diff options
467 files changed, 29572 insertions, 5599 deletions
diff --git a/.cirrus.yml b/.cirrus.yml index c27b76110..8e1bf03f0 100644 --- a/.cirrus.yml +++ b/.cirrus.yml @@ -92,7 +92,7 @@ gating_task: # Runs within Cirrus's "community cluster" container: - image: "quay.io/libpod/gate:latest" + image: "quay.io/libpod/gate:master" cpu: 4 memory: 12 @@ -184,7 +184,7 @@ varlink_api_task: # Runs within Cirrus's "community cluster" container: - image: "quay.io/libpod/gate:latest" + image: "quay.io/libpod/gate:master" cpu: 4 memory: 12 @@ -273,7 +273,7 @@ meta_task: - "build_without_cgo" container: - image: "quay.io/libpod/imgts:latest" # see contrib/imgts + image: "quay.io/libpod/imgts:master" # see contrib/imgts cpu: 1 memory: 1 @@ -309,7 +309,7 @@ image_prune_task: - "meta" container: - image: "quay.io/libpod/imgprune:latest" # see contrib/imgprune + image: "quay.io/libpod/imgprune:master" # see contrib/imgprune cpu: 1 memory: 1 @@ -714,7 +714,7 @@ success_task: GOSRC: "/go/src/github.com/containers/libpod" container: - image: "quay.io/libpod/gate:latest" + image: "quay.io/libpod/gate:master" cpu: 1 memory: 1 @@ -410,6 +410,9 @@ install.man: docs install.config: install ${SELINUXOPT} -d -m 755 $(DESTDIR)$(SHAREDIR_CONTAINERS) install ${SELINUXOPT} -m 644 libpod.conf $(DESTDIR)$(SHAREDIR_CONTAINERS)/libpod.conf + +install.seccomp: + install ${SELINUXOPT} -d -m 755 $(DESTDIR)$(SHAREDIR_CONTAINERS) install ${SELINUXOPT} -m 644 seccomp.json $(DESTDIR)$(SHAREDIR_CONTAINERS)/seccomp.json install.completions: @@ -36,7 +36,7 @@ This project tests all builds against each supported version of Fedora, the late ## Communications -If you think you've identified a security issue in the project, please *DO NOT* report the issue publically via the Github issue tracker, mailing list, or IRC. +If you think you've identified a security issue in the project, please *DO NOT* report the issue publicly via the Github issue tracker, mailing list, or IRC. Instead, send an email with as many details as possible to `security@lists.podman.io`. This is a private mailing list for the core maintainers. For general questions and discussion, please use the diff --git a/RELEASE_NOTES.md b/RELEASE_NOTES.md index cefad25f4..c16be818a 100644 --- a/RELEASE_NOTES.md +++ b/RELEASE_NOTES.md @@ -154,7 +154,7 @@ ## 1.5.0 ### Features -- Podman containers can now join the user namespaces of other containers with `--userns=container:$ID`, or a user namespace at an arbitary path with `--userns=ns:$PATH` +- Podman containers can now join the user namespaces of other containers with `--userns=container:$ID`, or a user namespace at an arbitrary path with `--userns=ns:$PATH` - Rootless Podman can experimentally squash all UIDs and GIDs in an image to a single UID and GID (which does not require use of the `newuidmap` and `newgidmap` executables) by passing `--storage-opt ignore_chown_errors` - The `podman generate kube` command now produces YAML for any bind mounts the container has created ([#2303](https://github.com/containers/libpod/issues/2303)) - The `podman container restore` command now features a new flag, `--ignore-static-ip`, that can be used with `--import` to import a single container with a static IP multiple times on the same host @@ -230,7 +230,7 @@ ## 1.4.3 ### Features - Podman now has greatly improved support for containers using multiple OCI runtimes. Containers now remember if they were created with a different runtime using `--runtime` and will always use that runtime -- The `cached` and `delegated` options for volume mounts are now allowed for Docker compatability ([#3340](https://github.com/containers/libpod/issues/3340)) +- The `cached` and `delegated` options for volume mounts are now allowed for Docker compatibility ([#3340](https://github.com/containers/libpod/issues/3340)) - The `podman diff` command now supports the `--latest` flag ### Bugfixes @@ -243,7 +243,7 @@ ### Misc - Podman now performs much better on systems with heavy I/O load - The `--cgroup-manager` flag to `podman` now shows the correct default setting in help if the default was overridden by `libpod.conf` -- For backwards compatability, setting `--log-driver=json-file` in `podman run` is now supported as an alias for `--log-driver=k8s-file`. This is considered deprecated, and `json-file` will be moved to a new implementation in the future ([#3363](https://github.com/containers/libpod/issues/3363)) +- For backwards compatibility, setting `--log-driver=json-file` in `podman run` is now supported as an alias for `--log-driver=k8s-file`. This is considered deprecated, and `json-file` will be moved to a new implementation in the future ([#3363](https://github.com/containers/libpod/issues/3363)) - Podman's default `libpod.conf` file now allows the [crun](https://github.com/giuseppe/crun) OCI runtime to be used if it is installed ## 1.4.2 @@ -297,7 +297,7 @@ - Fixed a bug where `podman exec` would fail on older kernels ([#2968](https://github.com/containers/libpod/issues/2968)) ### Misc -- The `podman inspect` command on containers now uses the `Id` key (instead of `ID`) for the container's ID, for better compatability with the output of `docker inspect` +- The `podman inspect` command on containers now uses the `Id` key (instead of `ID`) for the container's ID, for better compatibility with the output of `docker inspect` - The `podman commit` command is now usable with the Podman remote client - The `--signature-policy` flag (used with several image-related commands) has been deprecated - The `podman unshare` command now defines two environment variables in the spawned shell: `CONTAINERS_RUNROOT` and `CONTAINERS_GRAPHROOT`, pointing to temporary and permanent storage for rootless containers @@ -379,7 +379,7 @@ - The Podman remote client now builds on Windows - A major refactor of volumes created using the `podman volume` command was performed. There should be no major user-facing changes, but downgrading from Podman 1.3 to previous versions may render some volumes unable to be removed. - The `podman events` command now logs events to journald by default. The old behavior (log to file) can be configured in podman.conf via the `events_logger` option -- The `podman commit` command, in versions 1.2 and earlier, included all volumes mounted into the container as image volumes in the committed image. This behavior was incorrect and has been disabled by default; it can be reenabled with the `--include-volumes` flag +- The `podman commit` command, in versions 1.2 and earlier, included all volumes mounted into the container as image volumes in the committed image. This behavior was incorrect and has been disabled by default; it can be re-enabled with the `--include-volumes` flag ## 1.2.0 @@ -529,7 +529,7 @@ - Fixed a bug where detaching from a container using the detach keys would cause Podman to hang until the container exited - Fixed a bug where `podman create --rm` did not work with `podman start --attach` - Fixed a bug where invalid named volumes specified in `podman create` and `podman run` could cause segfaults ([#2301](https://github.com/containers/libpod/issues/2301)) -- Fixed a bug where the `runtime` field in `libpod.conf` was being ignored. `runtime` is legacy and deprecated, but will continue to be respected for the forseeable future +- Fixed a bug where the `runtime` field in `libpod.conf` was being ignored. `runtime` is legacy and deprecated, but will continue to be respected for the foreseeable future - Fixed a bug where `podman login` would sometimes report it logged in successfully when it did not - Fixed a bug where `podman pod create` would not error on receiving unused CLI argument - Fixed a bug where rootless `podman run` with the `--pod` argument would fail if the pod was stopped @@ -554,7 +554,7 @@ - `podman rm` can now delete containers in containers/storage, which can be used to resolve some situations where Podman fails to remove a container - The `podman search` command now searches multiple registries in parallel for improved performance - The `podman build` command now defaults `--pull-always` to true -- Containers which share a network namespace (for example, when in a pod) will now share /etc/hosts and /etc/resolv.conf between all containers in the pod, causing changes in one container to propogate to all containers sharing their networks +- Containers which share a network namespace (for example, when in a pod) will now share /etc/hosts and /etc/resolv.conf between all containers in the pod, causing changes in one container to propagate to all containers sharing their networks - The `podman rm` and `podman rmi` commands now return 1 (instead of 127) when all specified container or images are missing ## 1.0.0 @@ -593,7 +593,7 @@ - The `podman info` command now prints the path of the configuration file controlling container storage - Added `podman list` and `podman ls` as aliases for `podman ps`, and `podman container ps` and `podman container list` as aliases for `podman container ls` - Changed `podman generate kube` to generate Kubernetes service YAML in the same file as pod YAML, generating a single file instead of two -- To improve compatability with the Docker command line, `podman inspect -f '{{ json .ContainerConfig }}'` on images is no longer valid; please use `podman inspect -f '{{ json .Config }}'` instead +- To improve compatibility with the Docker command line, `podman inspect -f '{{ json .ContainerConfig }}'` on images is no longer valid; please use `podman inspect -f '{{ json .Config }}'` instead ## 0.12.1.2 ### Bugfixes @@ -626,7 +626,7 @@ ### Bugfixes - Fixed a breaking change in rootless Podman where a change in default paths caused Podman to be unable to function on systems upgraded from 0.10.x or earlier - Fixed a bug where `podman exec` without `-t` would still use a terminal if the container was created with `-t` -- Fixed a bug where container root propogation was not being properly adjusted if volumes with root propogation set were mounted into the container +- Fixed a bug where container root propagation was not being properly adjusted if volumes with root propagation set were mounted into the container - Fixed a bug where `podman exec` could hold the container lock longer than necessary waiting for an exited container - Fixed a bug where rootless containers using `slirp4netns` for networking were reporting using `bridge` networking in `podman inspect` - Fixed a bug where `podman container restore -a` was attempting to restore all containers, including created and running ones. It will now only attempt to restore stopped and exited containers @@ -692,7 +692,7 @@ - Changed default location of temporary libpod files in rootless Podman - Updated the default Podman seccomp profile -### Compatability +### Compatibility Several paths related to rootless Podman had their default values changed in this release. If paths were not hardcoded in libpod.conf, your system may lose track of running containers and believe they are newly-created. @@ -730,7 +730,7 @@ If paths were not hardcoded in libpod.conf, your system may lose track of runnin - Fixed an issue with rootless Podman not properly detecting when user namespaces were not enabled - Fixed an issue where Podman user namespaces were not preserving file capabilities - Fixed an issue where `resolv.conf` in container would unconditionally forward nameservers into the container, even localhost -- Fixed containers to release resources in the OCI runtime immediately after exiting, improving compatability with Kata containers +- Fixed containers to release resources in the OCI runtime immediately after exiting, improving compatibility with Kata containers - Fixed OCI runtime handling to fix several issues when using gVisor as an OCI runtime - Fixed SELinux relabel errors when starting containers after a system restart - Fixed a crash when initializing hooks on containers running systemd as init @@ -786,10 +786,10 @@ If paths were not hardcoded in libpod.conf, your system may lose track of runnin - Fixed rootless `podman create` with no command specified throwing an error ### Misc -- Added `podman rm --volumes` flag for compatability with Docker. As Podman does not presently support named volumes, this does nothing for now, but provides improved compatability with the Docker command line. +- Added `podman rm --volumes` flag for compatibility with Docker. As Podman does not presently support named volumes, this does nothing for now, but provides improved compatibility with the Docker command line. - Improved error messages from `podman pull` -### Compatability +### Compatibility - Podman is no longer being built by default with support for the Devicemapper storage driver. If you are using this storage driver, you should investigate switching to overlayfs. ## 0.9.1.1 @@ -848,6 +848,6 @@ It is recommended that you restart your system firewall after installing this re - Fixed issues with Apparmor in rootless containers - Fixed an issue with database encoding causing some containers created by Podman versions 0.8.1 and below to be unusable. -### Compatability: -We switched JSON encoding/decoding to a new library for this release to address a compatability issue introduced by v0.8.2. +### Compatibility: +We switched JSON encoding/decoding to a new library for this release to address a compatibility issue introduced by v0.8.2. However, this may cause issues with containers created in 0.8.2 and 0.8.3 with custom DNS servers. diff --git a/cmd/podman/attach.go b/cmd/podman/attach.go index b03673f29..eeedea8c8 100644 --- a/cmd/podman/attach.go +++ b/cmd/podman/attach.go @@ -37,7 +37,7 @@ func init() { flags.BoolVar(&attachCommand.SigProxy, "sig-proxy", true, "Proxy received signals to the process") flags.BoolVarP(&attachCommand.Latest, "latest", "l", false, "Act on the latest container podman is aware of") markFlagHiddenForRemoteClient("latest", flags) - // TODO allow for passing of a new deatch keys + // TODO allow for passing of a new detach keys markFlagHiddenForRemoteClient("detach-keys", flags) } diff --git a/cmd/podman/checkpoint.go b/cmd/podman/checkpoint.go index 22cdb1f39..07db519f8 100644 --- a/cmd/podman/checkpoint.go +++ b/cmd/podman/checkpoint.go @@ -26,7 +26,7 @@ var ( return checkpointCmd(&checkpointCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman container checkpoint --keep ctrID podman container checkpoint --all diff --git a/cmd/podman/cleanup.go b/cmd/podman/cleanup.go index c00654162..a8bc0c116 100644 --- a/cmd/podman/cleanup.go +++ b/cmd/podman/cleanup.go @@ -27,7 +27,7 @@ var ( return cleanupCmd(&cleanupCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman container cleanup --latest podman container cleanup ctrID1 ctrID2 ctrID3 diff --git a/cmd/podman/cliconfig/config.go b/cmd/podman/cliconfig/config.go index 158306ccc..745f49651 100644 --- a/cmd/podman/cliconfig/config.go +++ b/cmd/podman/cliconfig/config.go @@ -482,11 +482,12 @@ type RestoreValues struct { type RmValues struct { PodmanCommand - All bool - Force bool - Latest bool - Storage bool - Volumes bool + All bool + Force bool + Latest bool + Storage bool + Volumes bool + CIDFiles []string } type RmiValues struct { @@ -559,9 +560,10 @@ type StatsValues struct { type StopValues struct { PodmanCommand - All bool - Latest bool - Timeout uint + All bool + Latest bool + Timeout uint + CIDFiles []string } type TopValues struct { diff --git a/cmd/podman/common.go b/cmd/podman/common.go index 4db043f31..442823d2d 100644 --- a/cmd/podman/common.go +++ b/cmd/podman/common.go @@ -39,24 +39,45 @@ func shortID(id string) string { return id } -// checkAllAndLatest checks that --all and --latest are used correctly -func checkAllAndLatest(c *cobra.Command, args []string, ignoreArgLen bool) error { +// checkAllLatestAndCIDFile checks that --all and --latest are used correctly. +// If cidfile is set, also check for the --cidfile flag. +func checkAllLatestAndCIDFile(c *cobra.Command, args []string, ignoreArgLen bool, cidfile bool) error { argLen := len(args) if c.Flags().Lookup("all") == nil || c.Flags().Lookup("latest") == nil { - return errors.New("unable to lookup values for 'latest' or 'all'") + if !cidfile { + return errors.New("unable to lookup values for 'latest' or 'all'") + } else if c.Flags().Lookup("cidfile") == nil { + return errors.New("unable to lookup values for 'latest', 'all' or 'cidfile'") + } + } + + specifiedAll, _ := c.Flags().GetBool("all") + specifiedLatest, _ := c.Flags().GetBool("latest") + specifiedCIDFile := false + if cid, _ := c.Flags().GetStringArray("cidfile"); len(cid) > 0 { + specifiedCIDFile = true } - all, _ := c.Flags().GetBool("all") - latest, _ := c.Flags().GetBool("latest") - if all && latest { + + if specifiedCIDFile && (specifiedAll || specifiedLatest) { + return errors.Errorf("--all, --latest and --cidfile cannot be used together") + } else if specifiedAll && specifiedLatest { return errors.Errorf("--all and --latest cannot be used together") } + if ignoreArgLen { return nil } - if (all || latest) && argLen > 0 { + if (argLen > 0) && (specifiedAll || specifiedLatest) { return errors.Errorf("no arguments are needed with --all or --latest") + } else if cidfile && (argLen > 0) && (specifiedAll || specifiedLatest || specifiedCIDFile) { + return errors.Errorf("no arguments are needed with --all, --latest or --cidfile") } - if argLen < 1 && !all && !latest { + + if specifiedCIDFile { + return nil + } + + if argLen < 1 && !specifiedAll && !specifiedLatest && !specifiedCIDFile { return errors.Errorf("you must provide at least one name or id") } return nil diff --git a/cmd/podman/cp.go b/cmd/podman/cp.go index c53a97df3..762d70252 100644 --- a/cmd/podman/cp.go +++ b/cmd/podman/cp.go @@ -192,7 +192,7 @@ func copyBetweenHostAndContainer(runtime *libpod.Runtime, src string, dest strin } else if isBindMount, mount := isBindMountDestName(srcPath, ctr); isBindMount { path, err := pathWithBindMountSource(mount, srcPath) if err != nil { - return errors.Wrapf(err, "error getting source path from bind moutn %s", mount.Destination) + return errors.Wrapf(err, "error getting source path from bind mount %s", mount.Destination) } srcPath = path } else if filepath.IsAbs(srcPath) { diff --git a/cmd/podman/init.go b/cmd/podman/init.go index 3f97824fc..2e0b33828 100644 --- a/cmd/podman/init.go +++ b/cmd/podman/init.go @@ -23,7 +23,7 @@ var ( return initCmd(&initCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman init --latest podman init 3c45ef19d893 diff --git a/cmd/podman/kill.go b/cmd/podman/kill.go index d5056d86d..aba2008ca 100644 --- a/cmd/podman/kill.go +++ b/cmd/podman/kill.go @@ -24,7 +24,7 @@ var ( return killCmd(&killCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman kill mywebserver podman kill 860a4b23 diff --git a/cmd/podman/libpodruntime/runtime.go b/cmd/podman/libpodruntime/runtime.go index dd8c3f173..9425cfb9c 100644 --- a/cmd/podman/libpodruntime/runtime.go +++ b/cmd/podman/libpodruntime/runtime.go @@ -157,7 +157,7 @@ func getRuntime(ctx context.Context, c *cliconfig.PodmanCommand, renumber, migra // TODO flag to set CNI plugins dir? - // TODO I dont think these belong here? + // TODO I don't think these belong here? // Will follow up with a different PR to address // // Pod create options diff --git a/cmd/podman/main_local.go b/cmd/podman/main_local.go index f630f1210..0484e3cf0 100644 --- a/cmd/podman/main_local.go +++ b/cmd/podman/main_local.go @@ -64,7 +64,7 @@ func init() { rootCmd.PersistentFlags().StringVar(&MainGlobalOpts.Root, "root", "", "Path to the root directory in which data, including images, is stored") rootCmd.PersistentFlags().StringVar(&MainGlobalOpts.Runroot, "runroot", "", "Path to the 'run directory' where all state information is stored") rootCmd.PersistentFlags().StringVar(&MainGlobalOpts.Runtime, "runtime", "", "Path to the OCI-compatible binary used to run containers, default is /usr/bin/runc") - // -s is depracated due to conflict with -s on subcommands + // -s is deprecated due to conflict with -s on subcommands rootCmd.PersistentFlags().StringVar(&MainGlobalOpts.StorageDriver, "storage-driver", "", "Select which storage driver is used to manage storage of images and containers (default is overlay)") rootCmd.PersistentFlags().StringArrayVar(&MainGlobalOpts.StorageOpts, "storage-opt", []string{}, "Used to pass an option to the storage driver") rootCmd.PersistentFlags().BoolVar(&MainGlobalOpts.Syslog, "syslog", false, "Output logging information to syslog as well as the console") diff --git a/cmd/podman/mount.go b/cmd/podman/mount.go index b14827592..526a236fd 100644 --- a/cmd/podman/mount.go +++ b/cmd/podman/mount.go @@ -35,7 +35,7 @@ var ( return mountCmd(&mountCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, true) + return checkAllLatestAndCIDFile(cmd, args, true, false) }, } ) diff --git a/cmd/podman/pod_kill.go b/cmd/podman/pod_kill.go index 9bda77471..064946f72 100644 --- a/cmd/podman/pod_kill.go +++ b/cmd/podman/pod_kill.go @@ -28,7 +28,7 @@ var ( return podKillCmd(&podKillCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod kill podID podman pod kill --signal TERM mywebserver diff --git a/cmd/podman/pod_pause.go b/cmd/podman/pod_pause.go index 45e1319ff..320072919 100644 --- a/cmd/podman/pod_pause.go +++ b/cmd/podman/pod_pause.go @@ -25,7 +25,7 @@ var ( return podPauseCmd(&podPauseCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod pause podID1 podID2 podman pod pause --latest diff --git a/cmd/podman/pod_restart.go b/cmd/podman/pod_restart.go index cc090bd6e..cb9f3770f 100644 --- a/cmd/podman/pod_restart.go +++ b/cmd/podman/pod_restart.go @@ -26,7 +26,7 @@ var ( return podRestartCmd(&podRestartCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod restart podID1 podID2 podman pod restart --latest diff --git a/cmd/podman/pod_rm.go b/cmd/podman/pod_rm.go index 82d0eb977..86d6d2f27 100644 --- a/cmd/podman/pod_rm.go +++ b/cmd/podman/pod_rm.go @@ -26,7 +26,7 @@ var ( return podRmCmd(&podRmCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod rm mywebserverpod podman pod rm -f 860a4b23 diff --git a/cmd/podman/pod_start.go b/cmd/podman/pod_start.go index 64c951b43..aa2e09e98 100644 --- a/cmd/podman/pod_start.go +++ b/cmd/podman/pod_start.go @@ -26,7 +26,7 @@ var ( return podStartCmd(&podStartCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod start podID podman pod start --latest diff --git a/cmd/podman/pod_stop.go b/cmd/podman/pod_stop.go index edda99550..579e4f1d3 100644 --- a/cmd/podman/pod_stop.go +++ b/cmd/podman/pod_stop.go @@ -27,7 +27,7 @@ var ( return podStopCmd(&podStopCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod stop mywebserverpod podman pod stop --latest diff --git a/cmd/podman/pod_unpause.go b/cmd/podman/pod_unpause.go index 833434c3f..1f80a7c79 100644 --- a/cmd/podman/pod_unpause.go +++ b/cmd/podman/pod_unpause.go @@ -26,7 +26,7 @@ var ( return podUnpauseCmd(&podUnpauseCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman pod unpause podID1 podID2 podman pod unpause --all diff --git a/cmd/podman/port.go b/cmd/podman/port.go index 4e1f9642c..eef3d4b1d 100644 --- a/cmd/podman/port.go +++ b/cmd/podman/port.go @@ -26,7 +26,7 @@ var ( return portCmd(&portCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, true) + return checkAllLatestAndCIDFile(cmd, args, true, false) }, Example: `podman port --all podman port ctrID 80/tcp diff --git a/cmd/podman/remoteclientconfig/configfile_test.go b/cmd/podman/remoteclientconfig/configfile_test.go index 0bcac29a8..1710ee83f 100644 --- a/cmd/podman/remoteclientconfig/configfile_test.go +++ b/cmd/podman/remoteclientconfig/configfile_test.go @@ -88,7 +88,7 @@ func TestReadRemoteConfig(t *testing.T) { {"good", args{reader: strings.NewReader(goodConfig)}, makeGoodResult(), false}, // a connection with no destination is an error {"nodest", args{reader: strings.NewReader(noDest)}, nil, true}, - // a connnection with no user is OK + // a connection with no user is OK {"nouser", args{reader: strings.NewReader(noUser)}, makeNoUserResult(), false}, } for _, tt := range tests { diff --git a/cmd/podman/restart.go b/cmd/podman/restart.go index c97fb0dc1..996a9f7ce 100644 --- a/cmd/podman/restart.go +++ b/cmd/podman/restart.go @@ -23,7 +23,7 @@ var ( return restartCmd(&restartCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman restart ctrID podman restart --latest diff --git a/cmd/podman/restore.go b/cmd/podman/restore.go index caefadb6d..a8db7fa94 100644 --- a/cmd/podman/restore.go +++ b/cmd/podman/restore.go @@ -26,7 +26,7 @@ var ( return restoreCmd(&restoreCommand, cmd) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, true) + return checkAllLatestAndCIDFile(cmd, args, true, false) }, Example: `podman container restore ctrID podman container restore --latest diff --git a/cmd/podman/rm.go b/cmd/podman/rm.go index 6329a9d8e..b3bc8e1b9 100644 --- a/cmd/podman/rm.go +++ b/cmd/podman/rm.go @@ -25,7 +25,7 @@ var ( return rmCmd(&rmCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, true) }, Example: `podman rm imageID podman rm mywebserver myflaskserver 860a4b23 @@ -44,8 +44,10 @@ func init() { flags.BoolVarP(&rmCommand.Latest, "latest", "l", false, "Act on the latest container podman is aware of") flags.BoolVar(&rmCommand.Storage, "storage", false, "Remove container from storage library") flags.BoolVarP(&rmCommand.Volumes, "volumes", "v", false, "Remove anonymous volumes associated with the container") + flags.StringArrayVarP(&rmCommand.CIDFiles, "cidfile", "", nil, "Read the container ID from the file") markFlagHiddenForRemoteClient("storage", flags) markFlagHiddenForRemoteClient("latest", flags) + markFlagHiddenForRemoteClient("cidfile", flags) } // rmCmd removes one or more containers @@ -58,8 +60,8 @@ func rmCmd(c *cliconfig.RmValues) error { // Storage conflicts with --all/--latest/--volumes if c.Storage { - if c.All || c.Latest || c.Volumes { - return errors.Errorf("--storage conflicts with --volumes, --all, and --latest") + if c.All || c.Latest || c.Volumes || c.CIDFiles != nil { + return errors.Errorf("--storage conflicts with --volumes, --all, --latest and --cidfile") } } diff --git a/cmd/podman/shared/container.go b/cmd/podman/shared/container.go index bc64d63a9..f49943477 100644 --- a/cmd/podman/shared/container.go +++ b/cmd/podman/shared/container.go @@ -453,7 +453,7 @@ func PBatch(containers []*libpod.Container, workers int, opts PsOptions) []PsCon psResults := []PsContainerOutput{} // If the number of containers in question is less than the number of - // proposed parallel operations, we shouldnt spawn so many workers. + // proposed parallel operations, we shouldn't spawn so many workers. if workers > len(containers) { workers = len(containers) } @@ -694,7 +694,7 @@ func portsToString(ports []ocicni.PortMapping) string { portgroup, ok := portGroupMap[portMapKey] if !ok { portGroupMap[portMapKey] = &portGroup{first: v.ContainerPort, last: v.ContainerPort} - // This list is required to travese portGroupMap. + // This list is required to traverse portGroupMap. groupKeyList = append(groupKeyList, portMapKey) continue } diff --git a/cmd/podman/shared/create.go b/cmd/podman/shared/create.go index c7ea2e389..bb4e9cd12 100644 --- a/cmd/podman/shared/create.go +++ b/cmd/podman/shared/create.go @@ -7,6 +7,7 @@ import ( "io" "os" "path/filepath" + goruntime "runtime" "strconv" "strings" "syscall" @@ -88,9 +89,11 @@ func CreateContainer(ctx context.Context, c *GenericCLIResults, runtime *libpod. return nil, nil, err } + overrideOS := c.String("override-os") + overrideArch := c.String("override-arch") dockerRegistryOptions := image.DockerRegistryOptions{ - OSChoice: c.String("override-os"), - ArchitectureChoice: c.String("override-arch"), + OSChoice: overrideOS, + ArchitectureChoice: overrideArch, } newImage, err := runtime.ImageRuntime().New(ctx, name, rtc.SignaturePolicyPath, c.String("authfile"), writer, &dockerRegistryOptions, image.SigningOptions{}, nil, pullType) @@ -101,6 +104,15 @@ func CreateContainer(ctx context.Context, c *GenericCLIResults, runtime *libpod. if err != nil { return nil, nil, err } + + if overrideOS == "" && data.Os != goruntime.GOOS { + return nil, nil, errors.Errorf("incompatible image OS %q on %q host", data.Os, goruntime.GOOS) + } + + if overrideArch == "" && data.Architecture != goruntime.GOARCH { + return nil, nil, errors.Errorf("incompatible image architecture %q on %q host", data.Architecture, goruntime.GOARCH) + } + names := newImage.Names() if len(names) > 0 { imageName = names[0] @@ -111,7 +123,7 @@ func CreateContainer(ctx context.Context, c *GenericCLIResults, runtime *libpod. // if the user disabled the healthcheck with "none", we skip adding it healthCheckCommandInput := c.String("healthcheck-command") - // the user didnt disable the healthcheck but did pass in a healthcheck command + // the user didn't disable the healthcheck but did pass in a healthcheck command // now we need to make a healthcheck from the commandline input if healthCheckCommandInput != "none" { if len(healthCheckCommandInput) > 0 { @@ -214,24 +226,24 @@ func configureEntrypoint(c *GenericCLIResults, data *inspect.ImageData) []string return entrypoint } -func configurePod(c *GenericCLIResults, runtime *libpod.Runtime, namespaces map[string]string, podName string) (map[string]string, error) { +func configurePod(c *GenericCLIResults, runtime *libpod.Runtime, namespaces map[string]string, podName string) (map[string]string, string, error) { pod, err := runtime.LookupPod(podName) if err != nil { - return namespaces, err + return namespaces, "", err } podInfraID, err := pod.InfraContainerID() if err != nil { - return namespaces, err + return namespaces, "", err } hasUserns := false if podInfraID != "" { podCtr, err := runtime.GetContainer(podInfraID) if err != nil { - return namespaces, err + return namespaces, "", err } mappings, err := podCtr.IDMappings() if err != nil { - return namespaces, err + return namespaces, "", err } hasUserns = len(mappings.UIDMap) > 0 } @@ -251,7 +263,7 @@ func configurePod(c *GenericCLIResults, runtime *libpod.Runtime, namespaces map[ if (namespaces["uts"] == cc.Pod) || (!c.IsSet("uts") && pod.SharesUTS()) { namespaces["uts"] = fmt.Sprintf("container:%s", podInfraID) } - return namespaces, nil + return namespaces, podInfraID, nil } // Parses CLI options related to container creation into a config which can be @@ -359,6 +371,10 @@ func ParseCreateOpts(ctx context.Context, c *GenericCLIResults, runtime *libpod. if len(podName) < 1 && c.IsSet("pod") { return nil, errors.Errorf("new pod name must be at least one character") } + + // If we are adding a container to a pod, we would like to add an annotation for the infra ID + // so kata containers can share VMs inside the pod + var podInfraID string if c.IsSet("pod") { if strings.HasPrefix(originalPodName, "new:") { // pod does not exist; lets make it @@ -387,7 +403,7 @@ func ParseCreateOpts(ctx context.Context, c *GenericCLIResults, runtime *libpod. // The container now cannot have port bindings; so we reset the map portBindings = make(map[nat.Port][]nat.PortBinding) } - namespaces, err = configurePod(c, runtime, namespaces, podName) + namespaces, podInfraID, err = configurePod(c, runtime, namespaces, podName) if err != nil { return nil, err } @@ -485,12 +501,26 @@ func ParseCreateOpts(ctx context.Context, c *GenericCLIResults, runtime *libpod. // ANNOTATIONS annotations := make(map[string]string) + // First, add our default annotations - annotations[ann.ContainerType] = "sandbox" annotations[ann.TTY] = "false" if tty { annotations[ann.TTY] = "true" } + + // in the event this container is in a pod, and the pod has an infra container + // we will want to configure it as a type "container" instead defaulting to + // the behavior of a "sandbox" container + // In Kata containers: + // - "sandbox" is the annotation that denotes the container should use its own + // VM, which is the default behavior + // - "container" denotes the container should join the VM of the SandboxID + // (the infra container) + if podInfraID != "" { + annotations[ann.SandboxID] = podInfraID + annotations[ann.ContainerType] = ann.ContainerTypeContainer + } + if data != nil { // Next, add annotations from the image for key, value := range data.Annotations { diff --git a/cmd/podman/shared/parallel.go b/cmd/podman/shared/parallel.go index e6ce50f95..eb1d40073 100644 --- a/cmd/podman/shared/parallel.go +++ b/cmd/podman/shared/parallel.go @@ -72,7 +72,7 @@ func ParallelExecuteWorkerPool(workers int, functions []ParallelWorkerInput) (ma } // Parallelize provides the maximum number of parallel workers (int) as calculated by a basic -// heuristic. This can be overriden by the --max-workers primary switch to podman. +// heuristic. This can be overridden by the --max-workers primary switch to podman. func Parallelize(job string) int { numCpus := runtime.NumCPU() switch job { diff --git a/cmd/podman/shared/parse/parse_test.go b/cmd/podman/shared/parse/parse_test.go index 0a221c244..1359076a0 100644 --- a/cmd/podman/shared/parse/parse_test.go +++ b/cmd/podman/shared/parse/parse_test.go @@ -82,8 +82,8 @@ func TestValidateFileName(t *testing.T) { args args wantErr bool }{ - {name: "good", args: args{filename: "/som/rand/path"}, wantErr: false}, - {name: "good", args: args{filename: "som/rand/path"}, wantErr: false}, + {name: "good", args: args{filename: "/some/rand/path"}, wantErr: false}, + {name: "good", args: args{filename: "some/rand/path"}, wantErr: false}, {name: "good", args: args{filename: "/"}, wantErr: false}, {name: "bad", args: args{filename: "/:"}, wantErr: true}, {name: "bad", args: args{filename: ":/"}, wantErr: true}, diff --git a/cmd/podman/shared/workers.go b/cmd/podman/shared/workers.go index b6e3f10e7..a9d6bb77e 100644 --- a/cmd/podman/shared/workers.go +++ b/cmd/podman/shared/workers.go @@ -106,7 +106,7 @@ func (p *Pool) newWorker(slot int) { } // DefaultPoolSize provides the maximum number of parallel workers (int) as calculated by a basic -// heuristic. This can be overriden by the --max-workers primary switch to podman. +// heuristic. This can be overridden by the --max-workers primary switch to podman. func DefaultPoolSize(name string) int { numCpus := runtime.NumCPU() switch name { diff --git a/cmd/podman/stats.go b/cmd/podman/stats.go index f8c476386..f53e09412 100644 --- a/cmd/podman/stats.go +++ b/cmd/podman/stats.go @@ -128,7 +128,7 @@ func statsCmd(c *cliconfig.StatsValues) error { for _, ctr := range ctrs { initialStats, err := ctr.GetContainerStats(&libpod.ContainerStats{}) if err != nil { - // when doing "all", dont worry about containers that are not running + // when doing "all", don't worry about containers that are not running cause := errors.Cause(err) if c.All && (cause == define.ErrCtrRemoved || cause == define.ErrNoSuchCtr || cause == define.ErrCtrStateInvalid) { continue diff --git a/cmd/podman/stop.go b/cmd/podman/stop.go index e04d8a12b..acecb298e 100644 --- a/cmd/podman/stop.go +++ b/cmd/podman/stop.go @@ -25,7 +25,7 @@ var ( return stopCmd(&stopCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, true) }, Example: `podman stop ctrID podman stop --latest @@ -42,7 +42,9 @@ func init() { flags.BoolVarP(&stopCommand.Latest, "latest", "l", false, "Act on the latest container podman is aware of") flags.UintVar(&stopCommand.Timeout, "time", define.CtrRemoveTimeout, "Seconds to wait for stop before killing the container") flags.UintVarP(&stopCommand.Timeout, "timeout", "t", define.CtrRemoveTimeout, "Seconds to wait for stop before killing the container") + flags.StringArrayVarP(&stopCommand.CIDFiles, "cidfile", "", nil, "Read the container ID from the file") markFlagHiddenForRemoteClient("latest", flags) + markFlagHiddenForRemoteClient("cidfile", flags) } // stopCmd stops a container or containers diff --git a/cmd/podman/tree.go b/cmd/podman/tree.go index 904a0d375..cb1b3fc9c 100644 --- a/cmd/podman/tree.go +++ b/cmd/podman/tree.go @@ -115,7 +115,7 @@ func printImageChildren(layerMap map[string]*image.LayerInfo, layerID string, pr // add continueItem i.e. '|' for next iteration prefix prefix = prefix + continueItem } else if len(ll.ChildID) > 1 || len(ll.ChildID) == 0 { - // The above condition ensure, alignment happens for node, which has more then 1 childern. + // The above condition ensure, alignment happens for node, which has more then 1 children. // If node is last in printing hierarchy, it should not be printed as middleItem i.e. ├── intend = lastItem prefix = prefix + " " diff --git a/cmd/podman/umount.go b/cmd/podman/umount.go index c3d81d3a8..6ad485c2c 100644 --- a/cmd/podman/umount.go +++ b/cmd/podman/umount.go @@ -28,7 +28,7 @@ var ( return umountCmd(&umountCommand) }, Args: func(cmd *cobra.Command, args []string) error { - return checkAllAndLatest(cmd, args, false) + return checkAllLatestAndCIDFile(cmd, args, false, false) }, Example: `podman umount ctrID podman umount ctrID1 ctrID2 ctrID3 diff --git a/completions/bash/podman b/completions/bash/podman index 4d552b0a7..98950799e 100644 --- a/completions/bash/podman +++ b/completions/bash/podman @@ -1244,6 +1244,7 @@ _podman_build() { --no-cache --pull --pull-always + --pull-never --quiet -q --rm @@ -2004,7 +2005,7 @@ _podman_container_run() { return ;; --env|-e) - # we do not append a "=" here because "-e VARNAME" is legal systax, too + # we do not append a "=" here because "-e VARNAME" is legal syntax, too COMPREPLY=( $( compgen -e -- "$cur" ) ) __podman_nospace return @@ -2149,6 +2150,7 @@ _podman_rm() { local boolean_options=" --all -a + --cidfile --force -f --help @@ -2425,6 +2427,7 @@ _podman_stop() { local boolean_options=" --all -a + --cidfile -h --help --latest diff --git a/completions/zsh/_podman b/completions/zsh/_podman index 530649c0c..228498066 100644 --- a/completions/zsh/_podman +++ b/completions/zsh/_podman @@ -2,7 +2,7 @@ # To get zsh to reread this file: unset -f _podman;rm -f ~/.zcompdump;compinit -# On rereads, reset cache. (Not that the cacheing works, but some day it might) +# On rereads, reset cache. (Not that the caching works, but some day it might) unset -m '_podman_*' ############################################################################### diff --git a/contrib/cirrus/lib.sh b/contrib/cirrus/lib.sh index 297ed49ce..2e43a59f6 100644 --- a/contrib/cirrus/lib.sh +++ b/contrib/cirrus/lib.sh @@ -12,7 +12,7 @@ HOME="$(getent passwd $USER | cut -d : -f 6)" [[ -n "$UID" ]] || UID=$(getent passwd $USER | cut -d : -f 3) GID=$(getent passwd $USER | cut -d : -f 4) -# Essential default paths, many are overriden when executing under Cirrus-CI +# Essential default paths, many are overridden when executing under Cirrus-CI export GOPATH="${GOPATH:-/var/tmp/go}" if type -P go &> /dev/null then @@ -82,7 +82,7 @@ PERIODIC_APT_RE='^(APT::Periodic::.+")1"\;' LILTO="timeout_attempt_delay_command 24s 5 30s" BIGTO="timeout_attempt_delay_command 300s 5 30s" -# Safe env. vars. to transfer from root -> $ROOTLESS_USER (go env handled separetly) +# Safe env. vars. to transfer from root -> $ROOTLESS_USER (go env handled separately) ROOTLESS_ENV_RE='(CIRRUS_.+)|(ROOTLESS_.+)|(.+_IMAGE.*)|(.+_BASE)|(.*DIRPATH)|(.*FILEPATH)|(SOURCE.*)|(DEPEND.*)|(.+_DEPS_.+)|(OS_REL.*)|(.+_ENV_RE)|(TRAVIS)|(CI.+)|(TEST_REMOTE.*)' # Unsafe env. vars for display SECRET_ENV_RE='(IRCID)|(ACCOUNT)|(GC[EP]..+)|(SSH)' @@ -319,7 +319,7 @@ setup_rootless() { tee -a /etc/subuid >> /etc/subgid # Env. vars set by Cirrus and setup_environment.sh must be explicitly - # transfered to the test-user. + # transferred to the test-user. echo "Configuring rootless user's environment variables:" echo "# Added by $GOSRC/$SCRIPT_PATH/lib.sh setup_rootless()" _ENV_VAR_NAMES=$(awk 'BEGIN{for(v in ENVIRON) print v}' | \ diff --git a/contrib/cirrus/packer/systemd_banish.sh b/contrib/cirrus/packer/systemd_banish.sh index 396cf906c..6e2dd9c3e 100755 --- a/contrib/cirrus/packer/systemd_banish.sh +++ b/contrib/cirrus/packer/systemd_banish.sh @@ -3,7 +3,7 @@ set +e # Not all of these exist on every platform # This is intended to be executed on VMs as a startup script on initial-boot. -# Alternativly, it may be executed with the '--list' option to return the list +# Alternatively, it may be executed with the '--list' option to return the list # of systemd units defined for disablement (useful for testing). EVIL_UNITS="cron crond atd apt-daily-upgrade apt-daily fstrim motd-news systemd-tmpfiles-clean" diff --git a/docs/source/markdown/podman-build.1.md b/docs/source/markdown/podman-build.1.md index 567d0ead3..6c8f239a6 100644 --- a/docs/source/markdown/podman-build.1.md +++ b/docs/source/markdown/podman-build.1.md @@ -342,8 +342,8 @@ than the one in storage. Raise an error if the image is not in any listed registry and is not present locally. If the flag is disabled (with *--pull=false*), do not pull the image from the -registry, use only the local version. Raise an error if the image is not -present locally. +registry, unless there is no local image. Raise an error if the image is not +in any registry and is not present locally. Defaults to *true*. @@ -352,6 +352,11 @@ Defaults to *true*. Pull the image from the first registry it is found in as listed in registries.conf. Raise an error if not found in the registries, even if the image is present locally. +**--pull-never** + +Do not pull the image from the registry, use only the local version. Raise an error +if the image is not present locally. + **--quiet**, **-q** Suppress output messages which indicate which instruction is being processed, diff --git a/docs/source/markdown/podman-create.1.md b/docs/source/markdown/podman-create.1.md index d9ee69f82..0ddcc7ed8 100644 --- a/docs/source/markdown/podman-create.1.md +++ b/docs/source/markdown/podman-create.1.md @@ -334,7 +334,7 @@ option to `false`. The environment variables passed in include `http_proxy`, those. This option is only needed when the host system must use a proxy but the container should not use any proxy. Proxy environment variables specified for the container in any other way will override the values that would have -been passed thru from the host. (Other ways to specify the proxy for the +been passed through from the host. (Other ways to specify the proxy for the container include passing the values with the `--env` flag, or hard coding the proxy environment at container build time.) diff --git a/docs/source/markdown/podman-image-sign.1.md b/docs/source/markdown/podman-image-sign.1.md index 62845e715..fa75691bc 100644 --- a/docs/source/markdown/podman-image-sign.1.md +++ b/docs/source/markdown/podman-image-sign.1.md @@ -41,7 +41,7 @@ The write (and read) location for signatures is defined in YAML-based configuration files in /etc/containers/registries.d/. When you sign an image, Podman will use those configuration files to determine where to write the signature based on the the name of the originating -registry or a default storage value unless overriden with the --directory +registry or a default storage value unless overridden with the --directory option. For example, consider the following configuration file. docker: diff --git a/docs/source/markdown/podman-remote.1.md b/docs/source/markdown/podman-remote.1.md index 04010abaf..bbc54a2a6 100644 --- a/docs/source/markdown/podman-remote.1.md +++ b/docs/source/markdown/podman-remote.1.md @@ -17,7 +17,7 @@ Podman uses Buildah(1) internally to create container images. Both tools share i (not container) storage, hence each can use or manipulate images (but not containers) created by the other. -Podman-remote provides a local client interacting with a Podman backend node through a varlink ssh connection. In this context, a Podman node is a Linux system with Podman installed on it and the varlink service activated. Credentials for this session can be passed in using flags, enviroment variables, or in `podman-remote.conf` +Podman-remote provides a local client interacting with a Podman backend node through a varlink ssh connection. In this context, a Podman node is a Linux system with Podman installed on it and the varlink service activated. Credentials for this session can be passed in using flags, environment variables, or in `podman-remote.conf` **podman [GLOBAL OPTIONS]** diff --git a/docs/source/markdown/podman-rm.1.md b/docs/source/markdown/podman-rm.1.md index c1663129c..74831fef6 100644 --- a/docs/source/markdown/podman-rm.1.md +++ b/docs/source/markdown/podman-rm.1.md @@ -18,6 +18,10 @@ Running or unusable containers will not be removed without the `-f` option. Remove all containers. Can be used in conjunction with -f as well. +**--cidfile** + +Read container ID from the specified file and remove the container. Can be specified multiple times. + **--force**, **-f** Force the removal of running and paused containers. Forcing a container removal also @@ -50,11 +54,17 @@ Remove a container by its name *mywebserver* ``` podman rm mywebserver ``` + Remove several containers by name and container id. ``` podman rm mywebserver myflaskserver 860a4b23 ``` +Remove several containers reading their IDs from files. +``` +podman rm --cidfile ./cidfile-1 --cidfile /home/user/cidfile-2 +``` + Forcibly remove a container by container ID. ``` podman rm -f 860a4b23 diff --git a/docs/source/markdown/podman-run.1.md b/docs/source/markdown/podman-run.1.md index 28b00ee29..d487af235 100644 --- a/docs/source/markdown/podman-run.1.md +++ b/docs/source/markdown/podman-run.1.md @@ -341,7 +341,7 @@ option to `false`. The environment variables passed in include `http_proxy`, those. This option is only needed when the host system must use a proxy but the container should not use any proxy. Proxy environment variables specified for the container in any other way will override the values that would have -been passed thru from the host. (Other ways to specify the proxy for the +been passed through from the host. (Other ways to specify the proxy for the container include passing the values with the `--env` flag, or hard coding the proxy environment at container build time.) diff --git a/docs/source/markdown/podman-stop.1.md b/docs/source/markdown/podman-stop.1.md index b5ea670b0..5e8056e92 100644 --- a/docs/source/markdown/podman-stop.1.md +++ b/docs/source/markdown/podman-stop.1.md @@ -21,6 +21,10 @@ container and also via command line when creating the container. Stop all running containers. This does not include paused containers. +**--cidfile** + +Read container ID from the specified file and remove the container. Can be specified multiple times. + **--latest**, **-l** Instead of providing the container name or ID, use the last created container. If you use methods other than Podman @@ -40,6 +44,10 @@ podman stop 860a4b235279 podman stop mywebserver 860a4b235279 +podman stop --cidfile /home/user/cidfile-1 + +podman stop --cidfile /home/user/cidfile-1 --cidfile ./cidfile-2 + podman stop --timeout 2 860a4b235279 podman stop -a @@ -8,21 +8,20 @@ require ( github.com/buger/goterm v0.0.0-20181115115552-c206103e1f37 github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd // indirect - github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect github.com/containernetworking/cni v0.7.2-0.20190904153231-83439463f784 github.com/containernetworking/plugins v0.8.2 - github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982 + github.com/containers/buildah v1.11.5 github.com/containers/conmon v2.0.2+incompatible // indirect github.com/containers/image/v5 v5.0.0 github.com/containers/psgo v1.3.2 - github.com/containers/storage v1.13.5 + github.com/containers/storage v1.14.0 github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f // indirect github.com/cri-o/ocicni v0.1.1-0.20190920040751-deac903fd99b github.com/cyphar/filepath-securejoin v0.2.2 github.com/davecgh/go-spew v1.1.1 github.com/docker/distribution v2.7.1+incompatible - github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce + github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 github.com/docker/docker-credential-helpers v0.6.3 github.com/docker/go-connections v0.4.0 github.com/docker/go-units v0.4.0 @@ -33,7 +32,7 @@ require ( github.com/fatih/camelcase v1.0.0 github.com/fsnotify/fsnotify v1.4.7 github.com/ghodss/yaml v1.0.0 - github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f + github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e github.com/google/shlex v0.0.0-20181106134648-c34317bd91bf github.com/hashicorp/go-multierror v1.0.0 github.com/hpcloud/tail v1.0.0 @@ -45,7 +44,7 @@ require ( github.com/onsi/gomega v1.7.1 github.com/opencontainers/go-digest v1.0.0-rc1 github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 - github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158 + github.com/opencontainers/runc v1.0.0-rc9 github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7 github.com/opencontainers/runtime-tools v0.9.0 github.com/opencontainers/selinux v1.3.0 @@ -68,7 +67,7 @@ require ( golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45 // indirect golang.org/x/sync v0.0.0-20190423024810-112230192c58 - golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 google.golang.org/appengine v1.6.1 // indirect google.golang.org/genproto v0.0.0-20190620144150-6af8c5fc6601 // indirect gopkg.in/inf.v0 v0.9.1 // indirect @@ -15,8 +15,12 @@ github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiU github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c h1:YMP6olTU903X3gxQJckdmiP8/zkSMq4kN3uipsU9XjU= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c/go.mod h1:7xhjOwRV2+0HXGmM0jxaEu+ZiXJFoVZOTfL/dmqbrD8= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= github.com/PuerkitoBio/purell v1.0.0/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= github.com/PuerkitoBio/urlesc v0.0.0-20160726150825-5bd2802263f2/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= @@ -31,6 +35,7 @@ github.com/beorn7/perks v1.0.0 h1:HWo1m869IqiPhD389kmkxeTalrjNbbJTC8LXupb+sl0= github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM= github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/blang/semver v3.5.0+incompatible h1:CGxCgetQ64DKk7rdZ++Vfnb1+ogGNnB17OJKJXD2Cfs= github.com/blang/semver v3.5.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/blang/semver v3.5.1+incompatible h1:cQNTCjp13qL8KC3Nbxr/y2Bqb63oX6wdnnjpJbkM4JQ= @@ -43,6 +48,10 @@ github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b/go.mod github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd h1:qMd81Ts1T2OTKmB4acZcyKaMtRnY5Y44NuXGX2GFJ1w= github.com/codahale/hdrhistogram v0.0.0-20161010025455-3a0bb77429bd/go.mod h1:sE/e/2PUdi/liOCUjSTXgM1o87ZssimdTWN964YiIeI= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY= github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= @@ -50,6 +59,10 @@ github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882b github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= github.com/containernetworking/cni v0.7.0/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= github.com/containernetworking/cni v0.7.1 h1:fE3r16wpSEyaqY4Z4oFrLMmIGfBYIKpPrHK31EJ9FzE= github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= @@ -61,6 +74,8 @@ github.com/containers/buildah v1.11.4-0.20191028173731-21b4778b359e h1:iDavHEx5Y github.com/containers/buildah v1.11.4-0.20191028173731-21b4778b359e/go.mod h1:Igrk75FAxLnzDaHUbtpWB8pwL+Bv+cnakWMvqAXW2v8= github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982 h1:5WUe09k2sJSbmxwLHZLHc41TrIPrP0GlbhX+WDJBqvs= github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982/go.mod h1:eGWB4tLoo0hIBuytQpvgUC0hk2mvl2ofaYBeDsU/qoc= +github.com/containers/buildah v1.11.5 h1:bVpkaVlvA7G+1mBDAcX6yf7jNZJ/ZrrAHDt4WCx2i8E= +github.com/containers/buildah v1.11.5/go.mod h1:bfNPqLO8GnI0qMPmI6MHSpQNK+a3TH9syYsRg+iqhRw= github.com/containers/conmon v2.0.2+incompatible h1:h2HCdd/EBpwFn7RT82Y2GyXnVUHWxk1Jm4cESSZG4P8= github.com/containers/conmon v2.0.2+incompatible/go.mod h1:hgwZ2mtuDrppv78a/cOBNiCm6O0UMWGx1mu7P00nu5I= github.com/containers/image/v5 v5.0.0 h1:arnXgbt1ucsC/ndtSpiQY87rA0UjhF+/xQnPzqdBDn4= @@ -73,6 +88,8 @@ github.com/containers/storage v1.13.4 h1:j0bBaJDKbUHtAW1MXPFnwXJtqcH+foWeuXK1YaB github.com/containers/storage v1.13.4/go.mod h1:6D8nK2sU9V7nEmAraINRs88ZEscM5C5DK+8Npp27GeA= github.com/containers/storage v1.13.5 h1:/SUzGeOP2HDijpF7Yur21Ch6WTZC1BNeZF917CWcp5c= github.com/containers/storage v1.13.5/go.mod h1:HELz8Sn+UVbPaUZMI8RvIG9doD4y4z6Gtg4k7xdd2ZY= +github.com/containers/storage v1.14.0 h1:LbX6WZaDmkXt4DT4xWIg3YXAWd6oA4K9Fi6/KG1xt84= +github.com/containers/storage v1.14.0/go.mod h1:qGPsti/qC1xxX+xcpHfiTMT+8ThVE2Jf83wFHHqkDAY= github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk= github.com/coreos/go-iptables v0.4.2 h1:KH0EwId05JwWIfb96gWvkiT2cbuOu8ygqUaB+yPAwIg= @@ -80,6 +97,7 @@ github.com/coreos/go-iptables v0.4.2/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmeka github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7 h1:u9SHYsPQNyt5tgDm3YN7+9dYrpK96E5wFilTFWIDZOM= github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f h1:JOrtw2xFKzlg+cbHpyrpLDmnN1HqhBfnX7WDiW7eG2c= github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f h1:lBNOc5arjvs8E5mO2tbpBpLoyyu8B6e44T7hJy6potg= @@ -108,6 +126,8 @@ github.com/docker/docker v0.0.0-20171019062838-86f080cff091/go.mod h1:eEKB0N0r5N github.com/docker/docker v0.0.0-20180522102801-da99009bbb11/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce h1:H3csZuxZESJeeEiOxq4YXPNmLFbjl7u2qVBrAAGX/sA= github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= github.com/docker/docker-credential-helpers v0.6.1 h1:Dq4iIfcM7cNtddhLVWe9h4QDjsi4OER3Z8voPu/I52g= github.com/docker/docker-credential-helpers v0.6.1/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= @@ -143,6 +163,8 @@ github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= github.com/fsouza/go-dockerclient v1.5.0 h1:7OtayOe5HnoG+KWMHgyyPymwaodnB2IDYuVfseKyxbA= github.com/fsouza/go-dockerclient v1.5.0/go.mod h1:AqZZK/zFO3phxYxlTsAaeAMSdQ9mgHuhy+bjN034Qds= +github.com/fsouza/go-dockerclient v1.6.0 h1:f7j+AX94143JL1H3TiqSMkM4EcLDI0De1qD4GGn3Hig= +github.com/fsouza/go-dockerclient v1.6.0/go.mod h1:YWwtNPuL4XTX1SKJQk86cWPmmqwx+4np9qfPbb+znGc= github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk= @@ -158,6 +180,8 @@ github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/me github.com/godbus/dbus v0.0.0-20180201030542-885f9cc04c9c/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f h1:zlOR3rOlPAVvtfuxGKoghCmop5B0TRyu/ZieziZuGiM= github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v0.0.0-20171007142547-342cbe0a0415/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= @@ -202,11 +226,15 @@ github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gotestyourself/gotestyourself v2.2.0+incompatible/go.mod h1:zZKM6oeNM8k+FRljX1mnzVYeS8wiGgQyvST1/GafPbY= github.com/gregjones/httpcache v0.0.0-20170728041850-787624de3eb7/go.mod h1:FecbI9+v66THATjSRHfNgh1IVFe/9kFxbXtjV0ctIMA= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ= github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI= github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= @@ -239,6 +267,8 @@ github.com/klauspost/compress v1.7.2 h1:liMOoeIvFpr9kEvalrZ7VVBA4wGf7zfOgwBjzz/5 github.com/klauspost/compress v1.7.2/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/compress v1.8.1 h1:oygt2ychZFHOB6M9gUgajzgKrwRgHbGC77NwA4COVgI= github.com/klauspost/compress v1.8.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= +github.com/klauspost/compress v1.9.2 h1:LfVyl+ZlLlLDeQ/d2AqfGIIH4qEDu0Ed2S5GyhCWIWY= +github.com/klauspost/compress v1.9.2/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/cpuid v1.2.1 h1:vJi+O/nMdFt0vqm8NZBI6wzALWdA2X+egi0ogNyrC/w= github.com/klauspost/cpuid v1.2.1/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek= github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM= @@ -305,20 +335,26 @@ github.com/onsi/gomega v1.7.0 h1:XPnZz8VVBHjVsy1vzJmRwIcSwiUO+JFfrv/xGiigmME= github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.1 h1:K0jcRCwNQM3vFGh1ppMtDh/+7ApJrjldlX8fA0jDTLQ= github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU= github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.0.0-20190425234816-dae70e8efea4/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0= github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158 h1:/A6bAdnSZoTQmKml3MdHAnSEPnBAQeigNBl4sxnfaaQ= github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc9 h1:/k06BMULKF5hidyoZymkoDCzdJzltZpz/UU4LguQVtc= +github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7 h1:Dliu5QO+4JYWu/yMshaMU7G3JN2POGpwjJN7gjy10Go= github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/runtime-tools v0.9.0 h1:FYgwVsKRI/H9hU32MJ/4MLOzXWodKK5zsQavY8NPMkU= github.com/opencontainers/runtime-tools v0.9.0/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg= @@ -364,6 +400,8 @@ github.com/prometheus/procfs v0.0.2 h1:6LJUbpNm42llc4HRCuvApCSWB/WfhuNo9K98Q9sNG github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= github.com/prometheus/procfs v0.0.3 h1:CTwfnzjQ+8dS6MhHHu4YswVAD99sL2wjPqP+VkURmKE= github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= github.com/rogpeppe/go-charset v0.0.0-20180617210344-2471d30d28b4/go.mod h1:qgYeAmZ5ZIpBWTGllZSQnw97Dj+woV0toclVaRGI8pc= github.com/russross/blackfriday v1.5.2/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g= github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8 h1:2c1EFnZHIPCW8qKWgHMH/fX2PkSabFc5mrVzfUNdg5U= @@ -401,6 +439,7 @@ github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs= @@ -416,6 +455,7 @@ github.com/uber/jaeger-lib v0.0.0-20190122222657-d036253de8f5/go.mod h1:ComeNDZl github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0= github.com/ulikunitz/xz v0.5.6 h1:jGHAfXawEGZQ3blwU5wnWKQJvAraT7Ftq9EXjnXYgt8= github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= github.com/varlink/go v0.0.0-20190502142041-0f1d566d194b h1:hdDRrn9OP/roL8a/e/5Zu85ldrcdndu9IeBj2OEvQm0= github.com/varlink/go v0.0.0-20190502142041-0f1d566d194b/go.mod h1:YHaw8N660ESgMgLOZfLQqT1htFItynAUxMesFBho52s= github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE= @@ -435,12 +475,15 @@ github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xeipuuv/gojsonschema v0.0.0-20190816131739-be0936907f66/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y= github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg= github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q= go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= go.uber.org/atomic v1.4.0 h1:cxzIVoETapQEqDhQu3QfnvXAV4AlzcvUCxkVUFw3+EU= go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= @@ -466,6 +509,7 @@ golang.org/x/net v0.0.0-20190206173232-65e2d4e15006/go.mod h1:mL1N/T3taQHkDXs73r golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU= @@ -478,6 +522,7 @@ golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4 h1:YUO/7uOKsKeq9UokNS62b8FYywz3ker1l1vDZRCRefw= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20170830134202-bb24a47a89ea/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -493,7 +538,9 @@ golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190425145619-16072639606e h1:4ktJgTV34+N3qOZUc5fAaG3Pb11qzMm3PkAoTAgUZ2I= golang.org/x/sys v0.0.0-20190425145619-16072639606e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k= @@ -501,6 +548,8 @@ golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 h1:tdsQdquKbTNMsSZLqnLELJGzCANp9oXhu6zFBW6ODx4= golang.org/x/sys v0.0.0-20190902133755-9109b7679e13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -527,9 +576,11 @@ google.golang.org/appengine v1.6.1 h1:QzqyMA1tlu6CgqCDUtU9V+ZKhLFT2dkJuANu5QaxI3 google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= google.golang.org/genproto v0.0.0-20180831171423-11092d34479b/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/genproto v0.0.0-20190620144150-6af8c5fc6601 h1:9VBRTdmgQxbs6HE0sUnMrSWNePppAJU07NYvX5dIB04= google.golang.org/genproto v0.0.0-20190620144150-6af8c5fc6601/go.mod h1:z3L6/3dTEVtUr6QSP8miRzeRqwQOioJ9I66odjN4I7s= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= google.golang.org/grpc v1.24.0 h1:vb/1TCsVn3DcJlQ0Gs1yB1pKI6Do2/QNwxdKqmc/b0s= google.golang.org/grpc v1.24.0/go.mod h1:XDChyiUovWa60DnaeDeZmSW86xtLtjtZbwvSiRnRtcA= @@ -580,6 +631,7 @@ k8s.io/klog v0.3.3 h1:niceAagH1tzskmaie/icWd7ci1wbG7Bf2c6YGcQv+3c= k8s.io/klog v0.3.3/go.mod h1:Gq+BEi5rUBO/HRz0bTSXDUcqjScdoY3a9IHpCEIOOfk= k8s.io/kube-openapi v0.0.0-20190228160746-b3a7cee44a30/go.mod h1:BXM9ceUBTj2QnfH2MK1odQs778ajze1RxcmP6S8RVVc= k8s.io/kube-openapi v0.0.0-20190709113604-33be087ad058/go.mod h1:nfDlWeOsu3pUf4yWGL+ERqohP4YsZcBJXWMK+gkzOA4= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= k8s.io/utils v0.0.0-20190221042446-c2654d5206da/go.mod h1:8k8uAuAQ0rXslZKaEWd0c3oVhZz7sSzSiPnVZayjIX0= k8s.io/utils v0.0.0-20190607212802-c55fbcfc754a h1:2jUDc9gJja832Ftp+QbDV0tVhQHMISFn01els+2ZAcw= k8s.io/utils v0.0.0-20190607212802-c55fbcfc754a/go.mod h1:sZAwmy6armz5eXlNoLmJcl4F1QuKu7sr+mFQ0byX7Ew= diff --git a/hack/get_ci_vm.sh b/hack/get_ci_vm.sh index e1588d570..22f902e2d 100755 --- a/hack/get_ci_vm.sh +++ b/hack/get_ci_vm.sh @@ -267,7 +267,7 @@ echo -e "\n${YEL}Removing and re-creating $GOSRC on $VMNAME.${NOR}" showrun $SSH_CMD --command "rm -rf $GOSRC" showrun $SSH_CMD --command "mkdir -p $GOSRC" -echo -e "\n${YEL}Transfering tarball to $VMNAME.${NOR}" +echo -e "\n${YEL}Transferring tarball to $VMNAME.${NOR}" wait showrun $SCP_CMD $HOME/$TARBALL $SSHUSER@$VMNAME:/tmp/$TARBALL diff --git a/libpod/boltdb_state.go b/libpod/boltdb_state.go index 608a279c3..4918bf57a 100644 --- a/libpod/boltdb_state.go +++ b/libpod/boltdb_state.go @@ -2235,7 +2235,7 @@ func (s *BoltState) RemovePodContainers(pod *Pod) error { if ctr == nil { // This should never happen // State is inconsistent - return errors.Wrapf(define.ErrNoSuchCtr, "pod %s referenced nonexistant container %s", pod.ID(), string(id)) + return errors.Wrapf(define.ErrNoSuchCtr, "pod %s referenced nonexistent container %s", pod.ID(), string(id)) } ctrDeps := ctr.Bucket(dependenciesBkt) // This should never be nil, but if it is, we're diff --git a/libpod/config/config.go b/libpod/config/config.go index 5b4b57f3a..f1fa70fbc 100644 --- a/libpod/config/config.go +++ b/libpod/config/config.go @@ -469,6 +469,9 @@ func NewConfig(userConfigPath string) (*Config, error) { if defaultConfig, err := defaultConfigFromMemory(); err != nil { return nil, errors.Wrapf(err, "error generating default config from memory") } else { + // Check if we need to switch to cgroupfs and logger=file on rootless. + defaultConfig.checkCgroupsAndLogger() + if err := config.mergeConfig(defaultConfig); err != nil { return nil, errors.Wrapf(err, "error merging default config from memory") } @@ -487,9 +490,6 @@ func NewConfig(userConfigPath string) (*Config, error) { return nil, errors.Wrapf(define.ErrInvalidArg, "volume path must be an absolute path - instead got %q", config.VolumePath) } - // Check if we need to switch to cgroupfs on rootless. - config.checkCgroupsAndAdjustConfig() - return config, nil } @@ -524,11 +524,13 @@ func systemConfigs() ([]string, error) { return configs, nil } -// checkCgroupsAndAdjustConfig checks if we're running rootless with the systemd +// checkCgroupsAndLogger checks if we're running rootless with the systemd // cgroup manager. In case the user session isn't available, we're switching the -// cgroup manager to cgroupfs. Note, this only applies to rootless. -func (c *Config) checkCgroupsAndAdjustConfig() { - if !rootless.IsRootless() || c.CgroupManager != define.SystemdCgroupsManager { +// cgroup manager to cgroupfs and the events logger backend to 'file'. +// Note, this only applies to rootless. +func (c *Config) checkCgroupsAndLogger() { + if !rootless.IsRootless() || (c.CgroupManager != + define.SystemdCgroupsManager && c.EventsLogger == "file") { return } @@ -543,7 +545,8 @@ func (c *Config) checkCgroupsAndAdjustConfig() { logrus.Warningf("The cgroups manager is set to systemd but there is no systemd user session available") logrus.Warningf("For using systemd, you may need to login using an user session") logrus.Warningf("Alternatively, you can enable lingering with: `loginctl enable-linger %d` (possibly as root)", rootless.GetRootlessUID()) - logrus.Warningf("Falling back to --cgroup-manager=cgroupfs") + logrus.Warningf("Falling back to --cgroup-manager=cgroupfs and --events-backend=file") c.CgroupManager = define.CgroupfsCgroupsManager + c.EventsLogger = "file" } } diff --git a/libpod/container_internal.go b/libpod/container_internal.go index 028d7601d..4ff1913b5 100644 --- a/libpod/container_internal.go +++ b/libpod/container_internal.go @@ -652,6 +652,11 @@ func (c *Container) removeConmonFiles() error { return errors.Wrapf(err, "error removing container %s ctl file", c.ID()) } + winszFile := filepath.Join(c.bundlePath(), "winsz") + if err := os.Remove(winszFile); err != nil && !os.IsNotExist(err) { + return errors.Wrapf(err, "error removing container %s winsz file", c.ID()) + } + oomFile := filepath.Join(c.bundlePath(), "oom") if err := os.Remove(oomFile); err != nil && !os.IsNotExist(err) { return errors.Wrapf(err, "error removing container %s OOM file", c.ID()) diff --git a/libpod/container_internal_linux.go b/libpod/container_internal_linux.go index 26d6771b0..2ecd5911a 100644 --- a/libpod/container_internal_linux.go +++ b/libpod/container_internal_linux.go @@ -884,7 +884,12 @@ func (c *Container) restore(ctx context.Context, options ContainerCheckpointOpti // We want to have the same network namespace as before. if c.config.CreateNetNS { - if err := g.AddOrReplaceLinuxNamespace(string(spec.NetworkNamespace), c.state.NetNS.Path()); err != nil { + netNSPath := "" + if !c.config.PostConfigureNetNS { + netNSPath = c.state.NetNS.Path() + } + + if err := g.AddOrReplaceLinuxNamespace(string(spec.NetworkNamespace), netNSPath); err != nil { return err } } diff --git a/libpod/events/config.go b/libpod/events/config.go index 453c64f8c..20c01baff 100644 --- a/libpod/events/config.go +++ b/libpod/events/config.go @@ -167,7 +167,7 @@ type EventFilter func(*Event) bool var ( // ErrEventTypeBlank indicates the event log found something done by podman - // but it isnt likely an event + // but it isn't likely an event ErrEventTypeBlank = errors.New("event type blank") // ErrEventNotFound indicates that the event was not found in the event log diff --git a/libpod/healthcheck.go b/libpod/healthcheck.go index e9c950713..b42e7d16a 100644 --- a/libpod/healthcheck.go +++ b/libpod/healthcheck.go @@ -31,7 +31,7 @@ const ( // HealthCheckNotDefined means the container has no health // check defined in it HealthCheckNotDefined HealthCheckStatus = iota - // HealthCheckInternalError means somes something failed obtaining or running + // HealthCheckInternalError means some something failed obtaining or running // a given health check HealthCheckInternalError HealthCheckStatus = iota // HealthCheckDefined means the healthcheck was found on the container diff --git a/libpod/image/image.go b/libpod/image/image.go index 5871c8a57..fa75be44d 100644 --- a/libpod/image/image.go +++ b/libpod/image/image.go @@ -770,109 +770,65 @@ func (i *Image) History(ctx context.Context) ([]*History, error) { return nil, err } - // Use our layers list to find images that use any of them (or no - // layer, since every base layer is derived from an empty layer) as its - // topmost layer. - interestingLayers := make(map[string]bool) - var layer *storage.Layer - if i.TopLayer() != "" { - if layer, err = i.imageruntime.store.Layer(i.TopLayer()); err != nil { - return nil, err - } + // Build a mapping from top-layer to image ID. + images, err := i.imageruntime.GetImages() + if err != nil { + return nil, err } - interestingLayers[""] = true - for layer != nil { - interestingLayers[layer.ID] = true - if layer.Parent == "" { - break + topLayerMap := make(map[string]string) + for _, image := range images { + if _, exists := topLayerMap[image.TopLayer()]; !exists { + topLayerMap[image.TopLayer()] = image.ID() } - layer, err = i.imageruntime.store.Layer(layer.Parent) + } + + var allHistory []*History + var layer *storage.Layer + + // Check if we have an actual top layer to prevent lookup errors. + if i.TopLayer() != "" { + layer, err = i.imageruntime.store.Layer(i.TopLayer()) if err != nil { return nil, err } } - // Get the IDs of the images that share some of our layers. Hopefully - // this step means that we'll be able to avoid reading the - // configuration of every single image in local storage later on. - images, err := i.imageruntime.GetImages() - if err != nil { - return nil, errors.Wrapf(err, "error getting images from store") - } - interestingImages := make([]*Image, 0, len(images)) - for i := range images { - if interestingLayers[images[i].TopLayer()] { - interestingImages = append(interestingImages, images[i]) - } - } + // Iterate in reverse order over the history entries, and lookup the + // corresponding image ID, size and get the next later if needed. + numHistories := len(oci.History) - 1 + for x := numHistories; x >= 0; x-- { + var size int64 - // Build a list of image IDs that correspond to our history entries. - historyImages := make([]*Image, len(oci.History)) - if len(oci.History) > 0 { - // The starting image shares its whole history with itself. - historyImages[len(historyImages)-1] = i - for i := range interestingImages { - image, err := images[i].ociv1Image(ctx) - if err != nil { - return nil, errors.Wrapf(err, "error getting image configuration for image %q", images[i].ID()) + id := "<missing>" + if x == numHistories { + id = i.ID() + } else if layer != nil { + if !oci.History[x].EmptyLayer { + size = layer.UncompressedSize } - // If the candidate has a longer history or no history - // at all, then it doesn't share the portion of our - // history that we're interested in matching with other - // images. - if len(image.History) == 0 || len(image.History) > len(historyImages) { - continue - } - // If we don't include all of the layers that the - // candidate image does (i.e., our rootfs didn't look - // like its rootfs at any point), then it can't be part - // of our history. - if len(image.RootFS.DiffIDs) > len(oci.RootFS.DiffIDs) { - continue - } - candidateLayersAreUsed := true - for i := range image.RootFS.DiffIDs { - if image.RootFS.DiffIDs[i] != oci.RootFS.DiffIDs[i] { - candidateLayersAreUsed = false - break - } - } - if !candidateLayersAreUsed { - continue - } - // If the candidate's entire history is an initial - // portion of our history, then we're based on it, - // either directly or indirectly. - sharedHistory := historiesMatch(oci.History, image.History) - if sharedHistory == len(image.History) { - historyImages[sharedHistory-1] = images[i] + if imageID, exists := topLayerMap[layer.ID]; exists { + id = imageID + // Delete the entry to avoid reusing it for following history items. + delete(topLayerMap, layer.ID) } } - } - var ( - size int64 - sizeCount = 1 - allHistory []*History - ) - - for i := len(oci.History) - 1; i >= 0; i-- { - imageID := "<missing>" - if historyImages[i] != nil { - imageID = historyImages[i].ID() - } - if !oci.History[i].EmptyLayer { - size = img.LayerInfos()[len(img.LayerInfos())-sizeCount].Size - sizeCount++ - } allHistory = append(allHistory, &History{ - ID: imageID, - Created: oci.History[i].Created, - CreatedBy: oci.History[i].CreatedBy, + ID: id, + Created: oci.History[x].Created, + CreatedBy: oci.History[x].CreatedBy, Size: size, - Comment: oci.History[i].Comment, + Comment: oci.History[x].Comment, }) + + if layer != nil && layer.Parent != "" && !oci.History[x].EmptyLayer { + layer, err = i.imageruntime.store.Layer(layer.Parent) + if err != nil { + return nil, err + } + } } + return allHistory, nil } diff --git a/libpod/image/pull.go b/libpod/image/pull.go index 99c11e3ff..326a23f4c 100644 --- a/libpod/image/pull.go +++ b/libpod/image/pull.go @@ -330,7 +330,7 @@ func (ir *Runtime) doPullImage(ctx context.Context, sc *types.SystemContext, goa if goal.usedSearchRegistries && len(goal.searchedRegistries) == 0 { return nil, errors.Errorf("image name provided is a short name and no search registries are defined in the registries config file.") } - // If the image passed in was fully-qualified, we will have 1 refpair. Bc the image is fq'd, we dont need to yap about registries. + // If the image passed in was fully-qualified, we will have 1 refpair. Bc the image is fq'd, we don't need to yap about registries. if !goal.usedSearchRegistries { if pullErrors != nil && len(pullErrors.Errors) > 0 { // this should always be true return nil, errors.Wrap(pullErrors.Errors[0], "unable to pull image") diff --git a/libpod/kube.go b/libpod/kube.go index 47a77991e..6ae3e3d07 100644 --- a/libpod/kube.go +++ b/libpod/kube.go @@ -341,7 +341,7 @@ func libpodMountsToKubeVolumeMounts(c *Container) ([]v1.VolumeMount, []v1.Volume return vms, vos, nil } -// generateKubeVolumeMount takes a user specfied mount and returns +// generateKubeVolumeMount takes a user specified mount and returns // a kubernetes VolumeMount (to be added to the container) and a kubernetes Volume // (to be added to the pod) func generateKubeVolumeMount(m specs.Mount) (v1.VolumeMount, v1.Volume, error) { diff --git a/libpod/lock/shm/shm_lock.c b/libpod/lock/shm/shm_lock.c index fbb3f57cc..95052c40f 100644 --- a/libpod/lock/shm/shm_lock.c +++ b/libpod/lock/shm/shm_lock.c @@ -145,7 +145,7 @@ shm_struct_t *setup_lock_shm(char *path, uint32_t num_locks, int *error_code) { // Set mutexes to robust - if a process dies while holding a mutex, we'll get // a special error code on the next attempt to lock it. - // This should prevent panicing processes from leaving the state unusable. + // This should prevent panicking processes from leaving the state unusable. ret_code = pthread_mutexattr_setrobust(&attr, PTHREAD_MUTEX_ROBUST); if (ret_code != 0) { *error_code = -1 * ret_code; @@ -298,7 +298,7 @@ int32_t close_lock_shm(shm_struct_t *shm) { // Allocate the first available semaphore // Returns a positive integer guaranteed to be less than UINT32_MAX on success, // or negative errno values on failure -// On sucess, the returned integer is the number of the semaphore allocated +// On success, the returned integer is the number of the semaphore allocated int64_t allocate_semaphore(shm_struct_t *shm) { int ret_code, i; bitmap_t test_map; diff --git a/libpod/options.go b/libpod/options.go index 00b5626b4..bfbbb9e2d 100644 --- a/libpod/options.go +++ b/libpod/options.go @@ -386,8 +386,7 @@ func WithNamespace(ns string) RuntimeOption { // WithVolumePath sets the path under which all named volumes // should be created. -// The path changes based on whethe rthe user is running as root -// or not. +// The path changes based on whether the user is running as root or not. func WithVolumePath(volPath string) RuntimeOption { return func(rt *Runtime) error { if rt.valid { diff --git a/libpod/pod_api.go b/libpod/pod_api.go index 3a194f04b..b27257004 100644 --- a/libpod/pod_api.go +++ b/libpod/pod_api.go @@ -445,7 +445,7 @@ func (p *Pod) Inspect() (*PodInspect, error) { } for _, c := range containers { containerStatus := "unknown" - // Ignoring possible errors here because we dont want this to be + // Ignoring possible errors here because we don't want this to be // catastrophic in nature containerState, err := c.State() if err == nil { diff --git a/libpod/runtime_volume.go b/libpod/runtime_volume.go index a6ab748e5..835dccf9c 100644 --- a/libpod/runtime_volume.go +++ b/libpod/runtime_volume.go @@ -59,7 +59,7 @@ func (r *Runtime) GetVolume(name string) (*Volume, error) { return vol, nil } -// LookupVolume retrieves a volume by unambigious partial name. +// LookupVolume retrieves a volume by unambiguous partial name. func (r *Runtime) LookupVolume(name string) (*Volume, error) { r.lock.RLock() defer r.lock.RUnlock() diff --git a/pkg/adapter/containers.go b/pkg/adapter/containers.go index 287bd8474..02da9ec8c 100644 --- a/pkg/adapter/containers.go +++ b/pkg/adapter/containers.go @@ -79,7 +79,17 @@ func (r *LocalRuntime) StopContainers(ctx context.Context, cli *cliconfig.StopVa } logrus.Debugf("Setting maximum stop workers to %d", maxWorkers) - ctrs, err := shortcuts.GetContainersByContext(cli.All, cli.Latest, cli.InputArgs, r.Runtime) + names := cli.InputArgs + for _, cidFile := range cli.CIDFiles { + content, err := ioutil.ReadFile(cidFile) + if err != nil { + return nil, nil, errors.Wrap(err, "error reading CIDFile") + } + id := strings.Split(string(content), "\n")[0] + names = append(names, id) + } + + ctrs, err := shortcuts.GetContainersByContext(cli.All, cli.Latest, names, r.Runtime) if err != nil { return nil, nil, err } @@ -203,7 +213,17 @@ func (r *LocalRuntime) RemoveContainers(ctx context.Context, cli *cliconfig.RmVa return ok, failures, nil } - ctrs, err := shortcuts.GetContainersByContext(cli.All, cli.Latest, cli.InputArgs, r.Runtime) + names := cli.InputArgs + for _, cidFile := range cli.CIDFiles { + content, err := ioutil.ReadFile(cidFile) + if err != nil { + return nil, nil, errors.Wrap(err, "error reading CIDFile") + } + id := strings.Split(string(content), "\n")[0] + names = append(names, id) + } + + ctrs, err := shortcuts.GetContainersByContext(cli.All, cli.Latest, names, r.Runtime) if err != nil { // Failed to get containers. If force is specified, get the containers ID // and evict them diff --git a/pkg/adapter/containers_remote.go b/pkg/adapter/containers_remote.go index 20471d895..e34b8ffd9 100644 --- a/pkg/adapter/containers_remote.go +++ b/pkg/adapter/containers_remote.go @@ -178,7 +178,7 @@ func (r *LocalRuntime) LookupContainersWithStatus(filters []string) ([]*Containe if err != nil { return nil, err } - // This is not performance savy; if this turns out to be a problematic series of lookups, we need to + // This is not performance savvy; if this turns out to be a problematic series of lookups, we need to // create a new endpoint to speed things up for _, ctr := range ctrs { container, err := r.LookupContainer(ctr.Id) @@ -617,7 +617,7 @@ func (r *LocalRuntime) Checkpoint(c *cliconfig.CheckpointValues) error { return err } if c.All { - // We dont have a great way to get all the running containers, so need to get all and then + // We don't have a great way to get all the running containers, so need to get all and then // check status on them bc checkpoint considers checkpointing a stopped container an error var runningIds []string for _, id := range ids { @@ -660,7 +660,7 @@ func (r *LocalRuntime) Restore(ctx context.Context, c *cliconfig.RestoreValues) return err } if c.All { - // We dont have a great way to get all the exited containers, so need to get all and then + // We don't have a great way to get all the exited containers, so need to get all and then // check status on them bc checkpoint considers restoring a running container an error var exitedIDs []string for _, id := range ids { diff --git a/pkg/adapter/pods.go b/pkg/adapter/pods.go index 85f93ed3e..d73a8b21b 100644 --- a/pkg/adapter/pods.go +++ b/pkg/adapter/pods.go @@ -17,6 +17,7 @@ import ( "github.com/containers/libpod/libpod" "github.com/containers/libpod/libpod/image" "github.com/containers/libpod/pkg/adapter/shortcuts" + ann "github.com/containers/libpod/pkg/annotations" ns "github.com/containers/libpod/pkg/namespaces" createconfig "github.com/containers/libpod/pkg/spec" "github.com/containers/libpod/pkg/util" @@ -36,7 +37,7 @@ const ( ) // PodContainerStats is struct containing an adapter Pod and a libpod -// ContainerStats and is used primarily for outputing pod stats. +// ContainerStats and is used primarily for outputting pod stats. type PodContainerStats struct { Pod *Pod ContainerStats map[string]*libpod.ContainerStats @@ -595,12 +596,17 @@ func (r *LocalRuntime) PlayKubeYAML(ctx context.Context, c *cliconfig.KubePlayVa volumes[volume.Name] = hostPath.Path } + seccompPaths, err := initializeSeccompPaths(podYAML.ObjectMeta.Annotations) + if err != nil { + return nil, err + } + for _, container := range podYAML.Spec.Containers { newImage, err := r.ImageRuntime().New(ctx, container.Image, c.SignaturePolicy, c.Authfile, writer, &dockerRegistryOptions, image.SigningOptions{}, nil, util.PullImageMissing) if err != nil { return nil, err } - createConfig, err := kubeContainerToCreateConfig(ctx, container, r.Runtime, newImage, namespaces, volumes, pod.ID()) + createConfig, err := kubeContainerToCreateConfig(ctx, container, r.Runtime, newImage, namespaces, volumes, pod.ID(), podInfraID, seccompPaths) if err != nil { return nil, err } @@ -719,7 +725,7 @@ func setupSecurityContext(securityConfig *createconfig.SecurityConfig, userConfi } // kubeContainerToCreateConfig takes a v1.Container and returns a createconfig describing a container -func kubeContainerToCreateConfig(ctx context.Context, containerYAML v1.Container, runtime *libpod.Runtime, newImage *image.Image, namespaces map[string]string, volumes map[string]string, podID string) (*createconfig.CreateConfig, error) { +func kubeContainerToCreateConfig(ctx context.Context, containerYAML v1.Container, runtime *libpod.Runtime, newImage *image.Image, namespaces map[string]string, volumes map[string]string, podID, infraID string, seccompPaths *kubeSeccompPaths) (*createconfig.CreateConfig, error) { var ( containerConfig createconfig.CreateConfig pidConfig createconfig.PidConfig @@ -751,11 +757,7 @@ func kubeContainerToCreateConfig(ctx context.Context, containerYAML v1.Container setupSecurityContext(&securityConfig, &userConfig, containerYAML) - var err error - containerConfig.Security.SeccompProfilePath, err = libpod.DefaultSeccompPath() - if err != nil { - return nil, err - } + securityConfig.SeccompProfilePath = seccompPaths.findForContainer(containerConfig.Name) containerConfig.Command = []string{} if imageData != nil && imageData.Config != nil { @@ -800,6 +802,13 @@ func kubeContainerToCreateConfig(ctx context.Context, containerYAML v1.Container // Set default environment variables and incorporate data from image, if necessary envs := shared.EnvVariablesFromData(imageData) + annotations := make(map[string]string) + if infraID != "" { + annotations[ann.SandboxID] = infraID + annotations[ann.ContainerType] = ann.ContainerTypeContainer + } + containerConfig.Annotations = annotations + // Environment Variables for _, e := range containerYAML.Env { envs[e.Name] = e.Value @@ -818,3 +827,80 @@ func kubeContainerToCreateConfig(ctx context.Context, containerYAML v1.Container } return &containerConfig, nil } + +// kubeSeccompPaths holds information about a pod YAML's seccomp configuration +// it holds both container and pod seccomp paths +type kubeSeccompPaths struct { + containerPaths map[string]string + podPath string +} + +// findForContainer checks whether a container has a seccomp path configured for it +// if not, it returns the podPath, which should always have a value +func (k *kubeSeccompPaths) findForContainer(ctrName string) string { + if path, ok := k.containerPaths[ctrName]; ok { + return path + } + return k.podPath +} + +// initializeSeccompPaths takes annotations from the pod object metadata and finds annotations pertaining to seccomp +// it parses both pod and container level +func initializeSeccompPaths(annotations map[string]string) (*kubeSeccompPaths, error) { + seccompPaths := &kubeSeccompPaths{containerPaths: make(map[string]string)} + var err error + if annotations != nil { + for annKeyValue, seccomp := range annotations { + // check if it is prefaced with container.seccomp.security.alpha.kubernetes.io/ + prefixAndCtr := strings.Split(annKeyValue, "/") + if prefixAndCtr[0]+"/" != v1.SeccompContainerAnnotationKeyPrefix { + continue + } else if len(prefixAndCtr) != 2 { + // this could be caused by a user inputting either of + // container.seccomp.security.alpha.kubernetes.io{,/} + // both of which are invalid + return nil, errors.Errorf("Invalid seccomp path: %s", prefixAndCtr[0]) + } + + path, err := verifySeccompPath(seccomp) + if err != nil { + return nil, err + } + seccompPaths.containerPaths[prefixAndCtr[1]] = path + } + + podSeccomp, ok := annotations[v1.SeccompPodAnnotationKey] + if ok { + seccompPaths.podPath, err = verifySeccompPath(podSeccomp) + } else { + seccompPaths.podPath, err = libpod.DefaultSeccompPath() + } + if err != nil { + return nil, err + } + } + return seccompPaths, nil +} + +// verifySeccompPath takes a path and checks whether it is a default, unconfined, or a path +// the available options are parsed as defined in https://kubernetes.io/docs/concepts/policy/pod-security-policy/#seccomp +func verifySeccompPath(path string) (string, error) { + switch path { + case v1.DeprecatedSeccompProfileDockerDefault: + fallthrough + case v1.SeccompProfileRuntimeDefault: + return libpod.DefaultSeccompPath() + case "unconfined": + return path, nil + default: + // TODO we have an inconsistency here + // k8s parses `localhost/<path>` which is found at `<seccomp_root>` + // we currently parse `localhost:<seccomp_root>/<path> + // to fully conform, we need to find a good location for the seccomp root + parts := strings.Split(path, ":") + if parts[0] == "localhost" { + return parts[1], nil + } + return "", errors.Errorf("invalid seccomp path: %s", path) + } +} diff --git a/pkg/adapter/pods_remote.go b/pkg/adapter/pods_remote.go index 0c62ac923..16d34769e 100644 --- a/pkg/adapter/pods_remote.go +++ b/pkg/adapter/pods_remote.go @@ -19,7 +19,7 @@ import ( ) // PodContainerStats is struct containing an adapter Pod and a libpod -// ContainerStats and is used primarily for outputing pod stats. +// ContainerStats and is used primarily for outputting pod stats. type PodContainerStats struct { Pod *Pod ContainerStats map[string]*libpod.ContainerStats diff --git a/pkg/adapter/runtime_remote.go b/pkg/adapter/runtime_remote.go index 32eb934bf..ddd4b5271 100644 --- a/pkg/adapter/runtime_remote.go +++ b/pkg/adapter/runtime_remote.go @@ -450,7 +450,7 @@ func (r *LocalRuntime) GetFileFromRemoteHost(remoteFilePath, outputPath string, reader := r.Conn.Reader if _, err := io.CopyN(writer, reader, length); err != nil { - return errors.Wrap(err, "file transer failed") + return errors.Wrap(err, "file transfer failed") } return nil } diff --git a/pkg/hooks/docs/oci-hooks.5.md b/pkg/hooks/docs/oci-hooks.5.md index 0a01e1bb8..b50a6bddc 100644 --- a/pkg/hooks/docs/oci-hooks.5.md +++ b/pkg/hooks/docs/oci-hooks.5.md @@ -21,7 +21,7 @@ The default directory is `/usr/share/containers/oci/hooks.d`, but tools consumin If multiple directories are configured, a JSON filename in a preferred directory masks entries with the same filename in directories with lower precedence. For example, if a consuming tool watches for hooks in `/etc/containers/oci/hooks.d` and `/usr/share/containers/oci/hooks.d` (in order of decreasing precedence), then a hook definition in `/etc/containers/oci/hooks.d/01-my-hook.json` will mask any definition in `/usr/share/containers/oci/hooks.d/01-my-hook.json`. -Tools consuming this format may also opt to monitor the hook directries for changes, in which case they will notice additions, changes, and removals to JSON files without needing to be restarted or otherwise signaled. When the tool monitors multiple hooks directories, the precedence discussed in the previous paragraph still applies. For example, if a consuming tool watches for hooks in `/etc/containers/oci/hooks.d` and `/usr/share/containers/oci/hooks.d` (in order of decreasing precedence), then writing a new hook definition to `/etc/containers/oci/hooks.d/01-my-hook.json` will mask the hook previously loaded from `/usr/share/containers/oci/hooks.d/01-my-hook.json`. Subsequent changes to `/usr/share/containers/oci/hooks.d/01-my-hook.json` will have no effect on the consuming tool as long as `/etc/containers/oci/hooks.d/01-my-hook.json` exists. Removing `/etc/containers/oci/hooks.d/01-my-hook.json` will reload the hook from `/usr/share/containers/oci/hooks.d/01-my-hook.json`. +Tools consuming this format may also opt to monitor the hook directories for changes, in which case they will notice additions, changes, and removals to JSON files without needing to be restarted or otherwise signaled. When the tool monitors multiple hooks directories, the precedence discussed in the previous paragraph still applies. For example, if a consuming tool watches for hooks in `/etc/containers/oci/hooks.d` and `/usr/share/containers/oci/hooks.d` (in order of decreasing precedence), then writing a new hook definition to `/etc/containers/oci/hooks.d/01-my-hook.json` will mask the hook previously loaded from `/usr/share/containers/oci/hooks.d/01-my-hook.json`. Subsequent changes to `/usr/share/containers/oci/hooks.d/01-my-hook.json` will have no effect on the consuming tool as long as `/etc/containers/oci/hooks.d/01-my-hook.json` exists. Removing `/etc/containers/oci/hooks.d/01-my-hook.json` will reload the hook from `/usr/share/containers/oci/hooks.d/01-my-hook.json`. Hooks are injected in the order obtained by sorting the JSON file names, after converting them to lower case, based on their Unicode code points. For example, a matching hook defined in `01-my-hook.json` would be injected before matching hooks defined in `02-another-hook.json` and `01-UPPERCASE.json`. diff --git a/pkg/spec/storage.go b/pkg/spec/storage.go index 79c065b5d..dbdab0030 100644 --- a/pkg/spec/storage.go +++ b/pkg/spec/storage.go @@ -136,9 +136,9 @@ func (config *CreateConfig) parseVolumes(runtime *libpod.Runtime) ([]spec.Mount, unifiedMounts[initMount.Destination] = initMount } - // Before superceding, we need to find volume mounts which conflict with + // Before superseding, we need to find volume mounts which conflict with // named volumes, and vice versa. - // We'll delete the conflicts here as we supercede. + // We'll delete the conflicts here as we supersede. for dest := range unifiedMounts { if _, ok := baseVolumes[dest]; ok { delete(baseVolumes, dest) @@ -150,7 +150,7 @@ func (config *CreateConfig) parseVolumes(runtime *libpod.Runtime) ([]spec.Mount, } } - // Supercede volumes-from/image volumes with unified volumes from above. + // Supersede volumes-from/image volumes with unified volumes from above. // This is an unconditional replacement. for dest, mount := range unifiedMounts { baseMounts[dest] = mount @@ -336,7 +336,7 @@ func (config *CreateConfig) getMounts() (map[string]spec.Mount, map[string]*libp // TODO(vrothberg): the manual parsing can be replaced with a regular expression // to allow a more robust parsing of the mount format and to give - // precise errors regarding supported format versus suppored options. + // precise errors regarding supported format versus supported options. for _, mount := range config.MountsFlag { arr := strings.SplitN(mount, ",", 2) if len(arr) < 2 { @@ -820,7 +820,7 @@ func (config *CreateConfig) addContainerInitBinary(path string) (spec.Mount, err return mount, nil } -// Supercede existing mounts in the spec with new, user-specified mounts. +// Supersede existing mounts in the spec with new, user-specified mounts. // TODO: Should we unmount subtree mounts? E.g., if /tmp/ is mounted by // one mount, and we already have /tmp/a and /tmp/b, should we remove // the /tmp/a and /tmp/b mounts in favor of the more general /tmp? diff --git a/pkg/trust/trust.go b/pkg/trust/trust.go index b1febbe81..60de099fa 100644 --- a/pkg/trust/trust.go +++ b/pkg/trust/trust.go @@ -139,7 +139,7 @@ func LoadAndMergeConfig(dirPath string) (*RegistryConfiguration, error) { return &mergedConfig, nil } -// HaveMatchRegistry checks if trust settings for the registry have been configed in yaml file +// HaveMatchRegistry checks if trust settings for the registry have been configured in yaml file func HaveMatchRegistry(key string, registryConfigs *RegistryConfiguration) *RegistryNamespace { searchKey := key if !strings.Contains(searchKey, "/") { diff --git a/pkg/util/utils.go b/pkg/util/utils.go index 633d8a124..6906b26d5 100644 --- a/pkg/util/utils.go +++ b/pkg/util/utils.go @@ -84,7 +84,7 @@ func ParseChanges(option string) (key string, vals []string, err error) { if len(tokens) < 2 { return "", []string{}, fmt.Errorf("invalid key value %s", option) } - key = strings.Trim(tokens[0], " ") // Need to trim whitespace part of delimeter. + key = strings.Trim(tokens[0], " ") // Need to trim whitespace part of delimiter. val = tokens[1] if strings.Contains(tokens[1], "[") && strings.Contains(tokens[1], "]") { //Trim '[',']' if exist. diff --git a/test/e2e/build/basicalpine/Containerfile b/test/e2e/build/basicalpine/Containerfile new file mode 100644 index 000000000..67fd37901 --- /dev/null +++ b/test/e2e/build/basicalpine/Containerfile @@ -0,0 +1 @@ +FROM alpine diff --git a/test/e2e/build/context_dir_a_file b/test/e2e/build/context_dir_a_file new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/test/e2e/build/context_dir_a_file diff --git a/test/e2e/build/squash/Dockerfile.squash-a b/test/e2e/build/squash/Dockerfile.squash-a new file mode 100644 index 000000000..f084e093d --- /dev/null +++ b/test/e2e/build/squash/Dockerfile.squash-a @@ -0,0 +1,2 @@ +FROM busybox:latest +ADD alpinetest.tgz /data diff --git a/test/e2e/build/squash/Dockerfile.squash-b b/test/e2e/build/squash/Dockerfile.squash-b new file mode 100644 index 000000000..4c5fdb153 --- /dev/null +++ b/test/e2e/build/squash/Dockerfile.squash-b @@ -0,0 +1,2 @@ +FROM test-squash-a:latest +RUN rm -rf /data diff --git a/test/e2e/build/squash/Dockerfile.squash-c b/test/e2e/build/squash/Dockerfile.squash-c new file mode 100644 index 000000000..df9c90388 --- /dev/null +++ b/test/e2e/build/squash/Dockerfile.squash-c @@ -0,0 +1,3 @@ +FROM busybox:latest +ADD alpinetest.tgz /data +RUN rm -rf /data diff --git a/test/e2e/build/squash/alpinetest.tgz b/test/e2e/build/squash/alpinetest.tgz Binary files differnew file mode 100644 index 000000000..9b8e7bda7 --- /dev/null +++ b/test/e2e/build/squash/alpinetest.tgz diff --git a/test/e2e/build_test.go b/test/e2e/build_test.go new file mode 100644 index 000000000..71f5d1b02 --- /dev/null +++ b/test/e2e/build_test.go @@ -0,0 +1,108 @@ +// +build !remoteclient + +package integration + +import ( + "os" + "strings" + + . "github.com/containers/libpod/test/utils" + . "github.com/onsi/ginkgo" + . "github.com/onsi/gomega" +) + +var _ = Describe("Podman build", func() { + var ( + tempdir string + err error + podmanTest *PodmanTestIntegration + ) + + BeforeEach(func() { + tempdir, err = CreateTempDirInTempDir() + if err != nil { + os.Exit(1) + } + podmanTest = PodmanTestCreate(tempdir) + podmanTest.Setup() + podmanTest.RestoreAllArtifacts() + }) + + AfterEach(func() { + podmanTest.Cleanup() + f := CurrentGinkgoTestDescription() + processTestResult(f) + }) + + // Let's first do the most simple build possible to make sure stuff is + // happy and then clean up after ourselves to make sure that works too. + It("podman build and remove basic alpine", func() { + session := podmanTest.PodmanNoCache([]string{"build", "build/basicalpine"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + session = podmanTest.PodmanNoCache([]string{"rmi", "alpine"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + }) + + // If the context directory is pointing at a file and not a directory, + // that's a no no, fail out. + It("podman build context directory a file", func() { + session := podmanTest.PodmanNoCache([]string{"build", "build/context_dir_a_file"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(125)) + }) + + // Check that builds with different values for the squash options + // create the appropriate number of layers, then clean up after. + It("podman build basic alpine with squash", func() { + session := podmanTest.PodmanNoCache([]string{"build", "-f", "build/squash/Dockerfile.squash-a", "-t", "test-squash-a:latest", "build/squash"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + session = podmanTest.PodmanNoCache([]string{"inspect", "--format", "{{.RootFS.Layers}}", "test-squash-a"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + // Check for two layers + Expect(len(strings.Fields(session.OutputToString()))).To(Equal(2)) + + session = podmanTest.PodmanNoCache([]string{"build", "-f", "build/squash/Dockerfile.squash-b", "--squash", "-t", "test-squash-b:latest", "build/squash"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + session = podmanTest.PodmanNoCache([]string{"inspect", "--format", "{{.RootFS.Layers}}", "test-squash-b"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + // Check for three layers + Expect(len(strings.Fields(session.OutputToString()))).To(Equal(3)) + + session = podmanTest.PodmanNoCache([]string{"build", "-f", "build/squash/Dockerfile.squash-c", "--squash", "-t", "test-squash-c:latest", "build/squash"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + session = podmanTest.PodmanNoCache([]string{"inspect", "--format", "{{.RootFS.Layers}}", "test-squash-c"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + // Check for two layers + Expect(len(strings.Fields(session.OutputToString()))).To(Equal(2)) + + session = podmanTest.PodmanNoCache([]string{"build", "-f", "build/squash/Dockerfile.squash-c", "--squash-all", "-t", "test-squash-d:latest", "build/squash"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + session = podmanTest.PodmanNoCache([]string{"inspect", "--format", "{{.RootFS.Layers}}", "test-squash-d"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + // Check for one layers + Expect(len(strings.Fields(session.OutputToString()))).To(Equal(1)) + + session = podmanTest.PodmanNoCache([]string{"rm", "-a"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + session = podmanTest.PodmanNoCache([]string{"rmi", "-a", "-f"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + }) +}) diff --git a/test/e2e/common_test.go b/test/e2e/common_test.go index b390df8b2..16b971e65 100644 --- a/test/e2e/common_test.go +++ b/test/e2e/common_test.go @@ -559,3 +559,12 @@ func (p *PodmanTestIntegration) RunHealthCheck(cid string) error { } return errors.Errorf("unable to detect %s as running", cid) } + +func (p *PodmanTestIntegration) CreateSeccompJson(in []byte) (string, error) { + jsonFile := filepath.Join(p.TempDir, "seccomp.json") + err := WriteJsonFile(in, jsonFile) + if err != nil { + return "", err + } + return jsonFile, nil +} diff --git a/test/e2e/images_test.go b/test/e2e/images_test.go index e125c62b4..80e6d4444 100644 --- a/test/e2e/images_test.go +++ b/test/e2e/images_test.go @@ -360,7 +360,6 @@ LABEL "com.example.vendor"="Example Vendor" session.WaitWithDefaultTimeout() Expect(session.ExitCode()).To(Equal(0)) output = session.OutputToString() - Expect(output).To(Not(MatchRegexp("<missing>"))) Expect(output).To(Not(MatchRegexp("error"))) session = podmanTest.Podman([]string{"history", "--quiet", "foo"}) diff --git a/test/e2e/play_kube_test.go b/test/e2e/play_kube_test.go index 416c64b5a..29c60d7ac 100644 --- a/test/e2e/play_kube_test.go +++ b/test/e2e/play_kube_test.go @@ -3,6 +3,7 @@ package integration import ( + "fmt" "os" "path/filepath" "text/template" @@ -20,6 +21,13 @@ metadata: labels: app: {{ .Name }} name: {{ .Name }} +{{ with .Annotations }} + annotations: + {{ range $key, $value := . }} + {{ $key }}: {{ $value }} + {{ end }} +{{ end }} + spec: hostname: {{ .Hostname }} containers: @@ -72,6 +80,7 @@ var ( defaultCtrCmd = []string{"top"} defaultCtrImage = ALPINE defaultPodName = "testPod" + seccompPwdEPERM = []byte(`{"defaultAction":"SCMP_ACT_ALLOW","syscalls":[{"name":"getcwd","action":"SCMP_ACT_ERRNO"}]}`) ) func generateKubeYaml(pod *Pod, fileName string) error { @@ -95,16 +104,17 @@ func generateKubeYaml(pod *Pod, fileName string) error { // Pod describes the options a kube yaml can be configured at pod level type Pod struct { - Name string - Hostname string - Ctrs []*Ctr + Name string + Hostname string + Ctrs []*Ctr + Annotations map[string]string } // getPod takes a list of podOptions and returns a pod with sane defaults // and the configured options // if no containers are added, it will add the default container func getPod(options ...podOption) *Pod { - p := Pod{defaultPodName, "", make([]*Ctr, 0)} + p := Pod{defaultPodName, "", make([]*Ctr, 0), make(map[string]string)} for _, option := range options { option(&p) } @@ -128,6 +138,12 @@ func withCtr(c *Ctr) podOption { } } +func withAnnotation(k, v string) podOption { + return func(pod *Pod) { + pod.Annotations[k] = v + } +} + // Ctr describes the options a kube yaml can be configured at container level type Ctr struct { Name string @@ -330,4 +346,51 @@ var _ = Describe("Podman generate kube", func() { inspect.WaitWithDefaultTimeout() Expect(inspect.ExitCode()).To(Equal(0)) }) + + It("podman play kube seccomp container level", func() { + // expect play kube is expected to set a seccomp label if it's applied as an annotation + jsonFile, err := podmanTest.CreateSeccompJson(seccompPwdEPERM) + if err != nil { + fmt.Println(err) + Skip("Failed to prepare seccomp.json for test.") + } + + ctrAnnotation := "container.seccomp.security.alpha.kubernetes.io/" + defaultCtrName + ctr := getCtr(withCmd([]string{"pwd"})) + + err = generateKubeYaml(getPod(withCtr(ctr), withAnnotation(ctrAnnotation, "localhost:"+jsonFile)), kubeYaml) + Expect(err).To(BeNil()) + + kube := podmanTest.Podman([]string{"play", "kube", kubeYaml}) + kube.WaitWithDefaultTimeout() + Expect(kube.ExitCode()).To(Equal(0)) + + logs := podmanTest.Podman([]string{"logs", defaultCtrName}) + logs.WaitWithDefaultTimeout() + Expect(logs.ExitCode()).To(Equal(0)) + Expect(logs.OutputToString()).To(ContainSubstring("Operation not permitted")) + }) + + It("podman play kube seccomp pod level", func() { + // expect play kube is expected to set a seccomp label if it's applied as an annotation + jsonFile, err := podmanTest.CreateSeccompJson(seccompPwdEPERM) + if err != nil { + fmt.Println(err) + Skip("Failed to prepare seccomp.json for test.") + } + + ctr := getCtr(withCmd([]string{"pwd"})) + + err = generateKubeYaml(getPod(withCtr(ctr), withAnnotation("seccomp.security.alpha.kubernetes.io/pod", "localhost:"+jsonFile)), kubeYaml) + Expect(err).To(BeNil()) + + kube := podmanTest.Podman([]string{"play", "kube", kubeYaml}) + kube.WaitWithDefaultTimeout() + Expect(kube.ExitCode()).To(Equal(0)) + + logs := podmanTest.Podman([]string{"logs", defaultCtrName}) + logs.WaitWithDefaultTimeout() + Expect(logs.ExitCode()).To(Equal(0)) + Expect(logs.OutputToString()).To(ContainSubstring("Operation not permitted")) + }) }) diff --git a/test/e2e/pull_test.go b/test/e2e/pull_test.go index eee0b131b..96340ef30 100644 --- a/test/e2e/pull_test.go +++ b/test/e2e/pull_test.go @@ -339,7 +339,7 @@ var _ = Describe("Podman pull", func() { }) It("podman pull check all tags", func() { - session := podmanTest.PodmanNoCache([]string{"pull", "--all-tags", "alpine"}) + session := podmanTest.PodmanNoCache([]string{"pull", "--all-tags", "k8s.gcr.io/pause"}) session.WaitWithDefaultTimeout() Expect(session.ExitCode()).To(Equal(0)) Expect(session.LineInOuputStartsWith("Pulled Images:")).To(BeTrue()) @@ -348,10 +348,6 @@ var _ = Describe("Podman pull", func() { session.WaitWithDefaultTimeout() Expect(session.ExitCode()).To(Equal(0)) Expect(len(session.OutputToStringArray())).To(BeNumerically(">", 4)) - - rmi := podmanTest.PodmanNoCache([]string{"rmi", "-a", "-f"}) - rmi.WaitWithDefaultTimeout() - Expect(rmi.ExitCode()).To(Equal(0)) }) It("podman pull from docker with nonexist --authfile", func() { diff --git a/test/e2e/rm_test.go b/test/e2e/rm_test.go index 8ee7dc750..531f14feb 100644 --- a/test/e2e/rm_test.go +++ b/test/e2e/rm_test.go @@ -1,6 +1,7 @@ package integration import ( + "io/ioutil" "os" . "github.com/containers/libpod/test/utils" @@ -138,11 +139,86 @@ var _ = Describe("Podman rm", func() { }) + It("podman rm --cidfile", func() { + SkipIfRemote() + + tmpDir, err := ioutil.TempDir("", "") + Expect(err).To(BeNil()) + tmpFile := tmpDir + "cid" + + defer os.RemoveAll(tmpDir) + + session := podmanTest.Podman([]string{"create", "--cidfile", tmpFile, ALPINE, "ls"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + cid := session.OutputToStringArray()[0] + Expect(podmanTest.NumberOfContainers()).To(Equal(1)) + + result := podmanTest.Podman([]string{"rm", "--cidfile", tmpFile}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(0)) + output := result.OutputToString() + Expect(output).To(ContainSubstring(cid)) + Expect(podmanTest.NumberOfContainers()).To(Equal(0)) + }) + + It("podman rm multiple --cidfile", func() { + SkipIfRemote() + + tmpDir, err := ioutil.TempDir("", "") + Expect(err).To(BeNil()) + tmpFile1 := tmpDir + "cid-1" + tmpFile2 := tmpDir + "cid-2" + + defer os.RemoveAll(tmpDir) + + session := podmanTest.Podman([]string{"create", "--cidfile", tmpFile1, ALPINE, "ls"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + cid1 := session.OutputToStringArray()[0] + Expect(podmanTest.NumberOfContainers()).To(Equal(1)) + + session = podmanTest.Podman([]string{"create", "--cidfile", tmpFile2, ALPINE, "ls"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + cid2 := session.OutputToStringArray()[0] + Expect(podmanTest.NumberOfContainers()).To(Equal(2)) + + result := podmanTest.Podman([]string{"rm", "--cidfile", tmpFile1, "--cidfile", tmpFile2}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(0)) + output := result.OutputToString() + Expect(output).To(ContainSubstring(cid1)) + Expect(output).To(ContainSubstring(cid2)) + Expect(podmanTest.NumberOfContainers()).To(Equal(0)) + }) + + It("podman rm invalid --latest and --cidfile and --all", func() { + SkipIfRemote() + + result := podmanTest.Podman([]string{"rm", "--cidfile", "foobar", "--latest"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + + result = podmanTest.Podman([]string{"rm", "--cidfile", "foobar", "--all"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + + result = podmanTest.Podman([]string{"rm", "--cidfile", "foobar", "--all", "--latest"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + + result = podmanTest.Podman([]string{"rm", "--latest", "--all"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + }) + It("podman rm bogus container", func() { session := podmanTest.Podman([]string{"rm", "bogus"}) session.WaitWithDefaultTimeout() Expect(session.ExitCode()).To(Equal(1)) }) + It("podman rm bogus container and a running container", func() { session := podmanTest.RunTopContainer("test1") session.WaitWithDefaultTimeout() diff --git a/test/e2e/run_test.go b/test/e2e/run_test.go index 7fc85c9ce..72547ea00 100644 --- a/test/e2e/run_test.go +++ b/test/e2e/run_test.go @@ -160,9 +160,9 @@ var _ = Describe("Podman run", func() { }) It("podman run seccomp test", func() { - jsonFile := filepath.Join(podmanTest.TempDir, "seccomp.json") + in := []byte(`{"defaultAction":"SCMP_ACT_ALLOW","syscalls":[{"name":"getcwd","action":"SCMP_ACT_ERRNO"}]}`) - err := WriteJsonFile(in, jsonFile) + jsonFile, err := podmanTest.CreateSeccompJson(in) if err != nil { fmt.Println(err) Skip("Failed to prepare seccomp.json for test.") diff --git a/test/e2e/stop_test.go b/test/e2e/stop_test.go index 77ab6dbb0..c76cccfef 100644 --- a/test/e2e/stop_test.go +++ b/test/e2e/stop_test.go @@ -1,6 +1,7 @@ package integration import ( + "io/ioutil" "os" "strings" @@ -215,4 +216,79 @@ var _ = Describe("Podman stop", func() { Expect(strings.TrimSpace(finalCtrs.OutputToString())).To(Equal("")) }) + It("podman stop --cidfile", func() { + SkipIfRemote() + + tmpDir, err := ioutil.TempDir("", "") + Expect(err).To(BeNil()) + tmpFile := tmpDir + "cid" + + defer os.RemoveAll(tmpDir) + + session := podmanTest.Podman([]string{"create", "--cidfile", tmpFile, "-d", ALPINE, "top"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + cid := session.OutputToStringArray()[0] + + session = podmanTest.Podman([]string{"start", cid}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + + result := podmanTest.Podman([]string{"stop", "--cidfile", tmpFile}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(0)) + output := result.OutputToString() + Expect(output).To(ContainSubstring(cid)) + }) + + It("podman stop multiple --cidfile", func() { + SkipIfRemote() + + tmpDir, err := ioutil.TempDir("", "") + Expect(err).To(BeNil()) + tmpFile1 := tmpDir + "cid-1" + tmpFile2 := tmpDir + "cid-2" + + defer os.RemoveAll(tmpDir) + + session := podmanTest.Podman([]string{"run", "--cidfile", tmpFile1, "-d", ALPINE, "top"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + cid1 := session.OutputToStringArray()[0] + Expect(podmanTest.NumberOfContainers()).To(Equal(1)) + + session = podmanTest.Podman([]string{"run", "--cidfile", tmpFile2, "-d", ALPINE, "top"}) + session.WaitWithDefaultTimeout() + Expect(session.ExitCode()).To(Equal(0)) + cid2 := session.OutputToStringArray()[0] + Expect(podmanTest.NumberOfContainers()).To(Equal(2)) + + result := podmanTest.Podman([]string{"stop", "--cidfile", tmpFile1, "--cidfile", tmpFile2}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(0)) + output := result.OutputToString() + Expect(output).To(ContainSubstring(cid1)) + Expect(output).To(ContainSubstring(cid2)) + Expect(podmanTest.NumberOfContainers()).To(Equal(2)) + }) + + It("podman stop invalid --latest and --cidfile and --all", func() { + SkipIfRemote() + + result := podmanTest.Podman([]string{"stop", "--cidfile", "foobar", "--latest"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + + result = podmanTest.Podman([]string{"stop", "--cidfile", "foobar", "--all"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + + result = podmanTest.Podman([]string{"stop", "--cidfile", "foobar", "--all", "--latest"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + + result = podmanTest.Podman([]string{"stop", "--latest", "--all"}) + result.WaitWithDefaultTimeout() + Expect(result.ExitCode()).To(Equal(125)) + }) }) diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod index b3846826b..50b9d6e2e 100644 --- a/vendor/github.com/Microsoft/go-winio/go.mod +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -5,5 +5,5 @@ go 1.12 require ( github.com/pkg/errors v0.8.1 github.com/sirupsen/logrus v1.4.1 - golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 ) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum index babb4a70d..209aa8cf4 100644 --- a/vendor/github.com/Microsoft/go-winio/go.sum +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -14,3 +14,5 @@ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXf golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 000000000..47d7650fb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,54 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +# Lock down runhcs config + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" +target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" +target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +]
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml index a8ec5a593..7f0f81632 100644 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml @@ -8,22 +8,34 @@ environment: GOPATH: c:\gopath PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% -stack: go 1.11 +stack: go 1.12.9 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer + - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 + - go build ./cmd/wclayer + - go build ./internal/tools/grantvmgroupaccess + - go build ./internal/tools/uvmboot + - go build ./internal/tools/zapdir - go test -v ./... -tags admin + - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional + - go test -c ./test/cri-containerd/ -tags functional - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration + - go test -c ./test/runhcs/ -tags functional artifacts: - - path: 'wclayer.exe' + - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' + - path: 'wclayer.exe' + - path: 'grantvmgroupaccess.exe' + - path: 'uvmboot.exe' + - path: 'zapdir.exe' + - path: 'containerd-shim-runhcs-v1.test.exe' + - path: 'cri-containerd.test.exe' - path: 'functional.test.exe' - path: 'runhcs.test.exe'
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c3154..53c0a3854 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcessNoStdio(c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 000000000..5f76d444d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,37 @@ +module github.com/Microsoft/hcsshim + +go 1.12 + +require ( + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/prometheus/procfs v0.0.5 // indirect + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 000000000..578b78e81 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,131 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c4..09b3860a7 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 000000000..8193315f0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,83 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfef..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c030..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4b..62ba81751 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b56535..9a4705a49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbcf..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a2..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf9..d366f629f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,45 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,7 +55,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -86,120 +83,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) if err != nil { - return makeProcessError(process, operation, err, nil) + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") - return nil + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) - } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; but this function can only +// be called once on each Process. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,96 +334,116 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + if process.stdin != nil { + process.stdin.Close() + } return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + if process.stdin != nil { + process.stdin.Close() + } + if process.stdout != nil { + process.stdout.Close() + } + if process.stderr != nil { + process.stderr.Close() + } + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b242524..98df25bd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,24 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,49 +44,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, - } -} - -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" + id: id, + waitBlock: make(chan struct{}), } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) } // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + computeSystem.handle = handle defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) + if err != nil { + computeSystem.Close() } }() + if err = computeSystem.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } + return computeSystem, nil +} - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) if err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, events) + return err } - - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, nil) + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" } + return nil +} - return computeSystem, nil +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" } // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -271,360 +255,388 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError +} - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::System::Properties" + + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - return nil + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + return properties, nil } -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +// PropertiesV2 returns the requested container properties targeting a V2 schema container. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::PropertiesV2" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + properties := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) + } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) +// CreateProcessNoStdio launches a new process within the computeSystem. The +// Stdio handles are not cached on the process struct. +func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) { + operation := "hcsshim::System::CreateProcessNoStdio" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() + + // We don't do anything with these handles. Close them so they don't leak. + syscall.Close(processInfo.StdInput) + syscall.Close(processInfo.StdOutput) + syscall.Close(processInfo.StdError) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() + + return process, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,15 +644,15 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 @@ -649,36 +661,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c57..f07f532c1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed3187..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = <syscall>(args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004c..6a1c41e15 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b263..2df4a57f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de91..b7ae96fdd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 2318a4fce..61da242ee 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -55,8 +55,9 @@ type PaPolicy struct { type OutboundNatPolicy struct { Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` } type ActionType string diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029e..922f7c679 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 000000000..ba6b1a4a5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 000000000..f428bdaf7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 000000000..fee4765cb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ace..fb23617f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc2..bcfeb34d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779eab..c1ea3953b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707a..b4f9c315b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d5..8bf8cab60 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d285..10cea67e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d9..1d5dfe68a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -}
\ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe5..68aa04a57 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28bc..4fb231076 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e21..1fd7ca5d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c571..781a88401 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f71..85450c41e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe4..fe86cab65 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa76735..af8280048 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c3..8838519a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c5..ea3084bca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8dd..23b2ee9e7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c1..a017691f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef12..176c49d49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3b..9b86a4045 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604a..208074e9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3a..ec93d004e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go index 27d0b8c48..b4a36954d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -22,4 +22,9 @@ type Memory2 struct { // EnableDeferredCommit is private in the schema. If regenerated need to add back. EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dffd..811779b04 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,8 +10,7 @@ package hcsschema type MemoryInformationForVm struct { - - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f6..906ba597f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,10 +11,9 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` - - MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c2..a9c750b34 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827c..e5ea187a2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d179..d96c9501f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae2..21707a88e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e1..29d8c8012 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817a..41f8fdea0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8f..e9a662dd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d0..e4ed095c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c55734..82b0d0532 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d150..ad9a4fa9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b0245..bb24e88da 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e7356..21fe46062 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e57..6157e2522 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,10 +11,9 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` - RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` - - RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f6..17558cba0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -9,8 +9,11 @@ package hcsschema -type Properties struct { +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) +type Properties struct { Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` @@ -44,4 +47,8 @@ type Properties struct { SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffdf..d6d80df13 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - - PropertyTypes []string `json:"PropertyTypes,omitempty"` + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go new file mode 100644 index 000000000..f092b737f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e453128..8d5f5c171 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc8..006906f6e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc60..26fde99c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f4841..3f203176c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6cd..df9baa921 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba7..825b71865 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7d..f67b08eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8a..5eaf6a7f4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93b..ba7a6b396 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,12 +15,11 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` - Uptime100ns int32 `json:"Uptime100ns,omitempty"` + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` Processor *ProcessorStats `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df1..9c5e6eb53 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d7..4f042ffd9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,12 +11,11 @@ package hcsschema // Storage runtime statistics type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` - ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` - WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` - - WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c823..834869940 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f9..0e48ece50 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2bc..3ab409d82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d12..2abfccca3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e5606..ec5d0fb93 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8ec..91a3c83d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444a..70cf2d90d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a7..362df363e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a42..915e9b638 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279d..75196bd8c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f628667..8e1836dd6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,14 +10,13 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` - ReservedMemory int32 `json:"ReservedMemory,omitempty"` + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` - AssignedMemory int32 `json:"AssignedMemory,omitempty"` + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` SlpActive bool `json:"SlpActive,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc8..8ed7e566d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 000000000..7c2a0dc28 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,565 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc87..0f2a69f6a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 651676fb2..b3b431e35 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,7 +1,13 @@ package wclayer import ( + "os" + "path/filepath" + "syscall" + "unsafe" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" ) @@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) { if err != nil { return hcserror.New(err, title+" - failed", "") } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bedc..443596fba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a07..06671309d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf65..a259c1b82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd8..dc40bf519 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go @@ -24,4 +24,9 @@ import "github.com/Microsoft/hcsshim/internal/guid" //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index d853ab259..67f917f07 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") @@ -57,6 +59,9 @@ var ( procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") ) func activateLayer(info *driverInfo, id string) (hr error) { @@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bbd..f60ba5501 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 916950c02..477fe7078 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -46,6 +46,12 @@ func Get() OSVersion { return osv } +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + func (osv OSVersion) ToString() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index 2d9567f6f..3488cc451 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,10 +1,27 @@ package osversion const ( - - // RS2 was a client-only release in case you're asking why it's not in the list. + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Sever 1903 (semi-annual + // channel). + V19H1 = 18362 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7c..3362c6833 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed1566..000000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb
\ No newline at end of file diff --git a/vendor/github.com/containerd/cgroups/LICENSE b/vendor/github.com/containerd/cgroups/LICENSE new file mode 100644 index 000000000..261eeb9e9 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/cgroups/stats/v1/doc.go b/vendor/github.com/containerd/cgroups/stats/v1/doc.go new file mode 100644 index 000000000..23f3cdd4b --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package v1 diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go new file mode 100644 index 000000000..c7884e8ef --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go @@ -0,0 +1,5368 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/cgroups/stats/v1/metrics.proto + +package v1 + +import ( + fmt "fmt" + _ "github.com/gogo/protobuf/gogoproto" + proto "github.com/gogo/protobuf/proto" + io "io" + math "math" + reflect "reflect" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Metrics struct { + Hugetlb []*HugetlbStat `protobuf:"bytes,1,rep,name=hugetlb,proto3" json:"hugetlb,omitempty"` + Pids *PidsStat `protobuf:"bytes,2,opt,name=pids,proto3" json:"pids,omitempty"` + CPU *CPUStat `protobuf:"bytes,3,opt,name=cpu,proto3" json:"cpu,omitempty"` + Memory *MemoryStat `protobuf:"bytes,4,opt,name=memory,proto3" json:"memory,omitempty"` + Blkio *BlkIOStat `protobuf:"bytes,5,opt,name=blkio,proto3" json:"blkio,omitempty"` + Rdma *RdmaStat `protobuf:"bytes,6,opt,name=rdma,proto3" json:"rdma,omitempty"` + Network []*NetworkStat `protobuf:"bytes,7,rep,name=network,proto3" json:"network,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Metrics) Reset() { *m = Metrics{} } +func (*Metrics) ProtoMessage() {} +func (*Metrics) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{0} +} +func (m *Metrics) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Metrics) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Metrics.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Metrics) XXX_Merge(src proto.Message) { + xxx_messageInfo_Metrics.Merge(m, src) +} +func (m *Metrics) XXX_Size() int { + return m.Size() +} +func (m *Metrics) XXX_DiscardUnknown() { + xxx_messageInfo_Metrics.DiscardUnknown(m) +} + +var xxx_messageInfo_Metrics proto.InternalMessageInfo + +type HugetlbStat struct { + Usage uint64 `protobuf:"varint,1,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,2,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,3,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + Pagesize string `protobuf:"bytes,4,opt,name=pagesize,proto3" json:"pagesize,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *HugetlbStat) Reset() { *m = HugetlbStat{} } +func (*HugetlbStat) ProtoMessage() {} +func (*HugetlbStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{1} +} +func (m *HugetlbStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *HugetlbStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_HugetlbStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *HugetlbStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_HugetlbStat.Merge(m, src) +} +func (m *HugetlbStat) XXX_Size() int { + return m.Size() +} +func (m *HugetlbStat) XXX_DiscardUnknown() { + xxx_messageInfo_HugetlbStat.DiscardUnknown(m) +} + +var xxx_messageInfo_HugetlbStat proto.InternalMessageInfo + +type PidsStat struct { + Current uint64 `protobuf:"varint,1,opt,name=current,proto3" json:"current,omitempty"` + Limit uint64 `protobuf:"varint,2,opt,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PidsStat) Reset() { *m = PidsStat{} } +func (*PidsStat) ProtoMessage() {} +func (*PidsStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{2} +} +func (m *PidsStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *PidsStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_PidsStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *PidsStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_PidsStat.Merge(m, src) +} +func (m *PidsStat) XXX_Size() int { + return m.Size() +} +func (m *PidsStat) XXX_DiscardUnknown() { + xxx_messageInfo_PidsStat.DiscardUnknown(m) +} + +var xxx_messageInfo_PidsStat proto.InternalMessageInfo + +type CPUStat struct { + Usage *CPUUsage `protobuf:"bytes,1,opt,name=usage,proto3" json:"usage,omitempty"` + Throttling *Throttle `protobuf:"bytes,2,opt,name=throttling,proto3" json:"throttling,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUStat) Reset() { *m = CPUStat{} } +func (*CPUStat) ProtoMessage() {} +func (*CPUStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{3} +} +func (m *CPUStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUStat.Merge(m, src) +} +func (m *CPUStat) XXX_Size() int { + return m.Size() +} +func (m *CPUStat) XXX_DiscardUnknown() { + xxx_messageInfo_CPUStat.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUStat proto.InternalMessageInfo + +type CPUUsage struct { + // values in nanoseconds + Total uint64 `protobuf:"varint,1,opt,name=total,proto3" json:"total,omitempty"` + Kernel uint64 `protobuf:"varint,2,opt,name=kernel,proto3" json:"kernel,omitempty"` + User uint64 `protobuf:"varint,3,opt,name=user,proto3" json:"user,omitempty"` + PerCPU []uint64 `protobuf:"varint,4,rep,packed,name=per_cpu,json=perCpu,proto3" json:"per_cpu,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUUsage) Reset() { *m = CPUUsage{} } +func (*CPUUsage) ProtoMessage() {} +func (*CPUUsage) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{4} +} +func (m *CPUUsage) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUUsage) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUUsage.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUUsage) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUUsage.Merge(m, src) +} +func (m *CPUUsage) XXX_Size() int { + return m.Size() +} +func (m *CPUUsage) XXX_DiscardUnknown() { + xxx_messageInfo_CPUUsage.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUUsage proto.InternalMessageInfo + +type Throttle struct { + Periods uint64 `protobuf:"varint,1,opt,name=periods,proto3" json:"periods,omitempty"` + ThrottledPeriods uint64 `protobuf:"varint,2,opt,name=throttled_periods,json=throttledPeriods,proto3" json:"throttled_periods,omitempty"` + ThrottledTime uint64 `protobuf:"varint,3,opt,name=throttled_time,json=throttledTime,proto3" json:"throttled_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Throttle) Reset() { *m = Throttle{} } +func (*Throttle) ProtoMessage() {} +func (*Throttle) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{5} +} +func (m *Throttle) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Throttle) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Throttle.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Throttle) XXX_Merge(src proto.Message) { + xxx_messageInfo_Throttle.Merge(m, src) +} +func (m *Throttle) XXX_Size() int { + return m.Size() +} +func (m *Throttle) XXX_DiscardUnknown() { + xxx_messageInfo_Throttle.DiscardUnknown(m) +} + +var xxx_messageInfo_Throttle proto.InternalMessageInfo + +type MemoryStat struct { + Cache uint64 `protobuf:"varint,1,opt,name=cache,proto3" json:"cache,omitempty"` + RSS uint64 `protobuf:"varint,2,opt,name=rss,proto3" json:"rss,omitempty"` + RSSHuge uint64 `protobuf:"varint,3,opt,name=rss_huge,json=rssHuge,proto3" json:"rss_huge,omitempty"` + MappedFile uint64 `protobuf:"varint,4,opt,name=mapped_file,json=mappedFile,proto3" json:"mapped_file,omitempty"` + Dirty uint64 `protobuf:"varint,5,opt,name=dirty,proto3" json:"dirty,omitempty"` + Writeback uint64 `protobuf:"varint,6,opt,name=writeback,proto3" json:"writeback,omitempty"` + PgPgIn uint64 `protobuf:"varint,7,opt,name=pg_pg_in,json=pgPgIn,proto3" json:"pg_pg_in,omitempty"` + PgPgOut uint64 `protobuf:"varint,8,opt,name=pg_pg_out,json=pgPgOut,proto3" json:"pg_pg_out,omitempty"` + PgFault uint64 `protobuf:"varint,9,opt,name=pg_fault,json=pgFault,proto3" json:"pg_fault,omitempty"` + PgMajFault uint64 `protobuf:"varint,10,opt,name=pg_maj_fault,json=pgMajFault,proto3" json:"pg_maj_fault,omitempty"` + InactiveAnon uint64 `protobuf:"varint,11,opt,name=inactive_anon,json=inactiveAnon,proto3" json:"inactive_anon,omitempty"` + ActiveAnon uint64 `protobuf:"varint,12,opt,name=active_anon,json=activeAnon,proto3" json:"active_anon,omitempty"` + InactiveFile uint64 `protobuf:"varint,13,opt,name=inactive_file,json=inactiveFile,proto3" json:"inactive_file,omitempty"` + ActiveFile uint64 `protobuf:"varint,14,opt,name=active_file,json=activeFile,proto3" json:"active_file,omitempty"` + Unevictable uint64 `protobuf:"varint,15,opt,name=unevictable,proto3" json:"unevictable,omitempty"` + HierarchicalMemoryLimit uint64 `protobuf:"varint,16,opt,name=hierarchical_memory_limit,json=hierarchicalMemoryLimit,proto3" json:"hierarchical_memory_limit,omitempty"` + HierarchicalSwapLimit uint64 `protobuf:"varint,17,opt,name=hierarchical_swap_limit,json=hierarchicalSwapLimit,proto3" json:"hierarchical_swap_limit,omitempty"` + TotalCache uint64 `protobuf:"varint,18,opt,name=total_cache,json=totalCache,proto3" json:"total_cache,omitempty"` + TotalRSS uint64 `protobuf:"varint,19,opt,name=total_rss,json=totalRss,proto3" json:"total_rss,omitempty"` + TotalRSSHuge uint64 `protobuf:"varint,20,opt,name=total_rss_huge,json=totalRssHuge,proto3" json:"total_rss_huge,omitempty"` + TotalMappedFile uint64 `protobuf:"varint,21,opt,name=total_mapped_file,json=totalMappedFile,proto3" json:"total_mapped_file,omitempty"` + TotalDirty uint64 `protobuf:"varint,22,opt,name=total_dirty,json=totalDirty,proto3" json:"total_dirty,omitempty"` + TotalWriteback uint64 `protobuf:"varint,23,opt,name=total_writeback,json=totalWriteback,proto3" json:"total_writeback,omitempty"` + TotalPgPgIn uint64 `protobuf:"varint,24,opt,name=total_pg_pg_in,json=totalPgPgIn,proto3" json:"total_pg_pg_in,omitempty"` + TotalPgPgOut uint64 `protobuf:"varint,25,opt,name=total_pg_pg_out,json=totalPgPgOut,proto3" json:"total_pg_pg_out,omitempty"` + TotalPgFault uint64 `protobuf:"varint,26,opt,name=total_pg_fault,json=totalPgFault,proto3" json:"total_pg_fault,omitempty"` + TotalPgMajFault uint64 `protobuf:"varint,27,opt,name=total_pg_maj_fault,json=totalPgMajFault,proto3" json:"total_pg_maj_fault,omitempty"` + TotalInactiveAnon uint64 `protobuf:"varint,28,opt,name=total_inactive_anon,json=totalInactiveAnon,proto3" json:"total_inactive_anon,omitempty"` + TotalActiveAnon uint64 `protobuf:"varint,29,opt,name=total_active_anon,json=totalActiveAnon,proto3" json:"total_active_anon,omitempty"` + TotalInactiveFile uint64 `protobuf:"varint,30,opt,name=total_inactive_file,json=totalInactiveFile,proto3" json:"total_inactive_file,omitempty"` + TotalActiveFile uint64 `protobuf:"varint,31,opt,name=total_active_file,json=totalActiveFile,proto3" json:"total_active_file,omitempty"` + TotalUnevictable uint64 `protobuf:"varint,32,opt,name=total_unevictable,json=totalUnevictable,proto3" json:"total_unevictable,omitempty"` + Usage *MemoryEntry `protobuf:"bytes,33,opt,name=usage,proto3" json:"usage,omitempty"` + Swap *MemoryEntry `protobuf:"bytes,34,opt,name=swap,proto3" json:"swap,omitempty"` + Kernel *MemoryEntry `protobuf:"bytes,35,opt,name=kernel,proto3" json:"kernel,omitempty"` + KernelTCP *MemoryEntry `protobuf:"bytes,36,opt,name=kernel_tcp,json=kernelTcp,proto3" json:"kernel_tcp,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryStat) Reset() { *m = MemoryStat{} } +func (*MemoryStat) ProtoMessage() {} +func (*MemoryStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{6} +} +func (m *MemoryStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryStat.Merge(m, src) +} +func (m *MemoryStat) XXX_Size() int { + return m.Size() +} +func (m *MemoryStat) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryStat.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryStat proto.InternalMessageInfo + +type MemoryEntry struct { + Limit uint64 `protobuf:"varint,1,opt,name=limit,proto3" json:"limit,omitempty"` + Usage uint64 `protobuf:"varint,2,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,3,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,4,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryEntry) Reset() { *m = MemoryEntry{} } +func (*MemoryEntry) ProtoMessage() {} +func (*MemoryEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{7} +} +func (m *MemoryEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryEntry.Merge(m, src) +} +func (m *MemoryEntry) XXX_Size() int { + return m.Size() +} +func (m *MemoryEntry) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryEntry proto.InternalMessageInfo + +type BlkIOStat struct { + IoServiceBytesRecursive []*BlkIOEntry `protobuf:"bytes,1,rep,name=io_service_bytes_recursive,json=ioServiceBytesRecursive,proto3" json:"io_service_bytes_recursive,omitempty"` + IoServicedRecursive []*BlkIOEntry `protobuf:"bytes,2,rep,name=io_serviced_recursive,json=ioServicedRecursive,proto3" json:"io_serviced_recursive,omitempty"` + IoQueuedRecursive []*BlkIOEntry `protobuf:"bytes,3,rep,name=io_queued_recursive,json=ioQueuedRecursive,proto3" json:"io_queued_recursive,omitempty"` + IoServiceTimeRecursive []*BlkIOEntry `protobuf:"bytes,4,rep,name=io_service_time_recursive,json=ioServiceTimeRecursive,proto3" json:"io_service_time_recursive,omitempty"` + IoWaitTimeRecursive []*BlkIOEntry `protobuf:"bytes,5,rep,name=io_wait_time_recursive,json=ioWaitTimeRecursive,proto3" json:"io_wait_time_recursive,omitempty"` + IoMergedRecursive []*BlkIOEntry `protobuf:"bytes,6,rep,name=io_merged_recursive,json=ioMergedRecursive,proto3" json:"io_merged_recursive,omitempty"` + IoTimeRecursive []*BlkIOEntry `protobuf:"bytes,7,rep,name=io_time_recursive,json=ioTimeRecursive,proto3" json:"io_time_recursive,omitempty"` + SectorsRecursive []*BlkIOEntry `protobuf:"bytes,8,rep,name=sectors_recursive,json=sectorsRecursive,proto3" json:"sectors_recursive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOStat) Reset() { *m = BlkIOStat{} } +func (*BlkIOStat) ProtoMessage() {} +func (*BlkIOStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{8} +} +func (m *BlkIOStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOStat.Merge(m, src) +} +func (m *BlkIOStat) XXX_Size() int { + return m.Size() +} +func (m *BlkIOStat) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOStat.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOStat proto.InternalMessageInfo + +type BlkIOEntry struct { + Op string `protobuf:"bytes,1,opt,name=op,proto3" json:"op,omitempty"` + Device string `protobuf:"bytes,2,opt,name=device,proto3" json:"device,omitempty"` + Major uint64 `protobuf:"varint,3,opt,name=major,proto3" json:"major,omitempty"` + Minor uint64 `protobuf:"varint,4,opt,name=minor,proto3" json:"minor,omitempty"` + Value uint64 `protobuf:"varint,5,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOEntry) Reset() { *m = BlkIOEntry{} } +func (*BlkIOEntry) ProtoMessage() {} +func (*BlkIOEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{9} +} +func (m *BlkIOEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOEntry.Merge(m, src) +} +func (m *BlkIOEntry) XXX_Size() int { + return m.Size() +} +func (m *BlkIOEntry) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOEntry proto.InternalMessageInfo + +type RdmaStat struct { + Current []*RdmaEntry `protobuf:"bytes,1,rep,name=current,proto3" json:"current,omitempty"` + Limit []*RdmaEntry `protobuf:"bytes,2,rep,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaStat) Reset() { *m = RdmaStat{} } +func (*RdmaStat) ProtoMessage() {} +func (*RdmaStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{10} +} +func (m *RdmaStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaStat.Merge(m, src) +} +func (m *RdmaStat) XXX_Size() int { + return m.Size() +} +func (m *RdmaStat) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaStat.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaStat proto.InternalMessageInfo + +type RdmaEntry struct { + Device string `protobuf:"bytes,1,opt,name=device,proto3" json:"device,omitempty"` + HcaHandles uint32 `protobuf:"varint,2,opt,name=hca_handles,json=hcaHandles,proto3" json:"hca_handles,omitempty"` + HcaObjects uint32 `protobuf:"varint,3,opt,name=hca_objects,json=hcaObjects,proto3" json:"hca_objects,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaEntry) Reset() { *m = RdmaEntry{} } +func (*RdmaEntry) ProtoMessage() {} +func (*RdmaEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{11} +} +func (m *RdmaEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaEntry.Merge(m, src) +} +func (m *RdmaEntry) XXX_Size() int { + return m.Size() +} +func (m *RdmaEntry) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaEntry proto.InternalMessageInfo + +type NetworkStat struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + RxBytes uint64 `protobuf:"varint,2,opt,name=rx_bytes,json=rxBytes,proto3" json:"rx_bytes,omitempty"` + RxPackets uint64 `protobuf:"varint,3,opt,name=rx_packets,json=rxPackets,proto3" json:"rx_packets,omitempty"` + RxErrors uint64 `protobuf:"varint,4,opt,name=rx_errors,json=rxErrors,proto3" json:"rx_errors,omitempty"` + RxDropped uint64 `protobuf:"varint,5,opt,name=rx_dropped,json=rxDropped,proto3" json:"rx_dropped,omitempty"` + TxBytes uint64 `protobuf:"varint,6,opt,name=tx_bytes,json=txBytes,proto3" json:"tx_bytes,omitempty"` + TxPackets uint64 `protobuf:"varint,7,opt,name=tx_packets,json=txPackets,proto3" json:"tx_packets,omitempty"` + TxErrors uint64 `protobuf:"varint,8,opt,name=tx_errors,json=txErrors,proto3" json:"tx_errors,omitempty"` + TxDropped uint64 `protobuf:"varint,9,opt,name=tx_dropped,json=txDropped,proto3" json:"tx_dropped,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NetworkStat) Reset() { *m = NetworkStat{} } +func (*NetworkStat) ProtoMessage() {} +func (*NetworkStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{12} +} +func (m *NetworkStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *NetworkStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_NetworkStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *NetworkStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_NetworkStat.Merge(m, src) +} +func (m *NetworkStat) XXX_Size() int { + return m.Size() +} +func (m *NetworkStat) XXX_DiscardUnknown() { + xxx_messageInfo_NetworkStat.DiscardUnknown(m) +} + +var xxx_messageInfo_NetworkStat proto.InternalMessageInfo + +func init() { + proto.RegisterType((*Metrics)(nil), "io.containerd.cgroups.v1.Metrics") + proto.RegisterType((*HugetlbStat)(nil), "io.containerd.cgroups.v1.HugetlbStat") + proto.RegisterType((*PidsStat)(nil), "io.containerd.cgroups.v1.PidsStat") + proto.RegisterType((*CPUStat)(nil), "io.containerd.cgroups.v1.CPUStat") + proto.RegisterType((*CPUUsage)(nil), "io.containerd.cgroups.v1.CPUUsage") + proto.RegisterType((*Throttle)(nil), "io.containerd.cgroups.v1.Throttle") + proto.RegisterType((*MemoryStat)(nil), "io.containerd.cgroups.v1.MemoryStat") + proto.RegisterType((*MemoryEntry)(nil), "io.containerd.cgroups.v1.MemoryEntry") + proto.RegisterType((*BlkIOStat)(nil), "io.containerd.cgroups.v1.BlkIOStat") + proto.RegisterType((*BlkIOEntry)(nil), "io.containerd.cgroups.v1.BlkIOEntry") + proto.RegisterType((*RdmaStat)(nil), "io.containerd.cgroups.v1.RdmaStat") + proto.RegisterType((*RdmaEntry)(nil), "io.containerd.cgroups.v1.RdmaEntry") + proto.RegisterType((*NetworkStat)(nil), "io.containerd.cgroups.v1.NetworkStat") +} + +func init() { + proto.RegisterFile("github.com/containerd/cgroups/stats/v1/metrics.proto", fileDescriptor_a17b2d87c332bfaa) +} + +var fileDescriptor_a17b2d87c332bfaa = []byte{ + // 1558 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x57, 0xcf, 0x73, 0x13, 0x39, + 0x16, 0xc6, 0xb1, 0x13, 0xbb, 0x9f, 0x93, 0x90, 0x28, 0x10, 0x3a, 0x01, 0xe2, 0xe0, 0x24, 0xbb, + 0xd9, 0xa5, 0xca, 0x29, 0xd8, 0x2d, 0x6a, 0x61, 0xa1, 0xb6, 0x70, 0x80, 0x82, 0xda, 0xcd, 0x62, + 0xda, 0x49, 0xb1, 0x7b, 0xea, 0x92, 0xdb, 0xa2, 0xad, 0xc4, 0x6e, 0x35, 0x6a, 0xb5, 0xe3, 0xcc, + 0x69, 0x0e, 0x53, 0x35, 0xa7, 0xf9, 0x67, 0xe6, 0xaf, 0xe0, 0x38, 0x97, 0xa9, 0x9a, 0xb9, 0xa4, + 0x06, 0xff, 0x25, 0x53, 0x92, 0xfa, 0x87, 0x0c, 0x84, 0x8c, 0x6f, 0x2d, 0xe9, 0xfb, 0xbe, 0xf7, + 0xf4, 0xfa, 0x53, 0xeb, 0x35, 0xfc, 0xdd, 0xa7, 0xa2, 0x17, 0x77, 0x1a, 0x1e, 0x1b, 0xec, 0x79, + 0x2c, 0x10, 0x98, 0x06, 0x84, 0x77, 0xf7, 0x3c, 0x9f, 0xb3, 0x38, 0x8c, 0xf6, 0x22, 0x81, 0x45, + 0xb4, 0x37, 0xbc, 0xb7, 0x37, 0x20, 0x82, 0x53, 0x2f, 0x6a, 0x84, 0x9c, 0x09, 0x86, 0x6c, 0xca, + 0x1a, 0x39, 0xba, 0x91, 0xa0, 0x1b, 0xc3, 0x7b, 0xeb, 0xd7, 0x7c, 0xe6, 0x33, 0x05, 0xda, 0x93, + 0x4f, 0x1a, 0x5f, 0xff, 0xb1, 0x08, 0xe5, 0x03, 0xad, 0x80, 0xfe, 0x05, 0xe5, 0x5e, 0xec, 0x13, + 0xd1, 0xef, 0xd8, 0x85, 0xcd, 0xe2, 0x6e, 0xf5, 0xfe, 0x4e, 0xe3, 0x22, 0xb5, 0xc6, 0x4b, 0x0d, + 0x6c, 0x0b, 0x2c, 0x9c, 0x94, 0x85, 0x1e, 0x40, 0x29, 0xa4, 0xdd, 0xc8, 0x9e, 0xd9, 0x2c, 0xec, + 0x56, 0xef, 0xd7, 0x2f, 0x66, 0xb7, 0x68, 0x37, 0x52, 0x54, 0x85, 0x47, 0x8f, 0xa1, 0xe8, 0x85, + 0xb1, 0x5d, 0x54, 0xb4, 0x3b, 0x17, 0xd3, 0xf6, 0x5b, 0x47, 0x92, 0xd5, 0x2c, 0x8f, 0xcf, 0x6b, + 0xc5, 0xfd, 0xd6, 0x91, 0x23, 0x69, 0xe8, 0x31, 0xcc, 0x0d, 0xc8, 0x80, 0xf1, 0x33, 0xbb, 0xa4, + 0x04, 0xb6, 0x2f, 0x16, 0x38, 0x50, 0x38, 0x15, 0x39, 0xe1, 0xa0, 0x87, 0x30, 0xdb, 0xe9, 0x9f, + 0x50, 0x66, 0xcf, 0x2a, 0xf2, 0xd6, 0xc5, 0xe4, 0x66, 0xff, 0xe4, 0xd5, 0x6b, 0xc5, 0xd5, 0x0c, + 0xb9, 0x5d, 0xde, 0x1d, 0x60, 0x7b, 0xee, 0xb2, 0xed, 0x3a, 0xdd, 0x01, 0xd6, 0xdb, 0x95, 0x78, + 0x59, 0xe7, 0x80, 0x88, 0x53, 0xc6, 0x4f, 0xec, 0xf2, 0x65, 0x75, 0xfe, 0xaf, 0x06, 0xea, 0x3a, + 0x27, 0xac, 0xfa, 0x09, 0x54, 0x8d, 0xfa, 0xa3, 0x6b, 0x30, 0x1b, 0x47, 0xd8, 0x27, 0x76, 0x61, + 0xb3, 0xb0, 0x5b, 0x72, 0xf4, 0x00, 0x2d, 0x41, 0x71, 0x80, 0x47, 0xea, 0x5d, 0x94, 0x1c, 0xf9, + 0x88, 0x6c, 0x28, 0xbf, 0xc3, 0xb4, 0xef, 0x05, 0x42, 0x95, 0xba, 0xe4, 0xa4, 0x43, 0xb4, 0x0e, + 0x95, 0x10, 0xfb, 0x24, 0xa2, 0xdf, 0x10, 0x55, 0x44, 0xcb, 0xc9, 0xc6, 0xf5, 0x47, 0x50, 0x49, + 0x5f, 0x97, 0x54, 0xf0, 0x62, 0xce, 0x49, 0x20, 0x92, 0x58, 0xe9, 0x50, 0xe6, 0xd0, 0xa7, 0x03, + 0x2a, 0x92, 0x78, 0x7a, 0x50, 0xff, 0xbe, 0x00, 0xe5, 0xe4, 0xa5, 0xa1, 0x7f, 0x98, 0x59, 0x7e, + 0xb5, 0x5c, 0xfb, 0xad, 0xa3, 0x23, 0x89, 0x4c, 0x77, 0xd2, 0x04, 0x10, 0x3d, 0xce, 0x84, 0xe8, + 0xd3, 0xc0, 0xbf, 0xdc, 0x5c, 0x87, 0x1a, 0x4b, 0x1c, 0x83, 0x55, 0x7f, 0x0f, 0x95, 0x54, 0x56, + 0xe6, 0x2a, 0x98, 0xc0, 0xfd, 0xb4, 0x5e, 0x6a, 0x80, 0x56, 0x61, 0xee, 0x84, 0xf0, 0x80, 0xf4, + 0x93, 0x2d, 0x24, 0x23, 0x84, 0xa0, 0x14, 0x47, 0x84, 0x27, 0x25, 0x53, 0xcf, 0x68, 0x0b, 0xca, + 0x21, 0xe1, 0xae, 0x34, 0x6d, 0x69, 0xb3, 0xb8, 0x5b, 0x6a, 0xc2, 0xf8, 0xbc, 0x36, 0xd7, 0x22, + 0x5c, 0x9a, 0x72, 0x2e, 0x24, 0x7c, 0x3f, 0x8c, 0xeb, 0x23, 0xa8, 0xa4, 0xa9, 0xc8, 0xc2, 0x85, + 0x84, 0x53, 0xd6, 0x8d, 0xd2, 0xc2, 0x25, 0x43, 0x74, 0x17, 0x96, 0x93, 0x34, 0x49, 0xd7, 0x4d, + 0x31, 0x3a, 0x83, 0xa5, 0x6c, 0xa1, 0x95, 0x80, 0x77, 0x60, 0x31, 0x07, 0x0b, 0x3a, 0x20, 0x49, + 0x56, 0x0b, 0xd9, 0xec, 0x21, 0x1d, 0x90, 0xfa, 0xaf, 0x55, 0x80, 0xdc, 0xea, 0x72, 0xbf, 0x1e, + 0xf6, 0x7a, 0x99, 0x3f, 0xd4, 0x00, 0xad, 0x41, 0x91, 0x47, 0x49, 0x28, 0x7d, 0xa2, 0x9c, 0x76, + 0xdb, 0x91, 0x73, 0xe8, 0x4f, 0x50, 0xe1, 0x51, 0xe4, 0xca, 0x63, 0xad, 0x03, 0x34, 0xab, 0xe3, + 0xf3, 0x5a, 0xd9, 0x69, 0xb7, 0xa5, 0xed, 0x9c, 0x32, 0x8f, 0x22, 0xf9, 0x80, 0x6a, 0x50, 0x1d, + 0xe0, 0x30, 0x24, 0x5d, 0xf7, 0x1d, 0xed, 0x6b, 0xe7, 0x94, 0x1c, 0xd0, 0x53, 0x2f, 0x68, 0x5f, + 0x55, 0xba, 0x4b, 0xb9, 0x38, 0x53, 0x87, 0xab, 0xe4, 0xe8, 0x01, 0xba, 0x05, 0xd6, 0x29, 0xa7, + 0x82, 0x74, 0xb0, 0x77, 0xa2, 0x0e, 0x4f, 0xc9, 0xc9, 0x27, 0x90, 0x0d, 0x95, 0xd0, 0x77, 0x43, + 0xdf, 0xa5, 0x81, 0x5d, 0xd6, 0x6f, 0x22, 0xf4, 0x5b, 0xfe, 0xab, 0x00, 0xad, 0x83, 0xa5, 0x57, + 0x58, 0x2c, 0xec, 0x4a, 0x52, 0x46, 0xbf, 0xe5, 0xbf, 0x8e, 0x05, 0x5a, 0x53, 0xac, 0x77, 0x38, + 0xee, 0x0b, 0xdb, 0x4a, 0x97, 0x5e, 0xc8, 0x21, 0xda, 0x84, 0xf9, 0xd0, 0x77, 0x07, 0xf8, 0x38, + 0x59, 0x06, 0x9d, 0x66, 0xe8, 0x1f, 0xe0, 0x63, 0x8d, 0xd8, 0x82, 0x05, 0x1a, 0x60, 0x4f, 0xd0, + 0x21, 0x71, 0x71, 0xc0, 0x02, 0xbb, 0xaa, 0x20, 0xf3, 0xe9, 0xe4, 0xd3, 0x80, 0x05, 0x72, 0xb3, + 0x26, 0x64, 0x5e, 0xab, 0x18, 0x00, 0x53, 0x45, 0xd5, 0x63, 0x61, 0x52, 0x45, 0x55, 0x24, 0x57, + 0x51, 0x90, 0x45, 0x53, 0x45, 0x01, 0x36, 0xa1, 0x1a, 0x07, 0x64, 0x48, 0x3d, 0x81, 0x3b, 0x7d, + 0x62, 0x5f, 0x55, 0x00, 0x73, 0x0a, 0x3d, 0x82, 0xb5, 0x1e, 0x25, 0x1c, 0x73, 0xaf, 0x47, 0x3d, + 0xdc, 0x77, 0xf5, 0x87, 0xcc, 0xd5, 0xc7, 0x6f, 0x49, 0xe1, 0x6f, 0x98, 0x00, 0xed, 0x84, 0xff, + 0xc8, 0x65, 0xf4, 0x00, 0x26, 0x96, 0xdc, 0xe8, 0x14, 0x87, 0x09, 0x73, 0x59, 0x31, 0xaf, 0x9b, + 0xcb, 0xed, 0x53, 0x1c, 0x6a, 0x5e, 0x0d, 0xaa, 0xea, 0x94, 0xb8, 0xda, 0x48, 0x48, 0xa7, 0xad, + 0xa6, 0xf6, 0x95, 0x9b, 0xfe, 0x02, 0x96, 0x06, 0x48, 0x4f, 0xad, 0x28, 0xcf, 0xcc, 0x8f, 0xcf, + 0x6b, 0x95, 0x43, 0x39, 0x29, 0x8d, 0x55, 0x51, 0xcb, 0x4e, 0x14, 0xa1, 0x07, 0xb0, 0x98, 0x41, + 0xb5, 0xc7, 0xae, 0x29, 0xfc, 0xd2, 0xf8, 0xbc, 0x36, 0x9f, 0xe2, 0x95, 0xd1, 0xe6, 0x53, 0x8e, + 0x72, 0xdb, 0x5f, 0x61, 0x59, 0xf3, 0x4c, 0xcf, 0x5d, 0x57, 0x99, 0x5c, 0x55, 0x0b, 0x07, 0xb9, + 0xf1, 0xb2, 0x7c, 0xb5, 0xfd, 0x56, 0x8d, 0x7c, 0x9f, 0x29, 0x0f, 0xfe, 0x19, 0x34, 0xc7, 0xcd, + 0x9d, 0x78, 0x43, 0x81, 0x74, 0x6e, 0x6f, 0x33, 0x3b, 0x6e, 0xa5, 0xd9, 0x66, 0xa6, 0xb4, 0xf5, + 0x2b, 0x51, 0xb3, 0x2d, 0xed, 0xcc, 0x9d, 0x54, 0x2d, 0xf7, 0xe7, 0x9a, 0x7e, 0xf9, 0x19, 0x4a, + 0x9a, 0x74, 0xdb, 0xd0, 0xd2, 0x5e, 0x5c, 0x9f, 0x40, 0x69, 0x37, 0xde, 0x05, 0x94, 0xa1, 0x72, + 0xd7, 0xde, 0x34, 0x36, 0xda, 0xca, 0xad, 0xdb, 0x80, 0x15, 0x0d, 0x9e, 0x34, 0xf0, 0x2d, 0x85, + 0xd6, 0xf5, 0x7a, 0x65, 0xba, 0x38, 0x2b, 0xa2, 0x89, 0xbe, 0x6d, 0x68, 0x3f, 0xcd, 0xb1, 0x9f, + 0x6b, 0xab, 0x92, 0x6f, 0x7c, 0x41, 0x5b, 0x15, 0xfd, 0x53, 0x6d, 0x85, 0xae, 0x7d, 0xa6, 0xad, + 0xb0, 0x77, 0x53, 0xac, 0x69, 0xf6, 0xcd, 0xe4, 0xb3, 0x27, 0x17, 0x8e, 0x0c, 0xc7, 0xff, 0x33, + 0xbd, 0x3a, 0xee, 0xa8, 0x6f, 0xff, 0xce, 0x65, 0x17, 0xfc, 0xf3, 0x40, 0xf0, 0xb3, 0xf4, 0xf6, + 0x78, 0x08, 0x25, 0xe9, 0x72, 0xbb, 0x3e, 0x0d, 0x57, 0x51, 0xd0, 0x93, 0xec, 0x4a, 0xd8, 0x9a, + 0x86, 0x9c, 0xde, 0x1c, 0x6d, 0x00, 0xfd, 0xe4, 0x0a, 0x2f, 0xb4, 0xb7, 0xa7, 0x90, 0x68, 0x2e, + 0x8c, 0xcf, 0x6b, 0xd6, 0xbf, 0x15, 0xf9, 0x70, 0xbf, 0xe5, 0x58, 0x5a, 0xe7, 0xd0, 0x0b, 0xeb, + 0x04, 0xaa, 0x06, 0x30, 0xbf, 0x77, 0x0b, 0xc6, 0xbd, 0x9b, 0x77, 0x04, 0x33, 0x5f, 0xe8, 0x08, + 0x8a, 0x5f, 0xec, 0x08, 0x4a, 0x13, 0x1d, 0x41, 0xfd, 0xe7, 0x59, 0xb0, 0xb2, 0x86, 0x07, 0x61, + 0x58, 0xa7, 0xcc, 0x8d, 0x08, 0x1f, 0x52, 0x8f, 0xb8, 0x9d, 0x33, 0x41, 0x22, 0x97, 0x13, 0x2f, + 0xe6, 0x11, 0x1d, 0x92, 0xa4, 0x59, 0xdc, 0xbe, 0xa4, 0x73, 0xd2, 0xb5, 0xb9, 0x41, 0x59, 0x5b, + 0xcb, 0x34, 0xa5, 0x8a, 0x93, 0x8a, 0xa0, 0xff, 0xc1, 0xf5, 0x3c, 0x44, 0xd7, 0x50, 0x9f, 0x99, + 0x42, 0x7d, 0x25, 0x53, 0xef, 0xe6, 0xca, 0x87, 0xb0, 0x42, 0x99, 0xfb, 0x3e, 0x26, 0xf1, 0x84, + 0x6e, 0x71, 0x0a, 0xdd, 0x65, 0xca, 0xde, 0x28, 0x7e, 0xae, 0xea, 0xc2, 0x9a, 0x51, 0x12, 0x79, + 0x17, 0x1b, 0xda, 0xa5, 0x29, 0xb4, 0x57, 0xb3, 0x9c, 0xe5, 0xdd, 0x9d, 0x07, 0xf8, 0x3f, 0xac, + 0x52, 0xe6, 0x9e, 0x62, 0x2a, 0x3e, 0x55, 0x9f, 0x9d, 0xae, 0x22, 0x6f, 0x31, 0x15, 0x93, 0xd2, + 0xba, 0x22, 0x03, 0xc2, 0xfd, 0x89, 0x8a, 0xcc, 0x4d, 0x57, 0x91, 0x03, 0xc5, 0xcf, 0x55, 0x5b, + 0xb0, 0x4c, 0xd9, 0xa7, 0xb9, 0x96, 0xa7, 0xd0, 0xbc, 0x4a, 0xd9, 0x64, 0x9e, 0x6f, 0x60, 0x39, + 0x22, 0x9e, 0x60, 0xdc, 0x74, 0x5b, 0x65, 0x0a, 0xc5, 0xa5, 0x84, 0x9e, 0x49, 0xd6, 0x87, 0x00, + 0xf9, 0x3a, 0x5a, 0x84, 0x19, 0x16, 0xaa, 0xa3, 0x63, 0x39, 0x33, 0x2c, 0x94, 0x3d, 0x60, 0x57, + 0x7e, 0x76, 0xf4, 0xc1, 0xb1, 0x9c, 0x64, 0x24, 0xcf, 0xd3, 0x00, 0x1f, 0xb3, 0xb4, 0x09, 0xd4, + 0x03, 0x35, 0x4b, 0x03, 0xc6, 0x93, 0xb3, 0xa3, 0x07, 0x72, 0x76, 0x88, 0xfb, 0x31, 0x49, 0x7b, + 0x1e, 0x35, 0xa8, 0x7f, 0x57, 0x80, 0x4a, 0xfa, 0x1b, 0x80, 0x9e, 0x98, 0x6d, 0x74, 0xf1, 0xeb, + 0x7f, 0x1d, 0x92, 0xa4, 0x37, 0x93, 0xf5, 0xda, 0x0f, 0xf3, 0x5e, 0xfb, 0x0f, 0x93, 0x93, 0x86, + 0x9c, 0x80, 0x95, 0xcd, 0x19, 0xbb, 0x2d, 0x4c, 0xec, 0xb6, 0x06, 0xd5, 0x9e, 0x87, 0xdd, 0x1e, + 0x0e, 0xba, 0x7d, 0xa2, 0x3b, 0xc4, 0x05, 0x07, 0x7a, 0x1e, 0x7e, 0xa9, 0x67, 0x52, 0x00, 0xeb, + 0x1c, 0x13, 0x4f, 0x44, 0xaa, 0x28, 0x1a, 0xf0, 0x5a, 0xcf, 0xd4, 0x7f, 0x98, 0x81, 0xaa, 0xf1, + 0xe7, 0x22, 0x7b, 0xe8, 0x00, 0x0f, 0xd2, 0x38, 0xea, 0x59, 0x76, 0x6c, 0x7c, 0xa4, 0xbf, 0x25, + 0xc9, 0x67, 0xaa, 0xcc, 0x47, 0xea, 0xa3, 0x80, 0x6e, 0x03, 0xf0, 0x91, 0x1b, 0x62, 0xef, 0x84, + 0x24, 0xf2, 0x25, 0xc7, 0xe2, 0xa3, 0x96, 0x9e, 0x40, 0x37, 0xc1, 0xe2, 0x23, 0x97, 0x70, 0xce, + 0x78, 0x94, 0xd4, 0xbe, 0xc2, 0x47, 0xcf, 0xd5, 0x38, 0xe1, 0x76, 0x39, 0x93, 0xbd, 0x40, 0xf2, + 0x0e, 0x2c, 0x3e, 0x7a, 0xa6, 0x27, 0x64, 0x54, 0x91, 0x46, 0xd5, 0xad, 0x67, 0x59, 0xe4, 0x51, + 0x45, 0x1e, 0x55, 0xb7, 0x9e, 0x96, 0x30, 0xa3, 0x8a, 0x2c, 0xaa, 0xee, 0x3e, 0x2b, 0xc2, 0x88, + 0x2a, 0xf2, 0xa8, 0x56, 0xca, 0x4d, 0xa2, 0x36, 0xed, 0x0f, 0x1f, 0x37, 0xae, 0xfc, 0xf2, 0x71, + 0xe3, 0xca, 0xb7, 0xe3, 0x8d, 0xc2, 0x87, 0xf1, 0x46, 0xe1, 0xa7, 0xf1, 0x46, 0xe1, 0xb7, 0xf1, + 0x46, 0xa1, 0x33, 0xa7, 0x7e, 0xc3, 0xff, 0xf6, 0x7b, 0x00, 0x00, 0x00, 0xff, 0xff, 0x2f, 0xc0, + 0x49, 0x92, 0xee, 0x0f, 0x00, 0x00, +} + +func (m *Metrics) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metrics) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, msg := range m.Hugetlb { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.Pids != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Pids.Size())) + n1, err := m.Pids.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + if m.CPU != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.CPU.Size())) + n2, err := m.CPU.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + if m.Memory != nil { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Memory.Size())) + n3, err := m.Memory.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + } + if m.Blkio != nil { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Blkio.Size())) + n4, err := m.Blkio.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n4 + } + if m.Rdma != nil { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Rdma.Size())) + n5, err := m.Rdma.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n5 + } + if len(m.Network) > 0 { + for _, msg := range m.Network { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *HugetlbStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *HugetlbStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if len(m.Pagesize) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Pagesize))) + i += copy(dAtA[i:], m.Pagesize) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *PidsStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Current != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Current)) + } + if m.Limit != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != nil { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n6, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n6 + } + if m.Throttling != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Throttling.Size())) + n7, err := m.Throttling.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUUsage) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUUsage) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Total != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Total)) + } + if m.Kernel != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel)) + } + if m.User != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.User)) + } + if len(m.PerCPU) > 0 { + dAtA9 := make([]byte, len(m.PerCPU)*10) + var j8 int + for _, num := range m.PerCPU { + for num >= 1<<7 { + dAtA9[j8] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j8++ + } + dAtA9[j8] = uint8(num) + j8++ + } + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(j8)) + i += copy(dAtA[i:], dAtA9[:j8]) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *Throttle) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Throttle) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Periods != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Cache != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Cache)) + } + if m.RSS != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSS)) + } + if m.RSSHuge != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.MappedFile)) + } + if m.Dirty != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Dirty)) + } + if m.Writeback != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + dAtA[i] = 0x50 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + dAtA[i] = 0x58 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + dAtA[i] = 0x60 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + dAtA[i] = 0x68 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + dAtA[i] = 0x70 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + dAtA[i] = 0x78 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + dAtA[i] = 0x88 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + dAtA[i] = 0x90 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + dAtA[i] = 0x98 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + dAtA[i] = 0xa0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + dAtA[i] = 0xa8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + dAtA[i] = 0xb0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + dAtA[i] = 0xb8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + dAtA[i] = 0xc0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + dAtA[i] = 0xc8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + dAtA[i] = 0xd0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + dAtA[i] = 0xd8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + dAtA[i] = 0xe0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + dAtA[i] = 0xe8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + dAtA[i] = 0xf0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + dAtA[i] = 0xf8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + dAtA[i] = 0x8a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n10, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n10 + } + if m.Swap != nil { + dAtA[i] = 0x92 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Swap.Size())) + n11, err := m.Swap.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n11 + } + if m.Kernel != nil { + dAtA[i] = 0x9a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel.Size())) + n12, err := m.Kernel.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n12 + } + if m.KernelTCP != nil { + dAtA[i] = 0xa2 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.KernelTCP.Size())) + n13, err := m.KernelTCP.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n13 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Limit != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.Usage != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, msg := range m.IoServiceBytesRecursive { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServicedRecursive) > 0 { + for _, msg := range m.IoServicedRecursive { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, msg := range m.IoQueuedRecursive { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, msg := range m.IoServiceTimeRecursive { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, msg := range m.IoWaitTimeRecursive { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoMergedRecursive) > 0 { + for _, msg := range m.IoMergedRecursive { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoTimeRecursive) > 0 { + for _, msg := range m.IoTimeRecursive { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.SectorsRecursive) > 0 { + for _, msg := range m.SectorsRecursive { + dAtA[i] = 0x42 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Op) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Op))) + i += copy(dAtA[i:], m.Op) + } + if len(m.Device) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.Major != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Major)) + } + if m.Minor != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Minor)) + } + if m.Value != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Current) > 0 { + for _, msg := range m.Current { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.Limit) > 0 { + for _, msg := range m.Limit { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Device) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.HcaHandles != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *NetworkStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NetworkStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if m.RxBytes != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Metrics) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, e := range m.Hugetlb { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.Pids != nil { + l = m.Pids.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.CPU != nil { + l = m.CPU.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Memory != nil { + l = m.Memory.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Blkio != nil { + l = m.Blkio.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Rdma != nil { + l = m.Rdma.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if len(m.Network) > 0 { + for _, e := range m.Network { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *HugetlbStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + l = len(m.Pagesize) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *PidsStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Current != 0 { + n += 1 + sovMetrics(uint64(m.Current)) + } + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != nil { + l = m.Usage.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Throttling != nil { + l = m.Throttling.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUUsage) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Total != 0 { + n += 1 + sovMetrics(uint64(m.Total)) + } + if m.Kernel != 0 { + n += 1 + sovMetrics(uint64(m.Kernel)) + } + if m.User != 0 { + n += 1 + sovMetrics(uint64(m.User)) + } + if len(m.PerCPU) > 0 { + l = 0 + for _, e := range m.PerCPU { + l += sovMetrics(uint64(e)) + } + n += 1 + sovMetrics(uint64(l)) + l + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *Throttle) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Periods != 0 { + n += 1 + sovMetrics(uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cache != 0 { + n += 1 + sovMetrics(uint64(m.Cache)) + } + if m.RSS != 0 { + n += 1 + sovMetrics(uint64(m.RSS)) + } + if m.RSSHuge != 0 { + n += 1 + sovMetrics(uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + n += 1 + sovMetrics(uint64(m.MappedFile)) + } + if m.Dirty != 0 { + n += 1 + sovMetrics(uint64(m.Dirty)) + } + if m.Writeback != 0 { + n += 1 + sovMetrics(uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + n += 1 + sovMetrics(uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + n += 1 + sovMetrics(uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + n += 1 + sovMetrics(uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + n += 1 + sovMetrics(uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + n += 1 + sovMetrics(uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + n += 1 + sovMetrics(uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + n += 1 + sovMetrics(uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + n += 2 + sovMetrics(uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + n += 2 + sovMetrics(uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + n += 2 + sovMetrics(uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + n += 2 + sovMetrics(uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + l = m.Usage.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Swap != nil { + l = m.Swap.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Kernel != nil { + l = m.Kernel.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.KernelTCP != nil { + l = m.KernelTCP.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, e := range m.IoServiceBytesRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServicedRecursive) > 0 { + for _, e := range m.IoServicedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, e := range m.IoQueuedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, e := range m.IoServiceTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, e := range m.IoWaitTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoMergedRecursive) > 0 { + for _, e := range m.IoMergedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoTimeRecursive) > 0 { + for _, e := range m.IoTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.SectorsRecursive) > 0 { + for _, e := range m.SectorsRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Op) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Major != 0 { + n += 1 + sovMetrics(uint64(m.Major)) + } + if m.Minor != 0 { + n += 1 + sovMetrics(uint64(m.Minor)) + } + if m.Value != 0 { + n += 1 + sovMetrics(uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Current) > 0 { + for _, e := range m.Current { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.Limit) > 0 { + for _, e := range m.Limit { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.HcaHandles != 0 { + n += 1 + sovMetrics(uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + n += 1 + sovMetrics(uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *NetworkStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.RxBytes != 0 { + n += 1 + sovMetrics(uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + n += 1 + sovMetrics(uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + n += 1 + sovMetrics(uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + n += 1 + sovMetrics(uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + n += 1 + sovMetrics(uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + n += 1 + sovMetrics(uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + n += 1 + sovMetrics(uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + n += 1 + sovMetrics(uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovMetrics(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metrics) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Metrics{`, + `Hugetlb:` + strings.Replace(fmt.Sprintf("%v", this.Hugetlb), "HugetlbStat", "HugetlbStat", 1) + `,`, + `Pids:` + strings.Replace(fmt.Sprintf("%v", this.Pids), "PidsStat", "PidsStat", 1) + `,`, + `CPU:` + strings.Replace(fmt.Sprintf("%v", this.CPU), "CPUStat", "CPUStat", 1) + `,`, + `Memory:` + strings.Replace(fmt.Sprintf("%v", this.Memory), "MemoryStat", "MemoryStat", 1) + `,`, + `Blkio:` + strings.Replace(fmt.Sprintf("%v", this.Blkio), "BlkIOStat", "BlkIOStat", 1) + `,`, + `Rdma:` + strings.Replace(fmt.Sprintf("%v", this.Rdma), "RdmaStat", "RdmaStat", 1) + `,`, + `Network:` + strings.Replace(fmt.Sprintf("%v", this.Network), "NetworkStat", "NetworkStat", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *HugetlbStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&HugetlbStat{`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `Pagesize:` + fmt.Sprintf("%v", this.Pagesize) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *PidsStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsStat{`, + `Current:` + fmt.Sprintf("%v", this.Current) + `,`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUStat{`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "CPUUsage", "CPUUsage", 1) + `,`, + `Throttling:` + strings.Replace(fmt.Sprintf("%v", this.Throttling), "Throttle", "Throttle", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUUsage) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUUsage{`, + `Total:` + fmt.Sprintf("%v", this.Total) + `,`, + `Kernel:` + fmt.Sprintf("%v", this.Kernel) + `,`, + `User:` + fmt.Sprintf("%v", this.User) + `,`, + `PerCPU:` + fmt.Sprintf("%v", this.PerCPU) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *Throttle) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Throttle{`, + `Periods:` + fmt.Sprintf("%v", this.Periods) + `,`, + `ThrottledPeriods:` + fmt.Sprintf("%v", this.ThrottledPeriods) + `,`, + `ThrottledTime:` + fmt.Sprintf("%v", this.ThrottledTime) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryStat{`, + `Cache:` + fmt.Sprintf("%v", this.Cache) + `,`, + `RSS:` + fmt.Sprintf("%v", this.RSS) + `,`, + `RSSHuge:` + fmt.Sprintf("%v", this.RSSHuge) + `,`, + `MappedFile:` + fmt.Sprintf("%v", this.MappedFile) + `,`, + `Dirty:` + fmt.Sprintf("%v", this.Dirty) + `,`, + `Writeback:` + fmt.Sprintf("%v", this.Writeback) + `,`, + `PgPgIn:` + fmt.Sprintf("%v", this.PgPgIn) + `,`, + `PgPgOut:` + fmt.Sprintf("%v", this.PgPgOut) + `,`, + `PgFault:` + fmt.Sprintf("%v", this.PgFault) + `,`, + `PgMajFault:` + fmt.Sprintf("%v", this.PgMajFault) + `,`, + `InactiveAnon:` + fmt.Sprintf("%v", this.InactiveAnon) + `,`, + `ActiveAnon:` + fmt.Sprintf("%v", this.ActiveAnon) + `,`, + `InactiveFile:` + fmt.Sprintf("%v", this.InactiveFile) + `,`, + `ActiveFile:` + fmt.Sprintf("%v", this.ActiveFile) + `,`, + `Unevictable:` + fmt.Sprintf("%v", this.Unevictable) + `,`, + `HierarchicalMemoryLimit:` + fmt.Sprintf("%v", this.HierarchicalMemoryLimit) + `,`, + `HierarchicalSwapLimit:` + fmt.Sprintf("%v", this.HierarchicalSwapLimit) + `,`, + `TotalCache:` + fmt.Sprintf("%v", this.TotalCache) + `,`, + `TotalRSS:` + fmt.Sprintf("%v", this.TotalRSS) + `,`, + `TotalRSSHuge:` + fmt.Sprintf("%v", this.TotalRSSHuge) + `,`, + `TotalMappedFile:` + fmt.Sprintf("%v", this.TotalMappedFile) + `,`, + `TotalDirty:` + fmt.Sprintf("%v", this.TotalDirty) + `,`, + `TotalWriteback:` + fmt.Sprintf("%v", this.TotalWriteback) + `,`, + `TotalPgPgIn:` + fmt.Sprintf("%v", this.TotalPgPgIn) + `,`, + `TotalPgPgOut:` + fmt.Sprintf("%v", this.TotalPgPgOut) + `,`, + `TotalPgFault:` + fmt.Sprintf("%v", this.TotalPgFault) + `,`, + `TotalPgMajFault:` + fmt.Sprintf("%v", this.TotalPgMajFault) + `,`, + `TotalInactiveAnon:` + fmt.Sprintf("%v", this.TotalInactiveAnon) + `,`, + `TotalActiveAnon:` + fmt.Sprintf("%v", this.TotalActiveAnon) + `,`, + `TotalInactiveFile:` + fmt.Sprintf("%v", this.TotalInactiveFile) + `,`, + `TotalActiveFile:` + fmt.Sprintf("%v", this.TotalActiveFile) + `,`, + `TotalUnevictable:` + fmt.Sprintf("%v", this.TotalUnevictable) + `,`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Swap:` + strings.Replace(fmt.Sprintf("%v", this.Swap), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Kernel:` + strings.Replace(fmt.Sprintf("%v", this.Kernel), "MemoryEntry", "MemoryEntry", 1) + `,`, + `KernelTCP:` + strings.Replace(fmt.Sprintf("%v", this.KernelTCP), "MemoryEntry", "MemoryEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryEntry{`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOStat{`, + `IoServiceBytesRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceBytesRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServicedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServicedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoQueuedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoQueuedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServiceTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoWaitTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoWaitTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoMergedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoMergedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `SectorsRecursive:` + strings.Replace(fmt.Sprintf("%v", this.SectorsRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOEntry{`, + `Op:` + fmt.Sprintf("%v", this.Op) + `,`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `Major:` + fmt.Sprintf("%v", this.Major) + `,`, + `Minor:` + fmt.Sprintf("%v", this.Minor) + `,`, + `Value:` + fmt.Sprintf("%v", this.Value) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaStat{`, + `Current:` + strings.Replace(fmt.Sprintf("%v", this.Current), "RdmaEntry", "RdmaEntry", 1) + `,`, + `Limit:` + strings.Replace(fmt.Sprintf("%v", this.Limit), "RdmaEntry", "RdmaEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaEntry{`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `HcaHandles:` + fmt.Sprintf("%v", this.HcaHandles) + `,`, + `HcaObjects:` + fmt.Sprintf("%v", this.HcaObjects) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *NetworkStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NetworkStat{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `RxBytes:` + fmt.Sprintf("%v", this.RxBytes) + `,`, + `RxPackets:` + fmt.Sprintf("%v", this.RxPackets) + `,`, + `RxErrors:` + fmt.Sprintf("%v", this.RxErrors) + `,`, + `RxDropped:` + fmt.Sprintf("%v", this.RxDropped) + `,`, + `TxBytes:` + fmt.Sprintf("%v", this.TxBytes) + `,`, + `TxPackets:` + fmt.Sprintf("%v", this.TxPackets) + `,`, + `TxErrors:` + fmt.Sprintf("%v", this.TxErrors) + `,`, + `TxDropped:` + fmt.Sprintf("%v", this.TxDropped) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metrics) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metrics: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metrics: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Hugetlb", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Hugetlb = append(m.Hugetlb, &HugetlbStat{}) + if err := m.Hugetlb[len(m.Hugetlb)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pids", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Pids == nil { + m.Pids = &PidsStat{} + } + if err := m.Pids.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CPU", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CPU == nil { + m.CPU = &CPUStat{} + } + if err := m.CPU.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Memory", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Memory == nil { + m.Memory = &MemoryStat{} + } + if err := m.Memory.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Blkio", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Blkio == nil { + m.Blkio = &BlkIOStat{} + } + if err := m.Blkio.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rdma", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Rdma == nil { + m.Rdma = &RdmaStat{} + } + if err := m.Rdma.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Network", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Network = append(m.Network, &NetworkStat{}) + if err := m.Network[len(m.Network)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *HugetlbStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: HugetlbStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: HugetlbStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pagesize", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Pagesize = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + m.Current = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Current |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &CPUUsage{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Throttling", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Throttling == nil { + m.Throttling = &Throttle{} + } + if err := m.Throttling.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUUsage) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUUsage: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUUsage: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Total", wireType) + } + m.Total = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Total |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + m.Kernel = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Kernel |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field User", wireType) + } + m.User = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.User |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType == 0 { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.PerCPU) == 0 { + m.PerCPU = make([]uint64, 0, elementCount) + } + for iNdEx < postIndex { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field PerCPU", wireType) + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Throttle) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Throttle: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Throttle: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Periods", wireType) + } + m.Periods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Periods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledPeriods", wireType) + } + m.ThrottledPeriods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledPeriods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledTime", wireType) + } + m.ThrottledTime = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledTime |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Cache", wireType) + } + m.Cache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Cache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSS", wireType) + } + m.RSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSSHuge", wireType) + } + m.RSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MappedFile", wireType) + } + m.MappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Dirty", wireType) + } + m.Dirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Dirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Writeback", wireType) + } + m.Writeback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Writeback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgIn", wireType) + } + m.PgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgOut", wireType) + } + m.PgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgFault", wireType) + } + m.PgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgMajFault", wireType) + } + m.PgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveAnon", wireType) + } + m.InactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveAnon", wireType) + } + m.ActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveFile", wireType) + } + m.InactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 14: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveFile", wireType) + } + m.ActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 15: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Unevictable", wireType) + } + m.Unevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Unevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 16: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalMemoryLimit", wireType) + } + m.HierarchicalMemoryLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalMemoryLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 17: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalSwapLimit", wireType) + } + m.HierarchicalSwapLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalSwapLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 18: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalCache", wireType) + } + m.TotalCache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalCache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 19: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSS", wireType) + } + m.TotalRSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 20: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSSHuge", wireType) + } + m.TotalRSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 21: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalMappedFile", wireType) + } + m.TotalMappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalMappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 22: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalDirty", wireType) + } + m.TotalDirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalDirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 23: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalWriteback", wireType) + } + m.TotalWriteback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalWriteback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 24: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgIn", wireType) + } + m.TotalPgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 25: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgOut", wireType) + } + m.TotalPgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 26: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgFault", wireType) + } + m.TotalPgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 27: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgMajFault", wireType) + } + m.TotalPgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 28: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveAnon", wireType) + } + m.TotalInactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 29: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveAnon", wireType) + } + m.TotalActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 30: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveFile", wireType) + } + m.TotalInactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 31: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveFile", wireType) + } + m.TotalActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 32: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalUnevictable", wireType) + } + m.TotalUnevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalUnevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 33: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &MemoryEntry{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 34: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Swap", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Swap == nil { + m.Swap = &MemoryEntry{} + } + if err := m.Swap.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 35: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Kernel == nil { + m.Kernel = &MemoryEntry{} + } + if err := m.Kernel.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 36: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTCP", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.KernelTCP == nil { + m.KernelTCP = &MemoryEntry{} + } + if err := m.KernelTCP.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceBytesRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceBytesRecursive = append(m.IoServiceBytesRecursive, &BlkIOEntry{}) + if err := m.IoServiceBytesRecursive[len(m.IoServiceBytesRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServicedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServicedRecursive = append(m.IoServicedRecursive, &BlkIOEntry{}) + if err := m.IoServicedRecursive[len(m.IoServicedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoQueuedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoQueuedRecursive = append(m.IoQueuedRecursive, &BlkIOEntry{}) + if err := m.IoQueuedRecursive[len(m.IoQueuedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceTimeRecursive = append(m.IoServiceTimeRecursive, &BlkIOEntry{}) + if err := m.IoServiceTimeRecursive[len(m.IoServiceTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoWaitTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoWaitTimeRecursive = append(m.IoWaitTimeRecursive, &BlkIOEntry{}) + if err := m.IoWaitTimeRecursive[len(m.IoWaitTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoMergedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoMergedRecursive = append(m.IoMergedRecursive, &BlkIOEntry{}) + if err := m.IoMergedRecursive[len(m.IoMergedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoTimeRecursive = append(m.IoTimeRecursive, &BlkIOEntry{}) + if err := m.IoTimeRecursive[len(m.IoTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SectorsRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SectorsRecursive = append(m.SectorsRecursive, &BlkIOEntry{}) + if err := m.SectorsRecursive[len(m.SectorsRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Op", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Op = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Major", wireType) + } + m.Major = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Major |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Minor", wireType) + } + m.Minor = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Minor |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Value", wireType) + } + m.Value = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Value |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Current = append(m.Current, &RdmaEntry{}) + if err := m.Current[len(m.Current)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Limit = append(m.Limit, &RdmaEntry{}) + if err := m.Limit[len(m.Limit)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaHandles", wireType) + } + m.HcaHandles = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaHandles |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaObjects", wireType) + } + m.HcaObjects = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaObjects |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NetworkStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NetworkStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NetworkStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxBytes", wireType) + } + m.RxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxPackets", wireType) + } + m.RxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxErrors", wireType) + } + m.RxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxDropped", wireType) + } + m.RxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxBytes", wireType) + } + m.TxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxPackets", wireType) + } + m.TxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxErrors", wireType) + } + m.TxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxDropped", wireType) + } + m.TxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMetrics(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt new file mode 100644 index 000000000..7a960c678 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt @@ -0,0 +1,712 @@ +file { + name: "github.com/containerd/cgroups/stats/v1/metrics.proto" + package: "io.containerd.cgroups.v1" + dependency: "gogoproto/gogo.proto" + message_type { + name: "Metrics" + field { + name: "hugetlb" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.HugetlbStat" + json_name: "hugetlb" + } + field { + name: "pids" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.PidsStat" + json_name: "pids" + } + field { + name: "cpu" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUStat" + options { + 65004: "CPU" + } + json_name: "cpu" + } + field { + name: "memory" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryStat" + json_name: "memory" + } + field { + name: "blkio" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOStat" + json_name: "blkio" + } + field { + name: "rdma" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaStat" + json_name: "rdma" + } + field { + name: "network" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.NetworkStat" + json_name: "network" + } + } + message_type { + name: "HugetlbStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + field { + name: "pagesize" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "pagesize" + } + } + message_type { + name: "PidsStat" + field { + name: "current" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + } + message_type { + name: "CPUStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUUsage" + json_name: "usage" + } + field { + name: "throttling" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.Throttle" + json_name: "throttling" + } + } + message_type { + name: "CPUUsage" + field { + name: "total" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "total" + } + field { + name: "kernel" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "kernel" + } + field { + name: "user" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "user" + } + field { + name: "per_cpu" + number: 4 + label: LABEL_REPEATED + type: TYPE_UINT64 + options { + 65004: "PerCPU" + } + json_name: "perCpu" + } + } + message_type { + name: "Throttle" + field { + name: "periods" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "periods" + } + field { + name: "throttled_periods" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledPeriods" + } + field { + name: "throttled_time" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledTime" + } + } + message_type { + name: "MemoryStat" + field { + name: "cache" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "cache" + } + field { + name: "rss" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSS" + } + json_name: "rss" + } + field { + name: "rss_huge" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSSHuge" + } + json_name: "rssHuge" + } + field { + name: "mapped_file" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "mappedFile" + } + field { + name: "dirty" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "dirty" + } + field { + name: "writeback" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "writeback" + } + field { + name: "pg_pg_in" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgIn" + } + field { + name: "pg_pg_out" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgOut" + } + field { + name: "pg_fault" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgFault" + } + field { + name: "pg_maj_fault" + number: 10 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgMajFault" + } + field { + name: "inactive_anon" + number: 11 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveAnon" + } + field { + name: "active_anon" + number: 12 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeAnon" + } + field { + name: "inactive_file" + number: 13 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveFile" + } + field { + name: "active_file" + number: 14 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeFile" + } + field { + name: "unevictable" + number: 15 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "unevictable" + } + field { + name: "hierarchical_memory_limit" + number: 16 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalMemoryLimit" + } + field { + name: "hierarchical_swap_limit" + number: 17 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalSwapLimit" + } + field { + name: "total_cache" + number: 18 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalCache" + } + field { + name: "total_rss" + number: 19 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSS" + } + json_name: "totalRss" + } + field { + name: "total_rss_huge" + number: 20 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSSHuge" + } + json_name: "totalRssHuge" + } + field { + name: "total_mapped_file" + number: 21 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalMappedFile" + } + field { + name: "total_dirty" + number: 22 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalDirty" + } + field { + name: "total_writeback" + number: 23 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalWriteback" + } + field { + name: "total_pg_pg_in" + number: 24 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgIn" + } + field { + name: "total_pg_pg_out" + number: 25 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgOut" + } + field { + name: "total_pg_fault" + number: 26 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgFault" + } + field { + name: "total_pg_maj_fault" + number: 27 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgMajFault" + } + field { + name: "total_inactive_anon" + number: 28 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveAnon" + } + field { + name: "total_active_anon" + number: 29 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveAnon" + } + field { + name: "total_inactive_file" + number: 30 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveFile" + } + field { + name: "total_active_file" + number: 31 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveFile" + } + field { + name: "total_unevictable" + number: 32 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalUnevictable" + } + field { + name: "usage" + number: 33 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "usage" + } + field { + name: "swap" + number: 34 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "swap" + } + field { + name: "kernel" + number: 35 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "kernel" + } + field { + name: "kernel_tcp" + number: 36 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + options { + 65004: "KernelTCP" + } + json_name: "kernelTcp" + } + } + message_type { + name: "MemoryEntry" + field { + name: "limit" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + field { + name: "usage" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + } + message_type { + name: "BlkIOStat" + field { + name: "io_service_bytes_recursive" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceBytesRecursive" + } + field { + name: "io_serviced_recursive" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServicedRecursive" + } + field { + name: "io_queued_recursive" + number: 3 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioQueuedRecursive" + } + field { + name: "io_service_time_recursive" + number: 4 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceTimeRecursive" + } + field { + name: "io_wait_time_recursive" + number: 5 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioWaitTimeRecursive" + } + field { + name: "io_merged_recursive" + number: 6 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioMergedRecursive" + } + field { + name: "io_time_recursive" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioTimeRecursive" + } + field { + name: "sectors_recursive" + number: 8 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "sectorsRecursive" + } + } + message_type { + name: "BlkIOEntry" + field { + name: "op" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "op" + } + field { + name: "device" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "major" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "major" + } + field { + name: "minor" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "minor" + } + field { + name: "value" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "value" + } + } + message_type { + name: "RdmaStat" + field { + name: "current" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "limit" + } + } + message_type { + name: "RdmaEntry" + field { + name: "device" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "hca_handles" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaHandles" + } + field { + name: "hca_objects" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaObjects" + } + } + message_type { + name: "NetworkStat" + field { + name: "name" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "name" + } + field { + name: "rx_bytes" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxBytes" + } + field { + name: "rx_packets" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxPackets" + } + field { + name: "rx_errors" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxErrors" + } + field { + name: "rx_dropped" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxDropped" + } + field { + name: "tx_bytes" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txBytes" + } + field { + name: "tx_packets" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txPackets" + } + field { + name: "tx_errors" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txErrors" + } + field { + name: "tx_dropped" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txDropped" + } + } + syntax: "proto3" +} diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto new file mode 100644 index 000000000..62b519806 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto @@ -0,0 +1,136 @@ +syntax = "proto3"; + +package io.containerd.cgroups.v1; + +import "gogoproto/gogo.proto"; + +message Metrics { + repeated HugetlbStat hugetlb = 1; + PidsStat pids = 2; + CPUStat cpu = 3 [(gogoproto.customname) = "CPU"]; + MemoryStat memory = 4; + BlkIOStat blkio = 5; + RdmaStat rdma = 6; + repeated NetworkStat network = 7; +} + +message HugetlbStat { + uint64 usage = 1; + uint64 max = 2; + uint64 failcnt = 3; + string pagesize = 4; +} + +message PidsStat { + uint64 current = 1; + uint64 limit = 2; +} + +message CPUStat { + CPUUsage usage = 1; + Throttle throttling = 2; +} + +message CPUUsage { + // values in nanoseconds + uint64 total = 1; + uint64 kernel = 2; + uint64 user = 3; + repeated uint64 per_cpu = 4 [(gogoproto.customname) = "PerCPU"]; + +} + +message Throttle { + uint64 periods = 1; + uint64 throttled_periods = 2; + uint64 throttled_time = 3; +} + +message MemoryStat { + uint64 cache = 1; + uint64 rss = 2 [(gogoproto.customname) = "RSS"]; + uint64 rss_huge = 3 [(gogoproto.customname) = "RSSHuge"]; + uint64 mapped_file = 4; + uint64 dirty = 5; + uint64 writeback = 6; + uint64 pg_pg_in = 7; + uint64 pg_pg_out = 8; + uint64 pg_fault = 9; + uint64 pg_maj_fault = 10; + uint64 inactive_anon = 11; + uint64 active_anon = 12; + uint64 inactive_file = 13; + uint64 active_file = 14; + uint64 unevictable = 15; + uint64 hierarchical_memory_limit = 16; + uint64 hierarchical_swap_limit = 17; + uint64 total_cache = 18; + uint64 total_rss = 19 [(gogoproto.customname) = "TotalRSS"]; + uint64 total_rss_huge = 20 [(gogoproto.customname) = "TotalRSSHuge"]; + uint64 total_mapped_file = 21; + uint64 total_dirty = 22; + uint64 total_writeback = 23; + uint64 total_pg_pg_in = 24; + uint64 total_pg_pg_out = 25; + uint64 total_pg_fault = 26; + uint64 total_pg_maj_fault = 27; + uint64 total_inactive_anon = 28; + uint64 total_active_anon = 29; + uint64 total_inactive_file = 30; + uint64 total_active_file = 31; + uint64 total_unevictable = 32; + MemoryEntry usage = 33; + MemoryEntry swap = 34; + MemoryEntry kernel = 35; + MemoryEntry kernel_tcp = 36 [(gogoproto.customname) = "KernelTCP"]; + +} + +message MemoryEntry { + uint64 limit = 1; + uint64 usage = 2; + uint64 max = 3; + uint64 failcnt = 4; +} + +message BlkIOStat { + repeated BlkIOEntry io_service_bytes_recursive = 1; + repeated BlkIOEntry io_serviced_recursive = 2; + repeated BlkIOEntry io_queued_recursive = 3; + repeated BlkIOEntry io_service_time_recursive = 4; + repeated BlkIOEntry io_wait_time_recursive = 5; + repeated BlkIOEntry io_merged_recursive = 6; + repeated BlkIOEntry io_time_recursive = 7; + repeated BlkIOEntry sectors_recursive = 8; +} + +message BlkIOEntry { + string op = 1; + string device = 2; + uint64 major = 3; + uint64 minor = 4; + uint64 value = 5; +} + +message RdmaStat { + repeated RdmaEntry current = 1; + repeated RdmaEntry limit = 2; +} + +message RdmaEntry { + string device = 1; + uint32 hca_handles = 2; + uint32 hca_objects = 3; +} + +message NetworkStat { + string name = 1; + uint64 rx_bytes = 2; + uint64 rx_packets = 3; + uint64 rx_errors = 4; + uint64 rx_dropped = 5; + uint64 tx_bytes = 6; + uint64 tx_packets = 7; + uint64 tx_errors = 8; + uint64 tx_dropped = 9; +} diff --git a/vendor/github.com/containers/buildah/.travis.yml b/vendor/github.com/containers/buildah/.travis.yml index a74108230..8bf3756f5 100644 --- a/vendor/github.com/containers/buildah/.travis.yml +++ b/vendor/github.com/containers/buildah/.travis.yml @@ -68,21 +68,25 @@ script: # Fail fast - set -e # Let's do some docker stuff just for verification purposes - - docker ps --all - - docker images - - ls -alF /home/travis/auth - - docker pull docker.io/alpine - - echo testpassword | docker login localhost:5000 --username testuser --password-stdin - - docker tag alpine localhost:5000/my-alpine - - docker push localhost:5000/my-alpine - - docker ps --all - - docker images - - docker rmi docker.io/alpine - - docker rmi localhost:5000/my-alpine - - docker pull localhost:5000/my-alpine - - docker ps --all - - docker images - - docker rmi localhost:5000/my-alpine +# Commented out the following in order to get travis runs +# under the 50 minute requirement. Do not remove as we may +# want to use this in cirrius testing when we move there. +# - docker ps --all +# - docker images +# - ls -alF /home/travis/auth +# - docker pull docker.io/alpine +# - echo testpassword | docker login localhost:5000 --username testuser --password-stdin +# - docker tag alpine localhost:5000/my-alpine +# - docker push localhost:5000/my-alpine +# - docker ps --all +# - docker images +# - docker rmi docker.io/alpine +# - docker rmi localhost:5000/my-alpine +# - docker pull localhost:5000/my-alpine +# - docker ps --all +# - docker images +# - docker rmi localhost:5000/my-alpine +# End Speed up comment # Setting up Docker Registry is complete, let's do Buildah testing! - make install.tools -j4 - make install.libseccomp.sudo all runc validate lint SECURITYTAGS="apparmor seccomp" diff --git a/vendor/github.com/containers/buildah/buildah.go b/vendor/github.com/containers/buildah/buildah.go index d57eea818..7042590d1 100644 --- a/vendor/github.com/containers/buildah/buildah.go +++ b/vendor/github.com/containers/buildah/buildah.go @@ -27,7 +27,7 @@ const ( Package = "buildah" // Version for the Package. Bump version in contrib/rpm/buildah.spec // too. - Version = "1.12.0-dev" + Version = "1.11.5" // The value we use to identify what type of information, currently a // serialized Builder structure, we are using as per-container state. // This should only be changed when we make incompatible changes to @@ -40,7 +40,7 @@ const ( stateFile = Package + ".json" ) -// PullPolicy takes the value PullIfMissing, PullAlways, or PullNever. +// PullPolicy takes the value PullIfMissing, PullAlways, PullIfNewer, or PullNever. type PullPolicy int const ( @@ -52,6 +52,11 @@ const ( // take, signalling that a fresh, possibly updated, copy of the image // should be pulled from a registry before the build proceeds. PullAlways + // PullIfNewer is one of the values that BuilderOptions.PullPolicy + // can take, signalling that the source image should only be pulled + // from a registry if a local copy is not already present or if a + // newer version the image is present on the repository. + PullIfNewer // PullNever is one of the values that BuilderOptions.PullPolicy can // take, signalling that the source image should not be pulled from a // registry if a local copy of it is not already present. @@ -65,6 +70,8 @@ func (p PullPolicy) String() string { return "PullIfMissing" case PullAlways: return "PullAlways" + case PullIfNewer: + return "PullIfNewer" case PullNever: return "PullNever" } diff --git a/vendor/github.com/containers/buildah/changelog.txt b/vendor/github.com/containers/buildah/changelog.txt index 6e98e5405..098e6d6d4 100644 --- a/vendor/github.com/containers/buildah/changelog.txt +++ b/vendor/github.com/containers/buildah/changelog.txt @@ -1,3 +1,30 @@ +- Changelog for v1.11.5 (2019-11-11) + * Enhance error on unsafe symbolic link targets + * Add OCIRuntime to info + * Check nonexsit authfile + * Only output image id if running buildah bud --quiet + * Fix --pull=true||false and add --pull-never to bud and from (retry) + * cgroups v2: tweak or skip tests + * Prepwork: new 'skip' helpers for tests + * Handle configuration blobs for manifest lists + * unmarshalConvertedConfig: avoid using the updated image's ref + * Add completions for Manifest commands + * Add disableFips option to secrets pkg + * Update bud.bats test archive test + * Add test for caching based on content digest + * Builder.untarPath(): always evaluate b.ContentDigester.Hash() + * Bump github.com/onsi/ginkgo from 1.10.1 to 1.10.2 + * Fix another broken test: copy-url-mtime + * yet more fixes + * Actual bug fix for 'add' test: fix the expected mode + * BATS tests - lots of mostly minor cleanup + * build: drop support for ostree + * Add support for make vendor-in-container + * imgtype: exit with error if storage fails + * remove XDG_RUNTIME_DIR from default authfile path + * fix troubleshooting redirect instructions + * Bump back to v1.12.0-dev + - Changelog for v1.11.4 (2019-10-28) * buildah: add a "manifest" command * manifests: add the module diff --git a/vendor/github.com/containers/buildah/config.go b/vendor/github.com/containers/buildah/config.go index 617619e45..32f2171eb 100644 --- a/vendor/github.com/containers/buildah/config.go +++ b/vendor/github.com/containers/buildah/config.go @@ -26,7 +26,7 @@ func unmarshalConvertedConfig(ctx context.Context, dest interface{}, img types.I return errors.Wrapf(err, "error getting manifest MIME type for %q", transports.ImageName(img.Reference())) } if wantedManifestMIMEType != actualManifestMIMEType { - img, err = img.UpdatedImage(ctx, types.ManifestUpdateOptions{ + updatedImg, err := img.UpdatedImage(ctx, types.ManifestUpdateOptions{ ManifestMIMEType: wantedManifestMIMEType, InformationOnly: types.ManifestUpdateInformation{ // Strictly speaking, every value in here is invalid. But… Destination: nil, // Destination is technically required, but actually necessary only for conversion _to_ v2s1. Leave it nil, we will crash if that ever changes. @@ -35,8 +35,9 @@ func unmarshalConvertedConfig(ctx context.Context, dest interface{}, img types.I }, }) if err != nil { - return errors.Wrapf(err, "error converting image %q to %s", transports.ImageName(img.Reference()), wantedManifestMIMEType) + return errors.Wrapf(err, "error converting image %q from %q to %q", transports.ImageName(img.Reference()), actualManifestMIMEType, wantedManifestMIMEType) } + img = updatedImg } config, err := img.ConfigBlob(ctx) if err != nil { diff --git a/vendor/github.com/containers/buildah/go.mod b/vendor/github.com/containers/buildah/go.mod index c8741b781..2c76c46bf 100644 --- a/vendor/github.com/containers/buildah/go.mod +++ b/vendor/github.com/containers/buildah/go.mod @@ -14,7 +14,7 @@ require ( github.com/docker/go-units v0.4.0 github.com/docker/libnetwork v0.8.0-dev.2.0.20190625141545-5a177b73e316 github.com/etcd-io/bbolt v1.3.3 - github.com/fsouza/go-dockerclient v1.5.0 + github.com/fsouza/go-dockerclient v1.6.0 github.com/ghodss/yaml v1.0.0 github.com/hashicorp/go-multierror v1.0.0 github.com/imdario/mergo v0.3.6 // indirect @@ -43,7 +43,7 @@ require ( github.com/vishvananda/netns v0.0.0-20190625233234-7109fa855b0f // indirect github.com/xeipuuv/gojsonschema v1.1.0 // indirect golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad - golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 golang.org/x/time v0.0.0-20190921001708-c4c64cad1fd0 // indirect google.golang.org/grpc v1.24.0 // indirect k8s.io/api v0.0.0-20190813020757-36bff7324fb7 // indirect diff --git a/vendor/github.com/containers/buildah/go.sum b/vendor/github.com/containers/buildah/go.sum index 4a6673b04..15dab4794 100644 --- a/vendor/github.com/containers/buildah/go.sum +++ b/vendor/github.com/containers/buildah/go.sum @@ -11,8 +11,12 @@ github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiU github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c h1:YMP6olTU903X3gxQJckdmiP8/zkSMq4kN3uipsU9XjU= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c/go.mod h1:7xhjOwRV2+0HXGmM0jxaEu+ZiXJFoVZOTfL/dmqbrD8= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= github.com/PuerkitoBio/purell v1.0.0/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= github.com/PuerkitoBio/urlesc v0.0.0-20160726150825-5bd2802263f2/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= @@ -25,14 +29,25 @@ github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24 github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM= github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/blang/semver v3.5.0+incompatible h1:CGxCgetQ64DKk7rdZ++Vfnb1+ogGNnB17OJKJXD2Cfs= github.com/blang/semver v3.5.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY= github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882bXEDKfWIf0wa8HRvpnBoPszJJXL+TVbBw4M= github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= github.com/containernetworking/cni v0.7.1 h1:fE3r16wpSEyaqY4Z4oFrLMmIGfBYIKpPrHK31EJ9FzE= github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= github.com/containers/image/v4 v4.0.1 h1:idNGHChj0Pyv3vLrxul2oSVMZLeFqpoq3CjLeVgapSQ= @@ -48,6 +63,7 @@ github.com/containers/storage v1.13.5/go.mod h1:HELz8Sn+UVbPaUZMI8RvIG9doD4y4z6G github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk= github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/cpuguy83/go-md2man v1.0.10/go.mod h1:SmD6nW6nTyfqj6ABTjUi3V3JVMnlJmwcJI5acqYI6dE= github.com/cyphar/filepath-securejoin v0.2.2 h1:jCwT2GTP+PY5nBz3c/YL5PAIbusElVrPujOBSCj8xRg= github.com/cyphar/filepath-securejoin v0.2.2/go.mod h1:FpkQEhXnPnOthhzymB7CGsFk2G9VLXONKD9G7QGMM+4= @@ -64,6 +80,8 @@ github.com/docker/docker v1.4.2-0.20190710153559-aa8249ae1b8b h1:+Ga+YpCDpcY1fln github.com/docker/docker v1.4.2-0.20190710153559-aa8249ae1b8b/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce h1:H3csZuxZESJeeEiOxq4YXPNmLFbjl7u2qVBrAAGX/sA= github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= github.com/docker/docker-credential-helpers v0.6.1 h1:Dq4iIfcM7cNtddhLVWe9h4QDjsi4OER3Z8voPu/I52g= github.com/docker/docker-credential-helpers v0.6.1/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= @@ -90,6 +108,8 @@ github.com/fsouza/go-dockerclient v1.4.4 h1:Sd5nD4wdAgiPxvrbYUzT2ZZNmPk3z+GGnZ+f github.com/fsouza/go-dockerclient v1.4.4/go.mod h1:PrwszSL5fbmsESocROrOGq/NULMXRw+bajY0ltzD6MA= github.com/fsouza/go-dockerclient v1.5.0 h1:7OtayOe5HnoG+KWMHgyyPymwaodnB2IDYuVfseKyxbA= github.com/fsouza/go-dockerclient v1.5.0/go.mod h1:AqZZK/zFO3phxYxlTsAaeAMSdQ9mgHuhy+bjN034Qds= +github.com/fsouza/go-dockerclient v1.6.0 h1:f7j+AX94143JL1H3TiqSMkM4EcLDI0De1qD4GGn3Hig= +github.com/fsouza/go-dockerclient v1.6.0/go.mod h1:YWwtNPuL4XTX1SKJQk86cWPmmqwx+4np9qfPbb+znGc= github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk= @@ -102,6 +122,7 @@ github.com/go-openapi/jsonreference v0.0.0-20160704190145-13c6e3589ad9/go.mod h1 github.com/go-openapi/spec v0.0.0-20160808142527-6aced65f8501/go.mod h1:J8+jY1nAiCcj+friV/PDoE1/3eeccG9LYBs0tYvLOWc= github.com/go-openapi/swag v0.0.0-20160704191624-1d0bd113de87/go.mod h1:DXUve3Dpr1UfpPtxFw+EFuQ41HhCWZfha5jSVRG7C7I= github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= @@ -133,11 +154,15 @@ github.com/gorilla/mux v0.0.0-20170217192616-94e7d24fd285/go.mod h1:1lud6UwP+6or github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= github.com/gotestyourself/gotestyourself v2.2.0+incompatible/go.mod h1:zZKM6oeNM8k+FRljX1mnzVYeS8wiGgQyvST1/GafPbY= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o= github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ= github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI= github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= @@ -219,19 +244,23 @@ github.com/onsi/gomega v1.5.0 h1:izbySO9zDPmjJ8rDjLvkA2zJHIo+HkYXHnf7eN7SSyo= github.com/onsi/gomega v1.5.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.0 h1:XPnZz8VVBHjVsy1vzJmRwIcSwiUO+JFfrv/xGiigmME= github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU= github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0= github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158 h1:/A6bAdnSZoTQmKml3MdHAnSEPnBAQeigNBl4sxnfaaQ= github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7 h1:Dliu5QO+4JYWu/yMshaMU7G3JN2POGpwjJN7gjy10Go= github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/runtime-tools v0.9.0 h1:FYgwVsKRI/H9hU32MJ/4MLOzXWodKK5zsQavY8NPMkU= github.com/opencontainers/runtime-tools v0.9.0/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg= @@ -271,6 +300,8 @@ github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= github.com/prometheus/procfs v0.0.3 h1:CTwfnzjQ+8dS6MhHHu4YswVAD99sL2wjPqP+VkURmKE= github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= github.com/russross/blackfriday v1.5.2/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g= github.com/seccomp/containers-golang v0.0.0-20180629143253-cdfdaa7543f4 h1:rOG9oHVIndNR14f3HRyBy9UPQYmIPniWqTU1TDdHhq4= github.com/seccomp/containers-golang v0.0.0-20180629143253-cdfdaa7543f4/go.mod h1:f/98/SnvAzhAEFQJ3u836FePXvcbE8BS0YGMQNn4mhA= @@ -300,6 +331,7 @@ github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs= @@ -307,6 +339,7 @@ github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0= github.com/ulikunitz/xz v0.5.6 h1:jGHAfXawEGZQ3blwU5wnWKQJvAraT7Ftq9EXjnXYgt8= github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE= github.com/vbatts/tar-split v0.11.1/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g= github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tLAD8IceomUCNw= @@ -321,12 +354,15 @@ github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xeipuuv/gojsonschema v0.0.0-20190816131739-be0936907f66/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y= github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg= github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q= go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= @@ -335,12 +371,19 @@ golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4 h1:HuIa8hRrWRSrqYzx1qI49N golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad h1:5E5raQxcv+6CZ11RrBYQe5WRbUIWpScjh0kvHZkZIrQ= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= golang.org/x/net v0.0.0-20170114055629-f2499483f923/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU= golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= @@ -349,9 +392,11 @@ golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4 h1:YUO/7uOKsKeq9UokNS62b8FYywz3ker1l1vDZRCRefw= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20170830134202-bb24a47a89ea/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -360,7 +405,9 @@ golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5h golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190422165155-953cdadca894 h1:Cz4ceDQGXuKRnVBDTS23GTn/pU5OE2C0WrNTOYK1Uuc= golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -370,6 +417,8 @@ golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3 h1:4y9KwBHBgBNwDbtu44R5o1fdO golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 h1:tdsQdquKbTNMsSZLqnLELJGzCANp9oXhu6zFBW6ODx4= golang.org/x/sys v0.0.0-20190902133755-9109b7679e13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -382,12 +431,19 @@ golang.org/x/tools v0.0.0-20180810170437-e96c4e24768d/go.mod h1:n7NCudcB/nEzxVGm golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20181011042414-1f849cf54d09/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= google.golang.org/genproto v0.0.0-20180831171423-11092d34479b h1:lohp5blsw53GBXtLyLNaTXPXS9pJ1tiTw61ZHUoE9Qw= google.golang.org/genproto v0.0.0-20180831171423-11092d34479b/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.22.0 h1:J0UbZOIrCAl+fpTOf8YLs4dJo8L/owV4LYVtAXQoPkw= google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= google.golang.org/grpc v1.24.0 h1:vb/1TCsVn3DcJlQ0Gs1yB1pKI6Do2/QNwxdKqmc/b0s= @@ -410,6 +466,7 @@ gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gotest.tools v0.0.0-20190624233834-05ebafbffc79/go.mod h1:R//lfYlUuTOTfblYI3lGoAAAebUdzjvbmQsuB7Ykd90= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= k8s.io/api v0.0.0-20190813020757-36bff7324fb7 h1:4uJOjRn9kWq4AqJRE8+qzmAy+lJd9rh8TY455dNef4U= k8s.io/api v0.0.0-20190813020757-36bff7324fb7/go.mod h1:3Iy+myeAORNCLgjd/Xu9ebwN7Vh59Bw0vh9jhoX+V58= @@ -423,6 +480,7 @@ k8s.io/klog v0.0.0-20181102134211-b9b56d5dfc92/go.mod h1:Gq+BEi5rUBO/HRz0bTSXDUc k8s.io/klog v0.3.1 h1:RVgyDHY/kFKtLqh67NvEWIgkMneNoIrdkN0CxDSQc68= k8s.io/klog v0.3.1/go.mod h1:Gq+BEi5rUBO/HRz0bTSXDUcqjScdoY3a9IHpCEIOOfk= k8s.io/kube-openapi v0.0.0-20190709113604-33be087ad058/go.mod h1:nfDlWeOsu3pUf4yWGL+ERqohP4YsZcBJXWMK+gkzOA4= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= sigs.k8s.io/structured-merge-diff v0.0.0-20190525122527-15d366b2352e/go.mod h1:wWxsB5ozmmv/SG7nM11ayaAW51xMvak/t1r0CSlcokI= sigs.k8s.io/yaml v1.1.0 h1:4A07+ZFc2wgJwo8YNlQpr1rVlgUDlxXHhPJciaPY5gs= sigs.k8s.io/yaml v1.1.0/go.mod h1:UJmg0vDUVViEyp3mgSv9WPwZCDxu4rQW1olrI1uml+o= diff --git a/vendor/github.com/containers/buildah/imagebuildah/build.go b/vendor/github.com/containers/buildah/imagebuildah/build.go index 6b2c9c84c..fb9600b1a 100644 --- a/vendor/github.com/containers/buildah/imagebuildah/build.go +++ b/vendor/github.com/containers/buildah/imagebuildah/build.go @@ -27,6 +27,7 @@ import ( const ( PullIfMissing = buildah.PullIfMissing PullAlways = buildah.PullAlways + PullIfNewer = buildah.PullIfNewer PullNever = buildah.PullNever Gzip = archive.Gzip @@ -45,7 +46,7 @@ type BuildOptions struct { // commands. ContextDirectory string // PullPolicy controls whether or not we pull images. It should be one - // of PullIfMissing, PullAlways, or PullNever. + // of PullIfMissing, PullAlways, PullIfNewer, or PullNever. PullPolicy buildah.PullPolicy // Registry is a value which is prepended to the image's name, if it // needs to be pulled and the image name alone can not be resolved to a diff --git a/vendor/github.com/containers/buildah/imagebuildah/executor.go b/vendor/github.com/containers/buildah/imagebuildah/executor.go index 27ec1bb23..35fc3d63d 100644 --- a/vendor/github.com/containers/buildah/imagebuildah/executor.go +++ b/vendor/github.com/containers/buildah/imagebuildah/executor.go @@ -339,6 +339,11 @@ func (b *Executor) Build(ctx context.Context, stages imagebuilder.Stages) (image var cleanupImages []string cleanupStages := make(map[int]*StageExecutor) + stdout := b.out + if b.quiet { + b.out = ioutil.Discard + } + cleanup := func() error { var lastErr error // Clean up any containers associated with the final container @@ -527,6 +532,10 @@ func (b *Executor) Build(ctx context.Context, stages imagebuilder.Stages) (image if err = ioutil.WriteFile(b.iidfile, []byte(imageID), 0644); err != nil { return imageID, ref, errors.Wrapf(err, "failed to write image ID to file %q", b.iidfile) } + } else { + if _, err := stdout.Write([]byte(imageID + "\n")); err != nil { + return imageID, ref, errors.Wrapf(err, "failed to write image ID to stdout") + } } return imageID, ref, nil diff --git a/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go b/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go index fad2bfe95..67c0a0eb9 100644 --- a/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go +++ b/vendor/github.com/containers/buildah/imagebuildah/stage_executor.go @@ -318,7 +318,7 @@ func (s *StageExecutor) digestSpecifiedContent(node *parser.Node, argValues []st // directory. contextSrc, err := securejoin.SecureJoin(contextDir, src) if err != nil { - return "", errors.Wrapf(err, "error joining %q and %q", contextDir, src) + return "", errors.Wrapf(err, "forbidden path for %q, it is outside of the build context %q", src, contextDir) } sources = append(sources, contextSrc) } @@ -432,7 +432,7 @@ func (s *StageExecutor) Copy(excludes []string, copies ...imagebuilder.Copy) err // directory. srcSecure, err := securejoin.SecureJoin(contextDir, src) if err != nil { - return err + return errors.Wrapf(err, "forbidden path for %q, it is outside of the build context %q", src, contextDir) } if hadFinalPathSeparator { // If destination is a folder, we need to take extra care to diff --git a/vendor/github.com/containers/buildah/import.go b/vendor/github.com/containers/buildah/import.go index 751ce6ae1..329633b44 100644 --- a/vendor/github.com/containers/buildah/import.go +++ b/vendor/github.com/containers/buildah/import.go @@ -5,8 +5,10 @@ import ( "github.com/containers/buildah/docker" "github.com/containers/buildah/util" + "github.com/containers/image/v5/image" "github.com/containers/image/v5/manifest" is "github.com/containers/image/v5/storage" + "github.com/containers/image/v5/transports" "github.com/containers/image/v5/types" "github.com/containers/storage" digest "github.com/opencontainers/go-digest" @@ -28,12 +30,39 @@ func importBuilderDataFromImage(ctx context.Context, store storage.Store, system if err != nil { return nil, errors.Wrapf(err, "no such image %q", imageID) } - src, err2 := ref.NewImage(ctx, systemContext) - if err2 != nil { - return nil, errors.Wrapf(err2, "error instantiating image") + src, err := ref.NewImageSource(ctx, systemContext) + if err != nil { + return nil, errors.Wrapf(err, "error instantiating image source") } defer src.Close() + imageDigest := "" + manifestBytes, manifestType, err := src.GetManifest(ctx, nil) + if err != nil { + return nil, errors.Wrapf(err, "error loading image manifest for %q", transports.ImageName(ref)) + } + if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { + imageDigest = manifestDigest.String() + } + + var instanceDigest *digest.Digest + if manifest.MIMETypeIsMultiImage(manifestType) { + list, err := manifest.ListFromBlob(manifestBytes, manifestType) + if err != nil { + return nil, errors.Wrapf(err, "error parsing image manifest for %q as list", transports.ImageName(ref)) + } + instance, err := list.ChooseInstance(systemContext) + if err != nil { + return nil, errors.Wrapf(err, "error finding an appropriate image in manifest list %q", transports.ImageName(ref)) + } + instanceDigest = &instance + } + + image, err := image.FromUnparsedImage(ctx, systemContext, image.UnparsedInstance(src, instanceDigest)) + if err != nil { + return nil, errors.Wrapf(err, "error instantiating image for %q instance %q", transports.ImageName(ref), instanceDigest) + } + imageName := "" if img, err3 := store.Image(imageID); err3 == nil { if len(img.Names) > 0 { @@ -48,13 +77,6 @@ func importBuilderDataFromImage(ctx context.Context, store storage.Store, system } } - imageDigest := "" - if manifestBytes, _, err := src.Manifest(ctx); err == nil { - if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { - imageDigest = manifestDigest.String() - } - } - defaultNamespaceOptions, err := DefaultNamespaceOptions() if err != nil { return nil, err @@ -79,7 +101,7 @@ func importBuilderDataFromImage(ctx context.Context, store storage.Store, system }, } - if err := builder.initConfig(ctx, src); err != nil { + if err := builder.initConfig(ctx, image); err != nil { return nil, errors.Wrapf(err, "error preparing image configuration") } diff --git a/vendor/github.com/containers/buildah/info.go b/vendor/github.com/containers/buildah/info.go index c741bb449..322bd8834 100644 --- a/vendor/github.com/containers/buildah/info.go +++ b/vendor/github.com/containers/buildah/info.go @@ -52,10 +52,13 @@ func hostInfo() map[string]interface{} { logrus.Error(err, "err reading cgroups mode") } cgroupVersion := "v1" + ociruntime := "runc" if unified { cgroupVersion = "v2" + ociruntime = "crun" } info["CgroupVersion"] = cgroupVersion + info["OCIRuntime"] = ociruntime mi, err := system.ReadMemInfo() if err != nil { diff --git a/vendor/github.com/containers/buildah/new.go b/vendor/github.com/containers/buildah/new.go index 87cfd5d0d..68c6ebd54 100644 --- a/vendor/github.com/containers/buildah/new.go +++ b/vendor/github.com/containers/buildah/new.go @@ -5,8 +5,10 @@ import ( "fmt" "math/rand" "strings" + "time" "github.com/containers/buildah/util" + "github.com/containers/image/v5/image" "github.com/containers/image/v5/manifest" "github.com/containers/image/v5/pkg/sysregistriesv2" is "github.com/containers/image/v5/storage" @@ -14,6 +16,7 @@ import ( "github.com/containers/image/v5/transports/alltransports" "github.com/containers/image/v5/types" "github.com/containers/storage" + digest "github.com/opencontainers/go-digest" "github.com/openshift/imagebuilder" "github.com/pkg/errors" "github.com/sirupsen/logrus" @@ -154,23 +157,47 @@ func resolveImage(ctx context.Context, systemContext *types.SystemContext, store if destImage == "" { return nil, "", nil, errors.Errorf("error computing local image name for %q", transports.ImageName(srcRef)) } - ref, err := is.Transport.ParseStoreReference(store, destImage) if err != nil { return nil, "", nil, errors.Wrapf(err, "error parsing reference to image %q", destImage) } - img, err := is.Transport.GetStoreImage(store, ref) - if err == nil { - return ref, transport, img, nil - } - if errors.Cause(err) == storage.ErrImageUnknown && options.PullPolicy != PullIfMissing { - logrus.Debugf("no such image %q: %v", transports.ImageName(ref), err) - failures = append(failures, failure{ - resolvedImageName: image, - err: fmt.Errorf("no such image %q", transports.ImageName(ref)), - }) - continue + if options.PullPolicy == PullIfNewer { + img, err := is.Transport.GetStoreImage(store, ref) + if err == nil { + // Let's see if this image is on the repository and if it's there + // then note it's Created date. + var repoImageCreated time.Time + repoImageFound := false + repoImage, err := srcRef.NewImage(ctx, systemContext) + if err == nil { + inspect, err := repoImage.Inspect(ctx) + if err == nil { + repoImageFound = true + repoImageCreated = *inspect.Created + } + repoImage.Close() + } + if !repoImageFound || repoImageCreated == img.Created { + // The image is only local or the same date is on the + // local and repo versions of the image, no need to pull. + return ref, transport, img, nil + } + } + } else { + // Get the image from the store if present for PullNever and PullIfMissing + img, err := is.Transport.GetStoreImage(store, ref) + if err == nil { + return ref, transport, img, nil + } + if errors.Cause(err) == storage.ErrImageUnknown && options.PullPolicy == PullNever { + logrus.Debugf("no such image %q: %v", transports.ImageName(ref), err) + failures = append(failures, failure{ + resolvedImageName: image, + err: fmt.Errorf("no such image %q", transports.ImageName(ref)), + }) + continue + } } pulledImg, pulledReference, err := pullAndFindImage(ctx, store, srcRef, options, systemContext) @@ -253,35 +280,53 @@ func newBuilder(ctx context.Context, store storage.Store, options BuilderOptions return nil, err } } - image := options.FromImage + imageSpec := options.FromImage imageID := "" imageDigest := "" topLayer := "" if img != nil { - image = getImageName(imageNamePrefix(image), img) + imageSpec = getImageName(imageNamePrefix(imageSpec), img) imageID = img.ID topLayer = img.TopLayer } - var src types.ImageCloser + var src types.Image if ref != nil { - src, err = ref.NewImage(ctx, systemContext) + srcSrc, err := ref.NewImageSource(ctx, systemContext) if err != nil { return nil, errors.Wrapf(err, "error instantiating image for %q", transports.ImageName(ref)) } - if manifestBytes, _, err := src.Manifest(ctx); err == nil { - if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { - imageDigest = manifestDigest.String() + defer srcSrc.Close() + manifestBytes, manifestType, err := srcSrc.GetManifest(ctx, nil) + if err != nil { + return nil, errors.Wrapf(err, "error loading image manifest for %q", transports.ImageName(ref)) + } + if manifestDigest, err := manifest.Digest(manifestBytes); err == nil { + imageDigest = manifestDigest.String() + } + var instanceDigest *digest.Digest + if manifest.MIMETypeIsMultiImage(manifestType) { + list, err := manifest.ListFromBlob(manifestBytes, manifestType) + if err != nil { + return nil, errors.Wrapf(err, "error parsing image manifest for %q as list", transports.ImageName(ref)) + } + instance, err := list.ChooseInstance(systemContext) + if err != nil { + return nil, errors.Wrapf(err, "error finding an appropriate image in manifest list %q", transports.ImageName(ref)) } + instanceDigest = &instance + } + src, err = image.FromUnparsedImage(ctx, systemContext, image.UnparsedInstance(srcSrc, instanceDigest)) + if err != nil { + return nil, errors.Wrapf(err, "error instantiating image for %q instance %q", transports.ImageName(ref), instanceDigest) } - defer src.Close() } name := "working-container" if options.Container != "" { name = options.Container } else { - if image != "" { - name = imageNamePrefix(image) + "-" + name + if imageSpec != "" { + name = imageNamePrefix(imageSpec) + "-" + name } } var container *storage.Container @@ -332,7 +377,7 @@ func newBuilder(ctx context.Context, store storage.Store, options BuilderOptions builder := &Builder{ store: store, Type: containerType, - FromImage: image, + FromImage: imageSpec, FromImageID: imageID, FromImageDigest: imageDigest, Container: name, diff --git a/vendor/github.com/containers/buildah/pkg/cli/common.go b/vendor/github.com/containers/buildah/pkg/cli/common.go index e8979cd7f..6f49cc240 100644 --- a/vendor/github.com/containers/buildah/pkg/cli/common.go +++ b/vendor/github.com/containers/buildah/pkg/cli/common.go @@ -63,6 +63,7 @@ type BudResults struct { Platform string Pull bool PullAlways bool + PullNever bool Quiet bool Rm bool Runtime string @@ -159,8 +160,9 @@ func GetBudFlags(flags *BudResults) pflag.FlagSet { fs.StringVar(&flags.Logfile, "logfile", "", "log to `file` instead of stdout/stderr") fs.IntVar(&flags.Loglevel, "loglevel", 0, "adjust logging level (range from -2 to 3)") fs.StringVar(&flags.Platform, "platform", "", "CLI compatibility: no action or effect") - fs.BoolVar(&flags.Pull, "pull", true, "pull the image if not present") - fs.BoolVar(&flags.PullAlways, "pull-always", false, "pull the image, even if a version is present") + fs.BoolVar(&flags.Pull, "pull", true, "pull the image from the registry if newer or not present in store, if false, only pull the image if not present") + fs.BoolVar(&flags.PullAlways, "pull-always", false, "pull the image even if the named image is present in store") + fs.BoolVar(&flags.PullNever, "pull-never", false, "do not pull the image, use the image present in store if available") fs.BoolVarP(&flags.Quiet, "quiet", "q", false, "refrain from announcing build instructions and image read/write progress") fs.BoolVar(&flags.Rm, "rm", true, "Remove intermediate containers after a successful build") // "runtime" definition moved to avoid name collision in podman build. Defined in cmd/buildah/bud.go. @@ -265,9 +267,15 @@ func VerifyFlagsArgsOrder(args []string) error { } func GetDefaultAuthFile() string { - authfile := os.Getenv("REGISTRY_AUTH_FILE") - if authfile != "" { - return authfile + return os.Getenv("REGISTRY_AUTH_FILE") +} + +func CheckAuthFile(authfile string) error { + if authfile == "" { + return nil } - return "" + if _, err := os.Stat(authfile); err != nil { + return errors.Wrapf(err, "error checking authfile path %s", authfile) + } + return nil } diff --git a/vendor/github.com/containers/storage/.cirrus.yml b/vendor/github.com/containers/storage/.cirrus.yml index 619e077d0..e4b38947d 100644 --- a/vendor/github.com/containers/storage/.cirrus.yml +++ b/vendor/github.com/containers/storage/.cirrus.yml @@ -19,9 +19,11 @@ env: #### # GCE project where images live IMAGE_PROJECT: "libpod-218412" - FEDORA_CACHE_IMAGE_NAME: "fedora-cloud-base-30-1-2-1556821664" - PRIOR_FEDORA_CACHE_IMAGE_NAME: "fedora-cloud-base-29-1-2-1541789245" - UBUNTU_CACHE_IMAGE_NAME: "ubuntu-1904-disco-v20190514" + _BUILT_IMAGE_SUFFIX: "libpod-6228273469587456" + FEDORA_CACHE_IMAGE_NAME: "fedora-31-${_BUILT_IMAGE_SUFFIX}" + PRIOR_FEDORA_CACHE_IMAGE_NAME: "fedora-30-${_BUILT_IMAGE_SUFFIX}" + UBUNTU_CACHE_IMAGE_NAME: "ubuntu-19-${_BUILT_IMAGE_SUFFIX}" + PRIOR_UBUNTU_CACHE_IMAGE_NAME: "ubuntu-18-${_BUILT_IMAGE_SUFFIX}" #### #### Command variables to help avoid duplication @@ -49,11 +51,14 @@ gce_instance: image_name: "${FEDORA_CACHE_IMAGE_NAME}" testing_task: + depends_on: + - lint gce_instance: # Only need to specify differences from defaults (above) matrix: # Duplicate this task for each matrix product. image_name: "${FEDORA_CACHE_IMAGE_NAME}" image_name: "${PRIOR_FEDORA_CACHE_IMAGE_NAME}" image_name: "${UBUNTU_CACHE_IMAGE_NAME}" + # image_name: "${PRIOR_UBUNTU_CACHE_IMAGE_NAME}" # No fuse3 support # Separate scripts for separate outputs, makes debugging easier. setup_script: '${CIRRUS_WORKING_DIR}/${SCRIPT_BASE}/setup.sh |& ${_TIMESTAMP}' @@ -99,6 +104,7 @@ meta_task: ${FEDORA_CACHE_IMAGE_NAME} ${PRIOR_FEDORA_CACHE_IMAGE_NAME} ${UBUNTU_CACHE_IMAGE_NAME} + ${PRIOR_UBUNTU_CACHE_IMAGE_NAME} BUILDID: "${CIRRUS_BUILD_ID}" REPOREF: "${CIRRUS_CHANGE_IN_REPO}" GCPJSON: ENCRYPTED[244a93fe8b386b48b96f748342bf741350e43805eee81dd04b45093bdf737e540b993fc735df41f131835fa0f9b65826] @@ -110,7 +116,7 @@ meta_task: vendor_task: container: - image: golang:1.12 + image: golang:1.13 modules_cache: fingerprint_script: cat go.sum folder: $GOPATH/pkg/mod diff --git a/vendor/github.com/containers/storage/.travis.yml b/vendor/github.com/containers/storage/.travis.yml index dc1c61391..a7865729d 100644 --- a/vendor/github.com/containers/storage/.travis.yml +++ b/vendor/github.com/containers/storage/.travis.yml @@ -15,30 +15,21 @@ env: - GO_VERSION="stable" DISTRO="ubuntu" - - GO_VERSION="1.11" - DISTRO="ubuntu" - - - GO_VERSION="1.12" + - GO_VERSION="1.12.12" DISTRO="ubuntu" # Fedora - GO_VERSION="stable" DISTRO="fedora" - - GO_VERSION="1.11" - DISTRO="fedora" - - - GO_VERSION="1.12" + - GO_VERSION="1.12.12" DISTRO="fedora" # CentOS - GO_VERSION="stable" DISTRO="centos" - - GO_VERSION="1.11" - DISTRO="centos" - - - GO_VERSION="1.12" + - GO_VERSION="1.12.12" DISTRO="centos" # GO_VERSION="stable" builds successfully, but tests fail on all platforms. diff --git a/vendor/github.com/containers/storage/Makefile b/vendor/github.com/containers/storage/Makefile index 90e5ca499..83005307f 100644 --- a/vendor/github.com/containers/storage/Makefile +++ b/vendor/github.com/containers/storage/Makefile @@ -127,6 +127,9 @@ lint: install.tools help: ## this help @awk 'BEGIN {FS = ":.