41..fccc5c93b 100644 --- a/test/e2e/ps_test.go +++ b/test/e2e/ps_test.go @@ -227,6 +227,22 @@ var _ = Describe("Podman ps", func() { Expect(output[0]).To(Equal(fullCid)) }) + It("podman ps filter by exited does not need all", func() { + ctr := podmanTest.Podman([]string{"run", "-t", "-i", ALPINE, "ls", "/"}) + ctr.WaitWithDefaultTimeout() + Expect(ctr.ExitCode()).To(Equal(0)) + + psAll := podmanTest.Podman([]string{"ps", "-aq", "--no-trunc"}) + psAll.WaitWithDefaultTimeout() + Expect(psAll.ExitCode()).To(Equal(0)) + + psFilter := podmanTest.Podman([]string{"ps", "--no-trunc", "--quiet", "--filter", "status=exited"}) + psFilter.WaitWithDefaultTimeout() + Expect(psFilter.ExitCode()).To(Equal(0)) + + Expect(psAll.OutputToString()).To(Equal(psFilter.OutputToString())) + }) + It("podman ps mutually exclusive flags", func() { session := podmanTest.Podman([]string{"ps", "-aqs"}) session.WaitWithDefaultTimeout() diff --git a/vendor/github.com/acarl005/stripansi/LICENSE b/vendor/github.com/acarl005/stripansi/LICENSE new file mode 100644 index 000000000..00abe0dbf --- /dev/null +++ b/vendor/github.com/acarl005/stripansi/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Andrew Carlson + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/vendor/github.com/acarl005/stripansi/README.md b/vendor/github.com/acarl005/stripansi/README.md new file mode 100644 index 000000000..8bdb1f505 --- /dev/null +++ b/vendor/github.com/acarl005/stripansi/README.md @@ -0,0 +1,30 @@ +Strip ANSI +========== + +This Go package removes ANSI escape codes from strings. + +Ideally, we would prevent these from appearing in any text we want to process. +However, sometimes this can't be helped, and we need to be able to deal with that noise. +This will use a regexp to remove those unwanted escape codes. + + +## Install + +```sh +$ go get -u github.com/acarl005/stripansi +``` + +## Usage + +```go +import ( + "fmt" + "github.com/acarl005/stripansi" +) + +func main() { + msg := "\x1b[38;5;140m foo\x1b[0m bar" + cleanMsg := stripansi.Strip(msg) + fmt.Println(cleanMsg) // " foo bar" +} +``` diff --git a/vendor/github.com/acarl005/stripansi/stripansi.go b/vendor/github.com/acarl005/stripansi/stripansi.go new file mode 100644 index 000000000..235732a78 --- /dev/null +++ b/vendor/github.com/acarl005/stripansi/stripansi.go @@ -0,0 +1,13 @@ +package stripansi + +import ( + "regexp" +) + +const ansi = "[\u001B\u009B][[\\]()#;?]*(?:(?:(?:[a-zA-Z\\d]*(?:;[a-zA-Z\\d]*)*)?\u0007)|(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PRZcf-ntqry=><~]))" + +var re = regexp.MustCompile(ansi) + +func Strip(str string) string { + return re.ReplaceAllString(str, "") +} diff --git a/vendor/github.com/containers/image/v5/copy/copy.go b/vendor/github.com/containers/image/v5/copy/copy.go index 29660b6b2..36957fc77 100644 --- a/vendor/github.com/containers/image/v5/copy/copy.go +++ b/vendor/github.com/containers/image/v5/copy/copy.go @@ -709,7 +709,7 @@ func checkImageDestinationForCurrentRuntime(ctx context.Context, sys *types.Syst wantedOS = sys.OSChoice } if wantedOS != c.OS { - return fmt.Errorf("Image operating system mismatch: image uses %q, expecting %q", c.OS, wantedOS) + logrus.Infof("Image operating system mismatch: image uses %q, expecting %q", c.OS, wantedOS) } wantedArch := runtime.GOARCH @@ -717,7 +717,7 @@ func checkImageDestinationForCurrentRuntime(ctx context.Context, sys *types.Syst wantedArch = sys.ArchitectureChoice } if wantedArch != c.Architecture { - return fmt.Errorf("Image architecture mismatch: image uses %q, expecting %q", c.Architecture, wantedArch) + logrus.Infof("Image architecture mismatch: image uses %q, expecting %q", c.Architecture, wantedArch) } } return nil diff --git a/vendor/github.com/containers/image/v5/directory/directory_dest.go b/vendor/github.com/containers/image/v5/directory/directory_dest.go index caa7a207f..d70b6c07f 100644 --- a/vendor/github.com/containers/image/v5/directory/directory_dest.go +++ b/vendor/github.com/containers/image/v5/directory/directory_dest.go @@ -6,6 +6,7 @@ import ( "io/ioutil" "os" "path/filepath" + "runtime" "github.com/containers/image/v5/types" "github.com/opencontainers/go-digest" @@ -142,8 +143,11 @@ func (d *dirImageDestination) PutBlob(ctx context.Context, stream io.Reader, inp return types.BlobInfo{}, err } succeeded := false + explicitClosed := false defer func() { - blobFile.Close() + if !explicitClosed { + blobFile.Close() + } if !succeeded { os.Remove(blobFile.Name()) } @@ -164,10 +168,21 @@ func (d *dirImageDestination) PutBlob(ctx context.Context, stream io.Reader, inp if err := blobFile.Sync(); err != nil { return types.BlobInfo{}, err } - if err := blobFile.Chmod(0644); err != nil { - return types.BlobInfo{}, err + + // On POSIX systems, blobFile was created with mode 0600, so we need to make it readable. + // On Windows, the “permissions of newly created files” argument to syscall.Open is + // ignored and the file is already readable; besides, blobFile.Chmod, i.e. syscall.Fchmod, + // always fails on Windows. + if runtime.GOOS != "windows" { + if err := blobFile.Chmod(0644); err != nil { + return types.BlobInfo{}, err + } } + blobPath := d.ref.layerPath(computedDigest) + // need to explicitly close the file, since a rename won't otherwise not work on Windows + blobFile.Close() + explicitClosed = true if err := os.Rename(blobFile.Name(), blobPath); err != nil { return types.BlobInfo{}, err } diff --git a/vendor/github.com/containers/image/v5/docker/docker_client.go b/vendor/github.com/containers/image/v5/docker/docker_client.go index 986bcb986..aa8463d18 100644 --- a/vendor/github.com/containers/image/v5/docker/docker_client.go +++ b/vendor/github.com/containers/image/v5/docker/docker_client.go @@ -6,7 +6,6 @@ import ( "encoding/json" "fmt" "io" - "io/ioutil" "net/http" "net/url" "os" @@ -17,6 +16,7 @@ import ( "time" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/pkg/docker/config" "github.com/containers/image/v5/pkg/sysregistriesv2" "github.com/containers/image/v5/pkg/tlsclientconfig" @@ -45,6 +45,10 @@ const ( extensionSignatureSchemaVersion = 2 // extensionSignature.Version extensionSignatureTypeAtomic = "atomic" // extensionSignature.Type + + backoffNumIterations = 5 + backoffInitialDelay = 2 * time.Second + backoffMaxDelay = 60 * time.Second ) var systemPerHostCertDirPaths = [2]string{"/etc/containers/certs.d", "/etc/docker/certs.d"} @@ -277,7 +281,7 @@ func CheckAuth(ctx context.Context, sys *types.SystemContext, username, password } defer resp.Body.Close() - return httpResponseToError(resp) + return httpResponseToError(resp, "") } // SearchResult holds the information of each matching image @@ -351,7 +355,7 @@ func SearchRegistry(ctx context.Context, sys *types.SystemContext, registry, ima } else { defer resp.Body.Close() if resp.StatusCode != http.StatusOK { - logrus.Debugf("error getting search results from v1 endpoint %q: %v", registry, httpResponseToError(resp)) + logrus.Debugf("error getting search results from v1 endpoint %q: %v", registry, httpResponseToError(resp, "")) } else { if err := json.NewDecoder(resp.Body).Decode(v1Res); err != nil { return nil, err @@ -368,7 +372,7 @@ func SearchRegistry(ctx context.Context, sys *types.SystemContext, registry, ima } else { defer resp.Body.Close() if resp.StatusCode != http.StatusOK { - logrus.Errorf("error getting search results from v2 endpoint %q: %v", registry, httpResponseToError(resp)) + logrus.Errorf("error getting search results from v2 endpoint %q: %v", registry, httpResponseToError(resp, "")) } else { if err := json.NewDecoder(resp.Body).Decode(v2Res); err != nil { return nil, err @@ -400,74 +404,64 @@ func (c *dockerClient) makeRequest(ctx context.Context, method, path string, hea return c.makeRequestToResolvedURL(ctx, method, url, headers, stream, -1, auth, extraScope) } +// parseRetryAfter determines the delay required by the "Retry-After" header in res and returns it, +// silently falling back to fallbackDelay if the header is missing or invalid. +func parseRetryAfter(res *http.Response, fallbackDelay time.Duration) time.Duration { + after := res.Header.Get("Retry-After") + if after == "" { + return fallbackDelay + } + logrus.Debugf("Detected 'Retry-After' header %q", after) + // First, check if we have a numerical value. + if num, err := strconv.ParseInt(after, 10, 64); err == nil { + return time.Duration(num) * time.Second + } + // Second, check if we have an HTTP date. + // If the delta between the date and now is positive, use it. + // Otherwise, fall back to using the default exponential back off. + if t, err := http.ParseTime(after); err == nil { + delta := time.Until(t) + if delta > 0 { + return delta + } + logrus.Debugf("Retry-After date in the past, ignoring it") + return fallbackDelay + } + // If the header contents are bogus, fall back to using the default exponential back off. + logrus.Debugf("Invalid Retry-After format, ignoring it") + return fallbackDelay +} + // makeRequestToResolvedURL creates and executes a http.Request with the specified parameters, adding authentication and TLS options for the Docker client. // streamLen, if not -1, specifies the length of the data expected on stream. // makeRequest should generally be preferred. -// In case of an http 429 status code in the response, it performs an exponential back off starting at 2 seconds for at most 5 iterations. -// If the `Retry-After` header is set in the response, the specified value or date is -// If the stream is non-nil, no back off will be performed. +// In case of an HTTP 429 status code in the response, it may automatically retry a few times. // TODO(runcom): too many arguments here, use a struct func (c *dockerClient) makeRequestToResolvedURL(ctx context.Context, method, url string, headers map[string][]string, stream io.Reader, streamLen int64, auth sendAuth, extraScope *authScope) (*http.Response, error) { - var ( - res *http.Response - err error - delay int64 - ) - delay = 2 - const numIterations = 5 - const maxDelay = 60 - - // math.Min() only supports float64, so have an anonymous func to avoid - // casting. - min := func(a int64, b int64) int64 { - if a < b { - return a + delay := backoffInitialDelay + attempts := 0 + for { + res, err := c.makeRequestToResolvedURLOnce(ctx, method, url, headers, stream, streamLen, auth, extraScope) + attempts++ + if res == nil || res.StatusCode != http.StatusTooManyRequests || // Only retry on StatusTooManyRequests, success or other failure is returned to caller immediately + stream != nil || // We can't retry with a body (which is not restartable in the general case) + attempts == backoffNumIterations { + return res, err } - return b - } - nextDelay := func(r *http.Response, delay int64) int64 { - after := res.Header.Get("Retry-After") - if after == "" { - return min(delay, maxDelay) - } - logrus.Debugf("detected 'Retry-After' header %q", after) - // First check if we have a numerical value. - if num, err := strconv.ParseInt(after, 10, 64); err == nil { - return min(num, maxDelay) + delay = parseRetryAfter(res, delay) + if delay > backoffMaxDelay { + delay = backoffMaxDelay } - // Secondly check if we have an http date. - // If the delta between the date and now is positive, use it. - // Otherwise, fall back to using the default exponential back off. - if t, err := http.ParseTime(after); err == nil { - delta := int64(time.Until(t).Seconds()) - if delta > 0 { - return min(delta, maxDelay) - } - logrus.Debugf("negative date: falling back to using %d seconds", delay) - return min(delay, maxDelay) + logrus.Debugf("Too many requests to %s: sleeping for %f seconds before next attempt", url, delay.Seconds()) + select { + case <-ctx.Done(): + return nil, ctx.Err() + case <-time.After(delay): + // Nothing } - // If the header contains bogus, fall back to using the default - // exponential back off. - logrus.Debugf("invalid format: falling back to using %d seconds", delay) - return min(delay, maxDelay) - } - - for i := 0; i < numIterations; i++ { - res, err = c.makeRequestToResolvedURLOnce(ctx, method, url, headers, stream, streamLen, auth, extraScope) - if stream == nil && res != nil && res.StatusCode == http.StatusTooManyRequests { - if i < numIterations-1 { - logrus.Errorf("HEADER %v", res.Header) - delay = nextDelay(res, delay) // compute next delay - does NOT exceed maxDelay - logrus.Debugf("too many request to %s: sleeping for %d seconds before next attempt", url, delay) - time.Sleep(time.Duration(delay) * time.Second) - delay = delay * 2 // exponential back off - } - continue - } - break + delay = delay * 2 // exponential back off } - return res, err } // makeRequestToResolvedURLOnce creates and executes a http.Request with the specified parameters, adding authentication and TLS options for the Docker client. @@ -597,7 +591,7 @@ func (c *dockerClient) getBearerToken(ctx context.Context, challenge challenge, default: return nil, errors.Errorf("unexpected http code: %d (%s), URL: %s", res.StatusCode, http.StatusText(res.StatusCode), authReq.URL) } - tokenBlob, err := ioutil.ReadAll(res.Body) + tokenBlob, err := iolimits.ReadAtMost(res.Body, iolimits.MaxAuthTokenBodySize) if err != nil { return nil, err } @@ -627,7 +621,7 @@ func (c *dockerClient) detectPropertiesHelper(ctx context.Context) error { defer resp.Body.Close() logrus.Debugf("Ping %s status %d", url, resp.StatusCode) if resp.StatusCode != http.StatusOK && resp.StatusCode != http.StatusUnauthorized { - return httpResponseToError(resp) + return httpResponseToError(resp, "") } c.challenges = parseAuthHeader(resp.Header) c.scheme = scheme @@ -690,7 +684,7 @@ func (c *dockerClient) getExtensionsSignatures(ctx context.Context, ref dockerRe return nil, errors.Wrapf(clientLib.HandleErrorResponse(res), "Error downloading signatures for %s in %s", manifestDigest, ref.ref.Name()) } - body, err := ioutil.ReadAll(res.Body) + body, err := iolimits.ReadAtMost(res.Body, iolimits.MaxSignatureListBodySize) if err != nil { return nil, err } diff --git a/vendor/github.com/containers/image/v5/docker/docker_image.go b/vendor/github.com/containers/image/v5/docker/docker_image.go index dad382cd0..483581dbc 100644 --- a/vendor/github.com/containers/image/v5/docker/docker_image.go +++ b/vendor/github.com/containers/image/v5/docker/docker_image.go @@ -70,7 +70,7 @@ func GetRepositoryTags(ctx context.Context, sys *types.SystemContext, ref types. return nil, err } defer res.Body.Close() - if err := httpResponseToError(res); err != nil { + if err := httpResponseToError(res, "Error fetching tags list"); err != nil { return nil, err } diff --git a/vendor/github.com/containers/image/v5/docker/docker_image_dest.go b/vendor/github.com/containers/image/v5/docker/docker_image_dest.go index 47a73d868..ab74e1607 100644 --- a/vendor/github.com/containers/image/v5/docker/docker_image_dest.go +++ b/vendor/github.com/containers/image/v5/docker/docker_image_dest.go @@ -15,6 +15,7 @@ import ( "strings" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/blobinfocache/none" "github.com/containers/image/v5/types" @@ -58,14 +59,16 @@ func (d *dockerImageDestination) Close() error { } func (d *dockerImageDestination) SupportedManifestMIMETypes() []string { - return []string{ + mimeTypes := []string{ imgspecv1.MediaTypeImageManifest, manifest.DockerV2Schema2MediaType, imgspecv1.MediaTypeImageIndex, manifest.DockerV2ListMediaType, - manifest.DockerV2Schema1SignedMediaType, - manifest.DockerV2Schema1MediaType, } + if d.c.sys == nil || !d.c.sys.DockerDisableDestSchema1MIMETypes { + mimeTypes = append(mimeTypes, manifest.DockerV2Schema1SignedMediaType, manifest.DockerV2Schema1MediaType) + } + return mimeTypes } // SupportsSignatures returns an error (to be displayed to the user) if the destination certainly can't store signatures. @@ -620,7 +623,7 @@ sigExists: } defer res.Body.Close() if res.StatusCode != http.StatusCreated { - body, err := ioutil.ReadAll(res.Body) + body, err := iolimits.ReadAtMost(res.Body, iolimits.MaxErrorBodySize) if err == nil { logrus.Debugf("Error body %s", string(body)) } diff --git a/vendor/github.com/containers/image/v5/docker/docker_image_src.go b/vendor/github.com/containers/image/v5/docker/docker_image_src.go index 35beb30e5..967845e72 100644 --- a/vendor/github.com/containers/image/v5/docker/docker_image_src.go +++ b/vendor/github.com/containers/image/v5/docker/docker_image_src.go @@ -10,8 +10,10 @@ import ( "net/url" "os" "strconv" + "strings" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/sysregistriesv2" "github.com/containers/image/v5/types" @@ -53,43 +55,77 @@ func newImageSource(ctx context.Context, sys *types.SystemContext, ref dockerRef // non-mirror original location last; this both transparently handles the case // of no mirrors configured, and ensures we return the error encountered when // acessing the upstream location if all endpoints fail. - manifestLoadErr := errors.New("Internal error: newImageSource returned without trying any endpoint") pullSources, err := registry.PullSourcesFromReference(ref.ref) if err != nil { return nil, err } + type attempt struct { + ref reference.Named + err error + } + attempts := []attempt{} for _, pullSource := range pullSources { - logrus.Debugf("Trying to pull %q", pullSource.Reference) - dockerRef, err := newReference(pullSource.Reference) - if err != nil { - return nil, err + logrus.Debugf("Trying to access %q", pullSource.Reference) + s, err := newImageSourceAttempt(ctx, sys, pullSource, primaryDomain) + if err == nil { + return s, nil } - - endpointSys := sys - // sys.DockerAuthConfig does not explicitly specify a registry; we must not blindly send the credentials intended for the primary endpoint to mirrors. - if endpointSys != nil && endpointSys.DockerAuthConfig != nil && reference.Domain(dockerRef.ref) != primaryDomain { - copy := *endpointSys - copy.DockerAuthConfig = nil - endpointSys = © + logrus.Debugf("Accessing %q failed: %v", pullSource.Reference, err) + attempts = append(attempts, attempt{ + ref: pullSource.Reference, + err: err, + }) + } + switch len(attempts) { + case 0: + return nil, errors.New("Internal error: newImageSource returned without trying any endpoint") + case 1: + return nil, attempts[0].err // If no mirrors are used, perfectly preserve the error type and add no noise. + default: + // Don’t just build a string, try to preserve the typed error. + primary := &attempts[len(attempts)-1] + extras := []string{} + for i := 0; i < len(attempts)-1; i++ { + // This is difficult to fit into a single-line string, when the error can contain arbitrary strings including any metacharacters we decide to use. + // The paired [] at least have some chance of being unambiguous. + extras = append(extras, fmt.Sprintf("[%s: %v]", attempts[i].ref.String(), attempts[i].err)) } + return nil, errors.Wrapf(primary.err, "(Mirrors also failed: %s): %s", strings.Join(extras, "\n"), primary.ref.String()) + } +} - client, err := newDockerClientFromRef(endpointSys, dockerRef, false, "pull") - if err != nil { - return nil, err - } - client.tlsClientConfig.InsecureSkipVerify = pullSource.Endpoint.Insecure +// newImageSourceAttempt is an internal helper for newImageSource. Everyone else must call newImageSource. +// Given a pullSource and primaryDomain, return a dockerImageSource if it is reachable. +// The caller must call .Close() on the returned ImageSource. +func newImageSourceAttempt(ctx context.Context, sys *types.SystemContext, pullSource sysregistriesv2.PullSource, primaryDomain string) (*dockerImageSource, error) { + ref, err := newReference(pullSource.Reference) + if err != nil { + return nil, err + } - testImageSource := &dockerImageSource{ - ref: dockerRef, - c: client, - } + endpointSys := sys + // sys.DockerAuthConfig does not explicitly specify a registry; we must not blindly send the credentials intended for the primary endpoint to mirrors. + if endpointSys != nil && endpointSys.DockerAuthConfig != nil && reference.Domain(ref.ref) != primaryDomain { + copy := *endpointSys + copy.DockerAuthConfig = nil + endpointSys = © + } - manifestLoadErr = testImageSource.ensureManifestIsLoaded(ctx) - if manifestLoadErr == nil { - return testImageSource, nil - } + client, err := newDockerClientFromRef(endpointSys, ref, false, "pull") + if err != nil { + return nil, err } - return nil, manifestLoadErr + client.tlsClientConfig.InsecureSkipVerify = pullSource.Endpoint.Insecure + + s := &dockerImageSource{ + ref: ref, + c: client, + } + + if err := s.ensureManifestIsLoaded(ctx); err != nil { + return nil, err + } + return s, nil } // Reference returns the reference used to set up this source, _as specified by the user_ @@ -156,7 +192,8 @@ func (s *dockerImageSource) fetchManifest(ctx context.Context, tagOrDigest strin if res.StatusCode != http.StatusOK { return nil, "", errors.Wrapf(client.HandleErrorResponse(res), "Error reading manifest %s in %s", tagOrDigest, s.ref.ref.Name()) } - manblob, err := ioutil.ReadAll(res.Body) + + manblob, err := iolimits.ReadAtMost(res.Body, iolimits.MaxManifestBodySize) if err != nil { return nil, "", err } @@ -239,7 +276,7 @@ func (s *dockerImageSource) GetBlob(ctx context.Context, info types.BlobInfo, ca if err != nil { return nil, 0, err } - if err := httpResponseToError(res); err != nil { + if err := httpResponseToError(res, "Error fetching blob"); err != nil { return nil, 0, err } cache.RecordKnownLocation(s.ref.Transport(), bicTransportScope(s.ref), info.Digest, newBICLocationReference(s.ref)) @@ -342,7 +379,7 @@ func (s *dockerImageSource) getOneSignature(ctx context.Context, url *url.URL) ( } else if res.StatusCode != http.StatusOK { return nil, false, errors.Errorf("Error reading signature from %s: status %d (%s)", url.String(), res.StatusCode, http.StatusText(res.StatusCode)) } - sig, err := ioutil.ReadAll(res.Body) + sig, err := iolimits.ReadAtMost(res.Body, iolimits.MaxSignatureBodySize) if err != nil { return nil, false, err } @@ -401,7 +438,7 @@ func deleteImage(ctx context.Context, sys *types.SystemContext, ref dockerRefere return err } defer get.Body.Close() - manifestBody, err := ioutil.ReadAll(get.Body) + manifestBody, err := iolimits.ReadAtMost(get.Body, iolimits.MaxManifestBodySize) if err != nil { return err } @@ -424,7 +461,7 @@ func deleteImage(ctx context.Context, sys *types.SystemContext, ref dockerRefere } defer delete.Body.Close() - body, err := ioutil.ReadAll(delete.Body) + body, err := iolimits.ReadAtMost(delete.Body, iolimits.MaxErrorBodySize) if err != nil { return err } diff --git a/vendor/github.com/containers/image/v5/docker/errors.go b/vendor/github.com/containers/image/v5/docker/errors.go index 860868f41..f626cc7da 100644 --- a/vendor/github.com/containers/image/v5/docker/errors.go +++ b/vendor/github.com/containers/image/v5/docker/errors.go @@ -14,7 +14,7 @@ var ( // docker V1 registry. ErrV1NotSupported = errors.New("can't talk to a V1 docker registry") // ErrTooManyRequests is returned when the status code returned is 429 - ErrTooManyRequests = errors.New("too many request to registry") + ErrTooManyRequests = errors.New("too many requests to registry") ) // ErrUnauthorizedForCredentials is returned when the status code returned is 401 @@ -26,9 +26,9 @@ func (e ErrUnauthorizedForCredentials) Error() string { return fmt.Sprintf("unable to retrieve auth token: invalid username/password: %s", e.Err.Error()) } -// httpResponseToError translates the https.Response into an error. It returns +// httpResponseToError translates the https.Response into an error, possibly prefixing it with the supplied context. It returns // nil if the response is not considered an error. -func httpResponseToError(res *http.Response) error { +func httpResponseToError(res *http.Response, context string) error { switch res.StatusCode { case http.StatusOK: return nil @@ -38,6 +38,9 @@ func httpResponseToError(res *http.Response) error { err := client.HandleErrorResponse(res) return ErrUnauthorizedForCredentials{Err: err} default: - return perrors.Errorf("invalid status code from registry %d (%s)", res.StatusCode, http.StatusText(res.StatusCode)) + if context != "" { + context = context + ": " + } + return perrors.Errorf("%sinvalid status code from registry %d (%s)", context, res.StatusCode, http.StatusText(res.StatusCode)) } } diff --git a/vendor/github.com/containers/image/v5/docker/tarfile/dest.go b/vendor/github.com/containers/image/v5/docker/tarfile/dest.go index c322156b5..c171da505 100644 --- a/vendor/github.com/containers/image/v5/docker/tarfile/dest.go +++ b/vendor/github.com/containers/image/v5/docker/tarfile/dest.go @@ -13,6 +13,7 @@ import ( "time" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/internal/tmpdir" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/types" @@ -143,7 +144,7 @@ func (d *Destination) PutBlob(ctx context.Context, stream io.Reader, inputInfo t } if isConfig { - buf, err := ioutil.ReadAll(stream) + buf, err := iolimits.ReadAtMost(stream, iolimits.MaxConfigBodySize) if err != nil { return types.BlobInfo{}, errors.Wrap(err, "Error reading Config file stream") } diff --git a/vendor/github.com/containers/image/v5/docker/tarfile/src.go b/vendor/github.com/containers/image/v5/docker/tarfile/src.go index 80dd753e4..c1f1a0f27 100644 --- a/vendor/github.com/containers/image/v5/docker/tarfile/src.go +++ b/vendor/github.com/containers/image/v5/docker/tarfile/src.go @@ -11,6 +11,7 @@ import ( "path" "sync" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/internal/tmpdir" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/compression" @@ -203,13 +204,13 @@ func findTarComponent(inputFile io.Reader, path string) (*tar.Reader, *tar.Heade } // readTarComponent returns full contents of componentPath. -func (s *Source) readTarComponent(path string) ([]byte, error) { +func (s *Source) readTarComponent(path string, limit int) ([]byte, error) { file, err := s.openTarComponent(path) if err != nil { return nil, errors.Wrapf(err, "Error loading tar component %s", path) } defer file.Close() - bytes, err := ioutil.ReadAll(file) + bytes, err := iolimits.ReadAtMost(file, limit) if err != nil { return nil, err } @@ -240,7 +241,7 @@ func (s *Source) ensureCachedDataIsPresentPrivate() error { } // Read and parse config. - configBytes, err := s.readTarComponent(tarManifest[0].Config) + configBytes, err := s.readTarComponent(tarManifest[0].Config, iolimits.MaxConfigBodySize) if err != nil { return err } @@ -266,7 +267,7 @@ func (s *Source) ensureCachedDataIsPresentPrivate() error { // loadTarManifest loads and decodes the manifest.json. func (s *Source) loadTarManifest() ([]ManifestItem, error) { // FIXME? Do we need to deal with the legacy format? - bytes, err := s.readTarComponent(manifestFileName) + bytes, err := s.readTarComponent(manifestFileName, iolimits.MaxTarFileManifestSize) if err != nil { return nil, err } diff --git a/vendor/github.com/containers/image/v5/image/docker_schema2.go b/vendor/github.com/containers/image/v5/image/docker_schema2.go index 7891562b7..1e2114d7e 100644 --- a/vendor/github.com/containers/image/v5/image/docker_schema2.go +++ b/vendor/github.com/containers/image/v5/image/docker_schema2.go @@ -7,10 +7,10 @@ import ( "encoding/hex" "encoding/json" "fmt" - "io/ioutil" "strings" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/blobinfocache/none" "github.com/containers/image/v5/types" @@ -102,7 +102,7 @@ func (m *manifestSchema2) ConfigBlob(ctx context.Context) ([]byte, error) { return nil, err } defer stream.Close() - blob, err := ioutil.ReadAll(stream) + blob, err := iolimits.ReadAtMost(stream, iolimits.MaxConfigBodySize) if err != nil { return nil, err } diff --git a/vendor/github.com/containers/image/v5/image/oci.go b/vendor/github.com/containers/image/v5/image/oci.go index 059d84977..b5ddb9aaa 100644 --- a/vendor/github.com/containers/image/v5/image/oci.go +++ b/vendor/github.com/containers/image/v5/image/oci.go @@ -4,9 +4,9 @@ import ( "context" "encoding/json" "fmt" - "io/ioutil" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/blobinfocache/none" "github.com/containers/image/v5/types" @@ -67,7 +67,7 @@ func (m *manifestOCI1) ConfigBlob(ctx context.Context) ([]byte, error) { return nil, err } defer stream.Close() - blob, err := ioutil.ReadAll(stream) + blob, err := iolimits.ReadAtMost(stream, iolimits.MaxConfigBodySize) if err != nil { return nil, err } diff --git a/vendor/github.com/containers/image/v5/internal/iolimits/iolimits.go b/vendor/github.com/containers/image/v5/internal/iolimits/iolimits.go new file mode 100644 index 000000000..3fed1995c --- /dev/null +++ b/vendor/github.com/containers/image/v5/internal/iolimits/iolimits.go @@ -0,0 +1,60 @@ +package iolimits + +import ( + "io" + "io/ioutil" + + "github.com/pkg/errors" +) + +// All constants below are intended to be used as limits for `ReadAtMost`. The +// immediate use-case for limiting the size of in-memory copied data is to +// protect against OOM DOS attacks as described inCVE-2020-1702. Instead of +// copying data until running out of memory, we error out after hitting the +// specified limit. +const ( + // megaByte denotes one megabyte and is intended to be used as a limit in + // `ReadAtMost`. + megaByte = 1 << 20 + // MaxManifestBodySize is the maximum allowed size of a manifest. The limit + // of 4 MB aligns with the one of a Docker registry: + // https://github.com/docker/distribution/blob/a8371794149d1d95f1e846744b05c87f2f825e5a/registry/handlers/manifests.go#L30 + MaxManifestBodySize = 4 * megaByte + // MaxAuthTokenBodySize is the maximum allowed size of an auth token. + // The limit of 1 MB is considered to be greatly sufficient. + MaxAuthTokenBodySize = megaByte + // MaxSignatureListBodySize is the maximum allowed size of a signature list. + // The limit of 4 MB is considered to be greatly sufficient. + MaxSignatureListBodySize = 4 * megaByte + // MaxSignatureBodySize is the maximum allowed size of a signature. + // The limit of 4 MB is considered to be greatly sufficient. + MaxSignatureBodySize = 4 * megaByte + // MaxErrorBodySize is the maximum allowed size of an error-response body. + // The limit of 1 MB is considered to be greatly sufficient. + MaxErrorBodySize = megaByte + // MaxConfigBodySize is the maximum allowed size of a config blob. + // The limit of 4 MB is considered to be greatly sufficient. + MaxConfigBodySize = 4 * megaByte + // MaxOpenShiftStatusBody is the maximum allowed size of an OpenShift status body. + // The limit of 4 MB is considered to be greatly sufficient. + MaxOpenShiftStatusBody = 4 * megaByte + // MaxTarFileManifestSize is the maximum allowed size of a (docker save)-like manifest (which may contain multiple images) + // The limit of 1 MB is considered to be greatly sufficient. + MaxTarFileManifestSize = megaByte +) + +// ReadAtMost reads from reader and errors out if the specified limit (in bytes) is exceeded. +func ReadAtMost(reader io.Reader, limit int) ([]byte, error) { + limitedReader := io.LimitReader(reader, int64(limit+1)) + + res, err := ioutil.ReadAll(limitedReader) + if err != nil { + return nil, err + } + + if len(res) > limit { + return nil, errors.Errorf("exceeded maximum allowed size of %d bytes", limit) + } + + return res, nil +} diff --git a/vendor/github.com/containers/image/v5/openshift/openshift.go b/vendor/github.com/containers/image/v5/openshift/openshift.go index b9242da6e..28bfc456d 100644 --- a/vendor/github.com/containers/image/v5/openshift/openshift.go +++ b/vendor/github.com/containers/image/v5/openshift/openshift.go @@ -7,13 +7,13 @@ import ( "encoding/json" "fmt" "io" - "io/ioutil" "net/http" "net/url" "strings" "github.com/containers/image/v5/docker" "github.com/containers/image/v5/docker/reference" + "github.com/containers/image/v5/internal/iolimits" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/types" "github.com/containers/image/v5/version" @@ -102,7 +102,7 @@ func (c *openshiftClient) doRequest(ctx context.Context, method, path string, re return nil, err } defer res.Body.Close() - body, err := ioutil.ReadAll(res.Body) + body, err := iolimits.ReadAtMost(res.Body, iolimits.MaxOpenShiftStatusBody) if err != nil { return nil, err } diff --git a/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go b/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go index 4825ab27c..277fba16b 100644 --- a/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go +++ b/vendor/github.com/containers/image/v5/signature/mechanism_gpgme.go @@ -139,7 +139,7 @@ func (m *gpgmeSigningMechanism) Sign(input []byte, keyIdentity string) ([]byte, } // Verify parses unverifiedSignature and returns the content and the signer's identity -func (m gpgmeSigningMechanism) Verify(unverifiedSignature []byte) (contents []byte, keyIdentity string, err error) { +func (m *gpgmeSigningMechanism) Verify(unverifiedSignature []byte) (contents []byte, keyIdentity string, err error) { signedBuffer := bytes.Buffer{} signedData, err := gpgme.NewDataWriter(&signedBuffer) if err != nil { @@ -170,6 +170,6 @@ func (m gpgmeSigningMechanism) Verify(unverifiedSignature []byte) (contents []by // WARNING: The short key identifier (which correponds to "Key ID" for OpenPGP keys) // is NOT the same as a "key identity" used in other calls ot this interface, and // the values may have no recognizable relationship if the public key is not available. -func (m gpgmeSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) { +func (m *gpgmeSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) { return gpgUntrustedSignatureContents(untrustedSignature) } diff --git a/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go b/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go index eccd610c9..51f20f310 100644 --- a/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go +++ b/vendor/github.com/containers/image/v5/signature/mechanism_openpgp.go @@ -154,6 +154,6 @@ func (m *openpgpSigningMechanism) Verify(unverifiedSignature []byte) (contents [ // WARNING: The short key identifier (which correponds to "Key ID" for OpenPGP keys) // is NOT the same as a "key identity" used in other calls ot this interface, and // the values may have no recognizable relationship if the public key is not available. -func (m openpgpSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) { +func (m *openpgpSigningMechanism) UntrustedSignatureContents(untrustedSignature []byte) (untrustedContents []byte, shortKeyIdentifier string, err error) { return gpgUntrustedSignatureContents(untrustedSignature) } diff --git a/vendor/github.com/containers/image/v5/types/types.go b/vendor/github.com/containers/image/v5/types/types.go index d38a17fab..ba249ca25 100644 --- a/vendor/github.com/containers/image/v5/types/types.go +++ b/vendor/github.com/containers/image/v5/types/types.go @@ -547,6 +547,8 @@ type SystemContext struct { // Note that this field is used mainly to integrate containers/image into projectatomic/docker // in order to not break any existing docker's integration tests. DockerDisableV1Ping bool + // If true, dockerImageDestination.SupportedManifestMIMETypes will omit the Schema1 media types from the supported list + DockerDisableDestSchema1MIMETypes bool // Directory to use for OSTree temporary files OSTreeTmpDirPath string diff --git a/vendor/github.com/containers/image/v5/version/version.go b/vendor/github.com/containers/image/v5/version/version.go index a92774466..1a44baf99 100644 --- a/vendor/github.com/containers/image/v5/version/version.go +++ b/vendor/github.com/containers/image/v5/version/version.go @@ -6,7 +6,7 @@ const ( // VersionMajor is for an API incompatible changes VersionMajor = 5 // VersionMinor is for functionality in a backwards-compatible manner - VersionMinor = 1 + VersionMinor = 2 // VersionPatch is for backwards-compatible bug fixes VersionPatch = 0 diff --git a/vendor/github.com/containers/storage/.golangci.yml b/vendor/github.com/containers/storage/.golangci.yml index ec4ebb187..cd4638a39 100644 --- a/vendor/github.com/containers/storage/.golangci.yml +++ b/vendor/github.com/containers/storage/.golangci.yml @@ -3,37 +3,35 @@ run: concurrency: 6 deadline: 5m linters: - disable-all: true - enable: - - bodyclose - - depguard - - gofmt - - interfacer - - typecheck - # - deadcode - # - dupl - # - errcheck - # - gochecknoglobals - # - gochecknoinits - # - goconst - # - gocritic - # - gocyclo - # - goimports - # - golint - # - gosec - # - gosimple - # - govet - # - ineffassign - # - lll - # - maligned - # - misspell - # - nakedret - # - prealloc - # - scopelint - # - staticcheck - # - structcheck - # - stylecheck - # - unconvert - # - unparam - # - unused - # - varcheck + enable-all: true + disable: + - dogsled + - dupl + - errcheck + - funlen + - gochecknoglobals + - gochecknoinits + - gocognit + - gocritic + - gocyclo + - godox + - gomnd + - gosec + - gosimple + - govet + - ineffassign + - lll + - maligned + - misspell + - nakedret + - prealloc + - scopelint + - staticcheck + - structcheck + - stylecheck + - unconvert + - unparam + - unused + - varcheck + - whitespace + - wsl diff --git a/vendor/github.com/containers/storage/VERSION b/vendor/github.com/containers/storage/VERSION index 928b5d437..98e863cdf 100644 --- a/vendor/github.com/containers/storage/VERSION +++ b/vendor/github.com/containers/storage/VERSION @@ -1 +1 @@ -1.15.8-dev +1.15.8 diff --git a/vendor/github.com/containers/storage/drivers/aufs/aufs.go b/vendor/github.com/containers/storage/drivers/aufs/aufs.go index 4430670a2..c4ced0488 100644 --- a/vendor/github.com/containers/storage/drivers/aufs/aufs.go +++ b/vendor/github.com/containers/storage/drivers/aufs/aufs.go @@ -35,7 +35,7 @@ import ( "sync" "time" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/archive" "github.com/containers/storage/pkg/chrootarchive" "github.com/containers/storage/pkg/directory" diff --git a/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go b/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go index 5be1639d0..be4362dc0 100644 --- a/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go +++ b/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go @@ -26,7 +26,7 @@ import ( "sync" "unsafe" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/idtools" "github.com/containers/storage/pkg/mount" "github.com/containers/storage/pkg/parsers" diff --git a/vendor/github.com/containers/storage/drivers/chown_unix.go b/vendor/github.com/containers/storage/drivers/chown_unix.go index 51d6d754b..94c641536 100644 --- a/vendor/github.com/containers/storage/drivers/chown_unix.go +++ b/vendor/github.com/containers/storage/drivers/chown_unix.go @@ -25,14 +25,14 @@ func platformLChown(path string, info os.FileInfo, toHost, toContainer *idtools. UID: uid, GID: gid, } - mappedUid, mappedGid, err := toContainer.ToContainer(pair) + mappedUID, mappedGID, err := toContainer.ToContainer(pair) if err != nil { if (uid != 0) || (gid != 0) { return fmt.Errorf("error mapping host ID pair %#v for %q to container: %v", pair, path, err) } - mappedUid, mappedGid = uid, gid + mappedUID, mappedGID = uid, gid } - uid, gid = mappedUid, mappedGid + uid, gid = mappedUID, mappedGID } if toHost != nil { pair := idtools.IDPair{ diff --git a/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go b/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go index 1ea6cfc36..867ad1196 100644 --- a/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go +++ b/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go @@ -18,7 +18,7 @@ import ( "sync" "time" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/devicemapper" "github.com/containers/storage/pkg/dmesg" "github.com/containers/storage/pkg/idtools" @@ -49,8 +49,13 @@ var ( lvmSetupConfigForce bool ) -const deviceSetMetaFile string = "deviceset-metadata" -const transactionMetaFile string = "transaction-metadata" +const ( + deviceSetMetaFile = "deviceset-metadata" + transactionMetaFile = "transaction-metadata" + xfs = "xfs" + ext4 = "ext4" + base = "base" +) type transaction struct { OpenTransactionID uint64 `json:"open_transaction_id"` @@ -199,7 +204,7 @@ func getDevName(name string) string { func (info *devInfo) Name() string { hash := info.Hash if hash == "" { - hash = "base" + hash = base } return fmt.Sprintf("%s-%s", info.devices.devicePrefix, hash) } @@ -219,7 +224,7 @@ func (devices *DeviceSet) metadataDir() string { func (devices *DeviceSet) metadataFile(info *devInfo) string { file := info.Hash if file == "" { - file = "base" + file = base } return path.Join(devices.metadataDir(), file) } @@ -440,7 +445,7 @@ func (devices *DeviceSet) deviceFileWalkFunction(path string, finfo os.FileInfo) logrus.Debugf("devmapper: Loading data for file %s", path) hash := finfo.Name() - if hash == "base" { + if hash == base { hash = "" } @@ -542,7 +547,7 @@ func xfsSupported() error { } // Check if kernel supports xfs filesystem or not. - exec.Command("modprobe", "xfs").Run() + exec.Command("modprobe", xfs).Run() f, err := os.Open("/proc/filesystems") if err != nil { @@ -567,16 +572,16 @@ func xfsSupported() error { func determineDefaultFS() string { err := xfsSupported() if err == nil { - return "xfs" + return xfs } - logrus.Warnf("devmapper: XFS is not supported in your system (%v). Defaulting to ext4 filesystem", err) - return "ext4" + logrus.Warnf("devmapper: XFS is not supported in your system (%v). Defaulting to %s filesystem", ext4, err) + return ext4 } // mkfsOptions tries to figure out whether some additional mkfs options are required func mkfsOptions(fs string) []string { - if fs == "xfs" && !kernel.CheckKernelVersion(3, 16, 0) { + if fs == xfs && !kernel.CheckKernelVersion(3, 16, 0) { // For kernels earlier than 3.16 (and newer xfsutils), // some xfs features need to be explicitly disabled. return []string{"-m", "crc=0,finobt=0"} @@ -609,9 +614,9 @@ func (devices *DeviceSet) createFilesystem(info *devInfo) (err error) { }() switch devices.filesystem { - case "xfs": + case xfs: err = exec.Command("mkfs.xfs", args...).Run() - case "ext4": + case ext4: err = exec.Command("mkfs.ext4", append([]string{"-E", "nodiscard,lazy_itable_init=0,lazy_journal_init=0"}, args...)...).Run() if err != nil { err = exec.Command("mkfs.ext4", append([]string{"-E", "nodiscard,lazy_itable_init=0"}, args...)...).Run() @@ -1197,7 +1202,7 @@ func (devices *DeviceSet) growFS(info *devInfo) error { } options := "" - if devices.BaseDeviceFilesystem == "xfs" { + if devices.BaseDeviceFilesystem == xfs { // XFS needs nouuid or it can't mount filesystems with the same fs options = joinMountOptions(options, "nouuid") } @@ -1210,11 +1215,11 @@ func (devices *DeviceSet) growFS(info *devInfo) error { defer unix.Unmount(fsMountPoint, unix.MNT_DETACH) switch devices.BaseDeviceFilesystem { - case "ext4": + case ext4: if out, err := exec.Command("resize2fs", info.DevName()).CombinedOutput(); err != nil { return fmt.Errorf("Failed to grow rootfs:%v:%s", err, string(out)) } - case "xfs": + case xfs: if out, err := exec.Command("xfs_growfs", info.DevName()).CombinedOutput(); err != nil { return fmt.Errorf("Failed to grow rootfs:%v:%s", err, string(out)) } @@ -2391,7 +2396,7 @@ func (devices *DeviceSet) MountDevice(hash, path string, moptions graphdriver.Mo options := "" - if fstype == "xfs" { + if fstype == xfs { // XFS needs nouuid or it can't mount filesystems with the same fs options = joinMountOptions(options, "nouuid") } @@ -2412,7 +2417,7 @@ func (devices *DeviceSet) MountDevice(hash, path string, moptions graphdriver.Mo return fmt.Errorf("devmapper: Error mounting '%s' on '%s': %s\n%v", info.DevName(), path, err, string(dmesg.Dmesg(256))) } - if fstype == "xfs" && devices.xfsNospaceRetries != "" { + if fstype == xfs && devices.xfsNospaceRetries != "" { if err := devices.xfsSetNospaceRetries(info); err != nil { unix.Unmount(path, unix.MNT_DETACH) devices.deactivateDevice(info) @@ -2693,7 +2698,7 @@ func NewDeviceSet(root string, doInit bool, options []string, uidMaps, gidMaps [ } devices.metaDataLoopbackSize = size case "dm.fs": - if val != "ext4" && val != "xfs" { + if val != ext4 && val != xfs { return nil, fmt.Errorf("devmapper: Unsupported filesystem %s", val) } devices.filesystem = val diff --git a/vendor/github.com/containers/storage/drivers/devmapper/driver.go b/vendor/github.com/containers/storage/drivers/devmapper/driver.go index 3c044c12e..ca50e7f06 100644 --- a/vendor/github.com/containers/storage/drivers/devmapper/driver.go +++ b/vendor/github.com/containers/storage/drivers/devmapper/driver.go @@ -9,7 +9,7 @@ import ( "path" "strconv" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/devicemapper" "github.com/containers/storage/pkg/idtools" "github.com/containers/storage/pkg/locker" diff --git a/vendor/github.com/containers/storage/drivers/driver.go b/vendor/github.com/containers/storage/drivers/driver.go index 8d6b2a5dc..a5393c10f 100644 --- a/vendor/github.com/containers/storage/drivers/driver.go +++ b/vendor/github.com/containers/storage/drivers/driver.go @@ -49,8 +49,8 @@ type MountOpts struct { // Mount label is the MAC Labels to assign to mount point (SELINUX) MountLabel string // UidMaps & GidMaps are the User Namespace mappings to be assigned to content in the mount point - UidMaps []idtools.IDMap - GidMaps []idtools.IDMap + UidMaps []idtools.IDMap // nolint: golint + GidMaps []idtools.IDMap // nolint: golint Options []string } diff --git a/vendor/github.com/containers/storage/drivers/overlay/overlay.go b/vendor/github.com/containers/storage/drivers/overlay/overlay.go index 25d885be9..232cac71a 100644 --- a/vendor/github.com/containers/storage/drivers/overlay/overlay.go +++ b/vendor/github.com/containers/storage/drivers/overlay/overlay.go @@ -401,9 +401,8 @@ func supportsOverlay(home string, homeMagic graphdriver.FsMagic, rootUID, rootGI if err == nil { logrus.Debugf("overlay test mount with multiple lowers succeeded") return supportsDType, nil - } else { - logrus.Debugf("overlay test mount with multiple lowers failed %v", err) } + logrus.Debugf("overlay test mount with multiple lowers failed %v", err) } flags = fmt.Sprintf("lowerdir=%s,upperdir=%s,workdir=%s", lower1Dir, upperDir, workDir) if len(flags) < unix.Getpagesize() { @@ -411,9 +410,8 @@ func supportsOverlay(home string, homeMagic graphdriver.FsMagic, rootUID, rootGI if err == nil { logrus.Errorf("overlay test mount with multiple lowers failed, but succeeded with a single lower") return supportsDType, errors.Wrap(graphdriver.ErrNotSupported, "kernel too old to provide multiple lowers feature for overlay") - } else { - logrus.Debugf("overlay test mount with a single lower failed %v", err) } + logrus.Debugf("overlay test mount with a single lower failed %v", err) } logrus.Errorf("'overlay' is not supported over %s at %q", backingFs, home) return supportsDType, errors.Wrapf(graphdriver.ErrIncompatibleFS, "'overlay' is not supported over %s at %q", backingFs, home) @@ -810,15 +808,6 @@ func (d *Driver) get(id string, disableShifting bool, options graphdriver.MountO return "", err } readWrite := true - // fuse-overlayfs doesn't support working without an upperdir. - if d.options.mountProgram == "" { - for _, o := range options.Options { - if o == "ro" { - readWrite = false - break - } - } - } lowers, err := ioutil.ReadFile(path.Join(dir, lowerFile)) if err != nil && !os.IsNotExist(err) { diff --git a/vendor/github.com/containers/storage/drivers/overlayutils/overlayutils.go b/vendor/github.com/containers/storage/drivers/overlayutils/overlayutils.go index 49aaad07d..9fc57b36b 100644 --- a/vendor/github.com/containers/storage/drivers/overlayutils/overlayutils.go +++ b/vendor/github.com/containers/storage/drivers/overlayutils/overlayutils.go @@ -5,7 +5,7 @@ package overlayutils import ( "fmt" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/pkg/errors" ) diff --git a/vendor/github.com/containers/storage/drivers/vfs/driver.go b/vendor/github.com/containers/storage/drivers/vfs/driver.go index 58a1635ae..f2859b427 100644 --- a/vendor/github.com/containers/storage/drivers/vfs/driver.go +++ b/vendor/github.com/containers/storage/drivers/vfs/driver.go @@ -8,7 +8,7 @@ import ( "strconv" "strings" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/archive" "github.com/containers/storage/pkg/idtools" "github.com/containers/storage/pkg/parsers" diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs.go b/vendor/github.com/containers/storage/drivers/zfs/zfs.go index a2bf5565b..c9c8c5c3c 100644 --- a/vendor/github.com/containers/storage/drivers/zfs/zfs.go +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs.go @@ -12,7 +12,7 @@ import ( "sync" "time" - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/idtools" "github.com/containers/storage/pkg/mount" "github.com/containers/storage/pkg/parsers" diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go b/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go index fb1ef3a3d..edcb1da36 100644 --- a/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go @@ -1,7 +1,7 @@ package zfs import ( - "github.com/containers/storage/drivers" + graphdriver "github.com/containers/storage/drivers" "github.com/pkg/errors" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/containers/storage/go.mod b/vendor/github.com/containers/storage/go.mod index b7a05a65b..ba40f9c14 100644 --- a/vendor/github.com/containers/storage/go.mod +++ b/vendor/github.com/containers/storage/go.mod @@ -7,14 +7,14 @@ require ( github.com/Microsoft/hcsshim v0.8.7 github.com/docker/docker v0.0.0-20171019062838-86f080cff091 // indirect github.com/docker/go-units v0.4.0 - github.com/klauspost/compress v1.9.7 + github.com/klauspost/compress v1.9.8 github.com/klauspost/cpuid v1.2.1 // indirect github.com/klauspost/pgzip v1.2.1 - github.com/mattn/go-shellwords v1.0.7 + github.com/mattn/go-shellwords v1.0.9 github.com/mistifyio/go-zfs v2.1.1+incompatible github.com/opencontainers/go-digest v1.0.0-rc1 github.com/opencontainers/runc v1.0.0-rc9 - github.com/opencontainers/selinux v1.3.0 + github.com/opencontainers/selinux v1.3.1 github.com/pkg/errors v0.9.1 github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7 github.com/sirupsen/logrus v1.4.2 @@ -24,7 +24,7 @@ require ( github.com/tchap/go-patricia v2.3.0+incompatible github.com/vbatts/tar-split v0.11.1 golang.org/x/net v0.0.0-20190628185345-da137c7871d7 - golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + golang.org/x/sys v0.0.0-20191115151921-52ab43148777 gotest.tools v2.2.0+incompatible ) diff --git a/vendor/github.com/containers/storage/go.sum b/vendor/github.com/containers/storage/go.sum index ffda0c42f..e2785594d 100644 --- a/vendor/github.com/containers/storage/go.sum +++ b/vendor/github.com/containers/storage/go.sum @@ -77,6 +77,8 @@ github.com/klauspost/compress v1.9.5 h1:U+CaK85mrNNb4k8BNOfgJtJ/gr6kswUCFj6miSzV github.com/klauspost/compress v1.9.5/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/compress v1.9.7 h1:hYW1gP94JUmAhBtJ+LNz5My+gBobDxPR1iVuKug26aA= github.com/klauspost/compress v1.9.7/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= +github.com/klauspost/compress v1.9.8 h1:VMAMUUOh+gaxKTMk+zqbjsSjsIcUcL/LF4o63i82QyA= +github.com/klauspost/compress v1.9.8/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/cpuid v1.2.1 h1:vJi+O/nMdFt0vqm8NZBI6wzALWdA2X+egi0ogNyrC/w= github.com/klauspost/cpuid v1.2.1/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek= github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM= @@ -89,6 +91,8 @@ github.com/mattn/go-shellwords v1.0.6 h1:9Jok5pILi5S1MnDirGVTufYGtksUs/V2BWUP3Zk github.com/mattn/go-shellwords v1.0.6/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= github.com/mattn/go-shellwords v1.0.7 h1:KqhVjVZomx2puPACkj9vrGFqnp42Htvo9SEAWePHKOs= github.com/mattn/go-shellwords v1.0.7/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= +github.com/mattn/go-shellwords v1.0.9 h1:eaB5JspOwiKKcHdqcjbfe5lA9cNn/4NRRtddXJCimqk= +github.com/mattn/go-shellwords v1.0.9/go.mod h1:EZzvwXDESEeg03EKmM+RmDnNOPKG4lLtQsUlTZDWQ8Y= github.com/mistifyio/go-zfs v2.1.1+incompatible h1:gAMO1HM9xBRONLHHYnu5iFsOJUiJdNZo6oqSENd4eW8= github.com/mistifyio/go-zfs v2.1.1+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4= github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618 h1:7InQ7/zrOh6SlFjaXFubv0xX0HsuC9qJsdqm7bNQpYM= @@ -111,6 +115,8 @@ github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4Ft github.com/opencontainers/selinux v1.2.2/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs= github.com/opencontainers/selinux v1.3.0 h1:xsI95WzPZu5exzA6JzkLSfdr/DilzOhCJOqGe5TgR0g= github.com/opencontainers/selinux v1.3.0/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs= +github.com/opencontainers/selinux v1.3.1 h1:dn2Rc3wTEvTB6iVqoFrKKeMb0uZ38ZheeyMu2h5C1TI= +github.com/opencontainers/selinux v1.3.1/go.mod h1:yTcKuYAh6R95iDpefGLQaPaRwJFwyzAJufJyiTt7s0g= github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= @@ -194,6 +200,8 @@ golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1 golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191025090151-53bf42e6b339 h1:zSqWKgm/o7HAnlAzBQ+aetp9fpuyytsXnKA8eiLHYQM= golang.org/x/sys v0.0.0-20191025090151-53bf42e6b339/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191115151921-52ab43148777 h1:wejkGHRTr38uaKRqECZlsCsJ1/TGxIyFbH32x5zUdu4= +golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191127021746-63cb32ae39b2 h1:/J2nHFg1MTqaRLFO7M+J78ASNsJoz3r0cvHBPQ77fsE= golang.org/x/sys v0.0.0-20191127021746-63cb32ae39b2/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= diff --git a/vendor/github.com/containers/storage/images.go b/vendor/github.com/containers/storage/images.go index 6373ebb41..ef95598b8 100644 --- a/vendor/github.com/containers/storage/images.go +++ b/vendor/github.com/containers/storage/images.go @@ -214,17 +214,17 @@ func bigDataNameIsManifest(name string) bool { // recomputeDigests takes a fixed digest and a name-to-digest map and builds a // list of the unique values that would identify the image. -func (image *Image) recomputeDigests() error { - validDigests := make([]digest.Digest, 0, len(image.BigDataDigests)+1) +func (i *Image) recomputeDigests() error { + validDigests := make([]digest.Digest, 0, len(i.BigDataDigests)+1) digests := make(map[digest.Digest]struct{}) - if image.Digest != "" { - if err := image.Digest.Validate(); err != nil { - return errors.Wrapf(err, "error validating image digest %q", string(image.Digest)) + if i.Digest != "" { + if err := i.Digest.Validate(); err != nil { + return errors.Wrapf(err, "error validating image digest %q", string(i.Digest)) } - digests[image.Digest] = struct{}{} - validDigests = append(validDigests, image.Digest) + digests[i.Digest] = struct{}{} + validDigests = append(validDigests, i.Digest) } - for name, digest := range image.BigDataDigests { + for name, digest := range i.BigDataDigests { if !bigDataNameIsManifest(name) { continue } @@ -237,10 +237,10 @@ func (image *Image) recomputeDigests() error { validDigests = append(validDigests, digest) } } - if image.Digest == "" && len(validDigests) > 0 { - image.Digest = validDigests[0] + if i.Digest == "" && len(validDigests) > 0 { + i.Digest = validDigests[0] } - image.Digests = validDigests + i.Digests = validDigests return nil } diff --git a/vendor/github.com/containers/storage/layers.go b/vendor/github.com/containers/storage/layers.go index 0c5fcafde..dccfc169d 100644 --- a/vendor/github.com/containers/storage/layers.go +++ b/vendor/github.com/containers/storage/layers.go @@ -239,6 +239,10 @@ type LayerStore interface { // ApplyDiff reads a tarstream which was created by a previous call to Diff and // applies its changes to a specified layer. ApplyDiff(to string, diff io.Reader) (int64, error) + + // LoadLocked wraps Load in a locked state. This means it loads the store + // and cleans-up invalid layers if needed. + LoadLocked() error } type layerStore struct { @@ -346,6 +350,7 @@ func (r *layerStore) Load() error { r.byname = names r.bycompressedsum = compressedsums r.byuncompressedsum = uncompressedsums + // Load and merge information about which layers are mounted, and where. if r.IsReadWrite() { r.mountsLockfile.RLock() @@ -353,22 +358,23 @@ func (r *layerStore) Load() error { if err = r.loadMounts(); err != nil { return err } - } - // Last step: if we're writable, try to remove anything that a previous - // user of this storage area marked for deletion but didn't manage to - // actually delete. - if r.IsReadWrite() && r.Locked() { - for _, layer := range r.layers { - if layer.Flags == nil { - layer.Flags = make(map[string]interface{}) - } - if cleanup, ok := layer.Flags[incompleteFlag]; ok { - if b, ok := cleanup.(bool); ok && b { - err = r.deleteInternal(layer.ID) - if err != nil { - break + + // Last step: as we’re writable, try to remove anything that a previous + // user of this storage area marked for deletion but didn't manage to + // actually delete. + if r.Locked() { + for _, layer := range r.layers { + if layer.Flags == nil { + layer.Flags = make(map[string]interface{}) + } + if cleanup, ok := layer.Flags[incompleteFlag]; ok { + if b, ok := cleanup.(bool); ok && b { + err = r.deleteInternal(layer.ID) + if err != nil { + break + } + shouldSave = true } - shouldSave = true } } } @@ -376,9 +382,16 @@ func (r *layerStore) Load() error { return r.saveLayers() } } + return err } +func (r *layerStore) LoadLocked() error { + r.lockfile.Lock() + defer r.lockfile.Unlock() + return r.Load() +} + func (r *layerStore) loadMounts() error { mounts := make(map[string]*Layer) mpath := r.mountspath() @@ -487,8 +500,6 @@ func (s *store) newLayerStore(rundir string, layerdir string, driver drivers.Dri if err != nil { return nil, err } - lockfile.Lock() - defer lockfile.Unlock() mountsLockfile, err := GetLockfile(filepath.Join(rundir, "mountpoints.lock")) if err != nil { return nil, err @@ -516,8 +527,6 @@ func newROLayerStore(rundir string, layerdir string, driver drivers.Driver) (ROL if err != nil { return nil, err } - lockfile.RLock() - defer lockfile.Unlock() rlstore := layerStore{ lockfile: lockfile, mountsLockfile: nil, diff --git a/vendor/github.com/containers/storage/layers_ffjson.go b/vendor/github.com/containers/storage/layers_ffjson.go deleted file mode 100644 index 3a1095226..000000000 --- a/vendor/github.com/containers/storage/layers_ffjson.go +++ /dev/null @@ -1,2156 +0,0 @@ -// Code generated by ffjson <https://github.com/pquerna/ffjson>. DO NOT EDIT. -// source: layers.go - -package storage - -import ( - "bytes" - "encoding/json" - "fmt" - "github.com/containers/storage/pkg/archive" - "github.com/containers/storage/pkg/idtools" - "github.com/opencontainers/go-digest" - fflib "github.com/pquerna/ffjson/fflib/v1" -) - -// MarshalJSON marshal bytes to json - template -func (j *DiffOptions) MarshalJSON() ([]byte, error) { - var buf fflib.Buffer - if j == nil { - buf.WriteString("null") - return buf.Bytes(), nil - } - err := j.MarshalJSONBuf(&buf) - if err != nil { - return nil, err - } - return buf.Bytes(), nil -} - -// MarshalJSONBuf marshal buff to json - template -func (j *DiffOptions) MarshalJSONBuf(buf fflib.EncodingBuffer) error { - if j == nil { - buf.WriteString("null") - return nil - } - var err error - var obj []byte - _ = obj - _ = err - if j.Compression != nil { - buf.WriteString(`{"Compression":`) - fflib.FormatBits2(buf, uint64(*j.Compression), 10, *j.Compression < 0) - } else { - buf.WriteString(`{"Compression":null`) - } - buf.WriteByte('}') - return nil -} - -const ( - ffjtDiffOptionsbase = iota - ffjtDiffOptionsnosuchkey - - ffjtDiffOptionsCompression -) - -var ffjKeyDiffOptionsCompression = []byte("Compression") - -// UnmarshalJSON umarshall json - template of ffjson -func (j *DiffOptions) UnmarshalJSON(input []byte) error { - fs := fflib.NewFFLexer(input) - return j.UnmarshalJSONFFLexer(fs, fflib.FFParse_map_start) -} - -// UnmarshalJSONFFLexer fast json unmarshall - template ffjson -func (j *DiffOptions) UnmarshalJSONFFLexer(fs *fflib.FFLexer, state fflib.FFParseState) error { - var err error - currentKey := ffjtDiffOptionsbase - _ = currentKey - tok := fflib.FFTok_init - wantedTok := fflib.FFTok_init - -mainparse: - for { - tok = fs.Scan() - // println(fmt.Sprintf("debug: tok: %v state: %v", tok, state)) - if tok == fflib.FFTok_error { - goto tokerror - } - - switch state { - - case fflib.FFParse_map_start: - if tok != fflib.FFTok_left_bracket { - wantedTok = fflib.FFTok_left_bracket - goto wrongtokenerror - } - state = fflib.FFParse_want_key - continue - - case fflib.FFParse_after_value: - if tok == fflib.FFTok_comma { - state = fflib.FFParse_want_key - } else if tok == fflib.FFTok_right_bracket { - goto done - } else { - wantedTok = fflib.FFTok_comma - goto wrongtokenerror - } - - case fflib.FFParse_want_key: - // json {} ended. goto exit. woo. - if tok == fflib.FFTok_right_bracket { - goto done - } - if tok != fflib.FFTok_string { - wantedTok = fflib.FFTok_string - goto wrongtokenerror - } - - kn := fs.Output.Bytes() - if len(kn) <= 0 { - // "" case. hrm. - currentKey = ffjtDiffOptionsnosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } else { - switch kn[0] { - - case 'C': - - if bytes.Equal(ffjKeyDiffOptionsCompression, kn) { - currentKey = ffjtDiffOptionsCompression - state = fflib.FFParse_want_colon - goto mainparse - } - - } - - if fflib.EqualFoldRight(ffjKeyDiffOptionsCompression, kn) { - currentKey = ffjtDiffOptionsCompression - state = fflib.FFParse_want_colon - goto mainparse - } - - currentKey = ffjtDiffOptionsnosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } - - case fflib.FFParse_want_colon: - if tok != fflib.FFTok_colon { - wantedTok = fflib.FFTok_colon - goto wrongtokenerror - } - state = fflib.FFParse_want_value - continue - case fflib.FFParse_want_value: - - if tok == fflib.FFTok_left_brace || tok == fflib.FFTok_left_bracket || tok == fflib.FFTok_integer || tok == fflib.FFTok_double || tok == fflib.FFTok_string || tok == fflib.FFTok_bool || tok == fflib.FFTok_null { - switch currentKey { - - case ffjtDiffOptionsCompression: - goto handle_Compression - - case ffjtDiffOptionsnosuchkey: - err = fs.SkipField(tok) - if err != nil { - return fs.WrapErr(err) - } - state = fflib.FFParse_after_value - goto mainparse - } - } else { - goto wantedvalue - } - } - } - -handle_Compression: - - /* handler: j.Compression type=archive.Compression kind=int quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for Compression", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - j.Compression = nil - - } else { - - tval, err := fflib.ParseInt(fs.Output.Bytes(), 10, 64) - - if err != nil { - return fs.WrapErr(err) - } - - ttypval := archive.Compression(tval) - j.Compression = &ttypval - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -wantedvalue: - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) -wrongtokenerror: - return fs.WrapErr(fmt.Errorf("ffjson: wanted token: %v, but got token: %v output=%s", wantedTok, tok, fs.Output.String())) -tokerror: - if fs.BigError != nil { - return fs.WrapErr(fs.BigError) - } - err = fs.Error.ToError() - if err != nil { - return fs.WrapErr(err) - } - panic("ffjson-generated: unreachable, please report bug.") -done: - - return nil -} - -// MarshalJSON marshal bytes to json - template -func (j *Layer) MarshalJSON() ([]byte, error) { - var buf fflib.Buffer - if j == nil { - buf.WriteString("null") - return buf.Bytes(), nil - } - err := j.MarshalJSONBuf(&buf) - if err != nil { - return nil, err - } - return buf.Bytes(), nil -} - -// MarshalJSONBuf marshal buff to json - template -func (j *Layer) MarshalJSONBuf(buf fflib.EncodingBuffer) error { - if j == nil { - buf.WriteString("null") - return nil - } - var err error - var obj []byte - _ = obj - _ = err - buf.WriteString(`{ "id":`) - fflib.WriteJsonString(buf, string(j.ID)) - buf.WriteByte(',') - if len(j.Names) != 0 { - buf.WriteString(`"names":`) - if j.Names != nil { - buf.WriteString(`[`) - for i, v := range j.Names { - if i != 0 { - buf.WriteString(`,`) - } - fflib.WriteJsonString(buf, string(v)) - } - buf.WriteString(`]`) - } else { - buf.WriteString(`null`) - } - buf.WriteByte(',') - } - if len(j.Parent) != 0 { - buf.WriteString(`"parent":`) - fflib.WriteJsonString(buf, string(j.Parent)) - buf.WriteByte(',') - } - if len(j.Metadata) != 0 { - buf.WriteString(`"metadata":`) - fflib.WriteJsonString(buf, string(j.Metadata)) - buf.WriteByte(',') - } - if len(j.MountLabel) != 0 { - buf.WriteString(`"mountlabel":`) - fflib.WriteJsonString(buf, string(j.MountLabel)) - buf.WriteByte(',') - } - if true { - buf.WriteString(`"created":`) - - { - - obj, err = j.Created.MarshalJSON() - if err != nil { - return err - } - buf.Write(obj) - - } - buf.WriteByte(',') - } - if len(j.CompressedDigest) != 0 { - buf.WriteString(`"compressed-diff-digest":`) - fflib.WriteJsonString(buf, string(j.CompressedDigest)) - buf.WriteByte(',') - } - if j.CompressedSize != 0 { - buf.WriteString(`"compressed-size":`) - fflib.FormatBits2(buf, uint64(j.CompressedSize), 10, j.CompressedSize < 0) - buf.WriteByte(',') - } - if len(j.UncompressedDigest) != 0 { - buf.WriteString(`"diff-digest":`) - fflib.WriteJsonString(buf, string(j.UncompressedDigest)) - buf.WriteByte(',') - } - if j.UncompressedSize != 0 { - buf.WriteString(`"diff-size":`) - fflib.FormatBits2(buf, uint64(j.UncompressedSize), 10, j.UncompressedSize < 0) - buf.WriteByte(',') - } - if j.CompressionType != 0 { - buf.WriteString(`"compression":`) - fflib.FormatBits2(buf, uint64(j.CompressionType), 10, j.CompressionType < 0) - buf.WriteByte(',') - } - if len(j.UIDs) != 0 { - buf.WriteString(`"uidset":`) - if j.UIDs != nil { - buf.WriteString(`[`) - for i, v := range j.UIDs { - if i != 0 { - buf.WriteString(`,`) - } - fflib.FormatBits2(buf, uint64(v), 10, false) - } - buf.WriteString(`]`) - } else { - buf.WriteString(`null`) - } - buf.WriteByte(',') - } - if len(j.GIDs) != 0 { - buf.WriteString(`"gidset":`) - if j.GIDs != nil { - buf.WriteString(`[`) - for i, v := range j.GIDs { - if i != 0 { - buf.WriteString(`,`) - } - fflib.FormatBits2(buf, uint64(v), 10, false) - } - buf.WriteString(`]`) - } else { - buf.WriteString(`null`) - } - buf.WriteByte(',') - } - if len(j.Flags) != 0 { - buf.WriteString(`"flags":`) - /* Falling back. type=map[string]interface {} kind=map */ - err = buf.Encode(j.Flags) - if err != nil { - return err - } - buf.WriteByte(',') - } - if len(j.UIDMap) != 0 { - buf.WriteString(`"uidmap":`) - if j.UIDMap != nil { - buf.WriteString(`[`) - for i, v := range j.UIDMap { - if i != 0 { - buf.WriteString(`,`) - } - /* Struct fall back. type=idtools.IDMap kind=struct */ - err = buf.Encode(&v) - if err != nil { - return err - } - } - buf.WriteString(`]`) - } else { - buf.WriteString(`null`) - } - buf.WriteByte(',') - } - if len(j.GIDMap) != 0 { - buf.WriteString(`"gidmap":`) - if j.GIDMap != nil { - buf.WriteString(`[`) - for i, v := range j.GIDMap { - if i != 0 { - buf.WriteString(`,`) - } - /* Struct fall back. type=idtools.IDMap kind=struct */ - err = buf.Encode(&v) - if err != nil { - return err - } - } - buf.WriteString(`]`) - } else { - buf.WriteString(`null`) - } - buf.WriteByte(',') - } - buf.Rewind(1) - buf.WriteByte('}') - return nil -} - -const ( - ffjtLayerbase = iota - ffjtLayernosuchkey - - ffjtLayerID - - ffjtLayerNames - - ffjtLayerParent - - ffjtLayerMetadata - - ffjtLayerMountLabel - - ffjtLayerCreated - - ffjtLayerCompressedDigest - - ffjtLayerCompressedSize - - ffjtLayerUncompressedDigest - - ffjtLayerUncompressedSize - - ffjtLayerCompressionType - - ffjtLayerUIDs - - ffjtLayerGIDs - - ffjtLayerFlags - - ffjtLayerUIDMap - - ffjtLayerGIDMap -) - -var ffjKeyLayerID = []byte("id") - -var ffjKeyLayerNames = []byte("names") - -var ffjKeyLayerParent = []byte("parent") - -var ffjKeyLayerMetadata = []byte("metadata") - -var ffjKeyLayerMountLabel = []byte("mountlabel") - -var ffjKeyLayerCreated = []byte("created") - -var ffjKeyLayerCompressedDigest = []byte("compressed-diff-digest") - -var ffjKeyLayerCompressedSize = []byte("compressed-size") - -var ffjKeyLayerUncompressedDigest = []byte("diff-digest") - -var ffjKeyLayerUncompressedSize = []byte("diff-size") - -var ffjKeyLayerCompressionType = []byte("compression") - -var ffjKeyLayerUIDs = []byte("uidset") - -var ffjKeyLayerGIDs = []byte("gidset") - -var ffjKeyLayerFlags = []byte("flags") - -var ffjKeyLayerUIDMap = []byte("uidmap") - -var ffjKeyLayerGIDMap = []byte("gidmap") - -// UnmarshalJSON umarshall json - template of ffjson -func (j *Layer) UnmarshalJSON(input []byte) error { - fs := fflib.NewFFLexer(input) - return j.UnmarshalJSONFFLexer(fs, fflib.FFParse_map_start) -} - -// UnmarshalJSONFFLexer fast json unmarshall - template ffjson -func (j *Layer) UnmarshalJSONFFLexer(fs *fflib.FFLexer, state fflib.FFParseState) error { - var err error - currentKey := ffjtLayerbase - _ = currentKey - tok := fflib.FFTok_init - wantedTok := fflib.FFTok_init - -mainparse: - for { - tok = fs.Scan() - // println(fmt.Sprintf("debug: tok: %v state: %v", tok, state)) - if tok == fflib.FFTok_error { - goto tokerror - } - - switch state { - - case fflib.FFParse_map_start: - if tok != fflib.FFTok_left_bracket { - wantedTok = fflib.FFTok_left_bracket - goto wrongtokenerror - } - state = fflib.FFParse_want_key - continue - - case fflib.FFParse_after_value: - if tok == fflib.FFTok_comma { - state = fflib.FFParse_want_key - } else if tok == fflib.FFTok_right_bracket { - goto done - } else { - wantedTok = fflib.FFTok_comma - goto wrongtokenerror - } - - case fflib.FFParse_want_key: - // json {} ended. goto exit. woo. - if tok == fflib.FFTok_right_bracket { - goto done - } - if tok != fflib.FFTok_string { - wantedTok = fflib.FFTok_string - goto wrongtokenerror - } - - kn := fs.Output.Bytes() - if len(kn) <= 0 { - // "" case. hrm. - currentKey = ffjtLayernosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } else { - switch kn[0] { - - case 'c': - - if bytes.Equal(ffjKeyLayerCreated, kn) { - currentKey = ffjtLayerCreated - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerCompressedDigest, kn) { - currentKey = ffjtLayerCompressedDigest - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerCompressedSize, kn) { - currentKey = ffjtLayerCompressedSize - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerCompressionType, kn) { - currentKey = ffjtLayerCompressionType - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'd': - - if bytes.Equal(ffjKeyLayerUncompressedDigest, kn) { - currentKey = ffjtLayerUncompressedDigest - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerUncompressedSize, kn) { - currentKey = ffjtLayerUncompressedSize - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'f': - - if bytes.Equal(ffjKeyLayerFlags, kn) { - currentKey = ffjtLayerFlags - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'g': - - if bytes.Equal(ffjKeyLayerGIDs, kn) { - currentKey = ffjtLayerGIDs - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerGIDMap, kn) { - currentKey = ffjtLayerGIDMap - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'i': - - if bytes.Equal(ffjKeyLayerID, kn) { - currentKey = ffjtLayerID - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'm': - - if bytes.Equal(ffjKeyLayerMetadata, kn) { - currentKey = ffjtLayerMetadata - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerMountLabel, kn) { - currentKey = ffjtLayerMountLabel - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'n': - - if bytes.Equal(ffjKeyLayerNames, kn) { - currentKey = ffjtLayerNames - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'p': - - if bytes.Equal(ffjKeyLayerParent, kn) { - currentKey = ffjtLayerParent - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'u': - - if bytes.Equal(ffjKeyLayerUIDs, kn) { - currentKey = ffjtLayerUIDs - state = fflib.FFParse_want_colon - goto mainparse - - } else if bytes.Equal(ffjKeyLayerUIDMap, kn) { - currentKey = ffjtLayerUIDMap - state = fflib.FFParse_want_colon - goto mainparse - } - - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerGIDMap, kn) { - currentKey = ffjtLayerGIDMap - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerUIDMap, kn) { - currentKey = ffjtLayerUIDMap - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerFlags, kn) { - currentKey = ffjtLayerFlags - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerGIDs, kn) { - currentKey = ffjtLayerGIDs - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerUIDs, kn) { - currentKey = ffjtLayerUIDs - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerCompressionType, kn) { - currentKey = ffjtLayerCompressionType - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerUncompressedSize, kn) { - currentKey = ffjtLayerUncompressedSize - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerUncompressedDigest, kn) { - currentKey = ffjtLayerUncompressedDigest - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerCompressedSize, kn) { - currentKey = ffjtLayerCompressedSize - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerCompressedDigest, kn) { - currentKey = ffjtLayerCompressedDigest - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerCreated, kn) { - currentKey = ffjtLayerCreated - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerMountLabel, kn) { - currentKey = ffjtLayerMountLabel - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerMetadata, kn) { - currentKey = ffjtLayerMetadata - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerParent, kn) { - currentKey = ffjtLayerParent - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.EqualFoldRight(ffjKeyLayerNames, kn) { - currentKey = ffjtLayerNames - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeyLayerID, kn) { - currentKey = ffjtLayerID - state = fflib.FFParse_want_colon - goto mainparse - } - - currentKey = ffjtLayernosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } - - case fflib.FFParse_want_colon: - if tok != fflib.FFTok_colon { - wantedTok = fflib.FFTok_colon - goto wrongtokenerror - } - state = fflib.FFParse_want_value - continue - case fflib.FFParse_want_value: - - if tok == fflib.FFTok_left_brace || tok == fflib.FFTok_left_bracket || tok == fflib.FFTok_integer || tok == fflib.FFTok_double || tok == fflib.FFTok_string || tok == fflib.FFTok_bool || tok == fflib.FFTok_null { - switch currentKey { - - case ffjtLayerID: - goto handle_ID - - case ffjtLayerNames: - goto handle_Names - - case ffjtLayerParent: - goto handle_Parent - - case ffjtLayerMetadata: - goto handle_Metadata - - case ffjtLayerMountLabel: - goto handle_MountLabel - - case ffjtLayerCreated: - goto handle_Created - - case ffjtLayerCompressedDigest: - goto handle_CompressedDigest - - case ffjtLayerCompressedSize: - goto handle_CompressedSize - - case ffjtLayerUncompressedDigest: - goto handle_UncompressedDigest - - case ffjtLayerUncompressedSize: - goto handle_UncompressedSize - - case ffjtLayerCompressionType: - goto handle_CompressionType - - case ffjtLayerUIDs: - goto handle_UIDs - - case ffjtLayerGIDs: - goto handle_GIDs - - case ffjtLayerFlags: - goto handle_Flags - - case ffjtLayerUIDMap: - goto handle_UIDMap - - case ffjtLayerGIDMap: - goto handle_GIDMap - - case ffjtLayernosuchkey: - err = fs.SkipField(tok) - if err != nil { - return fs.WrapErr(err) - } - state = fflib.FFParse_after_value - goto mainparse - } - } else { - goto wantedvalue - } - } - } - -handle_ID: - - /* handler: j.ID type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.ID = string(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_Names: - - /* handler: j.Names type=[]string kind=slice quoted=false*/ - - { - - { - if tok != fflib.FFTok_left_brace && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for ", tok)) - } - } - - if tok == fflib.FFTok_null { - j.Names = nil - } else { - - j.Names = []string{} - - wantVal := true - - for { - - var tmpJNames string - - tok = fs.Scan() - if tok == fflib.FFTok_error { - goto tokerror - } - if tok == fflib.FFTok_right_brace { - break - } - - if tok == fflib.FFTok_comma { - if wantVal == true { - // TODO(pquerna): this isn't an ideal error message, this handles - // things like [,,,] as an array value. - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) - } - continue - } else { - wantVal = true - } - - /* handler: tmpJNames type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - tmpJNames = string(string(outBuf)) - - } - } - - j.Names = append(j.Names, tmpJNames) - - wantVal = false - } - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_Parent: - - /* handler: j.Parent type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.Parent = string(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_Metadata: - - /* handler: j.Metadata type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.Metadata = string(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_MountLabel: - - /* handler: j.MountLabel type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.MountLabel = string(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_Created: - - /* handler: j.Created type=time.Time kind=struct quoted=false*/ - - { - if tok == fflib.FFTok_null { - - } else { - - tbuf, err := fs.CaptureField(tok) - if err != nil { - return fs.WrapErr(err) - } - - err = j.Created.UnmarshalJSON(tbuf) - if err != nil { - return fs.WrapErr(err) - } - } - state = fflib.FFParse_after_value - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_CompressedDigest: - - /* handler: j.CompressedDigest type=digest.Digest kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for Digest", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.CompressedDigest = digest.Digest(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_CompressedSize: - - /* handler: j.CompressedSize type=int64 kind=int64 quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for int64", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - } else { - - tval, err := fflib.ParseInt(fs.Output.Bytes(), 10, 64) - - if err != nil { - return fs.WrapErr(err) - } - - j.CompressedSize = int64(tval) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_UncompressedDigest: - - /* handler: j.UncompressedDigest type=digest.Digest kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for Digest", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.UncompressedDigest = digest.Digest(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_UncompressedSize: - - /* handler: j.UncompressedSize type=int64 kind=int64 quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for int64", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - } else { - - tval, err := fflib.ParseInt(fs.Output.Bytes(), 10, 64) - - if err != nil { - return fs.WrapErr(err) - } - - j.UncompressedSize = int64(tval) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_CompressionType: - - /* handler: j.CompressionType type=archive.Compression kind=int quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for Compression", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - } else { - - tval, err := fflib.ParseInt(fs.Output.Bytes(), 10, 64) - - if err != nil { - return fs.WrapErr(err) - } - - j.CompressionType = archive.Compression(tval) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_UIDs: - - /* handler: j.UIDs type=[]uint32 kind=slice quoted=false*/ - - { - - { - if tok != fflib.FFTok_left_brace && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for ", tok)) - } - } - - if tok == fflib.FFTok_null { - j.UIDs = nil - } else { - - j.UIDs = []uint32{} - - wantVal := true - - for { - - var tmpJUIDs uint32 - - tok = fs.Scan() - if tok == fflib.FFTok_error { - goto tokerror - } - if tok == fflib.FFTok_right_brace { - break - } - - if tok == fflib.FFTok_comma { - if wantVal == true { - // TODO(pquerna): this isn't an ideal error message, this handles - // things like [,,,] as an array value. - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) - } - continue - } else { - wantVal = true - } - - /* handler: tmpJUIDs type=uint32 kind=uint32 quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for uint32", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - } else { - - tval, err := fflib.ParseUint(fs.Output.Bytes(), 10, 32) - - if err != nil { - return fs.WrapErr(err) - } - - tmpJUIDs = uint32(tval) - - } - } - - j.UIDs = append(j.UIDs, tmpJUIDs) - - wantVal = false - } - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_GIDs: - - /* handler: j.GIDs type=[]uint32 kind=slice quoted=false*/ - - { - - { - if tok != fflib.FFTok_left_brace && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for ", tok)) - } - } - - if tok == fflib.FFTok_null { - j.GIDs = nil - } else { - - j.GIDs = []uint32{} - - wantVal := true - - for { - - var tmpJGIDs uint32 - - tok = fs.Scan() - if tok == fflib.FFTok_error { - goto tokerror - } - if tok == fflib.FFTok_right_brace { - break - } - - if tok == fflib.FFTok_comma { - if wantVal == true { - // TODO(pquerna): this isn't an ideal error message, this handles - // things like [,,,] as an array value. - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) - } - continue - } else { - wantVal = true - } - - /* handler: tmpJGIDs type=uint32 kind=uint32 quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for uint32", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - } else { - - tval, err := fflib.ParseUint(fs.Output.Bytes(), 10, 32) - - if err != nil { - return fs.WrapErr(err) - } - - tmpJGIDs = uint32(tval) - - } - } - - j.GIDs = append(j.GIDs, tmpJGIDs) - - wantVal = false - } - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_Flags: - - /* handler: j.Flags type=map[string]interface {} kind=map quoted=false*/ - - { - - { - if tok != fflib.FFTok_left_bracket && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for ", tok)) - } - } - - if tok == fflib.FFTok_null { - j.Flags = nil - } else { - - j.Flags = make(map[string]interface{}, 0) - - wantVal := true - - for { - - var k string - - var tmpJFlags interface{} - - tok = fs.Scan() - if tok == fflib.FFTok_error { - goto tokerror - } - if tok == fflib.FFTok_right_bracket { - break - } - - if tok == fflib.FFTok_comma { - if wantVal == true { - // TODO(pquerna): this isn't an ideal error message, this handles - // things like [,,,] as an array value. - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) - } - continue - } else { - wantVal = true - } - - /* handler: k type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - k = string(string(outBuf)) - - } - } - - // Expect ':' after key - tok = fs.Scan() - if tok != fflib.FFTok_colon { - return fs.WrapErr(fmt.Errorf("wanted colon token, but got token: %v", tok)) - } - - tok = fs.Scan() - /* handler: tmpJFlags type=interface {} kind=interface quoted=false*/ - - { - /* Falling back. type=interface {} kind=interface */ - tbuf, err := fs.CaptureField(tok) - if err != nil { - return fs.WrapErr(err) - } - - err = json.Unmarshal(tbuf, &tmpJFlags) - if err != nil { - return fs.WrapErr(err) - } - } - - j.Flags[k] = tmpJFlags - - wantVal = false - } - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_UIDMap: - - /* handler: j.UIDMap type=[]idtools.IDMap kind=slice quoted=false*/ - - { - - { - if tok != fflib.FFTok_left_brace && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for ", tok)) - } - } - - if tok == fflib.FFTok_null { - j.UIDMap = nil - } else { - - j.UIDMap = []idtools.IDMap{} - - wantVal := true - - for { - - var tmpJUIDMap idtools.IDMap - - tok = fs.Scan() - if tok == fflib.FFTok_error { - goto tokerror - } - if tok == fflib.FFTok_right_brace { - break - } - - if tok == fflib.FFTok_comma { - if wantVal == true { - // TODO(pquerna): this isn't an ideal error message, this handles - // things like [,,,] as an array value. - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) - } - continue - } else { - wantVal = true - } - - /* handler: tmpJUIDMap type=idtools.IDMap kind=struct quoted=false*/ - - { - /* Falling back. type=idtools.IDMap kind=struct */ - tbuf, err := fs.CaptureField(tok) - if err != nil { - return fs.WrapErr(err) - } - - err = json.Unmarshal(tbuf, &tmpJUIDMap) - if err != nil { - return fs.WrapErr(err) - } - } - - j.UIDMap = append(j.UIDMap, tmpJUIDMap) - - wantVal = false - } - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_GIDMap: - - /* handler: j.GIDMap type=[]idtools.IDMap kind=slice quoted=false*/ - - { - - { - if tok != fflib.FFTok_left_brace && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for ", tok)) - } - } - - if tok == fflib.FFTok_null { - j.GIDMap = nil - } else { - - j.GIDMap = []idtools.IDMap{} - - wantVal := true - - for { - - var tmpJGIDMap idtools.IDMap - - tok = fs.Scan() - if tok == fflib.FFTok_error { - goto tokerror - } - if tok == fflib.FFTok_right_brace { - break - } - - if tok == fflib.FFTok_comma { - if wantVal == true { - // TODO(pquerna): this isn't an ideal error message, this handles - // things like [,,,] as an array value. - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) - } - continue - } else { - wantVal = true - } - - /* handler: tmpJGIDMap type=idtools.IDMap kind=struct quoted=false*/ - - { - /* Falling back. type=idtools.IDMap kind=struct */ - tbuf, err := fs.CaptureField(tok) - if err != nil { - return fs.WrapErr(err) - } - - err = json.Unmarshal(tbuf, &tmpJGIDMap) - if err != nil { - return fs.WrapErr(err) - } - } - - j.GIDMap = append(j.GIDMap, tmpJGIDMap) - - wantVal = false - } - } - } - - state = fflib.FFParse_after_value - goto mainparse - -wantedvalue: - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) -wrongtokenerror: - return fs.WrapErr(fmt.Errorf("ffjson: wanted token: %v, but got token: %v output=%s", wantedTok, tok, fs.Output.String())) -tokerror: - if fs.BigError != nil { - return fs.WrapErr(fs.BigError) - } - err = fs.Error.ToError() - if err != nil { - return fs.WrapErr(err) - } - panic("ffjson-generated: unreachable, please report bug.") -done: - - return nil -} - -// MarshalJSON marshal bytes to json - template -func (j *layerMountPoint) MarshalJSON() ([]byte, error) { - var buf fflib.Buffer - if j == nil { - buf.WriteString("null") - return buf.Bytes(), nil - } - err := j.MarshalJSONBuf(&buf) - if err != nil { - return nil, err - } - return buf.Bytes(), nil -} - -// MarshalJSONBuf marshal buff to json - template -func (j *layerMountPoint) MarshalJSONBuf(buf fflib.EncodingBuffer) error { - if j == nil { - buf.WriteString("null") - return nil - } - var err error - var obj []byte - _ = obj - _ = err - buf.WriteString(`{"id":`) - fflib.WriteJsonString(buf, string(j.ID)) - buf.WriteString(`,"path":`) - fflib.WriteJsonString(buf, string(j.MountPoint)) - buf.WriteString(`,"count":`) - fflib.FormatBits2(buf, uint64(j.MountCount), 10, j.MountCount < 0) - buf.WriteByte('}') - return nil -} - -const ( - ffjtlayerMountPointbase = iota - ffjtlayerMountPointnosuchkey - - ffjtlayerMountPointID - - ffjtlayerMountPointMountPoint - - ffjtlayerMountPointMountCount -) - -var ffjKeylayerMountPointID = []byte("id") - -var ffjKeylayerMountPointMountPoint = []byte("path") - -var ffjKeylayerMountPointMountCount = []byte("count") - -// UnmarshalJSON umarshall json - template of ffjson -func (j *layerMountPoint) UnmarshalJSON(input []byte) error { - fs := fflib.NewFFLexer(input) - return j.UnmarshalJSONFFLexer(fs, fflib.FFParse_map_start) -} - -// UnmarshalJSONFFLexer fast json unmarshall - template ffjson -func (j *layerMountPoint) UnmarshalJSONFFLexer(fs *fflib.FFLexer, state fflib.FFParseState) error { - var err error - currentKey := ffjtlayerMountPointbase - _ = currentKey - tok := fflib.FFTok_init - wantedTok := fflib.FFTok_init - -mainparse: - for { - tok = fs.Scan() - // println(fmt.Sprintf("debug: tok: %v state: %v", tok, state)) - if tok == fflib.FFTok_error { - goto tokerror - } - - switch state { - - case fflib.FFParse_map_start: - if tok != fflib.FFTok_left_bracket { - wantedTok = fflib.FFTok_left_bracket - goto wrongtokenerror - } - state = fflib.FFParse_want_key - continue - - case fflib.FFParse_after_value: - if tok == fflib.FFTok_comma { - state = fflib.FFParse_want_key - } else if tok == fflib.FFTok_right_bracket { - goto done - } else { - wantedTok = fflib.FFTok_comma - goto wrongtokenerror - } - - case fflib.FFParse_want_key: - // json {} ended. goto exit. woo. - if tok == fflib.FFTok_right_bracket { - goto done - } - if tok != fflib.FFTok_string { - wantedTok = fflib.FFTok_string - goto wrongtokenerror - } - - kn := fs.Output.Bytes() - if len(kn) <= 0 { - // "" case. hrm. - currentKey = ffjtlayerMountPointnosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } else { - switch kn[0] { - - case 'c': - - if bytes.Equal(ffjKeylayerMountPointMountCount, kn) { - currentKey = ffjtlayerMountPointMountCount - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'i': - - if bytes.Equal(ffjKeylayerMountPointID, kn) { - currentKey = ffjtlayerMountPointID - state = fflib.FFParse_want_colon - goto mainparse - } - - case 'p': - - if bytes.Equal(ffjKeylayerMountPointMountPoint, kn) { - currentKey = ffjtlayerMountPointMountPoint - state = fflib.FFParse_want_colon - goto mainparse - } - - } - - if fflib.SimpleLetterEqualFold(ffjKeylayerMountPointMountCount, kn) { - currentKey = ffjtlayerMountPointMountCount - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeylayerMountPointMountPoint, kn) { - currentKey = ffjtlayerMountPointMountPoint - state = fflib.FFParse_want_colon - goto mainparse - } - - if fflib.SimpleLetterEqualFold(ffjKeylayerMountPointID, kn) { - currentKey = ffjtlayerMountPointID - state = fflib.FFParse_want_colon - goto mainparse - } - - currentKey = ffjtlayerMountPointnosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } - - case fflib.FFParse_want_colon: - if tok != fflib.FFTok_colon { - wantedTok = fflib.FFTok_colon - goto wrongtokenerror - } - state = fflib.FFParse_want_value - continue - case fflib.FFParse_want_value: - - if tok == fflib.FFTok_left_brace || tok == fflib.FFTok_left_bracket || tok == fflib.FFTok_integer || tok == fflib.FFTok_double || tok == fflib.FFTok_string || tok == fflib.FFTok_bool || tok == fflib.FFTok_null { - switch currentKey { - - case ffjtlayerMountPointID: - goto handle_ID - - case ffjtlayerMountPointMountPoint: - goto handle_MountPoint - - case ffjtlayerMountPointMountCount: - goto handle_MountCount - - case ffjtlayerMountPointnosuchkey: - err = fs.SkipField(tok) - if err != nil { - return fs.WrapErr(err) - } - state = fflib.FFParse_after_value - goto mainparse - } - } else { - goto wantedvalue - } - } - } - -handle_ID: - - /* handler: j.ID type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.ID = string(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_MountPoint: - - /* handler: j.MountPoint type=string kind=string quoted=false*/ - - { - - { - if tok != fflib.FFTok_string && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for string", tok)) - } - } - - if tok == fflib.FFTok_null { - - } else { - - outBuf := fs.Output.Bytes() - - j.MountPoint = string(string(outBuf)) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -handle_MountCount: - - /* handler: j.MountCount type=int kind=int quoted=false*/ - - { - if tok != fflib.FFTok_integer && tok != fflib.FFTok_null { - return fs.WrapErr(fmt.Errorf("cannot unmarshal %s into Go value for int", tok)) - } - } - - { - - if tok == fflib.FFTok_null { - - } else { - - tval, err := fflib.ParseInt(fs.Output.Bytes(), 10, 64) - - if err != nil { - return fs.WrapErr(err) - } - - j.MountCount = int(tval) - - } - } - - state = fflib.FFParse_after_value - goto mainparse - -wantedvalue: - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) -wrongtokenerror: - return fs.WrapErr(fmt.Errorf("ffjson: wanted token: %v, but got token: %v output=%s", wantedTok, tok, fs.Output.String())) -tokerror: - if fs.BigError != nil { - return fs.WrapErr(fs.BigError) - } - err = fs.Error.ToError() - if err != nil { - return fs.WrapErr(err) - } - panic("ffjson-generated: unreachable, please report bug.") -done: - - return nil -} - -// MarshalJSON marshal bytes to json - template -func (j *layerStore) MarshalJSON() ([]byte, error) { - var buf fflib.Buffer - if j == nil { - buf.WriteString("null") - return buf.Bytes(), nil - } - err := j.MarshalJSONBuf(&buf) - if err != nil { - return nil, err - } - return buf.Bytes(), nil -} - -// MarshalJSONBuf marshal buff to json - template -func (j *layerStore) MarshalJSONBuf(buf fflib.EncodingBuffer) error { - if j == nil { - buf.WriteString("null") - return nil - } - var err error - var obj []byte - _ = obj - _ = err - buf.WriteString(`{}`) - return nil -} - -const ( - ffjtlayerStorebase = iota - ffjtlayerStorenosuchkey -) - -// UnmarshalJSON umarshall json - template of ffjson -func (j *layerStore) UnmarshalJSON(input []byte) error { - fs := fflib.NewFFLexer(input) - return j.UnmarshalJSONFFLexer(fs, fflib.FFParse_map_start) -} - -// UnmarshalJSONFFLexer fast json unmarshall - template ffjson -func (j *layerStore) UnmarshalJSONFFLexer(fs *fflib.FFLexer, state fflib.FFParseState) error { - var err error - currentKey := ffjtlayerStorebase - _ = currentKey - tok := fflib.FFTok_init - wantedTok := fflib.FFTok_init - -mainparse: - for { - tok = fs.Scan() - // println(fmt.Sprintf("debug: tok: %v state: %v", tok, state)) - if tok == fflib.FFTok_error { - goto tokerror - } - - switch state { - - case fflib.FFParse_map_start: - if tok != fflib.FFTok_left_bracket { - wantedTok = fflib.FFTok_left_bracket - goto wrongtokenerror - } - state = fflib.FFParse_want_key - continue - - case fflib.FFParse_after_value: - if tok == fflib.FFTok_comma { - state = fflib.FFParse_want_key - } else if tok == fflib.FFTok_right_bracket { - goto done - } else { - wantedTok = fflib.FFTok_comma - goto wrongtokenerror - } - - case fflib.FFParse_want_key: - // json {} ended. goto exit. woo. - if tok == fflib.FFTok_right_bracket { - goto done - } - if tok != fflib.FFTok_string { - wantedTok = fflib.FFTok_string - goto wrongtokenerror - } - - kn := fs.Output.Bytes() - if len(kn) <= 0 { - // "" case. hrm. - currentKey = ffjtlayerStorenosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } else { - switch kn[0] { - - } - - currentKey = ffjtlayerStorenosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } - - case fflib.FFParse_want_colon: - if tok != fflib.FFTok_colon { - wantedTok = fflib.FFTok_colon - goto wrongtokenerror - } - state = fflib.FFParse_want_value - continue - case fflib.FFParse_want_value: - - if tok == fflib.FFTok_left_brace || tok == fflib.FFTok_left_bracket || tok == fflib.FFTok_integer || tok == fflib.FFTok_double || tok == fflib.FFTok_string || tok == fflib.FFTok_bool || tok == fflib.FFTok_null { - switch currentKey { - - case ffjtlayerStorenosuchkey: - err = fs.SkipField(tok) - if err != nil { - return fs.WrapErr(err) - } - state = fflib.FFParse_after_value - goto mainparse - } - } else { - goto wantedvalue - } - } - } - -wantedvalue: - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) -wrongtokenerror: - return fs.WrapErr(fmt.Errorf("ffjson: wanted token: %v, but got token: %v output=%s", wantedTok, tok, fs.Output.String())) -tokerror: - if fs.BigError != nil { - return fs.WrapErr(fs.BigError) - } - err = fs.Error.ToError() - if err != nil { - return fs.WrapErr(err) - } - panic("ffjson-generated: unreachable, please report bug.") -done: - - return nil -} - -// MarshalJSON marshal bytes to json - template -func (j *simpleGetCloser) MarshalJSON() ([]byte, error) { - var buf fflib.Buffer - if j == nil { - buf.WriteString("null") - return buf.Bytes(), nil - } - err := j.MarshalJSONBuf(&buf) - if err != nil { - return nil, err - } - return buf.Bytes(), nil -} - -// MarshalJSONBuf marshal buff to json - template -func (j *simpleGetCloser) MarshalJSONBuf(buf fflib.EncodingBuffer) error { - if j == nil { - buf.WriteString("null") - return nil - } - var err error - var obj []byte - _ = obj - _ = err - buf.WriteString(`{}`) - return nil -} - -const ( - ffjtsimpleGetCloserbase = iota - ffjtsimpleGetClosernosuchkey -) - -// UnmarshalJSON umarshall json - template of ffjson -func (j *simpleGetCloser) UnmarshalJSON(input []byte) error { - fs := fflib.NewFFLexer(input) - return j.UnmarshalJSONFFLexer(fs, fflib.FFParse_map_start) -} - -// UnmarshalJSONFFLexer fast json unmarshall - template ffjson -func (j *simpleGetCloser) UnmarshalJSONFFLexer(fs *fflib.FFLexer, state fflib.FFParseState) error { - var err error - currentKey := ffjtsimpleGetCloserbase - _ = currentKey - tok := fflib.FFTok_init - wantedTok := fflib.FFTok_init - -mainparse: - for { - tok = fs.Scan() - // println(fmt.Sprintf("debug: tok: %v state: %v", tok, state)) - if tok == fflib.FFTok_error { - goto tokerror - } - - switch state { - - case fflib.FFParse_map_start: - if tok != fflib.FFTok_left_bracket { - wantedTok = fflib.FFTok_left_bracket - goto wrongtokenerror - } - state = fflib.FFParse_want_key - continue - - case fflib.FFParse_after_value: - if tok == fflib.FFTok_comma { - state = fflib.FFParse_want_key - } else if tok == fflib.FFTok_right_bracket { - goto done - } else { - wantedTok = fflib.FFTok_comma - goto wrongtokenerror - } - - case fflib.FFParse_want_key: - // json {} ended. goto exit. woo. - if tok == fflib.FFTok_right_bracket { - goto done - } - if tok != fflib.FFTok_string { - wantedTok = fflib.FFTok_string - goto wrongtokenerror - } - - kn := fs.Output.Bytes() - if len(kn) <= 0 { - // "" case. hrm. - currentKey = ffjtsimpleGetClosernosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } else { - switch kn[0] { - - } - - currentKey = ffjtsimpleGetClosernosuchkey - state = fflib.FFParse_want_colon - goto mainparse - } - - case fflib.FFParse_want_colon: - if tok != fflib.FFTok_colon { - wantedTok = fflib.FFTok_colon - goto wrongtokenerror - } - state = fflib.FFParse_want_value - continue - case fflib.FFParse_want_value: - - if tok == fflib.FFTok_left_brace || tok == fflib.FFTok_left_bracket || tok == fflib.FFTok_integer || tok == fflib.FFTok_double || tok == fflib.FFTok_string || tok == fflib.FFTok_bool || tok == fflib.FFTok_null { - switch currentKey { - - case ffjtsimpleGetClosernosuchkey: - err = fs.SkipField(tok) - if err != nil { - return fs.WrapErr(err) - } - state = fflib.FFParse_after_value - goto mainparse - } - } else { - goto wantedvalue - } - } - } - -wantedvalue: - return fs.WrapErr(fmt.Errorf("wanted value token, but got token: %v", tok)) -wrongtokenerror: - return fs.WrapErr(fmt.Errorf("ffjson: wanted token: %v, but got token: %v output=%s", wantedTok, tok, fs.Output.String())) -tokerror: - if fs.BigError != nil { - return fs.WrapErr(fs.BigError) - } - err = fs.Error.ToError() - if err != nil { - return fs.WrapErr(err) - } - panic("ffjson-generated: unreachable, please report bug.") -done: - - return nil -} diff --git a/vendor/github.com/containers/storage/pkg/archive/archive.go b/vendor/github.com/containers/storage/pkg/archive/archive.go index 6e2618d1e..d9a2e473c 100644 --- a/vendor/github.com/containers/storage/pkg/archive/archive.go +++ b/vendor/github.com/containers/storage/pkg/archive/archive.go @@ -68,6 +68,12 @@ type ( } ) +const ( + tarExt = "tar" + solaris = "solaris" + windows = "windows" +) + // Archiver allows the reuse of most utility functions of this package with a // pluggable Untar function. To facilitate the passing of specific id mappings // for untar, an archiver can be created with maps which will then be passed to @@ -325,15 +331,15 @@ func ReplaceFileTarWrapper(inputTarStream io.ReadCloser, mods map[string]TarModi func (compression *Compression) Extension() string { switch *compression { case Uncompressed: - return "tar" + return tarExt case Bzip2: - return "tar.bz2" + return tarExt + ".bz2" case Gzip: - return "tar.gz" + return tarExt + ".gz" case Xz: - return "tar.xz" + return tarExt + ".xz" case Zstd: - return "tar.zst" + return tarExt + ".zst" } return "" } @@ -670,7 +676,7 @@ func createTarFile(path, extractDir string, hdr *tar.Header, reader io.Reader, L } // Lchown is not supported on Windows. - if Lchown && runtime.GOOS != "windows" { + if Lchown && runtime.GOOS != windows { if chownOpts == nil { chownOpts = &idtools.IDPair{UID: hdr.Uid, GID: hdr.Gid} } diff --git a/vendor/github.com/containers/storage/pkg/archive/changes_unix.go b/vendor/github.com/containers/storage/pkg/archive/changes_unix.go index 031ec341b..805fb960a 100644 --- a/vendor/github.com/containers/storage/pkg/archive/changes_unix.go +++ b/vendor/github.com/containers/storage/pkg/archive/changes_unix.go @@ -13,17 +13,17 @@ import ( func statDifferent(oldStat *system.StatT, oldInfo *FileInfo, newStat *system.StatT, newInfo *FileInfo) bool { // Don't look at size for dirs, its not a good measure of change - oldUid, oldGid := oldStat.UID(), oldStat.GID() + oldUID, oldGID := oldStat.UID(), oldStat.GID() uid, gid := newStat.UID(), newStat.GID() if cuid, cgid, err := newInfo.idMappings.ToContainer(idtools.IDPair{UID: int(uid), GID: int(gid)}); err == nil { uid = uint32(cuid) gid = uint32(cgid) - if oldcuid, oldcgid, err := oldInfo.idMappings.ToContainer(idtools.IDPair{UID: int(oldUid), GID: int(oldGid)}); err == nil { - oldUid = uint32(oldcuid) - oldGid = uint32(oldcgid) + if oldcuid, oldcgid, err := oldInfo.idMappings.ToContainer(idtools.IDPair{UID: int(oldUID), GID: int(oldGID)}); err == nil { + oldUID = uint32(oldcuid) + oldGID = uint32(oldcgid) } } - ownerChanged := uid != oldUid || gid != oldGid + ownerChanged := uid != oldUID || gid != oldGID if oldStat.Mode() != newStat.Mode() || ownerChanged || oldStat.Rdev() != newStat.Rdev() || diff --git a/vendor/github.com/containers/storage/pkg/archive/diff.go b/vendor/github.com/containers/storage/pkg/archive/diff.go index 3c2601dee..78e3d9102 100644 --- a/vendor/github.com/containers/storage/pkg/archive/diff.go +++ b/vendor/github.com/containers/storage/pkg/archive/diff.go @@ -68,7 +68,7 @@ func UnpackLayer(dest string, layer io.Reader, options *TarOptions) (size int64, // specific or Linux-specific, this warning should be changed to an error // to cater for the situation where someone does manage to upload a Linux // image but have it tagged as Windows inadvertently. - if runtime.GOOS == "windows" { + if runtime.GOOS == windows { if strings.Contains(hdr.Name, ":") { logrus.Warnf("Windows: Ignoring %s (is this a Linux image?)", hdr.Name) continue diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go index 388eaf9d5..dc2e0c199 100644 --- a/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go @@ -226,8 +226,9 @@ func (p *Pattern) compile() error { sl := string(os.PathSeparator) escSL := sl - if sl == `\` { - escSL += `\` + const bs = `\` + if sl == bs { + escSL += bs } for scan.Peek() != scanner.EOF { @@ -262,11 +263,11 @@ func (p *Pattern) compile() error { } else if ch == '.' || ch == '$' { // Escape some regexp special chars that have no meaning // in golang's filepath.Match - regStr += `\` + string(ch) + regStr += bs + string(ch) } else if ch == '\\' { // escape next char. Note that a trailing \ in the pattern // will be left alone (but need to escape it) - if sl == `\` { + if sl == bs { // On windows map "\" to "\\", meaning an escaped backslash, // and then just continue because filepath.Match on // Windows doesn't allow escaping at all @@ -274,9 +275,9 @@ func (p *Pattern) compile() error { continue } if scan.Peek() != scanner.EOF { - regStr += `\` + string(scan.Next()) + regStr += bs + string(scan.Next()) } else { - regStr += `\` + regStr += bs } } else { regStr += string(ch) diff --git a/vendor/github.com/containers/storage/pkg/lockfile/lockfile_unix.go b/vendor/github.com/containers/storage/pkg/lockfile/lockfile_unix.go index 228c8cf24..302a523f5 100644 --- a/vendor/github.com/containers/storage/pkg/lockfile/lockfile_unix.go +++ b/vendor/github.com/containers/storage/pkg/lockfile/lockfile_unix.go @@ -77,14 +77,14 @@ func createLockerForPath(path string, ro bool) (Locker, error) { // lock locks the lockfile via FCTNL(2) based on the specified type and // command. -func (l *lockfile) lock(l_type int16, recursive bool) { +func (l *lockfile) lock(lType int16, recursive bool) { lk := unix.Flock_t{ - Type: l_type, + Type: lType, Whence: int16(os.SEEK_SET), Start: 0, Len: 0, } - switch l_type { + switch lType { case unix.F_RDLCK: l.rwMutex.RLock() case unix.F_WRLCK: @@ -96,7 +96,7 @@ func (l *lockfile) lock(l_type int16, recursive bool) { l.rwMutex.Lock() } default: - panic(fmt.Sprintf("attempted to acquire a file lock of unrecognized type %d", l_type)) + panic(fmt.Sprintf("attempted to acquire a file lock of unrecognized type %d", lType)) } l.stateMutex.Lock() defer l.stateMutex.Unlock() @@ -116,7 +116,7 @@ func (l *lockfile) lock(l_type int16, recursive bool) { time.Sleep(10 * time.Millisecond) } } - l.locktype = l_type + l.locktype = lType l.locked = true l.recursive = recursive l.counter++ diff --git a/vendor/github.com/containers/storage/pkg/mount/flags_linux.go b/vendor/github.com/containers/storage/pkg/mount/flags_linux.go index 0425d0dd6..a5dc5e287 100644 --- a/vendor/github.com/containers/storage/pkg/mount/flags_linux.go +++ b/vendor/github.com/containers/storage/pkg/mount/flags_linux.go @@ -82,6 +82,4 @@ const ( // it possible for the kernel to default to relatime or noatime but still // allow userspace to override it. STRICTATIME = unix.MS_STRICTATIME - - mntDetach = unix.MNT_DETACH ) diff --git a/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go b/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go index 39c36d472..de47c7af8 100644 --- a/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go +++ b/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go @@ -13,6 +13,8 @@ const ( // broflags is the combination of bind and read only broflags = unix.MS_BIND | unix.MS_RDONLY + + none = "none" ) // isremount returns true if either device name or flags identify a remount request, false otherwise. @@ -20,7 +22,7 @@ func isremount(device string, flags uintptr) bool { switch { // We treat device "" and "none" as a remount request to provide compatibility with // requests that don't explicitly set MS_REMOUNT such as those manipulating bind mounts. - case flags&unix.MS_REMOUNT != 0, device == "", device == "none": + case flags&unix.MS_REMOUNT != 0, device == "", device == none: return true default: return false diff --git a/vendor/github.com/containers/storage/store.go b/vendor/github.com/containers/storage/store.go index 272153e51..b84be4424 100644 --- a/vendor/github.com/containers/storage/store.go +++ b/vendor/github.com/containers/storage/store.go @@ -2783,18 +2783,24 @@ func (s *store) ContainerParentOwners(id string) ([]int, []int, error) { } func (s *store) Layers() ([]Layer, error) { - var layers []Layer lstore, err := s.LayerStore() if err != nil { return nil, err } + if err := lstore.LoadLocked(); err != nil { + return nil, err + } + layers, err := lstore.Layers() + if err != nil { + return nil, err + } lstores, err := s.ROLayerStores() if err != nil { return nil, err } - for _, s := range append([]ROLayerStore{lstore}, lstores...) { + for _, s := range lstores { store := s store.RLock() defer store.Unlock() diff --git a/vendor/github.com/containers/storage/utils.go b/vendor/github.com/containers/storage/utils.go index 5aa7c0851..28e0a8d6d 100644 --- a/vendor/github.com/containers/storage/utils.go +++ b/vendor/github.com/containers/storage/utils.go @@ -69,8 +69,8 @@ func ParseIDMapping(UIDMapSlice, GIDMapSlice []string, subUIDMap, subGIDMap stri } // GetRootlessRuntimeDir returns the runtime directory when running as non root -func GetRootlessRuntimeDir(rootlessUid int) (string, error) { - path, err := getRootlessRuntimeDir(rootlessUid) +func GetRootlessRuntimeDir(rootlessUID int) (string, error) { + path, err := getRootlessRuntimeDir(rootlessUID) if err != nil { return "", err } @@ -81,18 +81,18 @@ func GetRootlessRuntimeDir(rootlessUid int) (string, error) { return path, nil } -func getRootlessRuntimeDir(rootlessUid int) (string, error) { +func getRootlessRuntimeDir(rootlessUID int) (string, error) { runtimeDir := os.Getenv("XDG_RUNTIME_DIR") if runtimeDir != "" { return runtimeDir, nil } - tmpDir := fmt.Sprintf("/run/user/%d", rootlessUid) + tmpDir := fmt.Sprintf("/run/user/%d", rootlessUID) st, err := system.Stat(tmpDir) if err == nil && int(st.UID()) == os.Getuid() && st.Mode()&0700 == 0700 && st.Mode()&0066 == 0000 { return tmpDir, nil } - tmpDir = fmt.Sprintf("%s/%d", os.TempDir(), rootlessUid) + tmpDir = fmt.Sprintf("%s/%d", os.TempDir(), rootlessUID) if err := os.MkdirAll(tmpDir, 0700); err != nil { logrus.Errorf("failed to create %s: %v", tmpDir, err) } else { @@ -111,8 +111,8 @@ func getRootlessRuntimeDir(rootlessUid int) (string, error) { // getRootlessDirInfo returns the parent path of where the storage for containers and // volumes will be in rootless mode -func getRootlessDirInfo(rootlessUid int) (string, string, error) { - rootlessRuntime, err := GetRootlessRuntimeDir(rootlessUid) +func getRootlessDirInfo(rootlessUID int) (string, string, error) { + rootlessRuntime, err := GetRootlessRuntimeDir(rootlessUID) if err != nil { return "", "", err } @@ -135,10 +135,10 @@ func getRootlessDirInfo(rootlessUid int) (string, string, error) { } // getRootlessStorageOpts returns the storage opts for containers running as non root -func getRootlessStorageOpts(rootlessUid int) (StoreOptions, error) { +func getRootlessStorageOpts(rootlessUID int) (StoreOptions, error) { var opts StoreOptions - dataDir, rootlessRuntime, err := getRootlessDirInfo(rootlessUid) + dataDir, rootlessRuntime, err := getRootlessDirInfo(rootlessUID) if err != nil { return opts, err } @@ -153,10 +153,6 @@ func getRootlessStorageOpts(rootlessUid int) (StoreOptions, error) { return opts, nil } -type tomlOptionsConfig struct { - MountProgram string `toml:"mount_program"` -} - func getTomlStorage(storeOptions *StoreOptions) *tomlConfig { config := new(tomlConfig) @@ -189,21 +185,21 @@ func DefaultStoreOptionsAutoDetectUID() (StoreOptions, error) { } // DefaultStoreOptions returns the default storage ops for containers -func DefaultStoreOptions(rootless bool, rootlessUid int) (StoreOptions, error) { +func DefaultStoreOptions(rootless bool, rootlessUID int) (StoreOptions, error) { var ( defaultRootlessRunRoot string defaultRootlessGraphRoot string err error ) storageOpts := defaultStoreOptions - if rootless && rootlessUid != 0 { - storageOpts, err = getRootlessStorageOpts(rootlessUid) + if rootless && rootlessUID != 0 { + storageOpts, err = getRootlessStorageOpts(rootlessUID) if err != nil { return storageOpts, err } } - storageConf, err := DefaultConfigFile(rootless && rootlessUid != 0) + storageConf, err := DefaultConfigFile(rootless && rootlessUID != 0) if err != nil { return storageOpts, err } @@ -218,7 +214,7 @@ func DefaultStoreOptions(rootless bool, rootlessUid int) (StoreOptions, error) { ReloadConfigurationFile(storageConf, &storageOpts) } - if rootless && rootlessUid != 0 { + if rootless && rootlessUID != 0 { if err == nil { // If the file did not specify a graphroot or runroot, // set sane defaults so we don't try and use root-owned diff --git a/vendor/github.com/klauspost/compress/flate/deflate.go b/vendor/github.com/klauspost/compress/flate/deflate.go index 20c94f596..d9948ab40 100644 --- a/vendor/github.com/klauspost/compress/flate/deflate.go +++ b/vendor/github.com/klauspost/compress/flate/deflate.go @@ -644,7 +644,7 @@ func (d *compressor) init(w io.Writer, level int) (err error) { d.fill = (*compressor).fillBlock d.step = (*compressor).store case level == ConstantCompression: - d.w.logReusePenalty = uint(4) + d.w.logNewTablePenalty = 4 d.window = make([]byte, maxStoreBlockSize) d.fill = (*compressor).fillBlock d.step = (*compressor).storeHuff @@ -652,13 +652,13 @@ func (d *compressor) init(w io.Writer, level int) (err error) { level = 5 fallthrough case level >= 1 && level <= 6: - d.w.logReusePenalty = uint(level + 1) + d.w.logNewTablePenalty = 6 d.fast = newFastEnc(level) d.window = make([]byte, maxStoreBlockSize) d.fill = (*compressor).fillBlock d.step = (*compressor).storeFast case 7 <= level && level <= 9: - d.w.logReusePenalty = uint(level) + d.w.logNewTablePenalty = 10 d.state = &advancedState{} d.compressionLevel = levels[level] d.initDeflate() diff --git a/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go b/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go index dd74ffb87..9feea87a3 100644 --- a/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go +++ b/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go @@ -93,12 +93,12 @@ type huffmanBitWriter struct { err error lastHeader int // Set between 0 (reused block can be up to 2x the size) - logReusePenalty uint - lastHuffMan bool - bytes [256]byte - literalFreq [lengthCodesStart + 32]uint16 - offsetFreq [32]uint16 - codegenFreq [codegenCodeCount]uint16 + logNewTablePenalty uint + lastHuffMan bool + bytes [256]byte + literalFreq [lengthCodesStart + 32]uint16 + offsetFreq [32]uint16 + codegenFreq [codegenCodeCount]uint16 // codegen must have an extra space for the final symbol. codegen [literalCount + offsetCodeCount + 1]uint8 @@ -119,7 +119,7 @@ type huffmanBitWriter struct { // If lastHuffMan is set, a table for outputting literals has been generated and offsets are invalid. // // An incoming block estimates the output size of a new table using a 'fresh' by calculating the -// optimal size and adding a penalty in 'logReusePenalty'. +// optimal size and adding a penalty in 'logNewTablePenalty'. // A Huffman table is not optimal, which is why we add a penalty, and generating a new table // is slower both for compression and decompression. @@ -350,6 +350,13 @@ func (w *huffmanBitWriter) headerSize() (size, numCodegens int) { } // dynamicSize returns the size of dynamically encoded data in bits. +func (w *huffmanBitWriter) dynamicReuseSize(litEnc, offEnc *huffmanEncoder) (size int) { + size = litEnc.bitLength(w.literalFreq[:]) + + offEnc.bitLength(w.offsetFreq[:]) + return size +} + +// dynamicSize returns the size of dynamically encoded data in bits. func (w *huffmanBitWriter) dynamicSize(litEnc, offEnc *huffmanEncoder, extraBits int) (size, numCodegens int) { header, numCodegens := w.headerSize() size = header + @@ -451,12 +458,12 @@ func (w *huffmanBitWriter) writeDynamicHeader(numLiterals int, numOffsets int, n i := 0 for { - var codeWord int = int(w.codegen[i]) + var codeWord = uint32(w.codegen[i]) i++ if codeWord == badCode { break } - w.writeCode(w.codegenEncoding.codes[uint32(codeWord)]) + w.writeCode(w.codegenEncoding.codes[codeWord]) switch codeWord { case 16: @@ -602,14 +609,14 @@ func (w *huffmanBitWriter) writeBlockDynamic(tokens *tokens, eof bool, input []b var size int // Check if we should reuse. if w.lastHeader > 0 { - // Estimate size for using a new table + // Estimate size for using a new table. + // Use the previous header size as the best estimate. newSize := w.lastHeader + tokens.EstimatedBits() + newSize += newSize >> w.logNewTablePenalty // The estimated size is calculated as an optimal table. // We add a penalty to make it more realistic and re-use a bit more. - newSize += newSize >> (w.logReusePenalty & 31) - extra := w.extraBitSize() - reuseSize, _ := w.dynamicSize(w.literalEncoding, w.offsetEncoding, extra) + reuseSize := w.dynamicReuseSize(w.literalEncoding, w.offsetEncoding) + w.extraBitSize() // Check if a new table is better. if newSize < reuseSize { @@ -801,21 +808,30 @@ func (w *huffmanBitWriter) writeBlockHuff(eof bool, input []byte, sync bool) { } // Add everything as literals - estBits := histogramSize(input, w.literalFreq[:], !eof && !sync) + 15 + // We have to estimate the header size. + // Assume header is around 70 bytes: + // https://stackoverflow.com/a/25454430 + const guessHeaderSizeBits = 70 * 8 + estBits, estExtra := histogramSize(input, w.literalFreq[:], !eof && !sync) + estBits += w.lastHeader + 15 + if w.lastHeader == 0 { + estBits += guessHeaderSizeBits + } + estBits += estBits >> w.logNewTablePenalty // Store bytes, if we don't get a reasonable improvement. ssize, storable := w.storedSize(input) - if storable && ssize < (estBits+estBits>>4) { + if storable && ssize < estBits { w.writeStoredHeader(len(input), eof) w.writeBytes(input) return } if w.lastHeader > 0 { - size, _ := w.dynamicSize(w.literalEncoding, huffOffset, w.lastHeader) - estBits += estBits >> (w.logReusePenalty) + reuseSize := w.literalEncoding.bitLength(w.literalFreq[:256]) + estBits += estExtra - if estBits < size { + if estBits < reuseSize { // We owe an EOB w.writeCode(w.literalEncoding.codes[endBlockMarker]) w.lastHeader = 0 diff --git a/vendor/github.com/klauspost/compress/flate/huffman_code.go b/vendor/github.com/klauspost/compress/flate/huffman_code.go index 1810c6898..9d8e81ad6 100644 --- a/vendor/github.com/klauspost/compress/flate/huffman_code.go +++ b/vendor/github.com/klauspost/compress/flate/huffman_code.go @@ -7,7 +7,6 @@ package flate import ( "math" "math/bits" - "sort" ) const ( @@ -25,8 +24,6 @@ type huffmanEncoder struct { codes []hcode freqcache []literalNode bitCount [17]int32 - lns byLiteral // stored to avoid repeated allocation in generate - lfs byFreq // stored to avoid repeated allocation in generate } type literalNode struct { @@ -270,7 +267,7 @@ func (h *huffmanEncoder) assignEncodingAndSize(bitCount []int32, list []literalN // assigned in literal order (not frequency order). chunk := list[len(list)-int(bits):] - h.lns.sort(chunk) + sortByLiteral(chunk) for _, node := range chunk { h.codes[node.literal] = hcode{code: reverseBits(code, uint8(n)), len: uint16(n)} code++ @@ -315,7 +312,7 @@ func (h *huffmanEncoder) generate(freq []uint16, maxBits int32) { } return } - h.lfs.sort(list) + sortByFreq(list) // Get the number of literals for each bit count bitCount := h.bitCounts(list, maxBits) @@ -323,59 +320,44 @@ func (h *huffmanEncoder) generate(freq []uint16, maxBits int32) { h.assignEncodingAndSize(bitCount, list) } -type byLiteral []literalNode - -func (s *byLiteral) sort(a []literalNode) { - *s = byLiteral(a) - sort.Sort(s) -} - -func (s byLiteral) Len() int { return len(s) } - -func (s byLiteral) Less(i, j int) bool { - return s[i].literal < s[j].literal -} - -func (s byLiteral) Swap(i, j int) { s[i], s[j] = s[j], s[i] } - -type byFreq []literalNode - -func (s *byFreq) sort(a []literalNode) { - *s = byFreq(a) - sort.Sort(s) -} - -func (s byFreq) Len() int { return len(s) } - -func (s byFreq) Less(i, j int) bool { - if s[i].freq == s[j].freq { - return s[i].literal < s[j].literal +func atLeastOne(v float32) float32 { + if v < 1 { + return 1 } - return s[i].freq < s[j].freq + return v } -func (s byFreq) Swap(i, j int) { s[i], s[j] = s[j], s[i] } - // histogramSize accumulates a histogram of b in h. // An estimated size in bits is returned. // Unassigned values are assigned '1' in the histogram. // len(h) must be >= 256, and h's elements must be all zeroes. -func histogramSize(b []byte, h []uint16, fill bool) int { +func histogramSize(b []byte, h []uint16, fill bool) (int, int) { h = h[:256] for _, t := range b { h[t]++ } - invTotal := 1.0 / float64(len(b)) - shannon := 0.0 - single := math.Ceil(-math.Log2(invTotal)) - for i, v := range h[:] { - if v > 0 { - n := float64(v) - shannon += math.Ceil(-math.Log2(n*invTotal) * n) - } else if fill { - shannon += single - h[i] = 1 + invTotal := 1.0 / float32(len(b)) + shannon := float32(0.0) + var extra float32 + if fill { + oneBits := atLeastOne(-mFastLog2(invTotal)) + for i, v := range h[:] { + if v > 0 { + n := float32(v) + shannon += atLeastOne(-mFastLog2(n*invTotal)) * n + } else { + h[i] = 1 + extra += oneBits + } + } + } else { + for _, v := range h[:] { + if v > 0 { + n := float32(v) + shannon += atLeastOne(-mFastLog2(n*invTotal)) * n + } } } - return int(shannon + 0.99) + + return int(shannon + 0.99), int(extra + 0.99) } diff --git a/vendor/github.com/klauspost/compress/flate/huffman_sortByFreq.go b/vendor/github.com/klauspost/compress/flate/huffman_sortByFreq.go new file mode 100644 index 000000000..207780299 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/huffman_sortByFreq.go @@ -0,0 +1,178 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package flate + +// Sort sorts data. +// It makes one call to data.Len to determine n, and O(n*log(n)) calls to +// data.Less and data.Swap. The sort is not guaranteed to be stable. +func sortByFreq(data []literalNode) { + n := len(data) + quickSortByFreq(data, 0, n, maxDepth(n)) +} + +func quickSortByFreq(data []literalNode, a, b, maxDepth int) { + for b-a > 12 { // Use ShellSort for slices <= 12 elements + if maxDepth == 0 { + heapSort(data, a, b) + return + } + maxDepth-- + mlo, mhi := doPivotByFreq(data, a, b) + // Avoiding recursion on the larger subproblem guarantees + // a stack depth of at most lg(b-a). + if mlo-a < b-mhi { + quickSortByFreq(data, a, mlo, maxDepth) + a = mhi // i.e., quickSortByFreq(data, mhi, b) + } else { + quickSortByFreq(data, mhi, b, maxDepth) + b = mlo // i.e., quickSortByFreq(data, a, mlo) + } + } + if b-a > 1 { + // Do ShellSort pass with gap 6 + // It could be written in this simplified form cause b-a <= 12 + for i := a + 6; i < b; i++ { + if data[i].freq == data[i-6].freq && data[i].literal < data[i-6].literal || data[i].freq < data[i-6].freq { + data[i], data[i-6] = data[i-6], data[i] + } + } + insertionSortByFreq(data, a, b) + } +} + +// siftDownByFreq implements the heap property on data[lo, hi). +// first is an offset into the array where the root of the heap lies. +func siftDownByFreq(data []literalNode, lo, hi, first int) { + root := lo + for { + child := 2*root + 1 + if child >= hi { + break + } + if child+1 < hi && (data[first+child].freq == data[first+child+1].freq && data[first+child].literal < data[first+child+1].literal || data[first+child].freq < data[first+child+1].freq) { + child++ + } + if data[first+root].freq == data[first+child].freq && data[first+root].literal > data[first+child].literal || data[first+root].freq > data[first+child].freq { + return + } + data[first+root], data[first+child] = data[first+child], data[first+root] + root = child + } +} +func doPivotByFreq(data []literalNode, lo, hi int) (midlo, midhi int) { + m := int(uint(lo+hi) >> 1) // Written like this to avoid integer overflow. + if hi-lo > 40 { + // Tukey's ``Ninther,'' median of three medians of three. + s := (hi - lo) / 8 + medianOfThreeSortByFreq(data, lo, lo+s, lo+2*s) + medianOfThreeSortByFreq(data, m, m-s, m+s) + medianOfThreeSortByFreq(data, hi-1, hi-1-s, hi-1-2*s) + } + medianOfThreeSortByFreq(data, lo, m, hi-1) + + // Invariants are: + // data[lo] = pivot (set up by ChoosePivot) + // data[lo < i < a] < pivot + // data[a <= i < b] <= pivot + // data[b <= i < c] unexamined + // data[c <= i < hi-1] > pivot + // data[hi-1] >= pivot + pivot := lo + a, c := lo+1, hi-1 + + for ; a < c && (data[a].freq == data[pivot].freq && data[a].literal < data[pivot].literal || data[a].freq < data[pivot].freq); a++ { + } + b := a + for { + for ; b < c && (data[pivot].freq == data[b].freq && data[pivot].literal > data[b].literal || data[pivot].freq > data[b].freq); b++ { // data[b] <= pivot + } + for ; b < c && (data[pivot].freq == data[c-1].freq && data[pivot].literal < data[c-1].literal || data[pivot].freq < data[c-1].freq); c-- { // data[c-1] > pivot + } + if b >= c { + break + } + // data[b] > pivot; data[c-1] <= pivot + data[b], data[c-1] = data[c-1], data[b] + b++ + c-- + } + // If hi-c<3 then there are duplicates (by property of median of nine). + // Let's be a bit more conservative, and set border to 5. + protect := hi-c < 5 + if !protect && hi-c < (hi-lo)/4 { + // Lets test some points for equality to pivot + dups := 0 + if data[pivot].freq == data[hi-1].freq && data[pivot].literal > data[hi-1].literal || data[pivot].freq > data[hi-1].freq { // data[hi-1] = pivot + data[c], data[hi-1] = data[hi-1], data[c] + c++ + dups++ + } + if data[b-1].freq == data[pivot].freq && data[b-1].literal > data[pivot].literal || data[b-1].freq > data[pivot].freq { // data[b-1] = pivot + b-- + dups++ + } + // m-lo = (hi-lo)/2 > 6 + // b-lo > (hi-lo)*3/4-1 > 8 + // ==> m < b ==> data[m] <= pivot + if data[m].freq == data[pivot].freq && data[m].literal > data[pivot].literal || data[m].freq > data[pivot].freq { // data[m] = pivot + data[m], data[b-1] = data[b-1], data[m] + b-- + dups++ + } + // if at least 2 points are equal to pivot, assume skewed distribution + protect = dups > 1 + } + if protect { + // Protect against a lot of duplicates + // Add invariant: + // data[a <= i < b] unexamined + // data[b <= i < c] = pivot + for { + for ; a < b && (data[b-1].freq == data[pivot].freq && data[b-1].literal > data[pivot].literal || data[b-1].freq > data[pivot].freq); b-- { // data[b] == pivot + } + for ; a < b && (data[a].freq == data[pivot].freq && data[a].literal < data[pivot].literal || data[a].freq < data[pivot].freq); a++ { // data[a] < pivot + } + if a >= b { + break + } + // data[a] == pivot; data[b-1] < pivot + data[a], data[b-1] = data[b-1], data[a] + a++ + b-- + } + } + // Swap pivot into middle + data[pivot], data[b-1] = data[b-1], data[pivot] + return b - 1, c +} + +// Insertion sort +func insertionSortByFreq(data []literalNode, a, b int) { + for i := a + 1; i < b; i++ { + for j := i; j > a && (data[j].freq == data[j-1].freq && data[j].literal < data[j-1].literal || data[j].freq < data[j-1].freq); j-- { + data[j], data[j-1] = data[j-1], data[j] + } + } +} + +// quickSortByFreq, loosely following Bentley and McIlroy, +// ``Engineering a Sort Function,'' SP&E November 1993. + +// medianOfThreeSortByFreq moves the median of the three values data[m0], data[m1], data[m2] into data[m1]. +func medianOfThreeSortByFreq(data []literalNode, m1, m0, m2 int) { + // sort 3 elements + if data[m1].freq == data[m0].freq && data[m1].literal < data[m0].literal || data[m1].freq < data[m0].freq { + data[m1], data[m0] = data[m0], data[m1] + } + // data[m0] <= data[m1] + if data[m2].freq == data[m1].freq && data[m2].literal < data[m1].literal || data[m2].freq < data[m1].freq { + data[m2], data[m1] = data[m1], data[m2] + // data[m0] <= data[m2] && data[m1] < data[m2] + if data[m1].freq == data[m0].freq && data[m1].literal < data[m0].literal || data[m1].freq < data[m0].freq { + data[m1], data[m0] = data[m0], data[m1] + } + } + // now data[m0] <= data[m1] <= data[m2] +} diff --git a/vendor/github.com/klauspost/compress/flate/huffman_sortByLiteral.go b/vendor/github.com/klauspost/compress/flate/huffman_sortByLiteral.go new file mode 100644 index 000000000..93f1aea10 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/huffman_sortByLiteral.go @@ -0,0 +1,201 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package flate + +// Sort sorts data. +// It makes one call to data.Len to determine n, and O(n*log(n)) calls to +// data.Less and data.Swap. The sort is not guaranteed to be stable. +func sortByLiteral(data []literalNode) { + n := len(data) + quickSort(data, 0, n, maxDepth(n)) +} + +func quickSort(data []literalNode, a, b, maxDepth int) { + for b-a > 12 { // Use ShellSort for slices <= 12 elements + if maxDepth == 0 { + heapSort(data, a, b) + return + } + maxDepth-- + mlo, mhi := doPivot(data, a, b) + // Avoiding recursion on the larger subproblem guarantees + // a stack depth of at most lg(b-a). + if mlo-a < b-mhi { + quickSort(data, a, mlo, maxDepth) + a = mhi // i.e., quickSort(data, mhi, b) + } else { + quickSort(data, mhi, b, maxDepth) + b = mlo // i.e., quickSort(data, a, mlo) + } + } + if b-a > 1 { + // Do ShellSort pass with gap 6 + // It could be written in this simplified form cause b-a <= 12 + for i := a + 6; i < b; i++ { + if data[i].literal < data[i-6].literal { + data[i], data[i-6] = data[i-6], data[i] + } + } + insertionSort(data, a, b) + } +} +func heapSort(data []literalNode, a, b int) { + first := a + lo := 0 + hi := b - a + + // Build heap with greatest element at top. + for i := (hi - 1) / 2; i >= 0; i-- { + siftDown(data, i, hi, first) + } + + // Pop elements, largest first, into end of data. + for i := hi - 1; i >= 0; i-- { + data[first], data[first+i] = data[first+i], data[first] + siftDown(data, lo, i, first) + } +} + +// siftDown implements the heap property on data[lo, hi). +// first is an offset into the array where the root of the heap lies. +func siftDown(data []literalNode, lo, hi, first int) { + root := lo + for { + child := 2*root + 1 + if child >= hi { + break + } + if child+1 < hi && data[first+child].literal < data[first+child+1].literal { + child++ + } + if data[first+root].literal > data[first+child].literal { + return + } + data[first+root], data[first+child] = data[first+child], data[first+root] + root = child + } +} +func doPivot(data []literalNode, lo, hi int) (midlo, midhi int) { + m := int(uint(lo+hi) >> 1) // Written like this to avoid integer overflow. + if hi-lo > 40 { + // Tukey's ``Ninther,'' median of three medians of three. + s := (hi - lo) / 8 + medianOfThree(data, lo, lo+s, lo+2*s) + medianOfThree(data, m, m-s, m+s) + medianOfThree(data, hi-1, hi-1-s, hi-1-2*s) + } + medianOfThree(data, lo, m, hi-1) + + // Invariants are: + // data[lo] = pivot (set up by ChoosePivot) + // data[lo < i < a] < pivot + // data[a <= i < b] <= pivot + // data[b <= i < c] unexamined + // data[c <= i < hi-1] > pivot + // data[hi-1] >= pivot + pivot := lo + a, c := lo+1, hi-1 + + for ; a < c && data[a].literal < data[pivot].literal; a++ { + } + b := a + for { + for ; b < c && data[pivot].literal > data[b].literal; b++ { // data[b] <= pivot + } + for ; b < c && data[pivot].literal < data[c-1].literal; c-- { // data[c-1] > pivot + } + if b >= c { + break + } + // data[b] > pivot; data[c-1] <= pivot + data[b], data[c-1] = data[c-1], data[b] + b++ + c-- + } + // If hi-c<3 then there are duplicates (by property of median of nine). + // Let's be a bit more conservative, and set border to 5. + protect := hi-c < 5 + if !protect && hi-c < (hi-lo)/4 { + // Lets test some points for equality to pivot + dups := 0 + if data[pivot].literal > data[hi-1].literal { // data[hi-1] = pivot + data[c], data[hi-1] = data[hi-1], data[c] + c++ + dups++ + } + if data[b-1].literal > data[pivot].literal { // data[b-1] = pivot + b-- + dups++ + } + // m-lo = (hi-lo)/2 > 6 + // b-lo > (hi-lo)*3/4-1 > 8 + // ==> m < b ==> data[m] <= pivot + if data[m].literal > data[pivot].literal { // data[m] = pivot + data[m], data[b-1] = data[b-1], data[m] + b-- + dups++ + } + // if at least 2 points are equal to pivot, assume skewed distribution + protect = dups > 1 + } + if protect { + // Protect against a lot of duplicates + // Add invariant: + // data[a <= i < b] unexamined + // data[b <= i < c] = pivot + for { + for ; a < b && data[b-1].literal > data[pivot].literal; b-- { // data[b] == pivot + } + for ; a < b && data[a].literal < data[pivot].literal; a++ { // data[a] < pivot + } + if a >= b { + break + } + // data[a] == pivot; data[b-1] < pivot + data[a], data[b-1] = data[b-1], data[a] + a++ + b-- + } + } + // Swap pivot into middle + data[pivot], data[b-1] = data[b-1], data[pivot] + return b - 1, c +} + +// Insertion sort +func insertionSort(data []literalNode, a, b int) { + for i := a + 1; i < b; i++ { + for j := i; j > a && data[j].literal < data[j-1].literal; j-- { + data[j], data[j-1] = data[j-1], data[j] + } + } +} + +// maxDepth returns a threshold at which quicksort should switch +// to heapsort. It returns 2*ceil(lg(n+1)). +func maxDepth(n int) int { + var depth int + for i := n; i > 0; i >>= 1 { + depth++ + } + return depth * 2 +} + +// medianOfThree moves the median of the three values data[m0], data[m1], data[m2] into data[m1]. +func medianOfThree(data []literalNode, m1, m0, m2 int) { + // sort 3 elements + if data[m1].literal < data[m0].literal { + data[m1], data[m0] = data[m0], data[m1] + } + // data[m0] <= data[m1] + if data[m2].literal < data[m1].literal { + data[m2], data[m1] = data[m1], data[m2] + // data[m0] <= data[m2] && data[m1] < data[m2] + if data[m1].literal < data[m0].literal { + data[m1], data[m0] = data[m0], data[m1] + } + } + // now data[m0] <= data[m1] <= data[m2] +} diff --git a/vendor/github.com/klauspost/compress/flate/token.go b/vendor/github.com/klauspost/compress/flate/token.go index b3df0d894..099c0ddbc 100644 --- a/vendor/github.com/klauspost/compress/flate/token.go +++ b/vendor/github.com/klauspost/compress/flate/token.go @@ -184,9 +184,7 @@ func (t *tokens) indexTokens(in []token) { t.Reset() for _, tok := range in { if tok < matchType { - t.tokens[t.n] = tok - t.litHist[tok]++ - t.n++ + t.AddLiteral(tok.literal()) continue } t.AddMatch(uint32(tok.length()), tok.offset()) @@ -211,43 +209,53 @@ func (t *tokens) AddLiteral(lit byte) { t.nLits++ } +// from https://stackoverflow.com/a/28730362 +func mFastLog2(val float32) float32 { + ux := int32(math.Float32bits(val)) + log2 := (float32)(((ux >> 23) & 255) - 128) + ux &= -0x7f800001 + ux += 127 << 23 + uval := math.Float32frombits(uint32(ux)) + log2 += ((-0.34484843)*uval+2.02466578)*uval - 0.67487759 + return log2 +} + // EstimatedBits will return an minimum size estimated by an *optimal* // compression of the block. // The size of the block func (t *tokens) EstimatedBits() int { - shannon := float64(0) + shannon := float32(0) bits := int(0) nMatches := 0 if t.nLits > 0 { - invTotal := 1.0 / float64(t.nLits) + invTotal := 1.0 / float32(t.nLits) for _, v := range t.litHist[:] { if v > 0 { - n := float64(v) - shannon += math.Ceil(-math.Log2(n*invTotal) * n) + n := float32(v) + shannon += -mFastLog2(n*invTotal) * n } } // Just add 15 for EOB shannon += 15 - for _, v := range t.extraHist[1 : literalCount-256] { + for i, v := range t.extraHist[1 : literalCount-256] { if v > 0 { - n := float64(v) - shannon += math.Ceil(-math.Log2(n*invTotal) * n) - bits += int(lengthExtraBits[v&31]) * int(v) + n := float32(v) + shannon += -mFastLog2(n*invTotal) * n + bits += int(lengthExtraBits[i&31]) * int(v) nMatches += int(v) } } } if nMatches > 0 { - invTotal := 1.0 / float64(nMatches) - for _, v := range t.offHist[:offsetCodeCount] { + invTotal := 1.0 / float32(nMatches) + for i, v := range t.offHist[:offsetCodeCount] { if v > 0 { - n := float64(v) - shannon += math.Ceil(-math.Log2(n*invTotal) * n) - bits += int(offsetExtraBits[v&31]) * int(n) + n := float32(v) + shannon += -mFastLog2(n*invTotal) * n + bits += int(offsetExtraBits[i&31]) * int(v) } } } - return int(shannon) + bits } diff --git a/vendor/github.com/mattn/go-shellwords/go.mod b/vendor/github.com/mattn/go-shellwords/go.mod index 8d96dbd5f..927c8c7d6 100644 --- a/vendor/github.com/mattn/go-shellwords/go.mod +++ b/vendor/github.com/mattn/go-shellwords/go.mod @@ -1 +1,3 @@ module github.com/mattn/go-shellwords + +go 1.13 diff --git a/vendor/github.com/mattn/go-shellwords/shellwords.go b/vendor/github.com/mattn/go-shellwords/shellwords.go index ff5e73091..ef080861a 100644 --- a/vendor/github.com/mattn/go-shellwords/shellwords.go +++ b/vendor/github.com/mattn/go-shellwords/shellwords.go @@ -88,9 +88,17 @@ loop: backtick += string(r) } else if got { if p.ParseEnv { - buf = replaceEnv(p.Getenv, buf) + parser := &Parser{ParseEnv: false, ParseBacktick: false, Position: 0, Dir: p.Dir} + strs, err := parser.Parse(replaceEnv(p.Getenv, buf)) + if err != nil { + return nil, err + } + for _, str := range strs { + args = append(args, str) + } + } else { + args = append(args, buf) } - args = append(args, buf) buf = "" got = false } @@ -144,7 +152,7 @@ loop: } case '"': if !singleQuoted && !dollarQuote { - if doubleQuoted && buf == "" { + if doubleQuoted { got = true } doubleQuoted = !doubleQuoted @@ -152,7 +160,7 @@ loop: } case '\'': if !doubleQuoted && !dollarQuote { - if singleQuoted && buf == "" { + if singleQuoted { got = true } singleQuoted = !singleQuoted @@ -180,9 +188,17 @@ loop: if got { if p.ParseEnv { - buf = replaceEnv(p.Getenv, buf) + parser := &Parser{ParseEnv: false, ParseBacktick: false, Position: 0, Dir: p.Dir} + strs, err := parser.Parse(replaceEnv(p.Getenv, buf)) + if err != nil { + return nil, err + } + for _, str := range strs { + args = append(args, str) + } + } else { + args = append(args, buf) } - args = append(args, buf) } if escaped || singleQuoted || doubleQuoted || backQuote || dollarQuote { diff --git a/vendor/github.com/mtrmac/gpgme/.appveyor.yml b/vendor/github.com/mtrmac/gpgme/.appveyor.yml new file mode 100644 index 000000000..2fdc09ab5 --- /dev/null +++ b/vendor/github.com/mtrmac/gpgme/.appveyor.yml @@ -0,0 +1,40 @@ +--- +version: 0.{build} +platform: x86 +branches: + only: + - master + +clone_folder: c:\gopath\src\github.com\proglottis\gpgme + +environment: + GOPATH: c:\gopath + GOROOT: C:\go-x86 + CGO_LDFLAGS: -LC:\gpg\lib + CGO_CFLAGS: -IC:\gpg\include + GPG_DIR: C:\gpg + +install: + - nuget install 7ZipCLI -ExcludeVersion + - set PATH=%appveyor_build_folder%\7ZipCLI\tools;%PATH% + - appveyor DownloadFile https://www.gnupg.org/ftp/gcrypt/binary/gnupg-w32-2.1.20_20170403.exe -FileName gnupg-w32-2.1.20_20170403.exe + - 7z x -o%GPG_DIR% gnupg-w32-2.1.20_20170403.exe + - copy "%GPG_DIR%\lib\libgpg-error.imp" "%GPG_DIR%\lib\libgpg-error.a" + - copy "%GPG_DIR%\lib\libassuan.imp" "%GPG_DIR%\lib\libassuan.a" + - copy "%GPG_DIR%\lib\libgpgme.imp" "%GPG_DIR%\lib\libgpgme.a" + - set PATH=%GOPATH%\bin;%GOROOT%\bin;%GPG_DIR%\bin;C:\MinGW\bin;%PATH% + - C:\cygwin\bin\sed -i 's/"GPG_AGENT_INFO"/"GPG_AGENT_INFO="/;s/C.unsetenv(v)/C.putenv(v)/' %APPVEYOR_BUILD_FOLDER%\gpgme.go + +test_script: + - go test -v github.com/proglottis/gpgme + + +build_script: + - go build -o example_decrypt.exe -i %APPVEYOR_BUILD_FOLDER%\examples\decrypt.go + - go build -o example_encrypt.exe -i %APPVEYOR_BUILD_FOLDER%\examples\encrypt.go + +artifacts: + - path: example_decrypt.exe + name: decrypt example binary + - path: example_encrypt.exe + name: encrypt example binary
\ No newline at end of file diff --git a/vendor/github.com/mtrmac/gpgme/.travis.yml b/vendor/github.com/mtrmac/gpgme/.travis.yml new file mode 100644 index 000000000..619e33721 --- /dev/null +++ b/vendor/github.com/mtrmac/gpgme/.travis.yml @@ -0,0 +1,32 @@ +--- +language: go +os: + - linux + - osx + - windows +dist: xenial +sudo: false + +go: + - 1.11 + - 1.12 + - 1.13 + +addons: + apt: + packages: + - libgpgme11-dev + homebrew: + packages: + - gnupg + - gnupg@1.4 + - gpgme + update: true + +matrix: + allow_failures: + - os: windows + +before_install: + - if [[ "$TRAVIS_OS_NAME" == "windows" ]]; then choco install msys2; fi + - if [[ "$TRAVIS_OS_NAME" == "windows" ]]; then choco install gpg4win; fi diff --git a/vendor/github.com/mtrmac/gpgme/data.go b/vendor/github.com/mtrmac/gpgme/data.go index eebc97263..eee32c032 100644 --- a/vendor/github.com/mtrmac/gpgme/data.go +++ b/vendor/github.com/mtrmac/gpgme/data.go @@ -50,25 +50,25 @@ func gogpgme_writefunc(handle, buffer unsafe.Pointer, size C.size_t) C.ssize_t { } //export gogpgme_seekfunc -func gogpgme_seekfunc(handle unsafe.Pointer, offset C.off_t, whence C.int) C.off_t { +func gogpgme_seekfunc(handle unsafe.Pointer, offset C.gpgme_off_t, whence C.int) C.gpgme_off_t { d := callbackLookup(uintptr(handle)).(*Data) n, err := d.s.Seek(int64(offset), int(whence)) if err != nil { C.gpgme_err_set_errno(C.EIO) return -1 } - return C.off_t(n) + return C.gpgme_off_t(n) } // The Data buffer used to communicate with GPGME type Data struct { - dh C.gpgme_data_t + dh C.gpgme_data_t // WARNING: Call runtime.KeepAlive(d) after ANY passing of d.dh to C buf []byte cbs C.struct_gpgme_data_cbs r io.Reader w io.Writer s io.Seeker - cbc uintptr + cbc uintptr // WARNING: Call runtime.KeepAlive(d) after ANY use of d.cbc in C (typically via d.dh) } func newData() *Data { @@ -154,12 +154,14 @@ func (d *Data) Close() error { callbackDelete(d.cbc) } _, err := C.gpgme_data_release(d.dh) + runtime.KeepAlive(d) d.dh = nil return err } func (d *Data) Write(p []byte) (int, error) { n, err := C.gpgme_data_write(d.dh, unsafe.Pointer(&p[0]), C.size_t(len(p))) + runtime.KeepAlive(d) if err != nil { return 0, err } @@ -171,6 +173,7 @@ func (d *Data) Write(p []byte) (int, error) { func (d *Data) Read(p []byte) (int, error) { n, err := C.gpgme_data_read(d.dh, unsafe.Pointer(&p[0]), C.size_t(len(p))) + runtime.KeepAlive(d) if err != nil { return 0, err } @@ -181,11 +184,14 @@ func (d *Data) Read(p []byte) (int, error) { } func (d *Data) Seek(offset int64, whence int) (int64, error) { - n, err := C.gpgme_data_seek(d.dh, C.off_t(offset), C.int(whence)) + n, err := C.gogpgme_data_seek(d.dh, C.gpgme_off_t(offset), C.int(whence)) + runtime.KeepAlive(d) return int64(n), err } // Name returns the associated filename if any func (d *Data) Name() string { - return C.GoString(C.gpgme_data_get_file_name(d.dh)) + res := C.GoString(C.gpgme_data_get_file_name(d.dh)) + runtime.KeepAlive(d) + return res } diff --git a/vendor/github.com/mtrmac/gpgme/go.mod b/vendor/github.com/mtrmac/gpgme/go.mod new file mode 100644 index 000000000..3dd09c9fb --- /dev/null +++ b/vendor/github.com/mtrmac/gpgme/go.mod @@ -0,0 +1,3 @@ +module github.com/mtrmac/gpgme + +go 1.11 diff --git a/vendor/github.com/mtrmac/gpgme/go_gpgme.c b/vendor/github.com/mtrmac/gpgme/go_gpgme.c index b887574e0..00da3ab30 100644 --- a/vendor/github.com/mtrmac/gpgme/go_gpgme.c +++ b/vendor/github.com/mtrmac/gpgme/go_gpgme.c @@ -8,6 +8,28 @@ void gogpgme_set_passphrase_cb(gpgme_ctx_t ctx, gpgme_passphrase_cb_t cb, uintpt gpgme_set_passphrase_cb(ctx, cb, (void *)handle); } +gpgme_off_t gogpgme_data_seek(gpgme_data_t dh, gpgme_off_t offset, int whence) { + return gpgme_data_seek(dh, offset, whence); +} + +gpgme_error_t gogpgme_op_assuan_transact_ext( + gpgme_ctx_t ctx, + char* cmd, + uintptr_t data_h, + uintptr_t inquiry_h, + uintptr_t status_h, + gpgme_error_t *operr + ){ + return gpgme_op_assuan_transact_ext( + ctx, + cmd, + (gpgme_assuan_data_cb_t) gogpgme_assuan_data_callback, (void *)data_h, + (gpgme_assuan_inquire_cb_t) gogpgme_assuan_inquiry_callback, (void *)inquiry_h, + (gpgme_assuan_status_cb_t) gogpgme_assuan_status_callback, (void *)status_h, + operr + ); +} + unsigned int key_revoked(gpgme_key_t k) { return k->revoked; } diff --git a/vendor/github.com/mtrmac/gpgme/go_gpgme.h b/vendor/github.com/mtrmac/gpgme/go_gpgme.h index a3678b127..d4826ab36 100644 --- a/vendor/github.com/mtrmac/gpgme/go_gpgme.h +++ b/vendor/github.com/mtrmac/gpgme/go_gpgme.h @@ -6,12 +6,24 @@ #include <gpgme.h> +/* GPGME_VERSION_NUMBER was introduced in 1.4.0 */ +#if !defined(GPGME_VERSION_NUMBER) || GPGME_VERSION_NUMBER < 0x010402 +typedef off_t gpgme_off_t; /* Introduced in 1.4.2 */ +#endif + extern ssize_t gogpgme_readfunc(void *handle, void *buffer, size_t size); extern ssize_t gogpgme_writefunc(void *handle, void *buffer, size_t size); extern off_t gogpgme_seekfunc(void *handle, off_t offset, int whence); extern gpgme_error_t gogpgme_passfunc(void *hook, char *uid_hint, char *passphrase_info, int prev_was_bad, int fd); extern gpgme_error_t gogpgme_data_new_from_cbs(gpgme_data_t *dh, gpgme_data_cbs_t cbs, uintptr_t handle); extern void gogpgme_set_passphrase_cb(gpgme_ctx_t ctx, gpgme_passphrase_cb_t cb, uintptr_t handle); +extern gpgme_off_t gogpgme_data_seek(gpgme_data_t dh, gpgme_off_t offset, int whence); + +extern gpgme_error_t gogpgme_op_assuan_transact_ext(gpgme_ctx_t ctx, char *cmd, uintptr_t data_h, uintptr_t inquiry_h , uintptr_t status_h, gpgme_error_t *operr); + +extern gpgme_error_t gogpgme_assuan_data_callback(void *opaque, void* data, size_t datalen ); +extern gpgme_error_t gogpgme_assuan_inquiry_callback(void *opaque, char* name, char* args); +extern gpgme_error_t gogpgme_assuan_status_callback(void *opaque, char* status, char* args); extern unsigned int key_revoked(gpgme_key_t k); extern unsigned int key_expired(gpgme_key_t k); diff --git a/vendor/github.com/mtrmac/gpgme/gpgme.go b/vendor/github.com/mtrmac/gpgme/gpgme.go index 20aad737c..c19b9aebc 100644 --- a/vendor/github.com/mtrmac/gpgme/gpgme.go +++ b/vendor/github.com/mtrmac/gpgme/gpgme.go @@ -7,7 +7,6 @@ package gpgme // #include <gpgme.h> // #include "go_gpgme.h" import "C" - import ( "fmt" "io" @@ -48,9 +47,8 @@ const ( ProtocolAssuan