37 files changed, 5639 insertions, 0 deletions
diff --git a/vendor/github.com/Microsoft/hcsshim/LICENSE b/vendor/github.com/Microsoft/hcsshim/LICENSE
new file mode 100644
index 000000000..49d21669a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+\ No newline at end of file
diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md
new file mode 100644
index 000000000..30991a12e
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/README.md
@@ -0,0 +1,12 @@
+# hcsshim
+
+This package supports launching Windows Server containers from Go. It is
+primarily used in the [Docker Engine](https://github.com/docker/docker) project,
+but it can be freely used by other projects as well.
+
+This project has adopted the [Microsoft Open Source Code of
+Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
+see the [Code of Conduct
+FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
+[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
+questions or comments.
diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go
new file mode 100644
index 000000000..6d824d7a7
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/activatelayer.go
@@ -0,0 +1,28 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// ActivateLayer will find the layer with the given id and mount it's filesystem.
+// For a read/write layer, the mounted filesystem will appear as a volume on the
+// host, while a read-only layer is generally expected to be a no-op.
+// An activated layer must later be deactivated via DeactivateLayer.
+func ActivateLayer(info DriverInfo, id string) error {
+	title := "hcsshim::ActivateLayer "
+	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
+
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = activateLayer(&infop, id)
+	if err != nil {
+		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/baselayer.go
new file mode 100644
index 000000000..9babd4e18
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/baselayer.go
@@ -0,0 +1,183 @@
+package hcsshim
+
+import (
+	"errors"
+	"os"
+	"path/filepath"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+type baseLayerWriter struct {
+	root         string
+	f            *os.File
+	bw           *winio.BackupFileWriter
+	err          error
+	hasUtilityVM bool
+	dirInfo      []dirInfo
+}
+
+type dirInfo struct {
+	path     string
+	fileInfo winio.FileBasicInfo
+}
+
+// reapplyDirectoryTimes reapplies directory modification, creation, etc. times
+// after processing of the directory tree has completed. The times are expected
+// to be ordered such that parent directories come before child directories.
+func reapplyDirectoryTimes(dis []dirInfo) error {
+	for i := range dis {
+		di := &dis[len(dis)-i-1] // reverse order: process child directories first
+		f, err := winio.OpenForBackup(di.path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING)
+		if err != nil {
+			return err
+		}
+
+		err = winio.SetFileBasicInfo(f, &di.fileInfo)
+		f.Close()
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+func (w *baseLayerWriter) closeCurrentFile() error {
+	if w.f != nil {
+		err := w.bw.Close()
+		err2 := w.f.Close()
+		w.f = nil
+		w.bw = nil
+		if err != nil {
+			return err
+		}
+		if err2 != nil {
+			return err2
+		}
+	}
+	return nil
+}
+
+func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) {
+	defer func() {
+		if err != nil {
+			w.err = err
+		}
+	}()
+
+	err = w.closeCurrentFile()
+	if err != nil {
+		return err
+	}
+
+	if filepath.ToSlash(name) == `UtilityVM/Files` {
+		w.hasUtilityVM = true
+	}
+
+	path := filepath.Join(w.root, name)
+	path, err = makeLongAbsPath(path)
+	if err != nil {
+		return err
+	}
+
+	var f *os.File
+	defer func() {
+		if f != nil {
+			f.Close()
+		}
+	}()
+
+	createmode := uint32(syscall.CREATE_NEW)
+	if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 {
+		err := os.Mkdir(path, 0)
+		if err != nil && !os.IsExist(err) {
+			return err
+		}
+		createmode = syscall.OPEN_EXISTING
+		if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
+			w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo})
+		}
+	}
+
+	mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY)
+	f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode)
+	if err != nil {
+		return makeError(err, "Failed to OpenForBackup", path)
+	}
+
+	err = winio.SetFileBasicInfo(f, fileInfo)
+	if err != nil {
+		return makeError(err, "Failed to SetFileBasicInfo", path)
+	}
+
+	w.f = f
+	w.bw = winio.NewBackupFileWriter(f, true)
+	f = nil
+	return nil
+}
+
+func (w *baseLayerWriter) AddLink(name string, target string) (err error) {
+	defer func() {
+		if err != nil {
+			w.err = err
+		}
+	}()
+
+	err = w.closeCurrentFile()
+	if err != nil {
+		return err
+	}
+
+	linkpath, err := makeLongAbsPath(filepath.Join(w.root, name))
+	if err != nil {
+		return err
+	}
+
+	linktarget, err := makeLongAbsPath(filepath.Join(w.root, target))
+	if err != nil {
+		return err
+	}
+
+	return os.Link(linktarget, linkpath)
+}
+
+func (w *baseLayerWriter) Remove(name string) error {
+	return errors.New("base layer cannot have tombstones")
+}
+
+func (w *baseLayerWriter) Write(b []byte) (int, error) {
+	n, err := w.bw.Write(b)
+	if err != nil {
+		w.err = err
+	}
+	return n, err
+}
+
+func (w *baseLayerWriter) Close() error {
+	err := w.closeCurrentFile()
+	if err != nil {
+		return err
+	}
+	if w.err == nil {
+		// Restore the file times of all the directories, since they may have
+		// been modified by creating child directories.
+		err = reapplyDirectoryTimes(w.dirInfo)
+		if err != nil {
+			return err
+		}
+
+		err = ProcessBaseLayer(w.root)
+		if err != nil {
+			return err
+		}
+
+		if w.hasUtilityVM {
+			err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM"))
+			if err != nil {
+				return err
+			}
+		}
+	}
+	return w.err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/callback.go
new file mode 100644
index 000000000..e8c2b00c8
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/callback.go
@@ -0,0 +1,79 @@
+package hcsshim
+
+import (
+	"sync"
+	"syscall"
+)
+
+var (
+	nextCallback    uintptr
+	callbackMap     = map[uintptr]*notifcationWatcherContext{}
+	callbackMapLock = sync.RWMutex{}
+
+	notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
+
+	// Notifications for HCS_SYSTEM handles
+	hcsNotificationSystemExited          hcsNotification = 0x00000001
+	hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
+	hcsNotificationSystemStartCompleted  hcsNotification = 0x00000003
+	hcsNotificationSystemPauseCompleted  hcsNotification = 0x00000004
+	hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
+
+	// Notifications for HCS_PROCESS handles
+	hcsNotificationProcessExited hcsNotification = 0x00010000
+
+	// Common notifications
+	hcsNotificationInvalid           hcsNotification = 0x00000000
+	hcsNotificationServiceDisconnect hcsNotification = 0x01000000
+)
+
+type hcsNotification uint32
+type notificationChannel chan error
+
+type notifcationWatcherContext struct {
+	channels notificationChannels
+	handle   hcsCallback
+}
+
+type notificationChannels map[hcsNotification]notificationChannel
+
+func newChannels() notificationChannels {
+	channels := make(notificationChannels)
+
+	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
+	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
+	return channels
+}
+func closeChannels(channels notificationChannels) {
+	close(channels[hcsNotificationSystemExited])
+	close(channels[hcsNotificationSystemCreateCompleted])
+	close(channels[hcsNotificationSystemStartCompleted])
+	close(channels[hcsNotificationSystemPauseCompleted])
+	close(channels[hcsNotificationSystemResumeCompleted])
+	close(channels[hcsNotificationProcessExited])
+	close(channels[hcsNotificationServiceDisconnect])
+}
+
+func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
+	var result error
+	if int32(notificationStatus) < 0 {
+		result = syscall.Errno(win32FromHresult(notificationStatus))
+	}
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return 0
+	}
+
+	context.channels[notificationType] <- result
+
+	return 0
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/cgo.go
new file mode 100644
index 000000000..200333233
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/cgo.go
@@ -0,0 +1,7 @@
+package hcsshim
+
+import "C"
+
+// This import is needed to make the library compile as CGO because HCSSHIM
+// only works with CGO due to callbacks from HCS comming back from a C thread
+// which is not supported without CGO. See https://github.com/golang/go/issues/10973
diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go
new file mode 100644
index 000000000..b924d39f4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/container.go
@@ -0,0 +1,794 @@
+package hcsshim
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	defaultTimeout = time.Minute * 4
+)
+
+const (
+	pendingUpdatesQuery    = `{ "PropertyTypes" : ["PendingUpdates"]}`
+	statisticsQuery        = `{ "PropertyTypes" : ["Statistics"]}`
+	processListQuery       = `{ "PropertyTypes" : ["ProcessList"]}`
+	mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
+)
+
+type container struct {
+	handleLock     sync.RWMutex
+	handle         hcsSystem
+	id             string
+	callbackNumber uintptr
+}
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties struct {
+	ID                           string `json:"Id"`
+	Name                         string
+	SystemType                   string
+	Owner                        string
+	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
+	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	IsRuntimeTemplate            bool                                `json:",omitempty"`
+	RuntimeImagePath             string                              `json:",omitempty"`
+	Stopped                      bool                                `json:",omitempty"`
+	ExitType                     string                              `json:",omitempty"`
+	AreUpdatesPending            bool                                `json:",omitempty"`
+	ObRoot                       string                              `json:",omitempty"`
+	Statistics                   Statistics                          `json:",omitempty"`
+	ProcessList                  []ProcessListItem                   `json:",omitempty"`
+	MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
+}
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats struct {
+	UsageCommitBytes            uint64 `json:"MemoryUsageCommitBytes,omitempty"`
+	UsageCommitPeakBytes        uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+	UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats struct {
+	TotalRuntime100ns  uint64 `json:",omitempty"`