*?## "} /^[a-z A-Z_-]+:.*?## / {gsub(" ",",",$$1);gsub("\\\\n",sprintf("\n%22c"," "), $$2);printf "\033[36m%-21s\033[0m %s\n", $$1, $$2}' $(MAKEFILE_LIST) +vendor-in-container: + podman run --privileged --rm --env HOME=/root -v `pwd`:/src -w /src golang make vendor + vendor: export GO111MODULE=on \ $(GO) mod tidy && \ diff --git a/vendor/github.com/containers/storage/VERSION b/vendor/github.com/containers/storage/VERSION index 43ded9062..850e74240 100644 --- a/vendor/github.com/containers/storage/VERSION +++ b/vendor/github.com/containers/storage/VERSION @@ -1 +1 @@ -1.13.5 +1.14.0 diff --git a/vendor/github.com/containers/storage/drivers/copy/copy_linux.go b/vendor/github.com/containers/storage/drivers/copy/copy_linux.go index d614b78fc..e52545d5b 100644 --- a/vendor/github.com/containers/storage/drivers/copy/copy_linux.go +++ b/vendor/github.com/containers/storage/drivers/copy/copy_linux.go @@ -155,7 +155,7 @@ func DirCopy(srcDir, dstDir string, copyMode Mode, copyXattrs bool) error { switch mode := f.Mode(); { case mode.IsRegular(): - id := fileID{dev: stat.Dev, ino: stat.Ino} + id := fileID{dev: uint64(stat.Dev), ino: stat.Ino} if copyMode == Hardlink { isHardlink = true if err2 := os.Link(srcPath, dstPath); err2 != nil { diff --git a/vendor/github.com/containers/storage/drivers/driver_linux.go b/vendor/github.com/containers/storage/drivers/driver_linux.go index a45f6b44c..dddf8a8b4 100644 --- a/vendor/github.com/containers/storage/drivers/driver_linux.go +++ b/vendor/github.com/containers/storage/drivers/driver_linux.go @@ -48,6 +48,8 @@ const ( FsMagicZfs = FsMagic(0x2fc12fc1) // FsMagicOverlay filesystem id for overlay FsMagicOverlay = FsMagic(0x794C7630) + // FsMagicFUSE filesystem id for FUSE + FsMagicFUSE = FsMagic(0x65735546) ) var ( diff --git a/vendor/github.com/containers/storage/drivers/overlay/overlay.go b/vendor/github.com/containers/storage/drivers/overlay/overlay.go index 97222fe7a..13cd65fa5 100644 --- a/vendor/github.com/containers/storage/drivers/overlay/overlay.go +++ b/vendor/github.com/containers/storage/drivers/overlay/overlay.go @@ -231,13 +231,18 @@ func Init(home string, options graphdriver.Options) (graphdriver.Driver, error) } } + fileSystemType := graphdriver.FsMagicOverlay + if opts.mountProgram != "" { + fileSystemType = graphdriver.FsMagicFUSE + } + d := &Driver{ name: "overlay", home: home, runhome: runhome, uidMaps: options.UIDMaps, gidMaps: options.GIDMaps, - ctr: graphdriver.NewRefCounter(graphdriver.NewFsChecker(graphdriver.FsMagicOverlay)), + ctr: graphdriver.NewRefCounter(graphdriver.NewFsChecker(fileSystemType)), supportsDType: supportsDType, usingMetacopy: usingMetacopy, locker: locker.New(), @@ -1016,8 +1021,39 @@ func (d *Driver) Put(id string) error { if _, err := ioutil.ReadFile(path.Join(dir, lowerFile)); err != nil && !os.IsNotExist(err) { return err } - if err := unix.Unmount(mountpoint, unix.MNT_DETACH); err != nil && !os.IsNotExist(err) { - logrus.Debugf("Failed to unmount %s overlay: %s - %v", id, mountpoint, err) + + unmounted := false + + if d.options.mountProgram != "" { + // Attempt to unmount the FUSE mount using either fusermount or fusermount3. + // If they fail, fallback to unix.Unmount + for _, v := range []string{"fusermount3", "fusermount"} { + err := exec.Command(v, "-u", mountpoint).Run() + if err != nil && !os.IsNotExist(err) { + logrus.Debugf("Error unmounting %s with %s - %v", mountpoint, v, err) + } + if err == nil { + unmounted = true + break + } + } + // If fusermount|fusermount3 failed to unmount the FUSE file system, make sure all + // pending changes are propagated to the file system + if !unmounted { + fd, err := unix.Open(mountpoint, unix.O_DIRECTORY, 0) + if err == nil { + if err := unix.Syncfs(fd); err != nil { + logrus.Debugf("Error Syncfs(%s) - %v", mountpoint, err) + } + unix.Close(fd) + } + } + } + + if !unmounted { + if err := unix.Unmount(mountpoint, unix.MNT_DETACH); err != nil && !os.IsNotExist(err) { + logrus.Debugf("Failed to unmount %s overlay: %s - %v", id, mountpoint, err) + } } if err := unix.Rmdir(mountpoint); err != nil && !os.IsNotExist(err) { diff --git a/vendor/github.com/containers/storage/go.mod b/vendor/github.com/containers/storage/go.mod index 934e82ad2..f9d7a199c 100644 --- a/vendor/github.com/containers/storage/go.mod +++ b/vendor/github.com/containers/storage/go.mod @@ -3,22 +3,22 @@ module github.com/containers/storage require ( github.com/BurntSushi/toml v0.3.1 github.com/DataDog/zstd v1.4.0 // indirect - github.com/Microsoft/go-winio v0.4.12 + github.com/Microsoft/go-winio v0.4.14 github.com/Microsoft/hcsshim v0.8.6 - github.com/docker/docker v0.0.0-20171019062838-86f080cff091 + github.com/docker/docker v0.0.0-20171019062838-86f080cff091 // indirect github.com/docker/go-units v0.4.0 - github.com/klauspost/compress v1.7.2 + github.com/klauspost/compress v1.9.2 github.com/klauspost/cpuid v1.2.1 // indirect github.com/klauspost/pgzip v1.2.1 - github.com/mattn/go-shellwords v1.0.5 + github.com/mattn/go-shellwords v1.0.6 github.com/mistifyio/go-zfs v2.1.1+incompatible github.com/opencontainers/go-digest v1.0.0-rc1 - github.com/opencontainers/runc v1.0.0-rc8 - github.com/opencontainers/selinux v1.2.2 + github.com/opencontainers/runc v1.0.0-rc9 + github.com/opencontainers/selinux v1.3.0 github.com/pkg/errors v0.8.1 github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7 github.com/sirupsen/logrus v1.4.2 - github.com/stretchr/testify v1.3.0 + github.com/stretchr/testify v1.4.0 github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 github.com/tchap/go-patricia v2.3.0+incompatible github.com/vbatts/tar-split v0.11.1 @@ -26,3 +26,5 @@ require ( golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb gotest.tools v0.0.0-20190624233834-05ebafbffc79 ) + +go 1.13 diff --git a/vendor/github.com/containers/storage/go.sum b/vendor/github.com/containers/storage/go.sum index a0e05dd1d..6a81628bf 100644 --- a/vendor/github.com/containers/storage/go.sum +++ b/vendor/github.com/containers/storage/go.sum @@ -4,8 +4,20 @@ github.com/DataDog/zstd v1.4.0 h1:vhoV+DUHnRZdKW1i5UMjAk2G4JY8wN4ayRfYDNdEhwo= github.com/DataDog/zstd v1.4.0/go.mod h1:1jcaCB/ufaK+sKp1NBhlGmpz41jOoPQ35bpF36t7BBo= github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiUOryc= github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= +github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= +github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b h1:T4nWG1TXIxeor8mAu5bFguPJgSIGhZqv/f0z55KCrJM= +github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b/go.mod h1:TrMrLQfeENAPYPRsJuq3jsqdlRh3lvi6trTZJG8+tho= +github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50 h1:WMpHmC6AxwWb9hMqhudkqG7A/p14KiMnl6d3r1iUMjU= +github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f h1:JOrtw2xFKzlg+cbHpyrpLDmnN1HqhBfnX7WDiW7eG2c= +github.com/coreos/go-systemd v0.0.0-20190719114852-fd7a80b32e1f/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d h1:U+s90UTSYgptZMwQh2aRr3LuazLJIa+Pg3Kc1ylSYVY= +github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= +github.com/cyphar/filepath-securejoin v0.2.2 h1:jCwT2GTP+PY5nBz3c/YL5PAIbusElVrPujOBSCj8xRg= +github.com/cyphar/filepath-securejoin v0.2.2/go.mod h1:FpkQEhXnPnOthhzymB7CGsFk2G9VLXONKD9G7QGMM+4= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= @@ -13,10 +25,18 @@ github.com/docker/docker v0.0.0-20171019062838-86f080cff091 h1:QpxpTw4MJeOzbC7X0 github.com/docker/docker v0.0.0-20171019062838-86f080cff091/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v4.1.0+incompatible h1:WqqLRTsQic3apZUK9qC5sGNfXthmPXzUZ7nQPrNITa4= +github.com/godbus/dbus v4.1.0+incompatible/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs= +github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/go-cmp v0.2.0 h1:+dTQ8DZQJz0Mb/HjFlkptS1FeQ4cWSnN941F8aEG4SQ= github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= github.com/klauspost/compress v1.7.2 h1:liMOoeIvFpr9kEvalrZ7VVBA4wGf7zfOgwBjzz/5g2Y= github.com/klauspost/compress v1.7.2/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= +github.com/klauspost/compress v1.9.1 h1:TWy0o9J9c6LK9C8t7Msh6IAJNXbsU/nvKLTQUU5HdaY= +github.com/klauspost/compress v1.9.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= +github.com/klauspost/compress v1.9.2 h1:LfVyl+ZlLlLDeQ/d2AqfGIIH4qEDu0Ed2S5GyhCWIWY= +github.com/klauspost/compress v1.9.2/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A= github.com/klauspost/cpuid v1.2.1 h1:vJi+O/nMdFt0vqm8NZBI6wzALWdA2X+egi0ogNyrC/w= github.com/klauspost/cpuid v1.2.1/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek= github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM= @@ -25,16 +45,26 @@ github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGi github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/mattn/go-shellwords v1.0.5 h1:JhhFTIOslh5ZsPrpa3Wdg8bF0WI3b44EMblmU9wIsXc= github.com/mattn/go-shellwords v1.0.5/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= +github.com/mattn/go-shellwords v1.0.6 h1:9Jok5pILi5S1MnDirGVTufYGtksUs/V2BWUP3ZkeUUI= +github.com/mattn/go-shellwords v1.0.6/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= github.com/mistifyio/go-zfs v2.1.1+incompatible h1:gAMO1HM9xBRONLHHYnu5iFsOJUiJdNZo6oqSENd4eW8= github.com/mistifyio/go-zfs v2.1.1+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4= +github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618 h1:7InQ7/zrOh6SlFjaXFubv0xX0HsuC9qJsdqm7bNQpYM= +github.com/mrunalp/fileutils v0.0.0-20171103030105-7d4729fb3618/go.mod h1:x8F1gnqOkIEiO4rqoeEEEqQbo7HjGMTvyoq3gej4iT0= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/runc v0.1.1 h1:GlxAyO6x8rfZYN9Tt0Kti5a/cP41iuiO2yYT0IJGY8Y= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0= github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc9 h1:/k06BMULKF5hidyoZymkoDCzdJzltZpz/UU4LguQVtc= +github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v1.0.1 h1:wY4pOY8fBdSIvs9+IDHC55thBuEulhzfSgKeC1yFvzQ= +github.com/opencontainers/runtime-spec v1.0.1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg= github.com/opencontainers/selinux v1.2.2/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs= +github.com/opencontainers/selinux v1.3.0 h1:xsI95WzPZu5exzA6JzkLSfdr/DilzOhCJOqGe5TgR0g= +github.com/opencontainers/selinux v1.3.0/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs= github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= @@ -42,28 +72,49 @@ github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZb github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7 h1:gGBSHPOU7g8YjTbhwn+lvFm2VDEhhA+PwDIlstkgSxE= github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M= +github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q= +github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= +github.com/seccomp/libseccomp-golang v0.9.1 h1:NJjM5DNFOs0s3kYE1WUOr6G8V97sdt46rlXTMfXGWBo= +github.com/seccomp/libseccomp-golang v0.9.1/go.mod h1:GbW5+tmTXfcxTToHLXlScSlAvWlF4P2Ca7zGrPiEpWo= +github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo= +github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= github.com/sirupsen/logrus v1.4.2 h1:SPIRibHv4MatM3XXNO2BJeFLZwZ2LvZgfQ5+UNI2im4= github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE= github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.1.1 h1:2vfRuCMp5sSVIDSqO8oNnWJq7mPa6KVP3iPIwFBuy8A= github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= +github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= +github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs= github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I= +github.com/urfave/cli v1.22.1 h1:+mkCCcOFKPnCmVYVcURKps1Xe+3zP90gSYGNfRkjoIY= +github.com/urfave/cli v1.22.1/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE= github.com/vbatts/tar-split v0.11.1/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g= +github.com/vishvananda/netlink v1.0.0 h1:bqNY2lgheFIu1meHUFSH3d7vG93AFyqg3oGbJCOJgSM= +github.com/vishvananda/netlink v1.0.0/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= +github.com/vishvananda/netns v0.0.0-20190625233234-7109fa855b0f h1:nBX3nTcmxEtHSERBJaIo1Qa26VwRaopnZmfDQUXsF4I= +github.com/vishvananda/netns v0.0.0-20190625233234-7109fa855b0f/go.mod h1:ZjcWmFBXmLKZu9Nxj3WKYEafiSqer2rnvPr0en9UNpI= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU= golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k= golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/tools v0.0.0-20180810170437-e96c4e24768d/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw= +gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gotest.tools v0.0.0-20190624233834-05ebafbffc79 h1:C+K4iPg1rIvmCf4JjelkbWv2jeWevEwp05Lz8XfTYgE= gotest.tools v0.0.0-20190624233834-05ebafbffc79/go.mod h1:R//lfYlUuTOTfblYI3lGoAAAebUdzjvbmQsuB7Ykd90= diff --git a/vendor/github.com/containers/storage/pkg/archive/archive.go b/vendor/github.com/containers/storage/pkg/archive/archive.go index 20f017e64..ba635ae91 100644 --- a/vendor/github.com/containers/storage/pkg/archive/archive.go +++ b/vendor/github.com/containers/storage/pkg/archive/archive.go @@ -821,11 +821,12 @@ func TarWithOptions(srcPath string, options *TarOptions) (io.ReadCloser, error) // is asking for that file no matter what - which is true // for some files, like .dockerignore and Dockerfile (sometimes) if include != relFilePath { - skip, err = pm.Matches(relFilePath) + matches, err := pm.IsMatch(relFilePath) if err != nil { logrus.Errorf("Error matching %s: %v", relFilePath, err) return err } + skip = matches } if skip { diff --git a/vendor/github.com/containers/storage/pkg/archive/archive_linux.go b/vendor/github.com/containers/storage/pkg/archive/archive_linux.go index 5602c7e21..3a47eceae 100644 --- a/vendor/github.com/containers/storage/pkg/archive/archive_linux.go +++ b/vendor/github.com/containers/storage/pkg/archive/archive_linux.go @@ -61,10 +61,7 @@ func (o overlayWhiteoutConverter) ConvertWrite(hdr *tar.Header, path string, fi } if statErr == nil { if stat.Mode()&os.ModeCharDevice != 0 { - // It's a whiteout for this directory, so it can't have been - // both deleted and recreated in the layer we're diffing. - s := stat.Sys().(*syscall.Stat_t) - if major(s.Rdev) == 0 && minor(s.Rdev) == 0 { + if isWhiteOut(stat) { return nil, nil } } @@ -98,8 +95,7 @@ func (o overlayWhiteoutConverter) ConvertWrite(hdr *tar.Header, path string, fi // If it's whiteout for a parent directory, then the // original directory wasn't inherited into this layer, // so we don't need to emit whiteout for it. - s := stat.Sys().(*syscall.Stat_t) - if major(s.Rdev) == 0 && minor(s.Rdev) == 0 { + if isWhiteOut(stat) { return nil, nil } } @@ -141,3 +137,8 @@ func (overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, return true, nil } + +func isWhiteOut(stat os.FileInfo) bool { + s := stat.Sys().(*syscall.Stat_t) + return major(uint64(s.Rdev)) == 0 && minor(uint64(s.Rdev)) == 0 +} diff --git a/vendor/github.com/containers/storage/pkg/archive/changes_linux.go b/vendor/github.com/containers/storage/pkg/archive/changes_linux.go index b12309361..dc313d1ab 100644 --- a/vendor/github.com/containers/storage/pkg/archive/changes_linux.go +++ b/vendor/github.com/containers/storage/pkg/archive/changes_linux.go @@ -307,9 +307,7 @@ func overlayLowerContainsWhiteout(root, path string) (bool, error) { return false, err } if err == nil && stat.Mode()&os.ModeCharDevice != 0 { - // Check if there's whiteout for the specified item in the specified layer. - s := stat.Sys().(*syscall.Stat_t) - if major(s.Rdev) == 0 && minor(s.Rdev) == 0 { + if isWhiteOut(stat) { return true, nil } } @@ -319,8 +317,7 @@ func overlayLowerContainsWhiteout(root, path string) (bool, error) { func overlayDeletedFile(layers []string, root, path string, fi os.FileInfo) (string, error) { // If it's a whiteout item, then a file or directory with that name is removed by this layer. if fi.Mode()&os.ModeCharDevice != 0 { - s := fi.Sys().(*syscall.Stat_t) - if major(s.Rdev) == 0 && minor(s.Rdev) == 0 { + if isWhiteOut(fi) { return path, nil } } @@ -350,10 +347,7 @@ func overlayDeletedFile(layers []string, root, path string, fi os.FileInfo) (str } if err == nil { if stat.Mode()&os.ModeCharDevice != 0 { - // It's a whiteout for this directory, so it can't have been - // deleted in this layer. - s := stat.Sys().(*syscall.Stat_t) - if major(s.Rdev) == 0 && minor(s.Rdev) == 0 { + if isWhiteOut(stat) { return "", nil } } @@ -370,10 +364,7 @@ func overlayDeletedFile(layers []string, root, path string, fi os.FileInfo) (str } if err == nil { if stat.Mode()&os.ModeCharDevice != 0 { - // If it's whiteout for a parent directory, then the - // original directory wasn't inherited into the top layer. - s := stat.Sys().(*syscall.Stat_t) - if major(s.Rdev) == 0 && minor(s.Rdev) == 0 { + if isWhiteOut(stat) { return "", nil } } diff --git a/vendor/github.com/containers/storage/pkg/config/config.go b/vendor/github.com/containers/storage/pkg/config/config.go index 091040140..18a65bc0a 100644 --- a/vendor/github.com/containers/storage/pkg/config/config.go +++ b/vendor/github.com/containers/storage/pkg/config/config.go @@ -1,5 +1,9 @@ package config +import ( + "fmt" +) + // ThinpoolOptionsConfig represents the "storage.options.thinpool" // TOML config table. type ThinpoolOptionsConfig struct { @@ -47,6 +51,9 @@ type ThinpoolOptionsConfig struct { // devices. MountOpt string `toml:"mountopt"` + // Size + Size string `toml:"size"` + // UseDeferredDeletion marks device for deferred deletion UseDeferredDeletion string `toml:"use_deferred_deletion"` @@ -59,6 +66,47 @@ type ThinpoolOptionsConfig struct { XfsNoSpaceMaxRetries string `toml:"xfs_nospace_max_retries"` } +type AufsOptionsConfig struct { + // MountOpt specifies extra mount options used when mounting + MountOpt string `toml:"mountopt"` +} + +type BtrfsOptionsConfig struct { + // MinSpace is the minimal spaces allocated to the device + MinSpace string `toml:"min_space"` + // Size + Size string `toml:"size"` +} + +type OverlayOptionsConfig struct { + // IgnoreChownErrors is a flag for whether chown errors should be + // ignored when building an image. + IgnoreChownErrors string `toml:"ignore_chown_errors"` + // MountOpt specifies extra mount options used when mounting + MountOpt string `toml:"mountopt"` + // Alternative program to use for the mount of the file system + MountProgram string `toml:"mount_program"` + // Size + Size string `toml:"size"` + // Do not create a bind mount on the storage home + SkipMountHome string `toml:"skip_mount_home"` +} + +type VfsOptionsConfig struct { + // IgnoreChownErrors is a flag for whether chown errors should be + // ignored when building an image. + IgnoreChownErrors string `toml:"ignore_chown_errors"` +} + +type ZfsOptionsConfig struct { + // MountOpt specifies extra mount options used when mounting + MountOpt string `toml:"mountopt"` + // Name is the File System name of the ZFS File system + Name string `toml:"fsname"` + // Size + Size string `toml:"size"` +} + // OptionsConfig represents the "storage.options" TOML config table. type OptionsConfig struct { // AdditionalImagesStores is the location of additional read/only @@ -83,12 +131,158 @@ type OptionsConfig struct { // RemapGroup is the name of one or more entries in /etc/subgid which // should be used to set up default GID mappings. RemapGroup string `toml:"remap-group"` + + // Aufs container options to be handed to aufs drivers + Aufs struct{ AufsOptionsConfig } `toml:"aufs"` + + // Btrfs container options to be handed to btrfs drivers + Btrfs struct{ BtrfsOptionsConfig } `toml:"btrfs"` + // Thinpool container options to be handed to thinpool drivers Thinpool struct{ ThinpoolOptionsConfig } `toml:"thinpool"` + // Overlay container options to be handed to overlay drivers + Overlay struct{ OverlayOptionsConfig } `toml:"overlay"` + + // Vfs container options to be handed to VFS drivers + Vfs struct{ VfsOptionsConfig } `toml:"vfs"` + + // Zfs container options to be handed to ZFS drivers + Zfs struct{ ZfsOptionsConfig } `toml:"zfs"` + + // Do not create a bind mount on the storage home + SkipMountHome string `toml:"skip_mount_home"` + // Alternative program to use for the mount of the file system MountProgram string `toml:"mount_program"` // MountOpt specifies extra mount options used when mounting MountOpt string `toml:"mountopt"` } + +// GetGraphDriverOptions returns the driver specific options +func GetGraphDriverOptions(driverName string, options OptionsConfig) []string { + var doptions []string + switch driverName { + case "aufs": + if options.Aufs.MountOpt != "" { + return append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.Aufs.MountOpt)) + } else if options.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.MountOpt)) + } + + case "btrfs": + if options.Btrfs.MinSpace != "" { + return append(doptions, fmt.Sprintf("%s.min_space=%s", driverName, options.Btrfs.MinSpace)) + } + if options.Btrfs.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Btrfs.Size)) + } else if options.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Size)) + } + + case "devicemapper": + if options.Thinpool.AutoExtendPercent != "" { + doptions = append(doptions, fmt.Sprintf("dm.thinp_autoextend_percent=%s", options.Thinpool.AutoExtendPercent)) + } + if options.Thinpool.AutoExtendThreshold != "" { + doptions = append(doptions, fmt.Sprintf("dm.thinp_autoextend_threshold=%s", options.Thinpool.AutoExtendThreshold)) + } + if options.Thinpool.BaseSize != "" { + doptions = append(doptions, fmt.Sprintf("dm.basesize=%s", options.Thinpool.BaseSize)) + } + if options.Thinpool.BlockSize != "" { + doptions = append(doptions, fmt.Sprintf("dm.blocksize=%s", options.Thinpool.BlockSize)) + } + if options.Thinpool.DirectLvmDevice != "" { + doptions = append(doptions, fmt.Sprintf("dm.directlvm_device=%s", options.Thinpool.DirectLvmDevice)) + } + if options.Thinpool.DirectLvmDeviceForce != "" { + doptions = append(doptions, fmt.Sprintf("dm.directlvm_device_force=%s", options.Thinpool.DirectLvmDeviceForce)) + } + if options.Thinpool.Fs != "" { + doptions = append(doptions, fmt.Sprintf("dm.fs=%s", options.Thinpool.Fs)) + } + if options.Thinpool.LogLevel != "" { + doptions = append(doptions, fmt.Sprintf("dm.libdm_log_level=%s", options.Thinpool.LogLevel)) + } + if options.Thinpool.MinFreeSpace != "" { + doptions = append(doptions, fmt.Sprintf("dm.min_free_space=%s", options.Thinpool.MinFreeSpace)) + } + if options.Thinpool.MkfsArg != "" { + doptions = append(doptions, fmt.Sprintf("dm.mkfsarg=%s", options.Thinpool.MkfsArg)) + } + if options.Thinpool.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.Thinpool.MountOpt)) + } else if options.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.MountOpt)) + } + + if options.Thinpool.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Thinpool.Size)) + } else if options.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Size)) + } + + if options.Thinpool.UseDeferredDeletion != "" { + doptions = append(doptions, fmt.Sprintf("dm.use_deferred_deletion=%s", options.Thinpool.UseDeferredDeletion)) + } + if options.Thinpool.UseDeferredRemoval != "" { + doptions = append(doptions, fmt.Sprintf("dm.use_deferred_removal=%s", options.Thinpool.UseDeferredRemoval)) + } + if options.Thinpool.XfsNoSpaceMaxRetries != "" { + doptions = append(doptions, fmt.Sprintf("dm.xfs_nospace_max_retries=%s", options.Thinpool.XfsNoSpaceMaxRetries)) + } + + case "overlay": + if options.Overlay.IgnoreChownErrors != "" { + doptions = append(doptions, fmt.Sprintf("%s.ignore_chown_errors=%s", driverName, options.Overlay.IgnoreChownErrors)) + } else if options.IgnoreChownErrors != "" { + doptions = append(doptions, fmt.Sprintf("%s.ignore_chown_errors=%s", driverName, options.IgnoreChownErrors)) + } + if options.Overlay.MountProgram != "" { + doptions = append(doptions, fmt.Sprintf("%s.mount_program=%s", driverName, options.Overlay.MountProgram)) + } else if options.MountProgram != "" { + doptions = append(doptions, fmt.Sprintf("%s.mount_program=%s", driverName, options.MountProgram)) + } + if options.Overlay.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.Overlay.MountOpt)) + } else if options.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.MountOpt)) + } + if options.Overlay.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Overlay.Size)) + } else if options.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Size)) + } + + if options.Overlay.SkipMountHome != "" { + doptions = append(doptions, fmt.Sprintf("%s.skip_mount_home=%s", driverName, options.Overlay.SkipMountHome)) + } else if options.SkipMountHome != "" { + doptions = append(doptions, fmt.Sprintf("%s.skip_mount_home=%s", driverName, options.SkipMountHome)) + } + + case "vfs": + if options.Vfs.IgnoreChownErrors != "" { + doptions = append(doptions, fmt.Sprintf("%s.ignore_chown_errors=%s", driverName, options.Vfs.IgnoreChownErrors)) + } else if options.IgnoreChownErrors != "" { + doptions = append(doptions, fmt.Sprintf("%s.ignore_chown_errors=%s", driverName, options.IgnoreChownErrors)) + } + + case "zfs": + if options.Zfs.Name != "" { + doptions = append(doptions, fmt.Sprintf("%s.fsname=%s", driverName, options.Zfs.Name)) + } + if options.Zfs.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.Zfs.MountOpt)) + } else if options.MountOpt != "" { + doptions = append(doptions, fmt.Sprintf("%s.mountopt=%s", driverName, options.MountOpt)) + } + if options.Zfs.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Zfs.Size)) + } else if options.Size != "" { + doptions = append(doptions, fmt.Sprintf("%s.size=%s", driverName, options.Size)) + } + } + return doptions +} diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go index a129e654e..388eaf9d5 100644 --- a/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go @@ -57,6 +57,7 @@ func NewPatternMatcher(patterns []string) (*PatternMatcher, error) { return pm, nil } +// Deprecated: Please use the `MatchesResult` method instead. // Matches matches path against all the patterns. Matches is not safe to be // called concurrently func (pm *PatternMatcher) Matches(file string) (bool, error) { @@ -96,6 +97,85 @@ func (pm *PatternMatcher) Matches(file string) (bool, error) { return matched, nil } +type MatchResult struct { + isMatched bool + matches, excludes uint +} + +// Excludes returns true if the overall result is matched +func (m *MatchResult) IsMatched() bool { + return m.isMatched +} + +// Excludes returns the amount of matches of an MatchResult +func (m *MatchResult) Matches() uint { + return m.matches +} + +// Excludes returns the amount of excludes of an MatchResult +func (m *MatchResult) Excludes() uint { + return m.excludes +} + +// MatchesResult verifies the provided filepath against all patterns. +// It returns the `*MatchResult` result for the patterns on success, otherwise +// an error. This method is not safe to be called concurrently. +func (pm *PatternMatcher) MatchesResult(file string) (res *MatchResult, err error) { + file = filepath.FromSlash(file) + parentPath := filepath.Dir(file) + parentPathDirs := strings.Split(parentPath, string(os.PathSeparator)) + res = &MatchResult{false, 0, 0} + + for _, pattern := range pm.patterns { + negative := false + + if pattern.exclusion { + negative = true + } + + match, err := pattern.match(file) + if err != nil { + return nil, err + } + + if !match && parentPath != "." { + // Check to see if the pattern matches one of our parent dirs. + if len(pattern.dirs) <= len(parentPathDirs) { + match, _ = pattern.match(strings.Join( + parentPathDirs[:len(pattern.dirs)], + string(os.PathSeparator)), + ) + } + } + + if match { + res.isMatched = !negative + if negative { + res.excludes++ + } else { + res.matches++ + } + } + } + + if res.matches > 0 { + logrus.Debugf("Skipping excluded path: %s", file) + } + + return res, nil +} + +// IsMatch verifies the provided filepath against all patterns and returns true +// if it matches. A match is valid if the last match is a positive one. +// It returns an error on failure and is not safe to be called concurrently. +func (pm *PatternMatcher) IsMatch(file string) (matched bool, err error) { + res, err := pm.MatchesResult(file) + if err != nil { + return false, err + } + return res.isMatched, nil +} + // Exclusions returns true if any of the patterns define exclusions func (pm *PatternMatcher) Exclusions() bool { return pm.exclusions @@ -228,7 +308,7 @@ func Matches(file string, patterns []string) (bool, error) { return false, nil } - return pm.Matches(file) + return pm.IsMatch(file) } // CopyFile copies from src to dst until either EOF is reached diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go index e59867277..3d3829236 100644 --- a/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go @@ -63,7 +63,7 @@ func GetKernelVersion() (*VersionInfo, error) { } KVI.major = int(dwVersion & 0xFF) - KVI.minor = int((dwVersion & 0XFF00) >> 8) + KVI.minor = int((dwVersion & 0xFF00) >> 8) KVI.build = int((dwVersion & 0xFFFF0000) >> 16) return KVI, nil diff --git a/vendor/github.com/containers/storage/pkg/system/stat_linux.go b/vendor/github.com/containers/storage/pkg/system/stat_linux.go index 1939f9518..af7af20fa 100644 --- a/vendor/github.com/containers/storage/pkg/system/stat_linux.go +++ b/vendor/github.com/containers/storage/pkg/system/stat_linux.go @@ -8,7 +8,7 @@ func fromStatT(s *syscall.Stat_t) (*StatT, error) { mode: s.Mode, uid: s.Uid, gid: s.Gid, - rdev: s.Rdev, + rdev: uint64(s.Rdev), mtim: s.Mtim}, nil } diff --git a/vendor/github.com/containers/storage/storage.conf b/vendor/github.com/containers/storage/storage.conf index efd46eefb..db6d35768 100644 --- a/vendor/github.com/containers/storage/storage.conf +++ b/vendor/github.com/containers/storage/storage.conf @@ -21,25 +21,6 @@ graphroot = "/var/lib/containers/storage" additionalimagestores = [ ] -# Size is used to set a maximum size of the container image. Only supported by -# certain container storage drivers. -size = "" - -# Path to an helper program to use for mounting the file system instead of mounting it -# directly. -#mount_program = "/usr/bin/fuse-overlayfs" - -# mountopt specifies comma separated list of extra mount options -mountopt = "nodev" - -# ignore_chown_errors can be set to allow a non privileged user running with -# a single UID within a user namespace to run containers. The user can pull -# and use any image even those with multiple uids. Note multiple UIDs will be -# squasheddown to the default uid in the container. These images will have no -# separation between the users in the container. Only supported for the overlay -# and vfs drivers. -#ignore_chown_errors = false - # Remap-UIDs/GIDs is the mapping from UIDs/GIDs as they should appear inside of # a container, to the UIDs/GIDs as they should appear outside of the container, # and the length of the range of UIDs/GIDs. Additional mapped sets can be @@ -61,6 +42,28 @@ mountopt = "nodev" # remap-user = "storage" # remap-group = "storage" +[storage.options.overlay] +# ignore_chown_errors can be set to allow a non privileged user running with +# a single UID within a user namespace to run containers. The user can pull +# and use any image even those with multiple uids. Note multiple UIDs will be +# squashed down to the default uid in the container. These images will have no +# separation between the users in the container. Only supported for the overlay +# and vfs drivers. +#ignore_chown_errors = false + +# Path to an helper program to use for mounting the file system instead of mounting it +# directly. +#mount_program = "/usr/bin/fuse-overlayfs" + +# mountopt specifies comma separated list of extra mount options +mountopt = "nodev" + +# Set to skip a PRIVATE bind mount on the storage home directory. +skip_mount_home = "false" + +# Size is used to set a maximum size of the container image. +# size = "" + [storage.options.thinpool] # Storage Options for thinpool @@ -111,6 +114,9 @@ mountopt = "nodev" # device. # mkfsarg = "" +# Size is used to set a maximum size of the container image. +# size = "" + # use_deferred_removal marks devicemapper block device for deferred removal. # If the thinpool is in use when the driver attempts to remove it, the driver # tells the kernel to remove it as soon as possible. Note this does not free diff --git a/vendor/github.com/containers/storage/store.go b/vendor/github.com/containers/storage/store.go index 6e4bd4ee0..654e86880 100644 --- a/vendor/github.com/containers/storage/store.go +++ b/vendor/github.com/containers/storage/store.go @@ -18,7 +18,7 @@ import ( "github.com/BurntSushi/toml" drivers "github.com/containers/storage/drivers" "github.com/containers/storage/pkg/archive" - "github.com/containers/storage/pkg/config" + cfg "github.com/containers/storage/pkg/config" "github.com/containers/storage/pkg/directory" "github.com/containers/storage/pkg/idtools" "github.com/containers/storage/pkg/ioutils" @@ -3274,10 +3274,10 @@ func DefaultConfigFile(rootless bool) (string, error) { // TOML-friendly explicit tables used for conversions. type tomlConfig struct { Storage struct { - Driver string `toml:"driver"` - RunRoot string `toml:"runroot"` - GraphRoot string `toml:"graphroot"` - Options struct{ config.OptionsConfig } `toml:"options"` + Driver string `toml:"driver"` + RunRoot string `toml:"runroot"` + GraphRoot string `toml:"graphroot"` + Options cfg.OptionsConfig `toml:"options"` } `toml:"storage"` } @@ -3307,50 +3307,6 @@ func ReloadConfigurationFile(configFile string, storeOptions *StoreOptions) { if config.Storage.GraphRoot != "" { storeOptions.GraphRoot = config.Storage.GraphRoot } - if config.Storage.Options.Thinpool.AutoExtendPercent != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.thinp_autoextend_percent=%s", config.Storage.Options.Thinpool.AutoExtendPercent)) - } - - if config.Storage.Options.Thinpool.AutoExtendThreshold != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.thinp_autoextend_threshold=%s", config.Storage.Options.Thinpool.AutoExtendThreshold)) - } - - if config.Storage.Options.Thinpool.BaseSize != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.basesize=%s", config.Storage.Options.Thinpool.BaseSize)) - } - if config.Storage.Options.Thinpool.BlockSize != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.blocksize=%s", config.Storage.Options.Thinpool.BlockSize)) - } - if config.Storage.Options.Thinpool.DirectLvmDevice != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.directlvm_device=%s", config.Storage.Options.Thinpool.DirectLvmDevice)) - } - if config.Storage.Options.Thinpool.DirectLvmDeviceForce != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.directlvm_device_force=%s", config.Storage.Options.Thinpool.DirectLvmDeviceForce)) - } - if config.Storage.Options.Thinpool.Fs != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.fs=%s", config.Storage.Options.Thinpool.Fs)) - } - if config.Storage.Options.Thinpool.LogLevel != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.libdm_log_level=%s", config.Storage.Options.Thinpool.LogLevel)) - } - if config.Storage.Options.Thinpool.MinFreeSpace != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.min_free_space=%s", config.Storage.Options.Thinpool.MinFreeSpace)) - } - if config.Storage.Options.Thinpool.MkfsArg != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.mkfsarg=%s", config.Storage.Options.Thinpool.MkfsArg)) - } - if config.Storage.Options.Thinpool.MountOpt != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("%s.mountopt=%s", config.Storage.Driver, config.Storage.Options.Thinpool.MountOpt)) - } - if config.Storage.Options.Thinpool.UseDeferredDeletion != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.use_deferred_deletion=%s", config.Storage.Options.Thinpool.UseDeferredDeletion)) - } - if config.Storage.Options.Thinpool.UseDeferredRemoval != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.use_deferred_removal=%s", config.Storage.Options.Thinpool.UseDeferredRemoval)) - } - if config.Storage.Options.Thinpool.XfsNoSpaceMaxRetries != "" { - storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("dm.xfs_nospace_max_retries=%s", config.Storage.Options.Thinpool.XfsNoSpaceMaxRetries)) - } for _, s := range config.Storage.Options.AdditionalImageStores { storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, fmt.Sprintf("%s.imagestore=%s", config.Storage.Driver, s)) } @@ -3397,6 +3353,9 @@ func ReloadConfigurationFile(configFile string, storeOptions *StoreOptions) { if os.Getenv("STORAGE_DRIVER") != "" { storeOptions.GraphDriverName = os.Getenv("STORAGE_DRIVER") } + + storeOptions.GraphDriverOptions = cfg.GetGraphDriverOptions(storeOptions.GraphDriverName, config.Storage.Options) + if os.Getenv("STORAGE_OPTS") != "" { storeOptions.GraphDriverOptions = append(storeOptions.GraphDriverOptions, strings.Split(os.Getenv("STORAGE_OPTS"), ",")...) } diff --git a/vendor/github.com/docker/docker/AUTHORS b/vendor/github.com/docker/docker/AUTHORS index d5b6cbbea..ad166ba8d 100644 --- a/vendor/github.com/docker/docker/AUTHORS +++ b/vendor/github.com/docker/docker/AUTHORS @@ -18,6 +18,7 @@ Abhishek Chanda <abhishek.becs@gmail.com> Abhishek Sharma <abhishek@asharma.me> Abin Shahab <ashahab@altiscale.com> Adam Avilla <aavilla@yp.com> +Adam Dobrawy <naczelnik@jawnosc.tk> Adam Eijdenberg <adam.eijdenberg@gmail.com> Adam Kunk <adam.kunk@tiaa-cref.org> Adam Miller <admiller@redhat.com> @@ -113,6 +114,7 @@ Anda Xu <anda.xu@docker.com> Anders Janmyr <anders@janmyr.com> Andre Dublin <81dublin@gmail.com> Andre Granovsky <robotciti@live.com> +Andrea Denisse Gómez <crypto.andrea@protonmail.ch> Andrea Luzzardi <aluzzardi@gmail.com> Andrea Turli <andrea.turli@gmail.com> Andreas Elvers <andreas@work.de> @@ -177,8 +179,10 @@ Anusha Ragunathan <anusha.ragunathan@docker.com> apocas <petermdias@gmail.com> Arash Deshmeh <adeshmeh@ca.ibm.com> ArikaChen <eaglesora@gmail.com> +Arko Dasgupta <arko.dasgupta@docker.com> Arnaud Lefebvre <a.lefebvre@outlook.fr> Arnaud Porterie <arnaud.porterie@docker.com> +Arnaud Rebillout <arnaud.rebillout@collabora.com> Arthur Barr <arthur.barr@uk.ibm.com> Arthur Gautier <baloo@gandi.net> Artur Meyster <arthurfbi@yahoo.com> @@ -280,6 +284,7 @@ Carl Loa Odin <carlodin@gmail.com> Carl X. Su <bcbcarl@gmail.com> Carlo Mion <mion00@gmail.com> Carlos Alexandro Becker <caarlos0@gmail.com> +Carlos de Paula <me@carlosedp.com> Carlos Sanchez <carlos@apache.org> Carol Fager-Higgins <carol.fager-higgins@docker.com> Cary <caryhartline@users.noreply.github.com> @@ -329,6 +334,7 @@ Chris Gibson <chris@chrisg.io> Chris Khoo <chris.khoo@gmail.com> Chris McKinnel <chris.mckinnel@tangentlabs.co.uk> Chris McKinnel <chrismckinnel@gmail.com> +Chris Price <chris.price@docker.com> Chris Seto <chriskseto@gmail.com> Chris Snow <chsnow123@gmail.com> Chris St. Pierre <chris.a.st.pierre@gmail.com> @@ -418,12 +424,14 @@ Daniel Norberg <dano@spotify.com> Daniel Nordberg <dnordberg@gmail.com> Daniel Robinson <gottagetmac@gmail.com> Daniel S <dan.streby@gmail.com> +Daniel Sweet <danieljsweet@icloud.com> Daniel Von Fange <daniel@leancoder.com> Daniel Watkins <daniel@daniel-watkins.co.uk> Daniel X Moore <yahivin@gmail.com> Daniel YC Lin <dlin.tw@gmail.com> Daniel Zhang <jmzwcn@gmail.com> Danny Berger <dpb587@gmail.com> +Danny Milosavljevic <dannym@scratchpost.org> Danny Yates <danny@codeaholics.org> Danyal Khaliq <danyal.khaliq@tenpearls.com> Darren Coxall <darren@darrencoxall.com> @@ -517,6 +525,8 @@ Dmitry Smirnov <onlyjob@member.fsf.org> Dmitry V. Krivenok <krivenok.dmitry@gmail.com> Dmitry Vorobev <dimahabr@gmail.com> Dolph Mathews <dolph.mathews@gmail.com> +Dominic Tubach <dominic.tubach@to.com> +Dominic Yin <yindongchao@inspur.com> Dominik Dingel <dingel@linux.vnet.ibm.com> Dominik Finkbeiner <finkes93@gmail.com> Dominik Honnef <dominik@honnef.co> @@ -585,6 +595,7 @@ Erik Weathers <erikdw@gmail.com> Erno Hopearuoho <erno.hopearuoho@gmail.com> Erwin van der Koogh <info@erronis.nl> Ethan Bell <ebgamer29@gmail.com> +Ethan Mosbaugh <ethan@replicated.com> Euan Kemp <euan.kemp@coreos.com> Eugen Krizo <eugen.krizo@gmail.com> Eugene Yakubovich <eugene.yakubovich@coreos.com> @@ -621,6 +632,7 @@ Fareed Dudhia <fareeddudhia@googlemail.com> Fathi Boudra <fathi.boudra@linaro.org> Federico Gimenez <fgimenez@coit.es> Felipe Oliveira <felipeweb.programador@gmail.com> +Felipe Ruhland <felipe.ruhland@gmail.com> Felix Abecassis <fabecassis@nvidia.com> Felix Geisendörfer <felix@debuggable.com> Felix Hupfeld <felix@quobyte.com> @@ -655,6 +667,7 @@ Frank Groeneveld <frank@ivaldi.nl> Frank Herrmann <fgh@4gh.tv> Frank Macreery <frank@macreery.com> Frank Rosquin <frank.rosquin+github@gmail.com> +frankyang <yyb196@gmail.com> Fred Lifton <fred.lifton@docker.com> Frederick F. Kautz IV <fkautz@redhat.com> Frederik Loeffert <frederik@zitrusmedia.de> @@ -702,6 +715,7 @@ Gleb M Borisov <borisov.gleb@gmail.com> Glyn Normington <gnormington@gopivotal.com> GoBella <caili_welcome@163.com> Goffert van Gool <goffert@phusion.nl> +Goldwyn Rodrigues <rgoldwyn@suse.com> Gopikannan Venugopalsamy <gopikannan.venugopalsamy@gmail.com> Gosuke Miyashita <gosukenator@gmail.com> Gou Rao <gou@portworx.com> @@ -725,6 +739,7 @@ Guruprasad <lgp171188@gmail.com> Gustav Sinder <gustav.sinder@gmail.com> gwx296173 <gaojing3@huawei.com> Günter Zöchbauer <guenter@gzoechbauer.com> +Haichao Yang <yang.haichao@zte.com.cn> haikuoliu <haikuo@amazon.com> Hakan Özler <hakan.ozler@kodcu.com> Hamish Hutchings <moredhel@aoeu.me> @@ -733,6 +748,7 @@ Hans Rødtang <hansrodtang@gmail.com> Hao Shu Wei <haosw@cn.ibm.com> Hao Zhang <21521210@zju.edu.cn> Harald Albers <github@albersweb.de> +Harald Niesche <harald@niesche.de> Harley Laue <losinggeneration@gmail.com> Harold Cooper <hrldcpr@gmail.com> Harrison Turton <harrisonturton@gmail.com> @@ -752,9 +768,11 @@ Hobofan <goisser94@gmail.com> Hollie Teal <hollie@docker.com> Hong Xu <hong@topbug.net> Hongbin Lu <hongbin034@gmail.com> +Hongxu Jia <hongxu.jia@windriver.com> hsinko <21551195@zju.edu.cn> Hu Keping <hukeping@huawei.com> Hu Tao <hutao@cn.fujitsu.com> +HuanHuan Ye <logindaveye@gmail.com> Huanzhong Zhang <zhanghuanzhong90@gmail.com> Huayi Zhang <irachex@gmail.com> Hugo Duncan <hugo@hugoduncan.org> @@ -898,6 +916,7 @@ Jie Luo <luo612@zju.edu.cn> Jihyun Hwang <jhhwang@telcoware.com> Jilles Oldenbeuving <ojilles@gmail.com> Jim Alateras <jima@comware.com.au> +Jim Ehrismann <jim.ehrismann@docker.com> Jim Galasyn <jim.galasyn@docker.com> Jim Minter <jminter@redhat.com> Jim Perrin <jperrin@centos.org> @@ -935,7 +954,7 @@ John Feminella <jxf@jxf.me> John Gardiner Myers <jgmyers@proofpoint.com> John Gossman <johngos@microsoft.com> John Harris <john@johnharris.io> -John Howard (VM) <John.Howard@microsoft.com> +John Howard <github@lowenna.com> John Laswell <john.n.laswell@gmail.com> John Maguire <jmaguire@duosecurity.com> John Mulhausen <john@docker.com> @@ -949,6 +968,7 @@ John Willis <john.willis@docker.com> Jon Johnson <jonjohnson@google.com> Jon Surrell <jon.surrell@gmail.com> Jon Wedaman <jweede@gmail.com> +Jonas Dohse <jonas@dohse.ch> Jonas Pfenniger <jonas@pfenniger.name> Jonathan A. Schweder <jonathanschweder@gmail.com> Jonathan A. Sternberg <jonathansternberg@gmail.com> @@ -1002,6 +1022,7 @@ Julio Montes <imc.coder@gmail.com> Jun-Ru Chang <jrjang@gmail.com> Jussi Nummelin <jussi.nummelin@gmail.com> Justas Brazauskas <brazauskasjustas@gmail.com> +Justen Martin <jmart@the-coder.com> Justin Cormack <justin.cormack@docker.com> Justin Force <justin.force@gmail.com> Justin Menga <justin.menga@gmail.com> @@ -1010,6 +1031,7 @@ Justin Simonelis <justin.p.simonelis@gmail.com> Justin Terry <juterry@microsoft.com> Justyn Temme <justyntemme@gmail.com> Jyrki Puttonen <jyrkiput@gmail.com> +Jérémy Leherpeur <amenophis@leherpeur.net> Jérôme Petazzoni <jerome.petazzoni@docker.com> Jörg Thalheim <joerg@higgsboson.tk> K. Heller <pestophagous@gmail.com> @@ -1047,6 +1069,7 @@ Ken Reese <krrgithub@gmail.com> Kenfe-Mickaël Laventure <mickael.laventure@gmail.com> Kenjiro Nakayama <nakayamakenjiro@gmail.com> Kent Johnson <kentoj@gmail.com> +Kenta Tada <Kenta.Tada@sony.com> Kevin "qwazerty" Houdebert <kevin.houdebert@gmail.com> Kevin Burke <kev@inburke.com> Kevin Clark <kevin.clark@gmail.com> @@ -1057,6 +1080,7 @@ Kevin Kern <kaiwentan@harmonycloud.cn> Kevin Menard <kevin@nirvdrum.com> Kevin Meredith <kevin.m.meredith@gmail.com> Kevin P. Kucharczyk <kevinkucharczyk@gmail.com> +Kevin Parsons <kevpar@microsoft.com> Kevin Richardson <kevin@kevinrichardson.co> Kevin Shi <kshi@andrew.cmu.edu> Kevin Wallace <kevin@pentabarf.net> @@ -1147,6 +1171,7 @@ longliqiang88 <394564827@qq.com> Lorenz Leutgeb <lorenz.leutgeb@gmail.com> Lorenzo Fontana <fontanalorenz@gmail.com> Lotus Fenn <fenn.lotus@gmail.com> +Louis Delossantos <ldelossa.ld@gmail.com> Louis Opter <kalessin@kalessin.fr> Luca Favatella <luca.favatella@erlang-solutions.com> Luca Marturana <lucamarturana@gmail.com> @@ -1159,12 +1184,14 @@ Lucas Silvestre <lukas.silvestre@gmail.com> Luciano Mores <leslau@gmail.com> Luis Martínez de Bartolomé Izquierdo <lmartinez@biicode.com> Luiz Svoboda <luizek@gmail.com> +Lukas Heeren <lukas-heeren@hotmail.com> Lukas Waslowski <cr7pt0gr4ph7@gmail.com> lukaspustina <lukas.pustina@centerdevice.com> Lukasz Zajaczkowski <Lukasz.Zajaczkowski@ts.fujitsu.com> Luke Marsden <me@lukemarsden.net> Lyn <energylyn@zju.edu.cn> Lynda O'Leary <lyndaoleary29@gmail.com> +lzhfromutsc <lzhfromustc@gmail.com> Lénaïc Huard <lhuard@amadeus.com> Ma Müller <mueller-ma@users.noreply.github.com> Ma Shimiao <mashimiao.fnst@cn.fujitsu.com> @@ -1298,6 +1325,7 @@ Michael Stapelberg <michael+gh@stapelberg.de> Michael Steinert <mike.steinert@gmail.com> Michael Thies <michaelthies78@gmail.com> Michael West <mwest@mdsol.com> +Michael Zhao <michael.zhao@arm.com> Michal Fojtik <mfojtik@redhat.com> Michal Gebauer <mishak@mishak.net> Michal Jemala <michal.jemala@gmail.com> @@ -1382,6 +1410,7 @@ Neyazul Haque <nuhaque@gmail.com> Nghia Tran <nghia@google.com> Niall O'Higgins <niallo@unworkable.org> Nicholas E. Rabenau <nerab@gmx.at> +Nick Adcock <nick.adcock@docker.com> Nick DeCoursin <n.decoursin@foodpanda.com> Nick Irvine <nfirvine@nfirvine.com> Nick Neisen <nwneisen@gmail.com> @@ -1420,6 +1449,7 @@ Nuutti Kotivuori <naked@iki.fi> nzwsch <hi@nzwsch.com> O.S. Tezer <ostezer@gmail.com> objectified <objectified@gmail.com> +Odin Ugedal <odin@ugedal.com> Oguz Bilgic <fisyonet@gmail.com> Oh Jinkyun <tintypemolly@gmail.com> Ohad Schneider <ohadschn@users.noreply.github.com> @@ -1430,6 +1460,7 @@ Oliver Reason <oli@overrateddev.co> Olivier Gambier <dmp42@users.noreply.github.com> Olle Jonsson <olle.jonsson@gmail.com> Olli Janatuinen <olli.janatuinen@gmail.com> +Olly Pomeroy <oppomeroy@gmail.com> Omri Shiv <Omri.Shiv@teradata.com> Oriol Francès <oriolfa@gmail.com> Oskar Niburski <oskarniburski@gmail.com> @@ -1439,6 +1470,7 @@ Ovidio Mallo <ovidio.mallo@gmail.com> Panagiotis Moustafellos <pmoust@elastic.co> Paolo G. Giarrusso <p.giarrusso@gmail.com> Pascal <pascalgn@users.noreply.github.com> +Pascal Bach <pascal.bach@siemens.com> Pascal Borreli <pascal@borreli.com> Pascal Hartig <phartig@rdrei.net> Patrick Böänziger <patrick.baenziger@bsi-software.com> @@ -1463,6 +1495,7 @@ Paul Nasrat <pnasrat@gmail.com> Paul Weaver <pauweave@cisco.com> Paulo Ribeiro <paigr.io@gmail.com> Pavel Lobashov <ShockwaveNN@gmail.com> +Pavel Matěja <pavel@verotel.cz> Pavel Pletenev <cpp.create@gmail.com> Pavel Pospisil <pospispa@gmail.com> Pavel Sutyrin <pavel.sutyrin@gmail.com> @@ -1574,6 +1607,7 @@ Riku Voipio <riku.voipio@linaro.org> Riley Guerin <rileytg.dev@gmail.com> Ritesh H Shukla <sritesh@vmware.com> Riyaz Faizullabhoy <riyaz.faizullabhoy@docker.com> +Rob Gulewich <rgulewich@netflix.com> Rob Vesse <rvesse@dotnetrdf.org> Robert Bachmann <rb@robertbachmann.at> Robert Bittle <guywithnose@gmail.com> @@ -1582,11 +1616,13 @@ Robert Schneider <mail@shakeme.info> Robert Stern <lexandro2000@gmail.com> Robert Terhaar <rterhaar@atlanticdynamic.com> Robert Wallis <smilingrob@gmail.com> +Robert Wang <robert@arctic.tw> Roberto G. Hashioka <roberto.hashioka@docker.com> Roberto Muñoz Fernández <robertomf@gmail.com> Robin Naundorf <r.naundorf@fh-muenster.de> Robin Schneider <ypid@riseup.net> Robin Speekenbrink <robin@kingsquare.nl> +Robin Thoni <robin@rthoni.com> robpc <rpcann@gmail.com> Rodolfo Carvalho <rhcarvalho@gmail.com> Rodrigo Vaz <rodrigo.vaz@gmail.com> @@ -1620,6 +1656,7 @@ Rozhnov Alexandr <nox73@ya.ru> Rudolph Gottesheim <r.gottesheim@loot.at> Rui Cao <ruicao@alauda.io> Rui Lopes <rgl@ruilopes.com> +Ruilin Li <liruilin4@huawei.com> Runshen Zhu <runshen.zhu@gmail.com> Russ Magee <rmagee@gmail.com> Ryan Abrams <rdabrams@gmail.com> @@ -1658,6 +1695,7 @@ Sam J Sharpe <sam.sharpe@digital.cabinet-office.gov.uk> Sam Neirinck <sam@samneirinck.com> Sam Reis <sreis@atlassian.com> Sam Rijs <srijs@airpost.net> +Sam Whited <sam@samwhited.com> Sambuddha Basu <sambuddhabasu1@gmail.com> Sami Wagiaalla <swagiaal@redhat.com> Samuel Andaya <samuel@andaya.net> @@ -1672,6 +1710,7 @@ sapphiredev <se.imas.kr@gmail.com> Sargun Dhillon <sargun@netflix.com> Sascha Andres <sascha.andres@outlook.com> Sascha Grunert <sgrunert@suse.com> +SataQiu <qiushida@beyondcent.com> Satnam Singh <satnam@raintown.org> Satoshi Amemiya <satoshi_amemiya@voyagegroup.com> Satoshi Tagomori <tagomoris@gmail.com> @@ -1720,6 +1759,7 @@ Shijun Qin <qinshijun16@mails.ucas.ac.cn> Shishir Mahajan <shishir.mahajan@redhat.com> Shoubhik Bose <sbose78@gmail.com> Shourya Sarcar <shourya.sarcar@gmail.com> +Shu-Wai Chow <shu-wai.chow@seattlechildrens.org> shuai-z <zs.broccoli@gmail.com> Shukui Yang <yangshukui@huawei.com> Shuwei Hao <haosw@cn.ibm.com> @@ -1730,6 +1770,7 @@ Silas Sewell <silas@sewell.org> Silvan Jegen <s.jegen@gmail.com> Simão Reis <smnrsti@gmail.com> Simei He <hesimei@zju.edu.cn> +Simon Barendse <simon.barendse@gmail.com> Simon Eskildsen <sirup@sirupsen.com> Simon Ferquel <simon.ferquel@docker.com> Simon Leinen <simon.leinen@gmail.com> @@ -1738,6 +1779,7 @@ Simon Taranto <simon.taranto@gmail.com> Simon Vikstrom <pullreq@devsn.se> Sindhu S <sindhus@live.in> Sjoerd Langkemper <sjoerd-github@linuxonly.nl> +skanehira <sho19921005@gmail.com> Solganik Alexander <solganik@gmail.com> Solomon Hykes <solomon@docker.com> Song Gao <song@gao.io> @@ -1749,6 +1791,7 @@ Sridatta Thatipamala <sthatipamala@gmail.com> Sridhar Ratnakumar <sridharr@activestate.com> Srini Brahmaroutu <srbrahma@us.ibm.com> Srinivasan Srivatsan <srinivasan.srivatsan@hpe.com> +Staf Wagemakers <staf@wagemakers.be> Stanislav Bondarenko <stanislav.bondarenko@gmail.com> Steeve Morin <steeve.morin@gmail.com> Stefan Berger <stefanb@linux.vnet.ibm.com> @@ -1759,6 +1802,7 @@ Stefan Scherer <stefan.scherer@docker.com> Stefan Staudenmeyer <doerte@instana.com> Stefan Weil <sw@weilnetz.de> Stephan Spindler <shutefan@gmail.com> +Stephen Benjamin <stephen@redhat.com> Stephen Crosby <stevecrozz@gmail.com> Stephen Day <stephen.day@docker.com> Stephen Drake <stephen@xenolith.net> @@ -1775,10 +1819,12 @@ Steven Iveson <sjiveson@outlook.com> Steven Merrill <steven.merrill@gmail.com> Steven Richards <steven@axiomzen.co> Steven Taylor <steven.taylor@me.com> +Stig Larsson <stig@larsson.dev> Subhajit Ghosh <isubuz.g@gmail.com> Sujith Haridasan <sujith.h@gmail.com> Sun Gengze <690388648@qq.com> Sun Jianbo <wonderflow.sun@gmail.com> +Sune Keller <sune.keller@gmail.com> Sunny Gogoi <indiasuny000@gmail.com> Suryakumar Sudar <surya.trunks@gmail.com> Sven Dowideit <SvenDowideit@home.org.au> @@ -1829,6 +1875,7 @@ Tianyi Wang <capkurmagati@gmail.com> Tibor Vass <teabee89@gmail.com> Tiffany Jernigan <tiffany.f.j@gmail.com> Tiffany Low <tiffany@box.com> +Tim <elatllat@gmail.com> Tim Bart <tim@fewagainstmany.com> Tim Bosse <taim@bosboot.org> Tim Dettrick <t.dettrick@uq.edu.au> @@ -1914,6 +1961,7 @@ Victor Palma <palma.victor@gmail.com> Victor Vieux <victor.vieux@docker.com> Victoria Bialas <victoria.bialas@docker.com> Vijaya Kumar K <vijayak@caviumnetworks.com> +Vikram bir Singh <vikrambir.singh@docker.com> Viktor Stanchev <me@viktorstanchev.com> Viktor Vojnovski <viktor.vojnovski@amadeus.com> VinayRaghavanKS <raghavan.vinay@gmail.com> @@ -1971,6 +2019,7 @@ Wenyu You <21551128@zju.edu.cn> Wenzhi Liang <wenzhi.liang@gmail.com> Wes Morgan <cap10morgan@gmail.com> Wewang Xiaorenfine <wang.xiaoren@zte.com.cn> +Wiktor Kwapisiewicz <wiktor@metacode.biz> Will Dietz <w@wdtz.org> Will Rouesnel <w.rouesnel@gmail.com> Will Weaver <monkey@buildingbananas.com> @@ -1998,6 +2047,7 @@ xichengliudui <1693291525@qq.com> xiekeyang <xiekeyang@huawei.com> Ximo Guanter Gonzálbez <joaquin.guantergonzalbez@telefonica.com> Xinbo Weng <xihuanbo_0521@zju.edu.cn> +Xinfeng Liu <xinfeng.liu@gmail.com> Xinzi Zhou <imdreamrunner@gmail.com> Xiuming Chen <cc@cxm.cc> Xuecong Liao <satorulogic@gmail.com> @@ -2012,6 +2062,7 @@ Yang Pengfei <yangpengfei4@huawei.com> yangchenliang <yangchenliang@huawei.com> Yanqiang Miao <miao.yanqiang@zte.com.cn> Yao Zaiyong <yaozaiyong@hotmail.com> +Yash Murty <yashmurty@gmail.com> Yassine Tijani <yasstij11@gmail.com> Yasunori Mahata <nori@mahata.net> Yazhong Liu <yorkiefixer@gmail.com> @@ -2026,6 +2077,7 @@ Yongxin Li <yxli@alauda.io> Yongzhi Pan <panyongzhi@gmail.com> Yosef Fertel <yfertel@gmail.com> You-Sheng Yang (楊有勝) <vicamo@gmail.com> +youcai <omegacoleman@gmail.com> Youcef YEKHLEF <yyekhlef@gmail.com> Yu Changchun <yuchangchun1@huawei.com> Yu Chengxia <yuchengxia@huawei.com> @@ -2062,6 +2114,7 @@ Zhoulin Xie <zhoulin.xie@daocloud.io> Zhu Guihua <zhugh.fnst@cn.fujitsu.com> Zhu Kunjia <zhu.kunjia@zte.com.cn> Zhuoyun Wei <wzyboy@wzyboy.org> +Ziheng Liu <lzhfromustc@gmail.com> Zilin Du <zilin.du@gmail.com> zimbatm <zimbatm@zimbatm.com> Ziming Dong <bnudzm@foxmail.com> @@ -2070,7 +2123,7 @@ zmarouf <zeid.marouf@gmail.com> Zoltan Tombol <zoltan.tombol@gmail.com> Zou Yu <zouyu7@huawei.com> zqh <zqhxuyuan@gmail.com> -Zuhayr Elahi <elahi.zuhayr@gmail.com> +Zuhayr Elahi <zuhayr.elahi@docker.com> Zunayed Ali <zunayed@gmail.com> Álex González <agonzalezro@gmail.com> Álvaro Lázaro <alvaro.lazaro.g@gmail.com> diff --git a/vendor/github.com/docker/docker/api/swagger.yaml b/vendor/github.com/docker/docker/api/swagger.yaml index cc2451f03..0698bba52 100644 --- a/vendor/github.com/docker/docker/api/swagger.yaml +++ b/vendor/github.com/docker/docker/api/swagger.yaml @@ -3369,6 +3369,27 @@ definitions: format: "dateTime" Message: type: "string" + ServiceStatus: + description: | + The status of the service's tasks. Provided only when requested as + part of a ServiceList operation. + type: "object" + properties: + RunningTasks: + description: "The number of tasks for the service currently in the Running state" + type: "integer" + format: "uint64" + example: 7 + DesiredTasks: + description: | + The number of tasks for the service desired to be running. + For replicated services, this is the replica count from the + service spec. For global services, this is computed by taking + count of all tasks for the service with a Desired State other + than Shutdown. + type: "integer" + format: "uint64" + example: 10 example: ID: "9mnpnzenvg8p8tdbtq4wvbkcz" Version: @@ -4924,6 +4945,8 @@ paths: type: "integer" Driver: type: "string" + Platform: + type: "string" MountLabel: type: "string" ProcessLabel: @@ -9316,6 +9339,10 @@ paths: - `label=<service label>` - `mode=["replicated"|"global"]` - `name=<service name>` + - name: "status" + in: "query" + type: "boolean" + description: "Include service status, with count of running and desired tasks" tags: ["Service"] /services/create: post: @@ -10414,9 +10441,6 @@ paths: description: | Start a new interactive session with a server. Session allows server to call back to the client for advanced capabilities. - > **Note**: This endpoint is *experimental* and only available if the daemon is started with experimental - > features enabled. The specifications for this endpoint may still change in a future version of the API. - ### Hijacking This endpoint hijacks the HTTP connection to HTTP2 transport that allows the client to expose gPRC services on that connection. @@ -10450,4 +10474,4 @@ paths: description: "server error" schema: $ref: "#/definitions/ErrorResponse" - tags: ["Session (experimental)"] + tags: ["Session"] diff --git a/vendor/github.com/docker/docker/api/types/client.go b/vendor/github.com/docker/docker/api/types/client.go index 4b9f50282..8363ed736 100644 --- a/vendor/github.com/docker/docker/api/types/client.go +++ b/vendor/github.com/docker/docker/api/types/client.go @@ -363,6 +363,10 @@ type ServiceUpdateOptions struct { // ServiceListOptions holds parameters to list services with. type ServiceListOptions struct { Filters filters.Args + + // Status indicates whether the server should include the service task + // count of running and desired tasks. + Status bool } // ServiceInspectOptions holds parameters related to the "service inspect" diff --git a/vendor/github.com/docker/docker/api/types/filters/parse.go b/vendor/github.com/docker/docker/api/types/filters/parse.go index 2e24e769c..cd7ad92e7 100644 --- a/vendor/github.com/docker/docker/api/types/filters/parse.go +++ b/vendor/github.com/docker/docker/api/types/filters/parse.go @@ -36,6 +36,15 @@ func NewArgs(initialArgs ...KeyValuePair) Args { return args } +// Keys returns all the keys in list of Args +func (args Args) Keys() []string { + keys := make([]string, 0, len(args.fields)) + for k := range args.fields { + keys = append(keys, k) + } + return keys +} + // MarshalJSON returns a JSON byte representation of the Args func (args Args) MarshalJSON() ([]byte, error) { if len(args.fields) == 0 { diff --git a/vendor/github.com/docker/docker/api/types/swarm/service.go b/vendor/github.com/docker/docker/api/types/swarm/service.go index abf192e75..6b59711ab 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/service.go +++ b/vendor/github.com/docker/docker/api/types/swarm/service.go @@ -10,6 +10,13 @@ type Service struct { PreviousSpec *ServiceSpec `json:",omitempty"` Endpoint Endpoint `json:",omitempty"` UpdateStatus *UpdateStatus `json:",omitempty"` + + // ServiceStatus is an optional, extra field indicating the number of + // desired and running tasks. It is provided primarily as a shortcut to + // calculating these values client-side, which otherwise would require + // listing all tasks for a service, an operation that could be + // computation and network expensive. + ServiceStatus *ServiceStatus `json:",omitempty"` } // ServiceSpec represents the spec of a service. @@ -122,3 +129,17 @@ type UpdateConfig struct { // started, or the new task is started before the old task is shut down. Order string } + +// ServiceStatus represents the number of running tasks in a service and the +// number of tasks desired to be running. +type ServiceStatus struct { + // RunningTasks is the number of tasks for the service actually in the + // Running state + RunningTasks uint64 + + // DesiredTasks is the number of tasks desired to be running by the + // service. For replicated services, this is the replica count. For global + // services, this is computed by taking the number of tasks with desired + // state of not-Shutdown. + DesiredTasks uint64 +} diff --git a/vendor/github.com/docker/docker/client/container_list.go b/vendor/github.com/docker/docker/client/container_list.go index c099d80e2..a973de597 100644 --- a/vendor/github.com/docker/docker/client/container_list.go +++ b/vendor/github.com/docker/docker/client/container_list.go @@ -35,7 +35,7 @@ func (cli *Client) ContainerList(ctx context.Context, options types.ContainerLis } if options.Filters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, options.Filters) if err != nil { diff --git a/vendor/github.com/docker/docker/client/events.go b/vendor/github.com/docker/docker/client/events.go index f347cadf1..f0dc9d9e1 100644 --- a/vendor/github.com/docker/docker/client/events.go +++ b/vendor/github.com/docker/docker/client/events.go @@ -90,7 +90,7 @@ func buildEventsQueryParams(cliVersion string, options types.EventsOptions) (url } if options.Filters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cliVersion, options.Filters) if err != nil { return nil, err diff --git a/vendor/github.com/docker/docker/client/hijack.go b/vendor/github.com/docker/docker/client/hijack.go index e77084af6..e1dc49ef0 100644 --- a/vendor/github.com/docker/docker/client/hijack.go +++ b/vendor/github.com/docker/docker/client/hijack.go @@ -24,7 +24,7 @@ func (cli *Client) postHijacked(ctx context.Context, path string, query url.Valu } apiPath := cli.getAPIPath(ctx, path, query) - req, err := http.NewRequest("POST", apiPath, bodyEncoded) + req, err := http.NewRequest(http.MethodPost, apiPath, bodyEncoded) if err != nil { return types.HijackedResponse{}, err } @@ -40,7 +40,7 @@ func (cli *Client) postHijacked(ctx context.Context, path string, query url.Valu // DialHijack returns a hijacked connection with negotiated protocol proto. func (cli *Client) DialHijack(ctx context.Context, url, proto string, meta map[string][]string) (net.Conn, error) { - req, err := http.NewRequest("POST", url, nil) + req, err := http.NewRequest(http.MethodPost, url, nil) if err != nil { return nil, err } @@ -88,7 +88,7 @@ func (cli *Client) setupHijackConn(ctx context.Context, req *http.Request, proto // Server hijacks the connection, error 'connection closed' expected resp, err := clientconn.Do(req) - //lint:ignore SA1019 for connecting to old (pre go1.8) daemons + //nolint:staticcheck // ignore SA1019 for connecting to old (pre go1.8) daemons if err != httputil.ErrPersistEOF { if err != nil { return nil, err diff --git a/vendor/github.com/docker/docker/client/image_list.go b/vendor/github.com/docker/docker/client/image_list.go index a5bc4b095..a4d750509 100644 --- a/vendor/github.com/docker/docker/client/image_list.go +++ b/vendor/github.com/docker/docker/client/image_list.go @@ -24,7 +24,7 @@ func (cli *Client) ImageList(ctx context.Context, options types.ImageListOptions } } if optionFilters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, optionFilters) if err != nil { return images, err diff --git a/vendor/github.com/docker/docker/client/network_list.go b/vendor/github.com/docker/docker/client/network_list.go index 8ca7eb612..ed2acb557 100644 --- a/vendor/github.com/docker/docker/client/network_list.go +++ b/vendor/github.com/docker/docker/client/network_list.go @@ -13,7 +13,7 @@ import ( func (cli *Client) NetworkList(ctx context.Context, options types.NetworkListOptions) ([]types.NetworkResource, error) { query := url.Values{} if options.Filters.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, options.Filters) if err != nil { return nil, err diff --git a/vendor/github.com/docker/docker/client/ping.go b/vendor/github.com/docker/docker/client/ping.go index 90f39ec14..1cfc48a25 100644 --- a/vendor/github.com/docker/docker/client/ping.go +++ b/vendor/github.com/docker/docker/client/ping.go @@ -19,7 +19,7 @@ func (cli *Client) Ping(ctx context.Context) (types.Ping, error) { // Using cli.buildRequest() + cli.doRequest() instead of cli.sendRequest() // because ping requests are used during API version negotiation, so we want // to hit the non-versioned /_ping endpoint, not /v1.xx/_ping - req, err := cli.buildRequest("HEAD", path.Join(cli.basePath, "/_ping"), nil, nil) + req, err := cli.buildRequest(http.MethodHead, path.Join(cli.basePath, "/_ping"), nil, nil) if err != nil { return ping, err } @@ -35,7 +35,7 @@ func (cli *Client) Ping(ctx context.Context) (types.Ping, error) { return ping, err } - req, err = cli.buildRequest("GET", path.Join(cli.basePath, "/_ping"), nil, nil) + req, err = cli.buildRequest(http.MethodGet, path.Join(cli.basePath, "/_ping"), nil, nil) if err != nil { return ping, err } diff --git a/vendor/github.com/docker/docker/client/plugin_list.go b/vendor/github.com/docker/docker/client/plugin_list.go index a51c930e6..cf1935e2f 100644 --- a/vendor/github.com/docker/docker/client/plugin_list.go +++ b/vendor/github.com/docker/docker/client/plugin_list.go @@ -15,7 +15,7 @@ func (cli *Client) PluginList(ctx context.Context, filter filters.Args) (types.P query := url.Values{} if filter.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, filter) if err != nil { return plugins, err diff --git a/vendor/github.com/docker/docker/client/request.go b/vendor/github.com/docker/docker/client/request.go index 144c41636..ee15a46ed 100644 --- a/vendor/github.com/docker/docker/client/request.go +++ b/vendor/github.com/docker/docker/client/request.go @@ -29,12 +29,12 @@ type serverResponse struct { // head sends an http request to the docker API using the method HEAD. func (cli *Client) head(ctx context.Context, path string, query url.Values, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "HEAD", path, query, nil, headers) + return cli.sendRequest(ctx, http.MethodHead, path, query, nil, headers) } // get sends an http request to the docker API using the method GET with a specific Go context. func (cli *Client) get(ctx context.Context, path string, query url.Values, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "GET", path, query, nil, headers) + return cli.sendRequest(ctx, http.MethodGet, path, query, nil, headers) } // post sends an http request to the docker API using the method POST with a specific Go context. @@ -43,21 +43,21 @@ func (cli *Client) post(ctx context.Context, path string, query url.Values, obj if err != nil { return serverResponse{}, err } - return cli.sendRequest(ctx, "POST", path, query, body, headers) + return cli.sendRequest(ctx, http.MethodPost, path, query, body, headers) } func (cli *Client) postRaw(ctx context.Context, path string, query url.Values, body io.Reader, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "POST", path, query, body, headers) + return cli.sendRequest(ctx, http.MethodPost, path, query, body, headers) } // putRaw sends an http request to the docker API using the method PUT. func (cli *Client) putRaw(ctx context.Context, path string, query url.Values, body io.Reader, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "PUT", path, query, body, headers) + return cli.sendRequest(ctx, http.MethodPut, path, query, body, headers) } // delete sends an http request to the docker API using the method DELETE. func (cli *Client) delete(ctx context.Context, path string, query url.Values, headers map[string][]string) (serverResponse, error) { - return cli.sendRequest(ctx, "DELETE", path, query, nil, headers) + return cli.sendRequest(ctx, http.MethodDelete, path, query, nil, headers) } type headers map[string][]string @@ -79,7 +79,7 @@ func encodeBody(obj interface{}, headers headers) (io.Reader, headers, error) { } func (cli *Client) buildRequest(method, path string, body io.Reader, headers headers) (*http.Request, error) { - expectedPayload := (method == "POST" || method == "PUT") + expectedPayload := (method == http.MethodPost || method == http.MethodPut) if expectedPayload && body == nil { body = bytes.NewReader([]byte{}) } diff --git a/vendor/github.com/docker/docker/client/service_list.go b/vendor/github.com/docker/docker/client/service_list.go index 64d35e715..f97ec75a5 100644 --- a/vendor/github.com/docker/docker/client/service_list.go +++ b/vendor/github.com/docker/docker/client/service_list.go @@ -23,6 +23,10 @@ func (cli *Client) ServiceList(ctx context.Context, options types.ServiceListOpt query.Set("filters", filterJSON) } + if options.Status { + query.Set("status", "true") + } + resp, err := cli.get(ctx, "/services", query, nil) defer ensureReaderClosed(resp) if err != nil { diff --git a/vendor/github.com/docker/docker/client/volume_list.go b/vendor/github.com/docker/docker/client/volume_list.go index d68fc2b98..942498dde 100644 --- a/vendor/github.com/docker/docker/client/volume_list.go +++ b/vendor/github.com/docker/docker/client/volume_list.go @@ -15,7 +15,7 @@ func (cli *Client) VolumeList(ctx context.Context, filter filters.Args) (volumet query := url.Values{} if filter.Len() > 0 { - //lint:ignore SA1019 for old code + //nolint:staticcheck // ignore SA1019 for old code filterJSON, err := filters.ToParamWithVersion(cli.version, filter) if err != nil { return volumes, err diff --git a/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go b/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go index 284e8be7c..441bd727b 100644 --- a/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go +++ b/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go @@ -16,8 +16,11 @@ func Key() string { // Get returns the home directory of the current user with the help of // environment variables depending on the target operating system. // Returned path should be used with "path/filepath" to form new paths. -// If compiling statically, ensure the osusergo build tag is used. -// If needing to do nss lookups, do not compile statically. +// +// If linking statically with cgo enabled against glibc, ensure the +// osusergo build tag is used. +// +// If needing to do nss lookups, do not disable cgo or set osusergo. func Get() string { home := os.Getenv(Key()) if home == "" { diff --git a/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go b/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go index 6d6640898..814993ec3 100644 --- a/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go +++ b/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go @@ -139,13 +139,13 @@ type JSONMessage struct { Stream string `json:"stream,omitempty"` Status string `json:"status,omitempty"` Progress *JSONProgress `json:"progressDetail,omitempty"` - ProgressMessage string `json:"progress,omitempty"` //deprecated + ProgressMessage string `json:"progress,omitempty"` // deprecated ID string `json:"id,omitempty"` From string `json:"from,omitempty"` Time int64 `json:"time,omitempty"` TimeNano int64 `json:"timeNano,omitempty"` Error *JSONError `json:"errorDetail,omitempty"` - ErrorMessage string `json:"error,omitempty"` //deprecated + ErrorMessage string `json:"error,omitempty"` // deprecated // Aux contains out-of-band data, such as digests for push signing and image id after building. Aux *json.RawMessage `json:"aux,omitempty"` } @@ -177,7 +177,7 @@ func (jm *JSONMessage) Display(out io.Writer, isTerminal bool) error { if isTerminal && jm.Stream == "" && jm.Progress != nil { clearLine(out) endl = "\r" - fmt.Fprintf(out, endl) + fmt.Fprint(out, endl) } else if jm.Progress != nil && jm.Progress.String() != "" { //disable progressbar in non-terminal return nil } @@ -194,7 +194,7 @@ func (jm *JSONMessage) Display(out io.Writer, isTerminal bool) error { } if jm.Progress != nil && isTerminal { fmt.Fprintf(out, "%s %s%s", jm.Status, jm.Progress.String(), endl) - } else if jm.ProgressMessage != "" { //deprecated + } else if jm.ProgressMessage != "" { // deprecated fmt.Fprintf(out, "%s %s%s", jm.Status, jm.ProgressMessage, endl) } else if jm.Stream != "" { fmt.Fprintf(out, "%s%s", jm.Stream, endl) diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go b/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go index fe6e3ddba..58ca61f3f 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go +++ b/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go @@ -90,7 +90,6 @@ func parseInfoFile(r io.Reader, filter FilterFunc) ([]*Info, error) { mount propagation flags in fields[6]. The correct behavior is to ignore any unknown optional fields. */ - break } } if i == numFields { diff --git a/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go b/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go index f3f46055e..3c42cff5e 100644 --- a/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go +++ b/vendor/github.com/docker/docker/pkg/namesgenerator/names-generator.go @@ -153,7 +153,7 @@ var ( // Stefan Banach - Polish mathematician, was one of the founders of modern functional analysis. https://en.wikipedia.org/wiki/Stefan_Banach "banach", - // Buckaroo Banzai and his mentor Dr. Hikita perfectd the "oscillation overthruster", a device that allows one to pass through solid matter. - https://en.wikipedia.org/wiki/The_Adventures_of_Buckaroo_Banzai_Across_the_8th_Dimension + // Buckaroo Banzai and his mentor Dr. Hikita perfected the "oscillation overthruster", a device that allows one to pass through solid matter. - https://en.wikipedia.org/wiki/The_Adventures_of_Buckaroo_Banzai_Across_the_8th_Dimension "banzai", // John Bardeen co-invented the transistor - https://en.wikipedia.org/wiki/John_Bardeen diff --git a/vendor/github.com/docker/docker/pkg/pools/pools.go b/vendor/github.com/docker/docker/pkg/pools/pools.go index 3b978fd3b..3792c67a9 100644 --- a/vendor/github.com/docker/docker/pkg/pools/pools.go +++ b/vendor/github.com/docker/docker/pkg/pools/pools.go @@ -62,24 +62,23 @@ type bufferPool struct { func newBufferPoolWithSize(size int) *bufferPool { return &bufferPool{ pool: sync.Pool{ - New: func() interface{} { return make([]byte, size) }, + New: func() interface{} { s := make([]byte, size); return &s }, }, } } -func (bp *bufferPool) Get() []byte { - return bp.pool.Get().([]byte) +func (bp *bufferPool) Get() *[]byte { + return bp.pool.Get().(*[]byte) } -func (bp *bufferPool) Put(b []byte) { - //nolint:staticcheck // TODO changing this to a pointer makes tests fail. Investigate if we should change or not (otherwise remove this TODO) +func (bp *bufferPool) Put(b *[]byte) { bp.pool.Put(b) } // Copy is a convenience wrapper which uses a buffer to avoid allocation in io.Copy. func Copy(dst io.Writer, src io.Reader) (written int64, err error) { buf := buffer32KPool.Get() - written, err = io.CopyBuffer(dst, src, buf) + written, err = io.CopyBuffer(dst, src, *buf) buffer32KPool.Put(buf) return } diff --git a/vendor/github.com/docker/docker/pkg/system/init_windows.go b/vendor/github.com/docker/docker/pkg/system/init_windows.go index f303aa906..7e4ac55d7 100644 --- a/vendor/github.com/docker/docker/pkg/system/init_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/init_windows.go @@ -18,8 +18,7 @@ var ( // InitLCOW sets whether LCOW is supported or not. Requires RS5+ func InitLCOW(experimental bool) { - v := GetOSVersion() - if experimental && v.Build >= osversion.RS5 { + if experimental && osversion.Build() >= osversion.RS5 { lcowSupported = true } } diff --git a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go index eb19f9c85..67bec7e30 100644 --- a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go @@ -5,6 +5,7 @@ import ( "syscall" "unsafe" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" "golang.org/x/sys/windows" ) @@ -61,12 +62,7 @@ var ( // OSVersion is a wrapper for Windows version information // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx -type OSVersion struct { - Version uint32 - MajorVersion uint8 - MinorVersion uint8 - Build uint16 -} +type OSVersion osversion.OSVersion // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724833(v=vs.85).aspx type osVersionInfoEx struct { @@ -85,18 +81,9 @@ type osVersionInfoEx struct { // GetOSVersion gets the operating system version on Windows. Note that // dockerd.exe must be manifested to get the correct version information. +// Deprecated: use github.com/Microsoft/hcsshim/osversion.Get() instead func GetOSVersion() OSVersion { - var err error - osv := OSVersion{} - osv.Version, err = windows.GetVersion() - if err != nil { - // GetVersion never fails. - panic(err) - } - osv.MajorVersion = uint8(osv.Version & 0xFF) - osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) - osv.Build = uint16(osv.Version >> 16) - return osv + return OSVersion(osversion.Get()) } func (osv OSVersion) ToString() string { diff --git a/vendor/github.com/fsouza/go-dockerclient/Makefile b/vendor/github.com/fsouza/go-dockerclient/Makefile index e0880ff67..84e1bfaba 100644 --- a/vendor/github.com/fsouza/go-dockerclient/Makefile +++ b/vendor/github.com/fsouza/go-dockerclient/Makefile @@ -1,7 +1,6 @@ .PHONY: \ all \ lint \ - fmt \ pretest \ test \ integration @@ -12,10 +11,6 @@ lint: cd /tmp && GO111MODULE=on go get github.com/golangci/golangci-lint/cmd/golangci-lint@latest golangci-lint run -fmt: - GO111MODULE=off go get mvdan.cc/gofumpt - gofumpt -s -w . - pretest: lint gotest: diff --git a/vendor/github.com/fsouza/go-dockerclient/README.md b/vendor/github.com/fsouza/go-dockerclient/README.md index b7af7d0b9..f4ad8ca62 100644 --- a/vendor/github.com/fsouza/go-dockerclient/README.md +++ b/vendor/github.com/fsouza/go-dockerclient/README.md @@ -18,10 +18,10 @@ documentation](https://docs.docker.com/engine/api/latest/). Link for the official SDK: https://docs.docker.com/develop/sdk/ go-dockerclient was created before Docker had an official Go SDK and is -still maintained and relatively active because it's still used out there. New -features in the Docker API do not get automatically implemented here: it's -based on demand, if someone wants it, they can file an issue or a PR and the -feature may get implemented/merged. +still maintained and active because it's still used out there. New features in +the Docker API do not get automatically implemented here: it's based on demand, +if someone wants it, they can file an issue or a PR and the feature may get +implemented/merged. For new projects, using the official SDK is probably more appropriate as go-dockerclient lags behind the official SDK. @@ -105,7 +105,10 @@ import ( ) func main() { - client, _ := docker.NewClientFromEnv() + client, err := docker.NewClientFromEnv() + if err != nil { + // handle err + } // use client } ``` @@ -118,12 +121,11 @@ All development commands can be seen in the [Makefile](Makefile). Commited code must pass: -* [golangci-lint](integration_unix_test.go) -* [gofumpt](https://github.com/mvdan/gofumpt) +* [golangci-lint](https://github.com/golangci/golangci-lint) * [go test](https://golang.org/cmd/go/#hdr-Test_packages) -Running ``make test`` will check all of these. You can reformat the code with -``make fmt``. +Running ``make test`` will run all checks, as well as install any required +dependencies. ## Modules @@ -133,7 +135,7 @@ If you're using dep, you can check the [releases page](https://github.com/fsouza/go-dockerclient/releases) for the latest release fully compatible with dep. -With other vendoring tools, users might need to specify go-dockerclient's +With other vendoring tools, users need to specify go-dockerclient's dependencies manually. ## Using with Docker 1.9 and Go 1.4 diff --git a/vendor/github.com/fsouza/go-dockerclient/appveyor.yml b/vendor/github.com/fsouza/go-dockerclient/appveyor.yml index d9f374f50..e1574cfc2 100644 --- a/vendor/github.com/fsouza/go-dockerclient/appveyor.yml +++ b/vendor/github.com/fsouza/go-dockerclient/appveyor.yml @@ -7,8 +7,8 @@ environment: GOPROXY: https://proxy.golang.org GO111MODULE: on matrix: - - GOVERSION: "1.12.10" - - GOVERSION: "1.13.1" + - GOVERSION: "1.12.13" + - GOVERSION: "1.13.4" install: - choco install make - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% diff --git a/vendor/github.com/fsouza/go-dockerclient/container.go b/vendor/github.com/fsouza/go-dockerclient/container.go index 0a8ab361c..f6bfb59dc 100644 --- a/vendor/github.com/fsouza/go-dockerclient/container.go +++ b/vendor/github.com/fsouza/go-dockerclient/container.go @@ -546,26 +546,31 @@ func (c *Client) RenameContainer(opts RenameContainerOptions) error { // InspectContainer returns information about a container by its ID. // -// See https://goo.gl/FaI5JT for more details. +// Deprecated: Use InspectContainerWithOptions instead. func (c *Client) InspectContainer(id string) (*Container, error) { - return c.inspectContainer(id, doOptions{}) + return c.InspectContainerWithOptions(InspectContainerOptions{ID: id}) } // InspectContainerWithContext returns information about a container by its ID. // The context object can be used to cancel the inspect request. // -// See https://goo.gl/FaI5JT for more details. +// Deprecated: Use InspectContainerWithOptions instead. //nolint:golint func (c *Client) InspectContainerWithContext(id string, ctx context.Context) (*Container, error) { - return c.inspectContainer(id, doOptions{context: ctx}) + return c.InspectContainerWithOptions(InspectContainerOptions{ID: id, Context: ctx}) } -func (c *Client) inspectContainer(id string, opts doOptions) (*Container, error) { - path := "/containers/" + id + "/json" - resp, err := c.do(http.MethodGet, path, opts) +// InspectContainerWithOptions returns information about a container by its ID. +// +// See https://goo.gl/FaI5JT for more details. +func (c *Client) InspectContainerWithOptions(opts InspectContainerOptions) (*Container, error) { + path := "/containers/" + opts.ID + "/json?" + queryString(opts) + resp, err := c.do(http.MethodGet, path, doOptions{ + context: opts.Context, + }) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { - return nil, &NoSuchContainer{ID: id} + return nil, &NoSuchContainer{ID: opts.ID} } return nil, err } @@ -577,6 +582,15 @@ func (c *Client) inspectContainer(id string, opts doOptions) (*Container, error) return &container, nil } +// InspectContainerOptions specifies parameters for InspectContainerWithOptions. +// +// See https://goo.gl/FaI5JT for more details. +type InspectContainerOptions struct { + Context context.Context + ID string `qs:"-"` + Size bool +} + // ContainerChanges returns changes in the filesystem of the given container. // // See https://goo.gl/15KKzh for more details. diff --git a/vendor/github.com/fsouza/go-dockerclient/go.mod b/vendor/github.com/fsouza/go-dockerclient/go.mod index cb0ef690c..7bb88972c 100644 --- a/vendor/github.com/fsouza/go-dockerclient/go.mod +++ b/vendor/github.com/fsouza/go-dockerclient/go.mod @@ -4,16 +4,13 @@ go 1.12 require ( github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 // indirect - github.com/Microsoft/go-winio v0.4.14 - github.com/Microsoft/hcsshim v0.8.6 // indirect + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c // indirect github.com/containerd/containerd v1.3.0 // indirect - github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 // indirect github.com/docker/distribution v2.7.1+incompatible // indirect - github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce + github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 github.com/docker/go-connections v0.4.0 // indirect github.com/docker/go-units v0.4.0 - github.com/gogo/protobuf v1.2.1 // indirect - github.com/golang/protobuf v1.3.0 // indirect github.com/google/go-cmp v0.3.1 github.com/gorilla/mux v1.7.3 github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c // indirect @@ -22,5 +19,4 @@ require ( github.com/opencontainers/runc v0.1.1 // indirect golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad google.golang.org/grpc v1.22.0 // indirect - gotest.tools v2.2.0+incompatible // indirect ) diff --git a/vendor/github.com/fsouza/go-dockerclient/go.sum b/vendor/github.com/fsouza/go-dockerclient/go.sum index c4df2e956..ce78fee7a 100644 --- a/vendor/github.com/fsouza/go-dockerclient/go.sum +++ b/vendor/github.com/fsouza/go-dockerclient/go.sum @@ -2,85 +2,134 @@ cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMT github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 h1:w+iIsaOQNcT7OZ575w+acHgRric5iCyQh+xv+KJ4HB8= github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= -github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= -github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= -github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= -github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c h1:YMP6olTU903X3gxQJckdmiP8/zkSMq4kN3uipsU9XjU= +github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c/go.mod h1:7xhjOwRV2+0HXGmM0jxaEu+ZiXJFoVZOTfL/dmqbrD8= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY= github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= -github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882bXEDKfWIf0wa8HRvpnBoPszJJXL+TVbBw4M= -github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/docker/distribution v2.7.1+incompatible h1:a5mlkVzth6W5A4fOsS3D2EO5BUmsJpcB+cRlLU7cSug= github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= -github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce h1:H3csZuxZESJeeEiOxq4YXPNmLFbjl7u2qVBrAAGX/sA= -github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ= github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec= github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/golang/protobuf v1.3.0 h1:kbxbvI4Un1LUWKxufD+BiE6AEExYYgkQLQmLFqA1LFk= -github.com/golang/protobuf v1.3.0/go.mod h1:Qd/q+1AKNOZr9uGQzbzCmRO6sUih6GTPZv6a1/R87v0= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/google/go-cmp v0.3.1 h1:Xye71clBPdm5HgqGwUkwhbynsUJZhDbS20FvLhQ2izg= github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/gorilla/mux v1.7.3 h1:gnP5JzjVOuiZD07fKKToCAOjS0yOpj/qPETTXCCS6hw= github.com/gorilla/mux v1.7.3/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c h1:nXxl5PrvVm2L/wCy8dQu6DMTwH4oIuGN8GJDAlqDdVE= github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.1.1 h1:GlxAyO6x8rfZYN9Tt0Kti5a/cP41iuiO2yYT0IJGY8Y= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad h1:5E5raQxcv+6CZ11RrBYQe5WRbUIWpScjh0kvHZkZIrQ= golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= -golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= -golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= -google.golang.org/genproto v0.0.0-20180831171423-11092d34479b h1:lohp5blsw53GBXtLyLNaTXPXS9pJ1tiTw61ZHUoE9Qw= -google.golang.org/genproto v0.0.0-20180831171423-11092d34479b/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.22.0 h1:J0UbZOIrCAl+fpTOf8YLs4dJo8L/owV4LYVtAXQoPkw= google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/godbus/dbus/conn.go b/vendor/github.com/godbus/dbus/conn.go index b38920baf..9dced0cc4 100644 --- a/vendor/github.com/godbus/dbus/conn.go +++ b/vendor/github.com/godbus/dbus/conn.go @@ -134,6 +134,8 @@ func SystemBus() (conn *Conn, err error) { } // SystemBusPrivate returns a new private connection to the system bus. +// Note: this connection is not ready to use. One must perform Auth and Hello +// on the connection before it is useable. func SystemBusPrivate(opts ...ConnOption) (*Conn, error) { return Dial(getSystemBusPlatformAddress(), opts...) } @@ -267,7 +269,7 @@ func (conn *Conn) Eavesdrop(ch chan<- *Message) { conn.eavesdroppedLck.Unlock() } -// GetSerial returns an unused serial. +// getSerial returns an unused serial. func (conn *Conn) getSerial() uint32 { return conn.serialGen.GetSerial() } @@ -381,8 +383,6 @@ func (conn *Conn) Object(dest string, path ObjectPath) BusObject { return &Object{conn, dest, path} } -// outWorker runs in an own goroutine, encoding and sending messages that are -// sent to conn.out. func (conn *Conn) sendMessage(msg *Message) { conn.sendMessageAndIfClosed(msg, func() {}) } diff --git a/vendor/github.com/godbus/dbus/conn_other.go b/vendor/github.com/godbus/dbus/conn_other.go index 289044a44..616dcf664 100644 --- a/vendor/github.com/godbus/dbus/conn_other.go +++ b/vendor/github.com/godbus/dbus/conn_other.go @@ -14,8 +14,10 @@ import ( "strings" ) +var execCommand = exec.Command + func getSessionBusPlatformAddress() (string, error) { - cmd := exec.Command("dbus-launch") + cmd := execCommand("dbus-launch") b, err := cmd.CombinedOutput() if err != nil { @@ -25,7 +27,7 @@ func getSessionBusPlatformAddress() (string, error) { i := bytes.IndexByte(b, '=') j := bytes.IndexByte(b, '\n') - if i == -1 || j == -1 { + if i == -1 || j == -1 || i > j { return "", errors.New("dbus: couldn't determine address of session bus") } diff --git a/vendor/github.com/godbus/dbus/decoder.go b/vendor/github.com/godbus/dbus/decoder.go index 5c27d3b51..ede91575b 100644 --- a/vendor/github.com/godbus/dbus/decoder.go +++ b/vendor/github.com/godbus/dbus/decoder.go @@ -188,8 +188,14 @@ func (dec *decoder) decode(s string, depth int) interface{} { if depth >= 64 { panic(FormatError("input exceeds container depth limit")) } + sig := s[1:] length := dec.decode("u", depth).(uint32) - v := reflect.MakeSlice(reflect.SliceOf(typeFor(s[1:])), 0, int(length)) + // capacity can be determined only for fixed-size element types + var capacity int + if s := sigByteSize(sig); s != 0 { + capacity = int(length) / s + } + v := reflect.MakeSlice(reflect.SliceOf(typeFor(sig)), 0, capacity) // Even for empty arrays, the correct padding must be included align := alignment(typeFor(s[1:])) if len(s) > 1 && s[1] == '(' { @@ -227,6 +233,51 @@ func (dec *decoder) decode(s string, depth int) interface{} { } } +// sigByteSize tries to calculates size of the given signature in bytes. +// +// It returns zero when it can't, for example when it contains non-fixed size +// types such as strings, maps and arrays that require reading of the transmitted +// data, for that we would need to implement the unread method for Decoder first. +func sigByteSize(sig string) int { + var total int + for offset := 0; offset < len(sig); { + switch sig[offset] { + case 'y': + total += 1 + offset += 1 + case 'n', 'q': + total += 2 + offset += 1 + case 'b', 'i', 'u', 'h': + total += 4 + offset += 1 + case 'x', 't', 'd': + total += 8 + offset += 1 + case '(': + i := 1 + depth := 1 + for i < len(sig[offset:]) && depth != 0 { + if sig[offset+i] == '(' { + depth++ + } else if sig[offset+i] == ')' { + depth-- + } + i++ + } + s := sigByteSize(sig[offset+1 : offset+i-1]) + if s == 0 { + return 0 + } + total += s + offset += i + default: + return 0 + } + } + return total +} + // A FormatError is an error in the wire format. type FormatError string diff --git a/vendor/github.com/godbus/dbus/default_handler.go b/vendor/github.com/godbus/dbus/default_handler.go index 81dbcc7e4..890b6f4e0 100644 --- a/vendor/github.com/godbus/dbus/default_handler.go +++ b/vendor/github.com/godbus/dbus/default_handler.go @@ -263,13 +263,13 @@ func (sh *defaultSignalHandler) DeliverSignal(intf, name string, signal *Signal) case <-sh.closeChan: return default: - go func() { + go func(ch chan<- *Signal) { select { case ch <- signal: case <-sh.closeChan: return } - }() + }(ch) } } } diff --git a/vendor/github.com/godbus/dbus/go.mod b/vendor/github.com/godbus/dbus/go.mod index bdcd12598..57014e4ac 100644 --- a/vendor/github.com/godbus/dbus/go.mod +++ b/vendor/github.com/godbus/dbus/go.mod @@ -1 +1,3 @@ module github.com/godbus/dbus + +go 1.12 diff --git a/vendor/github.com/godbus/dbus/object.go b/vendor/github.com/godbus/dbus/object.go index f27ffe144..9309b9b40 100644 --- a/vendor/github.com/godbus/dbus/object.go +++ b/vendor/github.com/godbus/dbus/object.go @@ -16,6 +16,7 @@ type BusObject interface { AddMatchSignal(iface, member string, options ...MatchOption) *Call RemoveMatchSignal(iface, member string, options ...MatchOption) *Call GetProperty(p string) (Variant, error) + SetProperty(p string, v interface{}) error Destination() string Path() ObjectPath } @@ -146,7 +147,7 @@ func (o *Object) createCall(ctx context.Context, method string, flags Flags, ch } if msg.Flags&FlagNoReplyExpected == 0 { if ch == nil { - ch = make(chan *Call, 10) + ch = make(chan *Call, 1) } else if cap(ch) == 0 { panic("dbus: unbuffered channel passed to (*Object).Go") } @@ -187,7 +188,7 @@ func (o *Object) createCall(ctx context.Context, method string, flags Flags, ch return call } -// GetProperty calls org.freedesktop.DBus.Properties.GetProperty on the given +// GetProperty calls org.freedesktop.DBus.Properties.Get on the given // object. The property name must be given in interface.member notation. func (o *Object) GetProperty(p string) (Variant, error) { idx := strings.LastIndex(p, ".") @@ -208,6 +209,20 @@ func (o *Object) GetProperty(p string) (Variant, error) { return result, nil } +// SetProperty calls org.freedesktop.DBus.Properties.Set on the given +// object. The property name must be given in interface.member notation. +func (o *Object) SetProperty(p string, v interface{}) error { + idx := strings.LastIndex(p, ".") + if idx == -1 || idx+1 == len(p) { + return errors.New("dbus: invalid property " + p) + } + + iface := p[:idx] + prop := p[idx+1:] + + return o.Call("org.freedesktop.DBus.Properties.Set", 0, iface, prop, v).Err +} + // Destination returns the destination that calls on (o *Object) are sent to. func (o *Object) Destination() string { return o.dest diff --git a/vendor/github.com/godbus/dbus/transport_tcp.go b/vendor/github.com/godbus/dbus/transport_tcp.go index dd1c8e59c..f91c9b7d7 100644 --- a/vendor/github.com/godbus/dbus/transport_tcp.go +++ b/vendor/github.com/godbus/dbus/transport_tcp.go @@ -1,5 +1,3 @@ -//+build !windows - package dbus import ( diff --git a/vendor/github.com/godbus/dbus/transport_unix.go b/vendor/github.com/godbus/dbus/transport_unix.go index f000c6b5d..c7cd02f97 100644 --- a/vendor/github.com/godbus/dbus/transport_unix.go +++ b/vendor/github.com/godbus/dbus/transport_unix.go @@ -203,7 +203,7 @@ func (t *unixTransport) SendMessage(msg *Message) error { } } else { if err := msg.EncodeTo(t, nativeEndian); err != nil { - return nil + return err } } return nil diff --git a/vendor/github.com/gogo/protobuf/gogoproto/Makefile b/vendor/github.com/gogo/protobuf/gogoproto/Makefile new file mode 100644 index 000000000..0b4659b73 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/Makefile @@ -0,0 +1,37 @@ +# Protocol Buffers for Go with Gadgets +# +# Copyright (c) 2013, The GoGo Authors. All rights reserved. +# http://github.com/gogo/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + protoc --gogo_out=Mgoogle/protobuf/descriptor.proto=github.com/gogo/protobuf/protoc-gen-gogo/descriptor:../../../../ --proto_path=../../../../:../protobuf/:. *.proto + +restore: + cp gogo.pb.golden gogo.pb.go + +preserve: + cp gogo.pb.go gogo.pb.golden diff --git a/vendor/github.com/gogo/protobuf/gogoproto/doc.go b/vendor/github.com/gogo/protobuf/gogoproto/doc.go new file mode 100644 index 000000000..081c86fa8 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/doc.go @@ -0,0 +1,169 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package gogoproto provides extensions for protocol buffers to achieve: + + - fast marshalling and unmarshalling. + - peace of mind by optionally generating test and benchmark code. + - more canonical Go structures. + - less typing by optionally generating extra helper code. + - goprotobuf compatibility + +More Canonical Go Structures + +A lot of time working with a goprotobuf struct will lead you to a place where you create another struct that is easier to work with and then have a function to copy the values between the two structs. +You might also find that basic structs that started their life as part of an API need to be sent over the wire. With gob, you could just send it. With goprotobuf, you need to make a parallel struct. +Gogoprotobuf tries to fix these problems with the nullable, embed, customtype and customname field extensions. + + - nullable, if false, a field is generated without a pointer (see warning below). + - embed, if true, the field is generated as an embedded field. + - customtype, It works with the Marshal and Unmarshal methods, to allow you to have your own types in your struct, but marshal to bytes. For example, custom.Uuid or custom.Fixed128 + - customname (beta), Changes the generated fieldname. This is especially useful when generated methods conflict with fieldnames. + - casttype (beta), Changes the generated fieldtype. All generated code assumes that this type is castable to the protocol buffer field type. It does not work for structs or enums. + - castkey (beta), Changes the generated fieldtype for a map key. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + - castvalue (beta), Changes the generated fieldtype for a map value. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + +Warning about nullable: According to the Protocol Buffer specification, you should be able to tell whether a field is set or unset. With the option nullable=false this feature is lost, since your non-nullable fields will always be set. It can be seen as a layer on top of Protocol Buffers, where before and after marshalling all non-nullable fields are set and they cannot be unset. + +Let us look at: + + github.com/gogo/protobuf/test/example/example.proto + +for a quicker overview. + +The following message: + + package test; + + import "github.com/gogo/protobuf/gogoproto/gogo.proto"; + + message A { + optional string Description = 1 [(gogoproto.nullable) = false]; + optional int64 Number = 2 [(gogoproto.nullable) = false]; + optional bytes Id = 3 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uuid", (gogoproto.nullable) = false]; + } + +Will generate a go struct which looks a lot like this: + + type A struct { + Description string + Number int64 + Id github_com_gogo_protobuf_test_custom.Uuid + } + +You will see there are no pointers, since all fields are non-nullable. +You will also see a custom type which marshals to a string. +Be warned it is your responsibility to test your custom types thoroughly. +You should think of every possible empty and nil case for your marshaling, unmarshaling and size methods. + +Next we will embed the message A in message B. + + message B { + optional A A = 1 [(gogoproto.nullable) = false, (gogoproto.embed) = true]; + repeated bytes G = 2 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uint128", (gogoproto.nullable) = false]; + } + +See below that A is embedded in B. + + type B struct { + A + G []github_com_gogo_protobuf_test_custom.Uint128 + } + +Also see the repeated custom type. + + type Uint128 [2]uint64 + +Next we will create a custom name for one of our fields. + + message C { + optional int64 size = 1 [(gogoproto.customname) = "MySize"]; + } + +See below that the field's name is MySize and not Size. + + type C struct { + MySize *int64 + } + +The is useful when having a protocol buffer message with a field name which conflicts with a generated method. +As an example, having a field name size and using the sizer plugin to generate a Size method will cause a go compiler error. +Using customname you can fix this error without changing the field name. +This is typically useful when working with a protocol buffer that was designed before these methods and/or the go language were avialable. + +Gogoprotobuf also has some more subtle changes, these could be changed back: + + - the generated package name for imports do not have the extra /filename.pb, + but are actually the imports specified in the .proto file. + +Gogoprotobuf also has lost some features which should be brought back with time: + + - Marshalling and unmarshalling with reflect and without the unsafe package, + this requires work in pointer_reflect.go + +Why does nullable break protocol buffer specifications: + +The protocol buffer specification states, somewhere, that you should be able to tell whether a +field is set or unset. With the option nullable=false this feature is lost, +since your non-nullable fields will always be set. It can be seen as a layer on top of +protocol buffers, where before and after marshalling all non-nullable fields are set +and they cannot be unset. + +Goprotobuf Compatibility: + +Gogoprotobuf is compatible with Goprotobuf, because it is compatible with protocol buffers. +Gogoprotobuf generates the same code as goprotobuf if no extensions are used. +The enumprefix, getters and stringer extensions can be used to remove some of the unnecessary code generated by goprotobuf: + + - gogoproto_import, if false, the generated code imports github.com/golang/protobuf/proto instead of github.com/gogo/protobuf/proto. + - goproto_enum_prefix, if false, generates the enum constant names without the messagetype prefix + - goproto_enum_stringer (experimental), if false, the enum is generated without the default string method, this is useful for rather using enum_stringer, or allowing you to write your own string method. + - goproto_getters, if false, the message is generated without get methods, this is useful when you would rather want to use face + - goproto_stringer, if false, the message is generated without the default string method, this is useful for rather using stringer, or allowing you to write your own string method. + - goproto_extensions_map (beta), if false, the extensions field is generated as type []byte instead of type map[int32]proto.Extension + - goproto_unrecognized (beta), if false, XXX_unrecognized field is not generated. This is useful in conjunction with gogoproto.nullable=false, to generate structures completely devoid of pointers and reduce GC pressure at the cost of losing information about unrecognized fields. + - goproto_registration (beta), if true, the generated files will register all messages and types against both gogo/protobuf and golang/protobuf. This is necessary when using third-party packages which read registrations from golang/protobuf (such as the grpc-gateway). + +Less Typing and Peace of Mind is explained in their specific plugin folders godoc: + + - github.com/gogo/protobuf/plugin/<extension_name> + +If you do not use any of these extension the code that is generated +will be the same as if goprotobuf has generated it. + +The most complete way to see examples is to look at + + github.com/gogo/protobuf/test/thetest.proto + +Gogoprototest is a seperate project, +because we want to keep gogoprotobuf independent of goprotobuf, +but we still want to test it thoroughly. + +*/ +package gogoproto diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go new file mode 100644 index 000000000..e352808b9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go @@ -0,0 +1,874 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: gogo.proto + +package gogoproto + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + descriptor "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +var E_GoprotoEnumPrefix = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62001, + Name: "gogoproto.goproto_enum_prefix", + Tag: "varint,62001,opt,name=goproto_enum_prefix", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62021, + Name: "gogoproto.goproto_enum_stringer", + Tag: "varint,62021,opt,name=goproto_enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62022, + Name: "gogoproto.enum_stringer", + Tag: "varint,62022,opt,name=enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*string)(nil), + Field: 62023, + Name: "gogoproto.enum_customname", + Tag: "bytes,62023,opt,name=enum_customname", + Filename: "gogo.proto", +} + +var E_Enumdecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62024, + Name: "gogoproto.enumdecl", + Tag: "varint,62024,opt,name=enumdecl", + Filename: "gogo.proto", +} + +var E_EnumvalueCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumValueOptions)(nil), + ExtensionType: (*string)(nil), + Field: 66001, + Name: "gogoproto.enumvalue_customname", + Tag: "bytes,66001,opt,name=enumvalue_customname", + Filename: "gogo.proto", +} + +var E_GoprotoGettersAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63001, + Name: "gogoproto.goproto_getters_all", + Tag: "varint,63001,opt,name=goproto_getters_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumPrefixAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63002, + Name: "gogoproto.goproto_enum_prefix_all", + Tag: "varint,63002,opt,name=goproto_enum_prefix_all", + Filename: "gogo.proto", +} + +var E_GoprotoStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63003, + Name: "gogoproto.goproto_stringer_all", + Tag: "varint,63003,opt,name=goproto_stringer_all", + Filename: "gogo.proto", +} + +var E_VerboseEqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63004, + Name: "gogoproto.verbose_equal_all", + Tag: "varint,63004,opt,name=verbose_equal_all", + Filename: "gogo.proto", +} + +var E_FaceAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63005, + Name: "gogoproto.face_all", + Tag: "varint,63005,opt,name=face_all", + Filename: "gogo.proto", +} + +var E_GostringAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63006, + Name: "gogoproto.gostring_all", + Tag: "varint,63006,opt,name=gostring_all", + Filename: "gogo.proto", +} + +var E_PopulateAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63007, + Name: "gogoproto.populate_all", + Tag: "varint,63007,opt,name=populate_all", + Filename: "gogo.proto", +} + +var E_StringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63008, + Name: "gogoproto.stringer_all", + Tag: "varint,63008,opt,name=stringer_all", + Filename: "gogo.proto", +} + +var E_OnlyoneAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63009, + Name: "gogoproto.onlyone_all", + Tag: "varint,63009,opt,name=onlyone_all", + Filename: "gogo.proto", +} + +var E_EqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63013, + Name: "gogoproto.equal_all", + Tag: "varint,63013,opt,name=equal_all", + Filename: "gogo.proto", +} + +var E_DescriptionAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63014, + Name: "gogoproto.description_all", + Tag: "varint,63014,opt,name=description_all", + Filename: "gogo.proto", +} + +var E_TestgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63015, + Name: "gogoproto.testgen_all", + Tag: "varint,63015,opt,name=testgen_all", + Filename: "gogo.proto", +} + +var E_BenchgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63016, + Name: "gogoproto.benchgen_all", + Tag: "varint,63016,opt,name=benchgen_all", + Filename: "gogo.proto", +} + +var E_MarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63017, + Name: "gogoproto.marshaler_all", + Tag: "varint,63017,opt,name=marshaler_all", + Filename: "gogo.proto", +} + +var E_UnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63018, + Name: "gogoproto.unmarshaler_all", + Tag: "varint,63018,opt,name=unmarshaler_all", + Filename: "gogo.proto", +} + +var E_StableMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63019, + Name: "gogoproto.stable_marshaler_all", + Tag: "varint,63019,opt,name=stable_marshaler_all", + Filename: "gogo.proto", +} + +var E_SizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63020, + Name: "gogoproto.sizer_all", + Tag: "varint,63020,opt,name=sizer_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63021, + Name: "gogoproto.goproto_enum_stringer_all", + Tag: "varint,63021,opt,name=goproto_enum_stringer_all", + Filename: "gogo.proto", +} + +var E_EnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63022, + Name: "gogoproto.enum_stringer_all", + Tag: "varint,63022,opt,name=enum_stringer_all", + Filename: "gogo.proto", +} + +var E_UnsafeMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63023, + Name: "gogoproto.unsafe_marshaler_all", + Tag: "varint,63023,opt,name=unsafe_marshaler_all", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63024, + Name: "gogoproto.unsafe_unmarshaler_all", + Tag: "varint,63024,opt,name=unsafe_unmarshaler_all", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMapAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63025, + Name: "gogoproto.goproto_extensions_map_all", + Tag: "varint,63025,opt,name=goproto_extensions_map_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognizedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63026, + Name: "gogoproto.goproto_unrecognized_all", + Tag: "varint,63026,opt,name=goproto_unrecognized_all", + Filename: "gogo.proto", +} + +var E_GogoprotoImport = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63027, + Name: "gogoproto.gogoproto_import", + Tag: "varint,63027,opt,name=gogoproto_import", + Filename: "gogo.proto", +} + +var E_ProtosizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63028, + Name: "gogoproto.protosizer_all", + Tag: "varint,63028,opt,name=protosizer_all", + Filename: "gogo.proto", +} + +var E_CompareAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63029, + Name: "gogoproto.compare_all", + Tag: "varint,63029,opt,name=compare_all", + Filename: "gogo.proto", +} + +var E_TypedeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63030, + Name: "gogoproto.typedecl_all", + Tag: "varint,63030,opt,name=typedecl_all", + Filename: "gogo.proto", +} + +var E_EnumdeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63031, + Name: "gogoproto.enumdecl_all", + Tag: "varint,63031,opt,name=enumdecl_all", + Filename: "gogo.proto", +} + +var E_GoprotoRegistration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63032, + Name: "gogoproto.goproto_registration", + Tag: "varint,63032,opt,name=goproto_registration", + Filename: "gogo.proto", +} + +var E_MessagenameAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63033, + Name: "gogoproto.messagename_all", + Tag: "varint,63033,opt,name=messagename_all", + Filename: "gogo.proto", +} + +var E_GoprotoSizecacheAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63034, + Name: "gogoproto.goproto_sizecache_all", + Tag: "varint,63034,opt,name=goproto_sizecache_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63035, + Name: "gogoproto.goproto_unkeyed_all", + Tag: "varint,63035,opt,name=goproto_unkeyed_all", + Filename: "gogo.proto", +} + +var E_GoprotoGetters = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64001, + Name: "gogoproto.goproto_getters", + Tag: "varint,64001,opt,name=goproto_getters", + Filename: "gogo.proto", +} + +var E_GoprotoStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64003, + Name: "gogoproto.goproto_stringer", + Tag: "varint,64003,opt,name=goproto_stringer", + Filename: "gogo.proto", +} + +var E_VerboseEqual = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64004, + Name: "gogoproto.verbose_equal", + Tag: "varint,64004,opt,name=verbose_equal", + Filename: "gogo.proto", +} + +var E_Face = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64005, + Name: "gogoproto.face", + Tag: "varint,64005,opt,name=face", + Filename: "gogo.proto", +} + +var E_Gostring = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64006, + Name: "gogoproto.gostring", + Tag: "varint,64006,opt,name=gostring", + Filename: "gogo.proto", +} + +var E_Populate = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64007, + Name: "gogoproto.populate", + Tag: "varint,64007,opt,name=populate", + Filename: "gogo.proto", +} + +var E_Stringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 67008, + Name: "gogoproto.stringer", + Tag: "varint,67008,opt,name=stringer", + Filename: "gogo.proto", +} + +var E_Onlyone = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64009, + Name: "gogoproto.onlyone", + Tag: "varint,64009,opt,name=onlyone", + Filename: "gogo.proto", +} + +var E_Equal = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64013, + Name: "gogoproto.equal", + Tag: "varint,64013,opt,name=equal", + Filename: "gogo.proto", +} + +var E_Description = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64014, + Name: "gogoproto.description", + Tag: "varint,64014,opt,name=description", + Filename: "gogo.proto", +} + +var E_Testgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64015, + Name: "gogoproto.testgen", + Tag: "varint,64015,opt,name=testgen", + Filename: "gogo.proto", +} + +var E_Benchgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64016, + Name: "gogoproto.benchgen", + Tag: "varint,64016,opt,name=benchgen", + Filename: "gogo.proto", +} + +var E_Marshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64017, + Name: "gogoproto.marshaler", + Tag: "varint,64017,opt,name=marshaler", + Filename: "gogo.proto", +} + +var E_Unmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64018, + Name: "gogoproto.unmarshaler", + Tag: "varint,64018,opt,name=unmarshaler", + Filename: "gogo.proto", +} + +var E_StableMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64019, + Name: "gogoproto.stable_marshaler", + Tag: "varint,64019,opt,name=stable_marshaler", + Filename: "gogo.proto", +} + +var E_Sizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64020, + Name: "gogoproto.sizer", + Tag: "varint,64020,opt,name=sizer", + Filename: "gogo.proto", +} + +var E_UnsafeMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64023, + Name: "gogoproto.unsafe_marshaler", + Tag: "varint,64023,opt,name=unsafe_marshaler", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64024, + Name: "gogoproto.unsafe_unmarshaler", + Tag: "varint,64024,opt,name=unsafe_unmarshaler", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMap = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64025, + Name: "gogoproto.goproto_extensions_map", + Tag: "varint,64025,opt,name=goproto_extensions_map", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognized = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64026, + Name: "gogoproto.goproto_unrecognized", + Tag: "varint,64026,opt,name=goproto_unrecognized", + Filename: "gogo.proto", +} + +var E_Protosizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64028, + Name: "gogoproto.protosizer", + Tag: "varint,64028,opt,name=protosizer", + Filename: "gogo.proto", +} + +var E_Compare = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64029, + Name: "gogoproto.compare", + Tag: "varint,64029,opt,name=compare", + Filename: "gogo.proto", +} + +var E_Typedecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64030, + Name: "gogoproto.typedecl", + Tag: "varint,64030,opt,name=typedecl", + Filename: "gogo.proto", +} + +var E_Messagename = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64033, + Name: "gogoproto.messagename", + Tag: "varint,64033,opt,name=messagename", + Filename: "gogo.proto", +} + +var E_GoprotoSizecache = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64034, + Name: "gogoproto.goproto_sizecache", + Tag: "varint,64034,opt,name=goproto_sizecache", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64035, + Name: "gogoproto.goproto_unkeyed", + Tag: "varint,64035,opt,name=goproto_unkeyed", + Filename: "gogo.proto", +} + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65001, + Name: "gogoproto.nullable", + Tag: "varint,65001,opt,name=nullable", + Filename: "gogo.proto", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65002, + Name: "gogoproto.embed", + Tag: "varint,65002,opt,name=embed", + Filename: "gogo.proto", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65003, + Name: "gogoproto.customtype", + Tag: "bytes,65003,opt,name=customtype", + Filename: "gogo.proto", +} + +var E_Customname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65004, + Name: "gogoproto.customname", + Tag: "bytes,65004,opt,name=customname", + Filename: "gogo.proto", +} + +var E_Jsontag = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65005, + Name: "gogoproto.jsontag", + Tag: "bytes,65005,opt,name=jsontag", + Filename: "gogo.proto", +} + +var E_Moretags = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65006, + Name: "gogoproto.moretags", + Tag: "bytes,65006,opt,name=moretags", + Filename: "gogo.proto", +} + +var E_Casttype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65007, + Name: "gogoproto.casttype", + Tag: "bytes,65007,opt,name=casttype", + Filename: "gogo.proto", +} + +var E_Castkey = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65008, + Name: "gogoproto.castkey", + Tag: "bytes,65008,opt,name=castkey", + Filename: "gogo.proto", +} + +var E_Castvalue = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65009, + Name: "gogoproto.castvalue", + Tag: "bytes,65009,opt,name=castvalue", + Filename: "gogo.proto", +} + +var E_Stdtime = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65010, + Name: "gogoproto.stdtime", + Tag: "varint,65010,opt,name=stdtime", + Filename: "gogo.proto", +} + +var E_Stdduration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65011, + Name: "gogoproto.stdduration", + Tag: "varint,65011,opt,name=stdduration", + Filename: "gogo.proto", +} + +var E_Wktpointer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65012, + Name: "gogoproto.wktpointer", + Tag: "varint,65012,opt,name=wktpointer", + Filename: "gogo.proto", +} + +func init() { + proto.RegisterExtension(E_GoprotoEnumPrefix) + proto.RegisterExtension(E_GoprotoEnumStringer) + proto.RegisterExtension(E_EnumStringer) + proto.RegisterExtension(E_EnumCustomname) + proto.RegisterExtension(E_Enumdecl) + proto.RegisterExtension(E_EnumvalueCustomname) + proto.RegisterExtension(E_GoprotoGettersAll) + proto.RegisterExtension(E_GoprotoEnumPrefixAll) + proto.RegisterExtension(E_GoprotoStringerAll) + proto.RegisterExtension(E_VerboseEqualAll) + proto.RegisterExtension(E_FaceAll) + proto.RegisterExtension(E_GostringAll) + proto.RegisterExtension(E_PopulateAll) + proto.RegisterExtension(E_StringerAll) + proto.RegisterExtension(E_OnlyoneAll) + proto.RegisterExtension(E_EqualAll) + proto.RegisterExtension(E_DescriptionAll) + proto.RegisterExtension(E_TestgenAll) + proto.RegisterExtension(E_BenchgenAll) + proto.RegisterExtension(E_MarshalerAll) + proto.RegisterExtension(E_UnmarshalerAll) + proto.RegisterExtension(E_StableMarshalerAll) + proto.RegisterExtension(E_SizerAll) + proto.RegisterExtension(E_GoprotoEnumStringerAll) + proto.RegisterExtension(E_EnumStringerAll) + proto.RegisterExtension(E_UnsafeMarshalerAll) + proto.RegisterExtension(E_UnsafeUnmarshalerAll) + proto.RegisterExtension(E_GoprotoExtensionsMapAll) + proto.RegisterExtension(E_GoprotoUnrecognizedAll) + proto.RegisterExtension(E_GogoprotoImport) + proto.RegisterExtension(E_ProtosizerAll) + proto.RegisterExtension(E_CompareAll) + proto.RegisterExtension(E_TypedeclAll) + proto.RegisterExtension(E_EnumdeclAll) + proto.RegisterExtension(E_GoprotoRegistration) + proto.RegisterExtension(E_MessagenameAll) + proto.RegisterExtension(E_GoprotoSizecacheAll) + proto.RegisterExtension(E_GoprotoUnkeyedAll) + proto.RegisterExtension(E_GoprotoGetters) + proto.RegisterExtension(E_GoprotoStringer) + proto.RegisterExtension(E_VerboseEqual) + proto.RegisterExtension(E_Face) + proto.RegisterExtension(E_Gostring) + proto.RegisterExtension(E_Populate) + proto.RegisterExtension(E_Stringer) + proto.RegisterExtension(E_Onlyone) + proto.RegisterExtension(E_Equal) + proto.RegisterExtension(E_Description) + proto.RegisterExtension(E_Testgen) + proto.RegisterExtension(E_Benchgen) + proto.RegisterExtension(E_Marshaler) + proto.RegisterExtension(E_Unmarshaler) + proto.RegisterExtension(E_StableMarshaler) + proto.RegisterExtension(E_Sizer) + proto.RegisterExtension(E_UnsafeMarshaler) + proto.RegisterExtension(E_UnsafeUnmarshaler) + proto.RegisterExtension(E_GoprotoExtensionsMap) + proto.RegisterExtension(E_GoprotoUnrecognized) + proto.RegisterExtension(E_Protosizer) + proto.RegisterExtension(E_Compare) + proto.RegisterExtension(E_Typedecl) + proto.RegisterExtension(E_Messagename) + proto.RegisterExtension(E_GoprotoSizecache) + proto.RegisterExtension(E_GoprotoUnkeyed) + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) + proto.RegisterExtension(E_Customname) + proto.RegisterExtension(E_Jsontag) + proto.RegisterExtension(E_Moretags) + proto.RegisterExtension(E_Casttype) + proto.RegisterExtension(E_Castkey) + proto.RegisterExtension(E_Castvalue) + proto.RegisterExtension(E_Stdtime) + proto.RegisterExtension(E_Stdduration) + proto.RegisterExtension(E_Wktpointer) +} + +func init() { proto.RegisterFile("gogo.proto", fileDescriptor_592445b5231bc2b9) } + +var fileDescriptor_592445b5231bc2b9 = []byte{ + // 1328 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x98, 0x49, 0x6f, 0x1c, 0x45, + 0x14, 0x80, 0x85, 0x48, 0x64, 0x4f, 0x79, 0x8b, 0xc7, 0xc6, 0x84, 0x08, 0x44, 0xe0, 0xc4, 0xc9, + 0x3e, 0x45, 0x28, 0x65, 0x45, 0x96, 0x63, 0x39, 0x56, 0x10, 0x0e, 0xc6, 0x89, 0xc3, 0x76, 0x18, + 0xf5, 0xf4, 0x94, 0xdb, 0x8d, 0xbb, 0xbb, 0x9a, 0xee, 0xea, 0x10, 0xe7, 0x86, 0xc2, 0x22, 0x84, + 0xd8, 0x91, 0x20, 0x21, 0x09, 0x04, 0xc4, 0xbe, 0x86, 0x7d, 0xb9, 0x70, 0x61, 0xb9, 0xf2, 0x1f, + 0xb8, 0x00, 0x66, 0xf7, 0xcd, 0x17, 0xf4, 0xba, 0xdf, 0xeb, 0xa9, 0x69, 0x8f, 0x54, 0x35, 0xb7, + 0xf6, 0xb8, 0xbe, 0x6f, 0xaa, 0xdf, 0xeb, 0x7a, 0xef, 0x4d, 0x33, 0xe6, 0x49, 0x4f, 0x4e, 0xc6, + 0x89, 0x54, 0xb2, 0x5e, 0x83, 0xeb, 0xfc, 0x72, 0xdf, 0x7e, 0x4f, 0x4a, 0x2f, 0x10, 0x53, 0xf9, + 0x5f, 0xcd, 0x6c, 0x75, 0xaa, 0x25, 0x52, 0x37, 0xf1, 0x63, 0x25, 0x93, 0x62, 0x31, 0x3f, 0xc6, + 0xc6, 0x70, 0x71, 0x43, 0x44, 0x59, 0xd8, 0x88, 0x13, 0xb1, 0xea, 0x9f, 0xae, 0x5f, 0x3f, 0x59, + 0x90, 0x93, 0x44, 0x4e, 0xce, 0x47, 0x59, 0x78, 0x47, 0xac, 0x7c, 0x19, 0xa5, 0x7b, 0xaf, 0xfc, + 0x72, 0xf5, 0xfe, 0xab, 0x6e, 0xe9, 0x5f, 0x1e, 0x45, 0x14, 0xfe, 0xb7, 0x94, 0x83, 0x7c, 0x99, + 0x5d, 0xd3, 0xe1, 0x4b, 0x55, 0xe2, 0x47, 0x9e, 0x48, 0x0c, 0xc6, 0xef, 0xd1, 0x38, 0xa6, 0x19, + 0x8f, 0x23, 0xca, 0xe7, 0xd8, 0x50, 0x2f, 0xae, 0x1f, 0xd0, 0x35, 0x28, 0x74, 0xc9, 0x02, 0x1b, + 0xc9, 0x25, 0x6e, 0x96, 0x2a, 0x19, 0x46, 0x4e, 0x28, 0x0c, 0x9a, 0x1f, 0x73, 0x4d, 0x6d, 0x79, + 0x18, 0xb0, 0xb9, 0x92, 0xe2, 0x9c, 0xf5, 0xc3, 0x27, 0x2d, 0xe1, 0x06, 0x06, 0xc3, 0x4f, 0xb8, + 0x91, 0x72, 0x3d, 0x3f, 0xc9, 0xc6, 0xe1, 0xfa, 0x94, 0x13, 0x64, 0x42, 0xdf, 0xc9, 0x4d, 0x5d, + 0x3d, 0x27, 0x61, 0x19, 0xc9, 0x7e, 0x3e, 0xbb, 0x2b, 0xdf, 0xce, 0x58, 0x29, 0xd0, 0xf6, 0xa4, + 0x65, 0xd1, 0x13, 0x4a, 0x89, 0x24, 0x6d, 0x38, 0x41, 0xb7, 0xed, 0x1d, 0xf1, 0x83, 0xd2, 0x78, + 0x6e, 0xb3, 0x33, 0x8b, 0x0b, 0x05, 0x39, 0x1b, 0x04, 0x7c, 0x85, 0x5d, 0xdb, 0xe5, 0xa9, 0xb0, + 0x70, 0x9e, 0x47, 0xe7, 0xf8, 0x8e, 0x27, 0x03, 0xb4, 0x4b, 0x8c, 0x3e, 0x2f, 0x73, 0x69, 0xe1, + 0x7c, 0x19, 0x9d, 0x75, 0x64, 0x29, 0xa5, 0x60, 0xbc, 0x8d, 0x8d, 0x9e, 0x12, 0x49, 0x53, 0xa6, + 0xa2, 0x21, 0x1e, 0xc8, 0x9c, 0xc0, 0x42, 0x77, 0x01, 0x75, 0x23, 0x08, 0xce, 0x03, 0x07, 0xae, + 0x83, 0xac, 0x7f, 0xd5, 0x71, 0x85, 0x85, 0xe2, 0x22, 0x2a, 0xfa, 0x60, 0x3d, 0xa0, 0xb3, 0x6c, + 0xd0, 0x93, 0xc5, 0x2d, 0x59, 0xe0, 0x97, 0x10, 0x1f, 0x20, 0x06, 0x15, 0xb1, 0x8c, 0xb3, 0xc0, + 0x51, 0x36, 0x3b, 0x78, 0x85, 0x14, 0xc4, 0xa0, 0xa2, 0x87, 0xb0, 0xbe, 0x4a, 0x8a, 0x54, 0x8b, + 0xe7, 0x0c, 0x1b, 0x90, 0x51, 0xb0, 0x21, 0x23, 0x9b, 0x4d, 0x5c, 0x46, 0x03, 0x43, 0x04, 0x04, + 0xd3, 0xac, 0x66, 0x9b, 0x88, 0x37, 0x36, 0xe9, 0x78, 0x50, 0x06, 0x16, 0xd8, 0x08, 0x15, 0x28, + 0x5f, 0x46, 0x16, 0x8a, 0x37, 0x51, 0x31, 0xac, 0x61, 0x78, 0x1b, 0x4a, 0xa4, 0xca, 0x13, 0x36, + 0x92, 0xb7, 0xe8, 0x36, 0x10, 0xc1, 0x50, 0x36, 0x45, 0xe4, 0xae, 0xd9, 0x19, 0xde, 0xa6, 0x50, + 0x12, 0x03, 0x8a, 0x39, 0x36, 0x14, 0x3a, 0x49, 0xba, 0xe6, 0x04, 0x56, 0xe9, 0x78, 0x07, 0x1d, + 0x83, 0x25, 0x84, 0x11, 0xc9, 0xa2, 0x5e, 0x34, 0xef, 0x52, 0x44, 0x34, 0x0c, 0x8f, 0x5e, 0xaa, + 0x9c, 0x66, 0x20, 0x1a, 0xbd, 0xd8, 0xde, 0xa3, 0xa3, 0x57, 0xb0, 0x8b, 0xba, 0x71, 0x9a, 0xd5, + 0x52, 0xff, 0x8c, 0x95, 0xe6, 0x7d, 0xca, 0x74, 0x0e, 0x00, 0x7c, 0x0f, 0xbb, 0xae, 0x6b, 0x9b, + 0xb0, 0x90, 0x7d, 0x80, 0xb2, 0x89, 0x2e, 0xad, 0x02, 0x4b, 0x42, 0xaf, 0xca, 0x0f, 0xa9, 0x24, + 0x88, 0x8a, 0x6b, 0x89, 0x8d, 0x67, 0x51, 0xea, 0xac, 0xf6, 0x16, 0xb5, 0x8f, 0x28, 0x6a, 0x05, + 0xdb, 0x11, 0xb5, 0x13, 0x6c, 0x02, 0x8d, 0xbd, 0xe5, 0xf5, 0x63, 0x2a, 0xac, 0x05, 0xbd, 0xd2, + 0x99, 0xdd, 0xfb, 0xd8, 0xbe, 0x32, 0x9c, 0xa7, 0x95, 0x88, 0x52, 0x60, 0x1a, 0xa1, 0x13, 0x5b, + 0x98, 0xaf, 0xa0, 0x99, 0x2a, 0xfe, 0x7c, 0x29, 0x58, 0x74, 0x62, 0x90, 0xdf, 0xcd, 0xf6, 0x92, + 0x3c, 0x8b, 0x12, 0xe1, 0x4a, 0x2f, 0xf2, 0xcf, 0x88, 0x96, 0x85, 0xfa, 0x93, 0x4a, 0xaa, 0x56, + 0x34, 0x1c, 0xcc, 0x47, 0xd9, 0x9e, 0x72, 0x56, 0x69, 0xf8, 0x61, 0x2c, 0x13, 0x65, 0x30, 0x7e, + 0x4a, 0x99, 0x2a, 0xb9, 0xa3, 0x39, 0xc6, 0xe7, 0xd9, 0x70, 0xfe, 0xa7, 0xed, 0x23, 0xf9, 0x19, + 0x8a, 0x86, 0xda, 0x14, 0x16, 0x0e, 0x57, 0x86, 0xb1, 0x93, 0xd8, 0xd4, 0xbf, 0xcf, 0xa9, 0x70, + 0x20, 0x82, 0x85, 0x43, 0x6d, 0xc4, 0x02, 0xba, 0xbd, 0x85, 0xe1, 0x0b, 0x2a, 0x1c, 0xc4, 0xa0, + 0x82, 0x06, 0x06, 0x0b, 0xc5, 0x97, 0xa4, 0x20, 0x06, 0x14, 0x77, 0xb6, 0x1b, 0x6d, 0x22, 0x3c, + 0x3f, 0x55, 0x89, 0x03, 0xab, 0x0d, 0xaa, 0xaf, 0x36, 0x3b, 0x87, 0xb0, 0x65, 0x0d, 0x85, 0x4a, + 0x14, 0x8a, 0x34, 0x75, 0x3c, 0x01, 0x13, 0x87, 0xc5, 0xc6, 0xbe, 0xa6, 0x4a, 0xa4, 0x61, 0xb0, + 0x37, 0x6d, 0x42, 0x84, 0xb0, 0xbb, 0x8e, 0xbb, 0x66, 0xa3, 0xfb, 0xa6, 0xb2, 0xb9, 0xe3, 0xc4, + 0x82, 0x53, 0x9b, 0x7f, 0xb2, 0x68, 0x5d, 0x6c, 0x58, 0x3d, 0x9d, 0xdf, 0x56, 0xe6, 0x9f, 0x95, + 0x82, 0x2c, 0x6a, 0xc8, 0x48, 0x65, 0x9e, 0xaa, 0xdf, 0xb8, 0xc3, 0xb5, 0x58, 0xdc, 0x17, 0xe9, + 0x1e, 0xda, 0xc2, 0xfb, 0xed, 0x1c, 0xa7, 0xf8, 0xed, 0xf0, 0x90, 0x77, 0x0e, 0x3d, 0x66, 0xd9, + 0xd9, 0xad, 0xf2, 0x39, 0xef, 0x98, 0x79, 0xf8, 0x11, 0x36, 0xd4, 0x31, 0xf0, 0x98, 0x55, 0x0f, + 0xa3, 0x6a, 0x50, 0x9f, 0x77, 0xf8, 0x01, 0xb6, 0x0b, 0x86, 0x17, 0x33, 0xfe, 0x08, 0xe2, 0xf9, + 0x72, 0x7e, 0x88, 0xf5, 0xd3, 0xd0, 0x62, 0x46, 0x1f, 0x45, 0xb4, 0x44, 0x00, 0xa7, 0x81, 0xc5, + 0x8c, 0x3f, 0x46, 0x38, 0x21, 0x80, 0xdb, 0x87, 0xf0, 0xbb, 0x27, 0x76, 0x61, 0xd3, 0xa1, 0xd8, + 0x4d, 0xb3, 0x3e, 0x9c, 0x54, 0xcc, 0xf4, 0xe3, 0xf8, 0xe5, 0x44, 0xf0, 0x5b, 0xd9, 0x6e, 0xcb, + 0x80, 0x3f, 0x89, 0x68, 0xb1, 0x9e, 0xcf, 0xb1, 0x01, 0x6d, 0x3a, 0x31, 0xe3, 0x4f, 0x21, 0xae, + 0x53, 0xb0, 0x75, 0x9c, 0x4e, 0xcc, 0x82, 0xa7, 0x69, 0xeb, 0x48, 0x40, 0xd8, 0x68, 0x30, 0x31, + 0xd3, 0xcf, 0x50, 0xd4, 0x09, 0xe1, 0x33, 0xac, 0x56, 0x36, 0x1b, 0x33, 0xff, 0x2c, 0xf2, 0x6d, + 0x06, 0x22, 0xa0, 0x35, 0x3b, 0xb3, 0xe2, 0x39, 0x8a, 0x80, 0x46, 0xc1, 0x31, 0xaa, 0x0e, 0x30, + 0x66, 0xd3, 0xf3, 0x74, 0x8c, 0x2a, 0xf3, 0x0b, 0x64, 0x33, 0xaf, 0xf9, 0x66, 0xc5, 0x0b, 0x94, + 0xcd, 0x7c, 0x3d, 0x6c, 0xa3, 0x3a, 0x11, 0x98, 0x1d, 0x2f, 0xd2, 0x36, 0x2a, 0x03, 0x01, 0x5f, + 0x62, 0xf5, 0x9d, 0xd3, 0x80, 0xd9, 0xf7, 0x12, 0xfa, 0x46, 0x77, 0x0c, 0x03, 0xfc, 0x2e, 0x36, + 0xd1, 0x7d, 0x12, 0x30, 0x5b, 0xcf, 0x6d, 0x55, 0x7e, 0xbb, 0xe9, 0x83, 0x00, 0x3f, 0xd1, 0x6e, + 0x29, 0xfa, 0x14, 0x60, 0xd6, 0x9e, 0xdf, 0xea, 0x2c, 0xdc, 0xfa, 0x10, 0xc0, 0x67, 0x19, 0x6b, + 0x37, 0x60, 0xb3, 0xeb, 0x02, 0xba, 0x34, 0x08, 0x8e, 0x06, 0xf6, 0x5f, 0x33, 0x7f, 0x91, 0x8e, + 0x06, 0x12, 0x70, 0x34, 0xa8, 0xf5, 0x9a, 0xe9, 0x4b, 0x74, 0x34, 0x08, 0x81, 0x27, 0x5b, 0xeb, + 0x6e, 0x66, 0xc3, 0x65, 0x7a, 0xb2, 0x35, 0x8a, 0x1f, 0x63, 0xa3, 0x3b, 0x1a, 0xa2, 0x59, 0xf5, + 0x1a, 0xaa, 0xf6, 0x54, 0xfb, 0xa1, 0xde, 0xbc, 0xb0, 0x19, 0x9a, 0x6d, 0xaf, 0x57, 0x9a, 0x17, + 0xf6, 0x42, 0x3e, 0xcd, 0xfa, 0xa3, 0x2c, 0x08, 0xe0, 0xf0, 0xd4, 0x6f, 0xe8, 0xd2, 0x4d, 0x45, + 0xd0, 0x22, 0xc5, 0xaf, 0xdb, 0x18, 0x1d, 0x02, 0xf8, 0x01, 0xb6, 0x5b, 0x84, 0x4d, 0xd1, 0x32, + 0x91, 0xbf, 0x6d, 0x53, 0xc1, 0x84, 0xd5, 0x7c, 0x86, 0xb1, 0xe2, 0xd5, 0x08, 0x84, 0xd9, 0xc4, + 0xfe, 0xbe, 0x5d, 0xbc, 0xa5, 0xd1, 0x90, 0xb6, 0x20, 0x4f, 0x8a, 0x41, 0xb0, 0xd9, 0x29, 0xc8, + 0x33, 0x72, 0x90, 0xf5, 0xdd, 0x9f, 0xca, 0x48, 0x39, 0x9e, 0x89, 0xfe, 0x03, 0x69, 0x5a, 0x0f, + 0x01, 0x0b, 0x65, 0x22, 0x94, 0xe3, 0xa5, 0x26, 0xf6, 0x4f, 0x64, 0x4b, 0x00, 0x60, 0xd7, 0x49, + 0x95, 0xcd, 0x7d, 0xff, 0x45, 0x30, 0x01, 0xb0, 0x69, 0xb8, 0x5e, 0x17, 0x1b, 0x26, 0xf6, 0x6f, + 0xda, 0x34, 0xae, 0xe7, 0x87, 0x58, 0x0d, 0x2e, 0xf3, 0xb7, 0x4a, 0x26, 0xf8, 0x1f, 0x84, 0xdb, + 0x04, 0x7c, 0x73, 0xaa, 0x5a, 0xca, 0x37, 0x07, 0xfb, 0x5f, 0xcc, 0x34, 0xad, 0xe7, 0xb3, 0x6c, + 0x20, 0x55, 0xad, 0x56, 0x86, 0xf3, 0xa9, 0x01, 0xff, 0x6f, 0xbb, 0x7c, 0x65, 0x51, 0x32, 0x90, + 0xed, 0x07, 0xd7, 0x55, 0x2c, 0xfd, 0x48, 0x89, 0xc4, 0x64, 0xd8, 0x42, 0x83, 0x86, 0x1c, 0x9e, + 0x67, 0x63, 0xae, 0x0c, 0xab, 0xdc, 0x61, 0xb6, 0x20, 0x17, 0xe4, 0x52, 0x5e, 0x67, 0xee, 0xbd, + 0xd9, 0xf3, 0xd5, 0x5a, 0xd6, 0x9c, 0x74, 0x65, 0x38, 0x05, 0xbf, 0x3c, 0xda, 0x2f, 0x54, 0xcb, + 0xdf, 0x21, 0xff, 0x07, 0x00, 0x00, 0xff, 0xff, 0x9c, 0xaf, 0x70, 0x4e, 0x83, 0x15, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden new file mode 100644 index 000000000..f6502e4b9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden @@ -0,0 +1,45 @@ +// Code generated by protoc-gen-go. +// source: gogo.proto +// DO NOT EDIT! + +package gogoproto + +import proto "github.com/gogo/protobuf/proto" +import json "encoding/json" +import math "math" +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + +// Reference proto, json, and math imports to suppress error if they are not otherwise used. +var _ = proto.Marshal +var _ = &json.SyntaxError{} +var _ = math.Inf + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51235, + Name: "gogoproto.nullable", + Tag: "varint,51235,opt,name=nullable", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51236, + Name: "gogoproto.embed", + Tag: "varint,51236,opt,name=embed", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 51237, + Name: "gogoproto.customtype", + Tag: "bytes,51237,opt,name=customtype", +} + +func init() { + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto new file mode 100644 index 000000000..b80c85653 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto @@ -0,0 +1,144 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto2"; +package gogoproto; + +import "google/protobuf/descriptor.proto"; + +option java_package = "com.google.protobuf"; +option java_outer_classname = "GoGoProtos"; +option go_package = "github.com/gogo/protobuf/gogoproto"; + +extend google.protobuf.EnumOptions { + optional bool goproto_enum_prefix = 62001; + optional bool goproto_enum_stringer = 62021; + optional bool enum_stringer = 62022; + optional string enum_customname = 62023; + optional bool enumdecl = 62024; +} + +extend google.protobuf.EnumValueOptions { + optional string enumvalue_customname = 66001; +} + +extend google.protobuf.FileOptions { + optional bool goproto_getters_all = 63001; + optional bool goproto_enum_prefix_all = 63002; + optional bool goproto_stringer_all = 63003; + optional bool verbose_equal_all = 63004; + optional bool face_all = 63005; + optional bool gostring_all = 63006; + optional bool populate_all = 63007; + optional bool stringer_all = 63008; + optional bool onlyone_all = 63009; + + optional bool equal_all = 63013; + optional bool description_all = 63014; + optional bool testgen_all = 63015; + optional bool benchgen_all = 63016; + optional bool marshaler_all = 63017; + optional bool unmarshaler_all = 63018; + optional bool stable_marshaler_all = 63019; + + optional bool sizer_all = 63020; + + optional bool goproto_enum_stringer_all = 63021; + optional bool enum_stringer_all = 63022; + + optional bool unsafe_marshaler_all = 63023; + optional bool unsafe_unmarshaler_all = 63024; + + optional bool goproto_extensions_map_all = 63025; + optional bool goproto_unrecognized_all = 63026; + optional bool gogoproto_import = 63027; + optional bool protosizer_all = 63028; + optional bool compare_all = 63029; + optional bool typedecl_all = 63030; + optional bool enumdecl_all = 63031; + + optional bool goproto_registration = 63032; + optional bool messagename_all = 63033; + + optional bool goproto_sizecache_all = 63034; + optional bool goproto_unkeyed_all = 63035; +} + +extend google.protobuf.MessageOptions { + optional bool goproto_getters = 64001; + optional bool goproto_stringer = 64003; + optional bool verbose_equal = 64004; + optional bool face = 64005; + optional bool gostring = 64006; + optional bool populate = 64007; + optional bool stringer = 67008; + optional bool onlyone = 64009; + + optional bool equal = 64013; + optional bool description = 64014; + optional bool testgen = 64015; + optional bool benchgen = 64016; + optional bool marshaler = 64017; + optional bool unmarshaler = 64018; + optional bool stable_marshaler = 64019; + + optional bool sizer = 64020; + + optional bool unsafe_marshaler = 64023; + optional bool unsafe_unmarshaler = 64024; + + optional bool goproto_extensions_map = 64025; + optional bool goproto_unrecognized = 64026; + + optional bool protosizer = 64028; + optional bool compare = 64029; + + optional bool typedecl = 64030; + + optional bool messagename = 64033; + + optional bool goproto_sizecache = 64034; + optional bool goproto_unkeyed = 64035; +} + +extend google.protobuf.FieldOptions { + optional bool nullable = 65001; + optional bool embed = 65002; + optional string customtype = 65003; + optional string customname = 65004; + optional string jsontag = 65005; + optional string moretags = 65006; + optional string casttype = 65007; + optional string castkey = 65008; + optional string castvalue = 65009; + + optional bool stdtime = 65010; + optional bool stdduration = 65011; + optional bool wktpointer = 65012; + +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/helper.go b/vendor/github.com/gogo/protobuf/gogoproto/helper.go new file mode 100644 index 000000000..390d4e4be --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/helper.go @@ -0,0 +1,415 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package gogoproto + +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" +import proto "github.com/gogo/protobuf/proto" + +func IsEmbed(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Embed, false) +} + +func IsNullable(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Nullable, true) +} + +func IsStdTime(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdtime, false) +} + +func IsStdDuration(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdduration, false) +} + +func IsStdDouble(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.DoubleValue" +} + +func IsStdFloat(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.FloatValue" +} + +func IsStdInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int64Value" +} + +func IsStdUInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt64Value" +} + +func IsStdInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int32Value" +} + +func IsStdUInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt32Value" +} + +func IsStdBool(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BoolValue" +} + +func IsStdString(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.StringValue" +} + +func IsStdBytes(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BytesValue" +} + +func IsStdType(field *google_protobuf.FieldDescriptorProto) bool { + return (IsStdTime(field) || IsStdDuration(field) || + IsStdDouble(field) || IsStdFloat(field) || + IsStdInt64(field) || IsStdUInt64(field) || + IsStdInt32(field) || IsStdUInt32(field) || + IsStdBool(field) || + IsStdString(field) || IsStdBytes(field)) +} + +func IsWktPtr(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) +} + +func NeedsNilCheck(proto3 bool, field *google_protobuf.FieldDescriptorProto) bool { + nullable := IsNullable(field) + if field.IsMessage() || IsCustomType(field) { + return nullable + } + if proto3 { + return false + } + return nullable || *field.Type == google_protobuf.FieldDescriptorProto_TYPE_BYTES +} + +func IsCustomType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCustomType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastKey(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastKey(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastValue(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastValue(field) + if len(typ) > 0 { + return true + } + return false +} + +func HasEnumDecl(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_Enumdecl, proto.GetBoolExtension(file.Options, E_EnumdeclAll, true)) +} + +func HasTypeDecl(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Typedecl, proto.GetBoolExtension(file.Options, E_TypedeclAll, true)) +} + +func GetCustomType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customtype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Casttype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastKey(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castkey) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastValue(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castvalue) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func IsCustomName(field *google_protobuf.FieldDescriptorProto) bool { + name := GetCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumCustomName(field *google_protobuf.EnumDescriptorProto) bool { + name := GetEnumCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) bool { + name := GetEnumValueCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func GetCustomName(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumCustomName(field *google_protobuf.EnumDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumvalueCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetJsonTag(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Jsontag) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +func GetMoreTags(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Moretags) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +type EnableFunc func(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool + +func EnabledGoEnumPrefix(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumPrefix, proto.GetBoolExtension(file.Options, E_GoprotoEnumPrefixAll, true)) +} + +func EnabledGoStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoStringer, proto.GetBoolExtension(file.Options, E_GoprotoStringerAll, true)) +} + +func HasGoGetters(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoGetters, proto.GetBoolExtension(file.Options, E_GoprotoGettersAll, true)) +} + +func IsUnion(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Onlyone, proto.GetBoolExtension(file.Options, E_OnlyoneAll, false)) +} + +func HasGoString(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Gostring, proto.GetBoolExtension(file.Options, E_GostringAll, false)) +} + +func HasEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Equal, proto.GetBoolExtension(file.Options, E_EqualAll, false)) +} + +func HasVerboseEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_VerboseEqual, proto.GetBoolExtension(file.Options, E_VerboseEqualAll, false)) +} + +func IsStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Stringer, proto.GetBoolExtension(file.Options, E_StringerAll, false)) +} + +func IsFace(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Face, proto.GetBoolExtension(file.Options, E_FaceAll, false)) +} + +func HasDescription(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Description, proto.GetBoolExtension(file.Options, E_DescriptionAll, false)) +} + +func HasPopulate(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Populate, proto.GetBoolExtension(file.Options, E_PopulateAll, false)) +} + +func HasTestGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Testgen, proto.GetBoolExtension(file.Options, E_TestgenAll, false)) +} + +func HasBenchGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Benchgen, proto.GetBoolExtension(file.Options, E_BenchgenAll, false)) +} + +func IsMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Marshaler, proto.GetBoolExtension(file.Options, E_MarshalerAll, false)) +} + +func IsUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Unmarshaler, proto.GetBoolExtension(file.Options, E_UnmarshalerAll, false)) +} + +func IsStableMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_StableMarshaler, proto.GetBoolExtension(file.Options, E_StableMarshalerAll, false)) +} + +func IsSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Sizer, proto.GetBoolExtension(file.Options, E_SizerAll, false)) +} + +func IsProtoSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Protosizer, proto.GetBoolExtension(file.Options, E_ProtosizerAll, false)) +} + +func IsGoEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumStringer, proto.GetBoolExtension(file.Options, E_GoprotoEnumStringerAll, true)) +} + +func IsEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_EnumStringer, proto.GetBoolExtension(file.Options, E_EnumStringerAll, false)) +} + +func IsUnsafeMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeMarshaler, proto.GetBoolExtension(file.Options, E_UnsafeMarshalerAll, false)) +} + +func IsUnsafeUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeUnmarshaler, proto.GetBoolExtension(file.Options, E_UnsafeUnmarshalerAll, false)) +} + +func HasExtensionsMap(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoExtensionsMap, proto.GetBoolExtension(file.Options, E_GoprotoExtensionsMapAll, true)) +} + +func HasUnrecognized(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnrecognized, proto.GetBoolExtension(file.Options, E_GoprotoUnrecognizedAll, true)) +} + +func IsProto3(file *google_protobuf.FileDescriptorProto) bool { + return file.GetSyntax() == "proto3" +} + +func ImportsGoGoProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GogoprotoImport, true) +} + +func HasCompare(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Compare, proto.GetBoolExtension(file.Options, E_CompareAll, false)) +} + +func RegistersGolangProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GoprotoRegistration, false) +} + +func HasMessageName(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Messagename, proto.GetBoolExtension(file.Options, E_MessagenameAll, false)) +} + +func HasSizecache(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoSizecache, proto.GetBoolExtension(file.Options, E_GoprotoSizecacheAll, true)) +} + +func HasUnkeyed(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnkeyed, proto.GetBoolExtension(file.Options, E_GoprotoUnkeyedAll, true)) +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile new file mode 100644 index 000000000..3496dc99d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile @@ -0,0 +1,36 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + go install github.com/gogo/protobuf/protoc-gen-gostring + protoc --gogo_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto + protoc --gostring_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go new file mode 100644 index 000000000..a85bf1984 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go @@ -0,0 +1,118 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Package descriptor provides functions for obtaining protocol buffer +// descriptors for generated Go types. +// +// These functions cannot go in package proto because they depend on the +// generated protobuf descriptor messages, which themselves depend on proto. +package descriptor + +import ( + "bytes" + "compress/gzip" + "fmt" + "io/ioutil" + + "github.com/gogo/protobuf/proto" +) + +// extractFile extracts a FileDescriptorProto from a gzip'd buffer. +func extractFile(gz []byte) (*FileDescriptorProto, error) { + r, err := gzip.NewReader(bytes.NewReader(gz)) + if err != nil { + return nil, fmt.Errorf("failed to open gzip reader: %v", err) + } + defer r.Close() + + b, err := ioutil.ReadAll(r) + if err != nil { + return nil, fmt.Errorf("failed to uncompress descriptor: %v", err) + } + + fd := new(FileDescriptorProto) + if err := proto.Unmarshal(b, fd); err != nil { + return nil, fmt.Errorf("malformed FileDescriptorProto: %v", err) + } + + return fd, nil +} + +// Message is a proto.Message with a method to return its descriptor. +// +// Message types generated by the protocol compiler always satisfy +// the Message interface. +type Message interface { + proto.Message + Descriptor() ([]byte, []int) +} + +// ForMessage returns a FileDescriptorProto and a DescriptorProto from within it +// describing the given message. +func ForMessage(msg Message) (fd *FileDescriptorProto, md *DescriptorProto) { + gz, path := msg.Descriptor() + fd, err := extractFile(gz) + if err != nil { + panic(fmt.Sprintf("invalid FileDescriptorProto for %T: %v", msg, err)) + } + + md = fd.MessageType[path[0]] + for _, i := range path[1:] { + md = md.NestedType[i] + } + return fd, md +} + +// Is this field a scalar numeric type? +func (field *FieldDescriptorProto) IsScalar() bool { + if field.Type == nil { + return false + } + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE, + FieldDescriptorProto_TYPE_FLOAT, + FieldDescriptorProto_TYPE_INT64, + FieldDescriptorProto_TYPE_UINT64, + FieldDescriptorProto_TYPE_INT32, + FieldDescriptorProto_TYPE_FIXED64, + FieldDescriptorProto_TYPE_FIXED32, + FieldDescriptorProto_TYPE_BOOL, + FieldDescriptorProto_TYPE_UINT32, + FieldDescriptorProto_TYPE_ENUM, + FieldDescriptorProto_TYPE_SFIXED32, + FieldDescriptorProto_TYPE_SFIXED64, + FieldDescriptorProto_TYPE_SINT32, + FieldDescriptorProto_TYPE_SINT64: + return true + default: + return false + } +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go new file mode 100644 index 000000000..cacfa3923 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go @@ -0,0 +1,2865 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type FieldDescriptorProto_Type int32 + +const ( + // 0 is reserved for errors. + // Order is weird for historical reasons. + FieldDescriptorProto_TYPE_DOUBLE FieldDescriptorProto_Type = 1 + FieldDescriptorProto_TYPE_FLOAT FieldDescriptorProto_Type = 2 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT64 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT64 FieldDescriptorProto_Type = 3 + FieldDescriptorProto_TYPE_UINT64 FieldDescriptorProto_Type = 4 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT32 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT32 FieldDescriptorProto_Type = 5 + FieldDescriptorProto_TYPE_FIXED64 FieldDescriptorProto_Type = 6 + FieldDescriptorProto_TYPE_FIXED32 FieldDescriptorProto_Type = 7 + FieldDescriptorProto_TYPE_BOOL FieldDescriptorProto_Type = 8 + FieldDescriptorProto_TYPE_STRING FieldDescriptorProto_Type = 9 + // Tag-delimited aggregate. + // Group type is deprecated and not supported in proto3. However, Proto3 + // implementations should still be able to parse the group wire format and + // treat group fields as unknown fields. + FieldDescriptorProto_TYPE_GROUP FieldDescriptorProto_Type = 10 + FieldDescriptorProto_TYPE_MESSAGE FieldDescriptorProto_Type = 11 + // New in version 2. + FieldDescriptorProto_TYPE_BYTES FieldDescriptorProto_Type = 12 + FieldDescriptorProto_TYPE_UINT32 FieldDescriptorProto_Type = 13 + FieldDescriptorProto_TYPE_ENUM FieldDescriptorProto_Type = 14 + FieldDescriptorProto_TYPE_SFIXED32 FieldDescriptorProto_Type = 15 + FieldDescriptorProto_TYPE_SFIXED64 FieldDescriptorProto_Type = 16 + FieldDescriptorProto_TYPE_SINT32 FieldDescriptorProto_Type = 17 + FieldDescriptorProto_TYPE_SINT64 FieldDescriptorProto_Type = 18 +) + +var FieldDescriptorProto_Type_name = map[int32]string{ + 1: "TYPE_DOUBLE", + 2: "TYPE_FLOAT", + 3: "TYPE_INT64", + 4: "TYPE_UINT64", + 5: "TYPE_INT32", + 6: "TYPE_FIXED64", + 7: "TYPE_FIXED32", + 8: "TYPE_BOOL", + 9: "TYPE_STRING", + 10: "TYPE_GROUP", + 11: "TYPE_MESSAGE", + 12: "TYPE_BYTES", + 13: "TYPE_UINT32", + 14: "TYPE_ENUM", + 15: "TYPE_SFIXED32", + 16: "TYPE_SFIXED64", + 17: "TYPE_SINT32", + 18: "TYPE_SINT64", +} + +var FieldDescriptorProto_Type_value = map[string]int32{ + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18, +} + +func (x FieldDescriptorProto_Type) Enum() *FieldDescriptorProto_Type { + p := new(FieldDescriptorProto_Type) + *p = x + return p +} + +func (x FieldDescriptorProto_Type) String() string { + return proto.EnumName(FieldDescriptorProto_Type_name, int32(x)) +} + +func (x *FieldDescriptorProto_Type) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Type_value, data, "FieldDescriptorProto_Type") + if err != nil { + return err + } + *x = FieldDescriptorProto_Type(value) + return nil +} + +func (FieldDescriptorProto_Type) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 0} +} + +type FieldDescriptorProto_Label int32 + +const ( + // 0 is reserved for errors + FieldDescriptorProto_LABEL_OPTIONAL FieldDescriptorProto_Label = 1 + FieldDescriptorProto_LABEL_REQUIRED FieldDescriptorProto_Label = 2 + FieldDescriptorProto_LABEL_REPEATED FieldDescriptorProto_Label = 3 +) + +var FieldDescriptorProto_Label_name = map[int32]string{ + 1: "LABEL_OPTIONAL", + 2: "LABEL_REQUIRED", + 3: "LABEL_REPEATED", +} + +var FieldDescriptorProto_Label_value = map[string]int32{ + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3, +} + +func (x FieldDescriptorProto_Label) Enum() *FieldDescriptorProto_Label { + p := new(FieldDescriptorProto_Label) + *p = x + return p +} + +func (x FieldDescriptorProto_Label) String() string { + return proto.EnumName(FieldDescriptorProto_Label_name, int32(x)) +} + +func (x *FieldDescriptorProto_Label) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Label_value, data, "FieldDescriptorProto_Label") + if err != nil { + return err + } + *x = FieldDescriptorProto_Label(value) + return nil +} + +func (FieldDescriptorProto_Label) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 1} +} + +// Generated classes can be optimized for speed or code size. +type FileOptions_OptimizeMode int32 + +const ( + FileOptions_SPEED FileOptions_OptimizeMode = 1 + // etc. + FileOptions_CODE_SIZE FileOptions_OptimizeMode = 2 + FileOptions_LITE_RUNTIME FileOptions_OptimizeMode = 3 +) + +var FileOptions_OptimizeMode_name = map[int32]string{ + 1: "SPEED", + 2: "CODE_SIZE", + 3: "LITE_RUNTIME", +} + +var FileOptions_OptimizeMode_value = map[string]int32{ + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3, +} + +func (x FileOptions_OptimizeMode) Enum() *FileOptions_OptimizeMode { + p := new(FileOptions_OptimizeMode) + *p = x + return p +} + +func (x FileOptions_OptimizeMode) String() string { + return proto.EnumName(FileOptions_OptimizeMode_name, int32(x)) +} + +func (x *FileOptions_OptimizeMode) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FileOptions_OptimizeMode_value, data, "FileOptions_OptimizeMode") + if err != nil { + return err + } + *x = FileOptions_OptimizeMode(value) + return nil +} + +func (FileOptions_OptimizeMode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10, 0} +} + +type FieldOptions_CType int32 + +const ( + // Default mode. + FieldOptions_STRING FieldOptions_CType = 0 + FieldOptions_CORD FieldOptions_CType = 1 + FieldOptions_STRING_PIECE FieldOptions_CType = 2 +) + +var FieldOptions_CType_name = map[int32]string{ + 0: "STRING", + 1: "CORD", + 2: "STRING_PIECE", +} + +var FieldOptions_CType_value = map[string]int32{ + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2, +} + +func (x FieldOptions_CType) Enum() *FieldOptions_CType { + p := new(FieldOptions_CType) + *p = x + return p +} + +func (x FieldOptions_CType) String() string { + return proto.EnumName(FieldOptions_CType_name, int32(x)) +} + +func (x *FieldOptions_CType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_CType_value, data, "FieldOptions_CType") + if err != nil { + return err + } + *x = FieldOptions_CType(value) + return nil +} + +func (FieldOptions_CType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 0} +} + +type FieldOptions_JSType int32 + +const ( + // Use the default type. + FieldOptions_JS_NORMAL FieldOptions_JSType = 0 + // Use JavaScript strings. + FieldOptions_JS_STRING FieldOptions_JSType = 1 + // Use JavaScript numbers. + FieldOptions_JS_NUMBER FieldOptions_JSType = 2 +) + +var FieldOptions_JSType_name = map[int32]string{ + 0: "JS_NORMAL", + 1: "JS_STRING", + 2: "JS_NUMBER", +} + +var FieldOptions_JSType_value = map[string]int32{ + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2, +} + +func (x FieldOptions_JSType) Enum() *FieldOptions_JSType { + p := new(FieldOptions_JSType) + *p = x + return p +} + +func (x FieldOptions_JSType) String() string { + return proto.EnumName(FieldOptions_JSType_name, int32(x)) +} + +func (x *FieldOptions_JSType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_JSType_value, data, "FieldOptions_JSType") + if err != nil { + return err + } + *x = FieldOptions_JSType(value) + return nil +} + +func (FieldOptions_JSType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 1} +} + +// Is this method side-effect-free (or safe in HTTP parlance), or idempotent, +// or neither? HTTP based RPC implementation may choose GET verb for safe +// methods, and PUT verb for idempotent methods instead of the default POST. +type MethodOptions_IdempotencyLevel int32 + +const ( + MethodOptions_IDEMPOTENCY_UNKNOWN MethodOptions_IdempotencyLevel = 0 + MethodOptions_NO_SIDE_EFFECTS MethodOptions_IdempotencyLevel = 1 + MethodOptions_IDEMPOTENT MethodOptions_IdempotencyLevel = 2 +) + +var MethodOptions_IdempotencyLevel_name = map[int32]string{ + 0: "IDEMPOTENCY_UNKNOWN", + 1: "NO_SIDE_EFFECTS", + 2: "IDEMPOTENT", +} + +var MethodOptions_IdempotencyLevel_value = map[string]int32{ + "IDEMPOTENCY_UNKNOWN": 0, + "NO_SIDE_EFFECTS": 1, + "IDEMPOTENT": 2, +} + +func (x MethodOptions_IdempotencyLevel) Enum() *MethodOptions_IdempotencyLevel { + p := new(MethodOptions_IdempotencyLevel) + *p = x + return p +} + +func (x MethodOptions_IdempotencyLevel) String() string { + return proto.EnumName(MethodOptions_IdempotencyLevel_name, int32(x)) +} + +func (x *MethodOptions_IdempotencyLevel) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(MethodOptions_IdempotencyLevel_value, data, "MethodOptions_IdempotencyLevel") + if err != nil { + return err + } + *x = MethodOptions_IdempotencyLevel(value) + return nil +} + +func (MethodOptions_IdempotencyLevel) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17, 0} +} + +// The protocol compiler can output a FileDescriptorSet containing the .proto +// files it parses. +type FileDescriptorSet struct { + File []*FileDescriptorProto `protobuf:"bytes,1,rep,name=file" json:"file,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorSet) Reset() { *m = FileDescriptorSet{} } +func (m *FileDescriptorSet) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorSet) ProtoMessage() {} +func (*FileDescriptorSet) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{0} +} +func (m *FileDescriptorSet) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorSet.Unmarshal(m, b) +} +func (m *FileDescriptorSet) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorSet.Marshal(b, m, deterministic) +} +func (m *FileDescriptorSet) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorSet.Merge(m, src) +} +func (m *FileDescriptorSet) XXX_Size() int { + return xxx_messageInfo_FileDescriptorSet.Size(m) +} +func (m *FileDescriptorSet) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorSet.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorSet proto.InternalMessageInfo + +func (m *FileDescriptorSet) GetFile() []*FileDescriptorProto { + if m != nil { + return m.File + } + return nil +} + +// Describes a complete .proto file. +type FileDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Package *string `protobuf:"bytes,2,opt,name=package" json:"package,omitempty"` + // Names of files imported by this file. + Dependency []string `protobuf:"bytes,3,rep,name=dependency" json:"dependency,omitempty"` + // Indexes of the public imported files in the dependency list above. + PublicDependency []int32 `protobuf:"varint,10,rep,name=public_dependency,json=publicDependency" json:"public_dependency,omitempty"` + // Indexes of the weak imported files in the dependency list. + // For Google-internal migration only. Do not use. + WeakDependency []int32 `protobuf:"varint,11,rep,name=weak_dependency,json=weakDependency" json:"weak_dependency,omitempty"` + // All top-level definitions in this file. + MessageType []*DescriptorProto `protobuf:"bytes,4,rep,name=message_type,json=messageType" json:"message_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,5,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + Service []*ServiceDescriptorProto `protobuf:"bytes,6,rep,name=service" json:"service,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,7,rep,name=extension" json:"extension,omitempty"` + Options *FileOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + // This field contains optional information about the original source code. + // You may safely remove this entire field without harming runtime + // functionality of the descriptors -- the information is needed only by + // development tools. + SourceCodeInfo *SourceCodeInfo `protobuf:"bytes,9,opt,name=source_code_info,json=sourceCodeInfo" json:"source_code_info,omitempty"` + // The syntax of the proto file. + // The supported values are "proto2" and "proto3". + Syntax *string `protobuf:"bytes,12,opt,name=syntax" json:"syntax,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorProto) Reset() { *m = FileDescriptorProto{} } +func (m *FileDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorProto) ProtoMessage() {} +func (*FileDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{1} +} +func (m *FileDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorProto.Unmarshal(m, b) +} +func (m *FileDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FileDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorProto.Merge(m, src) +} +func (m *FileDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FileDescriptorProto.Size(m) +} +func (m *FileDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorProto proto.InternalMessageInfo + +func (m *FileDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FileDescriptorProto) GetPackage() string { + if m != nil && m.Package != nil { + return *m.Package + } + return "" +} + +func (m *FileDescriptorProto) GetDependency() []string { + if m != nil { + return m.Dependency + } + return nil +} + +func (m *FileDescriptorProto) GetPublicDependency() []int32 { + if m != nil { + return m.PublicDependency + } + return nil +} + +func (m *FileDescriptorProto) GetWeakDependency() []int32 { + if m != nil { + return m.WeakDependency + } + return nil +} + +func (m *FileDescriptorProto) GetMessageType() []*DescriptorProto { + if m != nil { + return m.MessageType + } + return nil +} + +func (m *FileDescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *FileDescriptorProto) GetService() []*ServiceDescriptorProto { + if m != nil { + return m.Service + } + return nil +} + +func (m *FileDescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *FileDescriptorProto) GetOptions() *FileOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *FileDescriptorProto) GetSourceCodeInfo() *SourceCodeInfo { + if m != nil { + return m.SourceCodeInfo + } + return nil +} + +func (m *FileDescriptorProto) GetSyntax() string { + if m != nil && m.Syntax != nil { + return *m.Syntax + } + return "" +} + +// Describes a message type. +type DescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Field []*FieldDescriptorProto `protobuf:"bytes,2,rep,name=field" json:"field,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,6,rep,name=extension" json:"extension,omitempty"` + NestedType []*DescriptorProto `protobuf:"bytes,3,rep,name=nested_type,json=nestedType" json:"nested_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,4,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + ExtensionRange []*DescriptorProto_ExtensionRange `protobuf:"bytes,5,rep,name=extension_range,json=extensionRange" json:"extension_range,omitempty"` + OneofDecl []*OneofDescriptorProto `protobuf:"bytes,8,rep,name=oneof_decl,json=oneofDecl" json:"oneof_decl,omitempty"` + Options *MessageOptions `protobuf:"bytes,7,opt,name=options" json:"options,omitempty"` + ReservedRange []*DescriptorProto_ReservedRange `protobuf:"bytes,9,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved field names, which may not be used by fields in the same message. + // A given name may only be reserved once. + ReservedName []string `protobuf:"bytes,10,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto) Reset() { *m = DescriptorProto{} } +func (m *DescriptorProto) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto) ProtoMessage() {} +func (*DescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2} +} +func (m *DescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto.Unmarshal(m, b) +} +func (m *DescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto.Marshal(b, m, deterministic) +} +func (m *DescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto.Merge(m, src) +} +func (m *DescriptorProto) XXX_Size() int { + return xxx_messageInfo_DescriptorProto.Size(m) +} +func (m *DescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto proto.InternalMessageInfo + +func (m *DescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *DescriptorProto) GetField() []*FieldDescriptorProto { + if m != nil { + return m.Field + } + return nil +} + +func (m *DescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *DescriptorProto) GetNestedType() []*DescriptorProto { + if m != nil { + return m.NestedType + } + return nil +} + +func (m *DescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *DescriptorProto) GetExtensionRange() []*DescriptorProto_ExtensionRange { + if m != nil { + return m.ExtensionRange + } + return nil +} + +func (m *DescriptorProto) GetOneofDecl() []*OneofDescriptorProto { + if m != nil { + return m.OneofDecl + } + return nil +} + +func (m *DescriptorProto) GetOptions() *MessageOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *DescriptorProto) GetReservedRange() []*DescriptorProto_ReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *DescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +type DescriptorProto_ExtensionRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + Options *ExtensionRangeOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ExtensionRange) Reset() { *m = DescriptorProto_ExtensionRange{} } +func (m *DescriptorProto_ExtensionRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ExtensionRange) ProtoMessage() {} +func (*DescriptorProto_ExtensionRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 0} +} +func (m *DescriptorProto_ExtensionRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ExtensionRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ExtensionRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ExtensionRange.Merge(m, src) +} +func (m *DescriptorProto_ExtensionRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Size(m) +} +func (m *DescriptorProto_ExtensionRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ExtensionRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ExtensionRange proto.InternalMessageInfo + +func (m *DescriptorProto_ExtensionRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetOptions() *ExtensionRangeOptions { + if m != nil { + return m.Options + } + return nil +} + +// Range of reserved tag numbers. Reserved tag numbers may not be used by +// fields or extension ranges in the same message. Reserved ranges may +// not overlap. +type DescriptorProto_ReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ReservedRange) Reset() { *m = DescriptorProto_ReservedRange{} } +func (m *DescriptorProto_ReservedRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ReservedRange) ProtoMessage() {} +func (*DescriptorProto_ReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 1} +} +func (m *DescriptorProto_ReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ReservedRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ReservedRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ReservedRange.Merge(m, src) +} +func (m *DescriptorProto_ReservedRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ReservedRange.Size(m) +} +func (m *DescriptorProto_ReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ReservedRange proto.InternalMessageInfo + +func (m *DescriptorProto_ReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +type ExtensionRangeOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ExtensionRangeOptions) Reset() { *m = ExtensionRangeOptions{} } +func (m *ExtensionRangeOptions) String() string { return proto.CompactTextString(m) } +func (*ExtensionRangeOptions) ProtoMessage() {} +func (*ExtensionRangeOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{3} +} + +var extRange_ExtensionRangeOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ExtensionRangeOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ExtensionRangeOptions +} + +func (m *ExtensionRangeOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ExtensionRangeOptions.Unmarshal(m, b) +} +func (m *ExtensionRangeOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ExtensionRangeOptions.Marshal(b, m, deterministic) +} +func (m *ExtensionRangeOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ExtensionRangeOptions.Merge(m, src) +} +func (m *ExtensionRangeOptions) XXX_Size() int { + return xxx_messageInfo_ExtensionRangeOptions.Size(m) +} +func (m *ExtensionRangeOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ExtensionRangeOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ExtensionRangeOptions proto.InternalMessageInfo + +func (m *ExtensionRangeOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// Describes a field within a message. +type FieldDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,3,opt,name=number" json:"number,omitempty"` + Label *FieldDescriptorProto_Label `protobuf:"varint,4,opt,name=label,enum=google.protobuf.FieldDescriptorProto_Label" json:"label,omitempty"` + // If type_name is set, this need not be set. If both this and type_name + // are set, this must be one of TYPE_ENUM, TYPE_MESSAGE or TYPE_GROUP. + Type *FieldDescriptorProto_Type `protobuf:"varint,5,opt,name=type,enum=google.protobuf.FieldDescriptorProto_Type" json:"type,omitempty"` + // For message and enum types, this is the name of the type. If the name + // starts with a '.', it is fully-qualified. Otherwise, C++-like scoping + // rules are used to find the type (i.e. first the nested types within this + // message are searched, then within the parent, on up to the root + // namespace). + TypeName *string `protobuf:"bytes,6,opt,name=type_name,json=typeName" json:"type_name,omitempty"` + // For extensions, this is the name of the type being extended. It is + // resolved in the same manner as type_name. + Extendee *string `protobuf:"bytes,2,opt,name=extendee" json:"extendee,omitempty"` + // For numeric types, contains the original text representation of the value. + // For booleans, "true" or "false". + // For strings, contains the default text contents (not escaped in any way). + // For bytes, contains the C escaped value. All bytes >= 128 are escaped. + // TODO(kenton): Base-64 encode? + DefaultValue *string `protobuf:"bytes,7,opt,name=default_value,json=defaultValue" json:"default_value,omitempty"` + // If set, gives the index of a oneof in the containing type's oneof_decl + // list. This field is a member of that oneof. + OneofIndex *int32 `protobuf:"varint,9,opt,name=oneof_index,json=oneofIndex" json:"oneof_index,omitempty"` + // JSON name of this field. The value is set by protocol compiler. If the + // user has set a "json_name" option on this field, that option's value + // will be used. Otherwise, it's deduced from the field's name by converting + // it to camelCase. + JsonName *string `protobuf:"bytes,10,opt,name=json_name,json=jsonName" json:"json_name,omitempty"` + Options *FieldOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldDescriptorProto) Reset() { *m = FieldDescriptorProto{} } +func (m *FieldDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FieldDescriptorProto) ProtoMessage() {} +func (*FieldDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4} +} +func (m *FieldDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldDescriptorProto.Unmarshal(m, b) +} +func (m *FieldDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FieldDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldDescriptorProto.Merge(m, src) +} +func (m *FieldDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FieldDescriptorProto.Size(m) +} +func (m *FieldDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FieldDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldDescriptorProto proto.InternalMessageInfo + +func (m *FieldDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FieldDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *FieldDescriptorProto) GetLabel() FieldDescriptorProto_Label { + if m != nil && m.Label != nil { + return *m.Label + } + return FieldDescriptorProto_LABEL_OPTIONAL +} + +func (m *FieldDescriptorProto) GetType() FieldDescriptorProto_Type { + if m != nil && m.Type != nil { + return *m.Type + } + return FieldDescriptorProto_TYPE_DOUBLE +} + +func (m *FieldDescriptorProto) GetTypeName() string { + if m != nil && m.TypeName != nil { + return *m.TypeName + } + return "" +} + +func (m *FieldDescriptorProto) GetExtendee() string { + if m != nil && m.Extendee != nil { + return *m.Extendee + } + return "" +} + +func (m *FieldDescriptorProto) GetDefaultValue() string { + if m != nil && m.DefaultValue != nil { + return *m.DefaultValue + } + return "" +} + +func (m *FieldDescriptorProto) GetOneofIndex() int32 { + if m != nil && m.OneofIndex != nil { + return *m.OneofIndex + } + return 0 +} + +func (m *FieldDescriptorProto) GetJsonName() string { + if m != nil && m.JsonName != nil { + return *m.JsonName + } + return "" +} + +func (m *FieldDescriptorProto) GetOptions() *FieldOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a oneof. +type OneofDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Options *OneofOptions `protobuf:"bytes,2,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofDescriptorProto) Reset() { *m = OneofDescriptorProto{} } +func (m *OneofDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*OneofDescriptorProto) ProtoMessage() {} +func (*OneofDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{5} +} +func (m *OneofDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofDescriptorProto.Unmarshal(m, b) +} +func (m *OneofDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofDescriptorProto.Marshal(b, m, deterministic) +} +func (m *OneofDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofDescriptorProto.Merge(m, src) +} +func (m *OneofDescriptorProto) XXX_Size() int { + return xxx_messageInfo_OneofDescriptorProto.Size(m) +} +func (m *OneofDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_OneofDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofDescriptorProto proto.InternalMessageInfo + +func (m *OneofDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *OneofDescriptorProto) GetOptions() *OneofOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes an enum type. +type EnumDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Value []*EnumValueDescriptorProto `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` + Options *EnumOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + // Range of reserved numeric values. Reserved numeric values may not be used + // by enum values in the same enum declaration. Reserved ranges may not + // overlap. + ReservedRange []*EnumDescriptorProto_EnumReservedRange `protobuf:"bytes,4,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved enum value names, which may not be reused. A given name may only + // be reserved once. + ReservedName []string `protobuf:"bytes,5,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto) Reset() { *m = EnumDescriptorProto{} } +func (m *EnumDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto) ProtoMessage() {} +func (*EnumDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6} +} +func (m *EnumDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto.Unmarshal(m, b) +} +func (m *EnumDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto.Merge(m, src) +} +func (m *EnumDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto.Size(m) +} +func (m *EnumDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto proto.InternalMessageInfo + +func (m *EnumDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumDescriptorProto) GetValue() []*EnumValueDescriptorProto { + if m != nil { + return m.Value + } + return nil +} + +func (m *EnumDescriptorProto) GetOptions() *EnumOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedRange() []*EnumDescriptorProto_EnumReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +// Range of reserved numeric values. Reserved values may not be used by +// entries in the same enum. Reserved ranges may not overlap. +// +// Note that this is distinct from DescriptorProto.ReservedRange in that it +// is inclusive such that it can appropriately represent the entire int32 +// domain. +type EnumDescriptorProto_EnumReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto_EnumReservedRange) Reset() { *m = EnumDescriptorProto_EnumReservedRange{} } +func (m *EnumDescriptorProto_EnumReservedRange) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto_EnumReservedRange) ProtoMessage() {} +func (*EnumDescriptorProto_EnumReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6, 0} +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Unmarshal(m, b) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Merge(m, src) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Size(m) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto_EnumReservedRange proto.InternalMessageInfo + +func (m *EnumDescriptorProto_EnumReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *EnumDescriptorProto_EnumReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +// Describes a value within an enum. +type EnumValueDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,2,opt,name=number" json:"number,omitempty"` + Options *EnumValueOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueDescriptorProto) Reset() { *m = EnumValueDescriptorProto{} } +func (m *EnumValueDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumValueDescriptorProto) ProtoMessage() {} +func (*EnumValueDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{7} +} +func (m *EnumValueDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueDescriptorProto.Unmarshal(m, b) +} +func (m *EnumValueDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumValueDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueDescriptorProto.Merge(m, src) +} +func (m *EnumValueDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumValueDescriptorProto.Size(m) +} +func (m *EnumValueDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueDescriptorProto proto.InternalMessageInfo + +func (m *EnumValueDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumValueDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *EnumValueDescriptorProto) GetOptions() *EnumValueOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a service. +type ServiceDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Method []*MethodDescriptorProto `protobuf:"bytes,2,rep,name=method" json:"method,omitempty"` + Options *ServiceOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceDescriptorProto) Reset() { *m = ServiceDescriptorProto{} } +func (m *ServiceDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*ServiceDescriptorProto) ProtoMessage() {} +func (*ServiceDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{8} +} +func (m *ServiceDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceDescriptorProto.Unmarshal(m, b) +} +func (m *ServiceDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceDescriptorProto.Marshal(b, m, deterministic) +} +func (m *ServiceDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceDescriptorProto.Merge(m, src) +} +func (m *ServiceDescriptorProto) XXX_Size() int { + return xxx_messageInfo_ServiceDescriptorProto.Size(m) +} +func (m *ServiceDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceDescriptorProto proto.InternalMessageInfo + +func (m *ServiceDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *ServiceDescriptorProto) GetMethod() []*MethodDescriptorProto { + if m != nil { + return m.Method + } + return nil +} + +func (m *ServiceDescriptorProto) GetOptions() *ServiceOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a method of a service. +type MethodDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + // Input and output type names. These are resolved in the same way as + // FieldDescriptorProto.type_name, but must refer to a message type. + InputType *string `protobuf:"bytes,2,opt,name=input_type,json=inputType" json:"input_type,omitempty"` + OutputType *string `protobuf:"bytes,3,opt,name=output_type,json=outputType" json:"output_type,omitempty"` + Options *MethodOptions `protobuf:"bytes,4,opt,name=options" json:"options,omitempty"` + // Identifies if client streams multiple client messages + ClientStreaming *bool `protobuf:"varint,5,opt,name=client_streaming,json=clientStreaming,def=0" json:"client_streaming,omitempty"` + // Identifies if server streams multiple server messages + ServerStreaming *bool `protobuf:"varint,6,opt,name=server_streaming,json=serverStreaming,def=0" json:"server_streaming,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodDescriptorProto) Reset() { *m = MethodDescriptorProto{} } +func (m *MethodDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*MethodDescriptorProto) ProtoMessage() {} +func (*MethodDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{9} +} +func (m *MethodDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodDescriptorProto.Unmarshal(m, b) +} +func (m *MethodDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodDescriptorProto.Marshal(b, m, deterministic) +} +func (m *MethodDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodDescriptorProto.Merge(m, src) +} +func (m *MethodDescriptorProto) XXX_Size() int { + return xxx_messageInfo_MethodDescriptorProto.Size(m) +} +func (m *MethodDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_MethodDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodDescriptorProto proto.InternalMessageInfo + +const Default_MethodDescriptorProto_ClientStreaming bool = false +const Default_MethodDescriptorProto_ServerStreaming bool = false + +func (m *MethodDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *MethodDescriptorProto) GetInputType() string { + if m != nil && m.InputType != nil { + return *m.InputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOutputType() string { + if m != nil && m.OutputType != nil { + return *m.OutputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOptions() *MethodOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *MethodDescriptorProto) GetClientStreaming() bool { + if m != nil && m.ClientStreaming != nil { + return *m.ClientStreaming + } + return Default_MethodDescriptorProto_ClientStreaming +} + +func (m *MethodDescriptorProto) GetServerStreaming() bool { + if m != nil && m.ServerStreaming != nil { + return *m.ServerStreaming + } + return Default_MethodDescriptorProto_ServerStreaming +} + +type FileOptions struct { + // Sets the Java package where classes generated from this .proto will be + // placed. By default, the proto package is used, but this is often + // inappropriate because proto packages do not normally start with backwards + // domain names. + JavaPackage *string `protobuf:"bytes,1,opt,name=java_package,json=javaPackage" json:"java_package,omitempty"` + // If set, all the classes from the .proto file are wrapped in a single + // outer class with the given name. This applies to both Proto1 + // (equivalent to the old "--one_java_file" option) and Proto2 (where + // a .proto always translates to a single class, but you may want to + // explicitly choose the class name). + JavaOuterClassname *string `protobuf:"bytes,8,opt,name=java_outer_classname,json=javaOuterClassname" json:"java_outer_classname,omitempty"` + // If set true, then the Java code generator will generate a separate .java + // file for each top-level message, enum, and service defined in the .proto + // file. Thus, these types will *not* be nested inside the outer class + // named by java_outer_classname. However, the outer class will still be + // generated to contain the file's getDescriptor() method as well as any + // top-level extensions defined in the file. + JavaMultipleFiles *bool `protobuf:"varint,10,opt,name=java_multiple_files,json=javaMultipleFiles,def=0" json:"java_multiple_files,omitempty"` + // This option does nothing. + JavaGenerateEqualsAndHash *bool `protobuf:"varint,20,opt,name=java_generate_equals_and_hash,json=javaGenerateEqualsAndHash" json:"java_generate_equals_and_hash,omitempty"` // Deprecated: Do not use. + // If set true, then the Java2 code generator will generate code that + // throws an exception whenever an attempt is made to assign a non-UTF-8 + // byte sequence to a string field. + // Message reflection will do the same. + // However, an extension field still accepts non-UTF-8 byte sequences. + // This option has no effect on when used with the lite runtime. + JavaStringCheckUtf8 *bool `protobuf:"varint,27,opt,name=java_string_check_utf8,json=javaStringCheckUtf8,def=0" json:"java_string_check_utf8,omitempty"` + OptimizeFor *FileOptions_OptimizeMode `protobuf:"varint,9,opt,name=optimize_for,json=optimizeFor,enum=google.protobuf.FileOptions_OptimizeMode,def=1" json:"optimize_for,omitempty"` + // Sets the Go package where structs generated from this .proto will be + // placed. If omitted, the Go package will be derived from the following: + // - The basename of the package import path, if provided. + // - Otherwise, the package statement in the .proto file, if present. + // - Otherwise, the basename of the .proto file, without extension. + GoPackage *string `protobuf:"bytes,11,opt,name=go_package,json=goPackage" json:"go_package,omitempty"` + // Should generic services be generated in each language? "Generic" services + // are not specific to any particular RPC system. They are generated by the + // main code generators in each language (without additional plugins). + // Generic services were the only kind of service generation supported by + // early versions of google.protobuf. + // + // Generic services are now considered deprecated in favor of using plugins + // that generate code specific to your particular RPC system. Therefore, + // these default to false. Old code which depends on generic services should + // explicitly set them to true. + CcGenericServices *bool `protobuf:"varint,16,opt,name=cc_generic_services,json=ccGenericServices,def=0" json:"cc_generic_services,omitempty"` + JavaGenericServices *bool `protobuf:"varint,17,opt,name=java_generic_services,json=javaGenericServices,def=0" json:"java_generic_services,omitempty"` + PyGenericServices *bool `protobuf:"varint,18,opt,name=py_generic_services,json=pyGenericServices,def=0" json:"py_generic_services,omitempty"` + PhpGenericServices *bool `protobuf:"varint,42,opt,name=php_generic_services,json=phpGenericServices,def=0" json:"php_generic_services,omitempty"` + // Is this file deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for everything in the file, or it will be completely ignored; in the very + // least, this is a formalization for deprecating files. + Deprecated *bool `protobuf:"varint,23,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Enables the use of arenas for the proto messages in this file. This applies + // only to generated classes for C++. + CcEnableArenas *bool `protobuf:"varint,31,opt,name=cc_enable_arenas,json=ccEnableArenas,def=0" json:"cc_enable_arenas,omitempty"` + // Sets the objective c class prefix which is prepended to all objective c + // generated classes from this .proto. There is no default. + ObjcClassPrefix *string `protobuf:"bytes,36,opt,name=objc_class_prefix,json=objcClassPrefix" json:"objc_class_prefix,omitempty"` + // Namespace for generated classes; defaults to the package. + CsharpNamespace *string `protobuf:"bytes,37,opt,name=csharp_namespace,json=csharpNamespace" json:"csharp_namespace,omitempty"` + // By default Swift generators will take the proto package and CamelCase it + // replacing '.' with underscore and use that to prefix the types/symbols + // defined. When this options is provided, they will use this value instead + // to prefix the types/symbols defined. + SwiftPrefix *string `protobuf:"bytes,39,opt,name=swift_prefix,json=swiftPrefix" json:"swift_prefix,omitempty"` + // Sets the php class prefix which is prepended to all php generated classes + // from this .proto. Default is empty. + PhpClassPrefix *string `protobuf:"bytes,40,opt,name=php_class_prefix,json=phpClassPrefix" json:"php_class_prefix,omitempty"` + // Use this option to change the namespace of php generated classes. Default + // is empty. When this option is empty, the package name will be used for + // determining the namespace. + PhpNamespace *string `protobuf:"bytes,41,opt,name=php_namespace,json=phpNamespace" json:"php_namespace,omitempty"` + // Use this option to change the namespace of php generated metadata classes. + // Default is empty. When this option is empty, the proto file name will be used + // for determining the namespace. + PhpMetadataNamespace *string `protobuf:"bytes,44,opt,name=php_metadata_namespace,json=phpMetadataNamespace" json:"php_metadata_namespace,omitempty"` + // Use this option to change the package of ruby generated classes. Default + // is empty. When this option is not set, the package name will be used for + // determining the ruby package. + RubyPackage *string `protobuf:"bytes,45,opt,name=ruby_package,json=rubyPackage" json:"ruby_package,omitempty"` + // The parser stores options it doesn't recognize here. + // See the documentation for the "Options" section above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileOptions) Reset() { *m = FileOptions{} } +func (m *FileOptions) String() string { return proto.CompactTextString(m) } +func (*FileOptions) ProtoMessage() {} +func (*FileOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10} +} + +var extRange_FileOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FileOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FileOptions +} + +func (m *FileOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileOptions.Unmarshal(m, b) +} +func (m *FileOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileOptions.Marshal(b, m, deterministic) +} +func (m *FileOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileOptions.Merge(m, src) +} +func (m *FileOptions) XXX_Size() int { + return xxx_messageInfo_FileOptions.Size(m) +} +func (m *FileOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FileOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FileOptions proto.InternalMessageInfo + +const Default_FileOptions_JavaMultipleFiles bool = false +const Default_FileOptions_JavaStringCheckUtf8 bool = false +const Default_FileOptions_OptimizeFor FileOptions_OptimizeMode = FileOptions_SPEED +const Default_FileOptions_CcGenericServices bool = false +const Default_FileOptions_JavaGenericServices bool = false +const Default_FileOptions_PyGenericServices bool = false +const Default_FileOptions_PhpGenericServices bool = false +const Default_FileOptions_Deprecated bool = false +const Default_FileOptions_CcEnableArenas bool = false + +func (m *FileOptions) GetJavaPackage() string { + if m != nil && m.JavaPackage != nil { + return *m.JavaPackage + } + return "" +} + +func (m *FileOptions) GetJavaOuterClassname() string { + if m != nil && m.JavaOuterClassname != nil { + return *m.JavaOuterClassname + } + return "" +} + +func (m *FileOptions) GetJavaMultipleFiles() bool { + if m != nil && m.JavaMultipleFiles != nil { + return *m.JavaMultipleFiles + } + return Default_FileOptions_JavaMultipleFiles +} + +// Deprecated: Do not use. +func (m *FileOptions) GetJavaGenerateEqualsAndHash() bool { + if m != nil && m.JavaGenerateEqualsAndHash != nil { + return *m.JavaGenerateEqualsAndHash + } + return false +} + +func (m *FileOptions) GetJavaStringCheckUtf8() bool { + if m != nil && m.JavaStringCheckUtf8 != nil { + return *m.JavaStringCheckUtf8 + } + return Default_FileOptions_JavaStringCheckUtf8 +} + +func (m *FileOptions) GetOptimizeFor() FileOptions_OptimizeMode { + if m != nil && m.OptimizeFor != nil { + return *m.OptimizeFor + } + return Default_FileOptions_OptimizeFor +} + +func (m *FileOptions) GetGoPackage() string { + if m != nil && m.GoPackage != nil { + return *m.GoPackage + } + return "" +} + +func (m *FileOptions) GetCcGenericServices() bool { + if m != nil && m.CcGenericServices != nil { + return *m.CcGenericServices + } + return Default_FileOptions_CcGenericServices +} + +func (m *FileOptions) GetJavaGenericServices() bool { + if m != nil && m.JavaGenericServices != nil { + return *m.JavaGenericServices + } + return Default_FileOptions_JavaGenericServices +} + +func (m *FileOptions) GetPyGenericServices() bool { + if m != nil && m.PyGenericServices != nil { + return *m.PyGenericServices + } + return Default_FileOptions_PyGenericServices +} + +func (m *FileOptions) GetPhpGenericServices() bool { + if m != nil && m.PhpGenericServices != nil { + return *m.PhpGenericServices + } + return Default_FileOptions_PhpGenericServices +} + +func (m *FileOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FileOptions_Deprecated +} + +func (m *FileOptions) GetCcEnableArenas() bool { + if m != nil && m.CcEnableArenas != nil { + return *m.CcEnableArenas + } + return Default_FileOptions_CcEnableArenas +} + +func (m *FileOptions) GetObjcClassPrefix() string { + if m != nil && m.ObjcClassPrefix != nil { + return *m.ObjcClassPrefix + } + return "" +} + +func (m *FileOptions) GetCsharpNamespace() string { + if m != nil && m.CsharpNamespace != nil { + return *m.CsharpNamespace + } + return "" +} + +func (m *FileOptions) GetSwiftPrefix() string { + if m != nil && m.SwiftPrefix != nil { + return *m.SwiftPrefix + } + return "" +} + +func (m *FileOptions) GetPhpClassPrefix() string { + if m != nil && m.PhpClassPrefix != nil { + return *m.PhpClassPrefix + } + return "" +} + +func (m *FileOptions) GetPhpNamespace() string { + if m != nil && m.PhpNamespace != nil { + return *m.PhpNamespace + } + return "" +} + +func (m *FileOptions) GetPhpMetadataNamespace() string { + if m != nil && m.PhpMetadataNamespace != nil { + return *m.PhpMetadataNamespace + } + return "" +} + +func (m *FileOptions) GetRubyPackage() string { + if m != nil && m.RubyPackage != nil { + return *m.RubyPackage + } + return "" +} + +func (m *FileOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MessageOptions struct { + // Set true to use the old proto1 MessageSet wire format for extensions. + // This is provided for backwards-compatibility with the MessageSet wire + // format. You should not use this for any other reason: It's less + // efficient, has fewer features, and is more complicated. + // + // The message must be defined exactly as follows: + // message Foo { + // option message_set_wire_format = true; + // extensions 4 to max; + // } + // Note that the message cannot have any defined fields; MessageSets only + // have extensions. + // + // All extensions of your type must be singular messages; e.g. they cannot + // be int32s, enums, or repeated messages. + // + // Because this is an option, the above two restrictions are not enforced by + // the protocol compiler. + MessageSetWireFormat *bool `protobuf:"varint,1,opt,name=message_set_wire_format,json=messageSetWireFormat,def=0" json:"message_set_wire_format,omitempty"` + // Disables the generation of the standard "descriptor()" accessor, which can + // conflict with a field of the same name. This is meant to make migration + // from proto1 easier; new code should avoid fields named "descriptor". + NoStandardDescriptorAccessor *bool `protobuf:"varint,2,opt,name=no_standard_descriptor_accessor,json=noStandardDescriptorAccessor,def=0" json:"no_standard_descriptor_accessor,omitempty"` + // Is this message deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the message, or it will be completely ignored; in the very least, + // this is a formalization for deprecating messages. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Whether the message is an automatically generated map entry type for the + // maps field. + // + // For maps fields: + // map<KeyType, ValueType> map_field = 1; + // The parsed descriptor looks like: + // message MapFieldEntry { + // option map_entry = true; + // optional KeyType key = 1; + // optional ValueType value = 2; + // } + // repeated MapFieldEntry map_field = 1; + // + // Implementations may choose not to generate the map_entry=true message, but + // use a native map in the target language to hold the keys and values. + // The reflection APIs in such implementions still need to work as + // if the field is a repeated message field. + // + // NOTE: Do not set the option in .proto files. Always use the maps syntax + // instead. The option should only be implicitly set by the proto compiler + // parser. + MapEntry *bool `protobuf:"varint,7,opt,name=map_entry,json=mapEntry" json:"map_entry,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MessageOptions) Reset() { *m = MessageOptions{} } +func (m *MessageOptions) String() string { return proto.CompactTextString(m) } +func (*MessageOptions) ProtoMessage() {} +func (*MessageOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{11} +} + +var extRange_MessageOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MessageOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MessageOptions +} + +func (m *MessageOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MessageOptions.Unmarshal(m, b) +} +func (m *MessageOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MessageOptions.Marshal(b, m, deterministic) +} +func (m *MessageOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MessageOptions.Merge(m, src) +} +func (m *MessageOptions) XXX_Size() int { + return xxx_messageInfo_MessageOptions.Size(m) +} +func (m *MessageOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MessageOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MessageOptions proto.InternalMessageInfo + +const Default_MessageOptions_MessageSetWireFormat bool = false +const Default_MessageOptions_NoStandardDescriptorAccessor bool = false +const Default_MessageOptions_Deprecated bool = false + +func (m *MessageOptions) GetMessageSetWireFormat() bool { + if m != nil && m.MessageSetWireFormat != nil { + return *m.MessageSetWireFormat + } + return Default_MessageOptions_MessageSetWireFormat +} + +func (m *MessageOptions) GetNoStandardDescriptorAccessor() bool { + if m != nil && m.NoStandardDescriptorAccessor != nil { + return *m.NoStandardDescriptorAccessor + } + return Default_MessageOptions_NoStandardDescriptorAccessor +} + +func (m *MessageOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MessageOptions_Deprecated +} + +func (m *MessageOptions) GetMapEntry() bool { + if m != nil && m.MapEntry != nil { + return *m.MapEntry + } + return false +} + +func (m *MessageOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type FieldOptions struct { + // The ctype option instructs the C++ code generator to use a different + // representation of the field than it normally would. See the specific + // options below. This option is not yet implemented in the open source + // release -- sorry, we'll try to include it in a future version! + Ctype *FieldOptions_CType `protobuf:"varint,1,opt,name=ctype,enum=google.protobuf.FieldOptions_CType,def=0" json:"ctype,omitempty"` + // The packed option can be enabled for repeated primitive fields to enable + // a more efficient representation on the wire. Rather than repeatedly + // writing the tag and type for each element, the entire array is encoded as + // a single length-delimited blob. In proto3, only explicit setting it to + // false will avoid using packed encoding. + Packed *bool `protobuf:"varint,2,opt,name=packed" json:"packed,omitempty"` + // The jstype option determines the JavaScript type used for values of the + // field. The option is permitted only for 64 bit integral and fixed types + // (int64, uint64, sint64, fixed64, sfixed64). A field with jstype JS_STRING + // is represented as JavaScript string, which avoids loss of precision that + // can happen when a large value is converted to a floating point JavaScript. + // Specifying JS_NUMBER for the jstype causes the generated JavaScript code to + // use the JavaScript "number" type. The behavior of the default option + // JS_NORMAL is implementation dependent. + // + // This option is an enum to permit additional types to be added, e.g. + // goog.math.Integer. + Jstype *FieldOptions_JSType `protobuf:"varint,6,opt,name=jstype,enum=google.protobuf.FieldOptions_JSType,def=0" json:"jstype,omitempty"` + // Should this field be parsed lazily? Lazy applies only to message-type + // fields. It means that when the outer message is initially parsed, the + // inner message's contents will not be parsed but instead stored in encoded + // form. The inner message will actually be parsed when it is first accessed. + // + // This is only a hint. Implementations are free to choose whether to use + // eager or lazy parsing regardless of the value of this option. However, + // setting this option true suggests that the protocol author believes that + // using lazy parsing on this field is worth the additional bookkeeping + // overhead typically needed to implement it. + // + // This option does not affect the public interface of any generated code; + // all method signatures remain the same. Furthermore, thread-safety of the + // interface is not affected by this option; const methods remain safe to + // call from multiple threads concurrently, while non-const methods continue + // to require exclusive access. + // + // + // Note that implementations may choose not to check required fields within + // a lazy sub-message. That is, calling IsInitialized() on the outer message + // may return true even if the inner message has missing required fields. + // This is necessary because otherwise the inner message would have to be + // parsed in order to perform the check, defeating the purpose of lazy + // parsing. An implementation which chooses not to check required fields + // must be consistent about it. That is, for any particular sub-message, the + // implementation must either *always* check its required fields, or *never* + // check its required fields, regardless of whether or not the message has + // been parsed. + Lazy *bool `protobuf:"varint,5,opt,name=lazy,def=0" json:"lazy,omitempty"` + // Is this field deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for accessors, or it will be completely ignored; in the very least, this + // is a formalization for deprecating fields. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // For Google-internal migration only. Do not use. + Weak *bool `protobuf:"varint,10,opt,name=weak,def=0" json:"weak,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldOptions) Reset() { *m = FieldOptions{} } +func (m *FieldOptions) String() string { return proto.CompactTextString(m) } +func (*FieldOptions) ProtoMessage() {} +func (*FieldOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12} +} + +var extRange_FieldOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FieldOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FieldOptions +} + +func (m *FieldOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldOptions.Unmarshal(m, b) +} +func (m *FieldOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldOptions.Marshal(b, m, deterministic) +} +func (m *FieldOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldOptions.Merge(m, src) +} +func (m *FieldOptions) XXX_Size() int { + return xxx_messageInfo_FieldOptions.Size(m) +} +func (m *FieldOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FieldOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldOptions proto.InternalMessageInfo + +const Default_FieldOptions_Ctype FieldOptions_CType = FieldOptions_STRING +const Default_FieldOptions_Jstype FieldOptions_JSType = FieldOptions_JS_NORMAL +const Default_FieldOptions_Lazy bool = false +const Default_FieldOptions_Deprecated bool = false +const Default_FieldOptions_Weak bool = false + +func (m *FieldOptions) GetCtype() FieldOptions_CType { + if m != nil && m.Ctype != nil { + return *m.Ctype + } + return Default_FieldOptions_Ctype +} + +func (m *FieldOptions) GetPacked() bool { + if m != nil && m.Packed != nil { + return *m.Packed + } + return false +} + +func (m *FieldOptions) GetJstype() FieldOptions_JSType { + if m != nil && m.Jstype != nil { + return *m.Jstype + } + return Default_FieldOptions_Jstype +} + +func (m *FieldOptions) GetLazy() bool { + if m != nil && m.Lazy != nil { + return *m.Lazy + } + return Default_FieldOptions_Lazy +} + +func (m *FieldOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FieldOptions_Deprecated +} + +func (m *FieldOptions) GetWeak() bool { + if m != nil && m.Weak != nil { + return *m.Weak + } + return Default_FieldOptions_Weak +} + +func (m *FieldOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type OneofOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofOptions) Reset() { *m = OneofOptions{} } +func (m *OneofOptions) String() string { return proto.CompactTextString(m) } +func (*OneofOptions) ProtoMessage() {} +func (*OneofOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{13} +} + +var extRange_OneofOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*OneofOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_OneofOptions +} + +func (m *OneofOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofOptions.Unmarshal(m, b) +} +func (m *OneofOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofOptions.Marshal(b, m, deterministic) +} +func (m *OneofOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofOptions.Merge(m, src) +} +func (m *OneofOptions) XXX_Size() int { + return xxx_messageInfo_OneofOptions.Size(m) +} +func (m *OneofOptions) XXX_DiscardUnknown() { + xxx_messageInfo_OneofOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofOptions proto.InternalMessageInfo + +func (m *OneofOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumOptions struct { + // Set this option to true to allow mapping different tag names to the same + // value. + AllowAlias *bool `protobuf:"varint,2,opt,name=allow_alias,json=allowAlias" json:"allow_alias,omitempty"` + // Is this enum deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum, or it will be completely ignored; in the very least, this + // is a formalization for deprecating enums. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumOptions) Reset() { *m = EnumOptions{} } +func (m *EnumOptions) String() string { return proto.CompactTextString(m) } +func (*EnumOptions) ProtoMessage() {} +func (*EnumOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{14} +} + +var extRange_EnumOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumOptions +} + +func (m *EnumOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumOptions.Unmarshal(m, b) +} +func (m *EnumOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumOptions.Marshal(b, m, deterministic) +} +func (m *EnumOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumOptions.Merge(m, src) +} +func (m *EnumOptions) XXX_Size() int { + return xxx_messageInfo_EnumOptions.Size(m) +} +func (m *EnumOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumOptions proto.InternalMessageInfo + +const Default_EnumOptions_Deprecated bool = false + +func (m *EnumOptions) GetAllowAlias() bool { + if m != nil && m.AllowAlias != nil { + return *m.AllowAlias + } + return false +} + +func (m *EnumOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumOptions_Deprecated +} + +func (m *EnumOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumValueOptions struct { + // Is this enum value deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum value, or it will be completely ignored; in the very least, + // this is a formalization for deprecating enum values. + Deprecated *bool `protobuf:"varint,1,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueOptions) Reset() { *m = EnumValueOptions{} } +func (m *EnumValueOptions) String() string { return proto.CompactTextString(m) } +func (*EnumValueOptions) ProtoMessage() {} +func (*EnumValueOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{15} +} + +var extRange_EnumValueOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumValueOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumValueOptions +} + +func (m *EnumValueOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueOptions.Unmarshal(m, b) +} +func (m *EnumValueOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueOptions.Marshal(b, m, deterministic) +} +func (m *EnumValueOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueOptions.Merge(m, src) +} +func (m *EnumValueOptions) XXX_Size() int { + return xxx_messageInfo_EnumValueOptions.Size(m) +} +func (m *EnumValueOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueOptions proto.InternalMessageInfo + +const Default_EnumValueOptions_Deprecated bool = false + +func (m *EnumValueOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumValueOptions_Deprecated +} + +func (m *EnumValueOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type ServiceOptions struct { + // Is this service deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the service, or it will be completely ignored; in the very least, + // this is a formalization for deprecating services. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceOptions) Reset() { *m = ServiceOptions{} } +func (m *ServiceOptions) String() string { return proto.CompactTextString(m) } +func (*ServiceOptions) ProtoMessage() {} +func (*ServiceOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{16} +} + +var extRange_ServiceOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ServiceOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ServiceOptions +} + +func (m *ServiceOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceOptions.Unmarshal(m, b) +} +func (m *ServiceOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceOptions.Marshal(b, m, deterministic) +} +func (m *ServiceOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceOptions.Merge(m, src) +} +func (m *ServiceOptions) XXX_Size() int { + return xxx_messageInfo_ServiceOptions.Size(m) +} +func (m *ServiceOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceOptions proto.InternalMessageInfo + +const Default_ServiceOptions_Deprecated bool = false + +func (m *ServiceOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_ServiceOptions_Deprecated +} + +func (m *ServiceOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MethodOptions struct { + // Is this method deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the method, or it will be completely ignored; in the very least, + // this is a formalization for deprecating methods. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + IdempotencyLevel *MethodOptions_IdempotencyLevel `protobuf:"varint,34,opt,name=idempotency_level,json=idempotencyLevel,enum=google.protobuf.MethodOptions_IdempotencyLevel,def=0" json:"idempotency_level,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodOptions) Reset() { *m = MethodOptions{} } +func (m *MethodOptions) String() string { return proto.CompactTextString(m) } +func (*MethodOptions) ProtoMessage() {} +func (*MethodOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17} +} + +var extRange_MethodOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MethodOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MethodOptions +} + +func (m *MethodOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodOptions.Unmarshal(m, b) +} +func (m *MethodOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodOptions.Marshal(b, m, deterministic) +} +func (m *MethodOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodOptions.Merge(m, src) +} +func (m *MethodOptions) XXX_Size() int { + return xxx_messageInfo_MethodOptions.Size(m) +} +func (m *MethodOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MethodOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodOptions proto.InternalMessageInfo + +const Default_MethodOptions_Deprecated bool = false +const Default_MethodOptions_IdempotencyLevel MethodOptions_IdempotencyLevel = MethodOptions_IDEMPOTENCY_UNKNOWN + +func (m *MethodOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MethodOptions_Deprecated +} + +func (m *MethodOptions) GetIdempotencyLevel() MethodOptions_IdempotencyLevel { + if m != nil && m.IdempotencyLevel != nil { + return *m.IdempotencyLevel + } + return Default_MethodOptions_IdempotencyLevel +} + +func (m *MethodOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// A message representing a option the parser does not recognize. This only +// appears in options protos created by the compiler::Parser class. +// DescriptorPool resolves these when building Descriptor objects. Therefore, +// options protos in descriptor objects (e.g. returned by Descriptor::options(), +// or produced by Descriptor::CopyTo()) will never have UninterpretedOptions +// in them. +type UninterpretedOption struct { + Name []*UninterpretedOption_NamePart `protobuf:"bytes,2,rep,name=name" json:"name,omitempty"` + // The value of the uninterpreted option, in whatever type the tokenizer + // identified it as during parsing. Exactly one of these should be set. + IdentifierValue *string `protobuf:"bytes,3,opt,name=identifier_value,json=identifierValue" json:"identifier_value,omitempty"` + PositiveIntValue *uint64 `protobuf:"varint,4,opt,name=positive_int_value,json=positiveIntValue" json:"positive_int_value,omitempty"` + NegativeIntValue *int64 `protobuf:"varint,5,opt,name=negative_int_value,json=negativeIntValue" json:"negative_int_value,omitempty"` + DoubleValue *float64 `protobuf:"fixed64,6,opt,name=double_value,json=doubleValue" json:"double_value,omitempty"` + StringValue []byte `protobuf:"bytes,7,opt,name=string_value,json=stringValue" json:"string_value,omitempty"` + AggregateValue *string `protobuf:"bytes,8,opt,name=aggregate_value,json=aggregateValue" json:"aggregate_value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption) Reset() { *m = UninterpretedOption{} } +func (m *UninterpretedOption) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption) ProtoMessage() {} +func (*UninterpretedOption) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18} +} +func (m *UninterpretedOption) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption.Unmarshal(m, b) +} +func (m *UninterpretedOption) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption.Merge(m, src) +} +func (m *UninterpretedOption) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption.Size(m) +} +func (m *UninterpretedOption) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption proto.InternalMessageInfo + +func (m *UninterpretedOption) GetName() []*UninterpretedOption_NamePart { + if m != nil { + return m.Name + } + return nil +} + +func (m *UninterpretedOption) GetIdentifierValue() string { + if m != nil && m.IdentifierValue != nil { + return *m.IdentifierValue + } + return "" +} + +func (m *UninterpretedOption) GetPositiveIntValue() uint64 { + if m != nil && m.PositiveIntValue != nil { + return *m.PositiveIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetNegativeIntValue() int64 { + if m != nil && m.NegativeIntValue != nil { + return *m.NegativeIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetDoubleValue() float64 { + if m != nil && m.DoubleValue != nil { + return *m.DoubleValue + } + return 0 +} + +func (m *UninterpretedOption) GetStringValue() []byte { + if m != nil { + return m.StringValue + } + return nil +} + +func (m *UninterpretedOption) GetAggregateValue() string { + if m != nil && m.AggregateValue != nil { + return *m.AggregateValue + } + return "" +} + +// The name of the uninterpreted option. Each string represents a segment in +// a dot-separated name. is_extension is true iff a segment represents an +// extension (denoted with parentheses in options specs in .proto files). +// E.g.,{ ["foo", false], ["bar.baz", true], ["qux", false] } represents +// "foo.(bar.baz).qux". +type UninterpretedOption_NamePart struct { + NamePart *string `protobuf:"bytes,1,req,name=name_part,json=namePart" json:"name_part,omitempty"` + IsExtension *bool `protobuf:"varint,2,req,name=is_extension,json=isExtension" json:"is_extension,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption_NamePart) Reset() { *m = UninterpretedOption_NamePart{} } +func (m *UninterpretedOption_NamePart) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption_NamePart) ProtoMessage() {} +func (*UninterpretedOption_NamePart) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18, 0} +} +func (m *UninterpretedOption_NamePart) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption_NamePart.Unmarshal(m, b) +} +func (m *UninterpretedOption_NamePart) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption_NamePart.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption_NamePart) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption_NamePart.Merge(m, src) +} +func (m *UninterpretedOption_NamePart) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption_NamePart.Size(m) +} +func (m *UninterpretedOption_NamePart) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption_NamePart.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption_NamePart proto.InternalMessageInfo + +func (m *UninterpretedOption_NamePart) GetNamePart() string { + if m != nil && m.NamePart != nil { + return *m.NamePart + } + return "" +} + +func (m *UninterpretedOption_NamePart) GetIsExtension() bool { + if m != nil && m.IsExtension != nil { + return *m.IsExtension + } + return false +} + +// Encapsulates information about the original source file from which a +// FileDescriptorProto was generated. +type SourceCodeInfo struct { + // A Location identifies a piece of source code in a .proto file which + // corresponds to a particular definition. This information is intended + // to be useful to IDEs, code indexers, documentation generators, and similar + // tools. + // + // For example, say we have a file like: + // message Foo { + // optional string foo = 1; + // } + // Let's look at just the field definition: + // optional string foo = 1; + // ^ ^^ ^^ ^ ^^^ + // a bc de f ghi + // We have the following locations: + // span path represents + // [a,i) [ 4, 0, 2, 0 ] The whole field definition. + // [a,b) [ 4, 0, 2, 0, 4 ] The label (optional). + // [c,d) [ 4, 0, 2, 0, 5 ] The type (string). + // [e,f) [ 4, 0, 2, 0, 1 ] The name (foo). + // [g,h) [ 4, 0, 2, 0, 3 ] The number (1). + // + // Notes: + // - A location may refer to a repeated field itself (i.e. not to any + // particular index within it). This is used whenever a set of elements are + // logically enclosed in a single code segment. For example, an entire + // extend block (possibly containing multiple extension definitions) will + // have an outer location whose path refers to the "extensions" repeated + // field without an index. + // - Multiple locations may have the same path. This happens when a single + // logical declaration is spread out across multiple places. The most + // obvious example is the "extend" block again -- there may be multiple + // extend blocks in the same scope, each of which will have the same path. + // - A location's span is not always a subset of its parent's span. For + // example, the "extendee" of an extension declaration appears at the + // beginning of the "extend" block and is shared by all extensions within + // the block. + // - Just because a location's span is a subset of some other location's span + // does not mean that it is a descendent. For example, a "group" defines + // both a type and a field in a single declaration. Thus, the locations + // corresponding to the type and field and their components will overlap. + // - Code which tries to interpret locations should probably be designed to + // ignore those that it doesn't understand, as more types of locations could + // be recorded in the future. + Location []*SourceCodeInfo_Location `protobuf:"bytes,1,rep,name=location" json:"location,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo) Reset() { *m = SourceCodeInfo{} } +func (m *SourceCodeInfo) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo) ProtoMessage() {} +func (*SourceCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19} +} +func (m *SourceCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo.Unmarshal(m, b) +} +func (m *SourceCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo.Merge(m, src) +} +func (m *SourceCodeInfo) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo.Size(m) +} +func (m *SourceCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo proto.InternalMessageInfo + +func (m *SourceCodeInfo) GetLocation() []*SourceCodeInfo_Location { + if m != nil { + return m.Location + } + return nil +} + +type SourceCodeInfo_Location struct { + // Identifies which part of the FileDescriptorProto was defined at this + // location. + // + // Each element is a field number or an index. They form a path from + // the root FileDescriptorProto to the place where the definition. For + // example, this path: + // [ 4, 3, 2, 7, 1 ] + // refers to: + // file.message_type(3) // 4, 3 + // .field(7) // 2, 7 + // .name() // 1 + // This is because FileDescriptorProto.message_type has field number 4: + // repeated DescriptorProto message_type = 4; + // and DescriptorProto.field has field number 2: + // repeated FieldDescriptorProto field = 2; + // and FieldDescriptorProto.name has field number 1: + // optional string name = 1; + // + // Thus, the above path gives the location of a field name. If we removed + // the last element: + // [ 4, 3, 2, 7 ] + // this path refers to the whole field declaration (from the beginning + // of the label to the terminating semicolon). + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Always has exactly three or four elements: start line, start column, + // end line (optional, otherwise assumed same as start line), end column. + // These are packed into a single field for efficiency. Note that line + // and column numbers are zero-based -- typically you will want to add + // 1 to each before displaying to a user. + Span []int32 `protobuf:"varint,2,rep,packed,name=span" json:"span,omitempty"` + // If this SourceCodeInfo represents a complete declaration, these are any + // comments appearing before and after the declaration which appear to be + // attached to the declaration. + // + // A series of line comments appearing on consecutive lines, with no other + // tokens appearing on those lines, will be treated as a single comment. + // + // leading_detached_comments will keep paragraphs of comments that appear + // before (but not connected to) the current element. Each paragraph, + // separated by empty lines, will be one comment element in the repeated + // field. + // + // Only the comment content is provided; comment markers (e.g. //) are + // stripped out. For block comments, leading whitespace and an asterisk + // will be stripped from the beginning of each line other than the first. + // Newlines are included in the output. + // + // Examples: + // + // optional int32 foo = 1; // Comment attached to foo. + // // Comment attached to bar. + // optional int32 bar = 2; + // + // optional string baz = 3; + // // Comment attached to baz. + // // Another line attached to baz. + // + // // Comment attached to qux. + // // + // // Another line attached to qux. + // optional double qux = 4; + // + // // Detached comment for corge. This is not leading or trailing comments + // // to qux or corge because there are blank lines separating it from + // // both. + // + // // Detached comment for corge paragraph 2. + // + // optional string corge = 5; + // /* Block comment attached + // * to corge. Leading asterisks + // * will be removed. */ + // /* Block comment attached to + // * grault. */ + // optional int32 grault = 6; + // + // // ignored detached comments. + LeadingComments *string `protobuf:"bytes,3,opt,name=leading_comments,json=leadingComments" json:"leading_comments,omitempty"` + TrailingComments *string `protobuf:"bytes,4,opt,name=trailing_comments,json=trailingComments" json:"trailing_comments,omitempty"` + LeadingDetachedComments []string `protobuf:"bytes,6,rep,name=leading_detached_comments,json=leadingDetachedComments" json:"leading_detached_comments,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo_Location) Reset() { *m = SourceCodeInfo_Location{} } +func (m *SourceCodeInfo_Location) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo_Location) ProtoMessage() {} +func (*SourceCodeInfo_Location) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19, 0} +} +func (m *SourceCodeInfo_Location) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo_Location.Unmarshal(m, b) +} +func (m *SourceCodeInfo_Location) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo_Location.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo_Location) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo_Location.Merge(m, src) +} +func (m *SourceCodeInfo_Location) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo_Location.Size(m) +} +func (m *SourceCodeInfo_Location) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo_Location.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo_Location proto.InternalMessageInfo + +func (m *SourceCodeInfo_Location) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *SourceCodeInfo_Location) GetSpan() []int32 { + if m != nil { + return m.Span + } + return nil +} + +func (m *SourceCodeInfo_Location) GetLeadingComments() string { + if m != nil && m.LeadingComments != nil { + return *m.LeadingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetTrailingComments() string { + if m != nil && m.TrailingComments != nil { + return *m.TrailingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetLeadingDetachedComments() []string { + if m != nil { + return m.LeadingDetachedComments + } + return nil +} + +// Describes the relationship between generated code and its original source +// file. A GeneratedCodeInfo message is associated with only one generated +// source file, but may contain references to different source .proto files. +type GeneratedCodeInfo struct { + // An Annotation connects some span of text in generated code to an element + // of its generating .proto file. + Annotation []*GeneratedCodeInfo_Annotation `protobuf:"bytes,1,rep,name=annotation" json:"annotation,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo) Reset() { *m = GeneratedCodeInfo{} } +func (m *GeneratedCodeInfo) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo) ProtoMessage() {} +func (*GeneratedCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20} +} +func (m *GeneratedCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo.Merge(m, src) +} +func (m *GeneratedCodeInfo) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo.Size(m) +} +func (m *GeneratedCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo proto.InternalMessageInfo + +func (m *GeneratedCodeInfo) GetAnnotation() []*GeneratedCodeInfo_Annotation { + if m != nil { + return m.Annotation + } + return nil +} + +type GeneratedCodeInfo_Annotation struct { + // Identifies the element in the original source .proto file. This field + // is formatted the same as SourceCodeInfo.Location.path. + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Identifies the filesystem path to the original source .proto. + SourceFile *string `protobuf:"bytes,2,opt,name=source_file,json=sourceFile" json:"source_file,omitempty"` + // Identifies the starting offset in bytes in the generated code + // that relates to the identified object. + Begin *int32 `protobuf:"varint,3,opt,name=begin" json:"begin,omitempty"` + // Identifies the ending offset in bytes in the generated code that + // relates to the identified offset. The end offset should be one past + // the last relevant byte (so the length of the text = end - begin). + End *int32 `protobuf:"varint,4,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo_Annotation) Reset() { *m = GeneratedCodeInfo_Annotation{} } +func (m *GeneratedCodeInfo_Annotation) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo_Annotation) ProtoMessage() {} +func (*GeneratedCodeInfo_Annotation) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20, 0} +} +func (m *GeneratedCodeInfo_Annotation) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo_Annotation.Merge(m, src) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Size(m) +} +func (m *GeneratedCodeInfo_Annotation) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo_Annotation.