Protocol = C.GPGME_PROTOCOL_ASSUAN ProtocolG13 Protocol = C.GPGME_PROTOCOL_G13 ProtocolUIServer Protocol = C.GPGME_PROTOCOL_UISERVER - // ProtocolSpawn Protocol = C.GPGME_PROTOCOL_SPAWN // Unavailable in 1.4.3 - ProtocolDefault Protocol = C.GPGME_PROTOCOL_DEFAULT - ProtocolUnknown Protocol = C.GPGME_PROTOCOL_UNKNOWN + ProtocolDefault Protocol = C.GPGME_PROTOCOL_DEFAULT + ProtocolUnknown Protocol = C.GPGME_PROTOCOL_UNKNOWN ) type PinEntryMode int @@ -70,7 +68,6 @@ const ( EncryptNoEncryptTo EncryptFlag = C.GPGME_ENCRYPT_NO_ENCRYPT_TO EncryptPrepare EncryptFlag = C.GPGME_ENCRYPT_PREPARE EncryptExceptSign EncryptFlag = C.GPGME_ENCRYPT_EXPECT_SIGN - // EncryptNoCompress EncryptFlag = C.GPGME_ENCRYPT_NO_COMPRESS // Unavailable in 1.4.3 ) type HashAlgo int @@ -84,7 +81,6 @@ const ( KeyListModeExtern KeyListMode = C.GPGME_KEYLIST_MODE_EXTERN KeyListModeSigs KeyListMode = C.GPGME_KEYLIST_MODE_SIGS KeyListModeSigNotations KeyListMode = C.GPGME_KEYLIST_MODE_SIG_NOTATIONS - // KeyListModeWithSecret KeyListMode = C.GPGME_KEYLIST_MODE_WITH_SECRET // Unavailable in 1.4.3 KeyListModeEphemeral KeyListMode = C.GPGME_KEYLIST_MODE_EPHEMERAL KeyListModeModeValidate KeyListMode = C.GPGME_KEYLIST_MODE_VALIDATE ) @@ -168,39 +164,60 @@ func EngineCheckVersion(p Protocol) error { } type EngineInfo struct { - info C.gpgme_engine_info_t + next *EngineInfo + protocol Protocol + fileName string + homeDir string + version string + requiredVersion string } -func (e *EngineInfo) Next() *EngineInfo { - if e.info.next == nil { - return nil +func copyEngineInfo(info C.gpgme_engine_info_t) *EngineInfo { + res := &EngineInfo{ + next: nil, + protocol: Protocol(info.protocol), + fileName: C.GoString(info.file_name), + homeDir: C.GoString(info.home_dir), + version: C.GoString(info.version), + requiredVersion: C.GoString(info.req_version), + } + if info.next != nil { + res.next = copyEngineInfo(info.next) } - return &EngineInfo{info: e.info.next} + return res +} + +func (e *EngineInfo) Next() *EngineInfo { + return e.next } func (e *EngineInfo) Protocol() Protocol { - return Protocol(e.info.protocol) + return e.protocol } func (e *EngineInfo) FileName() string { - return C.GoString(e.info.file_name) + return e.fileName } func (e *EngineInfo) Version() string { - return C.GoString(e.info.version) + return e.version } func (e *EngineInfo) RequiredVersion() string { - return C.GoString(e.info.req_version) + return e.requiredVersion } func (e *EngineInfo) HomeDir() string { - return C.GoString(e.info.home_dir) + return e.homeDir } func GetEngineInfo() (*EngineInfo, error) { - info := &EngineInfo{} - return info, handleError(C.gpgme_get_engine_info(&info.info)) + var cInfo C.gpgme_engine_info_t + err := handleError(C.gpgme_get_engine_info(&cInfo)) + if err != nil { + return nil, err + } + return copyEngineInfo(cInfo), nil // It is up to the caller not to invalidate cInfo concurrently until this is done. } func SetEngineInfo(proto Protocol, fileName, homeDir string) error { @@ -261,9 +278,9 @@ type Context struct { KeyError error callback Callback - cbc uintptr + cbc uintptr // WARNING: Call runtime.KeepAlive(c) after ANY use of c.cbc in C (typically via c.ctx) - ctx C.gpgme_ctx_t + ctx C.gpgme_ctx_t // WARNING: Call runtime.KeepAlive(c) after ANY passing of c.ctx to C } func New() (*Context, error) { @@ -281,49 +298,68 @@ func (c *Context) Release() { callbackDelete(c.cbc) } C.gpgme_release(c.ctx) + runtime.KeepAlive(c) c.ctx = nil } func (c *Context) SetArmor(yes bool) { C.gpgme_set_armor(c.ctx, cbool(yes)) + runtime.KeepAlive(c) } func (c *Context) Armor() bool { - return C.gpgme_get_armor(c.ctx) != 0 + res := C.gpgme_get_armor(c.ctx) != 0 + runtime.KeepAlive(c) + return res } func (c *Context) SetTextMode(yes bool) { C.gpgme_set_textmode(c.ctx, cbool(yes)) + runtime.KeepAlive(c) } func (c *Context) TextMode() bool { - return C.gpgme_get_textmode(c.ctx) != 0 + res := C.gpgme_get_textmode(c.ctx) != 0 + runtime.KeepAlive(c) + return res } func (c *Context) SetProtocol(p Protocol) error { - return handleError(C.gpgme_set_protocol(c.ctx, C.gpgme_protocol_t(p))) + err := handleError(C.gpgme_set_protocol(c.ctx, C.gpgme_protocol_t(p))) + runtime.KeepAlive(c) + return err } func (c *Context) Protocol() Protocol { - return Protocol(C.gpgme_get_protocol(c.ctx)) + res := Protocol(C.gpgme_get_protocol(c.ctx)) + runtime.KeepAlive(c) + return res } func (c *Context) SetKeyListMode(m KeyListMode) error { - return handleError(C.gpgme_set_keylist_mode(c.ctx, C.gpgme_keylist_mode_t(m))) + err := handleError(C.gpgme_set_keylist_mode(c.ctx, C.gpgme_keylist_mode_t(m))) + runtime.KeepAlive(c) + return err } func (c *Context) KeyListMode() KeyListMode { - return KeyListMode(C.gpgme_get_keylist_mode(c.ctx)) + res := KeyListMode(C.gpgme_get_keylist_mode(c.ctx)) + runtime.KeepAlive(c) + return res } // Unavailable in 1.3.2: // func (c *Context) SetPinEntryMode(m PinEntryMode) error { -// return handleError(C.gpgme_set_pinentry_mode(c.ctx, C.gpgme_pinentry_mode_t(m))) +// err := handleError(C.gpgme_set_pinentry_mode(c.ctx, C.gpgme_pinentry_mode_t(m))) +// runtime.KeepAlive(c) +// return err // } // Unavailable in 1.3.2: // func (c *Context) PinEntryMode() PinEntryMode { -// return PinEntryMode(C.gpgme_get_pinentry_mode(c.ctx)) +// res := PinEntryMode(C.gpgme_get_pinentry_mode(c.ctx)) +// runtime.KeepAlive(c) +// return res // } func (c *Context) SetCallback(callback Callback) error { @@ -340,11 +376,17 @@ func (c *Context) SetCallback(callback Callback) error { c.cbc = 0 _, err = C.gogpgme_set_passphrase_cb(c.ctx, nil, 0) } + runtime.KeepAlive(c) return err } func (c *Context) EngineInfo() *EngineInfo { - return &EngineInfo{info: C.gpgme_ctx_get_engine_info(c.ctx)} + cInfo := C.gpgme_ctx_get_engine_info(c.ctx) + runtime.KeepAlive(c) + // NOTE: c must be live as long as we are accessing cInfo. + res := copyEngineInfo(cInfo) + runtime.KeepAlive(c) // for accesses to cInfo + return res } func (c *Context) SetEngineInfo(proto Protocol, fileName, homeDir string) error { @@ -357,19 +399,23 @@ func (c *Context) SetEngineInfo(proto Protocol, fileName, homeDir string) error chome = C.CString(homeDir) defer C.free(unsafe.Pointer(chome)) } - return handleError(C.gpgme_ctx_set_engine_info(c.ctx, C.gpgme_protocol_t(proto), cfn, chome)) + err := handleError(C.gpgme_ctx_set_engine_info(c.ctx, C.gpgme_protocol_t(proto), cfn, chome)) + runtime.KeepAlive(c) + return err } func (c *Context) KeyListStart(pattern string, secretOnly bool) error { cpattern := C.CString(pattern) defer C.free(unsafe.Pointer(cpattern)) - err := C.gpgme_op_keylist_start(c.ctx, cpattern, cbool(secretOnly)) - return handleError(err) + err := handleError(C.gpgme_op_keylist_start(c.ctx, cpattern, cbool(secretOnly))) + runtime.KeepAlive(c) + return err } func (c *Context) KeyListNext() bool { c.Key = newKey() err := handleError(C.gpgme_op_keylist_next(c.ctx, &c.Key.k)) + runtime.KeepAlive(c) // implies runtime.KeepAlive(c.Key) if err != nil { if e, ok := err.(Error); ok && e.Code() == ErrorEOF { c.KeyError = nil @@ -383,7 +429,9 @@ func (c *Context) KeyListNext() bool { } func (c *Context) KeyListEnd() error { - return handleError(C.gpgme_op_keylist_end(c.ctx)) + err := handleError(C.gpgme_op_keylist_end(c.ctx)) + runtime.KeepAlive(c) + return err } func (c *Context) GetKey(fingerprint string, secret bool) (*Key, error) { @@ -391,7 +439,11 @@ func (c *Context) GetKey(fingerprint string, secret bool) (*Key, error) { cfpr := C.CString(fingerprint) defer C.free(unsafe.Pointer(cfpr)) err := handleError(C.gpgme_get_key(c.ctx, cfpr, &key.k, cbool(secret))) - if e, ok := err.(Error); key.k == nil && ok && e.Code() == ErrorEOF { + runtime.KeepAlive(c) + runtime.KeepAlive(key) + keyKIsNil := key.k == nil + runtime.KeepAlive(key) + if e, ok := err.(Error); keyKIsNil && ok && e.Code() == ErrorEOF { return nil, fmt.Errorf("key %q not found", fingerprint) } if err != nil { @@ -401,11 +453,19 @@ func (c *Context) GetKey(fingerprint string, secret bool) (*Key, error) { } func (c *Context) Decrypt(ciphertext, plaintext *Data) error { - return handleError(C.gpgme_op_decrypt(c.ctx, ciphertext.dh, plaintext.dh)) + err := handleError(C.gpgme_op_decrypt(c.ctx, ciphertext.dh, plaintext.dh)) + runtime.KeepAlive(c) + runtime.KeepAlive(ciphertext) + runtime.KeepAlive(plaintext) + return err } func (c *Context) DecryptVerify(ciphertext, plaintext *Data) error { - return handleError(C.gpgme_op_decrypt_verify(c.ctx, ciphertext.dh, plaintext.dh)) + err := handleError(C.gpgme_op_decrypt_verify(c.ctx, ciphertext.dh, plaintext.dh)) + runtime.KeepAlive(c) + runtime.KeepAlive(ciphertext) + runtime.KeepAlive(plaintext) + return err } type Signature struct { @@ -432,10 +492,20 @@ func (c *Context) Verify(sig, signedText, plain *Data) (string, []Signature, err plainPtr = plain.dh } err := handleError(C.gpgme_op_verify(c.ctx, sig.dh, signedTextPtr, plainPtr)) + runtime.KeepAlive(c) + runtime.KeepAlive(sig) + if signedText != nil { + runtime.KeepAlive(signedText) + } + if plain != nil { + runtime.KeepAlive(plain) + } if err != nil { return "", nil, err } res := C.gpgme_op_verify_result(c.ctx) + runtime.KeepAlive(c) + // NOTE: c must be live as long as we are accessing res. sigs := []Signature{} for s := res.signatures; s != nil; s = s.next { sig := Signature{ @@ -455,7 +525,9 @@ func (c *Context) Verify(sig, signedText, plain *Data) (string, []Signature, err } sigs = append(sigs, sig) } - return C.GoString(res.file_name), sigs, nil + fileName := C.GoString(res.file_name) + runtime.KeepAlive(c) // for all accesses to res above + return fileName, sigs, nil } func (c *Context) Encrypt(recipients []*Key, flags EncryptFlag, plaintext, ciphertext *Data) error { @@ -467,18 +539,116 @@ func (c *Context) Encrypt(recipients []*Key, flags EncryptFlag, plaintext, ciphe *ptr = recipients[i].k } err := C.gpgme_op_encrypt(c.ctx, (*C.gpgme_key_t)(recp), C.gpgme_encrypt_flags_t(flags), plaintext.dh, ciphertext.dh) + runtime.KeepAlive(c) + runtime.KeepAlive(recipients) + runtime.KeepAlive(plaintext) + runtime.KeepAlive(ciphertext) return handleError(err) } func (c *Context) Sign(signers []*Key, plain, sig *Data, mode SigMode) error { C.gpgme_signers_clear(c.ctx) + runtime.KeepAlive(c) for _, k := range signers { - if err := handleError(C.gpgme_signers_add(c.ctx, k.k)); err != nil { + err := handleError(C.gpgme_signers_add(c.ctx, k.k)) + runtime.KeepAlive(c) + runtime.KeepAlive(k) + if err != nil { C.gpgme_signers_clear(c.ctx) + runtime.KeepAlive(c) return err } } - return handleError(C.gpgme_op_sign(c.ctx, plain.dh, sig.dh, C.gpgme_sig_mode_t(mode))) + err := handleError(C.gpgme_op_sign(c.ctx, plain.dh, sig.dh, C.gpgme_sig_mode_t(mode))) + runtime.KeepAlive(c) + runtime.KeepAlive(plain) + runtime.KeepAlive(sig) + return err +} + +type AssuanDataCallback func(data []byte) error +type AssuanInquireCallback func(name, args string) error +type AssuanStatusCallback func(status, args string) error + +// AssuanSend sends a raw Assuan command to gpg-agent +func (c *Context) AssuanSend( + cmd string, + data AssuanDataCallback, + inquiry AssuanInquireCallback, + status AssuanStatusCallback, +) error { + var operr C.gpgme_error_t + + dataPtr := callbackAdd(&data) + inquiryPtr := callbackAdd(&inquiry) + statusPtr := callbackAdd(&status) + cmdCStr := C.CString(cmd) + defer C.free(unsafe.Pointer(cmdCStr)) + err := C.gogpgme_op_assuan_transact_ext( + c.ctx, + cmdCStr, + C.uintptr_t(dataPtr), + C.uintptr_t(inquiryPtr), + C.uintptr_t(statusPtr), + &operr, + ) + runtime.KeepAlive(c) + + if handleError(operr) != nil { + return handleError(operr) + } + return handleError(err) +} + +//export gogpgme_assuan_data_callback +func gogpgme_assuan_data_callback(handle unsafe.Pointer, data unsafe.Pointer, datalen C.size_t) C.gpgme_error_t { + c := callbackLookup(uintptr(handle)).(*AssuanDataCallback) + if *c == nil { + return 0 + } + (*c)(C.GoBytes(data, C.int(datalen))) + return 0 +} + +//export gogpgme_assuan_inquiry_callback +func gogpgme_assuan_inquiry_callback(handle unsafe.Pointer, cName *C.char, cArgs *C.char) C.gpgme_error_t { + name := C.GoString(cName) + args := C.GoString(cArgs) + c := callbackLookup(uintptr(handle)).(*AssuanInquireCallback) + if *c == nil { + return 0 + } + (*c)(name, args) + return 0 +} + +//export gogpgme_assuan_status_callback +func gogpgme_assuan_status_callback(handle unsafe.Pointer, cStatus *C.char, cArgs *C.char) C.gpgme_error_t { + status := C.GoString(cStatus) + args := C.GoString(cArgs) + c := callbackLookup(uintptr(handle)).(*AssuanStatusCallback) + if *c == nil { + return 0 + } + (*c)(status, args) + return 0 +} + +// ExportModeFlags defines how keys are exported from Export +type ExportModeFlags uint + +const ( + ExportModeExtern ExportModeFlags = C.GPGME_EXPORT_MODE_EXTERN + ExportModeMinimal ExportModeFlags = C.GPGME_EXPORT_MODE_MINIMAL +) + +func (c *Context) Export(pattern string, mode ExportModeFlags, data *Data) error { + pat := C.CString(pattern) + defer C.free(unsafe.Pointer(pat)) + err := handleError(C.gpgme_op_export(c.ctx, pat, C.gpgme_export_mode_t(mode), data.dh)) + runtime.KeepAlive(c) + runtime.KeepAlive(data) + return err } // ImportStatusFlags describes the type of ImportStatus.Status. The C API in gpgme.h simply uses "unsigned". @@ -517,10 +687,14 @@ type ImportResult struct { func (c *Context) Import(keyData *Data) (*ImportResult, error) { err := handleError(C.gpgme_op_import(c.ctx, keyData.dh)) + runtime.KeepAlive(c) + runtime.KeepAlive(keyData) if err != nil { return nil, err } res := C.gpgme_op_import_result(c.ctx) + runtime.KeepAlive(c) + // NOTE: c must be live as long as we are accessing res. imports := []ImportStatus{} for s := res.imports; s != nil; s = s.next { imports = append(imports, ImportStatus{ @@ -529,7 +703,7 @@ func (c *Context) Import(keyData *Data) (*ImportResult, error) { Status: ImportStatusFlags(s.status), }) } - return &ImportResult{ + importResult := &ImportResult{ Considered: int(res.considered), NoUserID: int(res.no_user_id), Imported: int(res.imported), @@ -544,11 +718,13 @@ func (c *Context) Import(keyData *Data) (*ImportResult, error) { SecretUnchanged: int(res.secret_unchanged), NotImported: int(res.not_imported), Imports: imports, - }, nil + } + runtime.KeepAlive(c) // for all accesses to res above + return importResult, nil } type Key struct { - k C.gpgme_key_t + k C.gpgme_key_t // WARNING: Call Runtime.KeepAlive(k) after ANY passing of k.k to C } func newKey() *Key { @@ -559,85 +735,122 @@ func newKey() *Key { func (k *Key) Release() { C.gpgme_key_release(k.k) + runtime.KeepAlive(k) k.k = nil } func (k *Key) Revoked() bool { - return C.key_revoked(k.k) != 0 + res := C.key_revoked(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) Expired() bool { - return C.key_expired(k.k) != 0 + res := C.key_expired(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) Disabled() bool { - return C.key_disabled(k.k) != 0 + res := C.key_disabled(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) Invalid() bool { - return C.key_invalid(k.k) != 0 + res := C.key_invalid(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) CanEncrypt() bool { - return C.key_can_encrypt(k.k) != 0 + res := C.key_can_encrypt(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) CanSign() bool { - return C.key_can_sign(k.k) != 0 + res := C.key_can_sign(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) CanCertify() bool { - return C.key_can_certify(k.k) != 0 + res := C.key_can_certify(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) Secret() bool { - return C.key_secret(k.k) != 0 + res := C.key_secret(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) CanAuthenticate() bool { - return C.key_can_authenticate(k.k) != 0 + res := C.key_can_authenticate(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) IsQualified() bool { - return C.key_is_qualified(k.k) != 0 + res := C.key_is_qualified(k.k) != 0 + runtime.KeepAlive(k) + return res } func (k *Key) Protocol() Protocol { - return Protocol(k.k.protocol) + res := Protocol(k.k.protocol) + runtime.KeepAlive(k) + return res } func (k *Key) IssuerSerial() string { - return C.GoString(k.k.issuer_serial) + res := C.GoString(k.k.issuer_serial) + runtime.KeepAlive(k) + return res } func (k *Key) IssuerName() string { - return C.GoString(k.k.issuer_name) + res := C.GoString(k.k.issuer_name) + runtime.KeepAlive(k) + return res } func (k *Key) ChainID() string { - return C.GoString(k.k.chain_id) + res := C.GoString(k.k.chain_id) + runtime.KeepAlive(k) + return res } func (k *Key) OwnerTrust() Validity { - return Validity(k.k.owner_trust) + res := Validity(k.k.owner_trust) + runtime.KeepAlive(k) + return res } func (k *Key) SubKeys() *SubKey { - if k.k.subkeys == nil { + subKeys := k.k.subkeys + runtime.KeepAlive(k) + if subKeys == nil { return nil } - return &SubKey{k: k.k.subkeys, parent: k} + return &SubKey{k: subKeys, parent: k} // The parent: k reference ensures subKeys remains valid } func (k *Key) UserIDs() *UserID { - if k.k.uids == nil { + uids := k.k.uids + runtime.KeepAlive(k) + if uids == nil { return nil } - return &UserID{u: k.k.uids, parent: k} + return &UserID{u: uids, parent: k} // The parent: k reference ensures uids remains valid } func (k *Key) KeyListMode() KeyListMode { - return KeyListMode(k.k.keylist_mode) + res := KeyListMode(k.k.keylist_mode) + runtime.KeepAlive(k) + return res } type SubKey struct { @@ -737,12 +950,3 @@ func (u *UserID) Comment() string { func (u *UserID) Email() string { return C.GoString(u.u.email) } - -// This is somewhat of a horrible hack. We need to unset GPG_AGENT_INFO so that gpgme does not pass --use-agent to GPG. -// os.Unsetenv should be enough, but that only calls the underlying C library (which gpgme uses) if cgo is involved -// - and cgo can't be used in tests. So, provide this helper for test initialization. -func unsetenvGPGAgentInfo() { - v := C.CString("GPG_AGENT_INFO") - defer C.free(unsafe.Pointer(v)) - C.unsetenv(v) -} diff --git a/vendor/github.com/mtrmac/gpgme/unset_agent_info.go b/vendor/github.com/mtrmac/gpgme/unset_agent_info.go new file mode 100644 index 000000000..986aca59f --- /dev/null +++ b/vendor/github.com/mtrmac/gpgme/unset_agent_info.go @@ -0,0 +1,18 @@ +// +build !windows + +package gpgme + +// #include <stdlib.h> +import "C" +import ( + "unsafe" +) + +// This is somewhat of a horrible hack. We need to unset GPG_AGENT_INFO so that gpgme does not pass --use-agent to GPG. +// os.Unsetenv should be enough, but that only calls the underlying C library (which gpgme uses) if cgo is involved +// - and cgo can't be used in tests. So, provide this helper for test initialization. +func unsetenvGPGAgentInfo() { + v := C.CString("GPG_AGENT_INFO") + defer C.free(unsafe.Pointer(v)) + C.unsetenv(v) +} diff --git a/vendor/github.com/mtrmac/gpgme/unset_agent_info_windows.go b/vendor/github.com/mtrmac/gpgme/unset_agent_info_windows.go new file mode 100644 index 000000000..431ec86d3 --- /dev/null +++ b/vendor/github.com/mtrmac/gpgme/unset_agent_info_windows.go @@ -0,0 +1,14 @@ +package gpgme + +// #include <stdlib.h> +import "C" +import ( + "unsafe" +) + +// unsetenv is not available in mingw +func unsetenvGPGAgentInfo() { + v := C.CString("GPG_AGENT_INFO=") + defer C.free(unsafe.Pointer(v)) + C.putenv(v) +} diff --git a/vendor/github.com/onsi/ginkgo/.travis.yml b/vendor/github.com/onsi/ginkgo/.travis.yml index b454d643c..65dc3002b 100644 --- a/vendor/github.com/onsi/ginkgo/.travis.yml +++ b/vendor/github.com/onsi/ginkgo/.travis.yml @@ -4,14 +4,22 @@ go: - 1.13.x - tip +cache: + directories: + - $GOPATH/pkg/mod + # allow internal package imports, necessary for forked repositories go_import_path: github.com/onsi/ginkgo install: - - go get -v -t ./... - - go get golang.org/x/tools/cmd/cover - - go get github.com/onsi/gomega - - go install github.com/onsi/ginkgo/ginkgo + - GO111MODULE="off" go get -v -t ./... + - GO111MODULE="off" go get golang.org/x/tools/cmd/cover + - GO111MODULE="off" go get github.com/onsi/gomega + - GO111MODULE="off" go install github.com/onsi/ginkgo/ginkgo - export PATH=$PATH:$HOME/gopath/bin -script: $HOME/gopath/bin/ginkgo -r --randomizeAllSpecs --randomizeSuites --race --trace && go vet +script: + - GO111MODULE="on" go mod tidy + - diff -u <(echo -n) <(git diff go.mod) + - diff -u <(echo -n) <(git diff go.sum) + - $HOME/gopath/bin/ginkgo -r --randomizeAllSpecs --randomizeSuites --race --trace && go vet diff --git a/vendor/github.com/onsi/ginkgo/CHANGELOG.md b/vendor/github.com/onsi/ginkgo/CHANGELOG.md index 96f03ad7c..84b479404 100644 --- a/vendor/github.com/onsi/ginkgo/CHANGELOG.md +++ b/vendor/github.com/onsi/ginkgo/CHANGELOG.md @@ -1,3 +1,8 @@ +## 1.12.0 + +### Features +- Add module definition (#630) [78916ab] + ## 1.11.0 ### Features diff --git a/vendor/github.com/onsi/ginkgo/config/config.go b/vendor/github.com/onsi/ginkgo/config/config.go index 14c82ec3a..949f8130f 100644 --- a/vendor/github.com/onsi/ginkgo/config/config.go +++ b/vendor/github.com/onsi/ginkgo/config/config.go @@ -20,7 +20,7 @@ import ( "fmt" ) -const VERSION = "1.11.0" +const VERSION = "1.12.0" type GinkgoConfigType struct { RandomSeed int64 diff --git a/vendor/github.com/onsi/ginkgo/go.mod b/vendor/github.com/onsi/ginkgo/go.mod new file mode 100644 index 000000000..15a4ab571 --- /dev/null +++ b/vendor/github.com/onsi/ginkgo/go.mod @@ -0,0 +1,9 @@ +module github.com/onsi/ginkgo + +require ( + github.com/hpcloud/tail v1.0.0 + github.com/onsi/gomega v1.7.1 + golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e +) + +go 1.12 diff --git a/vendor/github.com/onsi/ginkgo/go.sum b/vendor/github.com/onsi/ginkgo/go.sum new file mode 100644 index 000000000..29adce41a --- /dev/null +++ b/vendor/github.com/onsi/ginkgo/go.sum @@ -0,0 +1,26 @@ +github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV9I= +github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI= +github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= +github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/gomega v1.7.1 h1:K0jcRCwNQM3vFGh1ppMtDh/+7ApJrjldlX8fA0jDTLQ= +github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= +golang.org/x/net v0.0.0-20180906233101-161cd47e91fd h1:nTDtHvHSdCn1m6ITfMRqtOd/9+7a3s8RBNOZ3eYZzJA= +golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e h1:N7DeIrjYszNmSW409R3frPPwglRwMkXSBzwVbkOjLLA= +golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM= +gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/fsnotify.v1 v1.4.7 h1:xOHLXZwVvI9hhs+cLKq5+I5onOuwQLhQwiu63xxlHs4= +gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= +gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ= +gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= +gopkg.in/yaml.v2 v2.2.4 h1:/eiJrUcujPVeJ3xlSWaiNi3uSVmDGBK1pDHUHAnao1I= +gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= diff --git a/vendor/github.com/onsi/gomega/CHANGELOG.md b/vendor/github.com/onsi/gomega/CHANGELOG.md index 59ad384aa..3e9b5961b 100644 --- a/vendor/github.com/onsi/gomega/CHANGELOG.md +++ b/vendor/github.com/onsi/gomega/CHANGELOG.md @@ -1,3 +1,10 @@ +## 1.9.0 + +### Features +- Add ContainElements matcher (#370) [2f57380] +- Output missing and extra elements in ConsistOf failure message [a31eda7] +- Document method LargestMatching [7c5a280] + ## 1.8.1 ### Fixes diff --git a/vendor/github.com/onsi/gomega/gomega_dsl.go b/vendor/github.com/onsi/gomega/gomega_dsl.go index 4cb94d22f..0ab35bc7a 100644 --- a/vendor/github.com/onsi/gomega/gomega_dsl.go +++ b/vendor/github.com/onsi/gomega/gomega_dsl.go @@ -24,7 +24,7 @@ import ( "github.com/onsi/gomega/types" ) -const GOMEGA_VERSION = "1.8.1" +const GOMEGA_VERSION = "1.9.0" const nilFailHandlerPanic = `You are trying to make an assertion, but Gomega's fail handler is nil. If you're using Ginkgo then you probably forgot to put your assertion in an It(). diff --git a/vendor/github.com/onsi/gomega/matchers.go b/vendor/github.com/onsi/gomega/matchers.go index 9ec8893cb..11f5b1070 100644 --- a/vendor/github.com/onsi/gomega/matchers.go +++ b/vendor/github.com/onsi/gomega/matchers.go @@ -306,6 +306,20 @@ func ConsistOf(elements ...interface{}) types.GomegaMatcher { } } +//ContainElements succeeds if actual contains the passed in elements. The ordering of the elements does not matter. +//By default ContainElements() uses Equal() to match the elements, however custom matchers can be passed in instead. Here are some examples: +// +// Expect([]string{"Foo", "FooBar"}).Should(ContainElements("FooBar")) +// Expect([]string{"Foo", "FooBar"}).Should(ContainElements(ContainSubstring("Bar"), "Foo")) +// +//Actual must be an array, slice or map. +//For maps, ContainElements searches through the map's values. +func ContainElements(elements ...interface{}) types.GomegaMatcher { + return &matchers.ContainElementsMatcher{ + Elements: elements, + } +} + //HaveKey succeeds if actual is a map with the passed in key. //By default HaveKey uses Equal() to perform the match, however a //matcher can be passed in instead: diff --git a/vendor/github.com/onsi/gomega/matchers/consist_of.go b/vendor/github.com/onsi/gomega/matchers/consist_of.go index cbbf61802..e453b22d1 100644 --- a/vendor/github.com/onsi/gomega/matchers/consist_of.go +++ b/vendor/github.com/onsi/gomega/matchers/consist_of.go @@ -11,7 +11,9 @@ import ( ) type ConsistOfMatcher struct { - Elements []interface{} + Elements []interface{} + missingElements []interface{} + extraElements []interface{} } func (matcher *ConsistOfMatcher) Match(actual interface{}) (success bool, err error) { @@ -19,44 +21,63 @@ func (matcher *ConsistOfMatcher) Match(actual interface{}) (success bool, err er return false, fmt.Errorf("ConsistOf matcher expects an array/slice/map. Got:\n%s", format.Object(actual, 1)) } - elements := matcher.Elements - if len(matcher.Elements) == 1 && isArrayOrSlice(matcher.Elements[0]) { - elements = []interface{}{} - value := reflect.ValueOf(matcher.Elements[0]) - for i := 0; i < value.Len(); i++ { - elements = append(elements, value.Index(i).Interface()) - } + matchers := matchers(matcher.Elements) + values := valuesOf(actual) + + bipartiteGraph, err := bipartitegraph.NewBipartiteGraph(values, matchers, neighbours) + if err != nil { + return false, err } - matchers := []interface{}{} - for _, element := range elements { - matcher, isMatcher := element.