+	RuntimeUser100ns   uint64 `json:",omitempty"`
+	RuntimeKernel100ns uint64 `json:",omitempty"`
+}
+
+// StorageStats holds the storage statistics for a container
+type StorageStats struct {
+	ReadCountNormalized  uint64 `json:",omitempty"`
+	ReadSizeBytes        uint64 `json:",omitempty"`
+	WriteCountNormalized uint64 `json:",omitempty"`
+	WriteSizeBytes       uint64 `json:",omitempty"`
+}
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats struct {
+	BytesReceived          uint64 `json:",omitempty"`
+	BytesSent              uint64 `json:",omitempty"`
+	PacketsReceived        uint64 `json:",omitempty"`
+	PacketsSent            uint64 `json:",omitempty"`
+	DroppedPacketsIncoming uint64 `json:",omitempty"`
+	DroppedPacketsOutgoing uint64 `json:",omitempty"`
+	EndpointId             string `json:",omitempty"`
+	InstanceId             string `json:",omitempty"`
+}
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics struct {
+	Timestamp          time.Time      `json:",omitempty"`
+	ContainerStartTime time.Time      `json:",omitempty"`
+	Uptime100ns        uint64         `json:",omitempty"`
+	Memory             MemoryStats    `json:",omitempty"`
+	Processor          ProcessorStats `json:",omitempty"`
+	Storage            StorageStats   `json:",omitempty"`
+	Network            []NetworkStats `json:",omitempty"`
+}
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem struct {
+	CreateTimestamp              time.Time `json:",omitempty"`
+	ImageName                    string    `json:",omitempty"`
+	KernelTime100ns              uint64    `json:",omitempty"`
+	MemoryCommitBytes            uint64    `json:",omitempty"`
+	MemoryWorkingSetPrivateBytes uint64    `json:",omitempty"`
+	MemoryWorkingSetSharedBytes  uint64    `json:",omitempty"`
+	ProcessId                    uint32    `json:",omitempty"`
+	UserTime100ns                uint64    `json:",omitempty"`
+}
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController struct {
+	MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
+}
+
+// Type of Request Support in ModifySystem
+type RequestType string
+
+// Type of Resource Support in ModifySystem
+type ResourceType string
+
+// RequestType const
+const (
+	Add     RequestType  = "Add"
+	Remove  RequestType  = "Remove"
+	Network ResourceType = "Network"
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse struct {
+	Resource ResourceType `json:"ResourceType"`
+	Data     interface{}  `json:"Settings"`
+	Request  RequestType  `json:"RequestType,omitempty"`
+}
+
+// createContainerAdditionalJSON is read from the environment at initialisation
+// time. It allows an environment variable to define additional JSON which
+// is merged in the CreateContainer call to HCS.
+var createContainerAdditionalJSON string
+
+func init() {
+	createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")
+}
+
+// CreateContainer creates a new container with the given configuration but does not start it.
+func CreateContainer(id string, c *ContainerConfig) (Container, error) {
+	return createContainerWithJSON(id, c, "")
+}
+
+// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
+// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
+func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
+	return createContainerWithJSON(id, c, additionalJSON)
+}
+
+func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
+	operation := "CreateContainer"
+	title := "HCSShim::" + operation
+
+	container := &container{
+		id: id,
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, err
+	}
+
+	configuration := string(configurationb)
+	logrus.Debugf(title+" id=%s config=%s", id, configuration)
+
+	// Merge any additional JSON. Priority is given to what is passed in explicitly,
+	// falling back to what's set in the environment.
+	if additionalJSON == "" && createContainerAdditionalJSON != "" {
+		additionalJSON = createContainerAdditionalJSON
+	}
+	if additionalJSON != "" {
+		configurationMap := map[string]interface{}{}
+		if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
+			return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
+		}
+
+		additionalMap := map[string]interface{}{}
+		if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
+			return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
+		}
+
+		mergedMap := mergeMaps(additionalMap, configurationMap)
+		mergedJSON, err := json.Marshal(mergedMap)
+		if err != nil {
+			return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
+		}
+
+		configuration = string(mergedJSON)
+		logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
+	}
+
+	var (
+		resultp  *uint16
+		identity syscall.Handle
+	)
+	createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
+
+	if createError == nil || IsPending(createError) {
+		if err := container.registerCallback(); err != nil {
+			return nil, makeContainerError(container, operation, "", err)
+		}
+	}
+
+	err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
+	if err != nil {
+		return nil, makeContainerError(container, operation, configuration, err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
+	return container, nil
+}
+
+// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
+// in ToMap are overwritten. Values in fromMap are added to ToMap.
+// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
+func mergeMaps(fromMap, ToMap interface{}) interface{} {
+	switch fromMap := fromMap.(type) {
+	case map[string]interface{}:
+		ToMap, ok := ToMap.(map[string]interface{})
+		if !ok {
+			return fromMap
+		}
+		for keyToMap, valueToMap := range ToMap {
+			if valueFromMap, ok := fromMap[keyToMap]; ok {
+				fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
+			} else {
+				fromMap[keyToMap] = valueToMap
+			}
+		}
+	case nil:
+		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
+		ToMap, ok := ToMap.(map[string]interface{})
+		if ok {
+			return ToMap
+		}
+	}
+	return fromMap
+}
+
+// OpenContainer opens an existing container by ID.
+func OpenContainer(id string) (Container, error) {
+	operation := "OpenContainer"
+	title := "HCSShim::" + operation
+	logrus.Debugf(title+" id=%s", id)
+
+	container := &container{
+		id: id,
+	}
+
+	var (
+		handle  hcsSystem
+		resultp *uint16
+	)
+	err := hcsOpenComputeSystem(id, &handle, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	container.handle = handle
+
+	if err := container.registerCallback(); err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
+	return container, nil
+}
+
+// GetContainers gets a list of the containers on the system that match the query
+func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
+	operation := "GetContainers"
+	title := "HCSShim::" + operation
+
+	queryb, err := json.Marshal(q)
+	if err != nil {
+		return nil, err
+	}
+
+	query := string(queryb)
+	logrus.Debugf(title+" query=%s", query)
+
+	var (
+		resultp         *uint16
+		computeSystemsp *uint16
+	)
+	err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return nil, err
+	}
+
+	if computeSystemsp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
+	computeSystems := []ContainerProperties{}
+	if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+		return nil, err
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return computeSystems, nil
+}
+
+// Start synchronously starts the container.
+func (container *container) Start() error {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Start"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	var resultp *uint16
+	err := hcsStartComputeSystem(container.handle, "", &resultp)
+	err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+// Shutdown requests a container shutdown, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (container *container) Shutdown() error {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Shutdown"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	var resultp *uint16
+	err := hcsShutdownComputeSystem(container.handle, "", &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+// Terminate requests a container terminate, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (container *container) Terminate() error {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Terminate"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	var resultp *uint16
+	err := hcsTerminateComputeSystem(container.handle, "", &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+// Wait synchronously waits for the container to shutdown or terminate.
+func (container *container) Wait() error {
+	operation := "Wait"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+// WaitTimeout synchronously waits for the container to terminate or the duration to elapse.
+// If the timeout expires, IsTimeout(err) == true
+func (container *container) WaitTimeout(timeout time.Duration) error {
+	operation := "WaitTimeout"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+func (container *container) properties(query string) (*ContainerProperties, error) {
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return nil, err
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
+	properties := &ContainerProperties{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, err
+	}
+	return properties, nil
+}
+
+// HasPendingUpdates returns true if the container has updates pending to install
+func (container *container) HasPendingUpdates() (bool, error) {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "HasPendingUpdates"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	properties, err := container.properties(pendingUpdatesQuery)
+	if err != nil {
+		return false, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return properties.AreUpdatesPending, nil
+}
+
+// Statistics returns statistics for the container
+func (container *container) Statistics() (Statistics, error) {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Statistics"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	properties, err := container.properties(statisticsQuery)
+	if err != nil {
+		return Statistics{}, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return properties.Statistics, nil
+}
+
+// ProcessList returns an array of ProcessListItems for the container
+func (container *container) ProcessList() ([]ProcessListItem, error) {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "ProcessList"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	properties, err := container.properties(processListQuery)
+	if err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return properties.ProcessList, nil
+}
+
+// MappedVirtualDisks returns a map of the controllers and the disks mapped
+// to a container.
+//
+// Example of JSON returned by the query.