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo_Annotation proto.InternalMessageInfo + +func (m *GeneratedCodeInfo_Annotation) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *GeneratedCodeInfo_Annotation) GetSourceFile() string { + if m != nil && m.SourceFile != nil { + return *m.SourceFile + } + return "" +} + +func (m *GeneratedCodeInfo_Annotation) GetBegin() int32 { + if m != nil && m.Begin != nil { + return *m.Begin + } + return 0 +} + +func (m *GeneratedCodeInfo_Annotation) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func init() { + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Type", FieldDescriptorProto_Type_name, FieldDescriptorProto_Type_value) + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Label", FieldDescriptorProto_Label_name, FieldDescriptorProto_Label_value) + proto.RegisterEnum("google.protobuf.FileOptions_OptimizeMode", FileOptions_OptimizeMode_name, FileOptions_OptimizeMode_value) + proto.RegisterEnum("google.protobuf.FieldOptions_CType", FieldOptions_CType_name, FieldOptions_CType_value) + proto.RegisterEnum("google.protobuf.FieldOptions_JSType", FieldOptions_JSType_name, FieldOptions_JSType_value) + proto.RegisterEnum("google.protobuf.MethodOptions_IdempotencyLevel", MethodOptions_IdempotencyLevel_name, MethodOptions_IdempotencyLevel_value) + proto.RegisterType((*FileDescriptorSet)(nil), "google.protobuf.FileDescriptorSet") + proto.RegisterType((*FileDescriptorProto)(nil), "google.protobuf.FileDescriptorProto") + proto.RegisterType((*DescriptorProto)(nil), "google.protobuf.DescriptorProto") + proto.RegisterType((*DescriptorProto_ExtensionRange)(nil), "google.protobuf.DescriptorProto.ExtensionRange") + proto.RegisterType((*DescriptorProto_ReservedRange)(nil), "google.protobuf.DescriptorProto.ReservedRange") + proto.RegisterType((*ExtensionRangeOptions)(nil), "google.protobuf.ExtensionRangeOptions") + proto.RegisterType((*FieldDescriptorProto)(nil), "google.protobuf.FieldDescriptorProto") + proto.RegisterType((*OneofDescriptorProto)(nil), "google.protobuf.OneofDescriptorProto") + proto.RegisterType((*EnumDescriptorProto)(nil), "google.protobuf.EnumDescriptorProto") + proto.RegisterType((*EnumDescriptorProto_EnumReservedRange)(nil), "google.protobuf.EnumDescriptorProto.EnumReservedRange") + proto.RegisterType((*EnumValueDescriptorProto)(nil), "google.protobuf.EnumValueDescriptorProto") + proto.RegisterType((*ServiceDescriptorProto)(nil), "google.protobuf.ServiceDescriptorProto") + proto.RegisterType((*MethodDescriptorProto)(nil), "google.protobuf.MethodDescriptorProto") + proto.RegisterType((*FileOptions)(nil), "google.protobuf.FileOptions") + proto.RegisterType((*MessageOptions)(nil), "google.protobuf.MessageOptions") + proto.RegisterType((*FieldOptions)(nil), "google.protobuf.FieldOptions") + proto.RegisterType((*OneofOptions)(nil), "google.protobuf.OneofOptions") + proto.RegisterType((*EnumOptions)(nil), "google.protobuf.EnumOptions") + proto.RegisterType((*EnumValueOptions)(nil), "google.protobuf.EnumValueOptions") + proto.RegisterType((*ServiceOptions)(nil), "google.protobuf.ServiceOptions") + proto.RegisterType((*MethodOptions)(nil), "google.protobuf.MethodOptions") + proto.RegisterType((*UninterpretedOption)(nil), "google.protobuf.UninterpretedOption") + proto.RegisterType((*UninterpretedOption_NamePart)(nil), "google.protobuf.UninterpretedOption.NamePart") + proto.RegisterType((*SourceCodeInfo)(nil), "google.protobuf.SourceCodeInfo") + proto.RegisterType((*SourceCodeInfo_Location)(nil), "google.protobuf.SourceCodeInfo.Location") + proto.RegisterType((*GeneratedCodeInfo)(nil), "google.protobuf.GeneratedCodeInfo") + proto.RegisterType((*GeneratedCodeInfo_Annotation)(nil), "google.protobuf.GeneratedCodeInfo.Annotation") +} + +func init() { proto.RegisterFile("descriptor.proto", fileDescriptor_308767df5ffe18af) } + +var fileDescriptor_308767df5ffe18af = []byte{ + // 2522 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xc4, 0x59, 0xcd, 0x6f, 0xdb, 0xc8, + 0x15, 0x5f, 0x7d, 0x5a, 0x7a, 0x92, 0x65, 0x7a, 0xec, 0x75, 0x18, 0xef, 0x47, 0x1c, 0xed, 0x66, + 0xe3, 0x24, 0xbb, 0xca, 0xc2, 0x49, 0x9c, 0xac, 0x53, 0x6c, 0x2b, 0x4b, 0x8c, 0x57, 0xa9, 0xbe, + 0x4a, 0xc9, 0xdd, 0x64, 0x8b, 0x82, 0x18, 0x93, 0x23, 0x89, 0x09, 0x45, 0x72, 0x49, 0x2a, 0x89, + 0x83, 0x1e, 0x02, 0xf4, 0x54, 0xa0, 0x7f, 0x40, 0x51, 0x14, 0x3d, 0xf4, 0xb2, 0x40, 0xff, 0x80, + 0x02, 0xed, 0xbd, 0xd7, 0x02, 0xbd, 0xf7, 0x50, 0xa0, 0x05, 0xda, 0x3f, 0xa1, 0xc7, 0x62, 0x66, + 0x48, 0x8a, 0xd4, 0x47, 0xe2, 0x5d, 0x20, 0xd9, 0x93, 0x3d, 0xef, 0xfd, 0xde, 0x9b, 0x37, 0x8f, + 0xbf, 0x79, 0xf3, 0x66, 0x04, 0x82, 0x46, 0x5c, 0xd5, 0xd1, 0x6d, 0xcf, 0x72, 0x2a, 0xb6, 0x63, + 0x79, 0x16, 0x5a, 0x1b, 0x5a, 0xd6, 0xd0, 0x20, 0x7c, 0x74, 0x32, 0x19, 0x94, 0x5b, 0xb0, 0x7e, + 0x4f, 0x37, 0x48, 0x3d, 0x04, 0xf6, 0x88, 0x87, 0xee, 0x40, 0x7a, 0xa0, 0x1b, 0x44, 0x4c, 0xec, + 0xa4, 0x76, 0x0b, 0x7b, 0x1f, 0x56, 0x66, 0x8c, 0x2a, 0x71, 0x8b, 0x2e, 0x15, 0xcb, 0xcc, 0xa2, + 0xfc, 0xef, 0x34, 0x6c, 0x2c, 0xd0, 0x22, 0x04, 0x69, 0x13, 0x8f, 0xa9, 0xc7, 0xc4, 0x6e, 0x5e, + 0x66, 0xff, 0x23, 0x11, 0x56, 0x6c, 0xac, 0x3e, 0xc6, 0x43, 0x22, 0x26, 0x99, 0x38, 0x18, 0xa2, + 0xf7, 0x01, 0x34, 0x62, 0x13, 0x53, 0x23, 0xa6, 0x7a, 0x2a, 0xa6, 0x76, 0x52, 0xbb, 0x79, 0x39, + 0x22, 0x41, 0xd7, 0x60, 0xdd, 0x9e, 0x9c, 0x18, 0xba, 0xaa, 0x44, 0x60, 0xb0, 0x93, 0xda, 0xcd, + 0xc8, 0x02, 0x57, 0xd4, 0xa7, 0xe0, 0xcb, 0xb0, 0xf6, 0x94, 0xe0, 0xc7, 0x51, 0x68, 0x81, 0x41, + 0x4b, 0x54, 0x1c, 0x01, 0xd6, 0xa0, 0x38, 0x26, 0xae, 0x8b, 0x87, 0x44, 0xf1, 0x4e, 0x6d, 0x22, + 0xa6, 0xd9, 0xea, 0x77, 0xe6, 0x56, 0x3f, 0xbb, 0xf2, 0x82, 0x6f, 0xd5, 0x3f, 0xb5, 0x09, 0xaa, + 0x42, 0x9e, 0x98, 0x93, 0x31, 0xf7, 0x90, 0x59, 0x92, 0x3f, 0xc9, 0x9c, 0x8c, 0x67, 0xbd, 0xe4, + 0xa8, 0x99, 0xef, 0x62, 0xc5, 0x25, 0xce, 0x13, 0x5d, 0x25, 0x62, 0x96, 0x39, 0xb8, 0x3c, 0xe7, + 0xa0, 0xc7, 0xf5, 0xb3, 0x3e, 0x02, 0x3b, 0x54, 0x83, 0x3c, 0x79, 0xe6, 0x11, 0xd3, 0xd5, 0x2d, + 0x53, 0x5c, 0x61, 0x4e, 0x2e, 0x2d, 0xf8, 0x8a, 0xc4, 0xd0, 0x66, 0x5d, 0x4c, 0xed, 0xd0, 0x3e, + 0xac, 0x58, 0xb6, 0xa7, 0x5b, 0xa6, 0x2b, 0xe6, 0x76, 0x12, 0xbb, 0x85, 0xbd, 0x77, 0x17, 0x12, + 0xa1, 0xc3, 0x31, 0x72, 0x00, 0x46, 0x0d, 0x10, 0x5c, 0x6b, 0xe2, 0xa8, 0x44, 0x51, 0x2d, 0x8d, + 0x28, 0xba, 0x39, 0xb0, 0xc4, 0x3c, 0x73, 0x70, 0x61, 0x7e, 0x21, 0x0c, 0x58, 0xb3, 0x34, 0xd2, + 0x30, 0x07, 0x96, 0x5c, 0x72, 0x63, 0x63, 0xb4, 0x05, 0x59, 0xf7, 0xd4, 0xf4, 0xf0, 0x33, 0xb1, + 0xc8, 0x18, 0xe2, 0x8f, 0xca, 0x7f, 0xce, 0xc2, 0xda, 0x59, 0x28, 0x76, 0x17, 0x32, 0x03, 0xba, + 0x4a, 0x31, 0xf9, 0x6d, 0x72, 0xc0, 0x6d, 0xe2, 0x49, 0xcc, 0x7e, 0xc7, 0x24, 0x56, 0xa1, 0x60, + 0x12, 0xd7, 0x23, 0x1a, 0x67, 0x44, 0xea, 0x8c, 0x9c, 0x02, 0x6e, 0x34, 0x4f, 0xa9, 0xf4, 0x77, + 0xa2, 0xd4, 0x03, 0x58, 0x0b, 0x43, 0x52, 0x1c, 0x6c, 0x0e, 0x03, 0x6e, 0x5e, 0x7f, 0x55, 0x24, + 0x15, 0x29, 0xb0, 0x93, 0xa9, 0x99, 0x5c, 0x22, 0xb1, 0x31, 0xaa, 0x03, 0x58, 0x26, 0xb1, 0x06, + 0x8a, 0x46, 0x54, 0x43, 0xcc, 0x2d, 0xc9, 0x52, 0x87, 0x42, 0xe6, 0xb2, 0x64, 0x71, 0xa9, 0x6a, + 0xa0, 0xcf, 0xa6, 0x54, 0x5b, 0x59, 0xc2, 0x94, 0x16, 0xdf, 0x64, 0x73, 0x6c, 0x3b, 0x86, 0x92, + 0x43, 0x28, 0xef, 0x89, 0xe6, 0xaf, 0x2c, 0xcf, 0x82, 0xa8, 0xbc, 0x72, 0x65, 0xb2, 0x6f, 0xc6, + 0x17, 0xb6, 0xea, 0x44, 0x87, 0xe8, 0x03, 0x08, 0x05, 0x0a, 0xa3, 0x15, 0xb0, 0x2a, 0x54, 0x0c, + 0x84, 0x6d, 0x3c, 0x26, 0xdb, 0xcf, 0xa1, 0x14, 0x4f, 0x0f, 0xda, 0x84, 0x8c, 0xeb, 0x61, 0xc7, + 0x63, 0x2c, 0xcc, 0xc8, 0x7c, 0x80, 0x04, 0x48, 0x11, 0x53, 0x63, 0x55, 0x2e, 0x23, 0xd3, 0x7f, + 0xd1, 0x8f, 0xa6, 0x0b, 0x4e, 0xb1, 0x05, 0x7f, 0x34, 0xff, 0x45, 0x63, 0x9e, 0x67, 0xd7, 0xbd, + 0x7d, 0x1b, 0x56, 0x63, 0x0b, 0x38, 0xeb, 0xd4, 0xe5, 0x5f, 0xc0, 0xdb, 0x0b, 0x5d, 0xa3, 0x07, + 0xb0, 0x39, 0x31, 0x75, 0xd3, 0x23, 0x8e, 0xed, 0x10, 0xca, 0x58, 0x3e, 0x95, 0xf8, 0x9f, 0x95, + 0x25, 0x9c, 0x3b, 0x8e, 0xa2, 0xb9, 0x17, 0x79, 0x63, 0x32, 0x2f, 0xbc, 0x9a, 0xcf, 0xfd, 0x77, + 0x45, 0x78, 0xf1, 0xe2, 0xc5, 0x8b, 0x64, 0xf9, 0x37, 0x59, 0xd8, 0x5c, 0xb4, 0x67, 0x16, 0x6e, + 0xdf, 0x2d, 0xc8, 0x9a, 0x93, 0xf1, 0x09, 0x71, 0x58, 0x92, 0x32, 0xb2, 0x3f, 0x42, 0x55, 0xc8, + 0x18, 0xf8, 0x84, 0x18, 0x62, 0x7a, 0x27, 0xb1, 0x5b, 0xda, 0xbb, 0x76, 0xa6, 0x5d, 0x59, 0x69, + 0x52, 0x13, 0x99, 0x5b, 0xa2, 0xcf, 0x21, 0xed, 0x97, 0x68, 0xea, 0xe1, 0xea, 0xd9, 0x3c, 0xd0, + 0xbd, 0x24, 0x33, 0x3b, 0xf4, 0x0e, 0xe4, 0xe9, 0x5f, 0xce, 0x8d, 0x2c, 0x8b, 0x39, 0x47, 0x05, + 0x94, 0x17, 0x68, 0x1b, 0x72, 0x6c, 0x9b, 0x68, 0x24, 0x38, 0xda, 0xc2, 0x31, 0x25, 0x96, 0x46, + 0x06, 0x78, 0x62, 0x78, 0xca, 0x13, 0x6c, 0x4c, 0x08, 0x23, 0x7c, 0x5e, 0x2e, 0xfa, 0xc2, 0x9f, + 0x52, 0x19, 0xba, 0x00, 0x05, 0xbe, 0xab, 0x74, 0x53, 0x23, 0xcf, 0x58, 0xf5, 0xcc, 0xc8, 0x7c, + 0xa3, 0x35, 0xa8, 0x84, 0x4e, 0xff, 0xc8, 0xb5, 0xcc, 0x80, 0x9a, 0x6c, 0x0a, 0x2a, 0x60, 0xd3, + 0xdf, 0x9e, 0x2d, 0xdc, 0xef, 0x2d, 0x5e, 0xde, 0x2c, 0xa7, 0xca, 0x7f, 0x4a, 0x42, 0x9a, 0xd5, + 0x8b, 0x35, 0x28, 0xf4, 0x1f, 0x76, 0x25, 0xa5, 0xde, 0x39, 0x3e, 0x6c, 0x4a, 0x42, 0x02, 0x95, + 0x00, 0x98, 0xe0, 0x5e, 0xb3, 0x53, 0xed, 0x0b, 0xc9, 0x70, 0xdc, 0x68, 0xf7, 0xf7, 0x6f, 0x0a, + 0xa9, 0xd0, 0xe0, 0x98, 0x0b, 0xd2, 0x51, 0xc0, 0x8d, 0x3d, 0x21, 0x83, 0x04, 0x28, 0x72, 0x07, + 0x8d, 0x07, 0x52, 0x7d, 0xff, 0xa6, 0x90, 0x8d, 0x4b, 0x6e, 0xec, 0x09, 0x2b, 0x68, 0x15, 0xf2, + 0x4c, 0x72, 0xd8, 0xe9, 0x34, 0x85, 0x5c, 0xe8, 0xb3, 0xd7, 0x97, 0x1b, 0xed, 0x23, 0x21, 0x1f, + 0xfa, 0x3c, 0x92, 0x3b, 0xc7, 0x5d, 0x01, 0x42, 0x0f, 0x2d, 0xa9, 0xd7, 0xab, 0x1e, 0x49, 0x42, + 0x21, 0x44, 0x1c, 0x3e, 0xec, 0x4b, 0x3d, 0xa1, 0x18, 0x0b, 0xeb, 0xc6, 0x9e, 0xb0, 0x1a, 0x4e, + 0x21, 0xb5, 0x8f, 0x5b, 0x42, 0x09, 0xad, 0xc3, 0x2a, 0x9f, 0x22, 0x08, 0x62, 0x6d, 0x46, 0xb4, + 0x7f, 0x53, 0x10, 0xa6, 0x81, 0x70, 0x2f, 0xeb, 0x31, 0xc1, 0xfe, 0x4d, 0x01, 0x95, 0x6b, 0x90, + 0x61, 0xec, 0x42, 0x08, 0x4a, 0xcd, 0xea, 0xa1, 0xd4, 0x54, 0x3a, 0xdd, 0x7e, 0xa3, 0xd3, 0xae, + 0x36, 0x85, 0xc4, 0x54, 0x26, 0x4b, 0x3f, 0x39, 0x6e, 0xc8, 0x52, 0x5d, 0x48, 0x46, 0x65, 0x5d, + 0xa9, 0xda, 0x97, 0xea, 0x42, 0xaa, 0xac, 0xc2, 0xe6, 0xa2, 0x3a, 0xb9, 0x70, 0x67, 0x44, 0x3e, + 0x71, 0x72, 0xc9, 0x27, 0x66, 0xbe, 0xe6, 0x3e, 0xf1, 0xbf, 0x92, 0xb0, 0xb1, 0xe0, 0xac, 0x58, + 0x38, 0xc9, 0x0f, 0x21, 0xc3, 0x29, 0xca, 0x4f, 0xcf, 0x2b, 0x0b, 0x0f, 0x1d, 0x46, 0xd8, 0xb9, + 0x13, 0x94, 0xd9, 0x45, 0x3b, 0x88, 0xd4, 0x92, 0x0e, 0x82, 0xba, 0x98, 0xab, 0xe9, 0x3f, 0x9f, + 0xab, 0xe9, 0xfc, 0xd8, 0xdb, 0x3f, 0xcb, 0xb1, 0xc7, 0x64, 0xdf, 0xae, 0xb6, 0x67, 0x16, 0xd4, + 0xf6, 0xbb, 0xb0, 0x3e, 0xe7, 0xe8, 0xcc, 0x35, 0xf6, 0x97, 0x09, 0x10, 0x97, 0x25, 0xe7, 0x15, + 0x95, 0x2e, 0x19, 0xab, 0x74, 0x77, 0x67, 0x33, 0x78, 0x71, 0xf9, 0x47, 0x98, 0xfb, 0xd6, 0xdf, + 0x24, 0x60, 0x6b, 0x71, 0xa7, 0xb8, 0x30, 0x86, 0xcf, 0x21, 0x3b, 0x26, 0xde, 0xc8, 0x0a, 0xba, + 0xa5, 0x8f, 0x16, 0x9c, 0xc1, 0x54, 0x3d, 0xfb, 0xb1, 0x7d, 0xab, 0xe8, 0x21, 0x9e, 0x5a, 0xd6, + 0xee, 0xf1, 0x68, 0xe6, 0x22, 0xfd, 0x55, 0x12, 0xde, 0x5e, 0xe8, 0x7c, 0x61, 0xa0, 0xef, 0x01, + 0xe8, 0xa6, 0x3d, 0xf1, 0x78, 0x47, 0xc4, 0x0b, 0x6c, 0x9e, 0x49, 0x58, 0xf1, 0xa2, 0xc5, 0x73, + 0xe2, 0x85, 0xfa, 0x14, 0xd3, 0x03, 0x17, 0x31, 0xc0, 0x9d, 0x69, 0xa0, 0x69, 0x16, 0xe8, 0xfb, + 0x4b, 0x56, 0x3a, 0x47, 0xcc, 0x4f, 0x41, 0x50, 0x0d, 0x9d, 0x98, 0x9e, 0xe2, 0x7a, 0x0e, 0xc1, + 0x63, 0xdd, 0x1c, 0xb2, 0x13, 0x24, 0x77, 0x90, 0x19, 0x60, 0xc3, 0x25, 0xf2, 0x1a, 0x57, 0xf7, + 0x02, 0x2d, 0xb5, 0x60, 0x04, 0x72, 0x22, 0x16, 0xd9, 0x98, 0x05, 0x57, 0x87, 0x16, 0xe5, 0x5f, + 0xe7, 0xa1, 0x10, 0xe9, 0xab, 0xd1, 0x45, 0x28, 0x3e, 0xc2, 0x4f, 0xb0, 0x12, 0xdc, 0x95, 0x78, + 0x26, 0x0a, 0x54, 0xd6, 0xf5, 0xef, 0x4b, 0x9f, 0xc2, 0x26, 0x83, 0x58, 0x13, 0x8f, 0x38, 0x8a, + 0x6a, 0x60, 0xd7, 0x65, 0x49, 0xcb, 0x31, 0x28, 0xa2, 0xba, 0x0e, 0x55, 0xd5, 0x02, 0x0d, 0xba, + 0x05, 0x1b, 0xcc, 0x62, 0x3c, 0x31, 0x3c, 0xdd, 0x36, 0x88, 0x42, 0x6f, 0x6f, 0x2e, 0x3b, 0x49, + 0xc2, 0xc8, 0xd6, 0x29, 0xa2, 0xe5, 0x03, 0x68, 0x44, 0x2e, 0xaa, 0xc3, 0x7b, 0xcc, 0x6c, 0x48, + 0x4c, 0xe2, 0x60, 0x8f, 0x28, 0xe4, 0xeb, 0x09, 0x36, 0x5c, 0x05, 0x9b, 0x9a, 0x32, 0xc2, 0xee, + 0x48, 0xdc, 0xa4, 0x0e, 0x0e, 0x93, 0x62, 0x42, 0x3e, 0x4f, 0x81, 0x47, 0x3e, 0x4e, 0x62, 0xb0, + 0xaa, 0xa9, 0x7d, 0x81, 0xdd, 0x11, 0x3a, 0x80, 0x2d, 0xe6, 0xc5, 0xf5, 0x1c, 0xdd, 0x1c, 0x2a, + 0xea, 0x88, 0xa8, 0x8f, 0x95, 0x89, 0x37, 0xb8, 0x23, 0xbe, 0x13, 0x9d, 0x9f, 0x45, 0xd8, 0x63, + 0x98, 0x1a, 0x85, 0x1c, 0x7b, 0x83, 0x3b, 0xa8, 0x07, 0x45, 0xfa, 0x31, 0xc6, 0xfa, 0x73, 0xa2, + 0x0c, 0x2c, 0x87, 0x1d, 0x8d, 0xa5, 0x05, 0xa5, 0x29, 0x92, 0xc1, 0x4a, 0xc7, 0x37, 0x68, 0x59, + 0x1a, 0x39, 0xc8, 0xf4, 0xba, 0x92, 0x54, 0x97, 0x0b, 0x81, 0x97, 0x7b, 0x96, 0x43, 0x09, 0x35, + 0xb4, 0xc2, 0x04, 0x17, 0x38, 0xa1, 0x86, 0x56, 0x90, 0xde, 0x5b, 0xb0, 0xa1, 0xaa, 0x7c, 0xcd, + 0xba, 0xaa, 0xf8, 0x77, 0x2c, 0x57, 0x14, 0x62, 0xc9, 0x52, 0xd5, 0x23, 0x0e, 0xf0, 0x39, 0xee, + 0xa2, 0xcf, 0xe0, 0xed, 0x69, 0xb2, 0xa2, 0x86, 0xeb, 0x73, 0xab, 0x9c, 0x35, 0xbd, 0x05, 0x1b, + 0xf6, 0xe9, 0xbc, 0x21, 0x8a, 0xcd, 0x68, 0x9f, 0xce, 0x9a, 0xdd, 0x86, 0x4d, 0x7b, 0x64, 0xcf, + 0xdb, 0x5d, 0x8d, 0xda, 0x21, 0x7b, 0x64, 0xcf, 0x1a, 0x5e, 0x62, 0x17, 0x6e, 0x87, 0xa8, 0xd8, + 0x23, 0x9a, 0x78, 0x2e, 0x0a, 0x8f, 0x28, 0xd0, 0x75, 0x10, 0x54, 0x55, 0x21, 0x26, 0x3e, 0x31, + 0x88, 0x82, 0x1d, 0x62, 0x62, 0x57, 0xbc, 0x10, 0x05, 0x97, 0x54, 0x55, 0x62, 0xda, 0x2a, 0x53, + 0xa2, 0xab, 0xb0, 0x6e, 0x9d, 0x3c, 0x52, 0x39, 0x25, 0x15, 0xdb, 0x21, 0x03, 0xfd, 0x99, 0xf8, + 0x21, 0xcb, 0xef, 0x1a, 0x55, 0x30, 0x42, 0x76, 0x99, 0x18, 0x5d, 0x01, 0x41, 0x75, 0x47, 0xd8, + 0xb1, 0x59, 0x4d, 0x76, 0x6d, 0xac, 0x12, 0xf1, 0x12, 0x87, 0x72, 0x79, 0x3b, 0x10, 0xd3, 0x2d, + 0xe1, 0x3e, 0xd5, 0x07, 0x5e, 0xe0, 0xf1, 0x32, 0xdf, 0x12, 0x4c, 0xe6, 0x7b, 0xdb, 0x05, 0x81, + 0xa6, 0x22, 0x36, 0xf1, 0x2e, 0x83, 0x95, 0xec, 0x91, 0x1d, 0x9d, 0xf7, 0x03, 0x58, 0xa5, 0xc8, + 0xe9, 0xa4, 0x57, 0x78, 0x43, 0x66, 0x8f, 0x22, 0x33, 0xde, 0x84, 0x2d, 0x0a, 0x1a, 0x13, 0x0f, + 0x6b, 0xd8, 0xc3, 0x11, 0xf4, 0xc7, 0x0c, 0x4d, 0xf3, 0xde, 0xf2, 0x95, 0xb1, 0x38, 0x9d, 0xc9, + 0xc9, 0x69, 0xc8, 0xac, 0x4f, 0x78, 0x9c, 0x54, 0x16, 0x70, 0xeb, 0xb5, 0x35, 0xdd, 0xe5, 0x03, + 0x28, 0x46, 0x89, 0x8f, 0xf2, 0xc0, 0xa9, 0x2f, 0x24, 0x68, 0x17, 0x54, 0xeb, 0xd4, 0x69, 0xff, + 0xf2, 0x95, 0x24, 0x24, 0x69, 0x1f, 0xd5, 0x6c, 0xf4, 0x25, 0x45, 0x3e, 0x6e, 0xf7, 0x1b, 0x2d, + 0x49, 0x48, 0x45, 0x1b, 0xf6, 0xbf, 0x26, 0xa1, 0x14, 0xbf, 0x7b, 0xa1, 0x1f, 0xc0, 0xb9, 0xe0, + 0xa1, 0xc4, 0x25, 0x9e, 0xf2, 0x54, 0x77, 0xd8, 0x5e, 0x1c, 0x63, 0x7e, 0x2e, 0x86, 0x6c, 0xd8, + 0xf4, 0x51, 0x3d, 0xe2, 0x7d, 0xa9, 0x3b, 0x74, 0xa7, 0x8d, 0xb1, 0x87, 0x9a, 0x70, 0xc1, 0xb4, + 0x14, 0xd7, 0xc3, 0xa6, 0x86, 0x1d, 0x4d, 0x99, 0x3e, 0x51, 0x29, 0x58, 0x55, 0x89, 0xeb, 0x5a, + 0xfc, 0x0c, 0x0c, 0xbd, 0xbc, 0x6b, 0x5a, 0x3d, 0x1f, 0x3c, 0x3d, 0x1c, 0xaa, 0x3e, 0x74, 0x86, + 0xb9, 0xa9, 0x65, 0xcc, 0x7d, 0x07, 0xf2, 0x63, 0x6c, 0x2b, 0xc4, 0xf4, 0x9c, 0x53, 0xd6, 0x71, + 0xe7, 0xe4, 0xdc, 0x18, 0xdb, 0x12, 0x1d, 0xbf, 0x99, 0x8b, 0xcf, 0x3f, 0x52, 0x50, 0x8c, 0x76, + 0xdd, 0xf4, 0x12, 0xa3, 0xb2, 0x03, 0x2a, 0xc1, 0x4a, 0xd8, 0x07, 0x2f, 0xed, 0xd1, 0x2b, 0x35, + 0x7a, 0x72, 0x1d, 0x64, 0x79, 0x2f, 0x2c, 0x73, 0x4b, 0xda, 0x35, 0x50, 0x6a, 0x11, 0xde, 0x7b, + 0xe4, 0x64, 0x7f, 0x84, 0x8e, 0x20, 0xfb, 0xc8, 0x65, 0xbe, 0xb3, 0xcc, 0xf7, 0x87, 0x2f, 0xf7, + 0x7d, 0xbf, 0xc7, 0x9c, 0xe7, 0xef, 0xf7, 0x94, 0x76, 0x47, 0x6e, 0x55, 0x9b, 0xb2, 0x6f, 0x8e, + 0xce, 0x43, 0xda, 0xc0, 0xcf, 0x4f, 0xe3, 0x67, 0x1c, 0x13, 0x9d, 0x35, 0xf1, 0xe7, 0x21, 0xfd, + 0x94, 0xe0, 0xc7, 0xf1, 0x93, 0x85, 0x89, 0x5e, 0x23, 0xf5, 0xaf, 0x43, 0x86, 0xe5, 0x0b, 0x01, + 0xf8, 0x19, 0x13, 0xde, 0x42, 0x39, 0x48, 0xd7, 0x3a, 0x32, 0xa5, 0xbf, 0x00, 0x45, 0x2e, 0x55, + 0xba, 0x0d, 0xa9, 0x26, 0x09, 0xc9, 0xf2, 0x2d, 0xc8, 0xf2, 0x24, 0xd0, 0xad, 0x11, 0xa6, 0x41, + 0x78, 0xcb, 0x1f, 0xfa, 0x3e, 0x12, 0x81, 0xf6, 0xb8, 0x75, 0x28, 0xc9, 0x42, 0x32, 0xfa, 0x79, + 0x5d, 0x28, 0x46, 0x1b, 0xee, 0x37, 0xc3, 0xa9, 0xbf, 0x24, 0xa0, 0x10, 0x69, 0xa0, 0x69, 0xe7, + 0x83, 0x0d, 0xc3, 0x7a, 0xaa, 0x60, 0x43, 0xc7, 0xae, 0x4f, 0x0a, 0x60, 0xa2, 0x2a, 0x95, 0x9c, + 0xf5, 0xa3, 0xbd, 0x91, 0xe0, 0x7f, 0x9f, 0x00, 0x61, 0xb6, 0x77, 0x9d, 0x09, 0x30, 0xf1, 0xbd, + 0x06, 0xf8, 0xbb, 0x04, 0x94, 0xe2, 0x0d, 0xeb, 0x4c, 0x78, 0x17, 0xbf, 0xd7, 0xf0, 0xfe, 0x99, + 0x84, 0xd5, 0x58, 0x9b, 0x7a, 0xd6, 0xe8, 0xbe, 0x86, 0x75, 0x5d, 0x23, 0x63, 0xdb, 0xf2, 0x88, + 0xa9, 0x9e, 0x2a, 0x06, 0x79, 0x42, 0x0c, 0xb1, 0xcc, 0x0a, 0xc5, 0xf5, 0x97, 0x37, 0xc2, 0x95, + 0xc6, 0xd4, 0xae, 0x49, 0xcd, 0x0e, 0x36, 0x1a, 0x75, 0xa9, 0xd5, 0xed, 0xf4, 0xa5, 0x76, 0xed, + 0xa1, 0x72, 0xdc, 0xfe, 0x71, 0xbb, 0xf3, 0x65, 0x5b, 0x16, 0xf4, 0x19, 0xd8, 0x6b, 0xdc, 0xea, + 0x5d, 0x10, 0x66, 0x83, 0x42, 0xe7, 0x60, 0x51, 0x58, 0xc2, 0x5b, 0x68, 0x03, 0xd6, 0xda, 0x1d, + 0xa5, 0xd7, 0xa8, 0x4b, 0x8a, 0x74, 0xef, 0x9e, 0x54, 0xeb, 0xf7, 0xf8, 0xd3, 0x46, 0x88, 0xee, + 0xc7, 0x37, 0xf5, 0x6f, 0x53, 0xb0, 0xb1, 0x20, 0x12, 0x54, 0xf5, 0x2f, 0x25, 0xfc, 0x9e, 0xf4, + 0xc9, 0x59, 0xa2, 0xaf, 0xd0, 0xae, 0xa0, 0x8b, 0x1d, 0xcf, 0xbf, 0xc3, 0x5c, 0x01, 0x9a, 0x25, + 0xd3, 0xd3, 0x07, 0x3a, 0x71, 0xfc, 0x97, 0x20, 0x7e, 0x53, 0x59, 0x9b, 0xca, 0xf9, 0x63, 0xd0, + 0xc7, 0x80, 0x6c, 0xcb, 0xd5, 0x3d, 0xfd, 0x09, 0x51, 0x74, 0x33, 0x78, 0x36, 0xa2, 0x37, 0x97, + 0xb4, 0x2c, 0x04, 0x9a, 0x86, 0xe9, 0x85, 0x68, 0x93, 0x0c, 0xf1, 0x0c, 0x9a, 0x16, 0xf0, 0x94, + 0x2c, 0x04, 0x9a, 0x10, 0x7d, 0x11, 0x8a, 0x9a, 0x35, 0xa1, 0xed, 0x1c, 0xc7, 0xd1, 0xf3, 0x22, + 0x21, 0x17, 0xb8, 0x2c, 0x84, 0xf8, 0x8d, 0xfa, 0xf4, 0xbd, 0xaa, 0x28, 0x17, 0xb8, 0x8c, 0x43, + 0x2e, 0xc3, 0x1a, 0x1e, 0x0e, 0x1d, 0xea, 0x3c, 0x70, 0xc4, 0xaf, 0x1e, 0xa5, 0x50, 0xcc, 0x80, + 0xdb, 0xf7, 0x21, 0x17, 0xe4, 0x81, 0x1e, 0xc9, 0x34, 0x13, 0x8a, 0xcd, 0xef, 0xd3, 0xc9, 0xdd, + 0xbc, 0x9c, 0x33, 0x03, 0xe5, 0x45, 0x28, 0xea, 0xae, 0x32, 0x7d, 0x7e, 0x4f, 0xee, 0x24, 0x77, + 0x73, 0x72, 0x41, 0x77, 0xc3, 0xa7, 0xcb, 0xf2, 0x37, 0x49, 0x28, 0xc5, 0x7f, 0x3e, 0x40, 0x75, + 0xc8, 0x19, 0x96, 0x8a, 0x19, 0xb5, 0xf8, 0x6f, 0x57, 0xbb, 0xaf, 0xf8, 0xc5, 0xa1, 0xd2, 0xf4, + 0xf1, 0x72, 0x68, 0xb9, 0xfd, 0xb7, 0x04, 0xe4, 0x02, 0x31, 0xda, 0x82, 0xb4, 0x8d, 0xbd, 0x11, + 0x73, 0x97, 0x39, 0x4c, 0x0a, 0x09, 0x99, 0x8d, 0xa9, 0xdc, 0xb5, 0xb1, 0xc9, 0x28, 0xe0, 0xcb, + 0xe9, 0x98, 0x7e, 0x57, 0x83, 0x60, 0x8d, 0xdd, 0x6b, 0xac, 0xf1, 0x98, 0x98, 0x9e, 0x1b, 0x7c, + 0x57, 0x5f, 0x5e, 0xf3, 0xc5, 0xe8, 0x1a, 0xac, 0x7b, 0x0e, 0xd6, 0x8d, 0x18, 0x36, 0xcd, 0xb0, + 0x42, 0xa0, 0x08, 0xc1, 0x07, 0x70, 0x3e, 0xf0, 0xab, 0x11, 0x0f, 0xab, 0x23, 0xa2, 0x4d, 0x8d, + 0xb2, 0xec, 0xfd, 0xe2, 0x9c, 0x0f, 0xa8, 0xfb, 0xfa, 0xc0, 0xb6, 0xfc, 0xf7, 0x04, 0xac, 0x07, + 0x37, 0x31, 0x2d, 0x4c, 0x56, 0x0b, 0x00, 0x9b, 0xa6, 0xe5, 0x45, 0xd3, 0x35, 0x4f, 0xe5, 0x39, + 0xbb, 0x4a, 0x35, 0x34, 0x92, 0x23, 0x0e, 0xb6, 0xc7, 0x00, 0x53, 0xcd, 0xd2, 0xb4, 0x5d, 0x80, + 0x82, 0xff, 0xdb, 0x10, 0xfb, 0x81, 0x91, 0xdf, 0xdd, 0x81, 0x8b, 0xe8, 0x95, 0x0d, 0x6d, 0x42, + 0xe6, 0x84, 0x0c, 0x75, 0xd3, 0x7f, 0xf1, 0xe5, 0x83, 0xe0, 0x85, 0x25, 0x1d, 0xbe, 0xb0, 0x1c, + 0xfe, 0x0c, 0x36, 0x54, 0x6b, 0x3c, 0x1b, 0xee, 0xa1, 0x30, 0xf3, 0x7e, 0xe0, 0x7e, 0x91, 0xf8, + 0x0a, 0xa6, 0x2d, 0xe6, 0xff, 0x12, 0x89, 0x3f, 0x24, 0x53, 0x47, 0xdd, 0xc3, 0x3f, 0x26, 0xb7, + 0x8f, 0xb8, 0x69, 0x37, 0x58, 0xa9, 0x4c, 0x06, 0x06, 0x51, 0x69, 0xf4, 0xff, 0x0f, 0x00, 0x00, + 0xff, 0xff, 0x88, 0x17, 0xc1, 0xbe, 0x38, 0x1d, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go new file mode 100644 index 000000000..165b2110d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go @@ -0,0 +1,752 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + github_com_gogo_protobuf_proto "github.com/gogo/protobuf/proto" + proto "github.com/gogo/protobuf/proto" + math "math" + reflect "reflect" + sort "sort" + strconv "strconv" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +func (this *FileDescriptorSet) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.FileDescriptorSet{") + if this.File != nil { + s = append(s, "File: "+fmt.Sprintf("%#v", this.File)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 16) + s = append(s, "&descriptor.FileDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Package != nil { + s = append(s, "Package: "+valueToGoStringDescriptor(this.Package, "string")+",\n") + } + if this.Dependency != nil { + s = append(s, "Dependency: "+fmt.Sprintf("%#v", this.Dependency)+",\n") + } + if this.PublicDependency != nil { + s = append(s, "PublicDependency: "+fmt.Sprintf("%#v", this.PublicDependency)+",\n") + } + if this.WeakDependency != nil { + s = append(s, "WeakDependency: "+fmt.Sprintf("%#v", this.WeakDependency)+",\n") + } + if this.MessageType != nil { + s = append(s, "MessageType: "+fmt.Sprintf("%#v", this.MessageType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.Service != nil { + s = append(s, "Service: "+fmt.Sprintf("%#v", this.Service)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.SourceCodeInfo != nil { + s = append(s, "SourceCodeInfo: "+fmt.Sprintf("%#v", this.SourceCodeInfo)+",\n") + } + if this.Syntax != nil { + s = append(s, "Syntax: "+valueToGoStringDescriptor(this.Syntax, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.DescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Field != nil { + s = append(s, "Field: "+fmt.Sprintf("%#v", this.Field)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.NestedType != nil { + s = append(s, "NestedType: "+fmt.Sprintf("%#v", this.NestedType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.ExtensionRange != nil { + s = append(s, "ExtensionRange: "+fmt.Sprintf("%#v", this.ExtensionRange)+",\n") + } + if this.OneofDecl != nil { + s = append(s, "OneofDecl: "+fmt.Sprintf("%#v", this.OneofDecl)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ExtensionRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.DescriptorProto_ExtensionRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.DescriptorProto_ReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ExtensionRangeOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.ExtensionRangeOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.FieldDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Label != nil { + s = append(s, "Label: "+valueToGoStringDescriptor(this.Label, "FieldDescriptorProto_Label")+",\n") + } + if this.Type != nil { + s = append(s, "Type: "+valueToGoStringDescriptor(this.Type, "FieldDescriptorProto_Type")+",\n") + } + if this.TypeName != nil { + s = append(s, "TypeName: "+valueToGoStringDescriptor(this.TypeName, "string")+",\n") + } + if this.Extendee != nil { + s = append(s, "Extendee: "+valueToGoStringDescriptor(this.Extendee, "string")+",\n") + } + if this.DefaultValue != nil { + s = append(s, "DefaultValue: "+valueToGoStringDescriptor(this.DefaultValue, "string")+",\n") + } + if this.OneofIndex != nil { + s = append(s, "OneofIndex: "+valueToGoStringDescriptor(this.OneofIndex, "int32")+",\n") + } + if this.JsonName != nil { + s = append(s, "JsonName: "+valueToGoStringDescriptor(this.JsonName, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.OneofDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.EnumDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Value != nil { + s = append(s, "Value: "+fmt.Sprintf("%#v", this.Value)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto_EnumReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumDescriptorProto_EnumReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumValueDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.ServiceDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Method != nil { + s = append(s, "Method: "+fmt.Sprintf("%#v", this.Method)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 10) + s = append(s, "&descriptor.MethodDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.InputType != nil { + s = append(s, "InputType: "+valueToGoStringDescriptor(this.InputType, "string")+",\n") + } + if this.OutputType != nil { + s = append(s, "OutputType: "+valueToGoStringDescriptor(this.OutputType, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ClientStreaming != nil { + s = append(s, "ClientStreaming: "+valueToGoStringDescriptor(this.ClientStreaming, "bool")+",\n") + } + if this.ServerStreaming != nil { + s = append(s, "ServerStreaming: "+valueToGoStringDescriptor(this.ServerStreaming, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 25) + s = append(s, "&descriptor.FileOptions{") + if this.JavaPackage != nil { + s = append(s, "JavaPackage: "+valueToGoStringDescriptor(this.JavaPackage, "string")+",\n") + } + if this.JavaOuterClassname != nil { + s = append(s, "JavaOuterClassname: "+valueToGoStringDescriptor(this.JavaOuterClassname, "string")+",\n") + } + if this.JavaMultipleFiles != nil { + s = append(s, "JavaMultipleFiles: "+valueToGoStringDescriptor(this.JavaMultipleFiles, "bool")+",\n") + } + if this.JavaGenerateEqualsAndHash != nil { + s = append(s, "JavaGenerateEqualsAndHash: "+valueToGoStringDescriptor(this.JavaGenerateEqualsAndHash, "bool")+",\n") + } + if this.JavaStringCheckUtf8 != nil { + s = append(s, "JavaStringCheckUtf8: "+valueToGoStringDescriptor(this.JavaStringCheckUtf8, "bool")+",\n") + } + if this.OptimizeFor != nil { + s = append(s, "OptimizeFor: "+valueToGoStringDescriptor(this.OptimizeFor, "FileOptions_OptimizeMode")+",\n") + } + if this.GoPackage != nil { + s = append(s, "GoPackage: "+valueToGoStringDescriptor(this.GoPackage, "string")+",\n") + } + if this.CcGenericServices != nil { + s = append(s, "CcGenericServices: "+valueToGoStringDescriptor(this.CcGenericServices, "bool")+",\n") + } + if this.JavaGenericServices != nil { + s = append(s, "JavaGenericServices: "+valueToGoStringDescriptor(this.JavaGenericServices, "bool")+",\n") + } + if this.PyGenericServices != nil { + s = append(s, "PyGenericServices: "+valueToGoStringDescriptor(this.PyGenericServices, "bool")+",\n") + } + if this.PhpGenericServices != nil { + s = append(s, "PhpGenericServices: "+valueToGoStringDescriptor(this.PhpGenericServices, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.CcEnableArenas != nil { + s = append(s, "CcEnableArenas: "+valueToGoStringDescriptor(this.CcEnableArenas, "bool")+",\n") + } + if this.ObjcClassPrefix != nil { + s = append(s, "ObjcClassPrefix: "+valueToGoStringDescriptor(this.ObjcClassPrefix, "string")+",\n") + } + if this.CsharpNamespace != nil { + s = append(s, "CsharpNamespace: "+valueToGoStringDescriptor(this.CsharpNamespace, "string")+",\n") + } + if this.SwiftPrefix != nil { + s = append(s, "SwiftPrefix: "+valueToGoStringDescriptor(this.SwiftPrefix, "string")+",\n") + } + if this.PhpClassPrefix != nil { + s = append(s, "PhpClassPrefix: "+valueToGoStringDescriptor(this.PhpClassPrefix, "string")+",\n") + } + if this.PhpNamespace != nil { + s = append(s, "PhpNamespace: "+valueToGoStringDescriptor(this.PhpNamespace, "string")+",\n") + } + if this.PhpMetadataNamespace != nil { + s = append(s, "PhpMetadataNamespace: "+valueToGoStringDescriptor(this.PhpMetadataNamespace, "string")+",\n") + } + if this.RubyPackage != nil { + s = append(s, "RubyPackage: "+valueToGoStringDescriptor(this.RubyPackage, "string")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MessageOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.MessageOptions{") + if this.MessageSetWireFormat != nil { + s = append(s, "MessageSetWireFormat: "+valueToGoStringDescriptor(this.MessageSetWireFormat, "bool")+",\n") + } + if this.NoStandardDescriptorAccessor != nil { + s = append(s, "NoStandardDescriptorAccessor: "+valueToGoStringDescriptor(this.NoStandardDescriptorAccessor, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.MapEntry != nil { + s = append(s, "MapEntry: "+valueToGoStringDescriptor(this.MapEntry, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.FieldOptions{") + if this.Ctype != nil { + s = append(s, "Ctype: "+valueToGoStringDescriptor(this.Ctype, "FieldOptions_CType")+",\n") + } + if this.Packed != nil { + s = append(s, "Packed: "+valueToGoStringDescriptor(this.Packed, "bool")+",\n") + } + if this.Jstype != nil { + s = append(s, "Jstype: "+valueToGoStringDescriptor(this.Jstype, "FieldOptions_JSType")+",\n") + } + if this.Lazy != nil { + s = append(s, "Lazy: "+valueToGoStringDescriptor(this.Lazy, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.Weak != nil { + s = append(s, "Weak: "+valueToGoStringDescriptor(this.Weak, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.OneofOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumOptions{") + if this.AllowAlias != nil { + s = append(s, "AllowAlias: "+valueToGoStringDescriptor(this.AllowAlias, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumValueOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.ServiceOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.MethodOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.IdempotencyLevel != nil { + s = append(s, "IdempotencyLevel: "+valueToGoStringDescriptor(this.IdempotencyLevel, "MethodOptions_IdempotencyLevel")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.UninterpretedOption{") + if this.Name != nil { + s = append(s, "Name: "+fmt.Sprintf("%#v", this.Name)+",\n") + } + if this.IdentifierValue != nil { + s = append(s, "IdentifierValue: "+valueToGoStringDescriptor(this.IdentifierValue, "string")+",\n") + } + if this.PositiveIntValue != nil { + s = append(s, "PositiveIntValue: "+valueToGoStringDescriptor(this.PositiveIntValue, "uint64")+",\n") + } + if this.NegativeIntValue != nil { + s = append(s, "NegativeIntValue: "+valueToGoStringDescriptor(this.NegativeIntValue, "int64")+",\n") + } + if this.DoubleValue != nil { + s = append(s, "DoubleValue: "+valueToGoStringDescriptor(this.DoubleValue, "float64")+",\n") + } + if this.StringValue != nil { + s = append(s, "StringValue: "+valueToGoStringDescriptor(this.StringValue, "byte")+",\n") + } + if this.AggregateValue != nil { + s = append(s, "AggregateValue: "+valueToGoStringDescriptor(this.AggregateValue, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption_NamePart) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.UninterpretedOption_NamePart{") + if this.NamePart != nil { + s = append(s, "NamePart: "+valueToGoStringDescriptor(this.NamePart, "string")+",\n") + } + if this.IsExtension != nil { + s = append(s, "IsExtension: "+valueToGoStringDescriptor(this.IsExtension, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.SourceCodeInfo{") + if this.Location != nil { + s = append(s, "Location: "+fmt.Sprintf("%#v", this.Location)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo_Location) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.SourceCodeInfo_Location{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.Span != nil { + s = append(s, "Span: "+fmt.Sprintf("%#v", this.Span)+",\n") + } + if this.LeadingComments != nil { + s = append(s, "LeadingComments: "+valueToGoStringDescriptor(this.LeadingComments, "string")+",\n") + } + if this.TrailingComments != nil { + s = append(s, "TrailingComments: "+valueToGoStringDescriptor(this.TrailingComments, "string")+",\n") + } + if this.LeadingDetachedComments != nil { + s = append(s, "LeadingDetachedComments: "+fmt.Sprintf("%#v", this.LeadingDetachedComments)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.GeneratedCodeInfo{") + if this.Annotation != nil { + s = append(s, "Annotation: "+fmt.Sprintf("%#v", this.Annotation)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo_Annotation) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 8) + s = append(s, "&descriptor.GeneratedCodeInfo_Annotation{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.SourceFile != nil { + s = append(s, "SourceFile: "+valueToGoStringDescriptor(this.SourceFile, "string")+",\n") + } + if this.Begin != nil { + s = append(s, "Begin: "+valueToGoStringDescriptor(this.Begin, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func valueToGoStringDescriptor(v interface{}, typ string) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("func(v %v) *%v { return &v } ( %#v )", typ, typ, pv) +} +func extensionToGoStringDescriptor(m github_com_gogo_protobuf_proto.Message) string { + e := github_com_gogo_protobuf_proto.GetUnsafeExtensionsMap(m) + if e == nil { + return "nil" + } + s := "proto.NewUnsafeXXX_InternalExtensions(map[int32]proto.Extension{" + keys := make([]int, 0, len(e)) + for k := range e { + keys = append(keys, int(k)) + } + sort.Ints(keys) + ss := []string{} + for _, k := range keys { + ss = append(ss, strconv.Itoa(k)+": "+e[int32(k)].GoString()) + } + s += strings.Join(ss, ",") + "})" + return s +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go new file mode 100644 index 000000000..e0846a357 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go @@ -0,0 +1,390 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package descriptor + +import ( + "strings" +) + +func (msg *DescriptorProto) GetMapFields() (*FieldDescriptorProto, *FieldDescriptorProto) { + if !msg.GetOptions().GetMapEntry() { + return nil, nil + } + return msg.GetField()[0], msg.GetField()[1] +} + +func dotToUnderscore(r rune) rune { + if r == '.' { + return '_' + } + return r +} + +func (field *FieldDescriptorProto) WireType() (wire int) { + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE: + return 1 + case FieldDescriptorProto_TYPE_FLOAT: + return 5 + case FieldDescriptorProto_TYPE_INT64: + return 0 + case FieldDescriptorProto_TYPE_UINT64: + return 0 + case FieldDescriptorProto_TYPE_INT32: + return 0 + case FieldDescriptorProto_TYPE_UINT32: + return 0 + case FieldDescriptorProto_TYPE_FIXED64: + return 1 + case FieldDescriptorProto_TYPE_FIXED32: + return 5 + case FieldDescriptorProto_TYPE_BOOL: + return 0 + case FieldDescriptorProto_TYPE_STRING: + return 2 + case FieldDescriptorProto_TYPE_GROUP: + return 2 + case FieldDescriptorProto_TYPE_MESSAGE: + return 2 + case FieldDescriptorProto_TYPE_BYTES: + return 2 + case FieldDescriptorProto_TYPE_ENUM: + return 0 + case FieldDescriptorProto_TYPE_SFIXED32: + return 5 + case FieldDescriptorProto_TYPE_SFIXED64: + return 1 + case FieldDescriptorProto_TYPE_SINT32: + return 0 + case FieldDescriptorProto_TYPE_SINT64: + return 0 + } + panic("unreachable") +} + +func (field *FieldDescriptorProto) GetKeyUint64() (x uint64) { + packed := field.IsPacked() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey3Uint64() (x uint64) { + packed := field.IsPacked3() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey() []byte { + x := field.GetKeyUint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (field *FieldDescriptorProto) GetKey3() []byte { + x := field.GetKey3Uint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (desc *FileDescriptorSet) GetField(packageName, messageName, fieldName string) *FieldDescriptorProto { + msg := desc.GetMessage(packageName, messageName) + if msg == nil { + return nil + } + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (file *FileDescriptorProto) GetMessage(typeName string) *DescriptorProto { + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + nes := file.GetNestedMessage(msg, strings.TrimPrefix(typeName, msg.GetName()+".")) + if nes != nil { + return nes + } + } + return nil +} + +func (file *FileDescriptorProto) GetNestedMessage(msg *DescriptorProto, typeName string) *DescriptorProto { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + res := file.GetNestedMessage(nes, strings.TrimPrefix(typeName, nes.GetName()+".")) + if res != nil { + return res + } + } + return nil +} + +func (desc *FileDescriptorSet) GetMessage(packageName string, typeName string) *DescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + if msg.GetName()+"."+nes.GetName() == typeName { + return nes + } + } + } + } + return nil +} + +func (desc *FileDescriptorSet) IsProto3(packageName string, typeName string) bool { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + if msg.GetName()+"."+nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + } + } + return false +} + +func (msg *DescriptorProto) IsExtendable() bool { + return len(msg.GetExtensionRange()) > 0 +} + +func (desc *FileDescriptorSet) FindExtension(packageName string, typeName string, fieldName string) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetName() == fieldName { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindExtensionByFieldNumber(packageName string, typeName string, fieldNum int32) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetNumber() == fieldNum { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindMessage(packageName string, typeName string, fieldName string) (msgPackageName string, msgName string) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", "" + } + field := parent.GetFieldDescriptor(fieldName) + if field == nil { + var extPackageName string + extPackageName, field = desc.FindExtension(packageName, typeName, fieldName) + if field == nil { + return "", "" + } + packageName = extPackageName + } + typeNames := strings.Split(field.GetTypeName(), ".") + if len(typeNames) == 1 { + msg := desc.GetMessage(packageName, typeName) + if msg == nil { + return "", "" + } + return packageName, msg.GetName() + } + if len(typeNames) > 2 { + for i := 1; i < len(typeNames)-1; i++ { + packageName = strings.Join(typeNames[1:len(typeNames)-i], ".") + typeName = strings.Join(typeNames[len(typeNames)-i:], ".") + msg := desc.GetMessage(packageName, typeName) + if msg != nil { + typeNames := strings.Split(msg.GetName(), ".") + if len(typeNames) == 1 { + return packageName, msg.GetName() + } + return strings.Join(typeNames[1:len(typeNames)-1], "."), typeNames[len(typeNames)-1] + } + } + } + return "", "" +} + +func (msg *DescriptorProto) GetFieldDescriptor(fieldName string) *FieldDescriptorProto { + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (desc *FileDescriptorSet) GetEnum(packageName string, typeName string) *EnumDescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, enum := range file.GetEnumType() { + if enum.GetName() == typeName { + return enum + } + } + } + return nil +} + +func (f *FieldDescriptorProto) IsEnum() bool { + return *f.Type == FieldDescriptorProto_TYPE_ENUM +} + +func (f *FieldDescriptorProto) IsMessage() bool { + return *f.Type == FieldDescriptorProto_TYPE_MESSAGE +} + +func (f *FieldDescriptorProto) IsBytes() bool { + return *f.Type == FieldDescriptorProto_TYPE_BYTES +} + +func (f *FieldDescriptorProto) IsRepeated() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REPEATED +} + +func (f *FieldDescriptorProto) IsString() bool { + return *f.Type == FieldDescriptorProto_TYPE_STRING +} + +func (f *FieldDescriptorProto) IsBool() bool { + return *f.Type == FieldDescriptorProto_TYPE_BOOL +} + +func (f *FieldDescriptorProto) IsRequired() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REQUIRED +} + +func (f *FieldDescriptorProto) IsPacked() bool { + return f.Options != nil && f.GetOptions().GetPacked() +} + +func (f *FieldDescriptorProto) IsPacked3() bool { + if f.IsRepeated() && f.IsScalar() { + if f.Options == nil || f.GetOptions().Packed == nil { + return true + } + return f.Options != nil && f.GetOptions().GetPacked() + } + return false +} + +func (m *DescriptorProto) HasExtension() bool { + return len(m.ExtensionRange) > 0 +} diff --git a/vendor/github.com/hashicorp/golang-lru/LICENSE b/vendor/github.com/hashicorp/golang-lru/LICENSE new file mode 100644 index 000000000..be2cc4dfb --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/LICENSE @@ -0,0 +1,362 @@ +Mozilla Public License, version 2.0 + +1. Definitions + +1.1. "Contributor" + + means each individual or legal entity that creates, contributes to the + creation of, or owns Covered Software. + +1.2. "Contributor Version" + + means the combination of the Contributions of others (if any) used by a + Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + + means Source Code Form to which the initial Contributor has attached the + notice in Exhibit A, the Executable Form of such Source Code Form, and + Modifications of such Source Code Form, in each case including portions + thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + a. that the initial Contributor has attached the notice described in + Exhibit B to the Covered Software; or + + b. that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the terms of + a Secondary License. + +1.6. "Executable Form" + + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + + means a work that combines Covered Software with other material, in a + separate file or files, that is not Covered Software. + +1.8. "License" + + means this document. + +1.9. "Licensable" + + means having the right to grant, to the maximum extent possible, whether + at the time of the initial grant or subsequently, any and all of the + rights conveyed by this License. + +1.10. "Modifications" + + means any of the following: + + a. any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered Software; or + + b. any new file in Source Code Form that contains any Covered Software. + +1.11. "Patent Claims" of a Contributor + + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the License, + by the making, using, selling, offering for sale, having made, import, + or transfer of either its Contributions or its Contributor Version. + +1.12. "Secondary License" + + means either the GNU General Public License, Version 2.0, the GNU Lesser + General Public License, Version 2.1, the GNU Affero General Public + License, Version 3.0, or any later versions of those licenses. + +1.13. "Source Code Form" + + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that controls, is + controlled by, or is under common control with You. For purposes of this + definition, "control" means (a) the power, direct or indirect, to cause + the direction or management of such entity, whether by contract or + otherwise, or (b) ownership of more than fifty percent (50%) of the + outstanding shares or beneficial ownership of such entity. + + +2. License Grants and Conditions + +2.1. Grants + + Each Contributor hereby grants You a world-wide, royalty-free, + non-exclusive license: + + a. under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + + b. under Patent Claims of such Contributor to make, use, sell, offer for + sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + + The licenses granted in Section 2.1 with respect to any Contribution + become effective for each Contribution on the date the Contributor first + distributes such Contribution. + +2.3. Limitations on Grant Scope + + The licenses granted in this Section 2 are the only rights granted under + this License. No additional rights or licenses will be implied from the + distribution or licensing of Covered Software under this License. + Notwithstanding Section 2.1(b) above, no patent license is granted by a + Contributor: + + a. for any code that a Contributor has removed from Covered Software; or + + b. for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + + c. under Patent Claims infringed by Covered Software in the absence of + its Contributions. + + This License does not grant any rights in the trademarks, service marks, + or logos of any Contributor (except as may be necessary to comply with + the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + + No Contributor makes additional grants as a result of Your choice to + distribute the Covered Software under a subsequent version of this + License (see Section 10.2) or under the terms of a Secondary License (if + permitted under the terms of Section 3.3). + +2.5. Representation + + Each Contributor represents that the Contributor believes its + Contributions are its original creation(s) or it has sufficient rights to + grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + + This License is not intended to limit any rights You have under + applicable copyright doctrines of fair use, fair dealing, or other + equivalents. + +2.7. Conditions + + Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted in + Section 2.1. + + +3. Responsibilities + +3.1. Distribution of Source Form + + All distribution of Covered Software in Source Code Form, including any + Modifications that You create or to which You contribute, must be under + the terms of this License. You must inform recipients that the Source + Code Form of the Covered Software is governed by the terms of this + License, and how they can obtain a copy of this License. You may not + attempt to alter or restrict the recipients' rights in the Source Code + Form. + +3.2. Distribution of Executable Form + + If You distribute Covered Software in Executable Form then: + + a. such Covered Software must also be made available in Source Code Form, + as described in Section 3.1, and You must inform recipients of the + Executable Form how they can obtain a copy of such Source Code Form by + reasonable means in a timely manner, at a charge no more than the cost + of distribution to the recipient; and + + b. You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter the + recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + + You may create and distribute a Larger Work under terms of Your choice, + provided that You also comply with the requirements of this License for + the Covered Software. If the Larger Work is a combination of Covered + Software with a work governed by one or more Secondary Licenses, and the + Covered Software is not Incompatible With Secondary Licenses, this + License permits You to additionally distribute such Covered Software + under the terms of such Secondary License(s), so that the recipient of + the Larger Work may, at their option, further distribute the Covered + Software under the terms of either this License or such Secondary + License(s). + +3.4. Notices + + You may not remove or alter the substance of any license notices + (including copyright notices, patent notices, disclaimers of warranty, or + limitations of liability) contained within the Source Code Form of the + Covered Software, except that You may alter any license notices to the + extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + + You may choose to offer, and to charge a fee for, warranty, support, + indemnity or liability obligations to one or more recipients of Covered + Software. However, You may do so only on Your own behalf, and not on + behalf of any Contributor. You must make it absolutely clear that any + such warranty, support, indemnity, or liability obligation is offered by + You alone, and You hereby agree to indemnify every Contributor for any + liability incurred by such Contributor as a result of warranty, support, + indemnity or liability terms You offer. You may include additional + disclaimers of warranty and limitations of liability specific to any + jurisdiction. + +4. Inability to Comply Due to Statute or Regulation + + If it is impossible for You to comply with any of the terms of this License + with respect to some or all of the Covered Software due to statute, + judicial order, or regulation then You must: (a) comply with the terms of + this License to the maximum extent possible; and (b) describe the + limitations and the code they affect. Such description must be placed in a + text file included with all distributions of the Covered Software under + this License. Except to the extent prohibited by statute or regulation, + such description must be sufficiently detailed for a recipient of ordinary + skill to be able to understand it. + +5. Termination + +5.1. The rights granted under this License will terminate automatically if You + fail to comply with any of its terms. However, if You become compliant, + then the rights granted under this License from a particular Contributor + are reinstated (a) provisionally, unless and until such Contributor + explicitly and finally terminates Your grants, and (b) on an ongoing + basis, if such Contributor fails to notify You of the non-compliance by + some reasonable means prior to 60 days after You have come back into + compliance. Moreover, Your grants from a particular Contributor are + reinstated on an ongoing basis if such Contributor notifies You of the + non-compliance by some reasonable means, this is the first time You have + received notice of non-compliance with this License from such + Contributor, and You become compliant prior to 30 days after Your receipt + of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent + infringement claim (excluding declaratory judgment actions, + counter-claims, and cross-claims) alleging that a Contributor Version + directly or indirectly infringes any patent, then the rights granted to + You by any and all Contributors for the Covered Software under Section + 2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all end user + license agreements (excluding distributors and resellers) which have been + validly granted by You or Your distributors under this License prior to + termination shall survive termination. + +6. Disclaimer of Warranty + + Covered Software is provided under this License on an "as is" basis, + without warranty of any kind, either expressed, implied, or statutory, + including, without limitation, warranties that the Covered Software is free + of defects, merchantable, fit for a particular purpose or non-infringing. + The entire risk as to the quality and performance of the Covered Software + is with You. Should any Covered Software prove defective in any respect, + You (not any Contributor) assume the cost of any necessary servicing, + repair, or correction. This disclaimer of warranty constitutes an essential + part of this License. No use of any Covered Software is authorized under + this License except under this disclaimer. + +7. Limitation of Liability + + Under no circumstances and under no legal theory, whether tort (including + negligence), contract, or otherwise, shall any Contributor, or anyone who + distributes Covered Software as permitted above, be liable to You for any + direct, indirect, special, incidental, or consequential damages of any + character including, without limitation, damages for lost profits, loss of + goodwill, work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses, even if such party shall have been + informed of the possibility of such damages. This limitation of liability + shall not apply to liability for death or personal injury resulting from + such party's negligence to the extent applicable law prohibits such + limitation. Some jurisdictions do not allow the exclusion or limitation of + incidental or consequential damages, so this exclusion and limitation may + not apply to You. + +8. Litigation + + Any litigation relating to this License may be brought only in the courts + of a jurisdiction where the defendant maintains its principal place of + business and such litigation shall be governed by laws of that + jurisdiction, without reference to its conflict-of-law provisions. Nothing + in this Section shall prevent a party's ability to bring cross-claims or + counter-claims. + +9. Miscellaneous + + This License represents the complete agreement concerning the subject + matter hereof. If any provision of this License is held to be + unenforceable, such provision shall be reformed only to the extent + necessary to make it enforceable. Any law or regulation which provides that + the language of a contract shall be construed against the drafter shall not + be used to construe this License against a Contributor. + + +10. Versions of the License + +10.1. New Versions + + Mozilla Foundation is the license steward. Except as provided in Section + 10.3, no one other than the license steward has the right to modify or + publish new versions of this License. Each version will be given a + distinguishing version number. + +10.2. Effect of New Versions + + You may distribute the Covered Software under the terms of the version + of the License under which You originally received the Covered Software, + or under the terms of any subsequent version published by the license + steward. + +10.3. Modified Versions + + If you create software not governed by this License, and you want to + create a new license for such software, you may create and use a + modified version of this License if you rename the license and remove + any references to the name of the license steward (except to note that + such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary + Licenses If You choose to distribute Source Code Form that is + Incompatible With Secondary Licenses under the terms of this version of + the License, the notice described in Exhibit B of this License must be + attached. + +Exhibit A - Source Code Form License Notice + + This Source Code Form is subject to the + terms of the Mozilla Public License, v. + 2.0. If a copy of the MPL was not + distributed with this file, You can + obtain one at + http://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular file, +then You may include the notice in a location (such as a LICENSE file in a +relevant directory) where a recipient would be likely to look for such a +notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice + + This Source Code Form is "Incompatible + With Secondary Licenses", as defined by + the Mozilla Public License, v. 2.0. diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go new file mode 100644 index 000000000..5673773b2 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go @@ -0,0 +1,161 @@ +package simplelru + +import ( + "container/list" + "errors" +) + +// EvictCallback is used to get a callback when a cache entry is evicted +type EvictCallback func(key interface{}, value interface{}) + +// LRU implements a non-thread safe fixed size LRU cache +type LRU struct { + size int + evictList *list.List + items map[interface{}]*list.Element + onEvict EvictCallback +} + +// entry is used to hold a value in the evictList +type entry struct { + key interface{} + value interface{} +} + +// NewLRU constructs an LRU of the given size +func NewLRU(size int, onEvict EvictCallback) (*LRU, error) { + if size <= 0 { + return nil, errors.New("Must provide a positive size") + } + c := &LRU{ + size: size, + evictList: list.New(), + items: make(map[interface{}]*list.Element), + onEvict: onEvict, + } + return c, nil +} + +// Purge is used to completely clear the cache. +func (c *LRU) Purge() { + for k, v := range c.items { + if c.onEvict != nil { + c.onEvict(k, v.Value.(*entry).value) + } + delete(c.items, k) + } + c.evictList.Init() +} + +// Add adds a value to the cache. Returns true if an eviction occurred. +func (c *LRU) Add(key, value interface{}) (evicted bool) { + // Check for existing item + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + ent.Value.(*entry).value = value + return false + } + + // Add new item + ent := &entry{key, value} + entry := c.evictList.PushFront(ent) + c.items[key] = entry + + evict := c.evictList.Len() > c.size + // Verify size not exceeded + if evict { + c.removeOldest() + } + return evict +} + +// Get looks up a key's value from the cache. +func (c *LRU) Get(key interface{}) (value interface{}, ok bool) { + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + return ent.Value.(*entry).value, true + } + return +} + +// Contains checks if a key is in the cache, without updating the recent-ness +// or deleting it for being stale. +func (c *LRU) Contains(key interface{}) (ok bool) { + _, ok = c.items[key] + return ok +} + +// Peek returns the key value (or undefined if not found) without updating +// the "recently used"-ness of the key. +func (c *LRU) Peek(key interface{}) (value interface{}, ok bool) { + var ent *list.Element + if ent, ok = c.items[key]; ok { + return ent.Value.(*entry).value, true + } + return nil, ok +} + +// Remove removes the provided key from the cache, returning if the +// key was contained. +func (c *LRU) Remove(key interface{}) (present bool) { + if ent, ok := c.items[key]; ok { + c.removeElement(ent) + return true + } + return false +} + +// RemoveOldest removes the oldest item from the cache. +func (c *LRU) RemoveOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// GetOldest returns the oldest entry +func (c *LRU) GetOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// Keys returns a slice of the keys in the cache, from oldest to newest. +func (c *LRU) Keys() []interface{} { + keys := make([]interface{}, len(c.items)) + i := 0 + for ent := c.evictList.Back(); ent != nil; ent = ent.Prev() { + keys[i] = ent.Value.(*entry).key + i++ + } + return keys +} + +// Len returns the number of items in the cache. +func (c *LRU) Len() int { + return c.evictList.Len() +} + +// removeOldest removes the oldest item from the cache. +func (c *LRU) removeOldest() { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + } +} + +// removeElement is used to remove a given list element from the cache +func (c *LRU) removeElement(e *list.Element) { + c.evictList.Remove(e) + kv := e.Value.(*entry) + delete(c.items, kv.key) + if c.onEvict != nil { + c.onEvict(kv.key, kv.value) + } +} diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go new file mode 100644 index 000000000..74c707744 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go @@ -0,0 +1,36 @@ +package simplelru + +// LRUCache is the interface for simple LRU cache. +type LRUCache interface { + // Adds a value to the cache, returns true if an eviction occurred and + // updates the "recently used"-ness of the key. + Add(key, value interface{}) bool + + // Returns key's value from the cache and + // updates the "recently used"-ness of the key. #value, isFound + Get(key interface{}) (value interface{}, ok bool) + + // Check if a key exsists in cache without updating the recent-ness. + Contains(key interface{}) (ok bool) + + // Returns key's value without updating the "recently used"-ness of the key. + Peek(key interface{}) (value interface{}, ok bool) + + // Removes a key from the cache. + Remove(key interface{}) bool + + // Removes the oldest entry from cache. + RemoveOldest() (interface{}, interface{}, bool) + + // Returns the oldest entry from the cache. #key, value, isFound + GetOldest() (interface{}, interface{}, bool) + + // Returns a slice of the keys in the cache, from oldest to newest. + Keys() []interface{} + + // Returns the number of items in the cache. + Len() int + + // Clear all cache entries + Purge() +} diff --git a/vendor/github.com/klauspost/compress/flate/crc32_amd64.go b/vendor/github.com/klauspost/compress/flate/crc32_amd64.go deleted file mode 100644 index 8298d309a..000000000 --- a/vendor/github.com/klauspost/compress/flate/crc32_amd64.go +++ /dev/null @@ -1,42 +0,0 @@ -//+build !noasm -//+build !appengine -//+build !gccgo - -// Copyright 2015, Klaus Post, see LICENSE for details. - -package flate - -import ( - "github.com/klauspost/cpuid" -) - -// crc32sse returns a hash for the first 4 bytes of the slice -// len(a) must be >= 4. -//go:noescape -func crc32sse(a []byte) uint32 - -// crc32sseAll calculates hashes for each 4-byte set in a. -// dst must be east len(a) - 4 in size. -// The size is not checked by the assembly. -//go:noescape -func crc32sseAll(a []byte, dst []uint32) - -// matchLenSSE4 returns the number of matching bytes in a and b -// up to length 'max'. Both slices must be at least 'max' -// bytes in size. -// -// TODO: drop the "SSE4" name, since it doesn't use any SSE instructions. -// -//go:noescape -func matchLenSSE4(a, b []byte, max int) int - -// histogram accumulates a histogram of b in h. -// h must be at least 256 entries in length, -// and must be cleared before calling this function. -//go:noescape -func histogram(b []byte, h []int32) - -// Detect SSE 4.2 feature. -func init() { - useSSE42 = cpuid.CPU.SSE42() -} diff --git a/vendor/github.com/klauspost/compress/flate/crc32_amd64.s b/vendor/github.com/klauspost/compress/flate/crc32_amd64.s deleted file mode 100644 index a79943727..000000000 --- a/vendor/github.com/klauspost/compress/flate/crc32_amd64.s +++ /dev/null @@ -1,214 +0,0 @@ -//+build !noasm -//+build !appengine -//+build !gccgo - -// Copyright 2015, Klaus Post, see LICENSE for details. - -// func crc32sse(a []byte) uint32 -TEXT ·crc32sse(SB), 4, $0 - MOVQ a+0(FP), R10 - XORQ BX, BX - - // CRC32 dword (R10), EBX - BYTE $0xF2; BYTE $0x41; BYTE $0x0f - BYTE $0x38; BYTE $0xf1; BYTE $0x1a - - MOVL BX, ret+24(FP) - RET - -// func crc32sseAll(a []byte, dst []uint32) -TEXT ·crc32sseAll(SB), 4, $0 - MOVQ a+0(FP), R8 // R8: src - MOVQ a_len+8(FP), R10 // input length - MOVQ dst+24(FP), R9 // R9: dst - SUBQ $4, R10 - JS end - JZ one_crc - MOVQ R10, R13 - SHRQ $2, R10 // len/4 - ANDQ $3, R13 // len&3 - XORQ BX, BX - ADDQ $1, R13 - TESTQ R10, R10 - JZ rem_loop - -crc_loop: - MOVQ (R8), R11 - XORQ BX, BX - XORQ DX, DX - XORQ DI, DI - MOVQ R11, R12 - SHRQ $8, R11 - MOVQ R12, AX - MOVQ R11, CX - SHRQ $16, R12 - SHRQ $16, R11 - MOVQ R12, SI - - // CRC32 EAX, EBX - BYTE $0xF2; BYTE $0x0f - BYTE $0x38; BYTE $0xf1; BYTE $0xd8 - - // CRC32 ECX, EDX - BYTE $0xF2; BYTE $0x0f - BYTE $0x38; BYTE $0xf1; BYTE $0xd1 - - // CRC32 ESI, EDI - BYTE $0xF2; BYTE $0x0f - BYTE $0x38; BYTE $0xf1; BYTE $0xfe - MOVL BX, (R9) - MOVL DX, 4(R9) - MOVL DI, 8(R9) - - XORQ BX, BX - MOVL R11, AX - - // CRC32 EAX, EBX - BYTE $0xF2; BYTE $0x0f - BYTE $0x38; BYTE $0xf1; BYTE $0xd8 - MOVL BX, 12(R9) - - ADDQ $16, R9 - ADDQ $4, R8 - XORQ BX, BX - SUBQ $1, R10 - JNZ crc_loop - -rem_loop: - MOVL (R8), AX - - // CRC32 EAX, EBX - BYTE $0xF2; BYTE $0x0f - BYTE $0x38; BYTE $0xf1; BYTE $0xd8 - - MOVL BX, (R9) - ADDQ $4, R9 - ADDQ $1, R8 - XORQ BX, BX - SUBQ $1, R13 - JNZ rem_loop - -end: - RET - -one_crc: - MOVQ $1, R13 - XORQ BX, BX - JMP rem_loop - -// func matchLenSSE4(a, b []byte, max int) int -TEXT ·matchLenSSE4(SB), 4, $0 - MOVQ a_base+0(FP), SI - MOVQ b_base+24(FP), DI - MOVQ DI, DX - MOVQ max+48(FP), CX - -cmp8: - // As long as we are 8 or more bytes before the end of max, we can load and - // compare 8 bytes at a time. If those 8 bytes are equal, repeat. - CMPQ CX, $8 - JLT cmp1 - MOVQ (SI), AX - MOVQ (DI), BX - CMPQ AX, BX - JNE bsf - ADDQ $8, SI - ADDQ $8, DI - SUBQ $8, CX - JMP cmp8 - -bsf: - // If those 8 bytes were not equal, XOR the two 8 byte values, and return - // the index of the first byte that differs. The BSF instruction finds the - // least significant 1 bit, the amd64 architecture is little-endian, and - // the shift by 3 converts a bit index to a byte index. - XORQ AX, BX - BSFQ BX, BX - SHRQ $3, BX - ADDQ BX, DI - - // Subtract off &b[0] to convert from &b[ret] to ret, and return. - SUBQ DX, DI - MOVQ DI, ret+56(FP) - RET - -cmp1: - // In the slices' tail, compare 1 byte at a time. - CMPQ CX, $0 - JEQ matchLenEnd - MOVB (SI), AX - MOVB (DI), BX - CMPB AX, BX - JNE matchLenEnd - ADDQ $1, SI - ADDQ $1, DI - SUBQ $1, CX - JMP cmp1 - -matchLenEnd: - // Subtract off &b[0] to convert from &b[ret] to ret, and return. - SUBQ DX, DI - MOVQ DI, ret+56(FP) - RET - -// func histogram(b []byte, h []int32) -TEXT ·histogram(SB), 4, $0 - MOVQ b+0(FP), SI // SI: &b - MOVQ b_len+8(FP), R9 // R9: len(b) - MOVQ h+24(FP), DI // DI: Histogram - MOVQ R9, R8 - SHRQ $3, R8 - JZ hist1 - XORQ R11, R11 - -loop_hist8: - MOVQ (SI), R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - MOVB R10, R11 - INCL (DI)(R11*4) - SHRQ $8, R10 - - INCL (DI)(R10*4) - - ADDQ $8, SI - DECQ R8 - JNZ loop_hist8 - -hist1: - ANDQ $7, R9 - JZ end_hist - XORQ R10, R10 - -loop_hist1: - MOVB (SI), R10 - INCL (DI)(R10*4) - INCQ SI - DECQ R9 - JNZ loop_hist1 - -end_hist: - RET diff --git a/vendor/github.com/klauspost/compress/flate/crc32_noasm.go b/vendor/github.com/klauspost/compress/flate/crc32_noasm.go deleted file mode 100644 index dcf43bd50..000000000 --- a/vendor/github.com/klauspost/compress/flate/crc32_noasm.go +++ /dev/null @@ -1,35 +0,0 @@ -//+build !amd64 noasm appengine gccgo - -// Copyright 2015, Klaus Post, see LICENSE for details. - -package flate - -func init() { - useSSE42 = false -} - -// crc32sse should never be called. -func crc32sse(a []byte) uint32 { - panic("no assembler") -} - -// crc32sseAll should never be called. -func crc32sseAll(a []byte, dst []uint32) { - panic("no assembler") -} - -// matchLenSSE4 should never be called. -func matchLenSSE4(a, b []byte, max int) int { - panic("no assembler") - return 0 -} - -// histogram accumulates a histogram of b in h. -// -// len(h) must be >= 256, and h's elements must be all zeroes. -func histogram(b []byte, h []int32) { - h = h[:256] - for _, t := range b { - h[t]++ - } -} diff --git a/vendor/github.com/klauspost/compress/flate/deflate.go b/vendor/github.com/klauspost/compress/flate/deflate.go index 628795120..20c94f596 100644 --- a/vendor/github.com/klauspost/compress/flate/deflate.go +++ b/vendor/github.com/klauspost/compress/flate/deflate.go @@ -50,8 +50,6 @@ const ( skipNever = math.MaxInt32 ) -var useSSE42 bool - type compressionLevel struct { good, lazy, nice, chain, fastSkipHashing, level int } @@ -97,9 +95,8 @@ type advancedState struct { hashOffset int // input window: unprocessed data is window[index:windowEnd] - index int - bulkHasher func([]byte, []uint32) - hashMatch [maxMatchLength + minMatchLength]uint32 + index int + hashMatch [maxMatchLength + minMatchLength]uint32 } type compressor struct { @@ -120,7 +117,7 @@ type compressor struct { // queued output tokens tokens tokens - snap fastEnc + fast fastEnc state *advancedState } @@ -164,14 +161,14 @@ func (d *compressor) fillDeflate(b []byte) int { return n } -func (d *compressor) writeBlock(tok tokens, index int, eof bool) error { +func (d *compressor) writeBlock(tok *tokens, index int, eof bool) error { if index > 0 || eof { var window []byte if d.blockStart <= index { window = d.window[d.blockStart:index] } d.blockStart = index - d.w.writeBlock(tok.tokens[:tok.n], eof, window) + d.w.writeBlock(tok, eof, window) return d.w.err } return nil @@ -180,20 +177,20 @@ func (d *compressor) writeBlock(tok tokens, index int, eof bool) error { // writeBlockSkip writes the current block and uses the number of tokens // to determine if the block should be stored on no matches, or // only huffman encoded. -func (d *compressor) writeBlockSkip(tok tokens, index int, eof bool) error { +func (d *compressor) writeBlockSkip(tok *tokens, index int, eof bool) error { if index > 0 || eof { if d.blockStart <= index { window := d.window[d.blockStart:index] // If we removed less than a 64th of all literals // we huffman compress the block. if int(tok.n) > len(window)-int(tok.n>>6) { - d.w.writeBlockHuff(eof, window) + d.w.writeBlockHuff(eof, window, d.sync) } else { // Write a dynamic huffman block. - d.w.writeBlockDynamic(tok.tokens[:tok.n], eof, window) + d.w.writeBlockDynamic(tok, eof, window, d.sync) } } else { - d.w.writeBlock(tok.tokens[:tok.n], eof, nil) + d.w.writeBlock(tok, eof, nil) } d.blockStart = index return d.w.err @@ -208,8 +205,16 @@ func (d *compressor) writeBlockSkip(tok tokens, index int, eof bool) error { func (d *compressor) fillWindow(b []byte) { // Do not fill window if we are in store-only mode, // use constant or Snappy compression. - switch d.compressionLevel.level { - case 0, 1, 2: + if d.level == 0 { + return + } + if d.fast != nil { + // encode the last data, but discard the result + if len(b) > maxMatchOffset { + b = b[len(b)-maxMatchOffset:] + } + d.fast.Encode(&d.tokens, b) + d.tokens.Reset() return } s := d.state @@ -236,7 +241,7 @@ func (d *compressor) fillWindow(b []byte) { } dst := s.hashMatch[:dstSize] - s.bulkHasher(tocheck, dst) + bulkHash4(tocheck, dst) var newH uint32 for i, val := range dst { di := i + startindex @@ -284,62 +289,7 @@ func (d *compressor) findMatch(pos int, prevHead int, prevLength int, lookahead for i := prevHead; tries > 0; tries-- { if wEnd == win[i+length] { - n := matchLen(win[i:], wPos, minMatchLook) - - if n > length && (n > minMatchLength || pos-i <= 4096) { - length = n - offset = pos - i - ok = true - if n >= nice { - // The match is good enough that we don't try to find a better one. - break - } - wEnd = win[pos+n] - } - } - if i == minIndex { - // hashPrev[i & windowMask] has already been overwritten, so stop now. - break - } - i = int(d.state.hashPrev[i&windowMask]) - d.state.hashOffset - if i < minIndex || i < 0 { - break - } - } - return -} - -// Try to find a match starting at index whose length is greater than prevSize. -// We only look at chainCount possibilities before giving up. -// pos = s.index, prevHead = s.chainHead-s.hashOffset, prevLength=minMatchLength-1, lookahead -func (d *compressor) findMatchSSE(pos int, prevHead int, prevLength int, lookahead int) (length, offset int, ok bool) { - minMatchLook := maxMatchLength - if lookahead < minMatchLook { - minMatchLook = lookahead - } - - win := d.window[0 : pos+minMatchLook] - - // We quit when we get a match that's at least nice long - nice := len(win) - pos - if d.nice < nice { - nice = d.nice - } - - // If we've got a match that's good enough, only look in 1/4 the chain. - tries := d.chain - length = prevLength - if length >= d.good { - tries >>= 2 - } - - wEnd := win[pos+length] - wPos := win[pos:] - minIndex := pos - windowSize - - for i := prevHead; tries > 0; tries-- { - if wEnd == win[i+length] { - n := matchLenSSE4(win[i:], wPos, minMatchLook) + n := matchLen(win[i:i+minMatchLook], wPos) if n > length && (n > minMatchLength || pos-i <= 4096) { length = n @@ -372,42 +322,27 @@ func (d *compressor) writeStoredBlock(buf []byte) error { return d.w.err } -const hashmul = 0x1e35a7bd - // hash4 returns a hash representation of the first 4 bytes // of the supplied slice. // The caller must ensure that len(b) >= 4. func hash4(b []byte) uint32 { - return ((uint32(b[3]) | uint32(b[2])<<8 | uint32(b[1])<<16 | uint32(b[0])<<24) * hashmul) >> (32 - hashBits) + b = b[:4] + return hash4u(uint32(b[3])|uint32(b[2])<<8|uint32(b[1])<<16|uint32(b[0])<<24, hashBits) } // bulkHash4 will compute hashes using the same // algorithm as hash4 func bulkHash4(b []byte, dst []uint32) { - if len(b) < minMatchLength { + if len(b) < 4 { return } hb := uint32(b[3]) | uint32(b[2])<<8 | uint32(b[1])<<16 | uint32(b[0])<<24 - dst[0] = (hb * hashmul) >> (32 - hashBits) - end := len(b) - minMatchLength + 1 + dst[0] = hash4u(hb, hashBits) + end := len(b) - 4 + 1 for i := 1; i < end; i++ { hb = (hb << 8) | uint32(b[i+3]) - dst[i] = (hb * hashmul) >> (32 - hashBits) - } -} - -// matchLen returns the number of matching bytes in a and b -// up to length 'max'. Both slices must be at least 'max' -// bytes in size. -func matchLen(a, b []byte, max int) int { - a = a[:max] - b = b[:len(a)] - for i, av := range a { - if b[i] != av { - return i - } + dst[i] = hash4u(hb, hashBits) } - return max } func (d *compressor) initDeflate() { @@ -424,149 +359,6 @@ func (d *compressor) initDeflate() { s.offset = 0 s.hash = 0 s.chainHead = -1 - s.bulkHasher = bulkHash4 - if useSSE42 { - s.bulkHasher = crc32sseAll - } -} - -// Assumes that d.fastSkipHashing != skipNever, -// otherwise use deflateLazy -func (d *compressor) deflate() { - s := d.state - // Sanity enables additional runtime tests. - // It's intended to be used during development - // to supplement the currently ad-hoc unit tests. - const sanity = false - - if d.windowEnd-s.index < minMatchLength+maxMatchLength && !d.sync { - return - } - - s.maxInsertIndex = d.windowEnd - (minMatchLength - 1) - if s.index < s.maxInsertIndex { - s.hash = hash4(d.window[s.index : s.index+minMatchLength]) - } - - for { - if sanity && s.index > d.windowEnd { - panic("index > windowEnd") - } - lookahead := d.windowEnd - s.index - if lookahead < minMatchLength+maxMatchLength { - if !d.sync { - return - } - if sanity && s.index > d.windowEnd { - panic("index > windowEnd") - } - if lookahead == 0 { - if d.tokens.n > 0 { - if d.err = d.writeBlockSkip(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - return - } - } - if s.index < s.maxInsertIndex { - // Update the hash - s.hash = hash4(d.window[s.index : s.index+minMatchLength]) - ch := s.hashHead[s.hash&hashMask] - s.chainHead = int(ch) - s.hashPrev[s.index&windowMask] = ch - s.hashHead[s.hash&hashMask] = uint32(s.index + s.hashOffset) - } - s.length = minMatchLength - 1 - s.offset = 0 - minIndex := s.index - windowSize - if minIndex < 0 { - minIndex = 0 - } - - if s.chainHead-s.hashOffset >= minIndex && lookahead > minMatchLength-1 { - if newLength, newOffset, ok := d.findMatch(s.index, s.chainHead-s.hashOffset, minMatchLength-1, lookahead); ok { - s.length = newLength - s.offset = newOffset - } - } - if s.length >= minMatchLength { - s.ii = 0 - // There was a match at the previous step, and the current match is - // not better. Output the previous match. - // "s.length-3" should NOT be "s.length-minMatchLength", since the format always assume 3 - d.tokens.tokens[d.tokens.n] = matchToken(uint32(s.length-3), uint32(s.offset-minOffsetSize)) - d.tokens.n++ - // Insert in the hash table all strings up to the end of the match. - // index and index-1 are already inserted. If there is not enough - // lookahead, the last two strings are not inserted into the hash - // table. - if s.length <= d.fastSkipHashing { - var newIndex int - newIndex = s.index + s.length - // Calculate missing hashes - end := newIndex - if end > s.maxInsertIndex { - end = s.maxInsertIndex - } - end += minMatchLength - 1 - startindex := s.index + 1 - if startindex > s.maxInsertIndex { - startindex = s.maxInsertIndex - } - tocheck := d.window[startindex:end] - dstSize := len(tocheck) - minMatchLength + 1 - if dstSize > 0 { - dst := s.hashMatch[:dstSize] - bulkHash4(tocheck, dst) - var newH uint32 - for i, val := range dst { - di := i + startindex - newH = val & hashMask - // Get previous value with the same hash. - // Our chain should point to the previous value. - s.hashPrev[di&windowMask] = s.hashHead[newH] - // Set the head of the hash chain to us. - s.hashHead[newH] = uint32(di + s.hashOffset) - } - s.hash = newH - } - s.index = newIndex - } else { - // For matches this long, we don't bother inserting each individual - // item into the table. - s.index += s.length - if s.index < s.maxInsertIndex { - s.hash = hash4(d.window[s.index : s.index+minMatchLength]) - } - } - if d.tokens.n == maxFlateBlockTokens { - // The block includes the current character - if d.err = d.writeBlockSkip(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - } else { - s.ii++ - end := s.index + int(s.ii>>uint(d.fastSkipHashing)) + 1 - if end > d.windowEnd { - end = d.windowEnd - } - for i := s.index; i < end; i++ { - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[i])) - d.tokens.n++ - if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlockSkip(d.tokens, i+1, false); d.err != nil { - return - } - d.tokens.n = 0 - } - } - s.index = end - } - } } // deflateLazy is the same as deflate, but with d.fastSkipHashing == skipNever, @@ -603,15 +395,14 @@ func (d *compressor) deflateLazy() { // Flush current output block if any. if d.byteAvailable { // There is still one pending token that needs to be flushed - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ + d.tokens.AddLiteral(d.window[s.index-1]) d.byteAvailable = false } if d.tokens.n > 0 { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { + if d.err = d.writeBlock(&d.tokens, s.index, false); d.err != nil { return } - d.tokens.n = 0 + d.tokens.Reset() } return } @@ -642,8 +433,7 @@ func (d *compressor) deflateLazy() { if prevLength >= minMatchLength && s.length <= prevLength { // There was a match at the previous step, and the current match is // not better. Output the previous match. - d.tokens.tokens[d.tokens.n] = matchToken(uint32(prevLength-3), uint32(prevOffset-minOffsetSize)) - d.tokens.n++ + d.tokens.AddMatch(uint32(prevLength-3), uint32(prevOffset-minOffsetSize)) // Insert in the hash table all strings up to the end of the match. // index and index-1 are already inserted. If there is not enough @@ -684,10 +474,10 @@ func (d *compressor) deflateLazy() { s.length = minMatchLength - 1 if d.tokens.n == maxFlateBlockTokens { // The block includes the current character - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { + if d.err = d.writeBlock(&d.tokens, s.index, false); d.err != nil { return } - d.tokens.n = 0 + d.tokens.Reset() } } else { // Reset, if we got a match this run. @@ -697,13 +487,12 @@ func (d *compressor) deflateLazy() { // We have a byte waiting. Emit it. if d.byteAvailable { s.ii++ - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ + d.tokens.AddLiteral(d.window[s.index-1]) if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { + if d.err = d.writeBlock(&d.tokens, s.index, false); d.err != nil { return } - d.tokens.n = 0 + d.tokens.Reset() } s.index++ @@ -716,343 +505,24 @@ func (d *compressor) deflateLazy() { break } - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ + d.tokens.AddLiteral(d.window[s.index-1]) if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { + if d.err = d.writeBlock(&d.tokens, s.index, false); d.err != nil { return } - d.tokens.n = 0 + d.tokens.Reset() } s.index++ } // Flush last byte - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ + d.tokens.AddLiteral(d.window[s.index-1]) d.byteAvailable = false // s.length = minMatchLength - 1 // not needed, since s.ii is reset above, so it should never be > minMatchLength if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { + if d.err = d.writeBlock(&d.tokens, s.index, false); d.err != nil { return } - d.tokens.n = 0 - } - } - } else { - s.index++ - d.byteAvailable = true - } - } - } -} - -// Assumes that d.fastSkipHashing != skipNever, -// otherwise use deflateLazySSE -func (d *compressor) deflateSSE() { - s := d.state - // Sanity enables additional runtime tests. - // It's intended to be used during development - // to supplement the currently ad-hoc unit tests. - const sanity = false - - if d.windowEnd-s.index < minMatchLength+maxMatchLength && !d.sync { - return - } - - s.maxInsertIndex = d.windowEnd - (minMatchLength - 1) - if s.index < s.maxInsertIndex { - s.hash = crc32sse(d.window[s.index:s.index+minMatchLength]) & hashMask - } - - for { - if sanity && s.index > d.windowEnd { - panic("index > windowEnd") - } - lookahead := d.windowEnd - s.index - if lookahead < minMatchLength+maxMatchLength { - if !d.sync { - return - } - if sanity && s.index > d.windowEnd { - panic("index > windowEnd") - } - if lookahead == 0 { - if d.tokens.n > 0 { - if d.err = d.writeBlockSkip(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - return - } - } - if s.index < s.maxInsertIndex { - // Update the hash - s.hash = crc32sse(d.window[s.index:s.index+minMatchLength]) & hashMask - ch := s.hashHead[s.hash] - s.chainHead = int(ch) - s.hashPrev[s.index&windowMask] = ch - s.hashHead[s.hash] = uint32(s.index + s.hashOffset) - } - s.length = minMatchLength - 1 - s.offset = 0 - minIndex := s.index - windowSize - if minIndex < 0 { - minIndex = 0 - } - - if s.chainHead-s.hashOffset >= minIndex && lookahead > minMatchLength-1 { - if newLength, newOffset, ok := d.findMatchSSE(s.index, s.chainHead-s.hashOffset, minMatchLength-1, lookahead); ok { - s.length = newLength - s.offset = newOffset - } - } - if s.length >= minMatchLength { - s.ii = 0 - // There was a match at the previous step, and the current match is - // not better. Output the previous match. - // "s.length-3" should NOT be "s.length-minMatchLength", since the format always assume 3 - d.tokens.tokens[d.tokens.n] = matchToken(uint32(s.length-3), uint32(s.offset-minOffsetSize)) - d.tokens.n++ - // Insert in the hash table all strings up to the end of the match. - // index and index-1 are already inserted. If there is not enough - // lookahead, the last two strings are not inserted into the hash - // table. - if s.length <= d.fastSkipHashing { - var newIndex int - newIndex = s.index + s.length - // Calculate missing hashes - end := newIndex - if end > s.maxInsertIndex { - end = s.maxInsertIndex - } - end += minMatchLength - 1 - startindex := s.index + 1 - if startindex > s.maxInsertIndex { - startindex = s.maxInsertIndex - } - tocheck := d.window[startindex:end] - dstSize := len(tocheck) - minMatchLength + 1 - if dstSize > 0 { - dst := s.hashMatch[:dstSize] - - crc32sseAll(tocheck, dst) - var newH uint32 - for i, val := range dst { - di := i + startindex - newH = val & hashMask - // Get previous value with the same hash. - // Our chain should point to the previous value. - s.hashPrev[di&windowMask] = s.hashHead[newH] - // Set the head of the hash chain to us. - s.hashHead[newH] = uint32(di + s.hashOffset) - } - s.hash = newH - } - s.index = newIndex - } else { - // For matches this long, we don't bother inserting each individual - // item into the table. - s.index += s.length - if s.index < s.maxInsertIndex { - s.hash = crc32sse(d.window[s.index:s.index+minMatchLength]) & hashMask - } - } - if d.tokens.n == maxFlateBlockTokens { - // The block includes the current character - if d.err = d.writeBlockSkip(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - } else { - s.ii++ - end := s.index + int(s.ii>>5) + 1 - if end > d.windowEnd { - end = d.windowEnd - } - for i := s.index; i < end; i++ { - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[i])) - d.tokens.n++ - if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlockSkip(d.tokens, i+1, false); d.err != nil { - return - } - d.tokens.n = 0 - } - } - s.index = end - } - } -} - -// deflateLazy is the same as deflate, but with d.fastSkipHashing == skipNever, -// meaning it always has lazy matching on. -func (d *compressor) deflateLazySSE() { - s := d.state - // Sanity enables additional runtime tests. - // It's intended to be used during development - // to supplement the currently ad-hoc unit tests. - const sanity = false - - if d.windowEnd-s.index < minMatchLength+maxMatchLength && !d.sync { - return - } - - s.maxInsertIndex = d.windowEnd - (minMatchLength - 1) - if s.index < s.maxInsertIndex { - s.hash = crc32sse(d.window[s.index:s.index+minMatchLength]) & hashMask - } - - for { - if sanity && s.index > d.windowEnd { - panic("index > windowEnd") - } - lookahead := d.windowEnd - s.index - if lookahead < minMatchLength+maxMatchLength { - if !d.sync { - return - } - if sanity && s.index > d.windowEnd { - panic("index > windowEnd") - } - if lookahead == 0 { - // Flush current output block if any. - if d.byteAvailable { - // There is still one pending token that needs to be flushed - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ - d.byteAvailable = false - } - if d.tokens.n > 0 { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - return - } - } - if s.index < s.maxInsertIndex { - // Update the hash - s.hash = crc32sse(d.window[s.index:s.index+minMatchLength]) & hashMask - ch := s.hashHead[s.hash] - s.chainHead = int(ch) - s.hashPrev[s.index&windowMask] = ch - s.hashHead[s.hash] = uint32(s.index + s.hashOffset) - } - prevLength := s.length - prevOffset := s.offset - s.length = minMatchLength - 1 - s.offset = 0 - minIndex := s.index - windowSize - if minIndex < 0 { - minIndex = 0 - } - - if s.chainHead-s.hashOffset >= minIndex && lookahead > prevLength && prevLength < d.lazy { - if newLength, newOffset, ok := d.findMatchSSE(s.index, s.chainHead-s.hashOffset, minMatchLength-1, lookahead); ok { - s.length = newLength - s.offset = newOffset - } - } - if prevLength >= minMatchLength && s.length <= prevLength { - // There was a match at the previous step, and the current match is - // not better. Output the previous match. - d.tokens.tokens[d.tokens.n] = matchToken(uint32(prevLength-3), uint32(prevOffset-minOffsetSize)) - d.tokens.n++ - - // Insert in the hash table all strings up to the end of the match. - // index and index-1 are already inserted. If there is not enough - // lookahead, the last two strings are not inserted into the hash - // table. - var newIndex int - newIndex = s.index + prevLength - 1 - // Calculate missing hashes - end := newIndex - if end > s.maxInsertIndex { - end = s.maxInsertIndex - } - end += minMatchLength - 1 - startindex := s.index + 1 - if startindex > s.maxInsertIndex { - startindex = s.maxInsertIndex - } - tocheck := d.window[startindex:end] - dstSize := len(tocheck) - minMatchLength + 1 - if dstSize > 0 { - dst := s.hashMatch[:dstSize] - crc32sseAll(tocheck, dst) - var newH uint32 - for i, val := range dst { - di := i + startindex - newH = val & hashMask - // Get previous value with the same hash. - // Our chain should point to the previous value. - s.hashPrev[di&windowMask] = s.hashHead[newH] - // Set the head of the hash chain to us. - s.hashHead[newH] = uint32(di + s.hashOffset) - } - s.hash = newH - } - - s.index = newIndex - d.byteAvailable = false - s.length = minMatchLength - 1 - if d.tokens.n == maxFlateBlockTokens { - // The block includes the current character - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - } else { - // Reset, if we got a match this run. - if s.length >= minMatchLength { - s.ii = 0 - } - // We have a byte waiting. Emit it. - if d.byteAvailable { - s.ii++ - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ - if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - s.index++ - - // If we have a long run of no matches, skip additional bytes - // Resets when s.ii overflows after 64KB. - if s.ii > 31 { - n := int(s.ii >> 6) - for j := 0; j < n; j++ { - if s.index >= d.windowEnd-1 { - break - } - - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ - if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 - } - s.index++ - } - // Flush last byte - d.tokens.tokens[d.tokens.n] = literalToken(uint32(d.window[s.index-1])) - d.tokens.n++ - d.byteAvailable = false - // s.length = minMatchLength - 1 // not needed, since s.ii is reset above, so it should never be > minMatchLength - if d.tokens.n == maxFlateBlockTokens { - if d.err = d.writeBlock(d.tokens, s.index, false); d.err != nil { - return - } - d.tokens.n = 0 + d.tokens.Reset() } } } else { @@ -1085,17 +555,17 @@ func (d *compressor) storeHuff() { if d.windowEnd < len(d.window) && !d.sync || d.windowEnd == 0 { return } - d.w.writeBlockHuff(false, d.window[:d.windowEnd]) + d.w.writeBlockHuff(false, d.window[:d.windowEnd], d.sync) d.err = d.w.err d.windowEnd = 0 } -// storeHuff will compress and store the currently added data, +// storeFast will compress and store the currently added data, // if enough has been accumulated or we at the end of the stream. // Any error that occurred will be in d.err -func (d *compressor) storeSnappy() { +func (d *compressor) storeFast() { // We only compress if we have maxStoreBlockSize. - if d.windowEnd < maxStoreBlockSize { + if d.windowEnd < len(d.window) { if !d.sync { return } @@ -1106,32 +576,30 @@ func (d *compressor) storeSnappy() { } if d.windowEnd <= 32 { d.err = d.writeStoredBlock(d.window[:d.windowEnd]) - d.tokens.n = 0 - d.windowEnd = 0 } else { - d.w.writeBlockHuff(false, d.window[:d.windowEnd]) + d.w.writeBlockHuff(false, d.window[:d.windowEnd], true) d.err = d.w.err } - d.tokens.n = 0 + d.tokens.Reset() d.windowEnd = 0 - d.snap.Reset() + d.fast.Reset() return } } - d.snap.Encode(&d.tokens, d.window[:d.windowEnd]) + d.fast.Encode(&d.tokens, d.window[:d.windowEnd]) // If we made zero matches, store the block as is. - if int(d.tokens.n) == d.windowEnd { + if d.tokens.n == 0 { d.err = d.writeStoredBlock(d.window[:d.windowEnd]) // If we removed less than 1/16th, huffman compress the block. } else if int(d.tokens.n) > d.windowEnd-(d.windowEnd>>4) { - d.w.writeBlockHuff(false, d.window[:d.windowEnd]) + d.w.writeBlockHuff(false, d.window[:d.windowEnd], d.sync) d.err = d.w.err } else { - d.w.writeBlockDynamic(d.tokens.tokens[:d.tokens.n], false, d.window[:d.windowEnd]) + d.w.writeBlockDynamic(&d.tokens, false, d.window[:d.windowEnd], d.sync) d.err = d.w.err } - d.tokens.n = 0 + d.tokens.Reset() d.windowEnd = 0 } @@ -1176,36 +644,26 @@ func (d *compressor) init(w io.Writer, level int) (err error) { d.fill = (*compressor).fillBlock d.step = (*compressor).store case level == ConstantCompression: + d.w.logReusePenalty = uint(4) d.window = make([]byte, maxStoreBlockSize) d.fill = (*compressor).fillBlock d.step = (*compressor).storeHuff - case level >= 1 && level <= 4: - d.snap = newFastEnc(level) - d.window = make([]byte, maxStoreBlockSize) - d.fill = (*compressor).fillBlock - d.step = (*compressor).storeSnappy case level == DefaultCompression: level = 5 fallthrough - case 5 <= level && level <= 9: + case level >= 1 && level <= 6: + d.w.logReusePenalty = uint(level + 1) + d.fast = newFastEnc(level) + d.window = make([]byte, maxStoreBlockSize) + d.fill = (*compressor).fillBlock + d.step = (*compressor).storeFast + case 7 <= level && level <= 9: + d.w.logReusePenalty = uint(level) d.state = &advancedState{} d.compressionLevel = levels[level] d.initDeflate() d.fill = (*compressor).fillDeflate - if d.fastSkipHashing == skipNever { - if useSSE42 { - d.step = (*compressor).deflateLazySSE - } else { - d.step = (*compressor).deflateLazy - } - } else { - if useSSE42 { - d.step = (*compressor).deflateSSE - } else { - d.step = (*compressor).deflate - - } - } + d.step = (*compressor).deflateLazy default: return fmt.Errorf("flate: invalid compression level %d: want value in range [-2, 9]", level) } @@ -1218,10 +676,10 @@ func (d *compressor) reset(w io.Writer) { d.sync = false d.err = nil // We only need to reset a few things for Snappy. - if d.snap != nil { - d.snap.Reset() + if d.fast != nil { + d.fast.Reset() d.windowEnd = 0 - d.tokens.n = 0 + d.tokens.Reset() return } switch d.compressionLevel.chain { @@ -1240,7 +698,7 @@ func (d *compressor) reset(w io.Writer) { s.hashOffset = 1 s.index, d.windowEnd = 0, 0 d.blockStart, d.byteAvailable = 0, false - d.tokens.n = 0 + d.tokens.Reset() s.length = minMatchLength - 1 s.offset = 0 s.hash = 0 diff --git a/vendor/github.com/klauspost/compress/flate/fast_encoder.go b/vendor/github.com/klauspost/compress/flate/fast_encoder.go new file mode 100644 index 000000000..b0a470f92 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/fast_encoder.go @@ -0,0 +1,257 @@ +// Copyright 2011 The Snappy-Go Authors. All rights reserved. +// Modified for deflate by Klaus Post (c) 2015. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package flate + +import ( + "fmt" + "math/bits" +) + +type fastEnc interface { + Encode(dst *tokens, src []byte) + Reset() +} + +func newFastEnc(level int) fastEnc { + switch level { + case 1: + return &fastEncL1{fastGen: fastGen{cur: maxStoreBlockSize}} + case 2: + return &fastEncL2{fastGen: fastGen{cur: maxStoreBlockSize}} + case 3: + return &fastEncL3{fastGen: fastGen{cur: maxStoreBlockSize}} + case 4: + return &fastEncL4{fastGen: fastGen{cur: maxStoreBlockSize}} + case 5: + return &fastEncL5{fastGen: fastGen{cur: maxStoreBlockSize}} + case 6: + return &fastEncL6{fastGen: fastGen{cur: maxStoreBlockSize}} + default: + panic("invalid level specified") + } +} + +const ( + tableBits = 16 // Bits used in the table + tableSize = 1 << tableBits // Size of the table + tableShift = 32 - tableBits // Right-shift to get the tableBits most significant bits of a uint32. + baseMatchOffset = 1 // The smallest match offset + baseMatchLength = 3 // The smallest match length per the RFC section 3.2.5 + maxMatchOffset = 1 << 15 // The largest match offset + + bTableBits = 18 // Bits used in the big tables + bTableSize = 1 << bTableBits // Size of the table + allocHistory = maxMatchOffset * 10 // Size to preallocate for history. + bufferReset = (1 << 31) - allocHistory - maxStoreBlockSize // Reset the buffer offset when reaching this. +) + +const ( + prime3bytes = 506832829 + prime4bytes = 2654435761 + prime5bytes = 889523592379 + prime6bytes = 227718039650203 + prime7bytes = 58295818150454627 + prime8bytes = 0xcf1bbcdcb7a56463 +) + +func load32(b []byte, i int) uint32 { + // Help the compiler eliminate bounds checks on the read so it can be done in a single read. + b = b[i:] + b = b[:4] + return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 +} + +func load64(b []byte, i int) uint64 { + // Help the compiler eliminate bounds checks on the read so it can be done in a single read. + b = b[i:] + b = b[:8] + return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | + uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 +} + +func load3232(b []byte, i int32) uint32 { + // Help the compiler eliminate bounds checks on the read so it can be done in a single read. + b = b[i:] + b = b[:4] + return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 +} + +func load6432(b []byte, i int32) uint64 { + // Help the compiler eliminate bounds checks on the read so it can be done in a single read. + b = b[i:] + b = b[:8] + return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | + uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 +} + +func hash(u uint32) uint32 { + return (u * 0x1e35a7bd) >> tableShift +} + +type tableEntry struct { + val uint32 + offset int32 +} + +// fastGen maintains the table for matches, +// and the previous byte block for level 2. +// This is the generic implementation. +type fastGen struct { + hist []byte + cur int32 +} + +func (e *fastGen) addBlock(src []byte) int32 { + // check if we have space already + if len(e.hist)+len(src) > cap(e.hist) { + if cap(e.hist) == 0 { + e.hist = make([]byte, 0, allocHistory) + } else { + if cap(e.hist) < maxMatchOffset*2 { + panic("unexpected buffer size") + } + // Move down + offset := int32(len(e.hist)) - maxMatchOffset + copy(e.hist[0:maxMatchOffset], e.hist[offset:]) + e.cur += offset + e.hist = e.hist[:maxMatchOffset] + } + } + s := int32(len(e.hist)) + e.hist = append(e.hist, src...) + return s +} + +// hash4 returns the hash of u to fit in a hash table with h bits. +// Preferably h should be a constant and should always be <32. +func hash4u(u uint32, h uint8) uint32 { + return (u * prime4bytes) >> ((32 - h) & 31) +} + +type tableEntryPrev struct { + Cur tableEntry + Prev tableEntry +} + +// hash4x64 returns the hash of the lowest 4 bytes of u to fit in a hash table with h bits. +// Preferably h should be a constant and should always be <32. +func hash4x64(u uint64, h uint8) uint32 { + return (uint32(u) * prime4bytes) >> ((32 - h) & 31) +} + +// hash7 returns the hash of the lowest 7 bytes of u to fit in a hash table with h bits. +// Preferably h should be a constant and should always be <64. +func hash7(u uint64, h uint8) uint32 { + return uint32(((u << (64 - 56)) * prime7bytes) >> ((64 - h) & 63)) +} + +// hash8 returns the hash of u to fit in a hash table with h bits. +// Preferably h should be a constant and should always be <64. +func hash8(u uint64, h uint8) uint32 { + return uint32((u * prime8bytes) >> ((64 - h) & 63)) +} + +// hash6 returns the hash of the lowest 6 bytes of u to fit in a hash table with h bits. +// Preferably h should be a constant and should always be <64. +func hash6(u uint64, h uint8) uint32 { + return uint32(((u << (64 - 48)) * prime6bytes) >> ((64 - h) & 63)) +} + +// matchlen will return the match length between offsets and t in src. +// The maximum length returned is maxMatchLength - 4. +// It is assumed that s > t, that t >=0 and s < len(src). +func (e *fastGen) matchlen(s, t int32, src []byte) int32 { + if debugDecode { + if t >= s { + panic(fmt.Sprint("t >=s:", t, s)) + } + if int(s) >= len(src) { + panic(fmt.Sprint("s >= len(src):", s, len(src))) + } + if t < 0 { + panic(fmt.Sprint("t < 0:", t)) + } + if s-t > maxMatchOffset { + panic(fmt.Sprint(s, "-", t, "(", s-t, ") > maxMatchLength (", maxMatchOffset, ")")) + } + } + s1 := int(s) + maxMatchLength - 4 + if s1 > len(src) { + s1 = len(src) + } + + // Extend the match to be as long as possible. + return int32(matchLen(src[s:s1], src[t:])) +} + +// matchlenLong will return the match length between offsets and t in src. +// It is assumed that s > t, that t >=0 and s < len(src). +func (e *fastGen) matchlenLong(s, t int32, src []byte) int32 { + if debugDecode { + if t >= s { + panic(fmt.Sprint("t >=s:", t, s)) + } + if int(s) >= len(src) { + panic(fmt.Sprint("s >= len(src):", s, len(src))) + } + if t < 0 { + panic(fmt.Sprint("t < 0:", t)) + } + if s-t > maxMatchOffset { + panic(fmt.Sprint(s, "-", t, "(", s-t, ") > maxMatchLength (", maxMatchOffset, ")")) + } + } + // Extend the match to be as long as possible. + return int32(matchLen(src[s:], src[t:])) +} + +// Reset the encoding table. +func (e *fastGen) Reset() { + if cap(e.hist) < int(maxMatchOffset*8) { + l := maxMatchOffset * 8 + // Make it at least 1MB. + if l < 1<<20 { + l = 1 << 20 + } + e.hist = make([]byte, 0, l) + } + // We offset current position so everything will be out of reach + e.cur += maxMatchOffset + int32(len(e.hist)) + e.hist = e.hist[:0] +} + +// matchLen returns the maximum length. +// 'a' must be the shortest of the two. +func matchLen(a, b []byte) int { + b = b[:len(a)] + var checked int + if len(a) > 4 { + // Try 4 bytes first + if diff := load32(a, 0) ^ load32(b, 0); diff != 0 { + return bits.TrailingZeros32(diff) >> 3 + } + // Switch to 8 byte matching. + checked = 4 + a = a[4:] + b = b[4:] + for len(a) >= 8 { + b = b[:len(a)] + if diff := load64(a, 0) ^ load64(b, 0); diff != 0 { + return checked + (bits.TrailingZeros64(diff) >> 3) + } + checked += 8 + a = a[8:] + b = b[8:] + } + } + b = b[:len(a)] + for i := range a { + if a[i] != b[i] { + return int(i) + checked + } + } + return len(a) + checked +} diff --git a/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go b/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go index f46c65418..5ed476aa0 100644 --- a/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go +++ b/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go @@ -85,26 +85,48 @@ type huffmanBitWriter struct { // Data waiting to be written is bytes[0:nbytes] // and then the low nbits of bits. bits uint64 - nbits uint - bytes [256]byte - codegenFreq [codegenCodeCount]int32 + nbits uint16 nbytes uint8 - literalFreq []int32 - offsetFreq []int32 - codegen []uint8 literalEncoding *huffmanEncoder offsetEncoding *huffmanEncoder codegenEncoding *huffmanEncoder err error + lastHeader int + // Set between 0 (reused block can be up to 2x the size) + logReusePenalty uint + lastHuffMan bool + bytes [256]byte + literalFreq [lengthCodesStart + 32]uint16 + offsetFreq [32]uint16 + codegenFreq [codegenCodeCount]uint16 + + // codegen must have an extra space for the final symbol. + codegen [literalCount + offsetCodeCount + 1]uint8 } +// Huffman reuse. +// +// The huffmanBitWriter supports reusing huffman tables and thereby combining block sections. +// +// This is controlled by several variables: +// +// If lastHeader is non-zero the Huffman table can be reused. +// This also indicates that a Huffman table has been generated that can output all +// possible symbols. +// It also indicates that an EOB has not yet been emitted, so if a new tabel is generated +// an EOB with the previous table must be written. +// +// If lastHuffMan is set, a table for outputting literals has been generated and offsets are invalid. +// +// An incoming block estimates the output size of a new table using a 'fresh' by calculating the +// optimal size and adding a penalty in 'logReusePenalty'. +// A Huffman table is not optimal, which is why we add a penalty, and generating a new table +// is slower both for compression and decompression. + func newHuffmanBitWriter(w io.Writer) *huffmanBitWriter { return &huffmanBitWriter{ writer: w, - literalFreq: make([]int32, lengthCodesStart+32), - offsetFreq: make([]int32, 32), - codegen: make([]uint8, maxNumLit+offsetCodeCount+1), - literalEncoding: newHuffmanEncoder(maxNumLit), + literalEncoding: newHuffmanEncoder(literalCount), codegenEncoding: newHuffmanEncoder(codegenCodeCount), offsetEncoding: newHuffmanEncoder(offsetCodeCount), } @@ -114,6 +136,41 @@ func (w *huffmanBitWriter) reset(writer io.Writer) { w.writer = writer w.bits, w.nbits, w.nbytes, w.err = 0, 0, 0, nil w.bytes = [256]byte{} + w.lastHeader = 0 + w.lastHuffMan = false +} + +func (w *huffmanBitWriter) canReuse(t *tokens) (offsets, lits bool) { + offsets, lits = true, true + a := t.offHist[:offsetCodeCount] + b := w.offsetFreq[:len(a)] + for i := range a { + if b[i] == 0 && a[i] != 0 { + offsets = false + break + } + } + + a = t.extraHist[:literalCount-256] + b = w.literalFreq[256:literalCount] + b = b[:len(a)] + for i := range a { + if b[i] == 0 && a[i] != 0 { + lits = false + break + } + } + if lits { + a = t.litHist[:] + b = w.literalFreq[:len(a)] + for i := range a { + if b[i] == 0 && a[i] != 0 { + lits = false + break + } + } + } + return } func (w *huffmanBitWriter) flush() { @@ -144,30 +201,11 @@ func (w *huffmanBitWriter) write(b []byte) { _, w.err = w.writer.Write(b) } -func (w *huffmanBitWriter) writeBits(b int32, nb uint) { - w.bits |= uint64(b) << w.nbits +func (w *huffmanBitWriter) writeBits(b int32, nb uint16) { + w.bits |= uint64(b) << (w.nbits & 63) w.nbits += nb if w.nbits >= 48 { - bits := w.bits - w.bits >>= 48 - w.nbits -= 48 - n := w.nbytes - w.bytes[n] = byte(bits) - w.bytes[n+1] = byte(bits >> 8) - w.bytes[n+2] = byte(bits >> 16) - w.bytes[n+3] = byte(bits >> 24) - w.bytes[n+4] = byte(bits >> 32) - w.bytes[n+5] = byte(bits >> 40) - n += 6 - if n >= bufferFlushSize { - if w.err != nil { - n = 0 - return - } - w.write(w.bytes[:n]) - n = 0 - } - w.nbytes = n + w.writeOutBits() } } @@ -213,7 +251,7 @@ func (w *huffmanBitWriter) generateCodegen(numLiterals int, numOffsets int, litE // a copy of the frequencies, and as the place where we put the result. // This is fine because the output is always shorter than the input used // so far. - codegen := w.codegen // cache + codegen := w.codegen[:] // cache // Copy the concatenated code sizes to codegen. Put a marker at the end. cgnl := codegen[:numLiterals] for i := range cgnl { @@ -292,30 +330,54 @@ func (w *huffmanBitWriter) generateCodegen(numLiterals int, numOffsets int, litE codegen[outIndex] = badCode } -// dynamicSize returns the size of dynamically encoded data in bits. -func (w *huffmanBitWriter) dynamicSize(litEnc, offEnc *huffmanEncoder, extraBits int) (size, numCodegens int) { +func (w *huffmanBitWriter) codegens() int { + numCodegens := len(w.codegenFreq) + for numCodegens > 4 && w.codegenFreq[codegenOrder[numCodegens-1]] == 0 { + numCodegens-- + } + return numCodegens +} + +func (w *huffmanBitWriter) headerSize() (size, numCodegens int) { numCodegens = len(w.codegenFreq) for numCodegens > 4 && w.codegenFreq[codegenOrder[numCodegens-1]] == 0 { numCodegens-- } - header := 3 + 5 + 5 + 4 + (3 * numCodegens) + + return 3 + 5 + 5 + 4 + (3 * numCodegens) + w.codegenEncoding.bitLength(w.codegenFreq[:]) + int(w.codegenFreq[16])*2 + int(w.codegenFreq[17])*3 + - int(w.codegenFreq[18])*7 + int(w.codegenFreq[18])*7, numCodegens +} + +// dynamicSize returns the size of dynamically encoded data in bits. +func (w *huffmanBitWriter) dynamicSize(litEnc, offEnc *huffmanEncoder, extraBits int) (size, numCodegens int) { + header, numCodegens := w.headerSize() size = header + - litEnc.bitLength(w.literalFreq) + - offEnc.bitLength(w.offsetFreq) + + litEnc.bitLength(w.literalFreq[:]) + + offEnc.bitLength(w.offsetFreq[:]) + extraBits - return size, numCodegens } +// extraBitSize will return the number of bits that will be written +// as "extra" bits on matches. +func (w *huffmanBitWriter) extraBitSize() int { + total := 0 + for i, n := range w.literalFreq[257:literalCount] { + total += int(n) * int(lengthExtraBits[i&31]) + } + for i, n := range w.offsetFreq[:offsetCodeCount] { + total += int(n) * int(offsetExtraBits[i&31]) + } + return total +} + // fixedSize returns the size of dynamically encoded data in bits. func (w *huffmanBitWriter) fixedSize(extraBits int) int { return 3 + - fixedLiteralEncoding.bitLength(w.literalFreq) + - fixedOffsetEncoding.bitLength(w.offsetFreq) + + fixedLiteralEncoding.bitLength(w.literalFreq[:]) + + fixedOffsetEncoding.bitLength(w.offsetFreq[:]) + extraBits } @@ -333,30 +395,36 @@ func (w *huffmanBitWriter) storedSize(in []byte) (int, bool) { } func (w *huffmanBitWriter) writeCode(c hcode) { + // The function does not get inlined if we "& 63" the shift. w.bits |= uint64(c.code) << w.nbits - w.nbits += uint(c.len) + w.nbits += c.len if w.nbits >= 48 { - bits := w.bits - w.bits >>= 48 - w.nbits -= 48 - n := w.nbytes - w.bytes[n] = byte(bits) - w.bytes[n+1] = byte(bits >> 8) - w.bytes[n+2] = byte(bits >> 16) - w.bytes[n+3] = byte(bits >> 24) - w.bytes[n+4] = byte(bits >> 32) - w.bytes[n+5] = byte(bits >> 40) - n += 6 - if n >= bufferFlushSize { - if w.err != nil { - n = 0 - return - } - w.write(w.bytes[:n]) + w.writeOutBits() + } +} + +// writeOutBits will write bits to the buffer. +func (w *huffmanBitWriter) writeOutBits() { + bits := w.bits + w.bits >>= 48 + w.nbits -= 48 + n := w.nbytes + w.bytes[n] = byte(bits) + w.bytes[n+1] = byte(bits >> 8) + w.bytes[n+2] = byte(bits >> 16) + w.bytes[n+3] = byte(bits >> 24) + w.bytes[n+4] = byte(bits >> 32) + w.bytes[n+5] = byte(bits >> 40) + n += 6 + if n >= bufferFlushSize { + if w.err != nil { n = 0 + return } - w.nbytes = n + w.write(w.bytes[:n]) + n = 0 } + w.nbytes = n } // Write the header of a dynamic Huffman block to the output stream. @@ -412,6 +480,11 @@ func (w *huffmanBitWriter) writeStoredHeader(length int, isEof bool) { if w.err != nil { return } + if w.lastHeader > 0 { + // We owe an EOB + w.writeCode(w.literalEncoding.codes[endBlockMarker]) + w.lastHeader = 0 + } var flag int32 if isEof { flag = 1 @@ -426,6 +499,12 @@ func (w *huffmanBitWriter) writeFixedHeader(isEof bool) { if w.err != nil { return } + if w.lastHeader > 0 { + // We owe an EOB + w.writeCode(w.literalEncoding.codes[endBlockMarker]) + w.lastHeader = 0 + } + // Indicate that we are a fixed Huffman block var value int32 = 2 if isEof { @@ -439,29 +518,23 @@ func (w *huffmanBitWriter) writeFixedHeader(isEof bool) { // is larger than the original bytes, the data will be written as a // stored block. // If the input is nil, the tokens will always be Huffman encoded. -func (w *huffmanBitWriter) writeBlock(tokens []token, eof bool, input []byte) { +func (w *huffmanBitWriter) writeBlock(tokens *tokens, eof bool, input []byte) { if w.err != nil { return } - tokens = append(tokens, endBlockMarker) - numLiterals, numOffsets := w.indexTokens(tokens) - + tokens.AddEOB() + if w.lastHeader > 0 { + // We owe an EOB + w.writeCode(w.literalEncoding.codes[endBlockMarker]) + w.lastHeader = 0 + } + numLiterals, numOffsets := w.indexTokens(tokens, false) + w.generate(tokens) var extraBits int storedSize, storable := w.storedSize(input) if storable { - // We only bother calculating the costs of the extra bits required by - // the length of offset fields (which will be the same for both fixed - // and dynamic encoding), if we need to compare those two encodings - // against stored encoding. - for lengthCode := lengthCodesStart + 8; lengthCode < numLiterals; lengthCode++ { - // First eight length codes have extra size = 0. - extraBits += int(w.literalFreq[lengthCode]) * int(lengthExtraBits[lengthCode-lengthCodesStart]) - } - for offsetCode := 4; offsetCode < numOffsets; offsetCode++ { - // First four offset codes have extra size = 0. - extraBits += int(w.offsetFreq[offsetCode]) * int(offsetExtraBits[offsetCode&63]) - } + extraBits = w.extraBitSize() } // Figure out smallest code. @@ -500,7 +573,7 @@ func (w *huffmanBitWriter) writeBlock(tokens []token, eof bool, input []byte) { } // Write the tokens. - w.writeTokens(tokens, literalEncoding.codes, offsetEncoding.codes) + w.writeTokens(tokens.Slice(), literalEncoding.codes, offsetEncoding.codes) } // writeBlockDynamic encodes a block using a dynamic Huffman table. @@ -508,72 +581,103 @@ func (w *huffmanBitWriter) writeBlock(tokens []token, eof bool, input []byte) { // histogram distribution. // If input is supplied and the compression savings are below 1/16th of the // input size the block is stored. -func (w *huffmanBitWriter) writeBlockDynamic(tokens []token, eof bool, input []byte) { +func (w *huffmanBitWriter) writeBlockDynamic(tokens *tokens, eof bool, input []byte, sync bool) { if w.err != nil { return } - tokens = append(tokens, endBlockMarker) - numLiterals, numOffsets := w.indexTokens(tokens) + sync = sync || eof + if sync { + tokens.AddEOB() + } - // Generate codegen and codegenFrequencies, which indicates how to encode - // the literalEncoding and the offsetEncoding. - w.generateCodegen(numLiterals, numOffsets, w.literalEncoding, w.offsetEncoding) - w.codegenEncoding.generate(w.codegenFreq[:], 7) - size, numCodegens := w.dynamicSize(w.literalEncoding, w.offsetEncoding, 0) + // We cannot reuse pure huffman table. + if w.lastHuffMan && w.lastHeader > 0 { + // We will not try to reuse. + w.writeCode(w.literalEncoding.codes[endBlockMarker]) + w.lastHeader = 0 + w.lastHuffMan = false + } + if !sync { + tokens.Fill() + } + numLiterals, numOffsets := w.indexTokens(tokens, !sync) - // Store bytes, if we don't get a reasonable improvement. - if ssize, storable := w.storedSize(input); storable && ssize < (size+size>>4) { - w.writeStoredHeader(len(input), eof) - w.writeBytes(input) - return + var size int + // Check if we should reuse. + if w.lastHeader > 0 { + // Estimate size for using a new table + newSize := w.lastHeader + tokens.EstimatedBits() + + // The estimated size is calculated as an optimal table. + // We add a penalty to make it more realistic and re-use a bit more. + newSize += newSize >> (w.logReusePenalty & 31) + extra := w.extraBitSize() + reuseSize, _ := w.dynamicSize(w.literalEncoding, w.offsetEncoding, extra) + + // Check if a new table is better. + if newSize < reuseSize { + // Write the EOB we owe. + w.writeCode(w.literalEncoding.codes[endBlockMarker]) + size = newSize + w.lastHeader = 0 + } else { + size = reuseSize + } + // Check if we get a reasonable size decrease. + if ssize, storable := w.storedSize(input); storable && ssize < (size+size>>4) { + w.writeStoredHeader(len(input), eof) + w.writeBytes(input) + w.lastHeader = 0 + return + } } - // Write Huffman table. - w.writeDynamicHeader(numLiterals, numOffsets, numCodegens, eof) + // We want a new block/table + if w.lastHeader == 0 { + w.generate(tokens) + // Generate codegen and codegenFrequencies, which indicates how to encode + // the literalEncoding and the offsetEncoding. + w.generateCodegen(numLiterals, numOffsets, w.literalEncoding, w.offsetEncoding) + w.codegenEncoding.generate(w.codegenFreq[:], 7) + var numCodegens int + size, numCodegens = w.dynamicSize(w.literalEncoding, w.offsetEncoding, w.extraBitSize()) + // Store bytes, if we don't get a reasonable improvement. + if ssize, storable := w.storedSize(input); storable && ssize < (size+size>>4) { + w.writeStoredHeader(len(input), eof) + w.writeBytes(input) + w.lastHeader = 0 + return + } + + // Write Huffman table. + w.writeDynamicHeader(numLiterals, numOffsets, numCodegens, eof) + w.lastHeader, _ = w.headerSize() + w.lastHuffMan = false + } + if sync { + w.lastHeader = 0 + } // Write the tokens. - w.writeTokens(tokens, w.literalEncoding.codes, w.offsetEncoding.codes) + w.writeTokens(tokens.Slice(), w.literalEncoding.codes, w.offsetEncoding.codes) } // indexTokens indexes a slice of tokens, and updates // literalFreq and offsetFreq, and generates literalEncoding // and offsetEncoding. // The number of literal and offset tokens is returned. -func (w *huffmanBitWriter) indexTokens(tokens []token) (numLiterals, numOffsets int) { - for i := range w.literalFreq { - w.literalFreq[i] = 0 - } - for i := range w.offsetFreq { - w.offsetFreq[i] = 0 - } +func (w *huffmanBitWriter) indexTokens(t *tokens, filled bool) (numLiterals, numOffsets int) { + copy(w.literalFreq[:], t.litHist[:]) + copy(w.literalFreq[256:], t.extraHist[:]) + copy(w.offsetFreq[:], t.offHist[:offsetCodeCount]) - if len(tokens) == 0 { + if t.n == 0 { return } - - // Only last token should be endBlockMarker. - if tokens[len(tokens)-1] == endBlockMarker { - w.literalFreq[endBlockMarker]++ - tokens = tokens[:len(tokens)-1] + if filled { + return maxNumLit, maxNumDist } - - // Create slices up to the next power of two to avoid bounds checks. - lits := w.literalFreq[:256] - offs := w.offsetFreq[:32] - lengths := w.literalFreq[lengthCodesStart:] - lengths = lengths[:32] - for _, t := range tokens { - if t < endBlockMarker { - lits[t.literal()]++ - continue - } - length := t.length() - offset := t.offset() - lengths[lengthCode(length)&31]++ - offs[offsetCode(offset)&31]++ - } - // get the number of literals numLiterals = len(w.literalFreq) for w.literalFreq[numLiterals-1] == 0 { @@ -590,11 +694,14 @@ func (w *huffmanBitWriter) indexTokens(tokens []token) (numLiterals, numOffsets w.offsetFreq[0] = 1 numOffsets = 1 } - w.literalEncoding.generate(w.literalFreq[:maxNumLit], 15) - w.offsetEncoding.generate(w.offsetFreq[:offsetCodeCount], 15) return } +func (w *huffmanBitWriter) generate(t *tokens) { + w.literalEncoding.generate(w.literalFreq[:literalCount], 15) + w.offsetEncoding.generate(w.offsetFreq[:offsetCodeCount], 15) +} + // writeTokens writes a slice of tokens to the output. // codes for literal and offset encoding must be supplied. func (w *huffmanBitWriter) writeTokens(tokens []token, leCodes, oeCodes []hcode) { @@ -626,8 +733,19 @@ func (w *huffmanBitWriter) writeTokens(tokens []token, leCodes, oeCodes []hcode) // Write the length length := t.length() lengthCode := lengthCode(length) - w.writeCode(lengths[lengthCode&31]) - extraLengthBits := uint(lengthExtraBits[lengthCode&31]) + if false { + w.writeCode(lengths[lengthCode&31]) + } else { + // inlined + c := lengths[lengthCode&31] + w.bits |= uint64(c.code) << (w.nbits & 63) + w.nbits += c.len + if w.nbits >= 48 { + w.writeOutBits() + } + } + + extraLengthBits := uint16(lengthExtraBits[lengthCode&31]) if extraLengthBits > 0 { extraLength := int32(length - lengthBase[lengthCode&31]) w.writeBits(extraLength, extraLengthBits) @@ -635,8 +753,18 @@ func (w *huffmanBitWriter) writeTokens(tokens []token, leCodes, oeCodes []hcode) // Write the offset offset := t.offset() offsetCode := offsetCode(offset) - w.writeCode(offs[offsetCode&31]) - extraOffsetBits := uint(offsetExtraBits[offsetCode&63]) + if false { + w.writeCode(offs[offsetCode&31]) + } else { + // inlined + c := offs[offsetCode&31] + w.bits |= uint64(c.code) << (w.nbits & 63) + w.nbits += c.len + if w.nbits >= 48 { + w.writeOutBits() + } + } + extraOffsetBits := uint16(offsetExtraBits[offsetCode&63]) if extraOffsetBits > 0 { extraOffset := int32(offset - offsetBase[offsetCode&63]) w.writeBits(extraOffset, extraOffsetBits) @@ -661,75 +789,93 @@ func init() { // writeBlockHuff encodes a block of bytes as either // Huffman encoded literals or uncompressed bytes if the // results only gains very little from compression. -func (w *huffmanBitWriter) writeBlockHuff(eof bool, input []byte) { +func (w *huffmanBitWriter) writeBlockHuff(eof bool, input []byte, sync bool) { if w.err != nil { return } // Clear histogram - for i := range w.literalFreq { + for i := range w.literalFreq[:] { w.literalFreq[i] = 0 } + if !w.lastHuffMan { + for i := range w.offsetFreq[:] { + w.offsetFreq[i] = 0 + } + } // Add everything as literals - histogram(input, w.literalFreq) + estBits := histogramSize(input, w.literalFreq[:], !eof && !sync) + 15 - w.literalFreq[endBlockMarker] = 1 + // Store bytes, if we don't get a reasonable improvement. + ssize, storable := w.storedSize(input) + if storable && ssize < (estBits+estBits>>4) { + w.writeStoredHeader(len(input), eof) + w.writeBytes(input) + return + } - const numLiterals = endBlockMarker + 1 - const numOffsets = 1 + if w.lastHeader > 0 { + size, _ := w.dynamicSize(w.literalEncoding, huffOffset, w.lastHeader) + estBits += estBits >> (w.logReusePenalty) - w.literalEncoding.generate(w.literalFreq[:maxNumLit], 15) + if estBits < size { + // We owe an EOB + w.writeCode(w.literalEncoding.codes[endBlockMarker]) + w.lastHeader = 0 + } + } - // Figure out smallest code. - // Always use dynamic Huffman or Store - var numCodegens int + const numLiterals = endBlockMarker + 1 + const numOffsets = 1 + if w.lastHeader == 0 { + w.literalFreq[endBlockMarker] = 1 + w.literalEncoding.generate(w.literalFreq[:numLiterals], 15) - // Generate codegen and codegenFrequencies, which indicates how to encode - // the literalEncoding and the offsetEncoding. - w.generateCodegen(numLiterals, numOffsets, w.literalEncoding, huffOffset) - w.codegenEncoding.generate(w.codegenFreq[:], 7) - size, numCodegens := w.dynamicSize(w.literalEncoding, huffOffset, 0) + // Generate codegen and codegenFrequencies, which indicates how to encode + // the literalEncoding and the offsetEncoding. + w.generateCodegen(numLiterals, numOffsets, w.literalEncoding, huffOffset) + w.codegenEncoding.generate(w.codegenFreq[:], 7) + numCodegens := w.codegens() - // Store bytes, if we don't get a reasonable improvement. - if ssize, storable := w.storedSize(input); storable && ssize < (size+size>>4) { - w.writeStoredHeader(len(input), eof) - w.writeBytes(input) - return + // Huffman. + w.writeDynamicHeader(numLiterals, numOffsets, numCodegens, eof) + w.lastHuffMan = true + w.lastHeader, _ = w.headerSize() } - // Huffman. - w.writeDynamicHeader(numLiterals, numOffsets, numCodegens, eof) encoding := w.literalEncoding.codes[:257] - n := w.nbytes for _, t := range input { // Bitwriting inlined, ~30% speedup c := encoding[t] - w.bits |= uint64(c.code) << w.nbits - w.nbits += uint(c.len) - if w.nbits < 48 { - continue - } - // Store 6 bytes - bits := w.bits - w.bits >>= 48 - w.nbits -= 48 - w.bytes[n] = byte(bits) - w.bytes[n+1] = byte(bits >> 8) - w.bytes[n+2] = byte(bits >> 16) - w.bytes[n+3] = byte(bits >> 24) - w.bytes[n+4] = byte(bits >> 32) - w.bytes[n+5] = byte(bits >> 40) - n += 6 - if n < bufferFlushSize { - continue - } - w.write(w.bytes[:n]) - if w.err != nil { - return // Return early in the event of write failures + w.bits |= uint64(c.code) << ((w.nbits) & 63) + w.nbits += c.len + if w.nbits >= 48 { + bits := w.bits + w.bits >>= 48 + w.nbits -= 48 + n := w.nbytes + w.bytes[n] = byte(bits) + w.bytes[n+1] = byte(bits >> 8) + w.bytes[n+2] = byte(bits >> 16) + w.bytes[n+3] = byte(bits >> 24) + w.bytes[n+4] = byte(bits >> 32) + w.bytes[n+5] = byte(bits >> 40) + n += 6 + if n >= bufferFlushSize { + if w.err != nil { + n = 0 + return + } + w.write(w.bytes[:n]) + n = 0 + } + w.nbytes = n } - n = 0 } - w.nbytes = n - w.writeCode(encoding[endBlockMarker]) + if eof || sync { + w.writeCode(encoding[endBlockMarker]) + w.lastHeader = 0 + w.lastHuffMan = false + } } diff --git a/vendor/github.com/klauspost/compress/flate/huffman_code.go b/vendor/github.com/klauspost/compress/flate/huffman_code.go index f65f79336..d0099599c 100644 --- a/vendor/github.com/klauspost/compress/flate/huffman_code.go +++ b/vendor/github.com/klauspost/compress/flate/huffman_code.go @@ -10,6 +10,12 @@ import ( "sort" ) +const ( + maxBitsLimit = 16 + // number of valid literals + literalCount = 286 +) + // hcode is a huffman code with a bit code and bit length. type hcode struct { code, len uint16 @@ -25,7 +31,7 @@ type huffmanEncoder struct { type literalNode struct { literal uint16 - freq int32 + freq uint16 } // A levelInfo describes the state of the constructed tree for a given depth. @@ -54,7 +60,11 @@ func (h *hcode) set(code uint16, length uint16) { h.code = code } -func maxNode() literalNode { return literalNode{math.MaxUint16, math.MaxInt32} } +func reverseBits(number uint16, bitLength byte) uint16 { + return bits.Reverse16(number << ((16 - bitLength) & 15)) +} + +func maxNode() literalNode { return literalNode{math.MaxUint16, math.MaxUint16} } func newHuffmanEncoder(size int) *huffmanEncoder { // Make capacity to next power of two. @@ -64,10 +74,10 @@ func newHuffmanEncoder(size int) *huffmanEncoder { // Generates a HuffmanCode corresponding to the fixed literal table func generateFixedLiteralEncoding() *huffmanEncoder { - h := newHuffmanEncoder(maxNumLit) + h := newHuffmanEncoder(literalCount) codes := h.codes var ch uint16 - for ch = 0; ch < maxNumLit; ch++ { + for ch = 0; ch < literalCount; ch++ { var bits uint16 var size uint16 switch { @@ -108,7 +118,7 @@ func generateFixedOffsetEncoding() *huffmanEncoder { var fixedLiteralEncoding *huffmanEncoder = generateFixedLiteralEncoding() var fixedOffsetEncoding *huffmanEncoder = generateFixedOffsetEncoding() -func (h *huffmanEncoder) bitLength(freq []int32) int { +func (h *huffmanEncoder) bitLength(freq []uint16) int { var total int for i, f := range freq { if f != 0 { @@ -118,8 +128,6 @@ func (h *huffmanEncoder) bitLength(freq []int32) int { return total } -const maxBitsLimit = 16 - // Return the number of literals assigned to each bit size in the Huffman encoding // // This method is only called when list.length >= 3 @@ -163,9 +171,9 @@ func (h *huffmanEncoder) bitCounts(list []literalNode, maxBits int32) []int32 { // We initialize the levels as if we had already figured this out. levels[level] = levelInfo{ level: level, - lastFreq: list[1].freq, - nextCharFreq: list[2].freq, - nextPairFreq: list[0].freq + list[1].freq, + lastFreq: int32(list[1].freq), + nextCharFreq: int32(list[2].freq), + nextPairFreq: int32(list[0].freq) + int32(list[1].freq), } leafCounts[level][level] = 2 if level == 1 { @@ -197,7 +205,12 @@ func (h *huffmanEncoder) bitCounts(list []literalNode, maxBits int32) []int32 { l.lastFreq = l.nextCharFreq // Lower leafCounts are the same of the previous node. leafCounts[level][level] = n - l.nextCharFreq = list[n].freq + e := list[n] + if e.literal < math.MaxUint16 { + l.nextCharFreq = int32(e.freq) + } else { + l.nextCharFreq = math.MaxInt32 + } } else { // The next item on this row is a pair from the previous row. // nextPairFreq isn't valid until we generate two @@ -273,12 +286,12 @@ func (h *huffmanEncoder) assignEncodingAndSize(bitCount []int32, list []literalN // // freq An array of frequencies, in which frequency[i] gives the frequency of literal i. // maxBits The maximum number of bits to use for any literal. -func (h *huffmanEncoder) generate(freq []int32, maxBits int32) { +func (h *huffmanEncoder) generate(freq []uint16, maxBits int32) { if h.freqcache == nil { // Allocate a reusable buffer with the longest possible frequency table. - // Possible lengths are codegenCodeCount, offsetCodeCount and maxNumLit. - // The largest of these is maxNumLit, so we allocate for that case. - h.freqcache = make([]literalNode, maxNumLit+1) + // Possible lengths are codegenCodeCount, offsetCodeCount and literalCount. + // The largest of these is literalCount, so we allocate for that case. + h.freqcache = make([]literalNode, literalCount+1) } list := h.freqcache[:len(freq)+1] // Number of non-zero literals @@ -345,3 +358,27 @@ func (s byFreq) Less(i, j int) bool { } func (s byFreq) Swap(i, j int) { s[i], s[j] = s[j], s[i] } + +// histogramSize accumulates a histogram of b in h. +// An estimated size in bits is returned. +// Unassigned values are assigned '1' in the histogram. +// len(h) must be >= 256, and h's elements must be all zeroes. +func histogramSize(b []byte, h []uint16, fill bool) int { + h = h[:256] + for _, t := range b { + h[t]++ + } + invTotal := 1.0 / float64(len(b)) + shannon := 0.0 + single := math.Ceil(-math.Log2(invTotal)) + for i, v := range h[:] { + if v > 0 { + n := float64(v) + shannon += math.Ceil(-math.Log2(n*invTotal) * n) + } else if fill { + shannon += single + h[i] = 1 + } + } + return int(shannon + 0.99) +} diff --git a/vendor/github.com/klauspost/compress/flate/inflate.go b/vendor/github.com/klauspost/compress/flate/inflate.go index 800d0ce9e..6dc5b5d06 100644 --- a/vendor/github.com/klauspost/compress/flate/inflate.go +++ b/vendor/github.com/klauspost/compress/flate/inflate.go @@ -9,6 +9,7 @@ package flate import ( "bufio" + "fmt" "io" "math/bits" "strconv" @@ -24,6 +25,8 @@ const ( maxNumLit = 286 maxNumDist = 30 numCodes = 19 // number of codes in Huffman meta-code + + debugDecode = false ) // Initialize the fixedHuffmanDecoder only once upon first use. @@ -104,8 +107,8 @@ const ( type huffmanDecoder struct { min int // the minimum code length - chunks *[huffmanNumChunks]uint32 // chunks as described above - links [][]uint32 // overflow links + chunks *[huffmanNumChunks]uint16 // chunks as described above + links [][]uint16 // overflow links linkMask uint32 // mask the width of the link table } @@ -121,7 +124,7 @@ func (h *huffmanDecoder) init(lengths []int) bool { const sanity = false if h.chunks == nil { - h.chunks = &[huffmanNumChunks]uint32{} + h.chunks = &[huffmanNumChunks]uint16{} } if h.min != 0 { *h = huffmanDecoder{chunks: h.chunks, links: h.links} @@ -169,6 +172,9 @@ func (h *huffmanDecoder) init(lengths []int) bool { // accept degenerate single-code codings. See also // TestDegenerateHuffmanCoding. if code != 1<<uint(max) && !