(omegaMatcher) - if !isMatcher { - matcher = &EqualMatcher{Expected: element} - } - matchers = append(matchers, matcher) + edges := bipartiteGraph.LargestMatching() + if len(edges) == len(values) && len(edges) == len(matchers) { + return true, nil } - values := matcher.valuesOf(actual) + var missingMatchers []interface{} + matcher.extraElements, missingMatchers = bipartiteGraph.FreeLeftRight(edges) + matcher.missingElements = equalMatchersToElements(missingMatchers) - if len(values) != len(matchers) { - return false, nil - } + return false, nil +} - neighbours := func(v, m interface{}) (bool, error) { - match, err := m.(omegaMatcher).Match(v) - return match && err == nil, nil +func neighbours(value, matcher interface{}) (bool, error) { + match, err := matcher.(omegaMatcher).Match(value) + return match && err == nil, nil +} + +func equalMatchersToElements(matchers []interface{}) (elements []interface{}) { + for _, matcher := range matchers { + equalMatcher, ok := matcher.(*EqualMatcher) + if ok { + matcher = equalMatcher.Expected + } + elements = append(elements, matcher) } + return +} - bipartiteGraph, err := bipartitegraph.NewBipartiteGraph(values, matchers, neighbours) - if err != nil { - return false, err +func matchers(expectedElems []interface{}) (matchers []interface{}) { + elems := expectedElems + if len(expectedElems) == 1 && isArrayOrSlice(expectedElems[0]) { + elems = []interface{}{} + value := reflect.ValueOf(expectedElems[0]) + for i := 0; i < value.Len(); i++ { + elems = append(elems, value.Index(i).Interface()) + } } - return len(bipartiteGraph.LargestMatching()) == len(values), nil + for _, e := range elems { + matcher, isMatcher := e.(omegaMatcher) + if !isMatcher { + matcher = &EqualMatcher{Expected: e} + } + matchers = append(matchers, matcher) + } + return } -func (matcher *ConsistOfMatcher) valuesOf(actual interface{}) []interface{} { +func valuesOf(actual interface{}) []interface{} { value := reflect.ValueOf(actual) values := []interface{}{} if isMap(actual) { @@ -74,7 +95,21 @@ func (matcher *ConsistOfMatcher) valuesOf(actual interface{}) []interface{} { } func (matcher *ConsistOfMatcher) FailureMessage(actual interface{}) (message string) { - return format.Message(actual, "to consist of", matcher.Elements) + message = format.Message(actual, "to consist of", matcher.Elements) + message = appendMissingElements(message, matcher.missingElements) + if len(matcher.extraElements) > 0 { + message = fmt.Sprintf("%s\nthe extra elements were\n%s", message, + format.Object(matcher.extraElements, 1)) + } + return +} + +func appendMissingElements(message string, missingElements []interface{}) string { + if len(missingElements) == 0 { + return message + } + return fmt.Sprintf("%s\nthe missing elements were\n%s", message, + format.Object(missingElements, 1)) } func (matcher *ConsistOfMatcher) NegatedFailureMessage(actual interface{}) (message string) { diff --git a/vendor/github.com/onsi/gomega/matchers/contain_elements_matcher.go b/vendor/github.com/onsi/gomega/matchers/contain_elements_matcher.go new file mode 100644 index 000000000..19a9e78f8 --- /dev/null +++ b/vendor/github.com/onsi/gomega/matchers/contain_elements_matcher.go @@ -0,0 +1,44 @@ +package matchers + +import ( + "fmt" + + "github.com/onsi/gomega/format" + "github.com/onsi/gomega/matchers/support/goraph/bipartitegraph" +) + +type ContainElementsMatcher struct { + Elements []interface{} + missingElements []interface{} +} + +func (matcher *ContainElementsMatcher) Match(actual interface{}) (success bool, err error) { + if !isArrayOrSlice(actual) && !isMap(actual) { + return false, fmt.Errorf("ContainElements matcher expects an array/slice/map. Got:\n%s", format.Object(actual, 1)) + } + + matchers := matchers(matcher.Elements) + bipartiteGraph, err := bipartitegraph.NewBipartiteGraph(valuesOf(actual), matchers, neighbours) + if err != nil { + return false, err + } + + edges := bipartiteGraph.LargestMatching() + if len(edges) == len(matchers) { + return true, nil + } + + _, missingMatchers := bipartiteGraph.FreeLeftRight(edges) + matcher.missingElements = equalMatchersToElements(missingMatchers) + + return false, nil +} + +func (matcher *ContainElementsMatcher) FailureMessage(actual interface{}) (message string) { + message = format.Message(actual, "to contain elements", matcher.Elements) + return appendMissingElements(message, matcher.missingElements) +} + +func (matcher *ContainElementsMatcher) NegatedFailureMessage(actual interface{}) (message string) { + return format.Message(actual, "not to contain elements", matcher.Elements) +} diff --git a/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraph.go b/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraph.go index 108f28586..830e30827 100644 --- a/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraph.go +++ b/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraph.go @@ -13,13 +13,13 @@ type BipartiteGraph struct { func NewBipartiteGraph(leftValues, rightValues []interface{}, neighbours func(interface{}, interface{}) (bool, error)) (*BipartiteGraph, error) { left := NodeOrderedSet{} - for i := range leftValues { - left = append(left, Node{Id: i}) + for i, v := range leftValues { + left = append(left, Node{ID: i, Value: v}) } right := NodeOrderedSet{} - for j := range rightValues { - right = append(right, Node{Id: j + len(left)}) + for j, v := range rightValues { + right = append(right, Node{ID: j + len(left), Value: v}) } edges := EdgeSet{} @@ -31,10 +31,26 @@ func NewBipartiteGraph(leftValues, rightValues []interface{}, neighbours func(in } if neighbours { - edges = append(edges, Edge{Node1: left[i], Node2: right[j]}) + edges = append(edges, Edge{Node1: left[i].ID, Node2: right[j].ID}) } } } return &BipartiteGraph{left, right, edges}, nil } + +// FreeLeftRight returns left node values and right node values +// of the BipartiteGraph's nodes which are not part of the given edges. +func (bg *BipartiteGraph) FreeLeftRight(edges EdgeSet) (leftValues, rightValues []interface{}) { + for _, node := range bg.Left { + if edges.Free(node) { + leftValues = append(leftValues, node.Value) + } + } + for _, node := range bg.Right { + if edges.Free(node) { + rightValues = append(rightValues, node.Value) + } + } + return +} diff --git a/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraphmatching.go b/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraphmatching.go index 8181f43a4..1c54edd8f 100644 --- a/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraphmatching.go +++ b/vendor/github.com/onsi/gomega/matchers/support/goraph/bipartitegraph/bipartitegraphmatching.go @@ -1,9 +1,14 @@ package bipartitegraph -import . "github.com/onsi/gomega/matchers/support/goraph/node" -import . "github.com/onsi/gomega/matchers/support/goraph/edge" -import "github.com/onsi/gomega/matchers/support/goraph/util" - +import ( + . "github.com/onsi/gomega/matchers/support/goraph/edge" + . "github.com/onsi/gomega/matchers/support/goraph/node" + "github.com/onsi/gomega/matchers/support/goraph/util" +) + +// LargestMatching implements the Hopcroft–Karp algorithm taking as input a bipartite graph +// and outputting a maximum cardinality matching, i.e. a set of as many edges as possible +// with the property that no two edges share an endpoint. func (bg *BipartiteGraph) LargestMatching() (matching EdgeSet) { paths := bg.maximalDisjointSLAPCollection(matching) @@ -23,7 +28,7 @@ func (bg *BipartiteGraph) maximalDisjointSLAPCollection(matching EdgeSet) (resul return } - used := make(map[Node]bool) + used := make(map[int]bool) for _, u := range guideLayers[len(guideLayers)-1] { slap, found := bg.findDisjointSLAP(u, matching, guideLayers, used) @@ -43,7 +48,7 @@ func (bg *BipartiteGraph) findDisjointSLAP( start Node, matching EdgeSet, guideLayers []NodeOrderedSet, - used map[Node]bool, + used map[int]bool, ) ([]Edge, bool) { return bg.findDisjointSLAPHelper(start, EdgeSet{}, len(guideLayers)-1, matching, guideLayers, used) } @@ -54,16 +59,16 @@ func (bg *BipartiteGraph) findDisjointSLAPHelper( currentLevel int, matching EdgeSet, guideLayers []NodeOrderedSet, - used map[Node]bool, + used map[int]bool, ) (EdgeSet, bool) { - used[currentNode] = true + used[currentNode.ID] = true if currentLevel == 0 { return currentSLAP, true } for _, nextNode := range guideLayers[currentLevel-1] { - if used[nextNode] { + if used[nextNode.ID] { continue } @@ -84,17 +89,17 @@ func (bg *BipartiteGraph) findDisjointSLAPHelper( currentSLAP = currentSLAP[:len(currentSLAP)-1] } - used[currentNode] = false + used[currentNode.ID] = false return nil, false } func (bg *BipartiteGraph) createSLAPGuideLayers(matching EdgeSet) (guideLayers []NodeOrderedSet) { - used := make(map[Node]bool) + used := make(map[int]bool) currentLayer := NodeOrderedSet{} for _, node := range bg.Left { if matching.Free(node) { - used[node] = true + used[node.ID] = true currentLayer = append(currentLayer, node) } } @@ -113,7 +118,7 @@ func (bg *BipartiteGraph) createSLAPGuideLayers(matching EdgeSet) (guideLayers [ if util.Odd(len(guideLayers)) { for _, leftNode := range lastLayer { for _, rightNode := range bg.Right { - if used[rightNode] { + if used[rightNode.ID] { continue } @@ -123,7 +128,7 @@ func (bg *BipartiteGraph) createSLAPGuideLayers(matching EdgeSet) (guideLayers [ } currentLayer = append(currentLayer, rightNode) - used[rightNode] = true + used[rightNode.ID] = true if matching.Free(rightNode) { done = true @@ -133,7 +138,7 @@ func (bg *BipartiteGraph) createSLAPGuideLayers(matching EdgeSet) (guideLayers [ } else { for _, rightNode := range lastLayer { for _, leftNode := range bg.Left { - if used[leftNode] { + if used[leftNode.ID] { continue } @@ -143,7 +148,7 @@ func (bg *BipartiteGraph) createSLAPGuideLayers(matching EdgeSet) (guideLayers [ } currentLayer = append(currentLayer, leftNode) - used[leftNode] = true + used[leftNode.ID] = true } } diff --git a/vendor/github.com/onsi/gomega/matchers/support/goraph/edge/edge.go b/vendor/github.com/onsi/gomega/matchers/support/goraph/edge/edge.go index 4fd15cc06..8c38411b2 100644 --- a/vendor/github.com/onsi/gomega/matchers/support/goraph/edge/edge.go +++ b/vendor/github.com/onsi/gomega/matchers/support/goraph/edge/edge.go @@ -3,15 +3,15 @@ package edge import . "github.com/onsi/gomega/matchers/support/goraph/node" type Edge struct { - Node1 Node - Node2 Node + Node1 int + Node2 int } type EdgeSet []Edge func (ec EdgeSet) Free(node Node) bool { for _, e := range ec { - if e.Node1 == node || e.Node2 == node { + if e.Node1 == node.ID || e.Node2 == node.ID { return false } } @@ -31,7 +31,7 @@ func (ec EdgeSet) Contains(edge Edge) bool { func (ec EdgeSet) FindByNodes(node1, node2 Node) (Edge, bool) { for _, e := range ec { - if (e.Node1 == node1 && e.Node2 == node2) || (e.Node1 == node2 && e.Node2 == node1) { + if (e.Node1 == node1.ID && e.Node2 == node2.ID) || (e.Node1 == node2.ID && e.Node2 == node1.ID) { return e, true } } diff --git a/vendor/github.com/onsi/gomega/matchers/support/goraph/node/node.go b/vendor/github.com/onsi/gomega/matchers/support/goraph/node/node.go index 800c2ea8c..cd597a2f2 100644 --- a/vendor/github.com/onsi/gomega/matchers/support/goraph/node/node.go +++ b/vendor/github.com/onsi/gomega/matchers/support/goraph/node/node.go @@ -1,7 +1,8 @@ package node type Node struct { - Id int + ID int + Value interface{} } type NodeOrderedSet []Node diff --git a/vendor/github.com/vbauerster/mpb/v4/bar_option.go b/vendor/github.com/vbauerster/mpb/v4/bar_option.go index bb79ac6a4..7fb152562 100644 --- a/vendor/github.com/vbauerster/mpb/v4/bar_option.go +++ b/vendor/github.com/vbauerster/mpb/v4/bar_option.go @@ -10,11 +10,10 @@ import ( // BarOption is a function option which changes the default behavior of a bar. type BarOption func(*bState) -type mergeWrapper interface { - MergeUnwrap() []decor.Decorator -} - func (s *bState) addDecorators(dest *[]decor.Decorator, decorators ...decor.Decorator) { + type mergeWrapper interface { + MergeUnwrap() []decor.Decorator + } for _, decorator := range decorators { if mw, ok := decorator.(mergeWrapper); ok { *dest = append(*dest, mw.MergeUnwrap()...) diff --git a/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go b/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go index 5c0d16880..2271cbbe1 100644 --- a/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go +++ b/vendor/github.com/vbauerster/mpb/v4/decor/decorator.go @@ -4,6 +4,8 @@ import ( "fmt" "time" "unicode/utf8" + + "github.com/acarl005/stripansi" ) const ( @@ -117,25 +119,29 @@ var ( // W represents width and C represents bit set of width related config. // A decorator should embed WC, to enable width synchronization. type WC struct { - W int - C int - dynFormat string - staticFormat string - wsync chan int + W int + C int + dynFormat string + wsync chan int } // FormatMsg formats final message according to WC.W and WC.C. // Should be called by any Decorator implementation. func (wc *WC) FormatMsg(msg string) string { + var format string + runeCount := utf8.RuneCountInString(stripansi.Strip(msg)) + ansiCount := utf8.RuneCountInString(msg) - runeCount if (wc.C & DSyncWidth) != 0 { - wc.wsync <- utf8.RuneCountInString(msg) - max := <-wc.wsync if (wc.C & DextraSpace) != 0 { - max++ + runeCount++ } - return fmt.Sprintf(fmt.Sprintf(wc.dynFormat, max), msg) + wc.wsync <- runeCount + max := <-wc.wsync + format = fmt.Sprintf(wc.dynFormat, ansiCount+max) + } else { + format = fmt.Sprintf(wc.dynFormat, ansiCount+wc.W) } - return fmt.Sprintf(wc.staticFormat, msg) + return fmt.Sprintf(format, msg) } // Init initializes width related config. @@ -145,7 +151,6 @@ func (wc *WC) Init() WC { wc.dynFormat += "-" } wc.dynFormat += "%ds" - wc.staticFormat = fmt.Sprintf(wc.dynFormat, wc.W) if (wc.C & DSyncWidth) != 0 { // it's deliberate choice to override wsync on each Init() call, // this way globals like WCSyncSpace can be reused diff --git a/vendor/github.com/vbauerster/mpb/v4/decor/merge.go b/vendor/github.com/vbauerster/mpb/v4/decor/merge.go index fdf9e107b..723869209 100644 --- a/vendor/github.com/vbauerster/mpb/v4/decor/merge.go +++ b/vendor/github.com/vbauerster/mpb/v4/decor/merge.go @@ -2,6 +2,7 @@ package decor import ( "fmt" + "strings" "unicode/utf8" ) @@ -28,10 +29,7 @@ func Merge(decorator Decorator, placeholders ...WC) Decorator { if (wc.C & DSyncWidth) == 0 { return decorator } - md.placeHolders[i] = &placeHolderDecorator{ - WC: wc.Init(), - wch: make(chan int), - } + md.placeHolders[i] = &placeHolderDecorator{wc.Init()} } return md } @@ -69,29 +67,40 @@ func (d *mergeDecorator) Base() Decorator { func (d *mergeDecorator) Decor(st *Statistics) string { msg := d.Decorator.Decor(st) msgLen := utf8.RuneCountInString(msg) - - var space int - for _, ph := range d.placeHolders { - space += <-ph.wch + if (d.wc.C & DextraSpace) != 0 { + msgLen++ } - d.wc.wsync <- msgLen - space + var total int + max := utf8.RuneCountInString(d.placeHolders[0].FormatMsg("")) + total += max + pw := (msgLen - max) / len(d.placeHolders) + rem := (msgLen - max) % len(d.placeHolders) - max := <-d.wc.wsync - if (d.wc.C & DextraSpace) != 0 { - max++ + var diff int + for i := 1; i < len(d.placeHolders); i++ { + ph := d.placeHolders[i] + width := pw - diff + if (ph.WC.C & DextraSpace) != 0 { + width-- + if width < 0 { + width = 0 + } + } + max = utf8.RuneCountInString(ph.FormatMsg(strings.Repeat(" ", width))) + total += max + diff = max - pw } - return fmt.Sprintf(fmt.Sprintf(d.wc.dynFormat, max+space), msg) + + d.wc.wsync <- pw + rem + max = <-d.wc.wsync + return fmt.Sprintf(fmt.Sprintf(d.wc.dynFormat, max+total), msg) } type placeHolderDecorator struct { WC - wch chan int } -func (d *placeHolderDecorator) Decor(st *Statistics) string { - go func() { - d.wch <- utf8.RuneCountInString(d.FormatMsg("")) - }() +func (d *placeHolderDecorator) Decor(_ *Statistics) string { return "" } diff --git a/vendor/github.com/vbauerster/mpb/v4/go.mod b/vendor/github.com/vbauerster/mpb/v4/go.mod index 0c5ce51f1..9e7287d5d 100644 --- a/vendor/github.com/vbauerster/mpb/v4/go.mod +++ b/vendor/github.com/vbauerster/mpb/v4/go.mod @@ -2,6 +2,7 @@ module github.com/vbauerster/mpb/v4 require ( github.com/VividCortex/ewma v1.1.1 + github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d golang.org/x/crypto v0.0.0-20191112222119-e1110fd1c708 golang.org/x/sys v0.0.0-20191113165036-4c7a9d0fe056 // indirect ) diff --git a/vendor/github.com/vbauerster/mpb/v4/go.sum b/vendor/github.com/vbauerster/mpb/v4/go.sum index 94a9f1a28..5a1316274 100644 --- a/vendor/github.com/vbauerster/mpb/v4/go.sum +++ b/vendor/github.com/vbauerster/mpb/v4/go.sum @@ -1,5 +1,7 @@ github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM= github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA= +github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d h1:licZJFw2RwpHMqeKTCYkitsPqHNxTmd4SNR5r94FGM8= +github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d/go.mod h1:asat636LX7Bqt5lYEZ27JNDcqxfjdBQuJ/MM4CN/Lzo= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/crypto v0.0.0-20191112222119-e1110fd1c708 h1:pXVtWnwHkrWD9ru3sDxY/qFK/bfc0egRovX91EjWjf4= golang.org/x/crypto v0.0.0-20191112222119-e1110fd1c708/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= diff --git a/vendor/github.com/vbauerster/mpb/v4/proxyreader.go b/vendor/github.com/vbauerster/mpb/v4/proxyreader.go index 736142412..0e4b51f09 100644 --- a/vendor/github.com/vbauerster/mpb/v4/proxyreader.go +++ b/vendor/github.com/vbauerster/mpb/v4/proxyreader.go @@ -18,9 +18,7 @@ func (prox *proxyReader) Read(p []byte) (n int, err error) { prox.iT = time.Now() } if err == io.EOF { - go func() { - prox.bar.SetTotal(0, true) - }() + go prox.bar.SetTotal(0, true) } return } @@ -37,9 +35,7 @@ func (prox *proxyWriterTo) WriteTo(w io.Writer) (n int64, err error) { prox.iT = time.Now() } if err == io.EOF { - go func() { - prox.bar.SetTotal(0, true) - }() + go prox.bar.SetTotal(0, true) } return } diff --git a/vendor/modules.txt b/vendor/modules.txt index 4d96788a8..771e06635 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -29,6 +29,8 @@ github.com/Microsoft/hcsshim/internal/wclayer github.com/Microsoft/hcsshim/osversion # github.com/VividCortex/ewma v1.1.1 github.com/VividCortex/ewma +# github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d +github.com/acarl005/stripansi # github.com/beorn7/perks v1.0.1 github.com/beorn7/perks/quantile # github.com/blang/semver v3.5.1+incompatible @@ -80,7 +82,7 @@ github.com/containers/common/pkg/cgroups github.com/containers/common/pkg/unshare # github.com/containers/conmon v2.0.10+incompatible github.com/containers/conmon/runner/config -# github.com/containers/image/v5 v5.1.0 +# github.com/containers/image/v5 v5.2.0 github.com/containers/image/v5/copy github.com/containers/image/v5/directory github.com/containers/image/v5/directory/explicitfilepath @@ -91,6 +93,7 @@ github.com/containers/image/v5/docker/policyconfiguration github.com/containers/image/v5/docker/reference github.com/containers/image/v5/docker/tarfile github.com/containers/image/v5/image +github.com/containers/image/v5/internal/iolimits github.com/containers/image/v5/internal/pkg/keyctl github.com/containers/image/v5/internal/tmpdir github.com/containers/image/v5/manifest @@ -138,7 +141,7 @@ github.com/containers/psgo/internal/dev github.com/containers/psgo/internal/host github.com/containers/psgo/internal/proc github.com/containers/psgo/internal/process -# github.com/containers/storage v1.15.7 +# github.com/containers/storage v1.15.8 github.com/containers/storage github.com/containers/storage/drivers github.com/containers/storage/drivers/aufs @@ -312,7 +315,7 @@ github.com/inconshreveable/mousetrap github.com/ishidawataru/sctp # github.com/json-iterator/go v1.1.9 github.com/json-iterator/go -# github.com/klauspost/compress v1.9.7 +# github.com/klauspost/compress v1.9.8 github.com/klauspost/compress/flate github.com/klauspost/compress/fse github.com/klauspost/compress/huff0 @@ -323,7 +326,7 @@ github.com/klauspost/compress/zstd/internal/xxhash github.com/klauspost/pgzip # github.com/konsorten/go-windows-terminal-sequences v1.0.2 github.com/konsorten/go-windows-terminal-sequences -# github.com/mattn/go-shellwords v1.0.7 +# github.com/mattn/go-shellwords v1.0.9 github.com/mattn/go-shellwords # github.com/matttproud/golang_protobuf_extensions v1.0.1 github.com/matttproud/golang_protobuf_extensions/pbutil @@ -337,9 +340,9 @@ github.com/modern-go/reflect2 github.com/morikuni/aec # github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618 github.com/mrunalp/fileutils -# github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c +# github.com/mtrmac/gpgme v0.1.2 github.com/mtrmac/gpgme -# github.com/onsi/ginkgo v1.11.0 +# github.com/onsi/ginkgo v1.12.0 github.com/onsi/ginkgo github.com/onsi/ginkgo/config github.com/onsi/ginkgo/extensions/table @@ -366,7 +369,7 @@ github.com/onsi/ginkgo/reporters/stenographer github.com/onsi/ginkgo/reporters/stenographer/support/go-colorable github.com/onsi/ginkgo/reporters/stenographer/support/go-isatty github.com/onsi/ginkgo/types -# github.com/onsi/gomega v1.8.1 +# github.com/onsi/gomega v1.9.0 github.com/onsi/gomega github.com/onsi/gomega/format github.com/onsi/gomega/gbytes @@ -510,7 +513,7 @@ github.com/varlink/go/varlink/idl github.com/vbatts/tar-split/archive/tar github.com/vbatts/tar-split/tar/asm github.com/vbatts/tar-split/tar/storage -# github.com/vbauerster/mpb/v4 v4.11.1 +# github.com/vbauerster/mpb/v4 v4.11.2 github.com/vbauerster/mpb/v4 github.com/vbauerster/mpb/v4/cwriter github.com/vbauerster/mpb/v4/decor |