+//{
+//   "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
+//   "SystemType":"Container",
+//   "RuntimeOsType":"Linux",
+//   "RuntimeId":"00000000-0000-0000-0000-000000000000",
+//   "State":"Running",
+//   "MappedVirtualDiskControllers":{
+//      "0":{
+//         "MappedVirtualDisks":{
+//            "2":{
+//               "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
+//               "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
+//               "Lun":2,
+//               "CreateInUtilityVM":true
+//            },
+//            "3":{
+//               "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
+//               "Lun":3,
+//               "CreateInUtilityVM":true,
+//               "AttachOnly":true
+//            }
+//         }
+//      }
+//   }
+//}
+func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "MappedVirtualDiskList"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	properties, err := container.properties(mappedVirtualDiskQuery)
+	if err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return properties.MappedVirtualDiskControllers, nil
+}
+
+// Pause pauses the execution of the container. This feature is not enabled in TP5.
+func (container *container) Pause() error {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Pause"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	var resultp *uint16
+	err := hcsPauseComputeSystem(container.handle, "", &resultp)
+	err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+// Resume resumes the execution of the container. This feature is not enabled in TP5.
+func (container *container) Resume() error {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Resume"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	if container.handle == 0 {
+		return makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	var resultp *uint16
+	err := hcsResumeComputeSystem(container.handle, "", &resultp)
+	err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+// CreateProcess launches a new process within the container.
+func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "CreateProcess"
+	title := "HCSShim::Container::" + operation
+	var (
+		processInfo   hcsProcessInformation
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if container.handle == 0 {
+		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	// If we are not emulating a console, ignore any console size passed to us
+	if !c.EmulateConsole {
+		c.ConsoleSize[0] = 0
+		c.ConsoleSize[1] = 0
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	configuration := string(configurationb)
+	logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
+
+	err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return nil, makeContainerError(container, operation, configuration, err)
+	}
+
+	process := &process{
+		handle:    processHandle,
+		processID: int(processInfo.ProcessId),
+		container: container,
+		cachedPipes: &cachedPipes{
+			stdIn:  processInfo.StdInput,
+			stdOut: processInfo.StdOutput,
+			stdErr: processInfo.StdError,
+		},
+	}
+
+	if err := process.registerCallback(); err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
+	return process, nil
+}
+
+// OpenProcess gets an interface to an existing process within the container.
+func (container *container) OpenProcess(pid int) (Process, error) {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "OpenProcess"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
+	var (
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if container.handle == 0 {
+		return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	process := &process{
+		handle:    processHandle,
+		processID: pid,
+		container: container,
+	}
+
+	if err := process.registerCallback(); err != nil {
+		return nil, makeContainerError(container, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
+	return process, nil
+}
+
+// Close cleans up any state associated with the container but does not terminate or wait for it.
+func (container *container) Close() error {
+	container.handleLock.Lock()
+	defer container.handleLock.Unlock()
+	operation := "Close"
+	title := "HCSShim::Container::" + operation
+	logrus.Debugf(title+" id=%s", container.id)
+
+	// Don't double free this
+	if container.handle == 0 {
+		return nil
+	}
+
+	if err := container.unregisterCallback(); err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	if err := hcsCloseComputeSystem(container.handle); err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+
+	container.handle = 0
+
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
+
+func (container *container) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	container.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (container *container) unregisterCallback() error {
+	callbackNumber := container.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterComputeSystemCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterComputeSystemCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
+
+// Modifies the System by sending a request to HCS
+func (container *container) Modify(config *ResourceModificationRequestResponse) error {
+	container.handleLock.RLock()
+	defer container.handleLock.RUnlock()
+	operation := "Modify"
+	title := "HCSShim::Container::" + operation
+
+	if container.handle == 0 {
+		return makeContainerError(container, operation, "", ErrAlreadyClosed)
+	}
+
+	requestJSON, err := json.Marshal(config)
+	if err != nil {
+		return err
+	}
+
+	requestString := string(requestJSON)
+	logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
+
+	var resultp *uint16
+	err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return makeContainerError(container, operation, "", err)
+	}
+	logrus.Debugf(title+" succeeded id=%s", container.id)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go
new file mode 100644
index 000000000..035d9c394
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/createlayer.go
@@ -0,0 +1,27 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// CreateLayer creates a new, empty, read-only layer on the filesystem based on
+// the parent layer provided.
+func CreateLayer(info DriverInfo, id, parent string) error {
+	title := "hcsshim::CreateLayer "
+	logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = createLayer(&infop, id, parent)
+	if err != nil {
+		err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go
new file mode 100644
index 000000000..7a6a8854c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go
@@ -0,0 +1,35 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// CreateSandboxLayer creates and populates new read-write layer for use by a container.
+// This requires both the id of the direct parent layer, as well as the full list
+// of paths to all parent layers up to the base (and including the direct parent
+// whose id was provided).
+func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
+	title := "hcsshim::CreateSandboxLayer "
+	logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = createSandboxLayer(&infop, layerId, parentId, layers)
+	if err != nil {
+		err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go
new file mode 100644
index 000000000..fd785030f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go
@@ -0,0 +1,26 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
+func DeactivateLayer(info DriverInfo, id string) error {
+	title := "hcsshim::DeactivateLayer "
+	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = deactivateLayer(&infop, id)
+	if err != nil {
+		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go
new file mode 100644
index 000000000..b1e3b89fc
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/destroylayer.go
@@ -0,0 +1,27 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// DestroyLayer will remove the on-disk files representing the layer with the given
+// id, including that layer's containing folder, if any.
+func DestroyLayer(info DriverInfo, id string) error {
+	title := "hcsshim::DestroyLayer "
+	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = destroyLayer(&infop, id)
+	if err != nil {
+		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go
new file mode 100644
index 000000000..d2f9cc8bd
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/errors.go
@@ -0,0 +1,239 @@
+package hcsshim
+
+import (
+	"errors"
+	"fmt"
+	"syscall"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
+	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = syscall.Errno(0x490)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = syscall.Errno(0x32)
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = syscall.Errno(0xd)
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = syscall.Errno(0x7f)
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = errors.New("unsupported platform request")
+)
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	Process   *process
+	Operation string
+	ExtraInfo string
+	Err       error
+}
+
+// ContainerError is an error encountered in HCS during an operation on a Container object
+type ContainerError struct {
+	Container *container
+	Operation string
+	ExtraInfo string
+	Err       error
+}
+
+func (e *ContainerError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Container == nil {
+		return "unexpected nil container for error: " + e.Err.Error()
+	}
+
+	s := "container " + e.Container.id
+
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	if e.ExtraInfo != "" {
+		s += " extra info: " + e.ExtraInfo
+	}
+
+	return s
+}
+
+func makeContainerError(container *container, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ContainerError); ok {
+		return err
+	}
+	containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return containerError
+}
+
+func (e *ProcessError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Process == nil {
+		return "Unexpected nil process for error: " + e.Err.Error()
+	}
+
+	s := fmt.Sprintf("process %d", e.Process.processID)
+
+	if e.Process.container != nil {
+		s += " in container " + e.Process.container.id
+	}
+
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	return s
+}
+
+func makeProcessError(process *process, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return processError
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	err = getInnerError(err)
+	return err == ErrComputeSystemDoesNotExist ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	err = getInnerError(err)
+	return err == ErrAlreadyClosed
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationPending
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	err = getInnerError(err)
+	return err == ErrTimeout
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeAlreadyStopped ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	err = getInnerError(err)
+	// If Platform doesn't recognize or support the request sent, below errors are seen
+	return err == ErrVmcomputeInvalidJSON ||
+		err == ErrInvalidData ||
+		err == ErrNotSupported ||
+		err == ErrVmcomputeUnknownMessage
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *ContainerError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go
new file mode 100644
index 000000000..6946c6a84
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go
@@ -0,0 +1,26 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// ExpandSandboxSize expands the size of a layer to at least size bytes.
+func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
+	title := "hcsshim::ExpandSandboxSize "
+	logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = expandSandboxSize(&infop, layerId, size)
+	if err != nil {
+		err = makeErrorf(err, title, "layerId=%s  size=%d", layerId, size)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go
new file mode 100644
index 000000000..d7025f20b
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/exportlayer.go
@@ -0,0 +1,156 @@
+package hcsshim
+
+import (
+	"io"
+	"io/ioutil"
+	"os"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/sirupsen/logrus"
+)
+
+// ExportLayer will create a folder at exportFolderPath and fill that folder with
+// the transport format version of the layer identified by layerId. This transport
+// format includes any metadata required for later importing the layer (using
+// ImportLayer), and requires the full list of parent layer paths in order to
+// perform the export.
+func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
+	title := "hcsshim::ExportLayer "
+	logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = exportLayer(&infop, layerId, exportFolderPath, layers)
+	if err != nil {
+		err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
+	return nil
+}
+
+type LayerReader interface {
+	Next() (string, int64, *winio.FileBasicInfo, error)
+	Read(b []byte) (int, error)
+	Close() error
+}
+
+// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
+type FilterLayerReader struct {
+	context uintptr
+}
+
+// Next reads the next available file from a layer, ensuring that parent directories are always read
+// before child files and directories.
+//
+// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
+// extract a Win32 backup stream with the remainder of the metadata and the data.