(code == 1 && max == 1) { + if debugDecode { + fmt.Println("coding failed, code, max:", code, max, code == 1<<uint(max), code == 1 && max == 1, "(one should be true)") + } return false } @@ -185,7 +191,7 @@ func (h *huffmanDecoder) init(lengths []int) bool { // create link tables link := nextcode[huffmanChunkBits+1] >> 1 if cap(h.links) < huffmanNumChunks-link { - h.links = make([][]uint32, huffmanNumChunks-link) + h.links = make([][]uint16, huffmanNumChunks-link) } else { h.links = h.links[:huffmanNumChunks-link] } @@ -196,9 +202,9 @@ func (h *huffmanDecoder) init(lengths []int) bool { if sanity && h.chunks[reverse] != 0 { panic("impossible: overwriting existing chunk") } - h.chunks[reverse] = uint32(off<<huffmanValueShift | (huffmanChunkBits + 1)) + h.chunks[reverse] = uint16(off<<huffmanValueShift | (huffmanChunkBits + 1)) if cap(h.links[off]) < numLinks { - h.links[off] = make([]uint32, numLinks) + h.links[off] = make([]uint16, numLinks) } else { links := h.links[off][:0] h.links[off] = links[:numLinks] @@ -214,7 +220,7 @@ func (h *huffmanDecoder) init(lengths []int) bool { } code := nextcode[n] nextcode[n]++ - chunk := uint32(i<<huffmanValueShift | n) + chunk := uint16(i<<huffmanValueShift | n) reverse := int(bits.Reverse16(uint16(code))) reverse >>= uint(16 - n) if n <= huffmanChunkBits { @@ -347,6 +353,9 @@ func (f *decompressor) nextBlock() { f.huffmanBlock() default: // 3 is reserved. + if debugDecode { + fmt.Println("reserved data block encountered") + } f.err = CorruptInputError(f.roffset) } } @@ -425,11 +434,17 @@ func (f *decompressor) readHuffman() error { } nlit := int(f.b&0x1F) + 257 if nlit > maxNumLit { + if debugDecode { + fmt.Println("nlit > maxNumLit", nlit) + } return CorruptInputError(f.roffset) } f.b >>= 5 ndist := int(f.b&0x1F) + 1 if ndist > maxNumDist { + if debugDecode { + fmt.Println("ndist > maxNumDist", ndist) + } return CorruptInputError(f.roffset) } f.b >>= 5 @@ -453,6 +468,9 @@ func (f *decompressor) readHuffman() error { f.codebits[codeOrder[i]] = 0 } if !f.h1.init(f.codebits[0:]) { + if debugDecode { + fmt.Println("init codebits failed") + } return CorruptInputError(f.roffset) } @@ -480,6 +498,9 @@ func (f *decompressor) readHuffman() error { rep = 3 nb = 2 if i == 0 { + if debugDecode { + fmt.Println("i==0") + } return CorruptInputError(f.roffset) } b = f.bits[i-1] @@ -494,6 +515,9 @@ func (f *decompressor) readHuffman() error { } for f.nb < nb { if err := f.moreBits(); err != nil { + if debugDecode { + fmt.Println("morebits:", err) + } return err } } @@ -501,6 +525,9 @@ func (f *decompressor) readHuffman() error { f.b >>= nb f.nb -= nb if i+rep > n { + if debugDecode { + fmt.Println("i+rep > n", i, rep, n) + } return CorruptInputError(f.roffset) } for j := 0; j < rep; j++ { @@ -510,6 +537,9 @@ func (f *decompressor) readHuffman() error { } if !f.h1.init(f.bits[0:nlit]) || !f.h2.init(f.bits[nlit:nlit+ndist]) { + if debugDecode { + fmt.Println("init2 failed") + } return CorruptInputError(f.roffset) } @@ -587,12 +617,18 @@ readLiteral: length = 258 n = 0 default: + if debugDecode { + fmt.Println(v, ">= maxNumLit") + } f.err = CorruptInputError(f.roffset) return } if n > 0 { for f.nb < n { if err = f.moreBits(); err != nil { + if debugDecode { + fmt.Println("morebits n>0:", err) + } f.err = err return } @@ -606,6 +642,9 @@ readLiteral: if f.hd == nil { for f.nb < 5 { if err = f.moreBits(); err != nil { + if debugDecode { + fmt.Println("morebits f.nb<5:", err) + } f.err = err return } @@ -615,6 +654,9 @@ readLiteral: f.nb -= 5 } else { if dist, err = f.huffSym(f.hd); err != nil { + if debugDecode { + fmt.Println("huffsym:", err) + } f.err = err return } @@ -629,6 +671,9 @@ readLiteral: extra := (dist & 1) << nb for f.nb < nb { if err = f.moreBits(); err != nil { + if debugDecode { + fmt.Println("morebits f.nb<nb:", err) + } f.err = err return } @@ -638,12 +683,18 @@ readLiteral: f.nb -= nb dist = 1<<(nb+1) + 1 + extra default: + if debugDecode { + fmt.Println("dist too big:", dist, maxNumDist) + } f.err = CorruptInputError(f.roffset) return } // No check on length; encoding can be prescient. if dist > f.dict.histSize() { + if debugDecode { + fmt.Println("dist > f.dict.histSize():", dist, f.dict.histSize()) + } f.err = CorruptInputError(f.roffset) return } @@ -688,6 +739,9 @@ func (f *decompressor) dataBlock() { n := int(f.buf[0]) | int(f.buf[1])<<8 nn := int(f.buf[2]) | int(f.buf[3])<<8 if uint16(nn) != uint16(^n) { + if debugDecode { + fmt.Println("uint16(nn) != uint16(^n)", nn, ^n) + } f.err = CorruptInputError(f.roffset) return } @@ -789,6 +843,9 @@ func (f *decompressor) huffSym(h *huffmanDecoder) (int, error) { if n == 0 { f.b = b f.nb = nb + if debugDecode { + fmt.Println("huffsym: n==0") + } f.err = CorruptInputError(f.roffset) return 0, f.err } diff --git a/vendor/github.com/klauspost/compress/flate/level1.go b/vendor/github.com/klauspost/compress/flate/level1.go new file mode 100644 index 000000000..20de8f11f --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/level1.go @@ -0,0 +1,174 @@ +package flate + +// fastGen maintains the table for matches, +// and the previous byte block for level 2. +// This is the generic implementation. +type fastEncL1 struct { + fastGen + table [tableSize]tableEntry +} + +// EncodeL1 uses a similar algorithm to level 1 +func (e *fastEncL1) Encode(dst *tokens, src []byte) { + const ( + inputMargin = 12 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + // Protect against e.cur wraparound. + for e.cur >= bufferReset { + if len(e.hist) == 0 { + for i := range e.table[:] { + e.table[i] = tableEntry{} + } + e.cur = maxMatchOffset + break + } + // Shift down everything in the table that isn't already too far away. + minOff := e.cur + int32(len(e.hist)) - maxMatchOffset + for i := range e.table[:] { + v := e.table[i].offset + if v <= minOff { + v = 0 + } else { + v = v - e.cur + maxMatchOffset + } + e.table[i].offset = v + } + e.cur = maxMatchOffset + } + + s := e.addBlock(src) + + // This check isn't in the Snappy implementation, but there, the caller + // instead of the callee handles this case. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + // Override src + src = e.hist + nextEmit := s + + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int32(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load3232(src, s) + + for { + const skipLog = 5 + const doEvery = 2 + + nextS := s + var candidate tableEntry + for { + nextHash := hash(cv) + candidate = e.table[nextHash] + nextS = s + doEvery + (s-nextEmit)>>skipLog + if nextS > sLimit { + goto emitRemainder + } + + now := load6432(src, nextS) + e.table[nextHash] = tableEntry{offset: s + e.cur, val: cv} + nextHash = hash(uint32(now)) + + offset := s - (candidate.offset - e.cur) + if offset < maxMatchOffset && cv == candidate.val { + e.table[nextHash] = tableEntry{offset: nextS + e.cur, val: uint32(now)} + break + } + + // Do one right away... + cv = uint32(now) + s = nextS + nextS++ + candidate = e.table[nextHash] + now >>= 8 + e.table[nextHash] = tableEntry{offset: s + e.cur, val: cv} + + offset = s - (candidate.offset - e.cur) + if offset < maxMatchOffset && cv == candidate.val { + e.table[nextHash] = tableEntry{offset: nextS + e.cur, val: uint32(now)} + break + } + cv = uint32(now) + s = nextS + } + + // A 4-byte match has been found. We'll later see if more than 4 bytes + // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit + // them as literal bytes. + for { + // Invariant: we have a 4-byte match at s, and no need to emit any + // literal bytes prior to s. + + // Extend the 4-byte match as long as possible. + t := candidate.offset - e.cur + l := e.matchlenLong(s+4, t+4, src) + 4 + + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + + // Save the match found + dst.AddMatchLong(l, uint32(s-t-baseMatchOffset)) + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + if s >= sLimit { + // Index first pair after match end. + if int(s+l+4) < len(src) { + cv := load3232(src, s) + e.table[hash(cv)] = tableEntry{offset: s + e.cur, val: cv} + } + goto emitRemainder + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-2 and at s. If + // another emitCopy is not our next move, also calculate nextHash + // at s+1. At least on GOARCH=amd64, these three hash calculations + // are faster as one load64 call (with some shifts) instead of + // three load32 calls. + x := load6432(src, s-2) + o := e.cur + s - 2 + prevHash := hash(uint32(x)) + e.table[prevHash] = tableEntry{offset: o, val: uint32(x)} + x >>= 16 + currHash := hash(uint32(x)) + candidate = e.table[currHash] + e.table[currHash] = tableEntry{offset: o + 2, val: uint32(x)} + + offset := s - (candidate.offset - e.cur) + if offset > maxMatchOffset || uint32(x) != candidate.val { + cv = uint32(x >> 8) + s++ + break + } + } + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/level2.go b/vendor/github.com/klauspost/compress/flate/level2.go new file mode 100644 index 000000000..7c824431e --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/level2.go @@ -0,0 +1,199 @@ +package flate + +// fastGen maintains the table for matches, +// and the previous byte block for level 2. +// This is the generic implementation. +type fastEncL2 struct { + fastGen + table [bTableSize]tableEntry +} + +// EncodeL2 uses a similar algorithm to level 1, but is capable +// of matching across blocks giving better compression at a small slowdown. +func (e *fastEncL2) Encode(dst *tokens, src []byte) { + const ( + inputMargin = 12 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + // Protect against e.cur wraparound. + for e.cur >= bufferReset { + if len(e.hist) == 0 { + for i := range e.table[:] { + e.table[i] = tableEntry{} + } + e.cur = maxMatchOffset + break + } + // Shift down everything in the table that isn't already too far away. + minOff := e.cur + int32(len(e.hist)) - maxMatchOffset + for i := range e.table[:] { + v := e.table[i].offset + if v <= minOff { + v = 0 + } else { + v = v - e.cur + maxMatchOffset + } + e.table[i].offset = v + } + e.cur = maxMatchOffset + } + + s := e.addBlock(src) + + // This check isn't in the Snappy implementation, but there, the caller + // instead of the callee handles this case. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + // Override src + src = e.hist + nextEmit := s + + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int32(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load3232(src, s) + for { + // When should we start skipping if we haven't found matches in a long while. + const skipLog = 5 + const doEvery = 2 + + nextS := s + var candidate tableEntry + for { + nextHash := hash4u(cv, bTableBits) + s = nextS + nextS = s + doEvery + (s-nextEmit)>>skipLog + if nextS > sLimit { + goto emitRemainder + } + candidate = e.table[nextHash] + now := load6432(src, nextS) + e.table[nextHash] = tableEntry{offset: s + e.cur, val: cv} + nextHash = hash4u(uint32(now), bTableBits) + + offset := s - (candidate.offset - e.cur) + if offset < maxMatchOffset && cv == candidate.val { + e.table[nextHash] = tableEntry{offset: nextS + e.cur, val: uint32(now)} + break + } + + // Do one right away... + cv = uint32(now) + s = nextS + nextS++ + candidate = e.table[nextHash] + now >>= 8 + e.table[nextHash] = tableEntry{offset: s + e.cur, val: cv} + + offset = s - (candidate.offset - e.cur) + if offset < maxMatchOffset && cv == candidate.val { + break + } + cv = uint32(now) + } + + // A 4-byte match has been found. We'll later see if more than 4 bytes + // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit + // them as literal bytes. + + // Call emitCopy, and then see if another emitCopy could be our next + // move. Repeat until we find no match for the input immediately after + // what was consumed by the last emitCopy call. + // + // If we exit this loop normally then we need to call emitLiteral next, + // though we don't yet know how big the literal will be. We handle that + // by proceeding to the next iteration of the main loop. We also can + // exit this loop via goto if we get close to exhausting the input. + for { + // Invariant: we have a 4-byte match at s, and no need to emit any + // literal bytes prior to s. + + // Extend the 4-byte match as long as possible. + t := candidate.offset - e.cur + l := e.matchlenLong(s+4, t+4, src) + 4 + + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + + dst.AddMatchLong(l, uint32(s-t-baseMatchOffset)) + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + + if s >= sLimit { + // Index first pair after match end. + if int(s+l+4) < len(src) { + cv := load3232(src, s) + e.table[hash4u(cv, bTableBits)] = tableEntry{offset: s + e.cur, val: cv} + } + goto emitRemainder + } + + // Store every second hash in-between, but offset by 1. + for i := s - l + 2; i < s-5; i += 7 { + x := load6432(src, int32(i)) + nextHash := hash4u(uint32(x), bTableBits) + e.table[nextHash] = tableEntry{offset: e.cur + i, val: uint32(x)} + // Skip one + x >>= 16 + nextHash = hash4u(uint32(x), bTableBits) + e.table[nextHash] = tableEntry{offset: e.cur + i + 2, val: uint32(x)} + // Skip one + x >>= 16 + nextHash = hash4u(uint32(x), bTableBits) + e.table[nextHash] = tableEntry{offset: e.cur + i + 4, val: uint32(x)} + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-2 to s. If + // another emitCopy is not our next move, also calculate nextHash + // at s+1. At least on GOARCH=amd64, these three hash calculations + // are faster as one load64 call (with some shifts) instead of + // three load32 calls. + x := load6432(src, s-2) + o := e.cur + s - 2 + prevHash := hash4u(uint32(x), bTableBits) + prevHash2 := hash4u(uint32(x>>8), bTableBits) + e.table[prevHash] = tableEntry{offset: o, val: uint32(x)} + e.table[prevHash2] = tableEntry{offset: o + 1, val: uint32(x >> 8)} + currHash := hash4u(uint32(x>>16), bTableBits) + candidate = e.table[currHash] + e.table[currHash] = tableEntry{offset: o + 2, val: uint32(x >> 16)} + + offset := s - (candidate.offset - e.cur) + if offset > maxMatchOffset || uint32(x>>16) != candidate.val { + cv = uint32(x >> 24) + s++ + break + } + } + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/level3.go b/vendor/github.com/klauspost/compress/flate/level3.go new file mode 100644 index 000000000..4153d24c9 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/level3.go @@ -0,0 +1,225 @@ +package flate + +// fastEncL3 +type fastEncL3 struct { + fastGen + table [tableSize]tableEntryPrev +} + +// Encode uses a similar algorithm to level 2, will check up to two candidates. +func (e *fastEncL3) Encode(dst *tokens, src []byte) { + const ( + inputMargin = 8 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + // Protect against e.cur wraparound. + for e.cur >= bufferReset { + if len(e.hist) == 0 { + for i := range e.table[:] { + e.table[i] = tableEntryPrev{} + } + e.cur = maxMatchOffset + break + } + // Shift down everything in the table that isn't already too far away. + minOff := e.cur + int32(len(e.hist)) - maxMatchOffset + for i := range e.table[:] { + v := e.table[i] + if v.Cur.offset <= minOff { + v.Cur.offset = 0 + } else { + v.Cur.offset = v.Cur.offset - e.cur + maxMatchOffset + } + if v.Prev.offset <= minOff { + v.Prev.offset = 0 + } else { + v.Prev.offset = v.Prev.offset - e.cur + maxMatchOffset + } + e.table[i] = v + } + e.cur = maxMatchOffset + } + + s := e.addBlock(src) + + // Skip if too small. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + // Override src + src = e.hist + nextEmit := s + + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int32(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load3232(src, s) + for { + const skipLog = 6 + nextS := s + var candidate tableEntry + for { + nextHash := hash(cv) + s = nextS + nextS = s + 1 + (s-nextEmit)>>skipLog + if nextS > sLimit { + goto emitRemainder + } + candidates := e.table[nextHash] + now := load3232(src, nextS) + e.table[nextHash] = tableEntryPrev{Prev: candidates.Cur, Cur: tableEntry{offset: s + e.cur, val: cv}} + + // Check both candidates + candidate = candidates.Cur + offset := s - (candidate.offset - e.cur) + if cv == candidate.val { + if offset > maxMatchOffset { + cv = now + // Previous will also be invalid, we have nothing. + continue + } + o2 := s - (candidates.Prev.offset - e.cur) + if cv != candidates.Prev.val || o2 > maxMatchOffset { + break + } + // Both match and are valid, pick longest. + l1, l2 := matchLen(src[s+4:], src[s-offset+4:]), matchLen(src[s+4:], src[s-o2+4:]) + if l2 > l1 { + candidate = candidates.Prev + } + break + } else { + // We only check if value mismatches. + // Offset will always be invalid in other cases. + candidate = candidates.Prev + if cv == candidate.val { + offset := s - (candidate.offset - e.cur) + if offset <= maxMatchOffset { + break + } + } + } + cv = now + } + + // Call emitCopy, and then see if another emitCopy could be our next + // move. Repeat until we find no match for the input immediately after + // what was consumed by the last emitCopy call. + // + // If we exit this loop normally then we need to call emitLiteral next, + // though we don't yet know how big the literal will be. We handle that + // by proceeding to the next iteration of the main loop. We also can + // exit this loop via goto if we get close to exhausting the input. + for { + // Invariant: we have a 4-byte match at s, and no need to emit any + // literal bytes prior to s. + + // Extend the 4-byte match as long as possible. + // + t := candidate.offset - e.cur + l := e.matchlenLong(s+4, t+4, src) + 4 + + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + + dst.AddMatchLong(l, uint32(s-t-baseMatchOffset)) + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + + if s >= sLimit { + t += l + // Index first pair after match end. + if int(t+4) < len(src) && t > 0 { + cv := load3232(src, t) + nextHash := hash(cv) + e.table[nextHash] = tableEntryPrev{ + Prev: e.table[nextHash].Cur, + Cur: tableEntry{offset: e.cur + t, val: cv}, + } + } + goto emitRemainder + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-3 to s. + x := load6432(src, s-3) + prevHash := hash(uint32(x)) + e.table[prevHash] = tableEntryPrev{ + Prev: e.table[prevHash].Cur, + Cur: tableEntry{offset: e.cur + s - 3, val: uint32(x)}, + } + x >>= 8 + prevHash = hash(uint32(x)) + + e.table[prevHash] = tableEntryPrev{ + Prev: e.table[prevHash].Cur, + Cur: tableEntry{offset: e.cur + s - 2, val: uint32(x)}, + } + x >>= 8 + prevHash = hash(uint32(x)) + + e.table[prevHash] = tableEntryPrev{ + Prev: e.table[prevHash].Cur, + Cur: tableEntry{offset: e.cur + s - 1, val: uint32(x)}, + } + x >>= 8 + currHash := hash(uint32(x)) + candidates := e.table[currHash] + cv = uint32(x) + e.table[currHash] = tableEntryPrev{ + Prev: candidates.Cur, + Cur: tableEntry{offset: s + e.cur, val: cv}, + } + + // Check both candidates + candidate = candidates.Cur + if cv == candidate.val { + offset := s - (candidate.offset - e.cur) + if offset <= maxMatchOffset { + continue + } + } else { + // We only check if value mismatches. + // Offset will always be invalid in other cases. + candidate = candidates.Prev + if cv == candidate.val { + offset := s - (candidate.offset - e.cur) + if offset <= maxMatchOffset { + continue + } + } + } + cv = uint32(x >> 8) + s++ + break + } + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/level4.go b/vendor/github.com/klauspost/compress/flate/level4.go new file mode 100644 index 000000000..c689ac771 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/level4.go @@ -0,0 +1,210 @@ +package flate + +import "fmt" + +type fastEncL4 struct { + fastGen + table [tableSize]tableEntry + bTable [tableSize]tableEntry +} + +func (e *fastEncL4) Encode(dst *tokens, src []byte) { + const ( + inputMargin = 12 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + // Protect against e.cur wraparound. + for e.cur >= bufferReset { + if len(e.hist) == 0 { + for i := range e.table[:] { + e.table[i] = tableEntry{} + } + for i := range e.bTable[:] { + e.bTable[i] = tableEntry{} + } + e.cur = maxMatchOffset + break + } + // Shift down everything in the table that isn't already too far away. + minOff := e.cur + int32(len(e.hist)) - maxMatchOffset + for i := range e.table[:] { + v := e.table[i].offset + if v <= minOff { + v = 0 + } else { + v = v - e.cur + maxMatchOffset + } + e.table[i].offset = v + } + for i := range e.bTable[:] { + v := e.bTable[i].offset + if v <= minOff { + v = 0 + } else { + v = v - e.cur + maxMatchOffset + } + e.bTable[i].offset = v + } + e.cur = maxMatchOffset + } + + s := e.addBlock(src) + + // This check isn't in the Snappy implementation, but there, the caller + // instead of the callee handles this case. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + // Override src + src = e.hist + nextEmit := s + + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int32(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load6432(src, s) + for { + const skipLog = 6 + const doEvery = 1 + + nextS := s + var t int32 + for { + nextHashS := hash4x64(cv, tableBits) + nextHashL := hash7(cv, tableBits) + + s = nextS + nextS = s + doEvery + (s-nextEmit)>>skipLog + if nextS > sLimit { + goto emitRemainder + } + // Fetch a short+long candidate + sCandidate := e.table[nextHashS] + lCandidate := e.bTable[nextHashL] + next := load6432(src, nextS) + entry := tableEntry{offset: s + e.cur, val: uint32(cv)} + e.table[nextHashS] = entry + e.bTable[nextHashL] = entry + + t = lCandidate.offset - e.cur + if s-t < maxMatchOffset && uint32(cv) == lCandidate.val { + // We got a long match. Use that. + break + } + + t = sCandidate.offset - e.cur + if s-t < maxMatchOffset && uint32(cv) == sCandidate.val { + // Found a 4 match... + lCandidate = e.bTable[hash7(next, tableBits)] + + // If the next long is a candidate, check if we should use that instead... + lOff := nextS - (lCandidate.offset - e.cur) + if lOff < maxMatchOffset && lCandidate.val == uint32(next) { + l1, l2 := matchLen(src[s+4:], src[t+4:]), matchLen(src[nextS+4:], src[nextS-lOff+4:]) + if l2 > l1 { + s = nextS + t = lCandidate.offset - e.cur + } + } + break + } + cv = next + } + + // A 4-byte match has been found. We'll later see if more than 4 bytes + // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit + // them as literal bytes. + + // Extend the 4-byte match as long as possible. + l := e.matchlenLong(s+4, t+4, src) + 4 + + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + if false { + if t >= s { + panic("s-t") + } + if (s - t) > maxMatchOffset { + panic(fmt.Sprintln("mmo", t)) + } + if l < baseMatchLength { + panic("bml") + } + } + + dst.AddMatchLong(l, uint32(s-t-baseMatchOffset)) + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + + if s >= sLimit { + // Index first pair after match end. + if int(s+8) < len(src) { + cv := load6432(src, s) + e.table[hash4x64(cv, tableBits)] = tableEntry{offset: s + e.cur, val: uint32(cv)} + e.bTable[hash7(cv, tableBits)] = tableEntry{offset: s + e.cur, val: uint32(cv)} + } + goto emitRemainder + } + + // Store every 3rd hash in-between + if true { + i := nextS + if i < s-1 { + cv := load6432(src, i) + t := tableEntry{offset: i + e.cur, val: uint32(cv)} + t2 := tableEntry{val: uint32(cv >> 8), offset: t.offset + 1} + e.bTable[hash7(cv, tableBits)] = t + e.bTable[hash7(cv>>8, tableBits)] = t2 + e.table[hash4u(t2.val, tableBits)] = t2 + + i += 3 + for ; i < s-1; i += 3 { + cv := load6432(src, i) + t := tableEntry{offset: i + e.cur, val: uint32(cv)} + t2 := tableEntry{val: uint32(cv >> 8), offset: t.offset + 1} + e.bTable[hash7(cv, tableBits)] = t + e.bTable[hash7(cv>>8, tableBits)] = t2 + e.table[hash4u(t2.val, tableBits)] = t2 + } + } + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-1 and at s. + x := load6432(src, s-1) + o := e.cur + s - 1 + prevHashS := hash4x64(x, tableBits) + prevHashL := hash7(x, tableBits) + e.table[prevHashS] = tableEntry{offset: o, val: uint32(x)} + e.bTable[prevHashL] = tableEntry{offset: o, val: uint32(x)} + cv = x >> 8 + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/level5.go b/vendor/github.com/klauspost/compress/flate/level5.go new file mode 100644 index 000000000..14a235612 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/level5.go @@ -0,0 +1,276 @@ +package flate + +import "fmt" + +type fastEncL5 struct { + fastGen + table [tableSize]tableEntry + bTable [tableSize]tableEntryPrev +} + +func (e *fastEncL5) Encode(dst *tokens, src []byte) { + const ( + inputMargin = 12 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + // Protect against e.cur wraparound. + for e.cur >= bufferReset { + if len(e.hist) == 0 { + for i := range e.table[:] { + e.table[i] = tableEntry{} + } + for i := range e.bTable[:] { + e.bTable[i] = tableEntryPrev{} + } + e.cur = maxMatchOffset + break + } + // Shift down everything in the table that isn't already too far away. + minOff := e.cur + int32(len(e.hist)) - maxMatchOffset + for i := range e.table[:] { + v := e.table[i].offset + if v <= minOff { + v = 0 + } else { + v = v - e.cur + maxMatchOffset + } + e.table[i].offset = v + } + for i := range e.bTable[:] { + v := e.bTable[i] + if v.Cur.offset <= minOff { + v.Cur.offset = 0 + v.Prev.offset = 0 + } else { + v.Cur.offset = v.Cur.offset - e.cur + maxMatchOffset + if v.Prev.offset <= minOff { + v.Prev.offset = 0 + } else { + v.Prev.offset = v.Prev.offset - e.cur + maxMatchOffset + } + } + e.bTable[i] = v + } + e.cur = maxMatchOffset + } + + s := e.addBlock(src) + + // This check isn't in the Snappy implementation, but there, the caller + // instead of the callee handles this case. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + // Override src + src = e.hist + nextEmit := s + + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int32(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load6432(src, s) + for { + const skipLog = 6 + const doEvery = 1 + + nextS := s + var l int32 + var t int32 + for { + nextHashS := hash4x64(cv, tableBits) + nextHashL := hash7(cv, tableBits) + + s = nextS + nextS = s + doEvery + (s-nextEmit)>>skipLog + if nextS > sLimit { + goto emitRemainder + } + // Fetch a short+long candidate + sCandidate := e.table[nextHashS] + lCandidate := e.bTable[nextHashL] + next := load6432(src, nextS) + entry := tableEntry{offset: s + e.cur, val: uint32(cv)} + e.table[nextHashS] = entry + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = entry, eLong.Cur + + nextHashS = hash4x64(next, tableBits) + nextHashL = hash7(next, tableBits) + + t = lCandidate.Cur.offset - e.cur + if s-t < maxMatchOffset { + if uint32(cv) == lCandidate.Cur.val { + // Store the next match + e.table[nextHashS] = tableEntry{offset: nextS + e.cur, val: uint32(next)} + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: nextS + e.cur, val: uint32(next)}, eLong.Cur + + t2 := lCandidate.Prev.offset - e.cur + if s-t2 < maxMatchOffset && uint32(cv) == lCandidate.Prev.val { + l = e.matchlen(s+4, t+4, src) + 4 + ml1 := e.matchlen(s+4, t2+4, src) + 4 + if ml1 > l { + t = t2 + l = ml1 + break + } + } + break + } + t = lCandidate.Prev.offset - e.cur + if s-t < maxMatchOffset && uint32(cv) == lCandidate.Prev.val { + // Store the next match + e.table[nextHashS] = tableEntry{offset: nextS + e.cur, val: uint32(next)} + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: nextS + e.cur, val: uint32(next)}, eLong.Cur + break + } + } + + t = sCandidate.offset - e.cur + if s-t < maxMatchOffset && uint32(cv) == sCandidate.val { + // Found a 4 match... + l = e.matchlen(s+4, t+4, src) + 4 + lCandidate = e.bTable[nextHashL] + // Store the next match + + e.table[nextHashS] = tableEntry{offset: nextS + e.cur, val: uint32(next)} + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: nextS + e.cur, val: uint32(next)}, eLong.Cur + + // If the next long is a candidate, use that... + t2 := lCandidate.Cur.offset - e.cur + if nextS-t2 < maxMatchOffset { + if lCandidate.Cur.val == uint32(next) { + ml := e.matchlen(nextS+4, t2+4, src) + 4 + if ml > l { + t = t2 + s = nextS + l = ml + break + } + } + // If the previous long is a candidate, use that... + t2 = lCandidate.Prev.offset - e.cur + if nextS-t2 < maxMatchOffset && lCandidate.Prev.val == uint32(next) { + ml := e.matchlen(nextS+4, t2+4, src) + 4 + if ml > l { + t = t2 + s = nextS + l = ml + break + } + } + } + break + } + cv = next + } + + // A 4-byte match has been found. We'll later see if more than 4 bytes + // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit + // them as literal bytes. + + // Extend the 4-byte match as long as possible. + if l == 0 { + l = e.matchlenLong(s+4, t+4, src) + 4 + } else if l == maxMatchLength { + l += e.matchlenLong(s+l, t+l, src) + } + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + if false { + if t >= s { + panic(fmt.Sprintln("s-t", s, t)) + } + if (s - t) > maxMatchOffset { + panic(fmt.Sprintln("mmo", s-t)) + } + if l < baseMatchLength { + panic("bml") + } + } + + dst.AddMatchLong(l, uint32(s-t-baseMatchOffset)) + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + + if s >= sLimit { + goto emitRemainder + } + + // Store every 3rd hash in-between. + if true { + const hashEvery = 3 + i := s - l + 1 + if i < s-1 { + cv := load6432(src, i) + t := tableEntry{offset: i + e.cur, val: uint32(cv)} + e.table[hash4x64(cv, tableBits)] = t + eLong := &e.bTable[hash7(cv, tableBits)] + eLong.Cur, eLong.Prev = t, eLong.Cur + + // Do an long at i+1 + cv >>= 8 + t = tableEntry{offset: t.offset + 1, val: uint32(cv)} + eLong = &e.bTable[hash7(cv, tableBits)] + eLong.Cur, eLong.Prev = t, eLong.Cur + + // We only have enough bits for a short entry at i+2 + cv >>= 8 + t = tableEntry{offset: t.offset + 1, val: uint32(cv)} + e.table[hash4x64(cv, tableBits)] = t + + // Skip one - otherwise we risk hitting 's' + i += 4 + for ; i < s-1; i += hashEvery { + cv := load6432(src, i) + t := tableEntry{offset: i + e.cur, val: uint32(cv)} + t2 := tableEntry{offset: t.offset + 1, val: uint32(cv >> 8)} + eLong := &e.bTable[hash7(cv, tableBits)] + eLong.Cur, eLong.Prev = t, eLong.Cur + e.table[hash4u(t2.val, tableBits)] = t2 + } + } + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-1 and at s. + x := load6432(src, s-1) + o := e.cur + s - 1 + prevHashS := hash4x64(x, tableBits) + prevHashL := hash7(x, tableBits) + e.table[prevHashS] = tableEntry{offset: o, val: uint32(x)} + eLong := &e.bTable[prevHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: o, val: uint32(x)}, eLong.Cur + cv = x >> 8 + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/level6.go b/vendor/github.com/klauspost/compress/flate/level6.go new file mode 100644 index 000000000..cad0c7df7 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/level6.go @@ -0,0 +1,279 @@ +package flate + +import "fmt" + +type fastEncL6 struct { + fastGen + table [tableSize]tableEntry + bTable [tableSize]tableEntryPrev +} + +func (e *fastEncL6) Encode(dst *tokens, src []byte) { + const ( + inputMargin = 12 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + // Protect against e.cur wraparound. + for e.cur >= bufferReset { + if len(e.hist) == 0 { + for i := range e.table[:] { + e.table[i] = tableEntry{} + } + for i := range e.bTable[:] { + e.bTable[i] = tableEntryPrev{} + } + e.cur = maxMatchOffset + break + } + // Shift down everything in the table that isn't already too far away. + minOff := e.cur + int32(len(e.hist)) - maxMatchOffset + for i := range e.table[:] { + v := e.table[i].offset + if v <= minOff { + v = 0 + } else { + v = v - e.cur + maxMatchOffset + } + e.table[i].offset = v + } + for i := range e.bTable[:] { + v := e.bTable[i] + if v.Cur.offset <= minOff { + v.Cur.offset = 0 + v.Prev.offset = 0 + } else { + v.Cur.offset = v.Cur.offset - e.cur + maxMatchOffset + if v.Prev.offset <= minOff { + v.Prev.offset = 0 + } else { + v.Prev.offset = v.Prev.offset - e.cur + maxMatchOffset + } + } + e.bTable[i] = v + } + e.cur = maxMatchOffset + } + + s := e.addBlock(src) + + // This check isn't in the Snappy implementation, but there, the caller + // instead of the callee handles this case. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + // Override src + src = e.hist + nextEmit := s + + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int32(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load6432(src, s) + // Repeat MUST be > 1 and within range + repeat := int32(1) + for { + const skipLog = 7 + const doEvery = 1 + + nextS := s + var l int32 + var t int32 + for { + nextHashS := hash4x64(cv, tableBits) + nextHashL := hash7(cv, tableBits) + s = nextS + nextS = s + doEvery + (s-nextEmit)>>skipLog + if nextS > sLimit { + goto emitRemainder + } + // Fetch a short+long candidate + sCandidate := e.table[nextHashS] + lCandidate := e.bTable[nextHashL] + next := load6432(src, nextS) + entry := tableEntry{offset: s + e.cur, val: uint32(cv)} + e.table[nextHashS] = entry + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = entry, eLong.Cur + + // Calculate hashes of 'next' + nextHashS = hash4x64(next, tableBits) + nextHashL = hash7(next, tableBits) + + t = lCandidate.Cur.offset - e.cur + if s-t < maxMatchOffset { + if uint32(cv) == lCandidate.Cur.val { + // Long candidate matches at least 4 bytes. + + // Store the next match + e.table[nextHashS] = tableEntry{offset: nextS + e.cur, val: uint32(next)} + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: nextS + e.cur, val: uint32(next)}, eLong.Cur + + // Check the previous long candidate as well. + t2 := lCandidate.Prev.offset - e.cur + if s-t2 < maxMatchOffset && uint32(cv) == lCandidate.Prev.val { + l = e.matchlen(s+4, t+4, src) + 4 + ml1 := e.matchlen(s+4, t2+4, src) + 4 + if ml1 > l { + t = t2 + l = ml1 + break + } + } + break + } + // Current value did not match, but check if previous long value does. + t = lCandidate.Prev.offset - e.cur + if s-t < maxMatchOffset && uint32(cv) == lCandidate.Prev.val { + // Store the next match + e.table[nextHashS] = tableEntry{offset: nextS + e.cur, val: uint32(next)} + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: nextS + e.cur, val: uint32(next)}, eLong.Cur + break + } + } + + t = sCandidate.offset - e.cur + if s-t < maxMatchOffset && uint32(cv) == sCandidate.val { + // Found a 4 match... + l = e.matchlen(s+4, t+4, src) + 4 + + // Look up next long candidate (at nextS) + lCandidate = e.bTable[nextHashL] + + // Store the next match + e.table[nextHashS] = tableEntry{offset: nextS + e.cur, val: uint32(next)} + eLong := &e.bTable[nextHashL] + eLong.Cur, eLong.Prev = tableEntry{offset: nextS + e.cur, val: uint32(next)}, eLong.Cur + + // Check repeat at s + repOff + const repOff = 1 + t2 := s - repeat + repOff + if load3232(src, t2) == uint32(cv>>(8*repOff)) { + ml := e.matchlen(s+4+repOff, t2+4, src) + 4 + if ml > l { + t = t2 + l = ml + s += repOff + // Not worth checking more. + break + } + } + + // If the next long is a candidate, use that... + t2 = lCandidate.Cur.offset - e.cur + if nextS-t2 < maxMatchOffset { + if lCandidate.Cur.val == uint32(next) { + ml := e.matchlen(nextS+4, t2+4, src) + 4 + if ml > l { + t = t2 + s = nextS + l = ml + // This is ok, but check previous as well. + } + } + // If the previous long is a candidate, use that... + t2 = lCandidate.Prev.offset - e.cur + if nextS-t2 < maxMatchOffset && lCandidate.Prev.val == uint32(next) { + ml := e.matchlen(nextS+4, t2+4, src) + 4 + if ml > l { + t = t2 + s = nextS + l = ml + break + } + } + } + break + } + cv = next + } + + // A 4-byte match has been found. We'll later see if more than 4 bytes + // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit + // them as literal bytes. + + // Extend the 4-byte match as long as possible. + if l == 0 { + l = e.matchlenLong(s+4, t+4, src) + 4 + } else if l == maxMatchLength { + l += e.matchlenLong(s+l, t+l, src) + } + + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + if false { + if t >= s { + panic(fmt.Sprintln("s-t", s, t)) + } + if (s - t) > maxMatchOffset { + panic(fmt.Sprintln("mmo", s-t)) + } + if l < baseMatchLength { + panic("bml") + } + } + + dst.AddMatchLong(l, uint32(s-t-baseMatchOffset)) + repeat = s - t + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + + if s >= sLimit { + // Index after match end. + for i := nextS + 1; i < int32(len(src))-8; i += 2 { + cv := load6432(src, i) + e.table[hash4x64(cv, tableBits)] = tableEntry{offset: i + e.cur, val: uint32(cv)} + eLong := &e.bTable[hash7(cv, tableBits)] + eLong.Cur, eLong.Prev = tableEntry{offset: i + e.cur, val: uint32(cv)}, eLong.Cur + } + goto emitRemainder + } + + // Store every long hash in-between and every second short. + if true { + for i := nextS + 1; i < s-1; i += 2 { + cv := load6432(src, i) + t := tableEntry{offset: i + e.cur, val: uint32(cv)} + t2 := tableEntry{offset: t.offset + 1, val: uint32(cv >> 8)} + eLong := &e.bTable[hash7(cv, tableBits)] + eLong2 := &e.bTable[hash7(cv>>8, tableBits)] + e.table[hash4x64(cv, tableBits)] = t + eLong.Cur, eLong.Prev = t, eLong.Cur + eLong2.Cur, eLong2.Prev = t2, eLong2.Cur + } + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-1 and at s. + cv = load6432(src, s) + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/reverse_bits.go b/vendor/github.com/klauspost/compress/flate/reverse_bits.go deleted file mode 100644 index c1a02720d..000000000 --- a/vendor/github.com/klauspost/compress/flate/reverse_bits.go +++ /dev/null @@ -1,48 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -package flate - -var reverseByte = [256]byte{ - 0x00, 0x80, 0x40, 0xc0, 0x20, 0xa0, 0x60, 0xe0, - 0x10, 0x90, 0x50, 0xd0, 0x30, 0xb0, 0x70, 0xf0, - 0x08, 0x88, 0x48, 0xc8, 0x28, 0xa8, 0x68, 0xe8, - 0x18, 0x98, 0x58, 0xd8, 0x38, 0xb8, 0x78, 0xf8, - 0x04, 0x84, 0x44, 0xc4, 0x24, 0xa4, 0x64, 0xe4, - 0x14, 0x94, 0x54, 0xd4, 0x34, 0xb4, 0x74, 0xf4, - 0x0c, 0x8c, 0x4c, 0xcc, 0x2c, 0xac, 0x6c, 0xec, - 0x1c, 0x9c, 0x5c, 0xdc, 0x3c, 0xbc, 0x7c, 0xfc, - 0x02, 0x82, 0x42, 0xc2, 0x22, 0xa2, 0x62, 0xe2, - 0x12, 0x92, 0x52, 0xd2, 0x32, 0xb2, 0x72, 0xf2, - 0x0a, 0x8a, 0x4a, 0xca, 0x2a, 0xaa, 0x6a, 0xea, - 0x1a, 0x9a, 0x5a, 0xda, 0x3a, 0xba, 0x7a, 0xfa, - 0x06, 0x86, 0x46, 0xc6, 0x26, 0xa6, 0x66, 0xe6, - 0x16, 0x96, 0x56, 0xd6, 0x36, 0xb6, 0x76, 0xf6, - 0x0e, 0x8e, 0x4e, 0xce, 0x2e, 0xae, 0x6e, 0xee, - 0x1e, 0x9e, 0x5e, 0xde, 0x3e, 0xbe, 0x7e, 0xfe, - 0x01, 0x81, 0x41, 0xc1, 0x21, 0xa1, 0x61, 0xe1, - 0x11, 0x91, 0x51, 0xd1, 0x31, 0xb1, 0x71, 0xf1, - 0x09, 0x89, 0x49, 0xc9, 0x29, 0xa9, 0x69, 0xe9, - 0x19, 0x99, 0x59, 0xd9, 0x39, 0xb9, 0x79, 0xf9, - 0x05, 0x85, 0x45, 0xc5, 0x25, 0xa5, 0x65, 0xe5, - 0x15, 0x95, 0x55, 0xd5, 0x35, 0xb5, 0x75, 0xf5, - 0x0d, 0x8d, 0x4d, 0xcd, 0x2d, 0xad, 0x6d, 0xed, - 0x1d, 0x9d, 0x5d, 0xdd, 0x3d, 0xbd, 0x7d, 0xfd, - 0x03, 0x83, 0x43, 0xc3, 0x23, 0xa3, 0x63, 0xe3, - 0x13, 0x93, 0x53, 0xd3, 0x33, 0xb3, 0x73, 0xf3, - 0x0b, 0x8b, 0x4b, 0xcb, 0x2b, 0xab, 0x6b, 0xeb, - 0x1b, 0x9b, 0x5b, 0xdb, 0x3b, 0xbb, 0x7b, 0xfb, - 0x07, 0x87, 0x47, 0xc7, 0x27, 0xa7, 0x67, 0xe7, - 0x17, 0x97, 0x57, 0xd7, 0x37, 0xb7, 0x77, 0xf7, - 0x0f, 0x8f, 0x4f, 0xcf, 0x2f, 0xaf, 0x6f, 0xef, - 0x1f, 0x9f, 0x5f, 0xdf, 0x3f, 0xbf, 0x7f, 0xff, -} - -func reverseUint16(v uint16) uint16 { - return uint16(reverseByte[v>>8]) | uint16(reverseByte[v&0xFF])<<8 -} - -func reverseBits(number uint16, bitLength byte) uint16 { - return reverseUint16(number << uint8(16-bitLength)) -} diff --git a/vendor/github.com/klauspost/compress/flate/snappy.go b/vendor/github.com/klauspost/compress/flate/snappy.go deleted file mode 100644 index aebebd524..000000000 --- a/vendor/github.com/klauspost/compress/flate/snappy.go +++ /dev/null @@ -1,900 +0,0 @@ -// Copyright 2011 The Snappy-Go Authors. All rights reserved. -// Modified for deflate by Klaus Post (c) 2015. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -package flate - -// emitLiteral writes a literal chunk and returns the number of bytes written. -func emitLiteral(dst *tokens, lit []byte) { - ol := int(dst.n) - for i, v := range lit { - dst.tokens[(i+ol)&maxStoreBlockSize] = token(v) - } - dst.n += uint16(len(lit)) -} - -// emitCopy writes a copy chunk and returns the number of bytes written. -func emitCopy(dst *tokens, offset, length int) { - dst.tokens[dst.n] = matchToken(uint32(length-3), uint32(offset-minOffsetSize)) - dst.n++ -} - -type fastEnc interface { - Encode(dst *tokens, src []byte) - Reset() -} - -func newFastEnc(level int) fastEnc { - switch level { - case 1: - return &snappyL1{} - case 2: - return &snappyL2{snappyGen: snappyGen{cur: maxStoreBlockSize, prev: make([]byte, 0, maxStoreBlockSize)}} - case 3: - return &snappyL3{snappyGen: snappyGen{cur: maxStoreBlockSize, prev: make([]byte, 0, maxStoreBlockSize)}} - case 4: - return &snappyL4{snappyL3{snappyGen: snappyGen{cur: maxStoreBlockSize, prev: make([]byte, 0, maxStoreBlockSize)}}} - default: - panic("invalid level specified") - } -} - -const ( - tableBits = 14 // Bits used in the table - tableSize = 1 << tableBits // Size of the table - tableMask = tableSize - 1 // Mask for table indices. Redundant, but can eliminate bounds checks. - tableShift = 32 - tableBits // Right-shift to get the tableBits most significant bits of a uint32. - baseMatchOffset = 1 // The smallest match offset - baseMatchLength = 3 // The smallest match length per the RFC section 3.2.5 - maxMatchOffset = 1 << 15 // The largest match offset -) - -func load32(b []byte, i int) uint32 { - b = b[i : i+4 : len(b)] // Help the compiler eliminate bounds checks on the next line. - return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 -} - -func load64(b []byte, i int) uint64 { - b = b[i : i+8 : len(b)] // Help the compiler eliminate bounds checks on the next line. - return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | - uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 -} - -func hash(u uint32) uint32 { - return (u * 0x1e35a7bd) >> tableShift -} - -// snappyL1 encapsulates level 1 compression -type snappyL1 struct{} - -func (e *snappyL1) Reset() {} - -func (e *snappyL1) Encode(dst *tokens, src []byte) { - const ( - inputMargin = 16 - 1 - minNonLiteralBlockSize = 1 + 1 + inputMargin - ) - - // This check isn't in the Snappy implementation, but there, the caller - // instead of the callee handles this case. - if len(src) < minNonLiteralBlockSize { - // We do not fill the token table. - // This will be picked up by caller. - dst.n = uint16(len(src)) - return - } - - // Initialize the hash table. - // - // The table element type is uint16, as s < sLimit and sLimit < len(src) - // and len(src) <= maxStoreBlockSize and maxStoreBlockSize == 65535. - var table [tableSize]uint16 - - // sLimit is when to stop looking for offset/length copies. The inputMargin - // lets us use a fast path for emitLiteral in the main loop, while we are - // looking for copies. - sLimit := len(src) - inputMargin - - // nextEmit is where in src the next emitLiteral should start from. - nextEmit := 0 - - // The encoded form must start with a literal, as there are no previous - // bytes to copy, so we start looking for hash matches at s == 1. - s := 1 - nextHash := hash(load32(src, s)) - - for { - // Copied from the C++ snappy implementation: - // - // Heuristic match skipping: If 32 bytes are scanned with no matches - // found, start looking only at every other byte. If 32 more bytes are - // scanned (or skipped), look at every third byte, etc.. When a match - // is found, immediately go back to looking at every byte. This is a - // small loss (~5% performance, ~0.1% density) for compressible data - // due to more bookkeeping, but for non-compressible data (such as - // JPEG) it's a huge win since the compressor quickly "realizes" the - // data is incompressible and doesn't bother looking for matches - // everywhere. - // - // The "skip" variable keeps track of how many bytes there are since - // the last match; dividing it by 32 (ie. right-shifting by five) gives - // the number of bytes to move ahead for each iteration. - skip := 32 - - nextS := s - candidate := 0 - for { - s = nextS - bytesBetweenHashLookups := skip >> 5 - nextS = s + bytesBetweenHashLookups - skip += bytesBetweenHashLookups - if nextS > sLimit { - goto emitRemainder - } - candidate = int(table[nextHash&tableMask]) - table[nextHash&tableMask] = uint16(s) - nextHash = hash(load32(src, nextS)) - if s-candidate <= maxMatchOffset && load32(src, s) == load32(src, candidate) { - break - } - } - - // A 4-byte match has been found. We'll later see if more than 4 bytes - // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit - // them as literal bytes. - emitLiteral(dst, src[nextEmit:s]) - - // Call emitCopy, and then see if another emitCopy could be our next - // move. Repeat until we find no match for the input immediately after - // what was consumed by the last emitCopy call. - // - // If we exit this loop normally then we need to call emitLiteral next, - // though we don't yet know how big the literal will be. We handle that - // by proceeding to the next iteration of the main loop. We also can - // exit this loop via goto if we get close to exhausting the input. - for { - // Invariant: we have a 4-byte match at s, and no need to emit any - // literal bytes prior to s. - base := s - - // Extend the 4-byte match as long as possible. - // - // This is an inlined version of Snappy's: - // s = extendMatch(src, candidate+4, s+4) - s += 4 - s1 := base + maxMatchLength - if s1 > len(src) { - s1 = len(src) - } - a := src[s:s1] - b := src[candidate+4:] - b = b[:len(a)] - l := len(a) - for i := range a { - if a[i] != b[i] { - l = i - break - } - } - s += l - - // matchToken is flate's equivalent of Snappy's emitCopy. - dst.tokens[dst.n] = matchToken(uint32(s-base-baseMatchLength), uint32(base-candidate-baseMatchOffset)) - dst.n++ - nextEmit = s - if s >= sLimit { - goto emitRemainder - } - - // We could immediately start working at s now, but to improve - // compression we first update the hash table at s-1 and at s. If - // another emitCopy is not our next move, also calculate nextHash - // at s+1. At least on GOARCH=amd64, these three hash calculations - // are faster as one load64 call (with some shifts) instead of - // three load32 calls. - x := load64(src, s-1) - prevHash := hash(uint32(x >> 0)) - table[prevHash&tableMask] = uint16(s - 1) - currHash := hash(uint32(x >> 8)) - candidate = int(table[currHash&tableMask]) - table[currHash&tableMask] = uint16(s) - if s-candidate > maxMatchOffset || uint32(x>>8) != load32(src, candidate) { - nextHash = hash(uint32(x >> 16)) - s++ - break - } - } - } - -emitRemainder: - if nextEmit < len(src) { - emitLiteral(dst, src[nextEmit:]) - } -} - -type tableEntry struct { - val uint32 - offset int32 -} - -func load3232(b []byte, i int32) uint32 { - b = b[i : i+4 : len(b)] // Help the compiler eliminate bounds checks on the next line. - return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 -} - -func load6432(b []byte, i int32) uint64 { - b = b[i : i+8 : len(b)] // Help the compiler eliminate bounds checks on the next line. - return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | - uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 -} - -// snappyGen maintains the table for matches, -// and the previous byte block for level 2. -// This is the generic implementation. -type snappyGen struct { - prev []byte - cur int32 -} - -// snappyGen maintains the table for matches, -// and the previous byte block for level 2. -// This is the generic implementation. -type snappyL2 struct { - snappyGen - table [tableSize]tableEntry -} - -// EncodeL2 uses a similar algorithm to level 1, but is capable -// of matching across blocks giving better compression at a small slowdown. -func (e *snappyL2) Encode(dst *tokens, src []byte) { - const ( - inputMargin = 8 - 1 - minNonLiteralBlockSize = 1 + 1 + inputMargin - ) - - // Protect against e.cur wraparound. - if e.cur > 1<<30 { - for i := range e.table[:] { - e.table[i] = tableEntry{} - } - e.cur = maxStoreBlockSize - } - - // This check isn't in the Snappy implementation, but there, the caller - // instead of the callee handles this case. - if len(src) < minNonLiteralBlockSize { - // We do not fill the token table. - // This will be picked up by caller. - dst.n = uint16(len(src)) - e.cur += maxStoreBlockSize - e.prev = e.prev[:0] - return - } - - // sLimit is when to stop looking for offset/length copies. The inputMargin - // lets us use a fast path for emitLiteral in the main loop, while we are - // looking for copies. - sLimit := int32(len(src) - inputMargin) - - // nextEmit is where in src the next emitLiteral should start from. - nextEmit := int32(0) - s := int32(0) - cv := load3232(src, s) - nextHash := hash(cv) - - for { - // Copied from the C++ snappy implementation: - // - // Heuristic match skipping: If 32 bytes are scanned with no matches - // found, start looking only at every other byte. If 32 more bytes are - // scanned (or skipped), look at every third byte, etc.. When a match - // is found, immediately go back to looking at every byte. This is a - // small loss (~5% performance, ~0.1% density) for compressible data - // due to more bookkeeping, but for non-compressible data (such as - // JPEG) it's a huge win since the compressor quickly "realizes" the - // data is incompressible and doesn't bother looking for matches - // everywhere. - // - // The "skip" variable keeps track of how many bytes there are since - // the last match; dividing it by 32 (ie. right-shifting by five) gives - // the number of bytes to move ahead for each iteration. - skip := int32(32) - - nextS := s - var candidate tableEntry - for { - s = nextS - bytesBetweenHashLookups := skip >> 5 - nextS = s + bytesBetweenHashLookups - skip += bytesBetweenHashLookups - if nextS > sLimit { - goto emitRemainder - } - candidate = e.table[nextHash&tableMask] - now := load3232(src, nextS) - e.table[nextHash&tableMask] = tableEntry{offset: s + e.cur, val: cv} - nextHash = hash(now) - - offset := s - (candidate.offset - e.cur) - if offset > maxMatchOffset || cv != candidate.val { - // Out of range or not matched. - cv = now - continue - } - break - } - - // A 4-byte match has been found. We'll later see if more than 4 bytes - // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit - // them as literal bytes. - emitLiteral(dst, src[nextEmit:s]) - - // Call emitCopy, and then see if another emitCopy could be our next - // move. Repeat until we find no match for the input immediately after - // what was consumed by the last emitCopy call. - // - // If we exit this loop normally then we need to call emitLiteral next, - // though we don't yet know how big the literal will be. We handle that - // by proceeding to the next iteration of the main loop. We also can - // exit this loop via goto if we get close to exhausting the input. - for { - // Invariant: we have a 4-byte match at s, and no need to emit any - // literal bytes prior to s. - - // Extend the 4-byte match as long as possible. - // - s += 4 - t := candidate.offset - e.cur + 4 - l := e.matchlen(s, t, src) - - // matchToken is flate's equivalent of Snappy's emitCopy. (length,offset) - dst.tokens[dst.n] = matchToken(uint32(l+4-baseMatchLength), uint32(s-t-baseMatchOffset)) - dst.n++ - s += l - nextEmit = s - if s >= sLimit { - t += l - // Index first pair after match end. - if int(t+4) < len(src) && t > 0 { - cv := load3232(src, t) - e.table[hash(cv)&tableMask] = tableEntry{offset: t + e.cur, val: cv} - } - goto emitRemainder - } - - // We could immediately start working at s now, but to improve - // compression we first update the hash table at s-1 and at s. If - // another emitCopy is not our next move, also calculate nextHash - // at s+1. At least on GOARCH=amd64, these three hash calculations - // are faster as one load64 call (with some shifts) instead of - // three load32 calls. - x := load6432(src, s-1) - prevHash := hash(uint32(x)) - e.table[prevHash&tableMask] = tableEntry{offset: e.cur + s - 1, val: uint32(x)} - x >>= 8 - currHash := hash(uint32(x)) - candidate = e.table[currHash&tableMask] - e.table[currHash&tableMask] = tableEntry{offset: e.cur + s, val: uint32(x)} - - offset := s - (candidate.offset - e.cur) - if offset > maxMatchOffset || uint32(x) != candidate.val { - cv = uint32(x >> 8) - nextHash = hash(cv) - s++ - break - } - } - } - -emitRemainder: - if int(nextEmit) < len(src) { - emitLiteral(dst, src[nextEmit:]) - } - e.cur += int32(len(src)) - e.prev = e.prev[:len(src)] - copy(e.prev, src) -} - -type tableEntryPrev struct { - Cur tableEntry - Prev tableEntry -} - -// snappyL3 -type snappyL3 struct { - snappyGen - table [tableSize]tableEntryPrev -} - -// Encode uses a similar algorithm to level 2, will check up to two candidates. -func (e *snappyL3) Encode(dst *tokens, src []byte) { - const ( - inputMargin = 8 - 1 - minNonLiteralBlockSize = 1 + 1 + inputMargin - ) - - // Protect against e.cur wraparound. - if e.cur > 1<<30 { - for i := range e.table[:] { - e.table[i] = tableEntryPrev{} - } - e.snappyGen = snappyGen{cur: maxStoreBlockSize, prev: e.prev[:0]} - } - - // This check isn't in the Snappy implementation, but there, the caller - // instead of the callee handles this case. - if len(src) < minNonLiteralBlockSize { - // We do not fill the token table. - // This will be picked up by caller. - dst.n = uint16(len(src)) - e.cur += maxStoreBlockSize - e.prev = e.prev[:0] - return - } - - // sLimit is when to stop looking for offset/length copies. The inputMargin - // lets us use a fast path for emitLiteral in the main loop, while we are - // looking for copies. - sLimit := int32(len(src) - inputMargin) - - // nextEmit is where in src the next emitLiteral should start from. - nextEmit := int32(0) - s := int32(0) - cv := load3232(src, s) - nextHash := hash(cv) - - for { - // Copied from the C++ snappy implementation: - // - // Heuristic match skipping: If 32 bytes are scanned with no matches - // found, start looking only at every other byte. If 32 more bytes are - // scanned (or skipped), look at every third byte, etc.. When a match - // is found, immediately go back to looking at every byte. This is a - // small loss (~5% performance, ~0.1% density) for compressible data - // due to more bookkeeping, but for non-compressible data (such as - // JPEG) it's a huge win since the compressor quickly "realizes" the - // data is incompressible and doesn't bother looking for matches - // everywhere. - // - // The "skip" variable keeps track of how many bytes there are since - // the last match; dividing it by 32 (ie. right-shifting by five) gives - // the number of bytes to move ahead for each iteration. - skip := int32(32) - - nextS := s - var candidate tableEntry - for { - s = nextS - bytesBetweenHashLookups := skip >> 5 - nextS = s + bytesBetweenHashLookups - skip += bytesBetweenHashLookups - if nextS > sLimit { - goto emitRemainder - } - candidates := e.table[nextHash&tableMask] - now := load3232(src, nextS) - e.table[nextHash&tableMask] = tableEntryPrev{Prev: candidates.Cur, Cur: tableEntry{offset: s + e.cur, val: cv}} - nextHash = hash(now) - - // Check both candidates - candidate = candidates.Cur - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset <= maxMatchOffset { - break - } - } else { - // We only check if value mismatches. - // Offset will always be invalid in other cases. - candidate = candidates.Prev - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset <= maxMatchOffset { - break - } - } - } - cv = now - } - - // A 4-byte match has been found. We'll later see if more than 4 bytes - // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit - // them as literal bytes. - emitLiteral(dst, src[nextEmit:s]) - - // Call emitCopy, and then see if another emitCopy could be our next - // move. Repeat until we find no match for the input immediately after - // what was consumed by the last emitCopy call. - // - // If we exit this loop normally then we need to call emitLiteral next, - // though we don't yet know how big the literal will be. We handle that - // by proceeding to the next iteration of the main loop. We also can - // exit this loop via goto if we get close to exhausting the input. - for { - // Invariant: we have a 4-byte match at s, and no need to emit any - // literal bytes prior to s. - - // Extend the 4-byte match as long as possible. - // - s += 4 - t := candidate.offset - e.cur + 4 - l := e.matchlen(s, t, src) - - // matchToken is flate's equivalent of Snappy's emitCopy. (length,offset) - dst.tokens[dst.n] = matchToken(uint32(l+4-baseMatchLength), uint32(s-t-baseMatchOffset)) - dst.n++ - s += l - nextEmit = s - if s >= sLimit { - t += l - // Index first pair after match end. - if int(t+4) < len(src) && t > 0 { - cv := load3232(src, t) - nextHash = hash(cv) - e.table[nextHash&tableMask] = tableEntryPrev{ - Prev: e.table[nextHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + t, val: cv}, - } - } - goto emitRemainder - } - - // We could immediately start working at s now, but to improve - // compression we first update the hash table at s-3 to s. If - // another emitCopy is not our next move, also calculate nextHash - // at s+1. At least on GOARCH=amd64, these three hash calculations - // are faster as one load64 call (with some shifts) instead of - // three load32 calls. - x := load6432(src, s-3) - prevHash := hash(uint32(x)) - e.table[prevHash&tableMask] = tableEntryPrev{ - Prev: e.table[prevHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + s - 3, val: uint32(x)}, - } - x >>= 8 - prevHash = hash(uint32(x)) - - e.table[prevHash&tableMask] = tableEntryPrev{ - Prev: e.table[prevHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + s - 2, val: uint32(x)}, - } - x >>= 8 - prevHash = hash(uint32(x)) - - e.table[prevHash&tableMask] = tableEntryPrev{ - Prev: e.table[prevHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + s - 1, val: uint32(x)}, - } - x >>= 8 - currHash := hash(uint32(x)) - candidates := e.table[currHash&tableMask] - cv = uint32(x) - e.table[currHash&tableMask] = tableEntryPrev{ - Prev: candidates.Cur, - Cur: tableEntry{offset: s + e.cur, val: cv}, - } - - // Check both candidates - candidate = candidates.Cur - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset <= maxMatchOffset { - continue - } - } else { - // We only check if value mismatches. - // Offset will always be invalid in other cases. - candidate = candidates.Prev - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset <= maxMatchOffset { - continue - } - } - } - cv = uint32(x >> 8) - nextHash = hash(cv) - s++ - break - } - } - -emitRemainder: - if int(nextEmit) < len(src) { - emitLiteral(dst, src[nextEmit:]) - } - e.cur += int32(len(src)) - e.prev = e.prev[:len(src)] - copy(e.prev, src) -} - -// snappyL4 -type snappyL4 struct { - snappyL3 -} - -// Encode uses a similar algorithm to level 3, -// but will check up to two candidates if first isn't long enough. -func (e *snappyL4) Encode(dst *tokens, src []byte) { - const ( - inputMargin = 8 - 3 - minNonLiteralBlockSize = 1 + 1 + inputMargin - matchLenGood = 12 - ) - - // Protect against e.cur wraparound. - if e.cur > 1<<30 { - for i := range e.table[:] { - e.table[i] = tableEntryPrev{} - } - e.snappyGen = snappyGen{cur: maxStoreBlockSize, prev: e.prev[:0]} - } - - // This check isn't in the Snappy implementation, but there, the caller - // instead of the callee handles this case. - if len(src) < minNonLiteralBlockSize { - // We do not fill the token table. - // This will be picked up by caller. - dst.n = uint16(len(src)) - e.cur += maxStoreBlockSize - e.prev = e.prev[:0] - return - } - - // sLimit is when to stop looking for offset/length copies. The inputMargin - // lets us use a fast path for emitLiteral in the main loop, while we are - // looking for copies. - sLimit := int32(len(src) - inputMargin) - - // nextEmit is where in src the next emitLiteral should start from. - nextEmit := int32(0) - s := int32(0) - cv := load3232(src, s) - nextHash := hash(cv) - - for { - // Copied from the C++ snappy implementation: - // - // Heuristic match skipping: If 32 bytes are scanned with no matches - // found, start looking only at every other byte. If 32 more bytes are - // scanned (or skipped), look at every third byte, etc.. When a match - // is found, immediately go back to looking at every byte. This is a - // small loss (~5% performance, ~0.1% density) for compressible data - // due to more bookkeeping, but for non-compressible data (such as - // JPEG) it's a huge win since the compressor quickly "realizes" the - // data is incompressible and doesn't bother looking for matches - // everywhere. - // - // The "skip" variable keeps track of how many bytes there are since - // the last match; dividing it by 32 (ie. right-shifting by five) gives - // the number of bytes to move ahead for each iteration. - skip := int32(32) - - nextS := s - var candidate tableEntry - var candidateAlt tableEntry - for { - s = nextS - bytesBetweenHashLookups := skip >> 5 - nextS = s + bytesBetweenHashLookups - skip += bytesBetweenHashLookups - if nextS > sLimit { - goto emitRemainder - } - candidates := e.table[nextHash&tableMask] - now := load3232(src, nextS) - e.table[nextHash&tableMask] = tableEntryPrev{Prev: candidates.Cur, Cur: tableEntry{offset: s + e.cur, val: cv}} - nextHash = hash(now) - - // Check both candidates - candidate = candidates.Cur - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset < maxMatchOffset { - offset = s - (candidates.Prev.offset - e.cur) - if cv == candidates.Prev.val && offset < maxMatchOffset { - candidateAlt = candidates.Prev - } - break - } - } else { - // We only check if value mismatches. - // Offset will always be invalid in other cases. - candidate = candidates.Prev - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset < maxMatchOffset { - break - } - } - } - cv = now - } - - // A 4-byte match has been found. We'll later see if more than 4 bytes - // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit - // them as literal bytes. - emitLiteral(dst, src[nextEmit:s]) - - // Call emitCopy, and then see if another emitCopy could be our next - // move. Repeat until we find no match for the input immediately after - // what was consumed by the last emitCopy call. - // - // If we exit this loop normally then we need to call emitLiteral next, - // though we don't yet know how big the literal will be. We handle that - // by proceeding to the next iteration of the main loop. We also can - // exit this loop via goto if we get close to exhausting the input. - for { - // Invariant: we have a 4-byte match at s, and no need to emit any - // literal bytes prior to s. - - // Extend the 4-byte match as long as possible. - // - s += 4 - t := candidate.offset - e.cur + 4 - l := e.matchlen(s, t, src) - // Try alternative candidate if match length < matchLenGood. - if l < matchLenGood-4 && candidateAlt.offset != 0 { - t2 := candidateAlt.offset - e.cur + 4 - l2 := e.matchlen(s, t2, src) - if l2 > l { - l = l2 - t = t2 - } - } - // matchToken is flate's equivalent of Snappy's emitCopy. (length,offset) - dst.tokens[dst.n] = matchToken(uint32(l+4-baseMatchLength), uint32(s-t-baseMatchOffset)) - dst.n++ - s += l - nextEmit = s - if s >= sLimit { - t += l - // Index first pair after match end. - if int(t+4) < len(src) && t > 0 { - cv := load3232(src, t) - nextHash = hash(cv) - e.table[nextHash&tableMask] = tableEntryPrev{ - Prev: e.table[nextHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + t, val: cv}, - } - } - goto emitRemainder - } - - // We could immediately start working at s now, but to improve - // compression we first update the hash table at s-3 to s. If - // another emitCopy is not our next move, also calculate nextHash - // at s+1. At least on GOARCH=amd64, these three hash calculations - // are faster as one load64 call (with some shifts) instead of - // three load32 calls. - x := load6432(src, s-3) - prevHash := hash(uint32(x)) - e.table[prevHash&tableMask] = tableEntryPrev{ - Prev: e.table[prevHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + s - 3, val: uint32(x)}, - } - x >>= 8 - prevHash = hash(uint32(x)) - - e.table[prevHash&tableMask] = tableEntryPrev{ - Prev: e.table[prevHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + s - 2, val: uint32(x)}, - } - x >>= 8 - prevHash = hash(uint32(x)) - - e.table[prevHash&tableMask] = tableEntryPrev{ - Prev: e.table[prevHash&tableMask].Cur, - Cur: tableEntry{offset: e.cur + s - 1, val: uint32(x)}, - } - x >>= 8 - currHash := hash(uint32(x)) - candidates := e.table[currHash&tableMask] - cv = uint32(x) - e.table[currHash&tableMask] = tableEntryPrev{ - Prev: candidates.Cur, - Cur: tableEntry{offset: s + e.cur, val: cv}, - } - - // Check both candidates - candidate = candidates.Cur - candidateAlt = tableEntry{} - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset <= maxMatchOffset { - offset = s - (candidates.Prev.offset - e.cur) - if cv == candidates.Prev.val && offset <= maxMatchOffset { - candidateAlt = candidates.Prev - } - continue - } - } else { - // We only check if value mismatches. - // Offset will always be invalid in other cases. - candidate = candidates.Prev - if cv == candidate.val { - offset := s - (candidate.offset - e.cur) - if offset <= maxMatchOffset { - continue - } - } - } - cv = uint32(x >> 8) - nextHash = hash(cv) - s++ - break - } - } - -emitRemainder: - if int(nextEmit) < len(src) { - emitLiteral(dst, src[nextEmit:]) - } - e.cur += int32(len(src)) - e.prev = e.prev[:len(src)] - copy(e.prev, src) -} - -func (e *snappyGen) matchlen(s, t int32, src []byte) int32 { - s1 := int(s) + maxMatchLength - 4 - if s1 > len(src) { - s1 = len(src) - } - - // If we are inside the current block - if t >= 0 { - b := src[t:] - a := src[s:s1] - b = b[:len(a)] - // Extend the match to be as long as possible. - for i := range a { - if a[i] != b[i] { - return int32(i) - } - } - return int32(len(a)) - } - - // We found a match in the previous block. - tp := int32(len(e.prev)) + t - if tp < 0 { - return 0 - } - - // Extend the match to be as long as possible. - a := src[s:s1] - b := e.prev[tp:] - if len(b) > len(a) { - b = b[:len(a)] - } - a = a[:len(b)] - for i := range b { - if a[i] != b[i] { - return int32(i) - } - } - - // If we reached our limit, we matched everything we are - // allowed to in the previous block and we return. - n := int32(len(b)) - if int(s+n) == s1 { - return n - } - - // Continue looking for more matches in the current block. - a = src[s+n : s1] - b = src[:len(a)] - for i := range a { - if a[i] != b[i] { - return int32(i) + n - } - } - return int32(len(a)) + n -} - -// Reset the encoding table. -func (e *snappyGen) Reset() { - e.prev = e.prev[:0] - e.cur += maxMatchOffset -} diff --git a/vendor/github.com/klauspost/compress/flate/stateless.go b/vendor/github.com/klauspost/compress/flate/stateless.go new file mode 100644 index 000000000..524ee0ae3 --- /dev/null +++ b/vendor/github.com/klauspost/compress/flate/stateless.go @@ -0,0 +1,252 @@ +package flate + +import ( + "io" + "math" +) + +const ( + maxStatelessBlock = math.MaxInt16 + + slTableBits = 13 + slTableSize = 1 << slTableBits + slTableShift = 32 - slTableBits +) + +type statelessWriter struct { + dst io.Writer + closed bool +} + +func (s *statelessWriter) Close() error { + if s.closed { + return nil + } + s.closed = true + // Emit EOF block + return StatelessDeflate(s.dst, nil, true) +} + +func (s *statelessWriter) Write(p []byte) (n int, err error) { + err = StatelessDeflate(s.dst, p, false) + if err != nil { + return 0, err + } + return len(p), nil +} + +func (s *statelessWriter) Reset(w io.Writer) { + s.dst = w + s.closed = false +} + +// NewStatelessWriter will do compression but without maintaining any state +// between Write calls. +// There will be no memory kept between Write calls, +// but compression and speed will be suboptimal. +// Because of this, the size of actual Write calls will affect output size. +func NewStatelessWriter(dst io.Writer) io.WriteCloser { + return &statelessWriter{dst: dst} +} + +// StatelessDeflate allows to compress directly to a Writer without retaining state. +// When returning everything will be flushed. +func StatelessDeflate(out io.Writer, in []byte, eof bool) error { + var dst tokens + bw := newHuffmanBitWriter(out) + if eof && len(in) == 0 { + // Just write an EOF block. + // Could be faster... + bw.writeStoredHeader(0, true) + bw.flush() + return bw.err + } + + for len(in) > 0 { + todo := in + if len(todo) > maxStatelessBlock { + todo = todo[:maxStatelessBlock] + } + in = in[len(todo):] + // Compress + statelessEnc(&dst, todo) + isEof := eof && len(in) == 0 + + if dst.n == 0 { + bw.writeStoredHeader(len(todo), isEof) + if bw.err != nil { + return bw.err + } + bw.writeBytes(todo) + } else if int(dst.n) > len(todo)-len(todo)>>4 { + // If we removed less than 1/16th, huffman compress the block. + bw.writeBlockHuff(isEof, todo, false) + } else { + bw.writeBlockDynamic(&dst, isEof, todo, false) + } + if bw.err != nil { + return bw.err + } + dst.Reset() + } + if !eof { + // Align. + bw.writeStoredHeader(0, false) + } + bw.flush() + return bw.err +} + +func hashSL(u uint32) uint32 { + return (u * 0x1e35a7bd) >> slTableShift +} + +func load3216(b []byte, i int16) uint32 { + // Help the compiler eliminate bounds checks on the read so it can be done in a single read. + b = b[i:] + b = b[:4] + return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 +} + +func load6416(b []byte, i int16) uint64 { + // Help the compiler eliminate bounds checks on the read so it can be done in a single read. + b = b[i:] + b = b[:8] + return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | + uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 +} + +func statelessEnc(dst *tokens, src []byte) { + const ( + inputMargin = 12 - 1 + minNonLiteralBlockSize = 1 + 1 + inputMargin + ) + + type tableEntry struct { + offset int16 + } + + var table [slTableSize]tableEntry + + // This check isn't in the Snappy implementation, but there, the caller + // instead of the callee handles this case. + if len(src) < minNonLiteralBlockSize { + // We do not fill the token table. + // This will be picked up by caller. + dst.n = uint16(len(src)) + return + } + + s := int16(1) + nextEmit := int16(0) + // sLimit is when to stop looking for offset/length copies. The inputMargin + // lets us use a fast path for emitLiteral in the main loop, while we are + // looking for copies. + sLimit := int16(len(src) - inputMargin) + + // nextEmit is where in src the next emitLiteral should start from. + cv := load3216(src, s) + + for { + const skipLog = 5 + const doEvery = 2 + + nextS := s + var candidate tableEntry + for { + nextHash := hashSL(cv) + candidate = table[nextHash] + nextS = s + doEvery + (s-nextEmit)>>skipLog + if nextS > sLimit || nextS <= 0 { + goto emitRemainder + } + + now := load6416(src, nextS) + table[nextHash] = tableEntry{offset: s} + nextHash = hashSL(uint32(now)) + + if cv == load3216(src, candidate.offset) { + table[nextHash] = tableEntry{offset: nextS} + break + } + + // Do one right away... + cv = uint32(now) + s = nextS + nextS++ + candidate = table[nextHash] + now >>= 8 + table[nextHash] = tableEntry{offset: s} + + if cv == load3216(src, candidate.offset) { + table[nextHash] = tableEntry{offset: nextS} + break + } + cv = uint32(now) + s = nextS + } + + // A 4-byte match has been found. We'll later see if more than 4 bytes + // match. But, prior to the match, src[nextEmit:s] are unmatched. Emit + // them as literal bytes. + for { + // Invariant: we have a 4-byte match at s, and no need to emit any + // literal bytes prior to s. + + // Extend the 4-byte match as long as possible. + t := candidate.offset + l := int16(matchLen(src[s+4:], src[t+4:]) + 4) + + // Extend backwards + for t > 0 && s > nextEmit && src[t-1] == src[s-1] { + s-- + t-- + l++ + } + if nextEmit < s { + emitLiteral(dst, src[nextEmit:s]) + } + + // Save the match found + dst.AddMatchLong(int32(l), uint32(s-t-baseMatchOffset)) + s += l + nextEmit = s + if nextS >= s { + s = nextS + 1 + } + if s >= sLimit { + goto emitRemainder + } + + // We could immediately start working at s now, but to improve + // compression we first update the hash table at s-2 and at s. If + // another emitCopy is not our next move, also calculate nextHash + // at s+1. At least on GOARCH=amd64, these three hash calculations + // are faster as one load64 call (with some shifts) instead of + // three load32 calls. + x := load6416(src, s-2) + o := s - 2 + prevHash := hashSL(uint32(x)) + table[prevHash] = tableEntry{offset: o} + x >>= 16 + currHash := hashSL(uint32(x)) + candidate = table[currHash] + table[currHash] = tableEntry{offset: o + 2} + + if uint32(x) != load3216(src, candidate.offset) { + cv = uint32(x >> 8) + s++ + break + } + } + } + +emitRemainder: + if int(nextEmit) < len(src) { + // If nothing was added, don't encode literals. + if dst.n == 0 { + return + } + emitLiteral(dst, src[nextEmit:]) + } +} diff --git a/vendor/github.com/klauspost/compress/flate/token.go b/vendor/github.com/klauspost/compress/flate/token.go index 141299b97..b3df0d894 100644 --- a/vendor/github.com/klauspost/compress/flate/token.go +++ b/vendor/github.com/klauspost/compress/flate/token.go @@ -4,6 +4,14 @@ package flate +import ( + "bytes" + "encoding/binary" + "fmt" + "io" + "math" +) + const ( // 2 bits: type 0 = literal 1=EOF 2=Match 3=Unused // 8 bits: xlength = length - MIN_MATCH_LENGTH @@ -46,6 +54,36 @@ var lengthCodes = [256]uint8{ 27, 27, 27, 27, 27, 28, } +// lengthCodes1 is length codes, but starting at 1. +var lengthCodes1 = [256]uint8{ + 1, 2, 3, 4, 5, 6, 7, 8, 9, 9, + 10, 10, 11, 11, 12, 12, 13, 13, 13, 13, + 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, + 16, 16, 17, 17, 17, 17, 17, 17, 17, 17, + 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, + 19, 19, 19, 19, 19, 19, 20, 20, 20, 20, + 20, 20, 20, 20, 21, 21, 21, 21, 21, 21, + 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, + 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, + 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, + 23, 23, 23, 23, 23, 23, 23, 23, 23, 23, + 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, + 24, 24, 24, 24, 24, 24, 24, 24, 25, 25, + 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, + 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, + 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, + 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, + 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, + 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, + 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, + 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, + 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, + 27, 27, 27, 27, 28, 28, 28, 28, 28, 28, + 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, + 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, + 28, 28, 28, 28, 28, 29, +} + var offsetCodes = [256]uint32{ 0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8, 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, @@ -65,19 +103,236 @@ var offsetCodes = [256]uint32{ 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, } +// offsetCodes14 are offsetCodes, but with 14 added. +var offsetCodes14 = [256]uint32{ + 14, 15, 16, 17, 18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, + 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23, + 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, + 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, + 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, + 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, + 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, + 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, + 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, + 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, + 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, + 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, + 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, + 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, + 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, + 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +} + type token uint32 type tokens struct { - tokens [maxStoreBlockSize + 1]token - n uint16 // Must be able to contain maxStoreBlockSize + nLits int + extraHist [32]uint16 // codes 256->maxnumlit + offHist [32]uint16 // offset codes + litHist [256]uint16 // codes 0->255 + n uint16 // Must be able to contain maxStoreBlockSize + tokens [maxStoreBlockSize + 1]token +} + +func (t *tokens) Reset() { + if t.n == 0 { + return + } + t.n = 0 + t.nLits = 0 + for i := range t.litHist[:] { + t.litHist[i] = 0 + } + for i := range t.extraHist[:] { + t.extraHist[i] = 0 + } + for i := range t.offHist[:] { + t.offHist[i] = 0 + } +} + +func (t *tokens) Fill() { + if t.n == 0 { + return + } + for i, v := range t.litHist[:] { + if v == 0 { + t.litHist[i] = 1 + t.nLits++ + } + } + for i, v := range t.extraHist[:literalCount-256] { + if v == 0 { + t.nLits++ + t.extraHist[i] = 1 + } + } + for i, v := range t.offHist[:offsetCodeCount] { + if v == 0 { + t.offHist[i] = 1 + } + } +} + +func indexTokens(in []token) tokens { + var t tokens + t.indexTokens(in) + return t +} + +func (t *tokens) indexTokens(in []token) { + t.Reset() + for _, tok := range in { + if tok < matchType { + t.tokens[t.n] = tok + t.litHist[tok]++ + t.n++ + continue + } + t.AddMatch(uint32(tok.length()), tok.offset()) + } } -// Convert a literal into a literal token. -func literalToken(literal uint32) token { return token(literalType + literal) } +// emitLiteral writes a literal chunk and returns the number of bytes written. +func emitLiteral(dst *tokens, lit []byte) { + ol := int(dst.n) + for i, v := range lit { + dst.tokens[(i+ol)&maxStoreBlockSize] = token(v) + dst.litHist[v]++ + } + dst.n += uint16(len(lit)) + dst.nLits += len(lit) +} -// Convert a < xlength, xoffset > pair into a match token. -func matchToken(xlength uint32, xoffset uint32) token { - return token(matchType + xlength<<lengthShift + xoffset) +func (t *tokens) AddLiteral(lit byte) { + t.tokens[t.n] = token(lit) + t.litHist[lit]++ + t.n++ + t.nLits++ +} + +// EstimatedBits will return an minimum size estimated by an *optimal* +// compression of the block. +// The size of the block +func (t *tokens) EstimatedBits() int { + shannon := float64(0) + bits := int(0) + nMatches := 0 + if t.nLits > 0 { + invTotal := 1.0 / float64(t.nLits) + for _, v := range t.litHist[:] { + if v > 0 { + n := float64(v) + shannon += math.Ceil(-math.Log2(n*invTotal) * n) + } + } + // Just add 15 for EOB + shannon += 15 + for _, v := range t.extraHist[1 : literalCount-256] { + if v > 0 { + n := float64(v) + shannon += math.Ceil(-math.Log2(n*invTotal) * n) + bits += int(lengthExtraBits[v&31]) * int(v) + nMatches += int(v) + } + } + } + if nMatches > 0 { + invTotal := 1.0 / float64(nMatches) + for _, v := range t.offHist[:offsetCodeCount] { + if v > 0 { + n := float64(v) + shannon += math.Ceil(-math.Log2(n*invTotal) * n) + bits += int(offsetExtraBits[v&31]) * int(n) + } + } + } + + return int(shannon) + bits +} + +// AddMatch adds a match to the tokens. +// This function is very sensitive to inlining and right on the border. +func (t *tokens) AddMatch(xlength uint32, xoffset uint32) { + if debugDecode { + if xlength >= maxMatchLength+baseMatchLength { + panic(fmt.Errorf("invalid length: %v", xlength)) + } + if xoffset >= maxMatchOffset+baseMatchOffset { + panic(fmt.Errorf("invalid offset: %v", xoffset)) + } + } + t.nLits++ + lengthCode := lengthCodes1[uint8(xlength)] & 31 + t.tokens[t.n] = token(matchType | xlength<<lengthShift | xoffset) + t.extraHist[lengthCode]++ + t.offHist[offsetCode(xoffset)&31]++ + t.n++ +} + +// AddMatchLong adds a match to the tokens, potentially longer than max match length. +// Length should NOT have the base subtracted, only offset should. +func (t *tokens) AddMatchLong(xlength int32, xoffset uint32) { + if debugDecode { + if xoffset >= maxMatchOffset+baseMatchOffset { + panic(fmt.Errorf("invalid offset: %v", xoffset)) + } + } + oc := offsetCode(xoffset) & 31 + for xlength > 0 { + xl := xlength + if xl > 258 { + // We need to have at least baseMatchLength left over for next loop. + xl = 258 - baseMatchLength + } + xlength -= xl + xl -= 3 + t.nLits++ + lengthCode := lengthCodes1[uint8(xl)] & 31 + t.tokens[t.n] = token(matchType | uint32(xl)<<lengthShift | xoffset) + t.extraHist[lengthCode]++ + t.offHist[oc]++ + t.n++ + } +} + +func (t *tokens) AddEOB() { + t.tokens[t.n] = token(endBlockMarker) + t.extraHist[0]++ + t.n++ +} + +func (t *tokens) Slice() []token { + return t.tokens[:t.n] +} + +// VarInt returns the tokens as varint encoded bytes. +func (t *tokens) VarInt() []byte { + var b = make([]byte, binary.MaxVarintLen32*int(t.n)) + var off int + for _, v := range t.tokens[:t.n] { + off += binary.PutUvarint(b[off:], uint64(v)) + } + return b[:off] +} + +// FromVarInt restores t to the varint encoded tokens provided. +// Any data in t is removed. +func (t *tokens) FromVarInt(b []byte) error { + var buf = bytes.NewReader(b) + var toks []token + for { + r, err := binary.ReadUvarint(buf) + if err == io.EOF { + break + } + if err != nil { + return err + } + toks = append(toks, token(r)) + } + t.indexTokens(toks) + return nil } // Returns the type of a token @@ -96,11 +351,17 @@ func lengthCode(len uint8) uint32 { return uint32(lengthCodes[len]) } // Returns the offset code corresponding to a specific offset func offsetCode(off uint32) uint32 { + if false { + if off < uint32(len(offsetCodes)) { + return offsetCodes[off&255] + } else if off>>7 < uint32(len(offsetCodes)) { + return offsetCodes[(off>>7)&255] + 14 + } else { + return offsetCodes[(off>>14)&255] + 28 + } + } if off < uint32(len(offsetCodes)) { - return offsetCodes[off&255] - } else if off>>7 < uint32(len(offsetCodes)) { - return offsetCodes[(off>>7)&255] + 14 - } else { - return offsetCodes[(off>>14)&255] + 28 + return offsetCodes[uint8(off)] } + return offsetCodes14[uint8(off>>7)] } diff --git a/vendor/github.com/klauspost/compress/huff0/compress.go b/vendor/github.com/klauspost/compress/huff0/compress.go index dd4f7fefb..51e00aaeb 100644 --- a/vendor/github.com/klauspost/compress/huff0/compress.go +++ b/vendor/github.com/klauspost/compress/huff0/compress.go @@ -54,6 +54,12 @@ func compress(in []byte, s *Scratch, compressor func(src []byte) ([]byte, error) canReuse = s.canUseTable(s.prevTable) } + // We want the output size to be less than this: + wantSize := len(in) + if s.WantLogLess > 0 { + wantSize -= wantSize >> s.WantLogLess + } + // Reset for next run. s.clearCount = true s.maxCount = 0 @@ -77,7 +83,7 @@ func compress(in []byte, s *Scratch, compressor func(src []byte) ([]byte, error) s.cTable = s.prevTable s.Out, err = compressor(in) s.cTable = keepTable - if err == nil && len(s.Out) < len(in) { + if err == nil && len(s.Out) < wantSize { s.OutData = s.Out return s.Out, true, nil } @@ -100,13 +106,16 @@ func compress(in []byte, s *Scratch, compressor func(src []byte) ([]byte, error) hSize := len(s.Out) oldSize := s.prevTable.estimateSize(s.count[:s.symbolLen]) newSize := s.cTable.estimateSize(s.count[:s.symbolLen]) - if oldSize <= hSize+newSize || hSize+12 >= len(in) { + if oldSize <= hSize+newSize || hSize+12 >= wantSize { // Retain cTable even if we re-use. keepTable := s.cTable s.cTable = s.prevTable s.Out, err = compressor(in) s.cTable = keepTable - if len(s.Out) >= len(in) { + if err != nil { + return nil, false, err + } + if len(s.Out) >= wantSize { return nil, false, ErrIncompressible } s.OutData = s.Out @@ -128,7 +137,7 @@ func compress(in []byte, s *Scratch, compressor func(src []byte) ([]byte, error) s.OutTable = nil return nil, false, err } - if len(s.Out) >= len(in) { + if len(s.Out) >= wantSize { s.OutTable = nil return nil, false, ErrIncompressible } diff --git a/vendor/github.com/klauspost/compress/huff0/decompress.go b/vendor/github.com/klauspost/compress/huff0/decompress.go index 43b4815b3..7e68a4eb4 100644 --- a/vendor/github.com/klauspost/compress/huff0/decompress.go +++ b/vendor/github.com/klauspost/compress/huff0/decompress.go @@ -276,6 +276,7 @@ func (s *Scratch) Decompress4X(in []byte, dstSize int) (out []byte, err error) { // Use temp table to avoid bound checks/append penalty. var tmp = s.huffWeight[:256] var off uint8 + var decoded int // Decode 2 values from each decoder/loop. const bufoff = 256 / 4 @@ -306,6 +307,7 @@ bigloop: copy(dstOut[dstEvery*3:], tmp[bufoff*3:bufoff*4]) off = 0 dstOut = dstOut[bufoff:] + decoded += 256 // There must at least be 3 buffers left. if len(dstOut) < dstEvery*3 { return nil, errors.New("corruption detected: stream overrun 2") @@ -321,9 +323,11 @@ bigloop: copy(dstOut[dstEvery:dstEvery+ioff], tmp[bufoff:bufoff*2]) copy(dstOut[dstEvery*2:dstEvery*2+ioff], tmp[bufoff*2:bufoff*3]) copy(dstOut[dstEvery*3:dstEvery*3+ioff], tmp[bufoff*3:bufoff*4]) + decoded += int(off) * 4 dstOut = dstOut[off:] } + // Decode remaining. for i := range br { offset := dstEvery * i br := &br[i] @@ -335,12 +339,15 @@ bigloop: dstOut[offset] = decode(br) offset++ } + decoded += offset - dstEvery*i err = br.close() if err != nil { return nil, err } } - + if dstSize != decoded { + return nil, errors.New("corruption detected: short output block") + } return s.Out, nil } diff --git a/vendor/github.com/klauspost/compress/huff0/huff0.go b/vendor/github.com/klauspost/compress/huff0/huff0.go index 6f823f94d..6bc23bbf0 100644 --- a/vendor/github.com/klauspost/compress/huff0/huff0.go +++ b/vendor/github.com/klauspost/compress/huff0/huff0.go @@ -89,6 +89,12 @@ type Scratch struct { // Reuse will specify the reuse policy Reuse ReusePolicy + // WantLogLess allows to specify a log 2 reduction that should at least be achieved, + // otherwise the block will be returned as incompressible. + // The reduction should then at least be (input size >> WantLogLess) + // If WantLogLess == 0 any improvement will do. + WantLogLess uint8 + // MaxDecodedSize will set the maximum allowed output size. // This value will automatically be set to BlockSizeMax if not set. // Decoders will return ErrMaxDecodedSizeExceeded is this limit is exceeded. diff --git a/vendor/github.com/klauspost/compress/zstd/blockdec.go b/vendor/github.com/klauspost/compress/zstd/blockdec.go index 3e161ea15..47cc21d6d 100644 --- a/vendor/github.com/klauspost/compress/zstd/blockdec.go +++ b/vendor/github.com/klauspost/compress/zstd/blockdec.go @@ -11,6 +11,7 @@ import ( "sync" "github.com/klauspost/compress/huff0" + "github.com/klauspost/compress/zstd/internal/xxhash" ) type blockType uint8 @@ -160,7 +161,8 @@ func (b *blockDec) reset(br byteBuffer, windowSize uint64) error { b.data, err = br.readBig(cSize, b.dataStorage) if err != nil { if debug { - println("Reading block:", err) + println("Reading block:", err, "(", cSize, ")", len(b.data)) + printf("%T", br) } return err } @@ -275,7 +277,7 @@ func (b *blockDec) decodeBuf(hist *history) error { hist.b = nil err := b.decodeCompressed(hist) if debug { - println("Decompressed to total", len(b.dst), "bytes, error:", err) + println("Decompressed to total", len(b.dst), "bytes, hash:", xxhash.Sum64(b.dst), "error:", err) } hist.b = b.dst b.dst = saved @@ -368,7 +370,7 @@ func (b *blockDec) decodeCompressed(hist *history) error { } } if debug { - println("literals type:", litType, "litRegenSize:", litRegenSize, "litCompSize", litCompSize) + println("literals type:", litType, "litRegenSize:", litRegenSize, "litCompSize:", litCompSize, "sizeFormat:", sizeFormat, "4X:", fourStreams) } var literals []byte var huff *huff0.Scratch @@ -426,7 +428,6 @@ func (b *blockDec) decodeCompressed(hist *history) error { } literals = in[:litCompSize] in = in[litCompSize:] - huff = huffDecoderPool.Get().(*huff0.Scratch) var err error // Ensure we have space to store it. @@ -637,7 +638,7 @@ func (b *blockDec) decodeCompressed(hist *history) error { hist.huffTree = huff } if debug { - println("Final literals:", len(literals), "and", nSeqs, "sequences.") + println("Final literals:", len(literals), "hash:", xxhash.Sum64(literals), "and", nSeqs, "sequences.") } if nSeqs == 0 { diff --git a/vendor/github.com/klauspost/compress/zstd/blockenc.go b/vendor/github.com/klauspost/compress/zstd/blockenc.go index 9d9151a0e..8383279d2 100644 --- a/vendor/github.com/klauspost/compress/zstd/blockenc.go +++ b/vendor/github.com/klauspost/compress/zstd/blockenc.go @@ -51,7 +51,7 @@ func (b *blockEnc) init() { b.coders.llEnc = &fseEncoder{} b.coders.llPrev = &fseEncoder{} } - b.litEnc = &huff0.Scratch{} + b.litEnc = &huff0.Scratch{WantLogLess: 4} b.reset(nil) } @@ -391,6 +391,52 @@ func (b *blockEnc) encodeLits() error { return nil } +// fuzzFseEncoder can be used to fuzz the FSE encoder. +func fuzzFseEncoder(data []byte) int { + if len(data) > maxSequences || len(data) < 2 { + return 0 + } + enc := fseEncoder{} + hist := enc.Histogram()[:256] + maxSym := uint8(0) + for i, v := range data { + v = v & 63 + data[i] = v + hist[v]++ + if v > maxSym { + maxSym = v + } + } + if maxSym == 0 { + // All 0 + return 0 + } + maxCount := func(a []uint32) int { + var max uint32 + for _, v := range a { + if v > max { + max = v + } + } + return int(max) + } + cnt := maxCount(hist[:maxSym]) + if cnt == len(data) { + // RLE + return 0 + } + enc.HistogramFinished(maxSym, cnt) + err := enc.normalizeCount(len(data)) + if err != nil { + return 0 + } + _, err = enc.writeCount(nil) + if err != nil { + panic(err) + } + return 1 +} + // encode will encode the block and put the output in b.output. func (b *blockEnc) encode() error { if len(b.sequences) == 0 { @@ -415,16 +461,10 @@ func (b *blockEnc) encode() error { if len(b.literals) >= 1024 { // Use 4 Streams. out, reUsed, err = huff0.Compress4X(b.literals, b.litEnc) - if len(out) > len(b.literals)-len(b.literals)>>4 { - err = huff0.ErrIncompressible - } } else if len(b.literals) > 32 { // Use 1 stream single = true out, reUsed, err = huff0.Compress1X(b.literals, b.litEnc) - if len(out) > len(b.literals)-len(b.literals)>>4 { - err = huff0.ErrIncompressible - } } else { err = huff0.ErrIncompressible } @@ -711,7 +751,7 @@ func (b *blockEnc) encode() error { return nil } -var errIncompressible = errors.New("uncompressible") +var errIncompressible = errors.New("incompressible") func (b *blockEnc) genCodes() { if len(b.sequences) == 0 { diff --git a/vendor/github.com/klauspost/compress/zstd/bytebuf.go b/vendor/github.com/klauspost/compress/zstd/bytebuf.go index 3538063f1..07321acb1 100644 --- a/vendor/github.com/klauspost/compress/zstd/bytebuf.go +++ b/vendor/github.com/klauspost/compress/zstd/bytebuf.go @@ -101,6 +101,9 @@ func (r *readerWrapper) readBig(n int, dst []byte) ([]byte, error) { dst = make([]byte, n) } n2, err := io.ReadFull(r.r, dst[:n]) + if err == io.EOF && n > 0 { + err = io.ErrUnexpectedEOF + } return dst[:n2], err } diff --git a/vendor/github.com/klauspost/compress/zstd/decoder.go b/vendor/github.com/klauspost/compress/zstd/decoder.go index f4db3096a..1de94eef0 100644 --- a/vendor/github.com/klauspost/compress/zstd/decoder.go +++ b/vendor/github.com/klauspost/compress/zstd/decoder.go @@ -75,6 +75,7 @@ var ( // The Reset function can be used to initiate a new stream, which is will considerably // reduce the allocations normally caused by NewReader. func NewReader(r io.Reader, opts ...DOption) (*Decoder, error) { + initPredefined() var d Decoder d.o.setDefault() for _, o := range opts { @@ -123,7 +124,9 @@ func (d *Decoder) Read(p []byte) (int, error) { if d.current.err != nil { break } - d.nextBlock() + if !d.nextBlock(n == 0) { + return n, nil + } } } if len(d.current.b) > 0 { @@ -251,7 +254,7 @@ func (d *Decoder) WriteTo(w io.Writer) (int64, error) { if d.current.err != nil { break } - d.nextBlock() + d.nextBlock(true) } err := d.current.err if err != nil { @@ -328,7 +331,10 @@ func (d *Decoder) DecodeAll(input, dst []byte) ([]byte, error) { // nextBlock returns the next block. // If an error occurs d.err will be set. -func (d *Decoder) nextBlock() { +// Optionally the function can block for new output. +// If non-blocking mode is used the returned boolean will be false +// if no data was available without blocking. +func (d *Decoder) nextBlock(blocking bool) (ok bool) { if d.current.d != nil { if debug { printf("re-adding current decoder %p", d.current.d) @@ -338,12 +344,22 @@ func (d *Decoder) nextBlock() { } if d.current.err != nil { // Keep error state. - return + return blocking + } + + if blocking { + d.current.decodeOutput = <-d.current.output + } else { + select { + case d.current.decodeOutput = <-d.current.output: + default: + return false + } } - d.current.decodeOutput = <-d.current.output if debug { println("got", len(d.current.b), "bytes, error:", d.current.err) } + return true } // Close will release all resources. diff --git a/vendor/github.com/klauspost/compress/zstd/enc_dfast.go b/vendor/github.com/klauspost/compress/zstd/enc_dfast.go index e120625d8..2f41bcd0d 100644 --- a/vendor/github.com/klauspost/compress/zstd/enc_dfast.go +++ b/vendor/github.com/klauspost/compress/zstd/enc_dfast.go @@ -235,7 +235,7 @@ encodeLoop: if debug && s-t > e.maxMatchOff { panic("s - t >e.maxMatchOff") } - if debug { + if debugMatches { println("long match") } break @@ -259,7 +259,7 @@ encodeLoop: // but the likelihood of both the first 4 bytes and the hash matching should be enough. t = candidateL.offset - e.cur s += checkAt - if debug { + if debugMatches { println("long match (after short)") } break @@ -275,7 +275,7 @@ encodeLoop: if debug && t < 0 { panic("t<0") } - if debug { + if debugMatches { println("short match") } break diff --git a/vendor/github.com/klauspost/compress/zstd/encoder.go b/vendor/github.com/klauspost/compress/zstd/encoder.go index b7011be29..d79188271 100644 --- a/vendor/github.com/klauspost/compress/zstd/encoder.go +++ b/vendor/github.com/klauspost/compress/zstd/encoder.go @@ -59,6 +59,7 @@ type encoderState struct { // NewWriter will create a new Zstandard encoder. // If the encoder will be used for encoding blocks a nil writer can be used. func NewWriter(w io.Writer, opts ...EOption) (*Encoder, error) { + initPredefined() var e Encoder e.o.setDefault() for _, o := range opts { @@ -393,12 +394,31 @@ func (e *Encoder) Close() error { // EncodeAll will encode all input in src and append it to dst. // This function can be called concurrently, but each call will only run on a single goroutine. -// If empty input is given, nothing is returned. +// If empty input is given, nothing is returned, unless WithZeroFrames is specified. // Encoded blocks can be concatenated and the result will be the combined input stream. // Data compressed with EncodeAll can be decoded with the Decoder, // using either a stream or DecodeAll. func (e *Encoder) EncodeAll(src, dst []byte) []byte { if len(src) == 0 { + if e.o.fullZero { + // Add frame header. + fh := frameHeader{ + ContentSize: 0, + WindowSize: MinWindowSize, + SingleSegment: true, + // Adding a checksum would be a waste of space. + Checksum: false, + DictID: 0, + } + dst, _ = fh.appendTo(dst) + + // Write raw block as last one only. + var blk blockHeader + blk.setSize(0) + blk.setType(blockTypeRaw) + blk.setLast(true) + dst = blk.appendTo(dst) + } return dst } e.init.Do(func() { diff --git a/vendor/github.com/klauspost/compress/zstd/encoder_options.go b/vendor/github.com/klauspost/compress/zstd/encoder_options.go index a8559e900..0f83a325a 100644 --- a/vendor/github.com/klauspost/compress/zstd/encoder_options.go +++ b/vendor/github.com/klauspost/compress/zstd/encoder_options.go @@ -1,6 +1,7 @@ package zstd import ( + "errors" "fmt" "runtime" "strings" @@ -18,6 +19,7 @@ type encoderOptions struct { blockSize int windowSize int level EncoderLevel + fullZero bool } func (o *encoderOptions) setDefault() { @@ -63,6 +65,30 @@ func WithEncoderConcurrency(n int) EOption { } } +// WithWindowSize will set the maximum allowed back-reference distance. +// The value must be a power of two between WindowSizeMin and WindowSizeMax. +// A larger value will enable better compression but allocate more memory and, +// for above-default values, take considerably longer. +// The default value is determined by the compression level. +func WithWindowSize(n int) EOption { + return func(o *encoderOptions) error { + switch { + case n < MinWindowSize: + return fmt.Errorf("window size must be at least %d", MinWindowSize) + case n > MaxWindowSize: + return fmt.Errorf("window size must be at most %d", MaxWindowSize) + case (n & (n - 1)) != 0: + return errors.New("window size must be a power of 2") + } + + o.windowSize = n + if o.blockSize > o.windowSize { + o.blockSize = o.windowSize + } + return nil + } +} + // WithEncoderPadding will add padding to all output so the size will be a multiple of n. // This can be used to obfuscate the exact output size or make blocks of a certain size. // The contents will be a skippable frame, so it will be invisible by the decoder. @@ -166,6 +192,16 @@ func WithEncoderLevel(l EncoderLevel) EOption { } } +// WithZeroFrames will encode 0 length input as full frames. +// This can be needed for compatibility with zstandard usage, +// but is not needed for this package. +func WithZeroFrames(b bool) EOption { + return func(o *encoderOptions) error { + o.fullZero = b + return nil + } +} + // WithSingleSegment will set the "single segment" flag when EncodeAll is used. // If this flag is set, data must be regenerated within a single continuous memory segment. // In this case, Window_Descriptor byte is skipped, but Frame_Content_Size is necessarily present. diff --git a/vendor/github.com/klauspost/compress/zstd/framedec.go b/vendor/github.com/klauspost/compress/zstd/framedec.go index 839a95fbf..9e00437a2 100644 --- a/vendor/github.com/klauspost/compress/zstd/framedec.go +++ b/vendor/github.com/klauspost/compress/zstd/framedec.go @@ -49,7 +49,8 @@ type frameDec struct { const ( // The minimum Window_Size is 1 KB. - minWindowSize = 1 << 10 + MinWindowSize = 1 << 10 + MaxWindowSize = 1 << 30 ) var ( @@ -60,7 +61,7 @@ var ( func newFrameDec(o decoderOptions) *frameDec { d := frameDec{ o: o, - maxWindowSize: 1 << 30, + maxWindowSize: MaxWindowSize, } if d.maxWindowSize > o.maxDecodedSize { d.maxWindowSize = o.maxDecodedSize @@ -193,14 +194,14 @@ func (d *frameDec) reset(br byteBuffer) error { // When FCS_Field_Size is 2, the offset of 256 is added. d.FrameContentSize = uint64(b[0]) | (uint64(b[1]) << 8) + 256 case 4: - d.FrameContentSize = uint64(b[0]) | (uint64(b[1]) << 8) | (uint64(b[2]) << 16) | (uint64(b[3] << 24)) + d.FrameContentSize = uint64(b[0]) | (uint64(b[1]) << 8) | (uint64(b[2]) << 16) | (uint64(b[3]) << 24) case 8: d1 := uint32(b[0]) | (uint32(b[1]) << 8) | (uint32(b[2]) << 16) | (uint32(b[3]) << 24) d2 := uint32(b[4]) | (uint32(b[5]) << 8) | (uint32(b[6]) << 16) | (uint32(b[7]) << 24) d.FrameContentSize = uint64(d1) | (uint64(d2) << 32) } if debug { - println("field size bits:", v, "fcsSize:", fcsSize, "FrameContentSize:", d.FrameContentSize, hex.EncodeToString(b[:fcsSize])) + println("field size bits:", v, "fcsSize:", fcsSize, "FrameContentSize:", d.FrameContentSize, hex.EncodeToString(b[:fcsSize]), "singleseg:", d.SingleSegment, "window:", d.WindowSize) } } // Move this to shared. @@ -215,8 +216,8 @@ func (d *frameDec) reset(br byteBuffer) error { if d.WindowSize == 0 && d.SingleSegment { // We may not need window in this case. d.WindowSize = d.FrameContentSize - if d.WindowSize < minWindowSize { - d.WindowSize = minWindowSize + if d.WindowSize < MinWindowSize { + d.WindowSize = MinWindowSize } } @@ -225,7 +226,7 @@ func (d *frameDec) reset(br byteBuffer) error { return ErrWindowSizeExceeded } // The minimum Window_Size is 1 KB. - if d.WindowSize < minWindowSize { + if d.WindowSize < MinWindowSize { println("got window size: ", d.WindowSize) return ErrWindowSizeTooSmall } @@ -309,7 +310,9 @@ func (d *frameDec) checkCRC() error { } return ErrCRCMismatch } - println("CRC ok") + if debug { + println("CRC ok", tmp[:]) + } return nil } @@ -411,6 +414,7 @@ func (d *frameDec) startDecoder(output chan decodeOutput) { } written += int64(len(r.b)) if d.SingleSegment && uint64(written) > d.FrameContentSize { + println("runDecoder: single segment and", uint64(written), ">", d.FrameContentSize) r.err = ErrFrameSizeExceeded output <- r return @@ -461,6 +465,7 @@ func (d *frameDec) runDecoder(dst []byte, dec *blockDec) ([]byte, error) { break } if d.SingleSegment && uint64(len(d.history.b)) > d.o.maxDecodedSize { + println("runDecoder: single segment and", uint64(len(d.history.b)), ">", d.o.maxDecodedSize) err = ErrFrameSizeExceeded break } diff --git a/vendor/github.com/klauspost/compress/zstd/frameenc.go b/vendor/github.com/klauspost/compress/zstd/frameenc.go index acac32527..4479cfe18 100644 --- a/vendor/github.com/klauspost/compress/zstd/frameenc.go +++ b/vendor/github.com/klauspost/compress/zstd/frameenc.go @@ -5,7 +5,6 @@ package zstd import ( - "errors" "fmt" "io" "math" @@ -49,9 +48,7 @@ func (f frameHeader) appendTo(dst []byte) ([]byte, error) { windowLog := (bits.Len32(f.WindowSize-1) - winLogMin) << 3 dst = append(dst, uint8(windowLog)) } - if f.SingleSegment && f.ContentSize == 0 { - return nil, errors.New("single segment, but no size set") - } + switch fcs { case 0: if f.SingleSegment { diff --git a/vendor/github.com/klauspost/compress/zstd/fse_encoder.go b/vendor/github.com/klauspost/compress/zstd/fse_encoder.go index dfa6cf7ce..619836f52 100644 --- a/vendor/github.com/klauspost/compress/zstd/fse_encoder.go +++ b/vendor/github.com/klauspost/compress/zstd/fse_encoder.go @@ -502,13 +502,22 @@ func (s *fseEncoder) validateNorm() (err error) { // writeCount will write the normalized histogram count to header. // This is read back by readNCount. func (s *fseEncoder) writeCount(out []byte) ([]byte, error) { + if s.useRLE { + return append(out, s.rleVal), nil + } + if s.preDefined || s.reUsed { + // Never write predefined. + return out, nil + } + var ( tableLog = s.actualTableLog tableSize = 1 << tableLog previous0 bool charnum uint16 - maxHeaderSize = ((int(s.symbolLen) * int(tableLog)) >> 3) + 3 + // maximum header size plus 2 extra bytes for final output if bitCount == 0. + maxHeaderSize = ((int(s.symbolLen) * int(tableLog)) >> 3) + 3 + 2 // Write Table Size bitStream = uint32(tableLog - minEncTablelog) @@ -516,15 +525,12 @@ func (s *fseEncoder) writeCount(out []byte) ([]byte, error) { remaining = int16(tableSize + 1) /* +1 for extra accuracy */ threshold = int16(tableSize) nbBits = uint(tableLog + 1) + outP = len(out) ) - if s.useRLE { - return append(out, s.rleVal), nil + if cap(out) < outP+maxHeaderSize { + out = append(out, make([]byte, maxHeaderSize*3)...) + out = out[:len(out)-maxHeaderSize*3] } - if s.preDefined || s.reUsed { - // Never write predefined. - return out, nil - } - outP := len(out) out = out[:outP+maxHeaderSize] // stops at 1 @@ -594,11 +600,14 @@ func (s *fseEncoder) writeCount(out []byte) ([]byte, error) { } } + if outP+2 > len(out) { + return nil, fmt.Errorf("internal error: %d > %d, maxheader: %d, sl: %d, tl: %d, normcount: %v", outP+2, len(out), maxHeaderSize, s.symbolLen, int(tableLog), s.norm[:s.symbolLen]) + } out[outP] = byte(bitStream) out[outP+1] = byte(bitStream >> 8) outP += int((bitCount + 7) / 8) - if uint16(charnum) > s.symbolLen { + if charnum > s.symbolLen { return nil, errors.New("internal error: charnum > s.symbolLen") } return out[:outP], nil diff --git a/vendor/github.com/klauspost/compress/zstd/fse_predefined.go b/vendor/github.com/klauspost/compress/zstd/fse_predefined.go index 5186de802..6c17dc17f 100644 --- a/vendor/github.com/klauspost/compress/zstd/fse_predefined.go +++ b/vendor/github.com/klauspost/compress/zstd/fse_predefined.go @@ -7,6 +7,7 @@ package zstd import ( "fmt" "math" + "sync" ) var ( @@ -69,85 +70,89 @@ func fillBase(dst []baseOffset, base uint32, bits ...uint8) { } } -func init() { - // Literals length codes - tmp := make([]baseOffset, 36) - for i := range tmp[:16] { - tmp[i] = baseOffset{ - baseLine: uint32(i), - addBits: 0, +var predef sync.Once + +func initPredefined() { + predef.Do(func() { + // Literals length codes + tmp := make([]baseOffset, 36) + for i := range tmp[:16] { + tmp[i] = baseOffset{ + baseLine: uint32(i), + addBits: 0, + } } - } - fillBase(tmp[16:], 16, 1, 1, 1, 1, 2, 2, 3, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16) - symbolTableX[tableLiteralLengths] = tmp - - // Match length codes - tmp = make([]baseOffset, 53) - for i := range tmp[:32] { - tmp[i] = baseOffset{ - // The transformation adds the 3 length. - baseLine: uint32(i) + 3, - addBits: 0, - } - } - fillBase(tmp[32:], 35, 1, 1, 1, 1, 2, 2, 3, 3, 4, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16) - symbolTableX[tableMatchLengths] = tmp - - // Offset codes - tmp = make([]baseOffset, maxOffsetBits+1) - tmp[1] = baseOffset{ - baseLine: 1, - addBits: 1, - } - fillBase(tmp[2:], 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30) - symbolTableX[tableOffsets] = tmp - - // Fill predefined tables and transform them. - // https://github.com/facebook/zstd/blob/dev/doc/zstd_compression_format.md#default-distributions - for i := range fsePredef[:] { - f := &fsePredef[i] - switch tableIndex(i) { - case tableLiteralLengths: - // https://github.com/facebook/zstd/blob/ededcfca57366461021c922720878c81a5854a0a/lib/decompress/zstd_decompress_block.c#L243 - f.actualTableLog = 6 - copy(f.norm[:], []int16{4, 3, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, - 2, 2, 2, 2, 2, 2, 2, 2, 2, 3, 2, 1, 1, 1, 1, 1, - -1, -1, -1, -1}) - f.symbolLen = 36 - case tableOffsets: - // https://github.com/facebook/zstd/blob/ededcfca57366461021c922720878c81a5854a0a/lib/decompress/zstd_decompress_block.c#L281 - f.actualTableLog = 5 - copy(f.norm[:], []int16{ - 1, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 1, 1, - 1, 1, 1, 1, 1, 1, 1, 1, -1, -1, -1, -1, -1}) - f.symbolLen = 29 - case tableMatchLengths: - //https://github.com/facebook/zstd/blob/ededcfca57366461021c922720878c81a5854a0a/lib/decompress/zstd_decompress_block.c#L304 - f.actualTableLog = 6 - copy(f.norm[:], []int16{ - 1, 4, 3, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, 1, 1, 1, - 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, - 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, -1, -1, - -1, -1, -1, -1, -1}) - f.symbolLen = 53 + fillBase(tmp[16:], 16, 1, 1, 1, 1, 2, 2, 3, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16) + symbolTableX[tableLiteralLengths] = tmp + + // Match length codes + tmp = make([]baseOffset, 53) + for i := range tmp[:32] { + tmp[i] = baseOffset{ + // The transformation adds the 3 length. + baseLine: uint32(i) + 3, + addBits: 0, + } } - if err := f.buildDtable(); err != nil { - panic(fmt.Errorf("building table %v: %v", tableIndex(i), err)) + fillBase(tmp[32:], 35, 1, 1, 1, 1, 2, 2, 3, 3, 4, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16) + symbolTableX[tableMatchLengths] = tmp + + // Offset codes + tmp = make([]baseOffset, maxOffsetBits+1) + tmp[1] = baseOffset{ + baseLine: 1, + addBits: 1, } - if err := f.transform(symbolTableX[i]); err != nil { - panic(fmt.Errorf("building table %v: %v", tableIndex(i), err)) + fillBase(tmp[2:], 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30) + symbolTableX[tableOffsets] = tmp + + // Fill predefined tables and transform them. + // https://github.com/facebook/zstd/blob/dev/doc/zstd_compression_format.md#default-distributions + for i := range fsePredef[:] { + f := &fsePredef[i] + switch tableIndex(i) { + case tableLiteralLengths: + // https://github.com/facebook/zstd/blob/ededcfca57366461021c922720878c81a5854a0a/lib/decompress/zstd_decompress_block.c#L243 + f.actualTableLog = 6 + copy(f.norm[:], []int16{4, 3, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, + 2, 2, 2, 2, 2, 2, 2, 2, 2, 3, 2, 1, 1, 1, 1, 1, + -1, -1, -1, -1}) + f.symbolLen = 36 + case tableOffsets: + // https://github.com/facebook/zstd/blob/ededcfca57366461021c922720878c81a5854a0a/lib/decompress/zstd_decompress_block.c#L281 + f.actualTableLog = 5 + copy(f.norm[:], []int16{ + 1, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, -1, -1, -1, -1, -1}) + f.symbolLen = 29 + case tableMatchLengths: + //https://github.com/facebook/zstd/blob/ededcfca57366461021c922720878c81a5854a0a/lib/decompress/zstd_decompress_block.c#L304 + f.actualTableLog = 6 + copy(f.norm[:], []int16{ + 1, 4, 3, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, -1, -1, + -1, -1, -1, -1, -1}) + f.symbolLen = 53 + } + if err := f.buildDtable(); err != nil { + panic(fmt.Errorf("building table %v: %v", tableIndex(i), err)) + } + if err := f.transform(symbolTableX[i]); err != nil { + panic(fmt.Errorf("building table %v: %v", tableIndex(i), err)) + } + f.preDefined = true + + // Create encoder as well + enc := &fsePredefEnc[i] + copy(enc.norm[:], f.norm[:]) + enc.symbolLen = f.symbolLen + enc.actualTableLog = f.actualTableLog + if err := enc.buildCTable(); err != nil { + panic(fmt.Errorf("building encoding table %v: %v", tableIndex(i), err)) + } + enc.setBits(bitTables[i]) + enc.preDefined = true } - f.preDefined = true - - // Create encoder as well - enc := &fsePredefEnc[i] - copy(enc.norm[:], f.norm[:]) - enc.symbolLen = f.symbolLen - enc.actualTableLog = f.actualTableLog - if err := enc.buildCTable(); err != nil { - panic(fmt.Errorf("building encoding table %v: %v", tableIndex(i), err)) - } - enc.setBits(bitTables[i]) - enc.preDefined = true - } + }) } diff --git a/vendor/github.com/klauspost/compress/zstd/snappy.go b/vendor/github.com/klauspost/compress/zstd/snappy.go index e9e518570..a048818f9 100644 --- a/vendor/github.com/klauspost/compress/zstd/snappy.go +++ b/vendor/github.com/klauspost/compress/zstd/snappy.go @@ -80,6 +80,7 @@ type SnappyConverter struct { // If any error is detected on the Snappy stream it is returned. // The number of bytes written is returned. func (r *SnappyConverter) Convert(in io.Reader, w io.Writer) (int64, error) { + initPredefined() r.err = nil r.r = in if r.block == nil { diff --git a/vendor/github.com/klauspost/compress/zstd/zstd.go b/vendor/github.com/klauspost/compress/zstd/zstd.go index b975954c1..57a8a2f5b 100644 --- a/vendor/github.com/klauspost/compress/zstd/zstd.go +++ b/vendor/github.com/klauspost/compress/zstd/zstd.go @@ -11,6 +11,7 @@ import ( const debug = false const debugSequences = false +const debugMatches = false // force encoder to use predefined tables. const forcePreDef = false diff --git a/vendor/github.com/klauspost/cpuid/.gitignore b/vendor/github.com/klauspost/cpuid/.gitignore deleted file mode 100644 index daf913b1b..000000000 --- a/vendor/github.com/klauspost/cpuid/.gitignore +++ /dev/null @@ -1,24 +0,0 @@ -# Compiled Object files, Static and Dynamic libs (Shared Objects) -*.o -*.a -*.so - -# Folders -_obj -_test - -# Architecture specific extensions/prefixes -*.[568vq] -[568vq].out - -*.cgo1.go -*.cgo2.c -_cgo_defun.c -_cgo_gotypes.go -_cgo_export.* - -_testmain.go - -*.exe -*.test -*.prof diff --git a/vendor/github.com/klauspost/cpuid/.travis.yml b/vendor/github.com/klauspost/cpuid/.travis.yml deleted file mode 100644 index 630192d59..000000000 --- a/vendor/github.com/klauspost/cpuid/.travis.yml +++ /dev/null @@ -1,23 +0,0 @@ -language: go - -sudo: false - -os: - - linux - - osx -go: - - 1.8.x - - 1.9.x - - 1.10.x - - master - -script: - - go vet ./... - - go test -v ./... - - go test -race ./... - - diff <(gofmt -d .) <("") - -matrix: - allow_failures: - - go: 'master' - fast_finish: true diff --git a/vendor/github.com/klauspost/cpuid/CONTRIBUTING.txt b/vendor/github.com/klauspost/cpuid/CONTRIBUTING.txt deleted file mode 100644 index 2ef4714f7..000000000 --- a/vendor/github.com/klauspost/cpuid/CONTRIBUTING.txt +++ /dev/null @@ -1,35 +0,0 @@ -Developer Certificate of Origin
-Version 1.1
-
-Copyright (C) 2015- Klaus Post & Contributors.