+func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
+	var fileNamep *uint16
+	fileInfo := &winio.FileBasicInfo{}
+	var deleted uint32
+	var fileSize int64
+	err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
+	if err != nil {
+		if err == syscall.ERROR_NO_MORE_FILES {
+			err = io.EOF
+		} else {
+			err = makeError(err, "ExportLayerNext", "")
+		}
+		return "", 0, nil, err
+	}
+	fileName := convertAndFreeCoTaskMemString(fileNamep)
+	if deleted != 0 {
+		fileInfo = nil
+	}
+	if fileName[0] == '\\' {
+		fileName = fileName[1:]
+	}
+	return fileName, fileSize, fileInfo, nil
+}
+
+// Read reads from the current file's Win32 backup stream.
+func (r *FilterLayerReader) Read(b []byte) (int, error) {
+	var bytesRead uint32
+	err := exportLayerRead(r.context, b, &bytesRead)
+	if err != nil {
+		return 0, makeError(err, "ExportLayerRead", "")
+	}
+	if bytesRead == 0 {
+		return 0, io.EOF
+	}
+	return int(bytesRead), nil
+}
+
+// Close frees resources associated with the layer reader. It will return an
+// error if there was an error while reading the layer or of the layer was not
+// completely read.
+func (r *FilterLayerReader) Close() (err error) {
+	if r.context != 0 {
+		err = exportLayerEnd(r.context)
+		if err != nil {
+			err = makeError(err, "ExportLayerEnd", "")
+		}
+		r.context = 0
+	}
+	return
+}
+
+// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
+// The caller must have taken the SeBackupPrivilege privilege
+// to call this and any methods on the resulting LayerReader.
+func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
+	if procExportLayerBegin.Find() != nil {
+		// The new layer reader is not available on this Windows build. Fall back to the
+		// legacy export code path.
+		path, err := ioutil.TempDir("", "hcs")
+		if err != nil {
+			return nil, err
+		}
+		err = ExportLayer(info, layerID, path, parentLayerPaths)
+		if err != nil {
+			os.RemoveAll(path)
+			return nil, err
+		}
+		return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil
+	}
+
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return nil, err
+	}
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		return nil, err
+	}
+	r := &FilterLayerReader{}
+	err = exportLayerBegin(&infop, layerID, layers, &r.context)
+	if err != nil {
+		return nil, makeError(err, "ExportLayerBegin", "")
+	}
+	return r, err
+}
+
+type legacyLayerReaderWrapper struct {
+	*legacyLayerReader
+}
+
+func (r *legacyLayerReaderWrapper) Close() error {
+	err := r.legacyLayerReader.Close()
+	os.RemoveAll(r.root)
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go
new file mode 100644
index 000000000..89f8079d0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go
@@ -0,0 +1,55 @@
+package hcsshim
+
+import (
+	"syscall"
+
+	"github.com/sirupsen/logrus"
+)
+
+// GetLayerMountPath will look for a mounted layer with the given id and return
+// the path at which that layer can be accessed.  This path may be a volume path
+// if the layer is a mounted read-write layer, otherwise it is expected to be the
+// folder path at which the layer is stored.
+func GetLayerMountPath(info DriverInfo, id string) (string, error) {
+	title := "hcsshim::GetLayerMountPath "
+	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return "", err
+	}
+
+	var mountPathLength uintptr
+	mountPathLength = 0
+
+	// Call the procedure itself.
+	logrus.Debugf("Calling proc (1)")
+	err = getLayerMountPath(&infop, id, &mountPathLength, nil)
+	if err != nil {
+		err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour)
+		logrus.Error(err)
+		return "", err
+	}
+
+	// Allocate a mount path of the returned length.
+	if mountPathLength == 0 {
+		return "", nil
+	}
+	mountPathp := make([]uint16, mountPathLength)
+	mountPathp[0] = 0
+
+	// Call the procedure again
+	logrus.Debugf("Calling proc (2)")
+	err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0])
+	if err != nil {
+		err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour)
+		logrus.Error(err)
+		return "", err
+	}
+
+	path := syscall.UTF16ToString(mountPathp[0:])
+	logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path)
+	return path, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go
new file mode 100644
index 000000000..05d3d9532
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go
@@ -0,0 +1,22 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// GetSharedBaseImages will enumerate the images stored in the common central
+// image store and return descriptive info about those images for the purpose
+// of registering them with the graphdriver, graph, and tagstore.
+func GetSharedBaseImages() (imageData string, err error) {
+	title := "hcsshim::GetSharedBaseImages "
+
+	logrus.Debugf("Calling proc")
+	var buffer *uint16
+	err = getBaseImages(&buffer)
+	if err != nil {
+		err = makeError(err, title, "")
+		logrus.Error(err)
+		return
+	}
+	imageData = convertAndFreeCoTaskMemString(buffer)
+	logrus.Debugf(title+" - succeeded output=%s", imageData)
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go
new file mode 100644
index 000000000..620aba123
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/guid.go
@@ -0,0 +1,19 @@
+package hcsshim
+
+import (
+	"crypto/sha1"
+	"fmt"
+)
+
+type GUID [16]byte
+
+func NewGUID(source string) *GUID {
+	h := sha1.Sum([]byte(source))
+	var g GUID
+	copy(g[0:], h[0:16])
+	return &g
+}
+
+func (g *GUID) ToString() string {
+	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go
new file mode 100644
index 000000000..236ba1fa3
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go
@@ -0,0 +1,166 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcsshim
+
+import (
+	"fmt"
+	"syscall"
+	"unsafe"
+
+	"github.com/sirupsen/logrus"
+)
+
+//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go
+
+//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
+//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
+
+//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
+//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
+//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
+//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
+//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
+//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
+//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
+//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
+//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
+//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
+//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
+//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
+//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
+//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
+//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
+//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
+//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
+
+//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
+//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
+//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
+//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
+
+//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
+//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
+//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
+//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
+
+//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
+
+const (
+	// Specific user-visible exit codes
+	WaitErrExecFailed = 32767
+
+	ERROR_GEN_FAILURE          = syscall.Errno(31)
+	ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
+	WSAEINVAL                  = syscall.Errno(10022)
+
+	// Timeout on wait calls
+	TimeoutInfinite = 0xFFFFFFFF
+)
+
+type HcsError struct {
+	title string
+	rest  string
+	Err   error
+}
+
+type hcsSystem syscall.Handle
+type hcsProcess syscall.Handle
+type hcsCallback syscall.Handle
+
+type hcsProcessInformation struct {
+	ProcessId uint32
+	Reserved  uint32
+	StdInput  syscall.Handle
+	StdOutput syscall.Handle
+	StdError  syscall.Handle
+}
+
+func makeError(err error, title, rest string) error {
+	// Pass through DLL errors directly since they do not originate from HCS.
+	if _, ok := err.(*syscall.DLLError); ok {
+		return err
+	}
+	return &HcsError{title, rest, err}
+}
+
+func makeErrorf(err error, title, format string, a ...interface{}) error {
+	return makeError(err, title, fmt.Sprintf(format, a...))
+}
+
+func win32FromError(err error) uint32 {
+	if herr, ok := err.(*HcsError); ok {
+		return win32FromError(herr.Err)
+	}
+	if code, ok := err.(syscall.Errno); ok {
+		return uint32(code)
+	}
+	return uint32(ERROR_GEN_FAILURE)
+}
+
+func win32FromHresult(hr uintptr) uintptr {
+	if hr&0x1fff0000 == 0x00070000 {
+		return hr & 0xffff
+	}
+	return hr
+}
+
+func (e *HcsError) Error() string {
+	s := e.title
+	if len(s) > 0 && s[len(s)-1] != ' ' {
+		s += " "
+	}
+	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
+	if e.rest != "" {
+		if e.rest[0] != ' ' {
+			s += " "
+		}
+		s += e.rest
+	}
+	return s
+}
+
+func convertAndFreeCoTaskMemString(buffer *uint16) string {
+	str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
+	coTaskMemFree(unsafe.Pointer(buffer))
+	return str
+}
+
+func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
+	return []byte(convertAndFreeCoTaskMemString(buffer))
+}
+
+func processHcsResult(err error, resultp *uint16) error {
+	if resultp != nil {
+		result := convertAndFreeCoTaskMemString(resultp)
+		logrus.Debugf("Result: %s", result)
+	}
+	return err
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
new file mode 100644
index 000000000..92afc0c24
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
@@ -0,0 +1,318 @@
+package hcsshim
+
+import (
+	"encoding/json"
+	"fmt"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint struct {
+	Id                 string            `json:"ID,omitempty"`
+	Name               string            `json:",omitempty"`
+	VirtualNetwork     string            `json:",omitempty"`
+	VirtualNetworkName string            `json:",omitempty"`
+	Policies           []json.RawMessage `json:",omitempty"`
+	MacAddress         string            `json:",omitempty"`
+	IPAddress          net.IP            `json:",omitempty"`
+	DNSSuffix          string            `json:",omitempty"`
+	DNSServerList      string            `json:",omitempty"`
+	GatewayAddress     string            `json:",omitempty"`
+	EnableInternalDNS  bool              `json:",omitempty"`
+	DisableICC         bool              `json:",omitempty"`
+	PrefixLength       uint8             `json:",omitempty"`
+	IsRemoteEndpoint   bool              `json:",omitempty"`
+}
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest struct {
+	ContainerID    string     `json:"ContainerId,omitempty"`
+	SystemType     SystemType `json:"SystemType"`
+	CompartmentID  uint16     `json:"CompartmentId,omitempty"`
+	VirtualNICName string     `json:"VirtualNicName,omitempty"`
+}
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse struct {
+	Success bool
+	Error   string
+}
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	endpoint := &HNSEndpoint{}
+	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	var endpoint []HNSEndpoint
+	err := hnsCall("GET", "/endpoints/", "", &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
+func HotAttachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Add)
+}
+
+// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
+func HotDetachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Remove)
+}
+
+// ModifyContainer corresponding to the container id, by sending a request
+func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
+	container, err := OpenContainer(id)
+	if err != nil {
+		if IsNotExist(err) {
+			return ErrComputeSystemDoesNotExist
+		}
+		return getInnerError(err)
+	}
+	defer container.Close()
+	err = container.Modify(request)
+	if err != nil {
+		if IsNotSupported(err) {
+			return ErrPlatformNotSupported
+		}
+		return getInnerError(err)
+	}
+
+	return nil
+}
+
+func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
+	requestMessage := &ResourceModificationRequestResponse{
+		Resource: Network,
+		Request:  request,
+		Data:     endpointID,
+	}
+	err := modifyContainer(containerID, requestMessage)
+
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return HNSEndpointRequest("GET", endpointID, "")
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	hnsResponse, err := HNSListEndpointRequest()
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsEndpoint := range hnsResponse {
+		if hnsEndpoint.Name == endpointName {
+			return &hnsEndpoint, nil
+		}
+	}
+	return nil, fmt.Errorf("Endpoint %v not found", endpointName)
+}
+
+// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
+func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
+	operation := "Create"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	return HNSEndpointRequest("POST", "", string(jsonString))
+}
+
+// Delete Endpoint by sending EndpointRequest to HNS
+func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
+	operation := "Delete"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	return HNSEndpointRequest("DELETE", endpoint.Id, "")
+}
+
+// Update Endpoint
+func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
+	operation := "Update"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
+
+	return endpoint, err
+}
+
+// ContainerHotAttach attaches an endpoint to a running container
+func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
+	operation := "ContainerHotAttach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
+
+	return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
+}
+
+// ContainerHotDetach detaches an endpoint from a running container
+func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
+	operation := "ContainerHotDetach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
+
+	return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
+}
+
+// ApplyACLPolicy applies Acl Policy on the Endpoint
+func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error {
+	operation := "ApplyACLPolicy"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(policy)
+	if err != nil {
+		return err
+	}
+	endpoint.Policies[0] = jsonString
+	_, err = endpoint.Update()
+	return err
+}
+
+// ContainerAttach attaches an endpoint to container
+func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
+	operation := "ContainerAttach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID:   containerID,
+		CompartmentID: compartmentID,
+		SystemType:    ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// ContainerDetach detaches an endpoint from container
+func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
+	operation := "ContainerDetach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID: containerID,
+		SystemType:  ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// HostAttach attaches a nic on the host
+func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
+	operation := "HostAttach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		CompartmentID: compartmentID,
+		SystemType:    HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+
+}
+
+// HostDetach detaches a nic on the host
+func (endpoint *HNSEndpoint) HostDetach() error {
+	operation := "HostDetach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// VirtualMachineNICAttach attaches a endpoint to a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
+	operation := "VirtualMachineNicAttach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		VirtualNICName: virtualMachineNICName,
+		SystemType:     VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// VirtualMachineNICDetach detaches a endpoint  from a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
+	operation := "VirtualMachineNicDetach"
+	title := "HCSShim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go
new file mode 100644
index 000000000..2c1b979ae
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go
@@ -0,0 +1,40 @@
+package hcsshim
+
+import (
+	"encoding/json"
+	"fmt"
+
+	"github.com/sirupsen/logrus"
+)
+
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	var responseBuffer *uint16
+	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
+
+	err := _hnsCall(method, path, request, &responseBuffer)
+	if err != nil {
+		return makeError(err, "hnsCall ", "")
+	}
+	response := convertAndFreeCoTaskMemString(responseBuffer)
+
+	hnsresponse := &hnsResponse{}
+	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
+		return err
+	}
+
+	if !hnsresponse.Success {
+		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+	}
+
+	if len(hnsresponse.Output) == 0 {
+		return nil
+	}
+
+	logrus.Debugf("Network Response : %s", hnsresponse.Output)
+	err = json.Unmarshal(hnsresponse.Output, returnResponse)
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
new file mode 100644
index 000000000..3345bfa3f
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
@@ -0,0 +1,142 @@
+package hcsshim
+
+import (
+	"encoding/json"
+	"fmt"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet struct {
+	AddressPrefix  string            `json:",omitempty"`
+	GatewayAddress string            `json:",omitempty"`
+	Policies       []json.RawMessage `json:",omitempty"`
+}
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool struct {
+	StartMacAddress string `json:",omitempty"`
+	EndMacAddress   string `json:",omitempty"`
+}
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork struct {
+	Id                   string            `json:"ID,omitempty"`
+	Name                 string            `json:",omitempty"`
+	Type                 string            `json:",omitempty"`
+	NetworkAdapterName   string            `json:",omitempty"`
+	SourceMac            string            `json:",omitempty"`
+	Policies             []json.RawMessage `json:",omitempty"`
+	MacPools             []MacPool         `json:",omitempty"`
+	Subnets              []Subnet          `json:",omitempty"`
+	DNSSuffix            string            `json:",omitempty"`
+	DNSServerList        string            `json:",omitempty"`
+	DNSServerCompartment uint32            `json:",omitempty"`
+	ManagementIP         string            `json:",omitempty"`
+	AutomaticDNS         bool              `json:",omitempty"`
+}
+
+type hnsNetworkResponse struct {
+	Success bool
+	Error   string
+	Output  HNSNetwork
+}
+
+type hnsResponse struct {
+	Success bool
+	Error   string
+	Output  json.RawMessage
+}
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	var network HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return &network, nil
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	var network []HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return network, nil
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return HNSNetworkRequest("GET", networkID, "")
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsnetwork := range hsnnetworks {
+		if hnsnetwork.Name == networkName {
+			return &hnsnetwork, nil
+		}
+	}
+	return nil, fmt.Errorf("Network %v not found", networkName)
+}
+
+// Create Network by sending NetworkRequest to HNS.
+func (network *HNSNetwork) Create() (*HNSNetwork, error) {
+	operation := "Create"
+	title := "HCSShim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	jsonString, err := json.Marshal(network)
+	if err != nil {
+		return nil, err
+	}
+	return HNSNetworkRequest("POST", "", string(jsonString))
+}
+
+// Delete Network by sending NetworkRequest to HNS
+func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
+	operation := "Delete"
+	title := "HCSShim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	return HNSNetworkRequest("DELETE", network.Id, "")
+}
+
+// Creates an endpoint on the Network.