-Email: klauspost@gmail.com
-
-Everyone is permitted to copy and distribute verbatim copies of this
-license document, but changing it is not allowed.
-
-
-Developer's Certificate of Origin 1.1
-
-By making a contribution to this project, I certify that:
-
-(a) The contribution was created in whole or in part by me and I
- have the right to submit it under the open source license
- indicated in the file; or
-
-(b) The contribution is based upon previous work that, to the best
- of my knowledge, is covered under an appropriate open source
- license and I have the right under that license to submit that
- work with modifications, whether created in whole or in part
- by me, under the same open source license (unless I am
- permitted to submit under a different license), as indicated
- in the file; or
-
-(c) The contribution was provided directly to me by some other
- person who certified (a), (b) or (c) and I have not modified
- it.
-
-(d) I understand and agree that this project and the contribution
- are public and that a record of the contribution (including all
- personal information I submit with it, including my sign-off) is
- maintained indefinitely and may be redistributed consistent with
- this project or the open source license(s) involved.
diff --git a/vendor/github.com/klauspost/cpuid/LICENSE b/vendor/github.com/klauspost/cpuid/LICENSE deleted file mode 100644 index 5cec7ee94..000000000 --- a/vendor/github.com/klauspost/cpuid/LICENSE +++ /dev/null @@ -1,22 +0,0 @@ -The MIT License (MIT) - -Copyright (c) 2015 Klaus Post - -Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to deal -in the Software without restriction, including without limitation the rights -to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the Software is -furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all -copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE -SOFTWARE. - diff --git a/vendor/github.com/klauspost/cpuid/README.md b/vendor/github.com/klauspost/cpuid/README.md deleted file mode 100644 index a7fb41fbe..000000000 --- a/vendor/github.com/klauspost/cpuid/README.md +++ /dev/null @@ -1,147 +0,0 @@ -# cpuid -Package cpuid provides information about the CPU running the current program. - -CPU features are detected on startup, and kept for fast access through the life of the application. -Currently x86 / x64 (AMD64) is supported, and no external C (cgo) code is used, which should make the library very easy to use. - -You can access the CPU information by accessing the shared CPU variable of the cpuid library. - -Package home: https://github.com/klauspost/cpuid - -[![GoDoc][1]][2] [![Build Status][3]][4] - -[1]: https://godoc.org/github.com/klauspost/cpuid?status.svg -[2]: https://godoc.org/github.com/klauspost/cpuid -[3]: https://travis-ci.org/klauspost/cpuid.svg -[4]: https://travis-ci.org/klauspost/cpuid - -# features -## CPU Instructions -* **CMOV** (i686 CMOV) -* **NX** (NX (No-Execute) bit) -* **AMD3DNOW** (AMD 3DNOW) -* **AMD3DNOWEXT** (AMD 3DNowExt) -* **MMX** (standard MMX) -* **MMXEXT** (SSE integer functions or AMD MMX ext) -* **SSE** (SSE functions) -* **SSE2** (P4 SSE functions) -* **SSE3** (Prescott SSE3 functions) -* **SSSE3** (Conroe SSSE3 functions) -* **SSE4** (Penryn SSE4.1 functions) -* **SSE4A** (AMD Barcelona microarchitecture SSE4a instructions) -* **SSE42** (Nehalem SSE4.2 functions) -* **AVX** (AVX functions) -* **AVX2** (AVX2 functions) -* **FMA3** (Intel FMA 3) -* **FMA4** (Bulldozer FMA4 functions) -* **XOP** (Bulldozer XOP functions) -* **F16C** (Half-precision floating-point conversion) -* **BMI1** (Bit Manipulation Instruction Set 1) -* **BMI2** (Bit Manipulation Instruction Set 2) -* **TBM** (AMD Trailing Bit Manipulation) -* **LZCNT** (LZCNT instruction) -* **POPCNT** (POPCNT instruction) -* **AESNI** (Advanced Encryption Standard New Instructions) -* **CLMUL** (Carry-less Multiplication) -* **HTT** (Hyperthreading (enabled)) -* **HLE** (Hardware Lock Elision) -* **RTM** (Restricted Transactional Memory) -* **RDRAND** (RDRAND instruction is available) -* **RDSEED** (RDSEED instruction is available) -* **ADX** (Intel ADX (Multi-Precision Add-Carry Instruction Extensions)) -* **SHA** (Intel SHA Extensions) -* **AVX512F** (AVX-512 Foundation) -* **AVX512DQ** (AVX-512 Doubleword and Quadword Instructions) -* **AVX512IFMA** (AVX-512 Integer Fused Multiply-Add Instructions) -* **AVX512PF** (AVX-512 Prefetch Instructions) -* **AVX512ER** (AVX-512 Exponential and Reciprocal Instructions) -* **AVX512CD** (AVX-512 Conflict Detection Instructions) -* **AVX512BW** (AVX-512 Byte and Word Instructions) -* **AVX512VL** (AVX-512 Vector Length Extensions) -* **AVX512VBMI** (AVX-512 Vector Bit Manipulation Instructions) -* **MPX** (Intel MPX (Memory Protection Extensions)) -* **ERMS** (Enhanced REP MOVSB/STOSB) -* **RDTSCP** (RDTSCP Instruction) -* **CX16** (CMPXCHG16B Instruction) -* **SGX** (Software Guard Extensions, with activation details) - -## Performance -* **RDTSCP()** Returns current cycle count. Can be used for benchmarking. -* **SSE2SLOW** (SSE2 is supported, but usually not faster) -* **SSE3SLOW** (SSE3 is supported, but usually not faster) -* **ATOM** (Atom processor, some SSSE3 instructions are slower) -* **Cache line** (Probable size of a cache line). -* **L1, L2, L3 Cache size** on newer Intel/AMD CPUs. - -## Cpu Vendor/VM -* **Intel** -* **AMD** -* **VIA** -* **Transmeta** -* **NSC** -* **KVM** (Kernel-based Virtual Machine) -* **MSVM** (Microsoft Hyper-V or Windows Virtual PC) -* **VMware** -* **XenHVM** -* **Bhyve** -* **Hygon** - -# installing - -```go get github.com/klauspost/cpuid``` - -# example - -```Go -package main - -import ( - "fmt" - "github.com/klauspost/cpuid" -) - -func main() { - // Print basic CPU information: - fmt.Println("Name:", cpuid.CPU.BrandName) - fmt.Println("PhysicalCores:", cpuid.CPU.PhysicalCores) - fmt.Println("ThreadsPerCore:", cpuid.CPU.ThreadsPerCore) - fmt.Println("LogicalCores:", cpuid.CPU.LogicalCores) - fmt.Println("Family", cpuid.CPU.Family, "Model:", cpuid.CPU.Model) - fmt.Println("Features:", cpuid.CPU.Features) - fmt.Println("Cacheline bytes:", cpuid.CPU.CacheLine) - fmt.Println("L1 Data Cache:", cpuid.CPU.Cache.L1D, "bytes") - fmt.Println("L1 Instruction Cache:", cpuid.CPU.Cache.L1D, "bytes") - fmt.Println("L2 Cache:", cpuid.CPU.Cache.L2, "bytes") - fmt.Println("L3 Cache:", cpuid.CPU.Cache.L3, "bytes") - - // Test if we have a specific feature: - if cpuid.CPU.SSE() { - fmt.Println("We have Streaming SIMD Extensions") - } -} -``` - -Sample output: -``` ->go run main.go -Name: Intel(R) Core(TM) i5-2540M CPU @ 2.60GHz -PhysicalCores: 2 -ThreadsPerCore: 2 -LogicalCores: 4 -Family 6 Model: 42 -Features: CMOV,MMX,MMXEXT,SSE,SSE2,SSE3,SSSE3,SSE4.1,SSE4.2,AVX,AESNI,CLMUL -Cacheline bytes: 64 -We have Streaming SIMD Extensions -``` - -# private package - -In the "private" folder you can find an autogenerated version of the library you can include in your own packages. - -For this purpose all exports are removed, and functions and constants are lowercased. - -This is not a recommended way of using the library, but provided for convenience, if it is difficult for you to use external packages. - -# license - -This code is published under an MIT license. See LICENSE file for more information. diff --git a/vendor/github.com/klauspost/cpuid/cpuid.go b/vendor/github.com/klauspost/cpuid/cpuid.go deleted file mode 100644 index db9591321..000000000 --- a/vendor/github.com/klauspost/cpuid/cpuid.go +++ /dev/null @@ -1,1049 +0,0 @@ -// Copyright (c) 2015 Klaus Post, released under MIT License. See LICENSE file. - -// Package cpuid provides information about the CPU running the current program. -// -// CPU features are detected on startup, and kept for fast access through the life of the application. -// Currently x86 / x64 (AMD64) is supported. -// -// You can access the CPU information by accessing the shared CPU variable of the cpuid library. -// -// Package home: https://github.com/klauspost/cpuid -package cpuid - -import "strings" - -// Vendor is a representation of a CPU vendor. -type Vendor int - -const ( - Other Vendor = iota - Intel - AMD - VIA - Transmeta - NSC - KVM // Kernel-based Virtual Machine - MSVM // Microsoft Hyper-V or Windows Virtual PC - VMware - XenHVM - Bhyve - Hygon -) - -const ( - CMOV = 1 << iota // i686 CMOV - NX // NX (No-Execute) bit - AMD3DNOW // AMD 3DNOW - AMD3DNOWEXT // AMD 3DNowExt - MMX // standard MMX - MMXEXT // SSE integer functions or AMD MMX ext - SSE // SSE functions - SSE2 // P4 SSE functions - SSE3 // Prescott SSE3 functions - SSSE3 // Conroe SSSE3 functions - SSE4 // Penryn SSE4.1 functions - SSE4A // AMD Barcelona microarchitecture SSE4a instructions - SSE42 // Nehalem SSE4.2 functions - AVX // AVX functions - AVX2 // AVX2 functions - FMA3 // Intel FMA 3 - FMA4 // Bulldozer FMA4 functions - XOP // Bulldozer XOP functions - F16C // Half-precision floating-point conversion - BMI1 // Bit Manipulation Instruction Set 1 - BMI2 // Bit Manipulation Instruction Set 2 - TBM // AMD Trailing Bit Manipulation - LZCNT // LZCNT instruction - POPCNT // POPCNT instruction - AESNI // Advanced Encryption Standard New Instructions - CLMUL // Carry-less Multiplication - HTT // Hyperthreading (enabled) - HLE // Hardware Lock Elision - RTM // Restricted Transactional Memory - RDRAND // RDRAND instruction is available - RDSEED // RDSEED instruction is available - ADX // Intel ADX (Multi-Precision Add-Carry Instruction Extensions) - SHA // Intel SHA Extensions - AVX512F // AVX-512 Foundation - AVX512DQ // AVX-512 Doubleword and Quadword Instructions - AVX512IFMA // AVX-512 Integer Fused Multiply-Add Instructions - AVX512PF // AVX-512 Prefetch Instructions - AVX512ER // AVX-512 Exponential and Reciprocal Instructions - AVX512CD // AVX-512 Conflict Detection Instructions - AVX512BW // AVX-512 Byte and Word Instructions - AVX512VL // AVX-512 Vector Length Extensions - AVX512VBMI // AVX-512 Vector Bit Manipulation Instructions - MPX // Intel MPX (Memory Protection Extensions) - ERMS // Enhanced REP MOVSB/STOSB - RDTSCP // RDTSCP Instruction - CX16 // CMPXCHG16B Instruction - SGX // Software Guard Extensions - IBPB // Indirect Branch Restricted Speculation (IBRS) and Indirect Branch Predictor Barrier (IBPB) - STIBP // Single Thread Indirect Branch Predictors - - // Performance indicators - SSE2SLOW // SSE2 is supported, but usually not faster - SSE3SLOW // SSE3 is supported, but usually not faster - ATOM // Atom processor, some SSSE3 instructions are slower -) - -var flagNames = map[Flags]string{ - CMOV: "CMOV", // i686 CMOV - NX: "NX", // NX (No-Execute) bit - AMD3DNOW: "AMD3DNOW", // AMD 3DNOW - AMD3DNOWEXT: "AMD3DNOWEXT", // AMD 3DNowExt - MMX: "MMX", // Standard MMX - MMXEXT: "MMXEXT", // SSE integer functions or AMD MMX ext - SSE: "SSE", // SSE functions - SSE2: "SSE2", // P4 SSE2 functions - SSE3: "SSE3", // Prescott SSE3 functions - SSSE3: "SSSE3", // Conroe SSSE3 functions - SSE4: "SSE4.1", // Penryn SSE4.1 functions - SSE4A: "SSE4A", // AMD Barcelona microarchitecture SSE4a instructions - SSE42: "SSE4.2", // Nehalem SSE4.2 functions - AVX: "AVX", // AVX functions - AVX2: "AVX2", // AVX functions - FMA3: "FMA3", // Intel FMA 3 - FMA4: "FMA4", // Bulldozer FMA4 functions - XOP: "XOP", // Bulldozer XOP functions - F16C: "F16C", // Half-precision floating-point conversion - BMI1: "BMI1", // Bit Manipulation Instruction Set 1 - BMI2: "BMI2", // Bit Manipulation Instruction Set 2 - TBM: "TBM", // AMD Trailing Bit Manipulation - LZCNT: "LZCNT", // LZCNT instruction - POPCNT: "POPCNT", // POPCNT instruction - AESNI: "AESNI", // Advanced Encryption Standard New Instructions - CLMUL: "CLMUL", // Carry-less Multiplication - HTT: "HTT", // Hyperthreading (enabled) - HLE: "HLE", // Hardware Lock Elision - RTM: "RTM", // Restricted Transactional Memory - RDRAND: "RDRAND", // RDRAND instruction is available - RDSEED: "RDSEED", // RDSEED instruction is available - ADX: "ADX", // Intel ADX (Multi-Precision Add-Carry Instruction Extensions) - SHA: "SHA", // Intel SHA Extensions - AVX512F: "AVX512F", // AVX-512 Foundation - AVX512DQ: "AVX512DQ", // AVX-512 Doubleword and Quadword Instructions - AVX512IFMA: "AVX512IFMA", // AVX-512 Integer Fused Multiply-Add Instructions - AVX512PF: "AVX512PF", // AVX-512 Prefetch Instructions - AVX512ER: "AVX512ER", // AVX-512 Exponential and Reciprocal Instructions - AVX512CD: "AVX512CD", // AVX-512 Conflict Detection Instructions - AVX512BW: "AVX512BW", // AVX-512 Byte and Word Instructions - AVX512VL: "AVX512VL", // AVX-512 Vector Length Extensions - AVX512VBMI: "AVX512VBMI", // AVX-512 Vector Bit Manipulation Instructions - MPX: "MPX", // Intel MPX (Memory Protection Extensions) - ERMS: "ERMS", // Enhanced REP MOVSB/STOSB - RDTSCP: "RDTSCP", // RDTSCP Instruction - CX16: "CX16", // CMPXCHG16B Instruction - SGX: "SGX", // Software Guard Extensions - IBPB: "IBPB", // Indirect Branch Restricted Speculation and Indirect Branch Predictor Barrier - STIBP: "STIBP", // Single Thread Indirect Branch Predictors - - // Performance indicators - SSE2SLOW: "SSE2SLOW", // SSE2 supported, but usually not faster - SSE3SLOW: "SSE3SLOW", // SSE3 supported, but usually not faster - ATOM: "ATOM", // Atom processor, some SSSE3 instructions are slower - -} - -// CPUInfo contains information about the detected system CPU. -type CPUInfo struct { - BrandName string // Brand name reported by the CPU - VendorID Vendor // Comparable CPU vendor ID - Features Flags // Features of the CPU - PhysicalCores int // Number of physical processor cores in your CPU. Will be 0 if undetectable. - ThreadsPerCore int // Number of threads per physical core. Will be 1 if undetectable. - LogicalCores int // Number of physical cores times threads that can run on each core through the use of hyperthreading. Will be 0 if undetectable. - Family int // CPU family number - Model int // CPU model number - CacheLine int // Cache line size in bytes. Will be 0 if undetectable. - Cache struct { - L1I int // L1 Instruction Cache (per core or shared). Will be -1 if undetected - L1D int // L1 Data Cache (per core or shared). Will be -1 if undetected - L2 int // L2 Cache (per core or shared). Will be -1 if undetected - L3 int // L3 Instruction Cache (per core or shared). Will be -1 if undetected - } - SGX SGXSupport - maxFunc uint32 - maxExFunc uint32 -} - -var cpuid func(op uint32) (eax, ebx, ecx, edx uint32) -var cpuidex func(op, op2 uint32) (eax, ebx, ecx, edx uint32) -var xgetbv func(index uint32) (eax, edx uint32) -var rdtscpAsm func() (eax, ebx, ecx, edx uint32) - -// CPU contains information about the CPU as detected on startup, -// or when Detect last was called. -// -// Use this as the primary entry point to you data, -// this way queries are -var CPU CPUInfo - -func init() { - initCPU() - Detect() -} - -// Detect will re-detect current CPU info. -// This will replace the content of the exported CPU variable. -// -// Unless you expect the CPU to change while you are running your program -// you should not need to call this function. -// If you call this, you must ensure that no other goroutine is accessing the -// exported CPU variable. -func Detect() { - CPU.maxFunc = maxFunctionID() - CPU.maxExFunc = maxExtendedFunction() - CPU.BrandName = brandName() - CPU.CacheLine = cacheLine() - CPU.Family, CPU.Model = familyModel() - CPU.Features = support() - CPU.SGX = hasSGX(CPU.Features&SGX != 0) - CPU.ThreadsPerCore = threadsPerCore() - CPU.LogicalCores = logicalCores() - CPU.PhysicalCores = physicalCores() - CPU.VendorID = vendorID() - CPU.cacheSize() -} - -// Generated here: http://play.golang.org/p/BxFH2Gdc0G - -// Cmov indicates support of CMOV instructions -func (c CPUInfo) Cmov() bool { - return c.Features&CMOV != 0 -} - -// Amd3dnow indicates support of AMD 3DNOW! instructions -func (c CPUInfo) Amd3dnow() bool { - return c.Features&AMD3DNOW != 0 -} - -// Amd3dnowExt indicates support of AMD 3DNOW! Extended instructions -func (c CPUInfo) Amd3dnowExt() bool { - return c.Features&AMD3DNOWEXT != 0 -} - -// MMX indicates support of MMX instructions -func (c CPUInfo) MMX() bool { - return c.Features&MMX != 0 -} - -// MMXExt indicates support of MMXEXT instructions -// (SSE integer functions or AMD MMX ext) -func (c CPUInfo) MMXExt() bool { - return c.Features&MMXEXT != 0 -} - -// SSE indicates support of SSE instructions -func (c CPUInfo) SSE() bool { - return c.Features&SSE != 0 -} - -// SSE2 indicates support of SSE 2 instructions -func (c CPUInfo) SSE2() bool { - return c.Features&SSE2 != 0 -} - -// SSE3 indicates support of SSE 3 instructions -func (c CPUInfo) SSE3() bool { - return c.Features&SSE3 != 0 -} - -// SSSE3 indicates support of SSSE 3 instructions -func (c CPUInfo) SSSE3() bool { - return c.Features&SSSE3 != 0 -} - -// SSE4 indicates support of SSE 4 (also called SSE 4.1) instructions -func (c CPUInfo) SSE4() bool { - return c.Features&SSE4 != 0 -} - -// SSE42 indicates support of SSE4.2 instructions -func (c CPUInfo) SSE42() bool { - return c.Features&SSE42 != 0 -} - -// AVX indicates support of AVX instructions -// and operating system support of AVX instructions -func (c CPUInfo) AVX() bool { - return c.Features&AVX != 0 -} - -// AVX2 indicates support of AVX2 instructions -func (c CPUInfo) AVX2() bool { - return c.Features&AVX2 != 0 -} - -// FMA3 indicates support of FMA3 instructions -func (c CPUInfo) FMA3() bool { - return c.Features&FMA3 != 0 -} - -// FMA4 indicates support of FMA4 instructions -func (c CPUInfo) FMA4() bool { - return c.Features&FMA4 != 0 -} - -// XOP indicates support of XOP instructions -func (c CPUInfo) XOP() bool { - return c.Features&XOP != 0 -} - -// F16C indicates support of F16C instructions -func (c CPUInfo) F16C() bool { - return c.Features&F16C != 0 -} - -// BMI1 indicates support of BMI1 instructions -func (c CPUInfo) BMI1() bool { - return c.Features&BMI1 != 0 -} - -// BMI2 indicates support of BMI2 instructions -func (c CPUInfo) BMI2() bool { - return c.Features&BMI2 != 0 -} - -// TBM indicates support of TBM instructions -// (AMD Trailing Bit Manipulation) -func (c CPUInfo) TBM() bool { - return c.Features&TBM != 0 -} - -// Lzcnt indicates support of LZCNT instruction -func (c CPUInfo) Lzcnt() bool { - return c.Features&LZCNT != 0 -} - -// Popcnt indicates support of POPCNT instruction -func (c CPUInfo) Popcnt() bool { - return c.Features&POPCNT != 0 -} - -// HTT indicates the processor has Hyperthreading enabled -func (c CPUInfo) HTT() bool { - return c.Features&HTT != 0 -} - -// SSE2Slow indicates that SSE2 may be slow on this processor -func (c CPUInfo) SSE2Slow() bool { - return c.Features&SSE2SLOW != 0 -} - -// SSE3Slow indicates that SSE3 may be slow on this processor -func (c CPUInfo) SSE3Slow() bool { - return c.Features&SSE3SLOW != 0 -} - -// AesNi indicates support of AES-NI instructions -// (Advanced Encryption Standard New Instructions) -func (c CPUInfo) AesNi() bool { - return c.Features&AESNI != 0 -} - -// Clmul indicates support of CLMUL instructions -// (Carry-less Multiplication) -func (c CPUInfo) Clmul() bool { - return c.Features&CLMUL != 0 -} - -// NX indicates support of NX (No-Execute) bit -func (c CPUInfo) NX() bool { - return c.Features&NX != 0 -} - -// SSE4A indicates support of AMD Barcelona microarchitecture SSE4a instructions -func (c CPUInfo) SSE4A() bool { - return c.Features&SSE4A != 0 -} - -// HLE indicates support of Hardware Lock Elision -func (c CPUInfo) HLE() bool { - return c.Features&HLE != 0 -} - -// RTM indicates support of Restricted Transactional Memory -func (c CPUInfo) RTM() bool { - return c.Features&RTM != 0 -} - -// Rdrand indicates support of RDRAND instruction is available -func (c CPUInfo) Rdrand() bool { - return c.Features&RDRAND != 0 -} - -// Rdseed indicates support of RDSEED instruction is available -func (c CPUInfo) Rdseed() bool { - return c.Features&RDSEED != 0 -} - -// ADX indicates support of Intel ADX (Multi-Precision Add-Carry Instruction Extensions) -func (c CPUInfo) ADX() bool { - return c.Features&ADX != 0 -} - -// SHA indicates support of Intel SHA Extensions -func (c CPUInfo) SHA() bool { - return c.Features&SHA != 0 -} - -// AVX512F indicates support of AVX-512 Foundation -func (c CPUInfo) AVX512F() bool { - return c.Features&AVX512F != 0 -} - -// AVX512DQ indicates support of AVX-512 Doubleword and Quadword Instructions -func (c CPUInfo) AVX512DQ() bool { - return c.Features&AVX512DQ != 0 -} - -// AVX512IFMA indicates support of AVX-512 Integer Fused Multiply-Add Instructions -func (c CPUInfo) AVX512IFMA() bool { - return c.Features&AVX512IFMA != 0 -} - -// AVX512PF indicates support of AVX-512 Prefetch Instructions -func (c CPUInfo) AVX512PF() bool { - return c.Features&AVX512PF != 0 -} - -// AVX512ER indicates support of AVX-512 Exponential and Reciprocal Instructions -func (c CPUInfo) AVX512ER() bool { - return c.Features&AVX512ER != 0 -} - -// AVX512CD indicates support of AVX-512 Conflict Detection Instructions -func (c CPUInfo) AVX512CD() bool { - return c.Features&AVX512CD != 0 -} - -// AVX512BW indicates support of AVX-512 Byte and Word Instructions -func (c CPUInfo) AVX512BW() bool { - return c.Features&AVX512BW != 0 -} - -// AVX512VL indicates support of AVX-512 Vector Length Extensions -func (c CPUInfo) AVX512VL() bool { - return c.Features&AVX512VL != 0 -} - -// AVX512VBMI indicates support of AVX-512 Vector Bit Manipulation Instructions -func (c CPUInfo) AVX512VBMI() bool { - return c.Features&AVX512VBMI != 0 -} - -// MPX indicates support of Intel MPX (Memory Protection Extensions) -func (c CPUInfo) MPX() bool { - return c.Features&MPX != 0 -} - -// ERMS indicates support of Enhanced REP MOVSB/STOSB -func (c CPUInfo) ERMS() bool { - return c.Features&ERMS != 0 -} - -// RDTSCP Instruction is available. -func (c CPUInfo) RDTSCP() bool { - return c.Features&RDTSCP != 0 -} - -// CX16 indicates if CMPXCHG16B instruction is available. -func (c CPUInfo) CX16() bool { - return c.Features&CX16 != 0 -} - -// TSX is split into HLE (Hardware Lock Elision) and RTM (Restricted Transactional Memory) detection. -// So TSX simply checks that. -func (c CPUInfo) TSX() bool { - return c.Features&(HLE|RTM) == HLE|RTM -} - -// Atom indicates an Atom processor -func (c CPUInfo) Atom() bool { - return c.Features&ATOM != 0 -} - -// Intel returns true if vendor is recognized as Intel -func (c CPUInfo) Intel() bool { - return c.VendorID == Intel -} - -// AMD returns true if vendor is recognized as AMD -func (c CPUInfo) AMD() bool { - return c.VendorID == AMD -} - -// Hygon returns true if vendor is recognized as Hygon -func (c CPUInfo) Hygon() bool { - return c.VendorID == Hygon -} - -// Transmeta returns true if vendor is recognized as Transmeta -func (c CPUInfo) Transmeta() bool { - return c.VendorID == Transmeta -} - -// NSC returns true if vendor is recognized as National Semiconductor -func (c CPUInfo) NSC() bool { - return c.VendorID == NSC -} - -// VIA returns true if vendor is recognized as VIA -func (c CPUInfo) VIA() bool { - return c.VendorID == VIA -} - -// RTCounter returns the 64-bit time-stamp counter -// Uses the RDTSCP instruction. The value 0 is returned -// if the CPU does not support the instruction. -func (c CPUInfo) RTCounter() uint64 { - if !c.RDTSCP() { - return 0 - } - a, _, _, d := rdtscpAsm() - return uint64(a) | (uint64(d) << 32) -} - -// Ia32TscAux returns the IA32_TSC_AUX part of the RDTSCP. -// This variable is OS dependent, but on Linux contains information -// about the current cpu/core the code is running on. -// If the RDTSCP instruction isn't supported on the CPU, the value 0 is returned. -func (c CPUInfo) Ia32TscAux() uint32 { - if !c.RDTSCP() { - return 0 - } - _, _, ecx, _ := rdtscpAsm() - return ecx -} - -// LogicalCPU will return the Logical CPU the code is currently executing on. -// This is likely to change when the OS re-schedules the running thread -// to another CPU. -// If the current core cannot be detected, -1 will be returned. -func (c CPUInfo) LogicalCPU() int { - if c.maxFunc < 1 { - return -1 - } - _, ebx, _, _ := cpuid(1) - return int(ebx >> 24) -} - -// VM Will return true if the cpu id indicates we are in -// a virtual machine. This is only a hint, and will very likely -// have many false negatives. -func (c CPUInfo) VM() bool { - switch c.VendorID { - case MSVM, KVM, VMware, XenHVM, Bhyve: - return true - } - return false -} - -// Flags contains detected cpu features and caracteristics -type Flags uint64 - -// String returns a string representation of the detected -// CPU features. -func (f Flags) String() string { - return strings.Join(f.Strings(), ",") -} - -// Strings returns and array of the detected features. -func (f Flags) Strings() []string { - s := support() - r := make([]string, 0, 20) - for i := uint(0); i < 64; i++ { - key := Flags(1 << i) - val := flagNames[key] - if s&key != 0 { - r = append(r, val) - } - } - return r -} - -func maxExtendedFunction() uint32 { - eax, _, _, _ := cpuid(0x80000000) - return eax -} - -func maxFunctionID() uint32 { - a, _, _, _ := cpuid(0) - return a -} - -func brandName() string { - if maxExtendedFunction() >= 0x80000004 { - v := make([]uint32, 0, 48) - for i := uint32(0); i < 3; i++ { - a, b, c, d := cpuid(0x80000002 + i) - v = append(v, a, b, c, d) - } - return strings.Trim(string(valAsString(v...)), " ") - } - return "unknown" -} - -func threadsPerCore() int { - mfi := maxFunctionID() - if mfi < 0x4 || vendorID() != Intel { - return 1 - } - - if mfi < 0xb { - _, b, _, d := cpuid(1) - if (d & (1 << 28)) != 0 { - // v will contain logical core count - v := (b >> 16) & 255 - if v > 1 { - a4, _, _, _ := cpuid(4) - // physical cores - v2 := (a4 >> 26) + 1 - if v2 > 0 { - return int(v) / int(v2) - } - } - } - return 1 - } - _, b, _, _ := cpuidex(0xb, 0) - if b&0xffff == 0 { - return 1 - } - return int(b & 0xffff) -} - -func logicalCores() int { - mfi := maxFunctionID() - switch vendorID() { - case Intel: - // Use this on old Intel processors - if mfi < 0xb { - if mfi < 1 { - return 0 - } - // CPUID.1:EBX[23:16] represents the maximum number of addressable IDs (initial APIC ID) - // that can be assigned to logical processors in a physical package. - // The value may not be the same as the number of logical processors that are present in the hardware of a physical package. - _, ebx, _, _ := cpuid(1) - logical := (ebx >> 16) & 0xff - return int(logical) - } - _, b, _, _ := cpuidex(0xb, 1) - return int(b & 0xffff) - case AMD, Hygon: - _, b, _, _ := cpuid(1) - return int((b >> 16) & 0xff) - default: - return 0 - } -} - -func familyModel() (int, int) { - if maxFunctionID() < 0x1 { - return 0, 0 - } - eax, _, _, _ := cpuid(1) - family := ((eax >> 8) & 0xf) + ((eax >> 20) & 0xff) - model := ((eax >> 4) & 0xf) + ((eax >> 12) & 0xf0) - return int(family), int(model) -} - -func physicalCores() int { - switch vendorID() { - case Intel: - return logicalCores() / threadsPerCore() - case AMD, Hygon: - if maxExtendedFunction() >= 0x80000008 { - _, _, c, _ := cpuid(0x80000008) - return int(c&0xff) + 1 - } - } - return 0 -} - -// Except from http://en.wikipedia.org/wiki/CPUID#EAX.3D0:_Get_vendor_ID -var vendorMapping = map[string]Vendor{ - "AMDisbetter!": AMD, - "AuthenticAMD": AMD, - "CentaurHauls": VIA, - "GenuineIntel": Intel, - "TransmetaCPU": Transmeta, - "GenuineTMx86": Transmeta, - "Geode by NSC": NSC, - "VIA VIA VIA ": VIA, - "KVMKVMKVMKVM": KVM, - "Microsoft Hv": MSVM, - "VMwareVMware": VMware, - "XenVMMXenVMM": XenHVM, - "bhyve bhyve ": Bhyve, - "HygonGenuine": Hygon, -} - -func vendorID() Vendor { - _, b, c, d := cpuid(0) - v := valAsString(b, d, c) - vend, ok := vendorMapping[string(v)] - if !ok { - return Other - } - return vend -} - -func cacheLine() int { - if maxFunctionID() < 0x1 { - return 0 - } - - _, ebx, _, _ := cpuid(1) - cache := (ebx & 0xff00) >> 5 // cflush size - if cache == 0 && maxExtendedFunction() >= 0x80000006 { - _, _, ecx, _ := cpuid(0x80000006) - cache = ecx & 0xff // cacheline size - } - // TODO: Read from Cache and TLB Information - return int(cache) -} - -func (c *CPUInfo) cacheSize() { - c.Cache.L1D = -1 - c.Cache.L1I = -1 - c.Cache.L2 = -1 - c.Cache.L3 = -1 - vendor := vendorID() - switch vendor { - case Intel: - if maxFunctionID() < 4 { - return - } - for i := uint32(0); ; i++ { - eax, ebx, ecx, _ := cpuidex(4, i) - cacheType := eax & 15 - if cacheType == 0 { - break - } - cacheLevel := (eax >> 5) & 7 - coherency := int(ebx&0xfff) + 1 - partitions := int((ebx>>12)&0x3ff) + 1 - associativity := int((ebx>>22)&0x3ff) + 1 - sets := int(ecx) + 1 - size := associativity * partitions * coherency * sets - switch cacheLevel { - case 1: - if cacheType == 1 { - // 1 = Data Cache - c.Cache.L1D = size - } else if cacheType == 2 { - // 2 = Instruction Cache - c.Cache.L1I = size - } else { - if c.Cache.L1D < 0 { - c.Cache.L1I = size - } - if c.Cache.L1I < 0 { - c.Cache.L1I = size - } - } - case 2: - c.Cache.L2 = size - case 3: - c.Cache.L3 = size - } - } - case AMD, Hygon: - // Untested. - if maxExtendedFunction() < 0x80000005 { - return - } - _, _, ecx, edx := cpuid(0x80000005) - c.Cache.L1D = int(((ecx >> 24) & 0xFF) * 1024) - c.Cache.L1I = int(((edx >> 24) & 0xFF) * 1024) - - if maxExtendedFunction() < 0x80000006 { - return - } - _, _, ecx, _ = cpuid(0x80000006) - c.Cache.L2 = int(((ecx >> 16) & 0xFFFF) * 1024) - } - - return -} - -type SGXSupport struct { - Available bool - SGX1Supported bool - SGX2Supported bool - MaxEnclaveSizeNot64 int64 - MaxEnclaveSize64 int64 -} - -func hasSGX(available bool) (rval SGXSupport) { - rval.Available = available - - if !available { - return - } - - a, _, _, d := cpuidex(0x12, 0) - rval.SGX1Supported = a&0x01 != 0 - rval.SGX2Supported = a&0x02 != 0 - rval.MaxEnclaveSizeNot64 = 1 << (d & 0xFF) // pow 2 - rval.MaxEnclaveSize64 = 1 << ((d >> 8) & 0xFF) // pow 2 - - return -} - -func support() Flags { - mfi := maxFunctionID() - vend := vendorID() - if mfi < 0x1 { - return 0 - } - rval := uint64(0) - _, _, c, d := cpuid(1) - if (d & (1 << 15)) != 0 { - rval |= CMOV - } - if (d & (1 << 23)) != 0 { - rval |= MMX - } - if (d & (1 << 25)) != 0 { - rval |= MMXEXT - } - if (d & (1 << 25)) != 0 { - rval |= SSE - } - if (d & (1 << 26)) != 0 { - rval |= SSE2 - } - if (c & 1) != 0 { - rval |= SSE3 - } - if (c & 0x00000200) != 0 { - rval |= SSSE3 - } - if (c & 0x00080000) != 0 { - rval |= SSE4 - } - if (c & 0x00100000) != 0 { - rval |= SSE42 - } - if (c & (1 << 25)) != 0 { - rval |= AESNI - } - if (c & (1 << 1)) != 0 { - rval |= CLMUL - } - if c&(1<<23) != 0 { - rval |= POPCNT - } - if c&(1<<30) != 0 { - rval |= RDRAND - } - if c&(1<<29) != 0 { - rval |= F16C - } - if c&(1<<13) != 0 { - rval |= CX16 - } - if vend == Intel && (d&(1<<28)) != 0 && mfi >= 4 { - if threadsPerCore() > 1 { - rval |= HTT - } - } - - // Check XGETBV, OXSAVE and AVX bits - if c&(1<<26) != 0 && c&(1<<27) != 0 && c&(1<<28) != 0 { - // Check for OS support - eax, _ := xgetbv(0) - if (eax & 0x6) == 0x6 { - rval |= AVX - if (c & 0x00001000) != 0 { - rval |= FMA3 - } - } - } - - // Check AVX2, AVX2 requires OS support, but BMI1/2 don't. - if mfi >= 7 { - _, ebx, ecx, edx := cpuidex(7, 0) - if (rval&AVX) != 0 && (ebx&0x00000020) != 0 { - rval |= AVX2 - } - if (ebx & 0x00000008) != 0 { - rval |= BMI1 - if (ebx & 0x00000100) != 0 { - rval |= BMI2 - } - } - if ebx&(1<<2) != 0 { - rval |= SGX - } - if ebx&(1<<4) != 0 { - rval |= HLE - } - if ebx&(1<<9) != 0 { - rval |= ERMS - } - if ebx&(1<<11) != 0 { - rval |= RTM - } - if ebx&(1<<14) != 0 { - rval |= MPX - } - if ebx&(1<<18) != 0 { - rval |= RDSEED - } - if ebx&(1<<19) != 0 { - rval |= ADX - } - if ebx&(1<<29) != 0 { - rval |= SHA - } - if edx&(1<<26) != 0 { - rval |= IBPB - } - if edx&(1<<27) != 0 { - rval |= STIBP - } - - // Only detect AVX-512 features if XGETBV is supported - if c&((1<<26)|(1<<27)) == (1<<26)|(1<<27) { - // Check for OS support - eax, _ := xgetbv(0) - - // Verify that XCR0[7:5] = ‘111b’ (OPMASK state, upper 256-bit of ZMM0-ZMM15 and - // ZMM16-ZMM31 state are enabled by OS) - /// and that XCR0[2:1] = ‘11b’ (XMM state and YMM state are enabled by OS). - if (eax>>5)&7 == 7 && (eax>>1)&3 == 3 { - if ebx&(1<<16) != 0 { - rval |= AVX512F - } - if ebx&(1<<17) != 0 { - rval |= AVX512DQ - } - if ebx&(1<<21) != 0 { - rval |= AVX512IFMA - } - if ebx&(1<<26) != 0 { - rval |= AVX512PF - } - if ebx&(1<<27) != 0 { - rval |= AVX512ER - } - if ebx&(1<<28) != 0 { - rval |= AVX512CD - } - if ebx&(1<<30) != 0 { - rval |= AVX512BW - } - if ebx&(1<<31) != 0 { - rval |= AVX512VL - } - // ecx - if ecx&(1<<1) != 0 { - rval |= AVX512VBMI - } - } - } - } - - if maxExtendedFunction() >= 0x80000001 { - _, _, c, d := cpuid(0x80000001) - if (c & (1 << 5)) != 0 { - rval |= LZCNT - rval |= POPCNT - } - if (d & (1 << 31)) != 0 { - rval |= AMD3DNOW - } - if (d & (1 << 30)) != 0 { - rval |= AMD3DNOWEXT - } - if (d & (1 << 23)) != 0 { - rval |= MMX - } - if (d & (1 << 22)) != 0 { - rval |= MMXEXT - } - if (c & (1 << 6)) != 0 { - rval |= SSE4A - } - if d&(1<<20) != 0 { - rval |= NX - } - if d&(1<<27) != 0 { - rval |= RDTSCP - } - - /* Allow for selectively disabling SSE2 functions on AMD processors - with SSE2 support but not SSE4a. This includes Athlon64, some - Opteron, and some Sempron processors. MMX, SSE, or 3DNow! are faster - than SSE2 often enough to utilize this special-case flag. - AV_CPU_FLAG_SSE2 and AV_CPU_FLAG_SSE2SLOW are both set in this case - so that SSE2 is used unless explicitly disabled by checking - AV_CPU_FLAG_SSE2SLOW. */ - if vendorID() != Intel && - rval&SSE2 != 0 && (c&0x00000040) == 0 { - rval |= SSE2SLOW - } - - /* XOP and FMA4 use the AVX instruction coding scheme, so they can't be - * used unless the OS has AVX support. */ - if (rval & AVX) != 0 { - if (c & 0x00000800) != 0 { - rval |= XOP - } - if (c & 0x00010000) != 0 { - rval |= FMA4 - } - } - - if vendorID() == Intel { - family, model := familyModel() - if family == 6 && (model == 9 || model == 13 || model == 14) { - /* 6/9 (pentium-m "banias"), 6/13 (pentium-m "dothan"), and - * 6/14 (core1 "yonah") theoretically support sse2, but it's - * usually slower than mmx. */ - if (rval & SSE2) != 0 { - rval |= SSE2SLOW - } - if (rval & SSE3) != 0 { - rval |= SSE3SLOW - } - } - /* The Atom processor has SSSE3 support, which is useful in many cases, - * but sometimes the SSSE3 version is slower than the SSE2 equivalent - * on the Atom, but is generally faster on other processors supporting - * SSSE3. This flag allows for selectively disabling certain SSSE3 - * functions on the Atom. */ - if family == 6 && model == 28 { - rval |= ATOM - } - } - } - return Flags(rval) -} - -func valAsString(values ...uint32) []byte { - r := make([]byte, 4*len(values)) - for i, v := range values { - dst := r[i*4:] - dst[0] = byte(v & 0xff) - dst[1] = byte((v >> 8) & 0xff) - dst[2] = byte((v >> 16) & 0xff) - dst[3] = byte((v >> 24) & 0xff) - switch { - case dst[0] == 0: - return r[:i*4] - case dst[1] == 0: - return r[:i*4+1] - case dst[2] == 0: - return r[:i*4+2] - case dst[3] == 0: - return r[:i*4+3] - } - } - return r -} diff --git a/vendor/github.com/klauspost/cpuid/cpuid_386.s b/vendor/github.com/klauspost/cpuid/cpuid_386.s deleted file mode 100644 index 4d731711e..000000000 --- a/vendor/github.com/klauspost/cpuid/cpuid_386.s +++ /dev/null @@ -1,42 +0,0 @@ -// Copyright (c) 2015 Klaus Post, released under MIT License. See LICENSE file. - -// +build 386,!gccgo - -// func asmCpuid(op uint32) (eax, ebx, ecx, edx uint32) -TEXT ·asmCpuid(SB), 7, $0 - XORL CX, CX - MOVL op+0(FP), AX - CPUID - MOVL AX, eax+4(FP) - MOVL BX, ebx+8(FP) - MOVL CX, ecx+12(FP) - MOVL DX, edx+16(FP) - RET - -// func asmCpuidex(op, op2 uint32) (eax, ebx, ecx, edx uint32) -TEXT ·asmCpuidex(SB), 7, $0 - MOVL op+0(FP), AX - MOVL op2+4(FP), CX - CPUID - MOVL AX, eax+8(FP) - MOVL BX, ebx+12(FP) - MOVL CX, ecx+16(FP) - MOVL DX, edx+20(FP) - RET - -// func xgetbv(index uint32) (eax, edx uint32) -TEXT ·asmXgetbv(SB), 7, $0 - MOVL index+0(FP), CX - BYTE $0x0f; BYTE $0x01; BYTE $0xd0 // XGETBV - MOVL AX, eax+4(FP) - MOVL DX, edx+8(FP) - RET - -// func asmRdtscpAsm() (eax, ebx, ecx, edx uint32) -TEXT ·asmRdtscpAsm(SB), 7, $0 - BYTE $0x0F; BYTE $0x01; BYTE $0xF9 // RDTSCP - MOVL AX, eax+0(FP) - MOVL BX, ebx+4(FP) - MOVL CX, ecx+8(FP) - MOVL DX, edx+12(FP) - RET diff --git a/vendor/github.com/klauspost/cpuid/cpuid_amd64.s b/vendor/github.com/klauspost/cpuid/cpuid_amd64.s deleted file mode 100644 index 3c1d60e42..000000000 --- a/vendor/github.com/klauspost/cpuid/cpuid_amd64.s +++ /dev/null @@ -1,42 +0,0 @@ -// Copyright (c) 2015 Klaus Post, released under MIT License. See LICENSE file. - -//+build amd64,!gccgo - -// func asmCpuid(op uint32) (eax, ebx, ecx, edx uint32) -TEXT ·asmCpuid(SB), 7, $0 - XORQ CX, CX - MOVL op+0(FP), AX - CPUID - MOVL AX, eax+8(FP) - MOVL BX, ebx+12(FP) - MOVL CX, ecx+16(FP) - MOVL DX, edx+20(FP) - RET - -// func asmCpuidex(op, op2 uint32) (eax, ebx, ecx, edx uint32) -TEXT ·asmCpuidex(SB), 7, $0 - MOVL op+0(FP), AX - MOVL op2+4(FP), CX - CPUID - MOVL AX, eax+8(FP) - MOVL BX, ebx+12(FP) - MOVL CX, ecx+16(FP) - MOVL DX, edx+20(FP) - RET - -// func asmXgetbv(index uint32) (eax, edx uint32) -TEXT ·asmXgetbv(SB), 7, $0 - MOVL index+0(FP), CX - BYTE $0x0f; BYTE $0x01; BYTE $0xd0 // XGETBV - MOVL AX, eax+8(FP) - MOVL DX, edx+12(FP) - RET - -// func asmRdtscpAsm() (eax, ebx, ecx, edx uint32) -TEXT ·asmRdtscpAsm(SB), 7, $0 - BYTE $0x0F; BYTE $0x01; BYTE $0xF9 // RDTSCP - MOVL AX, eax+0(FP) - MOVL BX, ebx+4(FP) - MOVL CX, ecx+8(FP) - MOVL DX, edx+12(FP) - RET diff --git a/vendor/github.com/klauspost/cpuid/detect_intel.go b/vendor/github.com/klauspost/cpuid/detect_intel.go deleted file mode 100644 index a5f04dd6d..000000000 --- a/vendor/github.com/klauspost/cpuid/detect_intel.go +++ /dev/null @@ -1,17 +0,0 @@ -// Copyright (c) 2015 Klaus Post, released under MIT License. See LICENSE file. - -// +build 386,!gccgo amd64,!gccgo - -package cpuid - -func asmCpuid(op uint32) (eax, ebx, ecx, edx uint32) -func asmCpuidex(op, op2 uint32) (eax, ebx, ecx, edx uint32) -func asmXgetbv(index uint32) (eax, edx uint32) -func asmRdtscpAsm() (eax, ebx, ecx, edx uint32) - -func initCPU() { - cpuid = asmCpuid - cpuidex = asmCpuidex - xgetbv = asmXgetbv - rdtscpAsm = asmRdtscpAsm -} diff --git a/vendor/github.com/klauspost/cpuid/detect_ref.go b/vendor/github.com/klauspost/cpuid/detect_ref.go deleted file mode 100644 index 909c5d9a7..000000000 --- a/vendor/github.com/klauspost/cpuid/detect_ref.go +++ /dev/null @@ -1,23 +0,0 @@ -// Copyright (c) 2015 Klaus Post, released under MIT License. See LICENSE file. - -// +build !amd64,!386 gccgo - -package cpuid - -func initCPU() { - cpuid = func(op uint32) (eax, ebx, ecx, edx uint32) { - return 0, 0, 0, 0 - } - - cpuidex = func(op, op2 uint32) (eax, ebx, ecx, edx uint32) { - return 0, 0, 0, 0 - } - - xgetbv = func(index uint32) (eax, edx uint32) { - return 0, 0 - } - - rdtscpAsm = func() (eax, ebx, ecx, edx uint32) { - return 0, 0, 0, 0 - } -} diff --git a/vendor/github.com/klauspost/cpuid/generate.go b/vendor/github.com/klauspost/cpuid/generate.go deleted file mode 100644 index 90e7a98d2..000000000 --- a/vendor/github.com/klauspost/cpuid/generate.go +++ /dev/null @@ -1,4 +0,0 @@ -package cpuid - -//go:generate go run private-gen.go -//go:generate gofmt -w ./private diff --git a/vendor/github.com/opencontainers/runc/libcontainer/apparmor/apparmor.go b/vendor/github.com/opencontainers/runc/libcontainer/apparmor/apparmor.go index 7fff0627f..debfc1e48 100644 --- a/vendor/github.com/opencontainers/runc/libcontainer/apparmor/apparmor.go +++ b/vendor/github.com/opencontainers/runc/libcontainer/apparmor/apparmor.go @@ -6,6 +6,8 @@ import ( "fmt" "io/ioutil" "os" + + "github.com/opencontainers/runc/libcontainer/utils" ) // IsEnabled returns true if apparmor is enabled for the host. @@ -19,7 +21,7 @@ func IsEnabled() bool { return false } -func setprocattr(attr, value string) error { +func setProcAttr(attr, value string) error { // Under AppArmor you can only change your own attr, so use /proc/self/ // instead of /proc/<tid>/ like libapparmor does path := fmt.Sprintf("/proc/self/attr/%s", attr) @@ -30,6 +32,10 @@ func setprocattr(attr, value string) error { } defer f.Close() + if err := utils.EnsureProcHandle(f); err != nil { + return err + } + _, err = fmt.Fprintf(f, "%s", value) return err } @@ -37,7 +43,7 @@ func setprocattr(attr, value string) error { // changeOnExec reimplements aa_change_onexec from libapparmor in Go func changeOnExec(name string) error { value := "exec " + name - if err := setprocattr("exec", value); err != nil { + if err := setProcAttr("exec", value); err != nil { return fmt.Errorf("apparmor failed to apply profile: %s", err) } return nil diff --git a/vendor/github.com/opencontainers/runc/libcontainer/cgroups/utils.go b/vendor/github.com/opencontainers/runc/libcontainer/cgroups/utils.go index ec79ae767..60790f83b 100644 --- a/vendor/github.com/opencontainers/runc/libcontainer/cgroups/utils.go +++ b/vendor/github.com/opencontainers/runc/libcontainer/cgroups/utils.go @@ -11,6 +11,8 @@ import ( "path/filepath" "strconv" "strings" + "sync" + "syscall" "time" units "github.com/docker/go-units" @@ -22,6 +24,11 @@ const ( CgroupProcesses = "cgroup.procs" ) +var ( + isUnifiedOnce sync.Once + isUnified bool +) + // HugePageSizeUnitList is a list of the units used by the linux kernel when // naming the HugePage control files. // https://www.kernel.org/doc/Documentation/cgroup-v1/hugetlb.txt @@ -29,6 +36,18 @@ const ( // depends on https://github.com/docker/go-units/commit/a09cd47f892041a4fac473133d181f5aea6fa393 var HugePageSizeUnitList = []string{"B", "KB", "MB", "GB", "TB", "PB"} +// IsCgroup2UnifiedMode returns whether we are running in cgroup v2 unified mode. +func IsCgroup2UnifiedMode() bool { + isUnifiedOnce.Do(func() { + var st syscall.Statfs_t + if err := syscall.Statfs("/sys/fs/cgroup", &st); err != nil { + panic("cannot statfs cgroup root") + } + isUnified = st.Type == unix.CGROUP2_SUPER_MAGIC + }) + return isUnified +} + // https://www.kernel.org/doc/Documentation/cgroup-v1/cgroups.txt func FindCgroupMountpoint(cgroupPath, subsystem string) (string, error) { mnt, _, err := FindCgroupMountpointAndRoot(cgroupPath, subsystem) @@ -49,6 +68,10 @@ func FindCgroupMountpointAndRoot(cgroupPath, subsystem string) (string, string, } defer f.Close() + if IsCgroup2UnifiedMode() { + subsystem = "" + } + return findCgroupMountpointAndRootFromReader(f, cgroupPath, subsystem) } @@ -57,12 +80,12 @@ func findCgroupMountpointAndRootFromReader(reader io.Reader, cgroupPath, subsyst for scanner.Scan() { txt := scanner.Text() fields := strings.Fields(txt) - if len(fields) < 5 { + if len(fields) < 9 { continue } if strings.HasPrefix(fields[4], cgroupPath) { for _, opt := range strings.Split(fields[len(fields)-1], ",") { - if opt == subsystem { + if (subsystem == "" && fields[9] == "cgroup2") || opt == subsystem { return fields[4], fields[3], nil } } @@ -76,6 +99,19 @@ func findCgroupMountpointAndRootFromReader(reader io.Reader, cgroupPath, subsyst } func isSubsystemAvailable(subsystem string) bool { + if IsCgroup2UnifiedMode() { + controllers, err := GetAllSubsystems() + if err != nil { + return false + } + for _, c := range controllers { + if c == subsystem { + return true + } + } + return false + } + cgroups, err := ParseCgroupFile("/proc/self/cgroup") if err != nil { return false @@ -120,7 +156,7 @@ func FindCgroupMountpointDir() (string, error) { return "", fmt.Errorf("Found no fields post '-' in %q", text) } - if postSeparatorFields[0] == "cgroup" { + if postSeparatorFields[0] == "cgroup" || postSeparatorFields[0] == "cgroup2" { // Check that the mount is properly formatted. if numPostFields < 3 { return "", fmt.Errorf("Error found less than 3 fields post '-' in %q", text) @@ -193,6 +229,19 @@ func getCgroupMountsHelper(ss map[string]bool, mi io.Reader, all bool) ([]Mount, // GetCgroupMounts returns the mounts for the cgroup subsystems. // all indicates whether to return just the first instance or all the mounts. func GetCgroupMounts(all bool) ([]Mount, error) { + if IsCgroup2UnifiedMode() { + availableControllers, err := GetAllSubsystems() + if err != nil { + return nil, err + } + m := Mount{ + Mountpoint: "/sys/fs/cgroup", + Root: "/sys/fs/cgroup", + Subsystems: availableControllers, + } + return []Mount{m}, nil + } + f, err := os.Open("/proc/self/mountinfo") if err != nil { return nil, err @@ -356,6 +405,9 @@ func parseCgroupFromReader(r io.Reader) (map[string]string, error) { } func getControllerPath(subsystem string, cgroups map[string]string) (string, error) { + if IsCgroup2UnifiedMode() { + return "/", nil + } if p, ok := cgroups[subsystem]; ok { return p, nil diff --git a/vendor/github.com/opencontainers/runc/libcontainer/configs/blkio_device.go b/vendor/github.com/opencontainers/runc/libcontainer/configs/blkio_device.go index e0f3ca165..fa195bf90 100644 --- a/vendor/github.com/opencontainers/runc/libcontainer/configs/blkio_device.go +++ b/vendor/github.com/opencontainers/runc/libcontainer/configs/blkio_device.go @@ -59,3 +59,8 @@ func NewThrottleDevice(major, minor int64, rate uint64) *ThrottleDevice { func (td *ThrottleDevice) String() string { return fmt.Sprintf("%d:%d %d", td.Major, td.Minor, td.Rate) } + +// StringName formats the struct to be writable to the cgroup specific file +func (td *ThrottleDevice) StringName(name string) string { + return fmt.Sprintf("%d:%d %s=%d", td.Major, td.Minor, name, td.Rate) +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/configs/cgroup_linux.go b/vendor/github.com/opencontainers/runc/libcontainer/configs/cgroup_linux.go index e15a662f5..58ed19c9e 100644 --- a/vendor/github.com/opencontainers/runc/libcontainer/configs/cgroup_linux.go +++ b/vendor/github.com/opencontainers/runc/libcontainer/configs/cgroup_linux.go @@ -119,4 +119,12 @@ type Resources struct { // Set class identifier for container's network packets NetClsClassid uint32 `json:"net_cls_classid_u"` + + // Used on cgroups v2: + + // CpuWeight sets a proportional bandwidth limit. + CpuWeight uint64 `json:"cpu_weight"` + + // CpuMax sets she maximum bandwidth limit (format: max period). + CpuMax string `json:"cpu_max"` } diff --git a/vendor/github.com/opencontainers/runc/libcontainer/configs/config.go b/vendor/github.com/opencontainers/runc/libcontainer/configs/config.go index 7728522fe..24989e9f5 100644 --- a/vendor/github.com/opencontainers/runc/libcontainer/configs/config.go +++ b/vendor/github.com/opencontainers/runc/libcontainer/configs/config.go @@ -44,6 +44,7 @@ const ( Trap Allow Trace + Log ) // Operator is a comparison operator to be used when matching syscall arguments in Seccomp diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go index 11c3faafb..e05e30adc 100644 --- a/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go @@ -1,5 +1,5 @@ // +build linux -// +build arm64 amd64 mips mipsle mips64 mips64le ppc ppc64 ppc64le s390x +// +build arm64 amd64 mips mipsle mips64 mips64le ppc ppc64 ppc64le riscv64 s390x package system diff --git a/vendor/github.com/opencontainers/runc/libcontainer/utils/cmsg.go b/vendor/github.com/opencontainers/runc/libcontainer/utils/cmsg.go new file mode 100644 index 000000000..c8a9364d5 --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/utils/cmsg.go @@ -0,0 +1,93 @@ +// +build linux + +package utils + +/* + * Copyright 2016, 2017 SUSE LLC + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import ( + "fmt" + "os" + + "golang.org/x/sys/unix" +) + +// MaxSendfdLen is the maximum length of the name of a file descriptor being +// sent using SendFd. The name of the file handle returned by RecvFd will never +// be larger than this value. +const MaxNameLen = 4096 + +// oobSpace is the size of the oob slice required to store a single FD. Note +// that unix.UnixRights appears to make the assumption that fd is always int32, +// so sizeof(fd) = 4. +var oobSpace = unix.CmsgSpace(4) + +// RecvFd waits for a file descriptor to be sent over the given AF_UNIX +// socket. The file name of the remote file descriptor will be recreated +// locally (it is sent as non-auxiliary data in the same payload). +func RecvFd(socket *os.File) (*os.File, error) { + // For some reason, unix.Recvmsg uses the length rather than the capacity + // when passing the msg_controllen and other attributes to recvmsg. So we + // have to actually set the length. + name := make([]byte, MaxNameLen) + oob := make([]byte, oobSpace) + + sockfd := socket.Fd() + n, oobn, _, _, err := unix.Recvmsg(int(sockfd), name, oob, 0) + if err != nil { + return nil, err + } + + if n >= MaxNameLen || oobn != oobSpace { + return nil, fmt.Errorf("recvfd: incorrect number of bytes read (n=%d oobn=%d)", n, oobn) + } + + // Truncate. + name = name[:n] + oob = oob[:oobn] + + scms, err := unix.ParseSocketControlMessage(oob) + if err != nil { + return nil, err + } + if len(scms) != 1 { + return nil, fmt.Errorf("recvfd: number of SCMs is not 1: %d", len(scms)) + } + scm := scms[0] + + fds, err := unix.ParseUnixRights(&scm) + if err != nil { + return nil, err + } + if len(fds) != 1 { + return nil, fmt.Errorf("recvfd: number of fds is not 1: %d", len(fds)) + } + fd := uintptr(fds[0]) + + return os.NewFile(fd, string(name)), nil +} + +// SendFd sends a file descriptor over the given AF_UNIX socket. In +// addition, the file.Name() of the given file will also be sent as +// non-auxiliary data in the same payload (allowing to send contextual +// information for a file descriptor). +func SendFd(socket *os.File, name string, fd uintptr) error { + if len(name) >= MaxNameLen { + return fmt.Errorf("sendfd: filename too long: %s", name) + } + oob := unix.UnixRights(int(fd)) + return unix.Sendmsg(int(socket.Fd()), []byte(name), oob, nil, 0) +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/utils/utils.go b/vendor/github.com/opencontainers/runc/libcontainer/utils/utils.go new file mode 100644 index 000000000..40ccfaa1a --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/utils/utils.go @@ -0,0 +1,112 @@ +package utils + +import ( + "encoding/json" + "io" + "os" + "path/filepath" + "strings" + "unsafe" + + "golang.org/x/sys/unix" +) + +const ( + exitSignalOffset = 128 +) + +// ResolveRootfs ensures that the current working directory is +// not a symlink and returns the absolute path to the rootfs +func ResolveRootfs(uncleanRootfs string) (string, error) { + rootfs, err := filepath.Abs(uncleanRootfs) + if err != nil { + return "", err + } + return filepath.EvalSymlinks(rootfs) +} + +// ExitStatus returns the correct exit status for a process based on if it +// was signaled or exited cleanly +func ExitStatus(status unix.WaitStatus) int { + if status.Signaled() { + return exitSignalOffset + int(status.Signal()) + } + return status.ExitStatus() +} + +// WriteJSON writes the provided struct v to w using standard json marshaling +func WriteJSON(w io.Writer, v interface{}) error { + data, err := json.Marshal(v) + if err != nil { + return err + } + _, err = w.Write(data) + return err +} + +// CleanPath makes a path safe for use with filepath.Join. This is done by not +// only cleaning the path, but also (if the path is relative) adding a leading +// '/' and cleaning it (then removing the leading '/'). This ensures that a +// path resulting from prepending another path will always resolve to lexically +// be a subdirectory of the prefixed path. This is all done lexically, so paths +// that include symlinks won't be safe as a result of using CleanPath. +func CleanPath(path string) string { + // Deal with empty strings nicely. + if path == "" { + return "" + } + + // Ensure that all paths are cleaned (especially problematic ones like + // "/../../../../../" which can cause lots of issues). + path = filepath.Clean(path) + + // If the path isn't absolute, we need to do more processing to fix paths + // such as "../../../../<etc>/some/path". We also shouldn't convert absolute + // paths to relative ones. + if !filepath.IsAbs(path) { + path = filepath.Clean(string(os.PathSeparator) + path) + // This can't fail, as (by definition) all paths are relative to root. + path, _ = filepath.Rel(string(os.PathSeparator), path) + } + + // Clean the path again for good measure. + return filepath.Clean(path) +} + +// SearchLabels searches a list of key-value pairs for the provided key and +// returns the corresponding value. The pairs must be separated with '='. +func SearchLabels(labels []string, query string) string { + for _, l := range labels { + parts := strings.SplitN(l, "=", 2) + if len(parts) < 2 { + continue + } + if parts[0] == query { + return parts[1] + } + } + return "" +} + +// Annotations returns the bundle path and user defined annotations from the +// libcontainer state. We need to remove the bundle because that is a label +// added by libcontainer. +func Annotations(labels []string) (bundle string, userAnnotations map[string]string) { + userAnnotations = make(map[string]string) + for _, l := range labels { + parts := strings.SplitN(l, "=", 2) + if len(parts) < 2 { + continue + } + if parts[0] == "bundle" { + bundle = parts[1] + } else { + userAnnotations[parts[0]] = parts[1] + } + } + return +} + +func GetIntSize() int { + return int(unsafe.Sizeof(1)) +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/utils/utils_unix.go b/vendor/github.com/opencontainers/runc/libcontainer/utils/utils_unix.go new file mode 100644 index 000000000..1576f2d4a --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/utils/utils_unix.go @@ -0,0 +1,68 @@ +// +build !windows + +package utils + +import ( + "fmt" + "os" + "strconv" + + "golang.org/x/sys/unix" +) + +// EnsureProcHandle returns whether or not the given file handle is on procfs. +func EnsureProcHandle(fh *os.File) error { + var buf unix.Statfs_t + if err := unix.Fstatfs(int(fh.Fd()), &buf); err != nil { + return fmt.Errorf("ensure %s is on procfs: %v", fh.Name(), err) + } + if buf.Type != unix.PROC_SUPER_MAGIC { + return fmt.Errorf("%s is not on procfs", fh.Name()) + } + return nil +} + +// CloseExecFrom applies O_CLOEXEC to all file descriptors currently open for +// the process (except for those below the given fd value). +func CloseExecFrom(minFd int) error { + fdDir, err := os.Open("/proc/self/fd") + if err != nil { + return err + } + defer fdDir.Close() + + if err := EnsureProcHandle(fdDir); err != nil { + return err + } + + fdList, err := fdDir.Readdirnames(-1) + if err != nil { + return err + } + for _, fdStr := range fdList { + fd, err := strconv.Atoi(fdStr) + // Ignore non-numeric file names. + if err != nil { + continue + } + // Ignore descriptors lower than our specified minimum. + if fd < minFd { + continue + } + // Intentionally ignore errors from unix.CloseOnExec -- the cases where + // this might fail are basically file descriptors that have already + // been closed (including and especially the one that was created when + // ioutil.ReadDir did the "opendir" syscall). + unix.CloseOnExec(fd) + } + return nil +} + +// NewSockPair returns a new unix socket pair +func NewSockPair(name string) (parent *os.File, child *os.File, err error) { + fds, err := unix.Socketpair(unix.AF_LOCAL, unix.SOCK_STREAM|unix.SOCK_CLOEXEC, 0) + if err != nil { + return nil, nil, err + } + return os.NewFile(uintptr(fds[1]), name+"-p"), os.NewFile(uintptr(fds[0]), name+"-c"), nil +} diff --git a/vendor/github.com/prometheus/procfs/arp.go b/vendor/github.com/prometheus/procfs/arp.go new file mode 100644 index 000000000..916c9182a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/arp.go @@ -0,0 +1,85 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "fmt" + "io/ioutil" + "net" + "strings" +) + +// ARPEntry contains a single row of the columnar data represented in +// /proc/net/arp. +type ARPEntry struct { + // IP address + IPAddr net.IP + // MAC address + HWAddr net.HardwareAddr + // Name of the device + Device string +} + +// GatherARPEntries retrieves all the ARP entries, parse the relevant columns, +// and then return a slice of ARPEntry's. +func (fs FS) GatherARPEntries() ([]ARPEntry, error) { + data, err := ioutil.ReadFile(fs.proc.Path("net/arp")) + if err != nil { + return nil, fmt.Errorf("error reading arp %s: %s", fs.proc.Path("net/arp"), err) + } + + return parseARPEntries(data) +} + +func parseARPEntries(data []byte) ([]ARPEntry, error) { + lines := strings.Split(string(data), "\n") + entries := make([]ARPEntry, 0) + var err error + const ( + expectedDataWidth = 6 + expectedHeaderWidth = 9 + ) + for _, line := range lines { + columns := strings.Fields(line) + width := len(columns) + + if width == expectedHeaderWidth || width == 0 { + continue + } else if width == expectedDataWidth { + entry, err := parseARPEntry(columns) + if err != nil { + return []ARPEntry{}, fmt.Errorf("failed to parse ARP entry: %s", err) + } + entries = append(entries, entry) + } else { + return []ARPEntry{}, fmt.Errorf("%d columns were detected, but %d were expected", width, expectedDataWidth) + } + + } + + return entries, err +} + +func parseARPEntry(columns []string) (ARPEntry, error) { + ip := net.ParseIP(columns[0]) + mac := net.HardwareAddr(columns[3]) + + entry := ARPEntry{ + IPAddr: ip, + HWAddr: mac, + Device: columns[5], + } + + return entry, nil +} diff --git a/vendor/github.com/prometheus/procfs/buddyinfo.go b/vendor/github.com/prometheus/procfs/buddyinfo.go index 63d4229a4..10bd067a0 100644 --- a/vendor/github.com/prometheus/procfs/buddyinfo.go +++ b/vendor/github.com/prometheus/procfs/buddyinfo.go @@ -31,7 +31,7 @@ type BuddyInfo struct { Sizes []float64 } -// NewBuddyInfo reads the buddyinfo statistics from the specified `proc` filesystem. +// BuddyInfo reads the buddyinfo statistics from the specified `proc` filesystem. func (fs FS) BuddyInfo() ([]BuddyInfo, error) { file, err := os.Open(fs.proc.Path("buddyinfo")) if err != nil { diff --git a/vendor/github.com/prometheus/procfs/cpuinfo.go b/vendor/github.com/prometheus/procfs/cpuinfo.go new file mode 100644 index 000000000..16491d6ab --- /dev/null +++ b/vendor/github.com/prometheus/procfs/cpuinfo.go @@ -0,0 +1,166 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "bytes" + "io/ioutil" + "strconv" + "strings" +) + +// CPUInfo contains general information about a system CPU found in /proc/cpuinfo +type CPUInfo struct { + Processor uint + VendorID string + CPUFamily string + Model string + ModelName string + Stepping string + Microcode string + CPUMHz float64 + CacheSize string + PhysicalID string + Siblings uint + CoreID string + CPUCores uint + APICID string + InitialAPICID string + FPU string + FPUException string + CPUIDLevel uint + WP string + Flags []string + Bugs []string + BogoMips float64 + CLFlushSize uint + CacheAlignment uint + AddressSizes string + PowerManagement string +} + +// CPUInfo returns information about current system CPUs. +// See https://www.kernel.org/doc/Documentation/filesystems/proc.txt +func (fs FS) CPUInfo() ([]CPUInfo, error) { + data, err := ioutil.ReadFile(fs.proc.Path("cpuinfo")) + if err != nil { + return nil, err + } + return parseCPUInfo(data) +} + +// parseCPUInfo parses data from /proc/cpuinfo +func parseCPUInfo(info []byte) ([]CPUInfo, error) { + cpuinfo := []CPUInfo{} + i := -1 + scanner := bufio.NewScanner(bytes.NewReader(info)) + for scanner.Scan() { + line := scanner.Text() + if strings.TrimSpace(line) == "" { + continue + } + field := strings.SplitN(line, ": ", 2) + switch strings.TrimSpace(field[0]) { + case "processor": + cpuinfo = append(cpuinfo, CPUInfo{}) // start of the next processor + i++ + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].Processor = uint(v) + case "vendor_id": + cpuinfo[i].VendorID = field[1] + case "cpu family": + cpuinfo[i].CPUFamily = field[1] + case "model": + cpuinfo[i].Model = field[1] + case "model name": + cpuinfo[i].ModelName = field[1] + case "stepping": + cpuinfo[i].Stepping = field[1] + case "microcode": + cpuinfo[i].Microcode = field[1] + case "cpu MHz": + v, err := strconv.ParseFloat(field[1], 64) + if err != nil { + return nil, err + } + cpuinfo[i].CPUMHz = v + case "cache size": + cpuinfo[i].CacheSize = field[1] + case "physical id": + cpuinfo[i].PhysicalID = field[1] + case "siblings": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].Siblings = uint(v) + case "core id": + cpuinfo[i].CoreID = field[1] + case "cpu cores": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CPUCores = uint(v) + case "apicid": + cpuinfo[i].APICID = field[1] + case "initial apicid": + cpuinfo[i].InitialAPICID = field[1] + case "fpu": + cpuinfo[i].FPU = field[1] + case "fpu_exception": + cpuinfo[i].FPUException = field[1] + case "cpuid level": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CPUIDLevel = uint(v) + case "wp": + cpuinfo[i].WP = field[1] + case "flags": + cpuinfo[i].Flags = strings.Fields(field[1]) + case "bugs": + cpuinfo[i].Bugs = strings.Fields(field[1]) + case "bogomips": + v, err := strconv.ParseFloat(field[1], 64) + if err != nil { + return nil, err + } + cpuinfo[i].BogoMips = v + case "clflush size": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CLFlushSize = uint(v) + case "cache_alignment": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CacheAlignment = uint(v) + case "address sizes": + cpuinfo[i].AddressSizes = field[1] + case "power management": + cpuinfo[i].PowerManagement = field[1] + } + } + return cpuinfo, nil + +} diff --git a/vendor/github.com/prometheus/procfs/crypto.go b/vendor/github.com/prometheus/procfs/crypto.go new file mode 100644 index 000000000..19d4041b2 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/crypto.go @@ -0,0 +1,131 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bytes" + "fmt" + "io/ioutil" + "strconv" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// Crypto holds info parsed from /proc/crypto. +type Crypto struct { + Alignmask *uint64 + Async bool + Blocksize *uint64 + Chunksize *uint64 + Ctxsize *uint64 + Digestsize *uint64 + Driver string + Geniv string + Internal string + Ivsize *uint64 + Maxauthsize *uint64 + MaxKeysize *uint64 + MinKeysize *uint64 + Module string + Name string + Priority *int64 + Refcnt *int64 + Seedsize *uint64 + Selftest string + Type string + Walksize *uint64 +} + +// Crypto parses an crypto-file (/proc/crypto) and returns a slice of +// structs containing the relevant info. More information available here: +// https://kernel.readthedocs.io/en/sphinx-samples/crypto-API.html +func (fs FS) Crypto() ([]Crypto, error) { + data, err := ioutil.ReadFile(fs.proc.Path("crypto")) + if err != nil { + return nil, fmt.Errorf("error parsing crypto %s: %s", fs.proc.Path("crypto"), err) + } + crypto, err := parseCrypto(data) + if err != nil { + return nil, fmt.Errorf("error parsing crypto %s: %s", fs.proc.Path("crypto"), err) + } + return crypto, nil +} + +func parseCrypto(cryptoData []byte) ([]Crypto, error) { + crypto := []Crypto{} + + cryptoBlocks := bytes.Split(cryptoData, []byte("\n\n")) + + for _, block := range cryptoBlocks { + var newCryptoElem Crypto + + lines := strings.Split(string(block), "\n") + for _, line := range lines { + if strings.TrimSpace(line) == "" || line[0] == ' ' { + continue + } + fields := strings.Split(line, ":") + key := strings.TrimSpace(fields[0]) + value := strings.TrimSpace(fields[1]) + vp := util.NewValueParser(value) + + switch strings.TrimSpace(key) { + case "async": + b, err := strconv.ParseBool(value) + if err == nil { + newCryptoElem.Async = b + } + case "blocksize": + newCryptoElem.Blocksize = vp.PUInt64() + case "chunksize": + newCryptoElem.Chunksize = vp.PUInt64() + case "digestsize": + newCryptoElem.Digestsize = vp.PUInt64() + case "driver": + newCryptoElem.Driver = value + case "geniv": + newCryptoElem.Geniv = value + case "internal": + newCryptoElem.Internal = value + case "ivsize": + newCryptoElem.Ivsize = vp.PUInt64() + case "maxauthsize": + newCryptoElem.Maxauthsize = vp.PUInt64() + case "max keysize": + newCryptoElem.MaxKeysize = vp.PUInt64() + case "min keysize": + newCryptoElem.MinKeysize = vp.PUInt64() + case "module": + newCryptoElem.Module = value + case "name": + newCryptoElem.Name = value + case "priority": + newCryptoElem.Priority = vp.PInt64() + case "refcnt": + newCryptoElem.Refcnt = vp.PInt64() + case "seedsize": + newCryptoElem.Seedsize = vp.PUInt64() + case "selftest": + newCryptoElem.Selftest = value + case "type": + newCryptoElem.Type = value + case "walksize": + newCryptoElem.Walksize = vp.PUInt64() + } + } + crypto = append(crypto, newCryptoElem) + } + return crypto, nil +} diff --git a/vendor/github.com/prometheus/procfs/fixtures.ttar b/vendor/github.com/prometheus/procfs/fixtures.ttar index 6b42e7ba1..0b2905544 100644 --- a/vendor/github.com/prometheus/procfs/fixtures.ttar +++ b/vendor/github.com/prometheus/procfs/fixtures.ttar @@ -47,6 +47,48 @@ SymlinkTo: ../../symlinktargets/ghi Path: fixtures/proc/26231/fd/3 SymlinkTo: ../../symlinktargets/uvw # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/26231/fdinfo +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/0 +Lines: 6 +pos: 0 +flags: 02004000 +mnt_id: 13 +inotify wd:3 ino:1 sdev:34 mask:fce ignored_mask:0 fhandle-bytes:c fhandle-type:81 f_handle:000000000100000000000000 +inotify wd:2 ino:1300016 sdev:fd00002 mask:fce ignored_mask:0 fhandle-bytes:8 fhandle-type:1 f_handle:16003001ed3f022a +inotify wd:1 ino:2e0001 sdev:fd00000 mask:fce ignored_mask:0 fhandle-bytes:8 fhandle-type:1 f_handle:01002e00138e7c65 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/1 +Lines: 4 +pos: 0 +flags: 02004002 +mnt_id: 13 +eventfd-count: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/10 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/2 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/3 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/26231/io Lines: 7 rchar: 750339 @@ -126,6 +168,11 @@ SymlinkTo: net:[4026531993] Path: fixtures/proc/26231/root SymlinkTo: / # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/schedstat +Lines: 1 +411605849 93680043 79 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/26231/stat Lines: 1 26231 (vim) R 5392 7446 5392 34835 7446 4218880 32533 309516 26 82 1677 44 158 99 20 0 1 0 82375 56274944 1981 18446744073709551615 4194304 6294284 140736914091744 140736914087944 139965136429984 0 0 12288 1870679807 0 0 0 17 0 0 0 31 0 0 8391624 8481048 16420864 140736914093252 140736914093279 140736914093279 140736914096107 0 @@ -137,10 +184,10 @@ Lines: 53 Name: prometheus Umask: 0022 State: S (sleeping) -Tgid: 1 +Tgid: 26231 Ngid: 0 -Pid: 1 -PPid: 0 +Pid: 26231 +PPid: 1 TracerPid: 0 Uid: 0 0 0 0 Gid: 0 0 0 0 @@ -258,6 +305,18 @@ Lines: 1 com.github.uiautomatorNULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTEEOF Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26233/schedstat +Lines: 8 + ____________________________________ +< this is a malformed schedstat file > + ------------------------------------ + \ ^__^ + \ (oo)\_______ + (__)\ )\/\ + ||----w | + || || +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/proc/584 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -274,6 +333,1201 @@ Node 0, zone DMA32 759 572 791 475 194 45 12 0 Node 0, zone Normal 4381 1093 185 1530 567 102 4 0 0 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/cpuinfo +Lines: 216 +processor : 0 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 799.998 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 0 +cpu cores : 4 +apicid : 0 +initial apicid : 0 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 1 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.037 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 1 +cpu cores : 4 +apicid : 2 +initial apicid : 2 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 2 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.010 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 2 +cpu cores : 4 +apicid : 4 +initial apicid : 4 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 3 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.028 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 3 +cpu cores : 4 +apicid : 6 +initial apicid : 6 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 4 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 799.989 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 0 +cpu cores : 4 +apicid : 1 +initial apicid : 1 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 5 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.083 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 1 +cpu cores : 4 +apicid : 3 +initial apicid : 3 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 6 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.017 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 2 +cpu cores : 4 +apicid : 5 +initial apicid : 5 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 7 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.030 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 3 +cpu cores : 4 +apicid : 7 +initial apicid : 7 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/crypto +Lines: 971 +name : ccm(aes) +driver : ccm_base(ctr(aes-aesni),cbcmac(aes-aesni)) +module : ccm +priority : 300 +refcnt : 4 +selftest : passed +internal : no +type : aead +async : no +blocksize : 1 +ivsize : 16 +maxauthsize : 16 +geniv : <none> + +name : cbcmac(aes) +driver : cbcmac(aes-aesni) +module : ccm +priority : 300 +refcnt : 7 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 16 + +name : ecdh +driver : ecdh-generic +module : ecdh_generic +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : kpp + +name : ecb(arc4) +driver : ecb(arc4)-generic +module : arc4 +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 1 +max keysize : 256 +ivsize : 0 +chunksize : 1 +walksize : 1 + +name : arc4 +driver : arc4-generic +module : arc4 +priority : 0 +refcnt : 3 +selftest : passed +internal : no +type : cipher +blocksize : 1 +min keysize : 1 +max keysize : 256 + +name : crct10dif +driver : crct10dif-pclmul +module : crct10dif_pclmul +priority : 200 +refcnt : 2 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 2 + +name : crc32 +driver : crc32-pclmul +module : crc32_pclmul +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : __ghash +driver : cryptd(__ghash-pclmulqdqni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : ahash +async : yes +blocksize : 16 +digestsize : 16 + +name : ghash +driver : ghash-clmulni +module : ghash_clmulni_intel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : ahash +async : yes +blocksize : 16 +digestsize : 16 + +name : __ghash +driver : __ghash-pclmulqdqni +module : ghash_clmulni_intel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : shash +blocksize : 16 +digestsize : 16 + +name : crc32c +driver : crc32c-intel +module : crc32c_intel +priority : 200 +refcnt : 5 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : cbc(aes) +driver : cbc(aes-aesni) +module : kernel +priority : 300 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : ctr(aes) +driver : ctr(aes-aesni) +module : kernel +priority : 300 +refcnt : 5 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : pkcs1pad(rsa,sha256) +driver : pkcs1pad(rsa-generic,sha256) +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : akcipher + +name : __xts(aes) +driver : cryptd(__xts-aes-aesni) +module : kernel +priority : 451 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : xts(aes) +driver : xts-aes-aesni +module : kernel +priority : 401 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ctr(aes) +driver : cryptd(__ctr-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : ctr(aes) +driver : ctr-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __cbc(aes) +driver : cryptd(__cbc-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : cbc(aes) +driver : cbc-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ecb(aes) +driver : cryptd(__ecb-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : ecb(aes) +driver : ecb-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : __generic-gcm-aes-aesni +driver : cryptd(__driver-generic-gcm-aes-aesni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : yes +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : <none> + +name : gcm(aes) +driver : generic-gcm-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : aead +async : yes +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : <none> + +name : __generic-gcm-aes-aesni +driver : __driver-generic-gcm-aes-aesni +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : no +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : <none> + +name : __gcm-aes-aesni +driver : cryptd(__driver-gcm-aes-aesni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : yes +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : <none> + +name : rfc4106(gcm(aes)) +driver : rfc4106-gcm-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : aead +async : yes +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : <none> + +name : __gcm-aes-aesni +driver : __driver-gcm-aes-aesni +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : no +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : <none> + +name : __xts(aes) +driver : __xts-aes-aesni +module : kernel +priority : 401 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ctr(aes) +driver : __ctr-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __cbc(aes) +driver : __cbc-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ecb(aes) +driver : __ecb-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : __aes +driver : __aes-aesni +module : kernel +priority : 300 +refcnt : 1 +selftest : passed +internal : yes +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : aes +driver : aes-aesni +module : kernel +priority : 300 +refcnt : 8 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : hmac(sha1) +driver : hmac(sha1-generic) +module : kernel +priority : 100 +refcnt : 9 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 20 + +name : ghash +driver : ghash-generic +module : kernel +priority : 100 +refcnt : 3 +selftest : passed +internal : no +type : shash +blocksize : 16 +digestsize : 16 + +name : jitterentropy_rng +driver : jitterentropy_rng +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha256 +module : kernel +priority : 221 +refcnt : 2 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha512 +module : kernel +priority : 220 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha384 +module : kernel +priority : 219 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha1 +module : kernel +priority : 218 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha256 +module : kernel +priority : 217 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha512 +module : kernel +priority : 216 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha384 +module : kernel +priority : 215 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha1 +module : kernel +priority : 214 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes256 +module : kernel +priority : 213 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes192 +module : kernel +priority : 212 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes128 +module : kernel +priority : 211 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : hmac(sha256) +driver : hmac(sha256-generic) +module : kernel +priority : 100 +refcnt : 10 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 32 + +name : stdrng +driver : drbg_pr_hmac_sha256 +module : kernel +priority : 210 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha512 +module : kernel +priority : 209 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha384 +module : kernel +priority : 208 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha1 +module : kernel +priority : 207 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha256 +module : kernel +priority : 206 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha512 +module : kernel +priority : 205 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha384 +module : kernel +priority : 204 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha1 +module : kernel +priority : 203 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes256 +module : kernel +priority : 202 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes192 +module : kernel +priority : 201 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes128 +module : kernel +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : 842 +driver : 842-scomp +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : 842 +driver : 842-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : lzo-rle +driver : lzo-rle-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : lzo-rle +driver : lzo-rle-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : lzo +driver : lzo-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : lzo +driver : lzo-generic +module : kernel +priority : 0 +refcnt : 9 +selftest : passed +internal : no +type : compression + +name : crct10dif +driver : crct10dif-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 2 + +name : crc32c +driver : crc32c-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : zlib-deflate +driver : zlib-deflate-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : deflate +driver : deflate-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : deflate +driver : deflate-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : aes +driver : aes-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : sha224 +driver : sha224-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 28 + +name : sha256 +driver : sha256-generic +module : kernel +priority : 100 +refcnt : 11 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 32 + +name : sha1 +driver : sha1-generic +module : kernel +priority : 100 +refcnt : 11 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 20 + +name : md5 +driver : md5-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 16 + +name : ecb(cipher_null) +driver : ecb-cipher_null +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 0 +max keysize : 0 +ivsize : 0 +chunksize : 1 +walksize : 1 + +name : digest_null +driver : digest_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 0 + +name : compress_null +driver : compress_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : cipher_null +driver : cipher_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 1 +min keysize : 0 +max keysize : 0 + +name : rsa +driver : rsa-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : akcipher + +name : dh +driver : dh-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : kpp + +name : aes +driver : aes-asm +module : kernel +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/diskstats Lines: 49 1 0 ram0 0 0 0 0 0 0 0 0 0 0 0 @@ -423,6 +1677,12 @@ Mode: 644 Directory: fixtures/proc/net Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/net/arp +Lines: 2 +IP address HW type Flags HW address Mask Device +192.168.224.1 0x1 0x2 00:50:56:c0:00:08 * ens33 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/net/dev Lines: 6 Inter-| Receive | Transmit @@ -495,6 +1755,11 @@ proc4 2 2 10853 proc4ops 72 0 0 0 1098 2 0 0 0 0 8179 5896 0 0 0 0 5900 0 0 2 0 2 0 9609 0 2 150 1272 0 0 0 1236 0 0 0 0 3 3 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/net/softnet_stat +Lines: 1 +00015c73 00020e76 F0000769 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/net/unix Lines: 6 Num RefCount Protocol Flags Type St Inode Path @@ -567,6 +1832,16 @@ some avg10=0.10 avg60=2.00 avg300=3.85 total=15 full avg10=0.20 avg60=3.00 avg300=4.95 total=25 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/schedstat +Lines: 6 +version 15 +timestamp 15819019232 +cpu0 498494191 0 3533438552 2553969831 3853684107 2465731542 2045936778163039 343796328169361 4767485306 +domain0 00000000,00000003 212499247 210112015 1861015 1860405436 536440 369895 32599 210079416 25368550 24241256 384652 927363878 807233 6366 1647 24239609 2122447165 1886868564 121112060 2848625533 125678146 241025 1032026 1885836538 2545 12 2533 0 0 0 0 0 0 1387952561 21076581 0 +cpu1 518377256 0 4155211005 2778589869 10466382 2867629021 1904686152592476 364107263788241 5145567945 +domain0 00000000,00000003 217653037 215526982 1577949 1580427380 557469 393576 28538 215498444 28721913 27662819 371153 870843407 745912 5523 1639 27661180 2331056874 2107732788 111442342 652402556 123615235 196159 1045245 2106687543 2400 3 2397 0 0 0 0 0 0 1437804657 26220076 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/self SymlinkTo: 26231 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -619,6 +1894,493 @@ Path: fixtures/proc/symlinktargets/xyz Lines: 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/sys +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/sys/vm +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/admin_reserve_kbytes +Lines: 1 +8192 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/block_dump +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/compact_unevictable_allowed +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_background_bytes +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_background_ratio +Lines: 1 +10 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_bytes +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_expire_centisecs +Lines: 1 +3000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_ratio +Lines: 1 +20 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirty_writeback_centisecs +Lines: 1 +500 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/dirtytime_expire_seconds +Lines: 1 +43200 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/drop_caches +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/extfrag_threshold +Lines: 1 +500 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/hugetlb_shm_group +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/laptop_mode +Lines: 1 +5 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/legacy_va_layout +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/lowmem_reserve_ratio +Lines: 1 +256 256 32 0 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/max_map_count +Lines: 1 +65530 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/memory_failure_early_kill +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/memory_failure_recovery +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/min_free_kbytes +Lines: 1 +67584 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/min_slab_ratio +Lines: 1 +5 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/min_unmapped_ratio +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/mmap_min_addr +Lines: 1 +65536 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/nr_hugepages +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/nr_hugepages_mempolicy +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/nr_overcommit_hugepages +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/numa_stat +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/numa_zonelist_order +Lines: 1 +Node +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/oom_dump_tasks +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/oom_kill_allocating_task +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/overcommit_kbytes +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/overcommit_memory +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/overcommit_ratio +Lines: 1 +50 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/page-cluster +Lines: 1 +3 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/panic_on_oom +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/percpu_pagelist_fraction +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/stat_interval +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/swappiness +Lines: 1 +60 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/user_reserve_kbytes +Lines: 1 +131072 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/vfs_cache_pressure +Lines: 1 +100 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/watermark_boost_factor +Lines: 1 +15000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/watermark_scale_factor +Lines: 1 +10 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/sys/vm/zone_reclaim_mode +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/zoneinfo +Lines: 262 +Node 0, zone DMA + per-node stats + nr_inactive_anon 230981 + nr_active_anon 547580 + nr_inactive_file 316904 + nr_active_file 346282 + nr_unevictable 115467 + nr_slab_reclaimable 131220 + nr_slab_unreclaimable 47320 + nr_isolated_anon 0 + nr_isolated_file 0 + workingset_nodes 11627 + workingset_refault 466886 + workingset_activate 276925 + workingset_restore 84055 + workingset_nodereclaim 487 + nr_anon_pages 795576 + nr_mapped 215483 + nr_file_pages 761874 + nr_dirty 908 + nr_writeback 0 + nr_writeback_temp 0 + nr_shmem 224925 + nr_shmem_hugepages 0 + nr_shmem_pmdmapped 0 + nr_anon_transparent_hugepages 0 + nr_unstable 0 + nr_vmscan_write 12950 + nr_vmscan_immediate_reclaim 3033 + nr_dirtied 8007423 + nr_written 7752121 + nr_kernel_misc_reclaimable 0 + pages free 3952 + min 33 + low 41 + high 49 + spanned 4095 + present 3975 + managed 3956 + protection: (0, 2877, 7826, 7826, 7826) + nr_free_pages 3952 + nr_zone_inactive_anon 0 + nr_zone_active_anon 0 + nr_zone_inactive_file 0 + nr_zone_active_file 0 + nr_zone_unevictable 0 + nr_zone_write_pending 0 + nr_mlock 0 + nr_page_table_pages 0 + nr_kernel_stack 0 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 1 + numa_miss 0 + numa_foreign 0 + numa_interleave 0 + numa_local 1 + numa_other 0 + pagesets + cpu: 0 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 1 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 2 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 3 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 4 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 5 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 6 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 7 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + node_unreclaimable: 0 + start_pfn: 1 +Node 0, zone DMA32 + pages free 204252 + min 19510 + low 21059 + high 22608 + spanned 1044480 + present 759231 + managed 742806 + protection: (0, 0, 4949, 4949, 4949) + nr_free_pages 204252 + nr_zone_inactive_anon 118558 + nr_zone_active_anon 106598 + nr_zone_inactive_file 75475 + nr_zone_active_file 70293 + nr_zone_unevictable 66195 + nr_zone_write_pending 64 + nr_mlock 4 + nr_page_table_pages 1756 + nr_kernel_stack 2208 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 113952967 + numa_miss 0 + numa_foreign 0 + numa_interleave 0 + numa_local 113952967 + numa_other 0 + pagesets + cpu: 0 + count: 345 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 1 + count: 356 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 2 + count: 325 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 3 + count: 346 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 4 + count: 321 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 5 + count: 316 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 6 + count: 373 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 7 + count: 339 + high: 378 + batch: 63 + vm stats threshold: 48 + node_unreclaimable: 0 + start_pfn: 4096 +Node 0, zone Normal + pages free 18553 + min 11176 + low 13842 + high 16508 + spanned 1308160 + present 1308160 + managed 1268711 + protection: (0, 0, 0, 0, 0) + nr_free_pages 18553 + nr_zone_inactive_anon 112423 + nr_zone_active_anon 440982 + nr_zone_inactive_file 241429 + nr_zone_active_file 275989 + nr_zone_unevictable 49272 + nr_zone_write_pending 844 + nr_mlock 154 + nr_page_table_pages 9750 + nr_kernel_stack 15136 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 162718019 + numa_miss 0 + numa_foreign 0 + numa_interleave 26812 + numa_local 162718019 + numa_other 0 + pagesets + cpu: 0 + count: 316 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 1 + count: 366 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 2 + count: 60 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 3 + count: 256 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 4 + count: 253 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 5 + count: 159 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 6 + count: 311 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 7 + count: 264 + high: 378 + batch: 63 + vm stats threshold: 56 + node_unreclaimable: 0 + start_pfn: 1048576 +Node 0, zone Movable + pages free 0 + min 0 + low 0 + high 0 + spanned 0 + present 0 + managed 0 + protection: (0, 0, 0, 0, 0) +Node 0, zone Device + pages free 0 + min 0 + low 0 + high 0 + spanned 0 + present 0 + managed 0 + protection: (0, 0, 0, 0, 0) +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -921,6 +2683,9 @@ Lines: 1 0x20 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/net/eth0/device +SymlinkTo: ../../../devices/pci0000:00/0000:00:1f.6/ +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/sys/class/net/eth0/dormant Lines: 1 1 @@ -1005,114 +2770,391 @@ Mode: 644 Directory: fixtures/sys/class/power_supply Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply/AC +Path: fixtures/sys/class/power_supply/AC +SymlinkTo: ../../devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/power_supply/BAT0 +SymlinkTo: ../../devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/cooling_device0 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/online +Path: fixtures/sys/class/thermal/cooling_device0/cur_state +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/max_state +Lines: 1 +50 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/type +Lines: 1 +Processor +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/cooling_device1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/cur_state +Lines: 1 +-1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/max_state +Lines: 1 +27 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/type +Lines: 1 +intel_powerclamp +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/thermal_zone0 +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/policy +Lines: 1 +step_wise +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/temp +Lines: 1 +49925 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/type +Lines: 1 +bcm2835_thermal +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/thermal_zone1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/mode +Lines: 1 +enabled +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/passive +Lines: 1 +0 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/policy +Lines: 1 +step_wise +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/temp +Lines: 1 +44000 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/type +Lines: 1 +acpitz +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/device +SymlinkTo: ../../../ACPI0003:00 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/online +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/async +Lines: 1 +disabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/autosuspend_delay_ms +Lines: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/control +Lines: 1 +auto +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_active_kids +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_active_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_enabled +Lines: 1 +disabled +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_status +Lines: 1 +unsupported +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_suspended_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_usage +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup +Lines: 1 +enabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_abort_count +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_active +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_active_count +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_count +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_expire_count +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_last_time_ms +Lines: 1 +10598 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_max_time_ms +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_prevent_sleep_time_ms Lines: 1 0 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_total_time_ms +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/subsystem +SymlinkTo: ../../../../../../../../../class/power_supply +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/type Lines: 1 Mains Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/uevent +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/uevent Lines: 2 POWER_SUPPLY_NAME=AC POWER_SUPPLY_ONLINE=0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply/BAT0 +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/alarm +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/alarm Lines: 1 -2503000 +2369000 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/capacity +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/capacity Lines: 1 98 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/capacity_level +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/capacity_level Lines: 1 Normal Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/charge_start_threshold +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/charge_start_threshold Lines: 1 95 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/charge_stop_threshold +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/charge_stop_threshold Lines: 1 100 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/cycle_count +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/cycle_count Lines: 1 0 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_full +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/device +SymlinkTo: ../../../PNP0C0A:00 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_full Lines: 1 50060000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_full_design +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_full_design Lines: 1 47520000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_now +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_now Lines: 1 49450000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/manufacturer +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/manufacturer Lines: 1 LGC Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/model_name +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/model_name Lines: 1 LNV-45N1 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/power_now +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/async +Lines: 1 +disabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/autosuspend_delay_ms +Lines: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/control +Lines: 1 +auto +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_active_kids +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_active_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_enabled +Lines: 1 +disabled +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_status +Lines: 1 +unsupported +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_suspended_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_usage +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power_now Lines: 1 4830000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/present +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/present Lines: 1 1 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/serial_number +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/serial_number Lines: 1 38109 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/status +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/status Lines: 1 Discharging Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/technology +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/subsystem +SymlinkTo: ../../../../../../../../../class/power_supply +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/technology Lines: 1 Li-ion Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/type Lines: 1 Battery Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/uevent +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/uevent Lines: 16 POWER_SUPPLY_NAME=BAT0 POWER_SUPPLY_STATUS=Discharging @@ -1120,80 +3162,28 @@ POWER_SUPPLY_PRESENT=1 POWER_SUPPLY_TECHNOLOGY=Li-ion POWER_SUPPLY_CYCLE_COUNT=0 POWER_SUPPLY_VOLTAGE_MIN_DESIGN=10800000 -POWER_SUPPLY_VOLTAGE_NOW=12229000 -POWER_SUPPLY_POWER_NOW=4830000 +POWER_SUPPLY_VOLTAGE_NOW=11750000 +POWER_SUPPLY_POWER_NOW=5064000 POWER_SUPPLY_ENERGY_FULL_DESIGN=47520000 -POWER_SUPPLY_ENERGY_FULL=50060000 -POWER_SUPPLY_ENERGY_NOW=49450000 -POWER_SUPPLY_CAPACITY=98 +POWER_SUPPLY_ENERGY_FULL=47390000 +POWER_SUPPLY_ENERGY_NOW=40730000 +POWER_SUPPLY_CAPACITY=85 POWER_SUPPLY_CAPACITY_LEVEL=Normal POWER_SUPPLY_MODEL_NAME=LNV-45N1 POWER_SUPPLY_MANUFACTURER=LGC POWER_SUPPLY_SERIAL_NUMBER=38109 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/voltage_min_design +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/voltage_min_design Lines: 1 10800000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/voltage_now +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/voltage_now Lines: 1 12229000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal/thermal_zone0 -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/policy -Lines: 1 -step_wise -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/temp -Lines: 1 -49925 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/type -Lines: 1 -bcm2835_thermal -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal/thermal_zone1 -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/mode -Lines: 1 -enabled -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/passive -Lines: 1 -0 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/policy -Lines: 1 -step_wise -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/temp -Lines: 1 -44000 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/type -Lines: 1 -acpitz -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/devices -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/pci0000:00 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1443,6 +3433,131 @@ Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/pci0000:00/0000:00:1f.6 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/ari_enabled +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/broken_parity_status +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/class +Lines: 1 +0x020000 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/consistent_dma_mask_bits +Lines: 1 +64 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/d3cold_allowed +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/device +Lines: 1 +0x15d7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/dma_mask_bits +Lines: 1 +64 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/driver_override +Lines: 1 +(null) +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/enable +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/irq +Lines: 1 +140 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/local_cpulist +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/local_cpus +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/modalias +Lines: 1 +pci:v00008086d000015D7sv000017AAsd0000225Abc02sc00i00 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/msi_bus +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/numa_node +Lines: 1 +-1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/resource +Lines: 13 +0x00000000ec200000 0x00000000ec21ffff 0x0000000000040200 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/revision +Lines: 1 +0x21 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/subsystem_device +Lines: 1 +0x225a +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/subsystem_vendor +Lines: 1 +0x17aa +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/uevent +Lines: 6 +DRIVER=e1000e +PCI_CLASS=20000 +PCI_ID=8086:15D7 +PCI_SUBSYS_ID=17AA:225A +PCI_SLOT_NAME=0000:00:1f.6 +MODALIAS=pci:v00008086d000015D7sv000017AAsd0000225Abc02sc00i00 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/vendor +Lines: 1 +0x8086 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/rbd Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1500,6 +3615,52 @@ Mode: 775 Path: fixtures/sys/devices/system/cpu/cpu0/cpufreq SymlinkTo: ../cpufreq/policy0 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle/core_throttle_count +Lines: 1 +10084 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle/package_throttle_count +Lines: 1 +34818 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu0/topology +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_siblings +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_siblings_list +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/physical_package_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/thread_siblings +Lines: 1 +11 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/thread_siblings_list +Lines: 1 +0,4 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/system/cpu/cpu1 Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1561,6 +3722,52 @@ Lines: 1 <unsupported> Mode: 664 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle/core_throttle_count +Lines: 1 +523 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle/package_throttle_count +Lines: 1 +34818 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu1/topology +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_id +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_siblings +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_siblings_list +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/physical_package_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/thread_siblings +Lines: 1 +22 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/thread_siblings_list +Lines: 1 +1,5 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/system/cpu/cpufreq Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - diff --git a/vendor/github.com/prometheus/procfs/internal/util/parse.go b/vendor/github.com/prometheus/procfs/internal/util/parse.go new file mode 100644 index 000000000..755591d9a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/parse.go @@ -0,0 +1,88 @@ +// Copyright 2018 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package util + +import ( + "io/ioutil" + "strconv" + "strings" +) + +// ParseUint32s parses a slice of strings into a slice of uint32s. +func ParseUint32s(ss []string) ([]uint32, error) { + us := make([]uint32, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseUint(s, 10, 32) + if err != nil { + return nil, err + } + + us = append(us, uint32(u)) + } + + return us, nil +} + +// ParseUint64s parses a slice of strings into a slice of uint64s. +func ParseUint64s(ss []string) ([]uint64, error) { + us := make([]uint64, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseUint(s, 10, 64) + if err != nil { + return nil, err + } + + us = append(us, u) + } + + return us, nil +} + +// ParsePInt64s parses a slice of strings into a slice of int64 pointers. +func ParsePInt64s(ss []string) ([]*int64, error) { + us := make([]*int64, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseInt(s, 10, 64) + if err != nil { + return nil, err + } + + us = append(us, &u) + } + + return us, nil +} + +// ReadUintFromFile reads a file and attempts to parse a uint64 from it. +func ReadUintFromFile(path string) (uint64, error) { + data, err := ioutil.ReadFile(path) + if err != nil { + return 0, err + } + return strconv.ParseUint(strings.TrimSpace(string(data)), 10, 64) +} + +// ParseBool parses a string into a boolean pointer. +func ParseBool(b string) *bool { + var truth bool + switch b { + case "enabled": + truth = true + case "disabled": + truth = false + default: + return nil + } + return &truth +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go new file mode 100644 index 000000000..68b37c4b3 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go @@ -0,0 +1,45 @@ +// Copyright 2018 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build linux,!appengine + +package util + +import ( + "bytes" + "os" + "syscall" +) + +// SysReadFile is a simplified ioutil.ReadFile that invokes syscall.Read directly. +// https://github.com/prometheus/node_exporter/pull/728/files +func SysReadFile(file string) (string, error) { + f, err := os.Open(file) + if err != nil { + return "", err + } + defer f.Close() + + // On some machines, hwmon drivers are broken and return EAGAIN. This causes + // Go's ioutil.ReadFile implementation to poll forever. + // + // Since we either want to read data or bail immediately, do the simplest + // possible read using syscall directly. + b := make([]byte, 128) + n, err := syscall.Read(int(f.Fd()), b) + if err != nil { + return "", err + } + + return string(bytes.TrimSpace(b[:n])), nil +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go new file mode 100644 index 000000000..bd55b4537 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go @@ -0,0 +1,26 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build linux,appengine !linux + +package util + +import ( + "fmt" +) + +// SysReadFile is here implemented as a noop for builds that do not support +// the read syscall. For example Windows, or Linux on Google App Engine. +func SysReadFile(file string) (string, error) { + return "", fmt.Errorf("not supported on this platform") +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/valueparser.go b/vendor/github.com/prometheus/procfs/internal/util/valueparser.go new file mode 100644 index 000000000..ac93cb42d --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/valueparser.go @@ -0,0 +1,77 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package util + +import ( + "strconv" +) + +// TODO(mdlayher): util packages are an anti-pattern and this should be moved +// somewhere else that is more focused in the future. + +// A ValueParser enables parsing a single string into a variety of data types +// in a concise and safe way. The Err method must be invoked after invoking +// any other methods to ensure a value was successfully parsed. +type ValueParser struct { + v string + err error +} + +// NewValueParser creates a ValueParser using the input string. +func NewValueParser(v string) *ValueParser { + return &ValueParser{v: v} +} + +// PInt64 interprets the underlying value as an int64 and returns a pointer to +// that value. +func (vp *ValueParser) PInt64() *int64 { + if vp.err != nil { + return nil + } + + // A base value of zero makes ParseInt infer the correct base using the + // string's prefix, if any. + const base = 0 + v, err := strconv.ParseInt(vp.v, base, 64) + if err != nil { + vp.err = err + return nil + } + + return &v +} + +// PUInt64 interprets the underlying value as an uint64 and returns a pointer to +// that value. +func (vp *ValueParser) PUInt64() *uint64 { + if vp.err != nil { + return nil + } + + // A base value of zero makes ParseInt infer the correct base using the + // string's prefix, if any. + const base = 0 + v, err := strconv.ParseUint(vp.v, base, 64) + if err != nil { + vp.err = err + return nil + } + + return &v +} + +// Err returns the last error, if any, encountered by the ValueParser. +func (vp *ValueParser) Err() error { + return vp.err +} diff --git a/vendor/github.com/prometheus/procfs/net_softnet.go b/vendor/github.com/prometheus/procfs/net_softnet.go new file mode 100644 index 000000000..6fcad20af --- /dev/null +++ b/vendor/github.com/prometheus/procfs/net_softnet.go @@ -0,0 +1,91 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "fmt" + "io/ioutil" + "strconv" + "strings" +) + +// For the proc file format details, +// see https://elixir.bootlin.com/linux/v4.17/source/net/core/net-procfs.c#L162 +// and https://elixir.bootlin.com/linux/v4.17/source/include/linux/netdevice.h#L2810. + +// SoftnetEntry contains a single row of data from /proc/net/softnet_stat +type SoftnetEntry struct { + // Number of processed packets + Processed uint + // Number of dropped packets + Dropped uint + // Number of times processing packets ran out of quota + TimeSqueezed uint +} + +// GatherSoftnetStats reads /proc/net/softnet_stat, parse the relevant columns, +// and then return a slice of SoftnetEntry's. +func (fs FS) GatherSoftnetStats() ([]SoftnetEntry, error) { + data, err := ioutil.ReadFile(fs.proc.Path("net/softnet_stat")) + if err != nil { + return nil, fmt.Errorf("error reading softnet %s: %s", fs.proc.Path("net/softnet_stat"), err) + } + + return parseSoftnetEntries(data) +} + +func parseSoftnetEntries(data []byte) ([]SoftnetEntry, error) { + lines := strings.Split(string(data), "\n") + entries := make([]SoftnetEntry, 0) + var err error + const ( + expectedColumns = 11 + ) + for _, line := range lines { + columns := strings.Fields(line) + width := len(columns) + if width == 0 { + continue + } + if width != expectedColumns { + return []SoftnetEntry{}, fmt.Errorf("%d columns were detected, but %d were expected", width, expectedColumns) + } + var entry SoftnetEntry + if entry, err = parseSoftnetEntry(columns); err != nil { + return []SoftnetEntry{}, err + } + entries = append(entries, entry) + } + + return entries, nil +} + +func parseSoftnetEntry(columns []string) (SoftnetEntry, error) { + var err error + var processed, dropped, timeSqueezed uint64 + if processed, err = strconv.ParseUint(columns[0], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 0: %s", err) + } + if dropped, err = strconv.ParseUint(columns[1], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 1: %s", err) + } + if timeSqueezed, err = strconv.ParseUint(columns[2], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 2: %s", err) + } + return SoftnetEntry{ + Processed: uint(processed), + Dropped: uint(dropped), + TimeSqueezed: uint(timeSqueezed), + }, nil +} diff --git a/vendor/github.com/prometheus/procfs/proc.go b/vendor/github.com/prometheus/procfs/proc.go index 41c148d06..b7c79cf77 100644 --- a/vendor/github.com/prometheus/procfs/proc.go +++ b/vendor/github.com/prometheus/procfs/proc.go @@ -279,3 +279,33 @@ func (p Proc) fileDescriptors() ([]string, error) { func (p Proc) path(pa ...string) string { return p.fs.Path(append([]string{strconv.Itoa(p.PID)}, pa...)