+func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
+	return &HNSEndpoint{
+		VirtualNetwork: network.Id,
+		IPAddress:      ipAddress,
+		MacAddress:     string(macAddress),
+	}
+}
+
+func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateEndpoint"
+	title := "HCSShim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
+
+	endpoint.VirtualNetwork = network.Id
+	return endpoint.Create()
+}
+
+func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateRemoteEndpoint"
+	title := "HCSShim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+	endpoint.IsRemoteEndpoint = true
+	return network.CreateEndpoint(endpoint)
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go
new file mode 100644
index 000000000..ecfbf0eda
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go
@@ -0,0 +1,95 @@
+package hcsshim
+
+// Type of Request Support in ModifySystem
+type PolicyType string
+
+// RequestType const
+const (
+	Nat                  PolicyType = "NAT"
+	ACL                  PolicyType = "ACL"
+	PA                   PolicyType = "PA"
+	VLAN                 PolicyType = "VLAN"
+	VSID                 PolicyType = "VSID"
+	VNet                 PolicyType = "VNET"
+	L2Driver             PolicyType = "L2Driver"
+	Isolation            PolicyType = "Isolation"
+	QOS                  PolicyType = "QOS"
+	OutboundNat          PolicyType = "OutBoundNAT"
+	ExternalLoadBalancer PolicyType = "ELB"
+	Route                PolicyType = "ROUTE"
+)
+
+type NatPolicy struct {
+	Type         PolicyType `json:"Type"`
+	Protocol     string
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+type QosPolicy struct {
+	Type                            PolicyType `json:"Type"`
+	MaximumOutgoingBandwidthInBytes uint64
+}
+
+type IsolationPolicy struct {
+	Type               PolicyType `json:"Type"`
+	VLAN               uint
+	VSID               uint
+	InDefaultIsolation bool
+}
+
+type VlanPolicy struct {
+	Type PolicyType `json:"Type"`
+	VLAN uint
+}
+
+type VsidPolicy struct {
+	Type PolicyType `json:"Type"`
+	VSID uint
+}
+
+type PaPolicy struct {
+	Type PolicyType `json:"Type"`
+	PA   string     `json:"PA"`
+}
+
+type OutboundNatPolicy struct {
+	Policy
+	VIP        string   `json:"VIP,omitempty"`
+	Exceptions []string `json:"ExceptionList,omitempty"`
+}
+
+type ActionType string
+type DirectionType string
+type RuleType string
+
+const (
+	Allow ActionType = "Allow"
+	Block ActionType = "Block"
+
+	In  DirectionType = "In"
+	Out DirectionType = "Out"
+
+	Host   RuleType = "Host"
+	Switch RuleType = "Switch"
+)
+
+type ACLPolicy struct {
+	Type          PolicyType `json:"Type"`
+	Protocol      uint16
+	InternalPort  uint16
+	Action        ActionType
+	Direction     DirectionType
+	LocalAddress  string
+	RemoteAddress string
+	LocalPort     uint16
+	RemotePort    uint16
+	RuleType      RuleType `json:"RuleType,omitempty"`
+
+	Priority    uint16
+	ServiceName string
+}
+
+type Policy struct {
+	Type PolicyType `json:"Type"`
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
new file mode 100644
index 000000000..15653b4f4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
@@ -0,0 +1,196 @@
+package hcsshim
+
+import (
+	"encoding/json"
+
+	"github.com/sirupsen/logrus"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy struct {
+	Policy
+	DestinationPrefix string `json:"DestinationPrefix,omitempty"`
+	NextHop           string `json:"NextHop,omitempty"`
+	EncapEnabled      bool   `json:"NeedEncap,omitempty"`
+}
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy struct {
+	LBPolicy
+	SourceVIP string   `json:"SourceVIP,omitempty"`
+	VIPs      []string `json:"VIPs,omitempty"`
+	ILB       bool     `json:"ILB,omitempty"`
+}
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy struct {
+	Policy
+	Protocol     uint16 `json:"Protocol,omitempty"`
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList struct {
+	ID                 string            `json:"ID,omitempty"`
+	EndpointReferences []string          `json:"References,omitempty"`
+	Policies           []json.RawMessage `json:"Policies,omitempty"`
+}
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	var policy PolicyList
+	err := hnsCall(method, "/policylists/"+path, request, &policy)
+	if err != nil {
+		return nil, err
+	}
+
+	return &policy, nil
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	var plist []PolicyList
+	err := hnsCall("GET", "/policylists/", "", &plist)
+	if err != nil {
+		return nil, err
+	}
+
+	return plist, nil
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	policylist := &PolicyList{}
+	err := hnsCall(method, "/policylists/"+path, request, &policylist)
+	if err != nil {
+		return nil, err
+	}
+
+	return policylist, nil
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return PolicyListRequest("GET", policyListID, "")
+}
+
+// Create PolicyList by sending PolicyListRequest to HNS.
+func (policylist *PolicyList) Create() (*PolicyList, error) {
+	operation := "Create"
+	title := "HCSShim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+	jsonString, err := json.Marshal(policylist)
+	if err != nil {
+		return nil, err
+	}
+	return PolicyListRequest("POST", "", string(jsonString))
+}
+
+// Delete deletes PolicyList
+func (policylist *PolicyList) Delete() (*PolicyList, error) {
+	operation := "Delete"
+	title := "HCSShim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+
+	return PolicyListRequest("DELETE", policylist.ID, "")
+}
+
+// AddEndpoint add an endpoint to a Policy List
+func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "AddEndpoint"
+	title := "HCSShim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	// Add Endpoint to the Existing List
+	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+
+	return policylist.Create()
+}
+
+// RemoveEndpoint removes an endpoint from the Policy List
+func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "RemoveEndpoint"
+	title := "HCSShim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	elementToRemove := "/endpoints/" + endpoint.Id
+
+	var references []string
+
+	for _, endpointReference := range policylist.EndpointReferences {
+		if endpointReference == elementToRemove {
+			continue
+		}
+		references = append(references, endpointReference)
+	}
+	policylist.EndpointReferences = references
+	return policylist.Create()
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	operation := "AddLoadBalancer"
+	title := "HCSShim::PolicyList::" + operation
+	logrus.Debugf(title+" Vip:%s", vip)
+
+	policylist := &PolicyList{}
+
+	elbPolicy := &ELBPolicy{
+		VIPs: []string{vip},
+		ILB:  isILB,
+	}
+	elbPolicy.Type = ExternalLoadBalancer
+	elbPolicy.Protocol = protocol
+	elbPolicy.InternalPort = internalPort
+	elbPolicy.ExternalPort = externalPort
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(elbPolicy)
+	if err != nil {
+		return nil, err
+	}
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	operation := "AddRoute"
+	title := "HCSShim::PolicyList::" + operation
+	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
+
+	policylist := &PolicyList{}
+
+	rPolicy := &RoutePolicy{
+		DestinationPrefix: destinationPrefix,
+		NextHop:           nextHop,
+		EncapEnabled:      encapEnabled,
+	}
+	rPolicy.Type = Route
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(rPolicy)
+	if err != nil {
+		return nil, err
+	}
+
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go
new file mode 100644
index 000000000..3aed14376
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/importlayer.go
@@ -0,0 +1,212 @@
+package hcsshim
+
+import (
+	"errors"
+	"io/ioutil"
+	"os"
+	"path/filepath"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/sirupsen/logrus"
+)
+
+// ImportLayer will take the contents of the folder at importFolderPath and import
+// that into a layer with the id layerId.  Note that in order to correctly populate
+// the layer and interperet the transport format, all parent layers must already
+// be present on the system at the paths provided in parentLayerPaths.
+func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
+	title := "hcsshim::ImportLayer "
+	logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = importLayer(&infop, layerID, importFolderPath, layers)
+	if err != nil {
+		err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
+	return nil
+}
+
+// LayerWriter is an interface that supports writing a new container image layer.
+type LayerWriter interface {
+	// Add adds a file to the layer with given metadata.
+	Add(name string, fileInfo *winio.FileBasicInfo) error
+	// AddLink adds a hard link to the layer. The target must already have been added.
+	AddLink(name string, target string) error
+	// Remove removes a file that was present in a parent layer from the layer.
+	Remove(name string) error
+	// Write writes data to the current file. The data must be in the format of a Win32
+	// backup stream.
+	Write(b []byte) (int, error)
+	// Close finishes the layer writing process and releases any resources.
+	Close() error
+}
+
+// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
+type FilterLayerWriter struct {
+	context uintptr
+}
+
+// Add adds a file or directory to the layer. The file's parent directory must have already been added.
+//
+// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
+// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
+// winio.BackupStreamWriter can be used to facilitate this.
+func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
+	if name[0] != '\\' {
+		name = `\` + name
+	}
+	err := importLayerNext(w.context, name, fileInfo)
+	if err != nil {
+		return makeError(err, "ImportLayerNext", "")
+	}
+	return nil
+}
+
+// AddLink adds a hard link to the layer. The target of the link must have already been added.
+func (w *FilterLayerWriter) AddLink(name string, target string) error {
+	return errors.New("hard links not yet supported")
+}
+
+// Remove removes a file from the layer. The file must have been present in the parent layer.
+//
+// name contains the file's relative path.
+func (w *FilterLayerWriter) Remove(name string) error {
+	if name[0] != '\\' {
+		name = `\` + name
+	}
+	err := importLayerNext(w.context, name, nil)
+	if err != nil {
+		return makeError(err, "ImportLayerNext", "")
+	}
+	return nil
+}
+
+// Write writes more backup stream data to the current file.
+func (w *FilterLayerWriter) Write(b []byte) (int, error) {
+	err := importLayerWrite(w.context, b)
+	if err != nil {
+		err = makeError(err, "ImportLayerWrite", "")
+		return 0, err
+	}
+	return len(b), err
+}
+
+// Close completes the layer write operation. The error must be checked to ensure that the
+// operation was successful.
+func (w *FilterLayerWriter) Close() (err error) {
+	if w.context != 0 {
+		err = importLayerEnd(w.context)
+		if err != nil {
+			err = makeError(err, "ImportLayerEnd", "")
+		}
+		w.context = 0
+	}
+	return
+}
+
+type legacyLayerWriterWrapper struct {
+	*legacyLayerWriter
+	info             DriverInfo
+	layerID          string
+	path             string
+	parentLayerPaths []string
+}
+
+func (r *legacyLayerWriterWrapper) Close() error {
+	defer os.RemoveAll(r.root)
+	err := r.legacyLayerWriter.Close()
+	if err != nil {
+		return err
+	}
+
+	// Use the original path here because ImportLayer does not support long paths for the source in TP5.
+	// But do use a long path for the destination to work around another bug with directories
+	// with MAX_PATH - 12 < length < MAX_PATH.
+	info := r.info
+	fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID))
+	if err != nil {
+		return err
+	}
+
+	info.HomeDir = ""
+	if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil {
+		return err
+	}
+	// Add any hard links that were collected.
+	for _, lnk := range r.PendingLinks {
+		if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) {
+			return err
+		}
+		if err = os.Link(lnk.Target, lnk.Path); err != nil {
+			return err
+		}
+	}
+	// Prepare the utility VM for use if one is present in the layer.
+	if r.HasUtilityVM {
+		err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM"))
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+// NewLayerWriter returns a new layer writer for creating a layer on disk.
+// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
+// to call this and any methods on the resulting LayerWriter.
+func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
+	if len(parentLayerPaths) == 0 {
+		// This is a base layer. It gets imported differently.
+		return &baseLayerWriter{
+			root: filepath.Join(info.HomeDir, layerID),
+		}, nil
+	}
+
+	if procImportLayerBegin.Find() != nil {
+		// The new layer reader is not available on this Windows build. Fall back to the
+		// legacy export code path.
+		path, err := ioutil.TempDir("", "hcs")
+		if err != nil {
+			return nil, err
+		}
+		return &legacyLayerWriterWrapper{
+			legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)),
+			info:              info,
+			layerID:           layerID,
+			path:              path,
+			parentLayerPaths:  parentLayerPaths,
+		}, nil
+	}
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return nil, err
+	}
+
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		return nil, err
+	}
+
+	w := &FilterLayerWriter{}
+	err = importLayerBegin(&infop, layerID, layers, &w.context)
+	if err != nil {
+		return nil, makeError(err, "ImportLayerStart", "")
+	}
+	return w, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go
new file mode 100644
index 000000000..9fc7852e4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/interface.go
@@ -0,0 +1,187 @@
+package hcsshim
+
+import (
+	"encoding/json"
+	"io"
+	"time"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig struct {
+	ApplicationName   string            `json:",omitempty"`
+	CommandLine       string            `json:",omitempty"`
+	CommandArgs       []string          `json:",omitempty"` // Used by Linux Containers on Windows
+	User              string            `json:",omitempty"`
+	WorkingDirectory  string            `json:",omitempty"`
+	Environment       map[string]string `json:",omitempty"`
+	EmulateConsole    bool              `json:",omitempty"`
+	CreateStdInPipe   bool              `json:",omitempty"`
+	CreateStdOutPipe  bool              `json:",omitempty"`
+	CreateStdErrPipe  bool              `json:",omitempty"`
+	ConsoleSize       [2]uint           `json:",omitempty"`
+	CreateInUtilityVm bool              `json:",omitempty"` // Used by Linux Containers on Windows
+	OCISpecification  *json.RawMessage  `json:",omitempty"` // Used by Linux Containers on Windows
+}
+
+type Layer struct {
+	ID   string
+	Path string
+}
+
+type MappedDir struct {
+	HostPath         string
+	ContainerPath    string
+	ReadOnly         bool
+	BandwidthMaximum uint64
+	IOPSMaximum      uint64
+}
+
+type MappedPipe struct {
+	HostPath          string
+	ContainerPipeName string
+}
+
+type HvRuntime struct {
+	ImagePath           string `json:",omitempty"`
+	SkipTemplate        bool   `json:",omitempty"`
+	LinuxInitrdFile     string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
+	LinuxKernelFile     string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
+	LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
+	BootSource          string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
+	WritableBootSource  bool   `json:",omitempty"` // Linux Utility VM booting from VHD
+}
+
+type MappedVirtualDisk struct {
+	HostPath          string `json:",omitempty"` // Path to VHD on the host
+	ContainerPath     string // Platform-specific mount point path in the container
+	CreateInUtilityVM bool   `json:",omitempty"`
+	ReadOnly          bool   `json:",omitempty"`
+	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
+	AttachOnly        bool   `json:",omitempty:`
+}
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig struct {
+	SystemType                  string              // HCS requires this to be hard-coded to "Container"
+	Name                        string              // Name of the container. We use the docker ID.
+	Owner                       string              `json:",omitempty"` // The management platform that created this container
+	VolumePath                  string              `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
+	IgnoreFlushesDuringBoot     bool                `json:",omitempty"` // Optimization hint for container startup in Windows
+	LayerFolderPath             string              `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format  %root%\windowsfilter\containerID
+	Layers                      []Layer             // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
+	Credentials                 string              `json:",omitempty"` // Credentials information
+	ProcessorCount              uint32              `json:",omitempty"` // Number of processors to assign to the container.
+	ProcessorWeight             uint64              `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
+	ProcessorMaximum            int64               `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
+	StorageIOPSMaximum          uint64              `json:",omitempty"` // Maximum Storage IOPS
+	StorageBandwidthMaximum     uint64              `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
+	StorageSandboxSize          uint64              `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
+	MemoryMaximumInMB           int64               `json:",omitempty"` // Maximum memory available to the container in Megabytes
+	HostName                    string              `json:",omitempty"` // Hostname
+	MappedDirectories           []MappedDir         `json:",omitempty"` // List of mapped directories (volumes/mounts)
+	MappedPipes                 []MappedPipe        `json:",omitempty"` // List of mapped Windows named pipes
+	HvPartition                 bool                // True if it a Hyper-V Container
+	NetworkSharedContainerName  string              `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
+	EndpointList                []string            `json:",omitempty"` // List of networking endpoints to be attached to container
+	HvRuntime                   *HvRuntime          `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
+	Servicing                   bool                `json:",omitempty"` // True if this container is for servicing
+	AllowUnqualifiedDNSQuery    bool                `json:",omitempty"` // True to allow unqualified DNS name resolution
+	DNSSearchList               string              `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
+	ContainerType               string              `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
+	TerminateOnLastHandleClosed bool                `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
+	MappedVirtualDisks          []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
+}
+
+type ComputeSystemQuery struct {
+	IDs    []string `json:"Ids,omitempty"`
+	Types  []string `json:",omitempty"`
+	Names  []string `json:",omitempty"`
+	Owners []string `json:",omitempty"`
+}
+
+// Container represents a created (but not necessarily running) container.
+type Container interface {
+	// Start synchronously starts the container.
+	Start() error
+
+	// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+	Shutdown() error
+
+	// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+	Terminate() error
+
+	// Waits synchronously waits for the container to shutdown or terminate.
+	Wait() error
+
+	// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+	// returns false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// Pause pauses the execution of a container.
+	Pause() error
+
+	// Resume resumes the execution of a container.
+	Resume() error
+
+	// HasPendingUpdates returns true if the container has updates pending to install.
+	HasPendingUpdates() (bool, error)
+
+	// Statistics returns statistics for a container.
+	Statistics() (Statistics, error)
+
+	// ProcessList returns details for the processes in a container.
+	ProcessList() ([]ProcessListItem, error)
+
+	// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
+	MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
+
+	// CreateProcess launches a new process within the container.
+	CreateProcess(c *ProcessConfig) (Process, error)
+
+	// OpenProcess gets an interface to an existing process within the container.
+	OpenProcess(pid int) (Process, error)
+
+	// Close cleans up any state associated with the container but does not terminate or wait for it.
+	Close() error
+
+	// Modify the System
+	Modify(config *ResourceModificationRequestResponse) error
+}
+
+// Process represents a running or exited process.
+type Process interface {
+	// Pid returns the process ID of the process within the container.
+	Pid() int
+
+	// Kill signals the process to terminate but does not wait for it to finish terminating.
+	Kill() error
+
+	// Wait waits for the process to exit.
+	Wait() error
+
+	// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+	// false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// ExitCode returns the exit code of the process. The process must have
+	// already terminated.
+	ExitCode() (int, error)
+
+	// ResizeConsole resizes the console of the process.
+	ResizeConsole(width, height uint16) error
+
+	// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+	// these pipes does not close the underlying pipes; it should be possible to
+	// call this multiple times to get multiple interfaces.
+	Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
+
+	// CloseStdin closes the write side of the stdin pipe so that the process is
+	// notified on the read side that there is no more data in stdin.
+	CloseStdin() error
+
+	// Close cleans up any state associated with the process but does not kill
+	// or wait on it.
+	Close() error
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go
new file mode 100644
index 000000000..fe46f404c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/layerexists.go
@@ -0,0 +1,30 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// LayerExists will return true if a layer with the given id exists and is known
+// to the system.
+func LayerExists(info DriverInfo, id string) (bool, error) {
+	title := "hcsshim::LayerExists "
+	logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return false, err
+	}
+
+	// Call the procedure itself.
+	var exists uint32
+
+	err = layerExists(&infop, id, &exists)
+	if err != nil {
+		err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
+		logrus.Error(err)
+		return false, err
+	}
+
+	logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists)
+	return exists != 0, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/layerutils.go
new file mode 100644
index 000000000..c0e550377
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/layerutils.go
@@ -0,0 +1,111 @@
+package hcsshim
+
+// This file contains utility functions to support storage (graph) related
+// functionality.