...) } + +// FileDescriptorsInfo retrieves information about all file descriptors of +// the process. +func (p Proc) FileDescriptorsInfo() (ProcFDInfos, error) { + names, err := p.fileDescriptors() + if err != nil { + return nil, err + } + + var fdinfos ProcFDInfos + + for _, n := range names { + fdinfo, err := p.FDInfo(n) + if err != nil { + continue + } + fdinfos = append(fdinfos, *fdinfo) + } + + return fdinfos, nil +} + +// Schedstat returns task scheduling information for the process. +func (p Proc) Schedstat() (ProcSchedstat, error) { + contents, err := ioutil.ReadFile(p.path("schedstat")) + if err != nil { + return ProcSchedstat{}, err + } + return parseProcSchedstat(string(contents)) +} diff --git a/vendor/github.com/prometheus/procfs/proc_fdinfo.go b/vendor/github.com/prometheus/procfs/proc_fdinfo.go new file mode 100644 index 000000000..83b67d1bd --- /dev/null +++ b/vendor/github.com/prometheus/procfs/proc_fdinfo.go @@ -0,0 +1,132 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "fmt" + "io/ioutil" + "os" + "regexp" + "strings" +) + +// Regexp variables +var ( + rPos = regexp.MustCompile(`^pos:\s+(\d+)$`) + rFlags = regexp.MustCompile(`^flags:\s+(\d+)$`) + rMntID = regexp.MustCompile(`^mnt_id:\s+(\d+)$`) + rInotify = regexp.MustCompile(`^inotify`) +) + +// ProcFDInfo contains represents file descriptor information. +type ProcFDInfo struct { + // File descriptor + FD string + // File offset + Pos string + // File access mode and status flags + Flags string + // Mount point ID + MntID string + // List of inotify lines (structed) in the fdinfo file (kernel 3.8+ only) + InotifyInfos []InotifyInfo +} + +// FDInfo constructor. On kernels older than 3.8, InotifyInfos will always be empty. +func (p Proc) FDInfo(fd string) (*ProcFDInfo, error) { + f, err := os.Open(p.path("fdinfo", fd)) + if err != nil { + return nil, err + } + defer f.Close() + + fdinfo, err := ioutil.ReadAll(f) + if err != nil { + return nil, fmt.Errorf("could not read %s: %s", f.Name(), err) + } + + var text, pos, flags, mntid string + var inotify []InotifyInfo + + scanner := bufio.NewScanner(strings.NewReader(string(fdinfo))) + for scanner.Scan() { + text = scanner.Text() + if rPos.MatchString(text) { + pos = rPos.FindStringSubmatch(text)[1] + } else if rFlags.MatchString(text) { + flags = rFlags.FindStringSubmatch(text)[1] + } else if rMntID.MatchString(text) { + mntid = rMntID.FindStringSubmatch(text)[1] + } else if rInotify.MatchString(text) { + newInotify, err := parseInotifyInfo(text) + if err != nil { + return nil, err + } + inotify = append(inotify, *newInotify) + } + } + + i := &ProcFDInfo{ + FD: fd, + Pos: pos, + Flags: flags, + MntID: mntid, + InotifyInfos: inotify, + } + + return i, nil +} + +// InotifyInfo represents a single inotify line in the fdinfo file. +type InotifyInfo struct { + // Watch descriptor number + WD string + // Inode number + Ino string + // Device ID + Sdev string + // Mask of events being monitored + Mask string +} + +// InotifyInfo constructor. Only available on kernel 3.8+. +func parseInotifyInfo(line string) (*InotifyInfo, error) { + r := regexp.MustCompile(`^inotify\s+wd:([0-9a-f]+)\s+ino:([0-9a-f]+)\s+sdev:([0-9a-f]+)\s+mask:([0-9a-f]+)`) + m := r.FindStringSubmatch(line) + i := &InotifyInfo{ + WD: m[1], + Ino: m[2], + Sdev: m[3], + Mask: m[4], + } + return i, nil +} + +// ProcFDInfos represents a list of ProcFDInfo structs. +type ProcFDInfos []ProcFDInfo + +func (p ProcFDInfos) Len() int { return len(p) } +func (p ProcFDInfos) Swap(i, j int) { p[i], p[j] = p[j], p[i] } +func (p ProcFDInfos) Less(i, j int) bool { return p[i].FD < p[j].FD } + +// InotifyWatchLen returns the total number of inotify watches +func (p ProcFDInfos) InotifyWatchLen() (int, error) { + length := 0 + for _, f := range p { + length += len(f.InotifyInfos) + } + + return length, nil +} diff --git a/vendor/github.com/prometheus/procfs/proc_status.go b/vendor/github.com/prometheus/procfs/proc_status.go index 6b4b61f71..ad290fae7 100644 --- a/vendor/github.com/prometheus/procfs/proc_status.go +++ b/vendor/github.com/prometheus/procfs/proc_status.go @@ -21,7 +21,7 @@ import ( "strings" ) -// ProcStat provides status information about the process, +// ProcStatus provides status information about the process, // read from /proc/[pid]/stat. type ProcStatus struct { // The process ID. @@ -29,6 +29,9 @@ type ProcStatus struct { // The process name. Name string + // Thread group ID. + TGID int + // Peak virtual memory size. VmPeak uint64 // Virtual memory size. @@ -113,6 +116,8 @@ func (p Proc) NewStatus() (ProcStatus, error) { func (s *ProcStatus) fillStatus(k string, vString string, vUint uint64, vUintBytes uint64) { switch k { + case "Tgid": + s.TGID = int(vUint) case "Name": s.Name = vString case "VmPeak": diff --git a/vendor/github.com/prometheus/procfs/schedstat.go b/vendor/github.com/prometheus/procfs/schedstat.go new file mode 100644 index 000000000..a4c4089ac --- /dev/null +++ b/vendor/github.com/prometheus/procfs/schedstat.go @@ -0,0 +1,118 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "errors" + "os" + "regexp" + "strconv" +) + +var ( + cpuLineRE = regexp.MustCompile(`cpu(\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+)`) + procLineRE = regexp.MustCompile(`(\d+) (\d+) (\d+)`) +) + +// Schedstat contains scheduler statistics from /proc/schedstat +// +// See +// https://www.kernel.org/doc/Documentation/scheduler/sched-stats.txt +// for a detailed description of what these numbers mean. +// +// Note the current kernel documentation claims some of the time units are in +// jiffies when they are actually in nanoseconds since 2.6.23 with the +// introduction of CFS. A fix to the documentation is pending. See +// https://lore.kernel.org/patchwork/project/lkml/list/?series=403473 +type Schedstat struct { + CPUs []*SchedstatCPU +} + +// SchedstatCPU contains the values from one "cpu<N>" line +type SchedstatCPU struct { + CPUNum string + + RunningNanoseconds uint64 + WaitingNanoseconds uint64 + RunTimeslices uint64 +} + +// ProcSchedstat contains the values from /proc/<pid>/schedstat +type ProcSchedstat struct { + RunningNanoseconds uint64 + WaitingNanoseconds uint64 + RunTimeslices uint64 +} + +// Schedstat reads data from /proc/schedstat +func (fs FS) Schedstat() (*Schedstat, error) { + file, err := os.Open(fs.proc.Path("schedstat")) + if err != nil { + return nil, err + } + defer file.Close() + + stats := &Schedstat{} + scanner := bufio.NewScanner(file) + + for scanner.Scan() { + match := cpuLineRE.FindStringSubmatch(scanner.Text()) + if match != nil { + cpu := &SchedstatCPU{} + cpu.CPUNum = match[1] + + cpu.RunningNanoseconds, err = strconv.ParseUint(match[8], 10, 64) + if err != nil { + continue + } + + cpu.WaitingNanoseconds, err = strconv.ParseUint(match[9], 10, 64) + if err != nil { + continue + } + + cpu.RunTimeslices, err = strconv.ParseUint(match[10], 10, 64) + if err != nil { + continue + } + + stats.CPUs = append(stats.CPUs, cpu) + } + } + + return stats, nil +} + +func parseProcSchedstat(contents string) (stats ProcSchedstat, err error) { + match := procLineRE.FindStringSubmatch(contents) + + if match != nil { + stats.RunningNanoseconds, err = strconv.ParseUint(match[1], 10, 64) + if err != nil { + return + } + + stats.WaitingNanoseconds, err = strconv.ParseUint(match[2], 10, 64) + if err != nil { + return + } + + stats.RunTimeslices, err = strconv.ParseUint(match[3], 10, 64) + return + } + + err = errors.New("could not parse schedstat") + return +} diff --git a/vendor/github.com/prometheus/procfs/vm.go b/vendor/github.com/prometheus/procfs/vm.go new file mode 100644 index 000000000..cb1389141 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/vm.go @@ -0,0 +1,210 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !windows + +package procfs + +import ( + "fmt" + "io/ioutil" + "os" + "path/filepath" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// The VM interface is described at +// https://www.kernel.org/doc/Documentation/sysctl/vm.txt +// Each setting is exposed as a single file. +// Each file contains one line with a single numerical value, except lowmem_reserve_ratio which holds an array +// and numa_zonelist_order (deprecated) which is a string +type VM struct { + AdminReserveKbytes *int64 // /proc/sys/vm/admin_reserve_kbytes + BlockDump *int64 // /proc/sys/vm/block_dump + CompactUnevictableAllowed *int64 // /proc/sys/vm/compact_unevictable_allowed + DirtyBackgroundBytes *int64 // /proc/sys/vm/dirty_background_bytes + DirtyBackgroundRatio *int64 // /proc/sys/vm/dirty_background_ratio + DirtyBytes *int64 // /proc/sys/vm/dirty_bytes + DirtyExpireCentisecs *int64 // /proc/sys/vm/dirty_expire_centisecs + DirtyRatio *int64 // /proc/sys/vm/dirty_ratio + DirtytimeExpireSeconds *int64 // /proc/sys/vm/dirtytime_expire_seconds + DirtyWritebackCentisecs *int64 // /proc/sys/vm/dirty_writeback_centisecs + DropCaches *int64 // /proc/sys/vm/drop_caches + ExtfragThreshold *int64 // /proc/sys/vm/extfrag_threshold + HugetlbShmGroup *int64 // /proc/sys/vm/hugetlb_shm_group + LaptopMode *int64 // /proc/sys/vm/laptop_mode + LegacyVaLayout *int64 // /proc/sys/vm/legacy_va_layout + LowmemReserveRatio []*int64 // /proc/sys/vm/lowmem_reserve_ratio + MaxMapCount *int64 // /proc/sys/vm/max_map_count + MemoryFailureEarlyKill *int64 // /proc/sys/vm/memory_failure_early_kill + MemoryFailureRecovery *int64 // /proc/sys/vm/memory_failure_recovery + MinFreeKbytes *int64 // /proc/sys/vm/min_free_kbytes + MinSlabRatio *int64 // /proc/sys/vm/min_slab_ratio + MinUnmappedRatio *int64 // /proc/sys/vm/min_unmapped_ratio + MmapMinAddr *int64 // /proc/sys/vm/mmap_min_addr + NrHugepages *int64 // /proc/sys/vm/nr_hugepages + NrHugepagesMempolicy *int64 // /proc/sys/vm/nr_hugepages_mempolicy + NrOvercommitHugepages *int64 // /proc/sys/vm/nr_overcommit_hugepages + NumaStat *int64 // /proc/sys/vm/numa_stat + NumaZonelistOrder string // /proc/sys/vm/numa_zonelist_order + OomDumpTasks *int64 // /proc/sys/vm/oom_dump_tasks + OomKillAllocatingTask *int64 // /proc/sys/vm/oom_kill_allocating_task + OvercommitKbytes *int64 // /proc/sys/vm/overcommit_kbytes + OvercommitMemory *int64 // /proc/sys/vm/overcommit_memory + OvercommitRatio *int64 // /proc/sys/vm/overcommit_ratio + PageCluster *int64 // /proc/sys/vm/page-cluster + PanicOnOom *int64 // /proc/sys/vm/panic_on_oom + PercpuPagelistFraction *int64 // /proc/sys/vm/percpu_pagelist_fraction + StatInterval *int64 // /proc/sys/vm/stat_interval + Swappiness *int64 // /proc/sys/vm/swappiness + UserReserveKbytes *int64 // /proc/sys/vm/user_reserve_kbytes + VfsCachePressure *int64 // /proc/sys/vm/vfs_cache_pressure + WatermarkBoostFactor *int64 // /proc/sys/vm/watermark_boost_factor + WatermarkScaleFactor *int64 // /proc/sys/vm/watermark_scale_factor + ZoneReclaimMode *int64 // /proc/sys/vm/zone_reclaim_mode +} + +// VM reads the VM statistics from the specified `proc` filesystem. +func (fs FS) VM() (*VM, error) { + path := fs.proc.Path("sys/vm") + file, err := os.Stat(path) + if err != nil { + return nil, err + } + if !file.Mode().IsDir() { + return nil, fmt.Errorf("%s is not a directory", path) + } + + files, err := ioutil.ReadDir(path) + if err != nil { + return nil, err + } + + var vm VM + for _, f := range files { + if f.IsDir() { + continue + } + + name := filepath.Join(path, f.Name()) + // ignore errors on read, as there are some write only + // in /proc/sys/vm + value, err := util.SysReadFile(name) + if err != nil { + continue + } + vp := util.NewValueParser(value) + + switch f.Name() { + case "admin_reserve_kbytes": + vm.AdminReserveKbytes = vp.PInt64() + case "block_dump": + vm.BlockDump = vp.PInt64() + case "compact_unevictable_allowed": + vm.CompactUnevictableAllowed = vp.PInt64() + case "dirty_background_bytes": + vm.DirtyBackgroundBytes = vp.PInt64() + case "dirty_background_ratio": + vm.DirtyBackgroundRatio = vp.PInt64() + case "dirty_bytes": + vm.DirtyBytes = vp.PInt64() + case "dirty_expire_centisecs": + vm.DirtyExpireCentisecs = vp.PInt64() + case "dirty_ratio": + vm.DirtyRatio = vp.PInt64() + case "dirtytime_expire_seconds": + vm.DirtytimeExpireSeconds = vp.PInt64() + case "dirty_writeback_centisecs": + vm.DirtyWritebackCentisecs = vp.PInt64() + case "drop_caches": + vm.DropCaches = vp.PInt64() + case "extfrag_threshold": + vm.ExtfragThreshold = vp.PInt64() + case "hugetlb_shm_group": + vm.HugetlbShmGroup = vp.PInt64() + case "laptop_mode": + vm.LaptopMode = vp.PInt64() + case "legacy_va_layout": + vm.LegacyVaLayout = vp.PInt64() + case "lowmem_reserve_ratio": + stringSlice := strings.Fields(value) + pint64Slice := make([]*int64, 0, len(stringSlice)) + for _, value := range stringSlice { + vp := util.NewValueParser(value) + pint64Slice = append(pint64Slice, vp.PInt64()) + } + vm.LowmemReserveRatio = pint64Slice + case "max_map_count": + vm.MaxMapCount = vp.PInt64() + case "memory_failure_early_kill": + vm.MemoryFailureEarlyKill = vp.PInt64() + case "memory_failure_recovery": + vm.MemoryFailureRecovery = vp.PInt64() + case "min_free_kbytes": + vm.MinFreeKbytes = vp.PInt64() + case "min_slab_ratio": + vm.MinSlabRatio = vp.PInt64() + case "min_unmapped_ratio": + vm.MinUnmappedRatio = vp.PInt64() + case "mmap_min_addr": + vm.MmapMinAddr = vp.PInt64() + case "nr_hugepages": + vm.NrHugepages = vp.PInt64() + case "nr_hugepages_mempolicy": + vm.NrHugepagesMempolicy = vp.PInt64() + case "nr_overcommit_hugepages": + vm.NrOvercommitHugepages = vp.PInt64() + case "numa_stat": + vm.NumaStat = vp.PInt64() + case "numa_zonelist_order": + vm.NumaZonelistOrder = value + case "oom_dump_tasks": + vm.OomDumpTasks = vp.PInt64() + case "oom_kill_allocating_task": + vm.OomKillAllocatingTask = vp.PInt64() + case "overcommit_kbytes": + vm.OvercommitKbytes = vp.PInt64() + case "overcommit_memory": + vm.OvercommitMemory = vp.PInt64() + case "overcommit_ratio": + vm.OvercommitRatio = vp.PInt64() + case "page-cluster": + vm.PageCluster = vp.PInt64() + case "panic_on_oom": + vm.PanicOnOom = vp.PInt64() + case "percpu_pagelist_fraction": + vm.PercpuPagelistFraction = vp.PInt64() + case "stat_interval": + vm.StatInterval = vp.PInt64() + case "swappiness": + vm.Swappiness = vp.PInt64() + case "user_reserve_kbytes": + vm.UserReserveKbytes = vp.PInt64() + case "vfs_cache_pressure": + vm.VfsCachePressure = vp.PInt64() + case "watermark_boost_factor": + vm.WatermarkBoostFactor = vp.PInt64() + case "watermark_scale_factor": + vm.WatermarkScaleFactor = vp.PInt64() + case "zone_reclaim_mode": + vm.ZoneReclaimMode = vp.PInt64() + } + if err := vp.Err(); err != nil { + return nil, err + } + } + + return &vm, nil +} diff --git a/vendor/github.com/prometheus/procfs/zoneinfo.go b/vendor/github.com/prometheus/procfs/zoneinfo.go new file mode 100644 index 000000000..e941503d5 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/zoneinfo.go @@ -0,0 +1,196 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !windows + +package procfs + +import ( + "bytes" + "fmt" + "io/ioutil" + "regexp" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// Zoneinfo holds info parsed from /proc/zoneinfo. +type Zoneinfo struct { + Node string + Zone string + NrFreePages *int64 + Min *int64 + Low *int64 + High *int64 + Scanned *int64 + Spanned *int64 + Present *int64 + Managed *int64 + NrActiveAnon *int64 + NrInactiveAnon *int64 + NrIsolatedAnon *int64 + NrAnonPages *int64 + NrAnonTransparentHugepages *int64 + NrActiveFile *int64 + NrInactiveFile *int64 + NrIsolatedFile *int64 + NrFilePages *int64 + NrSlabReclaimable *int64 + NrSlabUnreclaimable *int64 + NrMlockStack *int64 + NrKernelStack *int64 + NrMapped *int64 + NrDirty *int64 + NrWriteback *int64 + NrUnevictable *int64 + NrShmem *int64 + NrDirtied *int64 + NrWritten *int64 + NumaHit *int64 + NumaMiss *int64 + NumaForeign *int64 + NumaInterleave *int64 + NumaLocal *int64 + NumaOther *int64 + Protection []*int64 +} + +var nodeZoneRE = regexp.MustCompile(`(\d+), zone\s+(\w+)`) + +// Zoneinfo parses an zoneinfo-file (/proc/zoneinfo) and returns a slice of +// structs containing the relevant info. More information available here: +// https://www.kernel.org/doc/Documentation/sysctl/vm.txt +func (fs FS) Zoneinfo() ([]Zoneinfo, error) { + data, err := ioutil.ReadFile(fs.proc.Path("zoneinfo")) + if err != nil { + return nil, fmt.Errorf("error reading zoneinfo %s: %s", fs.proc.Path("zoneinfo"), err) + } + zoneinfo, err := parseZoneinfo(data) + if err != nil { + return nil, fmt.Errorf("error parsing zoneinfo %s: %s", fs.proc.Path("zoneinfo"), err) + } + return zoneinfo, nil +} + +func parseZoneinfo(zoneinfoData []byte) ([]Zoneinfo, error) { + + zoneinfo := []Zoneinfo{} + + zoneinfoBlocks := bytes.Split(zoneinfoData, []byte("\nNode")) + for _, block := range zoneinfoBlocks { + var zoneinfoElement Zoneinfo + lines := strings.Split(string(block), "\n") + for _, line := range lines { + + if nodeZone := nodeZoneRE.FindStringSubmatch(line); nodeZone != nil { + zoneinfoElement.Node = nodeZone[1] + zoneinfoElement.Zone = nodeZone[2] + continue + } + if strings.HasPrefix(strings.TrimSpace(line), "per-node stats") { + zoneinfoElement.Zone = "" + continue + } + parts := strings.Fields(strings.TrimSpace(line)) + if len(parts) < 2 { + continue + } + vp := util.NewValueParser(parts[1]) + switch parts[0] { + case "nr_free_pages": + zoneinfoElement.NrFreePages = vp.PInt64() + case "min": + zoneinfoElement.Min = vp.PInt64() + case "low": + zoneinfoElement.Low = vp.PInt64() + case "high": + zoneinfoElement.High = vp.PInt64() + case "scanned": + zoneinfoElement.Scanned = vp.PInt64() + case "spanned": + zoneinfoElement.Spanned = vp.PInt64() + case "present": + zoneinfoElement.Present = vp.PInt64() + case "managed": + zoneinfoElement.Managed = vp.PInt64() + case "nr_active_anon": + zoneinfoElement.NrActiveAnon = vp.PInt64() + case "nr_inactive_anon": + zoneinfoElement.NrInactiveAnon = vp.PInt64() + case "nr_isolated_anon": + zoneinfoElement.NrIsolatedAnon = vp.PInt64() + case "nr_anon_pages": + zoneinfoElement.NrAnonPages = vp.PInt64() + case "nr_anon_transparent_hugepages": + zoneinfoElement.NrAnonTransparentHugepages = vp.PInt64() + case "nr_active_file": + zoneinfoElement.NrActiveFile = vp.PInt64() + case "nr_inactive_file": + zoneinfoElement.NrInactiveFile = vp.PInt64() + case "nr_isolated_file": + zoneinfoElement.NrIsolatedFile = vp.PInt64() + case "nr_file_pages": + zoneinfoElement.NrFilePages = vp.PInt64() + case "nr_slab_reclaimable": + zoneinfoElement.NrSlabReclaimable = vp.PInt64() + case "nr_slab_unreclaimable": + zoneinfoElement.NrSlabUnreclaimable = vp.PInt64() + case "nr_mlock_stack": + zoneinfoElement.NrMlockStack = vp.PInt64() + case "nr_kernel_stack": + zoneinfoElement.NrKernelStack = vp.PInt64() + case "nr_mapped": + zoneinfoElement.NrMapped = vp.PInt64() + case "nr_dirty": + zoneinfoElement.NrDirty = vp.PInt64() + case "nr_writeback": + zoneinfoElement.NrWriteback = vp.PInt64() + case "nr_unevictable": + zoneinfoElement.NrUnevictable = vp.PInt64() + case "nr_shmem": + zoneinfoElement.NrShmem = vp.PInt64() + case "nr_dirtied": + zoneinfoElement.NrDirtied = vp.PInt64() + case "nr_written": + zoneinfoElement.NrWritten = vp.PInt64() + case "numa_hit": + zoneinfoElement.NumaHit = vp.PInt64() + case "numa_miss": + zoneinfoElement.NumaMiss = vp.PInt64() + case "numa_foreign": + zoneinfoElement.NumaForeign = vp.PInt64() + case "numa_interleave": + zoneinfoElement.NumaInterleave = vp.PInt64() + case "numa_local": + zoneinfoElement.NumaLocal = vp.PInt64() + case "numa_other": + zoneinfoElement.NumaOther = vp.PInt64() + case "protection:": + protectionParts := strings.Split(line, ":") + protectionValues := strings.Replace(protectionParts[1], "(", "", 1) + protectionValues = strings.Replace(protectionValues, ")", "", 1) + protectionValues = strings.TrimSpace(protectionValues) + protectionStringMap := strings.Split(protectionValues, ", ") + val, err := util.ParsePInt64s(protectionStringMap) + if err == nil { + zoneinfoElement.Protection = val + } + } + + } + + zoneinfo = append(zoneinfo, zoneinfoElement) + } + return zoneinfo, nil +} diff --git a/vendor/go.opencensus.io/.gitignore b/vendor/go.opencensus.io/.gitignore new file mode 100644 index 000000000..74a6db472 --- /dev/null +++ b/vendor/go.opencensus.io/.gitignore @@ -0,0 +1,9 @@ +/.idea/ + +# go.opencensus.io/exporter/aws +/exporter/aws/ + +# Exclude vendor, use dep ensure after checkout: +/vendor/github.com/ +/vendor/golang.org/ +/vendor/google.golang.org/ diff --git a/vendor/go.opencensus.io/.travis.yml b/vendor/go.opencensus.io/.travis.yml new file mode 100644 index 000000000..bd6b66ee8 --- /dev/null +++ b/vendor/go.opencensus.io/.travis.yml @@ -0,0 +1,17 @@ +language: go + +go_import_path: go.opencensus.io + +go: + - 1.11.x + +env: + global: + GO111MODULE=on + +before_script: + - make install-tools + +script: + - make travis-ci + - go run internal/check/version.go # TODO move this to makefile diff --git a/vendor/go.opencensus.io/AUTHORS b/vendor/go.opencensus.io/AUTHORS new file mode 100644 index 000000000..e491a9e7f --- /dev/null +++ b/vendor/go.opencensus.io/AUTHORS @@ -0,0 +1 @@ +Google Inc. diff --git a/vendor/go.opencensus.io/CONTRIBUTING.md b/vendor/go.opencensus.io/CONTRIBUTING.md new file mode 100644 index 000000000..1ba3962c8 --- /dev/null +++ b/vendor/go.opencensus.io/CONTRIBUTING.md @@ -0,0 +1,63 @@ +# How to contribute + +We'd love to accept your patches and contributions to this project. There are +just a few small guidelines you need to follow. + +## Contributor License Agreement + +Contributions to this project must be accompanied by a Contributor License +Agreement. You (or your employer) retain the copyright to your contribution, +this simply gives us permission to use and redistribute your contributions as +part of the project. Head over to <https://cla.developers.google.com/> to see +your current agreements on file or to sign a new one. + +You generally only need to submit a CLA once, so if you've already submitted one +(even if it was for a different project), you probably don't need to do it +again. + +## Code reviews + +All submissions, including submissions by project members, require review. We +use GitHub pull requests for this purpose. Consult [GitHub Help] for more +information on using pull requests. + +[GitHub Help]: https://help.github.com/articles/about-pull-requests/ + +## Instructions + +Fork the repo, checkout the upstream repo to your GOPATH by: + +``` +$ go get -d go.opencensus.io +``` + +Add your fork as an origin: + +``` +cd $(go env GOPATH)/src/go.opencensus.io +git remote add fork git@github.com:YOUR_GITHUB_USERNAME/opencensus-go.git +``` + +Run tests: + +``` +$ make install-tools # Only first time. +$ make +``` + +Checkout a new branch, make modifications and push the branch to your fork: + +``` +$ git checkout -b feature +# edit files +$ git commit +$ git push fork feature +``` + +Open a pull request against the main opencensus-go repo. + +## General Notes +This project uses Appveyor and Travis for CI. + +The dependencies are managed with `go mod` if you work with the sources under your +`$GOPATH` you need to set the environment variable `GO111MODULE=on`.
\ No newline at end of file diff --git a/vendor/go.opencensus.io/Gopkg.lock b/vendor/go.opencensus.io/Gopkg.lock new file mode 100644 index 000000000..3be12ac8f --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.lock @@ -0,0 +1,231 @@ +# This file is autogenerated, do not edit; changes may be undone by the next 'dep ensure'. + + +[[projects]] + branch = "master" + digest = "1:eee9386329f4fcdf8d6c0def0c9771b634bdd5ba460d888aa98c17d59b37a76c" + name = "git.apache.org/thrift.git" + packages = ["lib/go/thrift"] + pruneopts = "UT" + revision = "6e67faa92827ece022380b211c2caaadd6145bf5" + source = "github.com/apache/thrift" + +[[projects]] + branch = "master" + digest = "1:d6afaeed1502aa28e80a4ed0981d570ad91b2579193404256ce672ed0a609e0d" + name = "github.com/beorn7/perks" + packages = ["quantile"] + pruneopts = "UT" + revision = "3a771d992973f24aa725d07868b467d1ddfceafb" + +[[projects]] + digest = "1:4c0989ca0bcd10799064318923b9bc2db6b4d6338dd75f3f2d86c3511aaaf5cf" + name = "github.com/golang/protobuf" + packages = [ + "proto", + "ptypes", + "ptypes/any", + "ptypes/duration", + "ptypes/timestamp", + ] + pruneopts = "UT" + revision = "aa810b61a9c79d51363740d207bb46cf8e620ed5" + version = "v1.2.0" + +[[projects]] + digest = "1:ff5ebae34cfbf047d505ee150de27e60570e8c394b3b8fdbb720ff6ac71985fc" + name = "github.com/matttproud/golang_protobuf_extensions" + packages = ["pbutil"] + pruneopts = "UT" + revision = "c12348ce28de40eed0136aa2b644d0ee0650e56c" + version = "v1.0.1" + +[[projects]] + digest = "1:824c8f3aa4c5f23928fa84ebbd5ed2e9443b3f0cb958a40c1f2fbed5cf5e64b1" + name = "github.com/openzipkin/zipkin-go" + packages = [ + ".", + "idgenerator", + "model", + "propagation", + "reporter", + "reporter/http", + ] + pruneopts = "UT" + revision = "d455a5674050831c1e187644faa4046d653433c2" + version = "v0.1.1" + +[[projects]] + digest = "1:d14a5f4bfecf017cb780bdde1b6483e5deb87e12c332544d2c430eda58734bcb" + name = "github.com/prometheus/client_golang" + packages = [ + "prometheus", + "prometheus/promhttp", + ] + pruneopts = "UT" + revision = "c5b7fccd204277076155f10851dad72b76a49317" + version = "v0.8.0" + +[[projects]] + branch = "master" + digest = "1:2d5cd61daa5565187e1d96bae64dbbc6080dacf741448e9629c64fd93203b0d4" + name = "github.com/prometheus/client_model" + packages = ["go"] + pruneopts = "UT" + revision = "5c3871d89910bfb32f5fcab2aa4b9ec68e65a99f" + +[[projects]] + branch = "master" + digest = "1:63b68062b8968092eb86bedc4e68894bd096ea6b24920faca8b9dcf451f54bb5" + name = "github.com/prometheus/common" + packages = [ + "expfmt", + "internal/bitbucket.org/ww/goautoneg", + "model", + ] + pruneopts = "UT" + revision = "c7de2306084e37d54b8be01f3541a8464345e9a5" + +[[projects]] + branch = "master" + digest = "1:8c49953a1414305f2ff5465147ee576dd705487c35b15918fcd4efdc0cb7a290" + name = "github.com/prometheus/procfs" + packages = [ + ".", + "internal/util", + "nfs", + "xfs", + ] + pruneopts = "UT" + revision = "05ee40e3a273f7245e8777337fc7b46e533a9a92" + +[[projects]] + branch = "master" + digest = "1:deafe4ab271911fec7de5b693d7faae3f38796d9eb8622e2b9e7df42bb3dfea9" + name = "golang.org/x/net" + packages = [ + "context", + "http/httpguts", + "http2", + "http2/hpack", + "idna", + "internal/timeseries", + "trace", + ] + pruneopts = "UT" + revision = "922f4815f713f213882e8ef45e0d315b164d705c" + +[[projects]] + branch = "master" + digest = "1:e0140c0c868c6e0f01c0380865194592c011fe521d6e12d78bfd33e756fe018a" + name = "golang.org/x/sync" + packages = ["semaphore"] + pruneopts = "UT" + revision = "1d60e4601c6fd243af51cc01ddf169918a5407ca" + +[[projects]] + branch = "master" + digest = "1:a3f00ac457c955fe86a41e1495e8f4c54cb5399d609374c5cc26aa7d72e542c8" + name = "golang.org/x/sys" + packages = ["unix"] + pruneopts = "UT" + revision = "3b58ed4ad3395d483fc92d5d14123ce2c3581fec" + +[[projects]] + digest = "1:a2ab62866c75542dd18d2b069fec854577a20211d7c0ea6ae746072a1dccdd18" + name = "golang.org/x/text" + packages = [ + "collate", + "collate/build", + "internal/colltab", + "internal/gen", + "internal/tag", + "internal/triegen", + "internal/ucd", + "language", + "secure/bidirule", + "transform", + "unicode/bidi", + "unicode/cldr", + "unicode/norm", + "unicode/rangetable", + ] + pruneopts = "UT" + revision = "f21a4dfb5e38f5895301dc265a8def02365cc3d0" + version = "v0.3.0" + +[[projects]] + branch = "master" + digest = "1:c0c17c94fe8bc1ab34e7f586a4a8b788c5e1f4f9f750ff23395b8b2f5a523530" + name = "google.golang.org/api" + packages = ["support/bundler"] + pruneopts = "UT" + revision = "e21acd801f91da814261b938941d193bb036441a" + +[[projects]] + branch = "master" + digest = "1:077c1c599507b3b3e9156d17d36e1e61928ee9b53a5b420f10f28ebd4a0b275c" + name = "google.golang.org/genproto" + packages = ["googleapis/rpc/status"] + pruneopts = "UT" + revision = "c66870c02cf823ceb633bcd05be3c7cda29976f4" + +[[projects]] + digest = "1:3dd7996ce6bf52dec6a2f69fa43e7c4cefea1d4dfa3c8ab7a5f8a9f7434e239d" + name = "google.golang.org/grpc" + packages = [ + ".", + "balancer", + "balancer/base", + "balancer/roundrobin", + "codes", + "connectivity", + "credentials", + "encoding", + "encoding/proto", + "grpclog", + "internal", + "internal/backoff", + "internal/channelz", + "internal/envconfig", + "internal/grpcrand", + "internal/transport", + "keepalive", + "metadata", + "naming", + "peer", + "resolver", + "resolver/dns", + "resolver/passthrough", + "stats", + "status", + "tap", + ] + pruneopts = "UT" + revision = "32fb0ac620c32ba40a4626ddf94d90d12cce3455" + version = "v1.14.0" + +[solve-meta] + analyzer-name = "dep" + analyzer-version = 1 + input-imports = [ + "git.apache.org/thrift.git/lib/go/thrift", + "github.com/golang/protobuf/proto", + "github.com/openzipkin/zipkin-go", + "github.com/openzipkin/zipkin-go/model", + "github.com/openzipkin/zipkin-go/reporter", + "github.com/openzipkin/zipkin-go/reporter/http", + "github.com/prometheus/client_golang/prometheus", + "github.com/prometheus/client_golang/prometheus/promhttp", + "golang.org/x/net/context", + "golang.org/x/net/http2", + "google.golang.org/api/support/bundler", + "google.golang.org/grpc", + "google.golang.org/grpc/codes", + "google.golang.org/grpc/grpclog", + "google.golang.org/grpc/metadata", + "google.golang.org/grpc/stats", + "google.golang.org/grpc/status", + ] + solver-name = "gps-cdcl" + solver-version = 1 diff --git a/vendor/go.opencensus.io/Gopkg.toml b/vendor/go.opencensus.io/Gopkg.toml new file mode 100644 index 000000000..a9f3cd68e --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.toml @@ -0,0 +1,36 @@ +# For v0.x.y dependencies, prefer adding a constraints of the form: version=">= 0.x.y" +# to avoid locking to a particular minor version which can cause dep to not be +# able to find a satisfying dependency graph. + +[[constraint]] + branch = "master" + name = "git.apache.org/thrift.git" + source = "github.com/apache/thrift" + +[[constraint]] + name = "github.com/golang/protobuf" + version = "1.0.0" + +[[constraint]] + name = "github.com/openzipkin/zipkin-go" + version = ">=0.1.0" + +[[constraint]] + name = "github.com/prometheus/client_golang" + version = ">=0.8.0" + +[[constraint]] + branch = "master" + name = "golang.org/x/net" + +[[constraint]] + branch = "master" + name = "google.golang.org/api" + +[[constraint]] + name = "google.golang.org/grpc" + version = "1.11.3" + +[prune] + go-tests = true + unused-packages = true diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 000000000..7a4a3ea24 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License.
\ No newline at end of file diff --git a/vendor/go.opencensus.io/Makefile b/vendor/go.opencensus.io/Makefile new file mode 100644 index 000000000..457866cb1 --- /dev/null +++ b/vendor/go.opencensus.io/Makefile @@ -0,0 +1,96 @@ +# TODO: Fix this on windows. +ALL_SRC := $(shell find . -name '*.go' \ + -not -path './vendor/*' \ + -not -path '*/gen-go/*' \ + -type f | sort) +ALL_PKGS := $(shell go list $(sort $(dir $(ALL_SRC)))) + +GOTEST_OPT?=-v -race -timeout 30s +GOTEST_OPT_WITH_COVERAGE = $(GOTEST_OPT) -coverprofile=coverage.txt -covermode=atomic +GOTEST=go test +GOFMT=gofmt +GOLINT=golint +GOVET=go vet +EMBEDMD=embedmd +# TODO decide if we need to change these names. +TRACE_ID_LINT_EXCEPTION="type name will be used as trace.TraceID by other packages" +TRACE_OPTION_LINT_EXCEPTION="type name will be used as trace.TraceOptions by other packages" +README_FILES := $(shell find . -name '*README.md' | sort | tr '\n' ' ') + +.DEFAULT_GOAL := fmt-lint-vet-embedmd-test + +.PHONY: fmt-lint-vet-embedmd-test +fmt-lint-vet-embedmd-test: fmt lint vet embedmd test + +# TODO enable test-with-coverage in tavis +.PHONY: travis-ci +travis-ci: fmt lint vet embedmd test test-386 + +all-pkgs: + @echo $(ALL_PKGS) | tr ' ' '\n' | sort + +all-srcs: + @echo $(ALL_SRC) | tr ' ' '\n' | sort + +.PHONY: test +test: + $(GOTEST) $(GOTEST_OPT) $(ALL_PKGS) + +.PHONY: test-386 +test-386: + GOARCH=386 $(GOTEST) -v -timeout 30s $(ALL_PKGS) + +.PHONY: test-with-coverage +test-with-coverage: + $(GOTEST) $(GOTEST_OPT_WITH_COVERAGE) $(ALL_PKGS) + +.PHONY: fmt +fmt: + @FMTOUT=`$(GOFMT) -s -l $(ALL_SRC) 2>&1`; \ + if [ "$$FMTOUT" ]; then \ + echo "$(GOFMT) FAILED => gofmt the following files:\n"; \ + echo "$$FMTOUT\n"; \ + exit 1; \ + else \ + echo "Fmt finished successfully"; \ + fi + +.PHONY: lint +lint: + @LINTOUT=`$(GOLINT) $(ALL_PKGS) | grep -v $(TRACE_ID_LINT_EXCEPTION) | grep -v $(TRACE_OPTION_LINT_EXCEPTION) 2>&1`; \ + if [ "$$LINTOUT" ]; then \ + echo "$(GOLINT) FAILED => clean the following lint errors:\n"; \ + echo "$$LINTOUT\n"; \ + exit 1; \ + else \ + echo "Lint finished successfully"; \ + fi + +.PHONY: vet +vet: + # TODO: Understand why go vet downloads "github.com/google/go-cmp v0.2.0" + @VETOUT=`$(GOVET) ./... | grep -v "go: downloading" 2>&1`; \ + if [ "$$VETOUT" ]; then \ + echo "$(GOVET) FAILED => go vet the following files:\n"; \ + echo "$$VETOUT\n"; \ + exit 1; \ + else \ + echo "Vet finished successfully"; \ + fi + +.PHONY: embedmd +embedmd: + @EMBEDMDOUT=`$(EMBEDMD) -d $(README_FILES) 2>&1`; \ + if [ "$$EMBEDMDOUT" ]; then \ + echo "$(EMBEDMD) FAILED => embedmd the following files:\n"; \ + echo "$$EMBEDMDOUT\n"; \ + exit 1; \ + else \ + echo "Embedmd finished successfully"; \ + fi + +.PHONY: install-tools +install-tools: + go get -u golang.org/x/tools/cmd/cover + go get -u golang.org/x/lint/golint + go get -u github.com/rakyll/embedmd diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 000000000..fabab2e06 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,263 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces + +## Overview + +![OpenCensus Overview](https://i.imgur.com/cf4ElHE.jpg) + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + +![Traces and spans](https://i.imgur.com/7hZwRVj.png) + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + +![CPU profile](https://i.imgur.com/jBKjlkw.png) + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter diff --git a/vendor/go.opencensus.io/appveyor.yml b/vendor/go.opencensus.io/appveyor.yml new file mode 100644 index 000000000..12bd7c4c7 --- /dev/null +++ b/vendor/go.opencensus.io/appveyor.yml @@ -0,0 +1,25 @@ +version: "{build}" + +platform: x64 + +clone_folder: c:\gopath\src\go.opencensus.io + +environment: + GOPATH: 'c:\gopath' + GOVERSION: '1.11' + GO111MODULE: 'on' + CGO_ENABLED: '0' # See: https://github.com/appveyor/ci/issues/2613 + +install: + - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% + - choco upgrade golang --version 1.11.5 # Temporary fix because of a go.sum bug in 1.11 + - go version + - go env + +build: false +deploy: false + +test_script: + - cd %APPVEYOR_BUILD_FOLDER% + - go build -v .\... + - go test -v .\... # No -race because cgo is disabled diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 000000000..cb4de80f3 --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,12 @@ +module go.opencensus.io + +require ( + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) diff --git a/vendor/go.opencensus.io/go.sum b/vendor/go.opencensus.io/go.sum new file mode 100644 index 000000000..0b948c2b4 --- /dev/null +++ b/vendor/go.opencensus.io/go.sum @@ -0,0 +1,61 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a h1:1BGLXjeY4akVXGgbC9HugT3Jv3hCI0z56oJR5vAMgBU= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd h1:r7DufRZuZbWB7j439YfAzP8RPDa9unLkpwQKUYbIMPI= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 000000000..9a638781c --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Now().Sub(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 000000000..de8ccf236 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 000000000..073af7b47 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 000000000..626d73645 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.22.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 000000000..0c54492a2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 000000000..775f8274f --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 000000000..04b1ee4f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 000000000..ffc264f23 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 000000000..e0d9a4b99 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 000000000..7e808d8f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 000000000..3f80a3368 --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,37 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/hashicorp/golang-lru/simplelru" +) + +type lruMap struct { + simpleLruMap *simplelru.LRU + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{} + lm.simpleLruMap, _ = simplelru.NewLRU(size, nil) + return lm +} + +func (lm *lruMap) add(key, value interface{}) { + evicted := lm.simpleLruMap.Add(key, value) + if evicted { + lm.droppedCount++ + } +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 000000000..71c10f9e3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 000000000..fbabad34c --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 000000000..c442d9902 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 000000000..ec60effd1 --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 000000000..38ead7bf0 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.simpleLruMap.Len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.simpleLruMap.Keys() { + value, ok := s.lruAttributes.simpleLruMap.Get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "<nil>" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 000000000..b7d8aaf28 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 000000000..e25419859 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 000000000..2d6c713eb --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +} diff --git a/vendor/golang.org/x/sys/unix/mkerrors.sh b/vendor/golang.org/x/sys/unix/mkerrors.sh index 85cfbd049..8a2dcfa51 100644 --- a/vendor/golang.org/x/sys/unix/mkerrors.sh +++ b/vendor/golang.org/x/sys/unix/mkerrors.sh @@ -183,20 +183,26 @@ struct ltchars { #include <sys/socket.h> #include <sys/xattr.h> #include <linux/bpf.h> +#include <linux/can.h> #include <linux/capability.h> +#include <linux/cryptouser.h> #include <linux/errqueue.h> +#include <linux/falloc.h> +#include <linux/fanotify.h> +#include <linux/filter.h> +#include <linux/fs.h> +#include <linux/genetlink.h> +#include <linux/hdreg.h> +#include <linux/icmpv6.h> #include <linux/if.h> +#include <linux/if_addr.h> #include <linux/if_alg.h> #include <linux/if_arp.h> #include <linux/if_ether.h> #include <linux/if_ppp.h> #include <linux/if_tun.h> #include <linux/if_packet.h> -#include <linux/if_addr.h> -#include <linux/falloc.h> -#include <linux/fanotify.h> -#include <linux/filter.h> -#include <linux/fs.h> +#include <linux/if_xdp.h> #include <linux/kexec.h> #include <linux/keyctl.h> #include <linux/loop.h> @@ -208,25 +214,21 @@ struct ltchars { #include <linux/net_namespace.h> #include <linux/nsfs.h> #include <linux/perf_event.h> +#include <linux/ptrace.h> #include <linux/random.h> #include <linux/reboot.h> +#include <linux/rtc.h> #include <linux/rtnetlink.h> -#include <linux/ptrace.h> #include <linux/sched.h> #include <linux/seccomp.h> -#include <linux/sockios.h> -#include <linux/wait.h> -#include <linux/icmpv6.h> #include <linux/serial.h> -#include <linux/can.h> -#include <linux/vm_sockets.h> +#include <linux/sockios.h> #include <linux/taskstats.h> -#include <linux/genetlink.h> +#include <linux/tipc.h> +#include <linux/vm_sockets.h> +#include <linux/wait.h> #include <linux/watchdog.h> -#include <linux/hdreg.h> -#include <linux/rtc.h> -#include <linux/if_xdp.h> -#include <linux/cryptouser.h> + #include <mtd/ubi-user.h> #include <net/route.h> @@ -265,6 +267,11 @@ struct ltchars { #define FS_KEY_DESC_PREFIX "fscrypt:" #define FS_KEY_DESC_PREFIX_SIZE 8 #define FS_MAX_KEY_SIZE 64 + +// The code generator produces -0x1 for (~0), but an unsigned value is necessary +// for the tipc_subscr timeout __u32 field. +#undef TIPC_WAIT_FOREVER +#define TIPC_WAIT_FOREVER 0xffffffff ' includes_NetBSD=' @@ -508,6 +515,7 @@ ccflags="$@" $2 ~ /^XDP_/ || $2 ~ /^(HDIO|WIN|SMART)_/ || $2 ~ /^CRYPTO_/ || + $2 ~ /^TIPC_/ || $2 !~ "WMESGLEN" && $2 ~ /^W[A-Z0-9]+$/ || $2 ~/^PPPIOC/ || diff --git a/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go b/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go index bf05603f1..b3c8e3301 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix_ppc.go @@ -29,6 +29,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go b/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go index 13d4321f4..9a6e02417 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix_ppc64.go @@ -29,6 +29,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index 97a8eef6f..3e6671426 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -413,8 +413,6 @@ func Kevent(kq int, changes, events []Kevent_t, timeout *Timespec) (n int, err e return kevent(kq, change, len(changes), event, len(events), timeout) } -//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL - // sysctlmib translates name to mib number and appends any additional args. func sysctlmib(name string, args ...int) ([]_C_int, error) { // Translate name to mib number. diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go index cd8be182a..cf1bec6a3 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go @@ -10,6 +10,7 @@ import ( "syscall" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL //sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) func setTimespec(sec, nsec int64) Timespec { @@ -45,6 +46,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go index d0d07243c..5867ed00b 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go @@ -10,6 +10,7 @@ import ( "syscall" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL //sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) func setTimespec(sec, nsec int64) Timespec { @@ -45,6 +46,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go index 01e8a38a9..e199e12a5 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go @@ -12,6 +12,10 @@ func ptrace(request int, pid int, addr uintptr, data uintptr) error { return ENOTSUP } +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: int32(sec), Nsec: int32(nsec)} } @@ -45,6 +49,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go index e674f81da..2c50ca901 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go @@ -14,6 +14,10 @@ func ptrace(request int, pid int, addr uintptr, data uintptr) error { return ENOTSUP } +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} } @@ -47,6 +51,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go index 474181c02..99d875624 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go @@ -14,6 +14,8 @@ package unix import "unsafe" +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go index 9babb31ea..a6b4830ac 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly_amd64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd.go b/vendor/golang.org/x/sys/unix/syscall_freebsd.go index d95c4436f..b62231bca 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd.go @@ -36,6 +36,8 @@ var ( // INO64_FIRST from /usr/src/lib/libc/sys/compat-ino64.h const _ino64First = 1200031 +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + func supportsABI(ver uint32) bool { osreldateOnce.Do(func() { osreldate, _ = SysctlUint32("kern.osreldate") }) return osreldate >= ver diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go index 21e03958c..dcc56457a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go index 9c945a657..321c3bace 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go index 5cd6243f2..697700831 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go index a31805487..dbbbfd603 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go @@ -33,6 +33,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index fe30b9544..e538bb567 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -775,6 +775,70 @@ func (sa *SockaddrPPPoE) sockaddr() (unsafe.Pointer, _Socklen, error) { return unsafe.Pointer(&sa.raw), SizeofSockaddrPPPoX, nil } +// SockaddrTIPC implements the Sockaddr interface for AF_TIPC type sockets. +// For more information on TIPC, see: http://tipc.sourceforge.net/. +type SockaddrTIPC struct { + // Scope is the publication scopes when binding service/service range. + // Should be set to TIPC_CLUSTER_SCOPE or TIPC_NODE_SCOPE. + Scope int + + // Addr is the type of address used to manipulate a socket. Addr must be + // one of: + // - *TIPCSocketAddr: "id" variant in the C addr union + // - *TIPCServiceRange: "nameseq" variant in the C addr union + // - *TIPCServiceName: "name" variant in the C addr union + // + // If nil, EINVAL will be returned when the structure is used. + Addr TIPCAddr + + raw RawSockaddrTIPC +} + +// TIPCAddr is implemented by types that can be used as an address for +// SockaddrTIPC. It is only implemented by *TIPCSocketAddr, *TIPCServiceRange, +// and *TIPCServiceName. +type TIPCAddr interface { + tipcAddrtype() uint8 + tipcAddr() [12]byte +} + +func (sa *TIPCSocketAddr) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCSocketAddr{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCSocketAddr) tipcAddrtype() uint8 { return TIPC_SOCKET_ADDR } + +func (sa *TIPCServiceRange) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCServiceRange{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCServiceRange) tipcAddrtype() uint8 { return TIPC_SERVICE_RANGE } + +func (sa *TIPCServiceName) tipcAddr() [12]byte { + var out [12]byte + copy(out[:], (*(*[unsafe.Sizeof(TIPCServiceName{})]byte)(unsafe.Pointer(sa)))[:]) + return out +} + +func (sa *TIPCServiceName) tipcAddrtype() uint8 { return TIPC_SERVICE_ADDR } + +func (sa *SockaddrTIPC) sockaddr() (unsafe.Pointer, _Socklen, error) { + if sa.Addr == nil { + return nil, 0, EINVAL + } + + sa.raw.Family = AF_TIPC + sa.raw.Scope = int8(sa.Scope) + sa.raw.Addrtype = sa.Addr.tipcAddrtype() + sa.raw.Addr = sa.Addr.tipcAddr() + + return unsafe.Pointer(&sa.raw), SizeofSockaddrTIPC, nil +} + func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { switch rsa.Addr.Family { case AF_NETLINK: @@ -901,6 +965,27 @@ func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { } } return sa, nil + case AF_TIPC: + pp := (*RawSockaddrTIPC)(unsafe.Pointer(rsa)) + + sa := &SockaddrTIPC{ + Scope: int(pp.Scope), + } + + // Determine which union variant is present in pp.Addr by checking + // pp.Addrtype. + switch pp.Addrtype { + case TIPC_SERVICE_RANGE: + sa.Addr = (*TIPCServiceRange)(unsafe.Pointer(&pp.Addr)) + case TIPC_SERVICE_ADDR: + sa.Addr = (*TIPCServiceName)(unsafe.Pointer(&pp.Addr)) + case TIPC_SOCKET_ADDR: + sa.Addr = (*TIPCSocketAddr)(unsafe.Pointer(&pp.Addr)) + default: + return nil, EINVAL + } + + return sa, nil } return nil, EAFNOSUPPORT } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_386.go index e2f8cf6e5..e7fa665e6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_386.go @@ -372,6 +372,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go index 87a30744d..088ce0f93 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go @@ -163,6 +163,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go index f62679443..11930fc8f 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go @@ -252,6 +252,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go index cb20b15d5..251e2d971 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go @@ -180,6 +180,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go index b3b21ec1e..7562fe97b 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go @@ -208,6 +208,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go index 5144d4e13..a939ff8f2 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go @@ -220,6 +220,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go index 0a100b66a..28d6d0f22 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go @@ -91,6 +91,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go index 6230f6405..6798c2625 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go @@ -179,6 +179,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go index f81dbdc9c..eb5cb1a71 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go @@ -120,6 +120,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go index b69565616..37321c12e 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go @@ -107,6 +107,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint64(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd.go b/vendor/golang.org/x/sys/unix/syscall_netbsd.go index 7f9812b4f..3e3f07507 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd.go @@ -18,6 +18,8 @@ import ( "unsafe" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go index 24f74e58c..24da8b524 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_386.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go index 6878bf7ff..25a0ac825 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_amd64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go index dbbfcf71d..21591ecd4 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go index f3434465a..804749635 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd_arm64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index 9a26768f6..035c043a7 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -18,6 +18,8 @@ import ( "unsafe" ) +//sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL + // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { Len uint8 diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go index d62da60d1..42b5a0e51 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_386.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go index 9a35334cb..6ea4b4883 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go index 5d812aaea..1c3d26fa2 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go index 0fb39cf5e..a8c458cb0 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_arm64.go @@ -28,6 +28,10 @@ func (msghdr *Msghdr) SetControllen(length int) { msghdr.Controllen = uint32(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = uint32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go index 91c32ddf0..b22a34d7a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go @@ -18,6 +18,10 @@ func (iov *Iovec) SetLen(length int) { iov.Len = uint64(length) } +func (msghdr *Msghdr) SetIovlen(length int) { + msghdr.Iovlen = int32(length) +} + func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go index 2839b3df2..1875f4595 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1087,6 +1091,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1099,6 +1114,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1692,6 +1711,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1730,6 +1750,10 @@ const ( PTRACE_SINGLEBLOCK = 0x21 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2438,6 +2468,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2451,7 +2546,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2650,6 +2745,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2666,6 +2763,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go index 99e3a3de2..4af5477da 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1087,6 +1091,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1099,6 +1114,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1678,6 +1695,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1693,6 +1712,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1731,6 +1751,10 @@ const ( PTRACE_SINGLEBLOCK = 0x21 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 @@ -1791,7 +1815,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1864,6 +1888,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1888,6 +1913,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1895,7 +1921,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1907,6 +1933,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1915,8 +1942,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2001,6 +2028,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2139,6 +2168,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2439,6 +2469,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2452,7 +2547,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2650,6 +2745,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2666,6 +2763,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go index f5f5ee562..eb2191994 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETSIGMASK = 0x420a PTRACE_GETVFPREGS = 0x1b PTRACE_GETWMMXREGS = 0x12 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x16 PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 @@ -1736,6 +1756,10 @@ const ( PTRACE_SET_SYSCALL = 0x17 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 PT_DATA_ADDR = 0x10004 PT_TEXT_ADDR = 0x10000 @@ -1797,7 +1821,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1870,6 +1894,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1894,6 +1919,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1901,7 +1927,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1913,6 +1939,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1921,8 +1948,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2007,6 +2034,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2145,6 +2174,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2445,6 +2475,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2458,7 +2553,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2656,6 +2751,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2672,6 +2769,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go index 64573bdb7..fba8ad48e 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -561,6 +564,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1089,6 +1093,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1101,6 +1116,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1678,6 +1695,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1691,6 +1710,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1723,6 +1743,12 @@ const ( PTRACE_SETSIGMASK = 0x420b PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 + PTRACE_SYSEMU = 0x1f + PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1781,7 +1807,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1854,6 +1880,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1878,6 +1905,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1885,7 +1913,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1897,6 +1925,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1905,8 +1934,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1991,6 +2020,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2129,6 +2160,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2430,6 +2462,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2443,7 +2540,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2641,6 +2738,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2657,6 +2756,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go index 3e948be30..995a7645a 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go index 8ac128bbd..2a38e1034 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go index e8845a7d4..d1df93831 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go index 338c044eb..b92e3a589 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1689,6 +1708,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_GET_THREAD_AREA = 0x19 PTRACE_GET_THREAD_AREA_3264 = 0xc4 PTRACE_GET_WATCH_REGS = 0xd0 @@ -1732,6 +1752,10 @@ const ( PTRACE_SET_WATCH_REGS = 0xd1 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1790,7 +1814,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1863,6 +1887,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1887,6 +1912,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1894,7 +1920,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1906,6 +1932,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1914,8 +1941,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2000,6 +2027,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2138,6 +2167,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2440,6 +2470,71 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 TPACKET_ALIGNMENT = 0x10 @@ -2453,7 +2548,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2652,6 +2747,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2668,6 +2765,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go index a696532fc..72fd7995f 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETVRREGS = 0x12 PTRACE_GETVSRREGS = 0x1b PTRACE_GET_DEBUGREG = 0x19 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1735,6 +1755,10 @@ const ( PTRACE_SINGLEBLOCK = 0x100 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1d PTRACE_SYSEMU_SINGLESTEP = 0x1e PTRACE_TRACEME = 0x0 @@ -1848,7 +1872,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1921,6 +1945,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1945,6 +1970,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1952,7 +1978,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1964,6 +1990,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1972,8 +1999,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2058,6 +2085,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2196,6 +2225,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2500,6 +2530,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 TPACKET_ALIGNMENT = 0x10 @@ -2513,7 +2608,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2711,6 +2806,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2727,6 +2824,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0xc00 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go index 9197b3353..d9d5837eb 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETVRREGS = 0x12 PTRACE_GETVSRREGS = 0x1b PTRACE_GET_DEBUGREG = 0x19 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1735,6 +1755,10 @@ const ( PTRACE_SINGLEBLOCK = 0x100 PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_SYSEMU = 0x1d PTRACE_SYSEMU_SINGLESTEP = 0x1e PTRACE_TRACEME = 0x0 @@ -1848,7 +1872,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1921,6 +1945,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1945,6 +1970,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1952,7 +1978,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1964,6 +1990,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1972,8 +1999,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2058,6 +2085,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2196,6 +2225,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2500,6 +2530,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 TPACKET_ALIGNMENT = 0x10 @@ -2513,7 +2608,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2711,6 +2806,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2727,6 +2824,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0xc00 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go index d1e023ed7..11810c85b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1675,6 +1692,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1688,6 +1707,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1720,6 +1740,10 @@ const ( PTRACE_SETSIGMASK = 0x420b PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 QNX4_SUPER_MAGIC = 0x2f QNX6_SUPER_MAGIC = 0x68191122 @@ -1778,7 +1802,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1851,6 +1875,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1875,6 +1900,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1882,7 +1908,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1894,6 +1920,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1902,8 +1929,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -1988,6 +2015,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2126,6 +2155,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2426,6 +2456,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2439,7 +2534,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2637,6 +2732,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2653,6 +2750,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go index 1dfacf183..70090835c 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go @@ -253,6 +253,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -304,9 +305,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -460,6 +462,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -560,6 +563,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1086,6 +1090,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1098,6 +1113,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1677,6 +1694,8 @@ const ( PTRACE_DETACH = 0x11 PTRACE_DISABLE_TE = 0x5010 PTRACE_ENABLE_TE = 0x5009 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1691,6 +1710,7 @@ const ( PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a PTRACE_GET_LAST_BREAK = 0x5006 + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1734,6 +1754,10 @@ const ( PTRACE_SINGLEBLOCK = 0xc PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TE_ABORT_RAND = 0x5011 PTRACE_TRACEME = 0x0 PT_ACR0 = 0x90 @@ -1851,7 +1875,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1924,6 +1948,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1948,6 +1973,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1955,7 +1981,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1967,6 +1993,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1975,8 +2002,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2061,6 +2088,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2199,6 +2228,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x44 SO_DOMAIN = 0x27 SO_DONTROUTE = 0x5 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2499,6 +2529,71 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2512,7 +2607,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2710,6 +2805,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2726,6 +2823,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 ) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go index b78e49fcf..99b5e165b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go @@ -256,6 +256,7 @@ const ( BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 BPF_F_SYSCTL_BASE_NAME = 0x1 + BPF_F_TEST_RND_HI32 = 0x4 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 @@ -307,9 +308,10 @@ const ( BPF_RET = 0x6 BPF_RSH = 0x70 BPF_SK_STORAGE_GET_F_CREATE = 0x1 - BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 + BPF_SOCK_OPS_ALL_CB_FLAGS = 0xf BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 + BPF_SOCK_OPS_RTT_CB_FLAG = 0x8 BPF_SOCK_OPS_STATE_CB_FLAG = 0x4 BPF_ST = 0x2 BPF_STX = 0x3 @@ -463,6 +465,7 @@ const ( DAXFS_MAGIC = 0x64646178 DEBUGFS_MAGIC = 0x64626720 DEVPTS_SUPER_MAGIC = 0x1cd1 + DMA_BUF_MAGIC = 0x444d4142 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -564,6 +567,7 @@ const ( ETH_P_IRDA = 0x17 ETH_P_LAT = 0x6004 ETH_P_LINK_CTL = 0x886c + ETH_P_LLDP = 0x88cc ETH_P_LOCALTALK = 0x9 ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 @@ -1090,6 +1094,17 @@ const ( KEXEC_PRESERVE_CONTEXT = 0x2 KEXEC_SEGMENT_MAX = 0x10 KEYCTL_ASSUME_AUTHORITY = 0x10 + KEYCTL_CAPABILITIES = 0x1f + KEYCTL_CAPS0_BIG_KEY = 0x10 + KEYCTL_CAPS0_CAPABILITIES = 0x1 + KEYCTL_CAPS0_DIFFIE_HELLMAN = 0x4 + KEYCTL_CAPS0_INVALIDATE = 0x20 + KEYCTL_CAPS0_MOVE = 0x80 + KEYCTL_CAPS0_PERSISTENT_KEYRINGS = 0x2 + KEYCTL_CAPS0_PUBLIC_KEY = 0x8 + KEYCTL_CAPS0_RESTRICT_KEYRING = 0x40 + KEYCTL_CAPS1_NS_KEYRING_NAME = 0x1 + KEYCTL_CAPS1_NS_KEY_TAG = 0x2 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 KEYCTL_DESCRIBE = 0x6 @@ -1102,6 +1117,8 @@ const ( KEYCTL_INVALIDATE = 0x15 KEYCTL_JOIN_SESSION_KEYRING = 0x1 KEYCTL_LINK = 0x8 + KEYCTL_MOVE = 0x1e + KEYCTL_MOVE_EXCL = 0x1 KEYCTL_NEGATE = 0xd KEYCTL_PKEY_DECRYPT = 0x1a KEYCTL_PKEY_ENCRYPT = 0x19 @@ -1679,6 +1696,8 @@ const ( PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 + PTRACE_EVENTMSG_SYSCALL_ENTRY = 0x1 + PTRACE_EVENTMSG_SYSCALL_EXIT = 0x2 PTRACE_EVENT_CLONE = 0x3 PTRACE_EVENT_EXEC = 0x4 PTRACE_EVENT_EXIT = 0x6 @@ -1696,6 +1715,7 @@ const ( PTRACE_GETREGSET = 0x4204 PTRACE_GETSIGINFO = 0x4202 PTRACE_GETSIGMASK = 0x420a + PTRACE_GET_SYSCALL_INFO = 0x420e PTRACE_INTERRUPT = 0x4207 PTRACE_KILL = 0x8 PTRACE_LISTEN = 0x4208 @@ -1735,6 +1755,10 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SPARC_DETACH = 0xb PTRACE_SYSCALL = 0x18 + PTRACE_SYSCALL_INFO_ENTRY = 0x1 + PTRACE_SYSCALL_INFO_EXIT = 0x2 + PTRACE_SYSCALL_INFO_NONE = 0x0 + PTRACE_SYSCALL_INFO_SECCOMP = 0x3 PTRACE_TRACEME = 0x0 PTRACE_WRITEDATA = 0x11 PTRACE_WRITETEXT = 0x13 @@ -1843,7 +1867,7 @@ const ( RTAX_UNSPEC = 0x0 RTAX_WINDOW = 0x3 RTA_ALIGNTO = 0x4 - RTA_MAX = 0x1d + RTA_MAX = 0x1e RTCF_DIRECTSRC = 0x4000000 RTCF_DOREDIRECT = 0x1000000 RTCF_LOG = 0x2000000 @@ -1916,6 +1940,7 @@ const ( RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 + RTM_DELNEXTHOP = 0x69 RTM_DELNSID = 0x59 RTM_DELQDISC = 0x25 RTM_DELROUTE = 0x19 @@ -1940,6 +1965,7 @@ const ( RTM_GETNEIGH = 0x1e RTM_GETNEIGHTBL = 0x42 RTM_GETNETCONF = 0x52 + RTM_GETNEXTHOP = 0x6a RTM_GETNSID = 0x5a RTM_GETQDISC = 0x26 RTM_GETROUTE = 0x1a @@ -1947,7 +1973,7 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x67 + RTM_MAX = 0x6b RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 @@ -1959,6 +1985,7 @@ const ( RTM_NEWNEIGH = 0x1c RTM_NEWNEIGHTBL = 0x40 RTM_NEWNETCONF = 0x50 + RTM_NEWNEXTHOP = 0x68 RTM_NEWNSID = 0x58 RTM_NEWPREFIX = 0x34 RTM_NEWQDISC = 0x24 @@ -1967,8 +1994,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x16 - RTM_NR_MSGTYPES = 0x58 + RTM_NR_FAMILIES = 0x17 + RTM_NR_MSGTYPES = 0x5c RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2053,6 +2080,8 @@ const ( SIOCDRARP = 0x8960 SIOCETHTOOL = 0x8946 SIOCGARP = 0x8954 + SIOCGETLINKNAME = 0x89e0 + SIOCGETNODEID = 0x89e1 SIOCGHWTSTAMP = 0x89b1 SIOCGIFADDR = 0x8915 SIOCGIFBR = 0x8940 @@ -2191,6 +2220,7 @@ const ( SO_DEBUG = 0x1 SO_DETACH_BPF = 0x1b SO_DETACH_FILTER = 0x1b + SO_DETACH_REUSEPORT_BPF = 0x47 SO_DOMAIN = 0x1029 SO_DONTROUTE = 0x10 SO_EE_CODE_TXTIME_INVALID_PARAM = 0x1 @@ -2488,6 +2518,71 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x20005437 + TIPC_ADDR_ID = 0x3 + TIPC_ADDR_MCAST = 0x1 + TIPC_ADDR_NAME = 0x2 + TIPC_ADDR_NAMESEQ = 0x1 + TIPC_CFG_SRV = 0x0 + TIPC_CLUSTER_BITS = 0xc + TIPC_CLUSTER_MASK = 0xfff000 + TIPC_CLUSTER_OFFSET = 0xc + TIPC_CLUSTER_SIZE = 0xfff + TIPC_CONN_SHUTDOWN = 0x5 + TIPC_CONN_TIMEOUT = 0x82 + TIPC_CRITICAL_IMPORTANCE = 0x3 + TIPC_DESTNAME = 0x3 + TIPC_DEST_DROPPABLE = 0x81 + TIPC_ERRINFO = 0x1 + TIPC_ERR_NO_NAME = 0x1 + TIPC_ERR_NO_NODE = 0x3 + TIPC_ERR_NO_PORT = 0x2 + TIPC_ERR_OVERLOAD = 0x4 + TIPC_GROUP_JOIN = 0x87 + TIPC_GROUP_LEAVE = 0x88 + TIPC_GROUP_LOOPBACK = 0x1 + TIPC_GROUP_MEMBER_EVTS = 0x2 + TIPC_HIGH_IMPORTANCE = 0x2 + TIPC_IMPORTANCE = 0x7f + TIPC_LINK_STATE = 0x2 + TIPC_LOW_IMPORTANCE = 0x0 + TIPC_MAX_BEARER_NAME = 0x20 + TIPC_MAX_IF_NAME = 0x10 + TIPC_MAX_LINK_NAME = 0x44 + TIPC_MAX_MEDIA_NAME = 0x10 + TIPC_MAX_USER_MSG_SIZE = 0x101d0 + TIPC_MCAST_BROADCAST = 0x85 + TIPC_MCAST_REPLICAST = 0x86 + TIPC_MEDIUM_IMPORTANCE = 0x1 + TIPC_NODEID_LEN = 0x10 + TIPC_NODE_BITS = 0xc + TIPC_NODE_MASK = 0xfff + TIPC_NODE_OFFSET = 0x0 + TIPC_NODE_RECVQ_DEPTH = 0x83 + TIPC_NODE_SIZE = 0xfff + TIPC_NODE_STATE = 0x0 + TIPC_OK = 0x0 + TIPC_PUBLISHED = 0x1 + TIPC_RESERVED_TYPES = 0x40 + TIPC_RETDATA = 0x2 + TIPC_SERVICE_ADDR = 0x2 + TIPC_SERVICE_RANGE = 0x1 + TIPC_SOCKET_ADDR = 0x3 + TIPC_SOCK_RECVQ_DEPTH = 0x84 + TIPC_SOCK_RECVQ_USED = 0x89 + TIPC_SRC_DROPPABLE = 0x80 + TIPC_SUBSCR_TIMEOUT = 0x3 + TIPC_SUB_CANCEL = 0x4 + TIPC_SUB_PORTS = 0x1 + TIPC_SUB_SERVICE = 0x2 + TIPC_TOP_SRV = 0x1 + TIPC_WAIT_FOREVER = 0xffffffff + TIPC_WITHDRAWN = 0x2 + TIPC_ZONE_BITS = 0x8 + TIPC_ZONE_CLUSTER_MASK = 0xfffff000 + TIPC_ZONE_MASK = 0xff000000 + TIPC_ZONE_OFFSET = 0x18 + TIPC_ZONE_SCOPE = 0x1 + TIPC_ZONE_SIZE = 0xff TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 TPACKET_ALIGNMENT = 0x10 @@ -2501,7 +2596,7 @@ const ( TP_STATUS_LOSING = 0x4 TP_STATUS_SENDING = 0x2 TP_STATUS_SEND_REQUEST = 0x1 - TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_RAW_HARDWARE = 0x80000000 TP_STATUS_TS_SOFTWARE = 0x20000000 TP_STATUS_TS_SYS_HARDWARE = 0x40000000 TP_STATUS_USER = 0x1 @@ -2699,6 +2794,8 @@ const ( XDP_FLAGS_SKB_MODE = 0x2 XDP_FLAGS_UPDATE_IF_NOEXIST = 0x1 XDP_MMAP_OFFSETS = 0x1 + XDP_OPTIONS = 0x8 + XDP_OPTIONS_ZEROCOPY = 0x1 XDP_PACKET_HEADROOM = 0x100 XDP_PGOFF_RX_RING = 0x0 XDP_PGOFF_TX_RING = 0x80000000 @@ -2715,6 +2812,7 @@ const ( XENFS_SUPER_MAGIC = 0xabba1974 XFS_SUPER_MAGIC = 0x58465342 XTABS = 0x1800 + Z3FOLD_MAGIC = 0x33 ZSMALLOC_MAGIC = 0x58295829 __TIOCFLUSH = 0x80047410 ) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go index 78ca92339..5ab9a8277 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -928,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { @@ -2326,6 +2320,27 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc___sysctl_trampoline() + +//go:linkname libc___sysctl libc___sysctl +//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s index f40465ca8..c6557b135 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -106,6 +104,8 @@ TEXT ·libc_chown_trampoline(SB),NOSPLIT,$0-0 JMP libc_chown(SB) TEXT ·libc_chroot_trampoline(SB),NOSPLIT,$0-0 JMP libc_chroot(SB) +TEXT ·libc_clock_gettime_trampoline(SB),NOSPLIT,$0-0 + JMP libc_clock_gettime(SB) TEXT ·libc_close_trampoline(SB),NOSPLIT,$0-0 JMP libc_close(SB) TEXT ·libc_dup_trampoline(SB),NOSPLIT,$0-0 @@ -262,6 +262,8 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 + JMP libc___sysctl(SB) TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go index 2581e8960..985f33888 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -1691,6 +1665,32 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int64, usec int32, err error) { r0, r1, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tp)), 0, 0) sec = int64(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go index 64df03c45..22163ef40 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -2341,6 +2320,27 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc___sysctl_trampoline() + +//go:linkname libc___sysctl libc___sysctl +//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s index debcb8ed3..ad410cfbc 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -264,6 +262,8 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 + JMP libc___sysctl(SB) TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go index f8caecef0..0e47deb78 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go index ed3306239..bbc18c4f6 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -928,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go index 3fd0f3c85..3f4cc0f34 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.1_11.go @@ -214,22 +214,6 @@ func kevent(kq int, change unsafe.Pointer, nchange int, event unsafe.Pointer, ne // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -377,16 +361,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go index 5258a7328..43356c832 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go @@ -304,27 +304,6 @@ func libc_kevent_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := syscall_syscall6(funcPC(libc___sysctl_trampoline), uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc___sysctl_trampoline() - -//go:linkname libc___sysctl libc___sysctl -//go:cgo_import_dynamic libc___sysctl __sysctl "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimes(path string, timeval *[2]Timeval) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -928,6 +907,21 @@ func libc_chroot_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ClockGettime(clockid int32, time *Timespec) (err error) { + _, _, e1 := syscall_syscall(funcPC(libc_clock_gettime_trampoline), uintptr(clockid), uintptr(unsafe.Pointer(time)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_clock_gettime_trampoline() + +//go:linkname libc_clock_gettime libc_clock_gettime +//go:cgo_import_dynamic libc_clock_gettime clock_gettime "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Close(fd int) (err error) { _, _, e1 := syscall_syscall(funcPC(libc_close_trampoline), uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s index f57f48f82..96ab9877e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s @@ -40,8 +40,6 @@ TEXT ·libc_sendmsg_trampoline(SB),NOSPLIT,$0-0 JMP libc_sendmsg(SB) TEXT ·libc_kevent_trampoline(SB),NOSPLIT,$0-0 JMP libc_kevent(SB) -TEXT ·libc___sysctl_trampoline(SB),NOSPLIT,$0-0 - JMP libc___sysctl(SB) TEXT ·libc_utimes_trampoline(SB),NOSPLIT,$0-0 JMP libc_utimes(SB) TEXT ·libc_futimes_trampoline(SB),NOSPLIT,$0-0 @@ -106,6 +104,8 @@ TEXT ·libc_chown_trampoline(SB),NOSPLIT,$0-0 JMP libc_chown(SB) TEXT ·libc_chroot_trampoline(SB),NOSPLIT,$0-0 JMP libc_chroot(SB) +TEXT ·libc_clock_gettime_trampoline(SB),NOSPLIT,$0-0 + JMP libc_clock_gettime(SB) TEXT ·libc_close_trampoline(SB),NOSPLIT,$0-0 JMP libc_close(SB) TEXT ·libc_dup_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go index e869c0603..7aae554f2 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go @@ -429,4 +429,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go index 4917b8ab6..7968439a9 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go @@ -351,4 +351,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go index f85fcb4f8..3c663c69d 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go index 678a119bc..753def987 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go @@ -296,4 +296,5 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go index 222c9f9a2..ac86bd544 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go @@ -414,4 +414,5 @@ const ( SYS_FSCONFIG = 4431 SYS_FSMOUNT = 4432 SYS_FSPICK = 4433 + SYS_PIDFD_OPEN = 4434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go index 28e6d0e9d..1f5705b58 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go @@ -344,4 +344,5 @@ const ( SYS_FSCONFIG = 5431 SYS_FSMOUNT = 5432 SYS_FSPICK = 5433 + SYS_PIDFD_OPEN = 5434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go index e643c6f63..d9ed95326 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go @@ -344,4 +344,5 @@ const ( SYS_FSCONFIG = 5431 SYS_FSMOUNT = 5432 SYS_FSPICK = 5433 + SYS_PIDFD_OPEN = 5434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go index 01d93c420..94266b65a 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go @@ -414,4 +414,5 @@ const ( SYS_FSCONFIG = 4431 SYS_FSMOUNT = 4432 SYS_FSPICK = 4433 + SYS_PIDFD_OPEN = 4434 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go index 5744149eb..52e3da649 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go index 21c832042..6141f90a8 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go @@ -393,4 +393,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go index c1bb6d8f2..4f7261a88 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go @@ -295,4 +295,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go index bc3cc6b5b..f47014ac0 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go @@ -358,4 +358,6 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go index 0a2841ba8..dd78abb0d 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go @@ -373,4 +373,5 @@ const ( SYS_FSCONFIG = 431 SYS_FSMOUNT = 432 SYS_FSPICK = 433 + SYS_PIDFD_OPEN = 434 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go index 50bc4128f..d02a18350 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -425,6 +432,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -614,6 +622,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -664,6 +673,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2521,3 +2537,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go index 055eaa76a..f347457e9 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -426,6 +433,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -615,6 +623,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -665,6 +674,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2535,3 +2551,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go index 66019c9cf..d53d575b8 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go @@ -289,6 +289,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -429,6 +436,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -618,6 +626,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -668,6 +677,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2512,3 +2528,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go index 3104798c4..aa41189bd 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2514,3 +2530,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go index 46c86021b..913efd616 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go @@ -288,6 +288,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2518,3 +2534,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go index c2fe1a62a..860fb5dae 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2516,3 +2532,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go index f1eb0d397..12138089a 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2516,3 +2532,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go index 8759bc36b..2498796fd 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go @@ -288,6 +288,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x8 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2518,3 +2534,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go index a81200541..17b83f758 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go @@ -287,6 +287,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2524,3 +2540,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go index 74b7a9199..d289725b6 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go @@ -287,6 +287,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -428,6 +435,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -617,6 +625,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -667,6 +676,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2524,3 +2540,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go index ccea3e638..7546c1340 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go @@ -286,6 +286,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]uint8 @@ -427,6 +434,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -616,6 +624,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -666,6 +675,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2542,3 +2558,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]uint8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]uint8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]uint8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go index d8fc0bc1c..8907bc74b 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go @@ -285,6 +285,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -426,6 +433,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -615,6 +623,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -665,6 +674,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2538,3 +2554,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go index 5e0ab9329..5efa151eb 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go @@ -289,6 +289,13 @@ type RawSockaddrXDP struct { type RawSockaddrPPPoX [0x1e]byte +type RawSockaddrTIPC struct { + Family uint16 + Addrtype uint8 + Scope int8 + Addr [12]byte +} + type RawSockaddr struct { Family uint16 Data [14]int8 @@ -430,6 +437,7 @@ const ( SizeofSockaddrVM = 0x10 SizeofSockaddrXDP = 0x10 SizeofSockaddrPPPoX = 0x1e + SizeofSockaddrTIPC = 0x10 SizeofLinger = 0x8 SizeofIovec = 0x10 SizeofIPMreq = 0x8 @@ -619,6 +627,7 @@ const ( SizeofRtAttr = 0x4 SizeofIfInfomsg = 0x10 SizeofIfAddrmsg = 0x8 + SizeofIfaCacheinfo = 0x10 SizeofRtMsg = 0xc SizeofRtNexthop = 0x8 SizeofNdUseroptmsg = 0x10 @@ -669,6 +678,13 @@ type IfAddrmsg struct { Index uint32 } +type IfaCacheinfo struct { + Prefered uint32 + Valid uint32 + Cstamp uint32 + Tstamp uint32 +} + type RtMsg struct { Family uint8 Dst_len uint8 @@ -2519,3 +2535,58 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } + +type TIPCSocketAddr struct { + Ref uint32 + Node uint32 +} + +type TIPCServiceRange struct { + Type uint32 + Lower uint32 + Upper uint32 +} + +type TIPCServiceName struct { + Type uint32 + Instance uint32 + Domain uint32 +} + +type TIPCSubscr struct { + Seq TIPCServiceRange + Timeout uint32 + Filter uint32 + Handle [8]int8 +} + +type TIPCEvent struct { + Event uint32 + Lower uint32 + Upper uint32 + Port TIPCSocketAddr + S TIPCSubscr +} + +type TIPCGroupReq struct { + Type uint32 + Instance uint32 + Scope uint32 + Flags uint32 +} + +type TIPCSIOCLNReq struct { + Peer uint32 + Id uint32 + Linkname [68]int8 +} + +type TIPCSIOCNodeIDReq struct { + Peer uint32 + Id [16]int8 +} + +const ( + TIPC_CLUSTER_SCOPE = 0x2 + TIPC_NODE_SCOPE = 0x3 +) diff --git a/vendor/golang.org/x/sys/windows/syscall_windows.go b/vendor/golang.org/x/sys/windows/syscall_windows.go index abdefc33c..ed36134b2 100644 --- a/vendor/golang.org/x/sys/windows/syscall_windows.go +++ b/vendor/golang.org/x/sys/windows/syscall_windows.go @@ -296,6 +296,10 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys SetVolumeLabel(rootPathName *uint16, volumeName *uint16) (err error) = SetVolumeLabelW //sys SetVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16) (err error) = SetVolumeMountPointW //sys MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret int32, err error) [failretval==0] = user32.MessageBoxW +//sys ExitWindowsEx(flags uint32, reason uint32) (err error) = user32.ExitWindowsEx +//sys InitiateSystemShutdownEx(machineName *uint16, message *uint16, timeout uint32, forceAppsClosed bool, rebootAfterShutdown bool, reason uint32) (err error) = advapi32.InitiateSystemShutdownExW +//sys SetProcessShutdownParameters(level uint32, flags uint32) (err error) = kernel32.SetProcessShutdownParameters +//sys GetProcessShutdownParameters(level *uint32, flags *uint32) (err error) = kernel32.GetProcessShutdownParameters //sys clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) = ole32.CLSIDFromString //sys stringFromGUID2(rguid *GUID, lpsz *uint16, cchMax int32) (chars int32) = ole32.StringFromGUID2 //sys coCreateGuid(pguid *GUID) (ret error) = ole32.CoCreateGuid diff --git a/vendor/golang.org/x/sys/windows/types_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go index 1ef80cd71..a9c1c506d 100644 --- a/vendor/golang.org/x/sys/windows/types_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -1688,3 +1688,68 @@ type OsVersionInfoEx struct { ProductType byte _ byte } + +const ( + EWX_LOGOFF = 0x00000000 + EWX_SHUTDOWN = 0x00000001 + EWX_REBOOT = 0x00000002 + EWX_FORCE = 0x00000004 + EWX_POWEROFF = 0x00000008 + EWX_FORCEIFHUNG = 0x00000010 + EWX_QUICKRESOLVE = 0x00000020 + EWX_RESTARTAPPS = 0x00000040 + EWX_HYBRID_SHUTDOWN = 0x00400000 + EWX_BOOTOPTIONS = 0x01000000 + + SHTDN_REASON_FLAG_COMMENT_REQUIRED = 0x01000000 + SHTDN_REASON_FLAG_DIRTY_PROBLEM_ID_REQUIRED = 0x02000000 + SHTDN_REASON_FLAG_CLEAN_UI = 0x04000000 + SHTDN_REASON_FLAG_DIRTY_UI = 0x08000000 + SHTDN_REASON_FLAG_USER_DEFINED = 0x40000000 + SHTDN_REASON_FLAG_PLANNED = 0x80000000 + SHTDN_REASON_MAJOR_OTHER = 0x00000000 + SHTDN_REASON_MAJOR_NONE = 0x00000000 + SHTDN_REASON_MAJOR_HARDWARE = 0x00010000 + SHTDN_REASON_MAJOR_OPERATINGSYSTEM = 0x00020000 + SHTDN_REASON_MAJOR_SOFTWARE = 0x00030000 + SHTDN_REASON_MAJOR_APPLICATION = 0x00040000 + SHTDN_REASON_MAJOR_SYSTEM = 0x00050000 + SHTDN_REASON_MAJOR_POWER = 0x00060000 + SHTDN_REASON_MAJOR_LEGACY_API = 0x00070000 + SHTDN_REASON_MINOR_OTHER = 0x00000000 + SHTDN_REASON_MINOR_NONE = 0x000000ff + SHTDN_REASON_MINOR_MAINTENANCE = 0x00000001 + SHTDN_REASON_MINOR_INSTALLATION = 0x00000002 + SHTDN_REASON_MINOR_UPGRADE = 0x00000003 + SHTDN_REASON_MINOR_RECONFIG = 0x00000004 + SHTDN_REASON_MINOR_HUNG = 0x00000005 + SHTDN_REASON_MINOR_UNSTABLE = 0x00000006 + SHTDN_REASON_MINOR_DISK = 0x00000007 + SHTDN_REASON_MINOR_PROCESSOR = 0x00000008 + SHTDN_REASON_MINOR_NETWORKCARD = 0x00000009 + SHTDN_REASON_MINOR_POWER_SUPPLY = 0x0000000a + SHTDN_REASON_MINOR_CORDUNPLUGGED = 0x0000000b + SHTDN_REASON_MINOR_ENVIRONMENT = 0x0000000c + SHTDN_REASON_MINOR_HARDWARE_DRIVER = 0x0000000d + SHTDN_REASON_MINOR_OTHERDRIVER = 0x0000000e + SHTDN_REASON_MINOR_BLUESCREEN = 0x0000000F + SHTDN_REASON_MINOR_SERVICEPACK = 0x00000010 + SHTDN_REASON_MINOR_HOTFIX = 0x00000011 + SHTDN_REASON_MINOR_SECURITYFIX = 0x00000012 + SHTDN_REASON_MINOR_SECURITY = 0x00000013 + SHTDN_REASON_MINOR_NETWORK_CONNECTIVITY = 0x00000014 + SHTDN_REASON_MINOR_WMI = 0x00000015 + SHTDN_REASON_MINOR_SERVICEPACK_UNINSTALL = 0x00000016 + SHTDN_REASON_MINOR_HOTFIX_UNINSTALL = 0x00000017 + SHTDN_REASON_MINOR_SECURITYFIX_UNINSTALL = 0x00000018 + SHTDN_REASON_MINOR_MMC = 0x00000019 + SHTDN_REASON_MINOR_SYSTEMRESTORE = 0x0000001a + SHTDN_REASON_MINOR_TERMSRV = 0x00000020 + SHTDN_REASON_MINOR_DC_PROMOTION = 0x00000021 + SHTDN_REASON_MINOR_DC_DEMOTION = 0x00000022 + SHTDN_REASON_UNKNOWN = SHTDN_REASON_MINOR_NONE + SHTDN_REASON_LEGACY_API = SHTDN_REASON_MAJOR_LEGACY_API | SHTDN_REASON_FLAG_PLANNED + SHTDN_REASON_VALID_BIT_MASK = 0xc0ffffff + + SHUTDOWN_NORETRY = 0x1 +) diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index 9c448be31..4a9893242 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -234,6 +234,10 @@ var ( procSetVolumeLabelW = modkernel32.NewProc("SetVolumeLabelW") procSetVolumeMountPointW = modkernel32.NewProc("SetVolumeMountPointW") procMessageBoxW = moduser32.NewProc("MessageBoxW") + procExitWindowsEx = moduser32.NewProc("ExitWindowsEx") + procInitiateSystemShutdownExW = modadvapi32.NewProc("InitiateSystemShutdownExW") + procSetProcessShutdownParameters = modkernel32.NewProc("SetProcessShutdownParameters") + procGetProcessShutdownParameters = modkernel32.NewProc("GetProcessShutdownParameters") procCLSIDFromString = modole32.NewProc("CLSIDFromString") procStringFromGUID2 = modole32.NewProc("StringFromGUID2") procCoCreateGuid = modole32.NewProc("CoCreateGuid") @@ -2584,6 +2588,66 @@ func MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret return } +func ExitWindowsEx(flags uint32, reason uint32) (err error) { + r1, _, e1 := syscall.Syscall(procExitWindowsEx.Addr(), 2, uintptr(flags), uintptr(reason), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func InitiateSystemShutdownEx(machineName *uint16, message *uint16, timeout uint32, forceAppsClosed bool, rebootAfterShutdown bool, reason uint32) (err error) { + var _p0 uint32 + if forceAppsClosed { + _p0 = 1 + } else { + _p0 = 0 + } + var _p1 uint32 + if rebootAfterShutdown { + _p1 = 1 + } else { + _p1 = 0 + } + r1, _, e1 := syscall.Syscall6(procInitiateSystemShutdownExW.Addr(), 6, uintptr(unsafe.Pointer(machineName)), uintptr(unsafe.Pointer(message)), uintptr(timeout), uintptr(_p0), uintptr(_p1), uintptr(reason)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetProcessShutdownParameters(level uint32, flags uint32) (err error) { + r1, _, e1 := syscall.Syscall(procSetProcessShutdownParameters.Addr(), 2, uintptr(level), uintptr(flags), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetProcessShutdownParameters(level *uint32, flags *uint32) (err error) { + r1, _, e1 := syscall.Syscall(procGetProcessShutdownParameters.Addr(), 2, uintptr(unsafe.Pointer(level)), uintptr(unsafe.Pointer(flags)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) { r0, _, _ := syscall.Syscall(procCLSIDFromString.Addr(), 2, uintptr(unsafe.Pointer(lpsz)), uintptr(unsafe.Pointer(pclsid)), 0) if r0 != 0 { diff --git a/vendor/modules.txt b/vendor/modules.txt index 71c50d78d..df0137a34 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -3,26 +3,28 @@ github.com/Azure/go-ansiterm github.com/Azure/go-ansiterm/winterm # github.com/BurntSushi/toml v0.3.1 github.com/BurntSushi/toml -# github.com/Microsoft/go-winio v0.4.14 +# github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 github.com/Microsoft/go-winio github.com/Microsoft/go-winio/archive/tar github.com/Microsoft/go-winio/backuptar github.com/Microsoft/go-winio/pkg/guid -# github.com/Microsoft/hcsshim v0.8.6 +# github.com/Microsoft/hcsshim v0.8.7-0.20191101173118-65519b62243c github.com/Microsoft/hcsshim -github.com/Microsoft/hcsshim/internal/guestrequest -github.com/Microsoft/hcsshim/internal/guid +github.com/Microsoft/hcsshim/internal/cow github.com/Microsoft/hcsshim/internal/hcs github.com/Microsoft/hcsshim/internal/hcserror github.com/Microsoft/hcsshim/internal/hns github.com/Microsoft/hcsshim/internal/interop +github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields github.com/Microsoft/hcsshim/internal/longpath github.com/Microsoft/hcsshim/internal/mergemaps +github.com/Microsoft/hcsshim/internal/oc github.com/Microsoft/hcsshim/internal/safefile github.com/Microsoft/hcsshim/internal/schema1 github.com/Microsoft/hcsshim/internal/schema2 github.com/Microsoft/hcsshim/internal/timeout +github.com/Microsoft/hcsshim/internal/vmcompute github.com/Microsoft/hcsshim/internal/wclayer github.com/Microsoft/hcsshim/osversion # github.com/VividCortex/ewma v1.1.1 @@ -36,6 +38,8 @@ github.com/buger/goterm # github.com/checkpoint-restore/go-criu v0.0.0-20190109184317-bdb7599cd87b github.com/checkpoint-restore/go-criu github.com/checkpoint-restore/go-criu/rpc +# github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f +github.com/containerd/cgroups/stats/v1 # github.com/containerd/containerd v1.3.0 github.com/containerd/containerd/errdefs # github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc @@ -56,7 +60,7 @@ github.com/containernetworking/plugins/pkg/ns github.com/containernetworking/plugins/pkg/utils/hwaddr github.com/containernetworking/plugins/plugins/ipam/host-local/backend github.com/containernetworking/plugins/plugins/ipam/host-local/backend/allocator -# github.com/containers/buildah v1.11.5-0.20191031204705-20e92ffe0982 +# github.com/containers/buildah v1.11.5 github.com/containers/buildah github.com/containers/buildah/bind github.com/containers/buildah/chroot @@ -121,7 +125,7 @@ github.com/containers/psgo/internal/dev github.com/containers/psgo/internal/host github.com/containers/psgo/internal/proc github.com/containers/psgo/internal/process -# github.com/containers/storage v1.13.5 +# github.com/containers/storage v1.14.0 github.com/containers/storage github.com/containers/storage/drivers github.com/containers/storage/drivers/aufs @@ -188,7 +192,7 @@ github.com/docker/distribution/registry/client/auth/challenge github.com/docker/distribution/registry/client/transport github.com/docker/distribution/registry/storage/cache github.com/docker/distribution/registry/storage/cache/memory -# github.com/docker/docker v1.4.2-0.20190927142053-ada3c14355ce +# github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 github.com/docker/docker/api github.com/docker/docker/api/types github.com/docker/docker/api/types/blkiodev @@ -248,14 +252,16 @@ github.com/etcd-io/bbolt github.com/fatih/camelcase # github.com/fsnotify/fsnotify v1.4.7 github.com/fsnotify/fsnotify -# github.com/fsouza/go-dockerclient v1.5.0 +# github.com/fsouza/go-dockerclient v1.6.0 github.com/fsouza/go-dockerclient # github.com/ghodss/yaml v1.0.0 github.com/ghodss/yaml -# github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f +# github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e github.com/godbus/dbus # github.com/gogo/protobuf v1.2.2-0.20190723190241-65acae22fc9d +github.com/gogo/protobuf/gogoproto github.com/gogo/protobuf/proto +github.com/gogo/protobuf/protoc-gen-gogo/descriptor github.com/gogo/protobuf/sortkeys # github.com/golang/protobuf v1.3.2 github.com/golang/protobuf/proto @@ -273,6 +279,8 @@ github.com/gorilla/mux github.com/hashicorp/errwrap # github.com/hashicorp/go-multierror v1.0.0 github.com/hashicorp/go-multierror +# github.com/hashicorp/golang-lru v0.5.1 +github.com/hashicorp/golang-lru/simplelru # github.com/hpcloud/tail v1.0.0 github.com/hpcloud/tail github.com/hpcloud/tail/ratelimiter @@ -287,15 +295,13 @@ github.com/inconshreveable/mousetrap github.com/ishidawataru/sctp # github.com/json-iterator/go v1.1.8 github.com/json-iterator/go -# github.com/klauspost/compress v1.8.1 +# github.com/klauspost/compress v1.9.2 github.com/klauspost/compress/flate github.com/klauspost/compress/fse github.com/klauspost/compress/huff0 github.com/klauspost/compress/snappy github.com/klauspost/compress/zstd github.com/klauspost/compress/zstd/internal/xxhash -# github.com/klauspost/cpuid v1.2.1 -github.com/klauspost/cpuid # github.com/klauspost/pgzip v1.2.1 github.com/klauspost/pgzip # github.com/konsorten/go-windows-terminal-sequences v1.0.2 @@ -365,13 +371,14 @@ github.com/opencontainers/go-digest # github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 github.com/opencontainers/image-spec/specs-go github.com/opencontainers/image-spec/specs-go/v1 -# github.com/opencontainers/runc v1.0.0-rc8.0.20190827142921-dd075602f158 +# github.com/opencontainers/runc v1.0.0-rc9 github.com/opencontainers/runc/libcontainer/apparmor github.com/opencontainers/runc/libcontainer/cgroups github.com/opencontainers/runc/libcontainer/configs github.com/opencontainers/runc/libcontainer/devices github.com/opencontainers/runc/libcontainer/system github.com/opencontainers/runc/libcontainer/user +github.com/opencontainers/runc/libcontainer/utils # github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7 github.com/opencontainers/runtime-spec/specs-go # github.com/opencontainers/runtime-tools v0.9.0 @@ -420,9 +427,10 @@ github.com/prometheus/client_model/go github.com/prometheus/common/expfmt github.com/prometheus/common/internal/bitbucket.org/ww/goautoneg github.com/prometheus/common/model -# github.com/prometheus/procfs v0.0.3 +# github.com/prometheus/procfs v0.0.5 github.com/prometheus/procfs github.com/prometheus/procfs/internal/fs +github.com/prometheus/procfs/internal/util # github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8 github.com/safchain/ethtool # github.com/seccomp/containers-golang v0.0.0-20190312124753-8ca8945ccf5f @@ -492,6 +500,12 @@ github.com/xeipuuv/gojsonpointer github.com/xeipuuv/gojsonreference # github.com/xeipuuv/gojsonschema v1.1.0 github.com/xeipuuv/gojsonschema +# go.opencensus.io v0.22.0 +go.opencensus.io +go.opencensus.io/internal +go.opencensus.io/trace +go.opencensus.io/trace/internal +go.opencensus.io/trace/tracestate # go.uber.org/atomic v1.4.0 go.uber.org/atomic # golang.org/x/crypto v0.0.0-20190927123631-a832865fa7ad @@ -521,7 +535,7 @@ golang.org/x/oauth2/internal # golang.org/x/sync v0.0.0-20190423024810-112230192c58 golang.org/x/sync/errgroup golang.org/x/sync/semaphore -# golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 +# golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 golang.org/x/sys/unix golang.org/x/sys/windows # golang.org/x/text v0.3.2 |