+
+import (
+	"path/filepath"
+	"syscall"
+
+	"github.com/sirupsen/logrus"
+)
+
+/* To pass into syscall, we need a struct matching the following:
+enum GraphDriverType
+{
+    DiffDriver,
+    FilterDriver
+};
+
+struct DriverInfo {
+    GraphDriverType Flavour;
+    LPCWSTR HomeDir;
+};
+*/
+type DriverInfo struct {
+	Flavour int
+	HomeDir string
+}
+
+type driverInfo struct {
+	Flavour  int
+	HomeDirp *uint16
+}
+
+func convertDriverInfo(info DriverInfo) (driverInfo, error) {
+	homedirp, err := syscall.UTF16PtrFromString(info.HomeDir)
+	if err != nil {
+		logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error())
+		return driverInfo{}, err
+	}
+
+	return driverInfo{
+		Flavour:  info.Flavour,
+		HomeDirp: homedirp,
+	}, nil
+}
+
+/* To pass into syscall, we need a struct matching the following:
+typedef struct _WC_LAYER_DESCRIPTOR {
+
+    //
+    // The ID of the layer
+    //
+
+    GUID LayerId;
+
+    //
+    // Additional flags
+    //
+
+    union {
+        struct {
+            ULONG Reserved : 31;
+            ULONG Dirty : 1;    // Created from sandbox as a result of snapshot
+        };
+        ULONG Value;
+    } Flags;
+
+    //
+    // Path to the layer root directory, null-terminated
+    //
+
+    PCWSTR Path;
+
+} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR;
+*/
+type WC_LAYER_DESCRIPTOR struct {
+	LayerId GUID
+	Flags   uint32
+	Pathp   *uint16
+}
+
+func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) {
+	// Array of descriptors that gets constructed.
+	var layers []WC_LAYER_DESCRIPTOR
+
+	for i := 0; i < len(parentLayerPaths); i++ {
+		// Create a layer descriptor, using the folder name
+		// as the source for a GUID LayerId
+		_, folderName := filepath.Split(parentLayerPaths[i])
+		g, err := NameToGuid(folderName)
+		if err != nil {
+			logrus.Debugf("Failed to convert name to guid %s", err)
+			return nil, err
+		}
+
+		p, err := syscall.UTF16PtrFromString(parentLayerPaths[i])
+		if err != nil {
+			logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err)
+			return nil, err
+		}
+
+		layers = append(layers, WC_LAYER_DESCRIPTOR{
+			LayerId: g,
+			Flags:   0,
+			Pathp:   p,
+		})
+	}
+
+	return layers, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/legacy.go
new file mode 100644
index 000000000..c7f6073ac
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/legacy.go
@@ -0,0 +1,741 @@
+package hcsshim
+
+import (
+	"bufio"
+	"encoding/binary"
+	"errors"
+	"fmt"
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+var errorIterationCanceled = errors.New("")
+
+var mutatedUtilityVMFiles = map[string]bool{
+	`EFI\Microsoft\Boot\BCD`:      true,
+	`EFI\Microsoft\Boot\BCD.LOG`:  true,
+	`EFI\Microsoft\Boot\BCD.LOG1`: true,
+	`EFI\Microsoft\Boot\BCD.LOG2`: true,
+}
+
+const (
+	filesPath          = `Files`
+	hivesPath          = `Hives`
+	utilityVMPath      = `UtilityVM`
+	utilityVMFilesPath = `UtilityVM\Files`
+)
+
+func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) {
+	return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition)
+}
+
+func makeLongAbsPath(path string) (string, error) {
+	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
+		return path, nil
+	}
+	if !filepath.IsAbs(path) {
+		absPath, err := filepath.Abs(path)
+		if err != nil {
+			return "", err
+		}
+		path = absPath
+	}
+	if strings.HasPrefix(path, `\\`) {
+		return `\\?\UNC\` + path[2:], nil
+	}
+	return `\\?\` + path, nil
+}
+
+func hasPathPrefix(p, prefix string) bool {
+	return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\'
+}
+
+type fileEntry struct {
+	path string
+	fi   os.FileInfo
+	err  error
+}
+
+type legacyLayerReader struct {
+	root         string
+	result       chan *fileEntry
+	proceed      chan bool
+	currentFile  *os.File
+	backupReader *winio.BackupFileReader
+}
+
+// newLegacyLayerReader returns a new LayerReader that can read the Windows
+// container layer transport format from disk.
+func newLegacyLayerReader(root string) *legacyLayerReader {
+	r := &legacyLayerReader{
+		root:    root,
+		result:  make(chan *fileEntry),
+		proceed: make(chan bool),
+	}
+	go r.walk()
+	return r
+}
+
+func readTombstones(path string) (map[string]([]string), error) {
+	tf, err := os.Open(filepath.Join(path, "tombstones.txt"))
+	if err != nil {
+		return nil, err
+	}
+	defer tf.Close()
+	s := bufio.NewScanner(tf)
+	if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" {
+		return nil, errors.New("Invalid tombstones file")
+	}
+
+	ts := make(map[string]([]string))
+	for s.Scan() {
+		t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\`
+		dir := filepath.Dir(t)
+		ts[dir] = append(ts[dir], t)
+	}
+	if err = s.Err(); err != nil {
+		return nil, err
+	}
+
+	return ts, nil
+}
+
+func (r *legacyLayerReader) walkUntilCancelled() error {
+	root, err := makeLongAbsPath(r.root)
+	if err != nil {
+		return err
+	}
+
+	r.root = root
+	ts, err := readTombstones(r.root)
+	if err != nil {
+		return err
+	}
+
+	err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error {
+		if err != nil {
+			return err
+		}
+		if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") {
+			return nil
+		}
+
+		r.result <- &fileEntry{path, info, nil}
+		if !<-r.proceed {
+			return errorIterationCanceled
+		}
+
+		// List all the tombstones.
+		if info.IsDir() {
+			relPath, err := filepath.Rel(r.root, path)
+			if err != nil {
+				return err
+			}
+			if dts, ok := ts[relPath]; ok {
+				for _, t := range dts {
+					r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil}
+					if !<-r.proceed {
+						return errorIterationCanceled
+					}
+				}
+			}
+		}
+		return nil
+	})
+	if err == errorIterationCanceled {
+		return nil
+	}
+	if err == nil {
+		return io.EOF
+	}
+	return err
+}
+
+func (r *legacyLayerReader) walk() {
+	defer close(r.result)
+	if !<-r.proceed {
+		return
+	}
+
+	err := r.walkUntilCancelled()
+	if err != nil {
+		for {
+			r.result <- &fileEntry{err: err}
+			if !<-r.proceed {
+				return
+			}
+		}
+	}
+}
+
+func (r *legacyLayerReader) reset() {
+	if r.backupReader != nil {
+		r.backupReader.Close()
+		r.backupReader = nil
+	}
+	if r.currentFile != nil {
+		r.currentFile.Close()
+		r.currentFile = nil
+	}
+}
+
+func findBackupStreamSize(r io.Reader) (int64, error) {
+	br := winio.NewBackupStreamReader(r)
+	for {
+		hdr, err := br.Next()
+		if err != nil {
+			if err == io.EOF {
+				err = nil
+			}
+			return 0, err
+		}
+		if hdr.Id == winio.BackupData {
+			return hdr.Size, nil
+		}
+	}
+}
+
+func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) {
+	r.reset()
+	r.proceed <- true
+	fe := <-r.result
+	if fe == nil {
+		err = errors.New("LegacyLayerReader closed")
+		return
+	}
+	if fe.err != nil {
+		err = fe.err
+		return
+	}
+
+	path, err = filepath.Rel(r.root, fe.path)
+	if err != nil {
+		return
+	}
+
+	if fe.fi == nil {
+		// This is a tombstone. Return a nil fileInfo.
+		return
+	}
+
+	if fe.fi.IsDir() && hasPathPrefix(path, filesPath) {
+		fe.path += ".$wcidirs$"
+	}
+
+	f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING)
+	if err != nil {
+		return
+	}
+	defer func() {
+		if f != nil {
+			f.Close()
+		}
+	}()
+
+	fileInfo, err = winio.GetFileBasicInfo(f)
+	if err != nil {
+		return
+	}
+
+	if !hasPathPrefix(path, filesPath) {
+		size = fe.fi.Size()
+		r.backupReader = winio.NewBackupFileReader(f, false)
+		if path == hivesPath || path == filesPath {
+			// The Hives directory has a non-deterministic file time because of the
+			// nature of the import process. Use the times from System_Delta.
+			var g *os.File
+			g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`))
+			if err != nil {
+				return
+			}
+			attr := fileInfo.FileAttributes
+			fileInfo, err = winio.GetFileBasicInfo(g)
+			g.Close()
+			if err != nil {
+				return
+			}
+			fileInfo.FileAttributes = attr
+		}
+
+		// The creation time and access time get reset for files outside of the Files path.
+		fileInfo.CreationTime = fileInfo.LastWriteTime
+		fileInfo.LastAccessTime = fileInfo.LastWriteTime
+
+	} else {
+		// The file attributes are written before the backup stream.
+		var attr uint32
+		err = binary.Read(f, binary.LittleEndian, &attr)
+		if err != nil {
+			return
+		}
+		fileInfo.FileAttributes = uintptr(attr)
+		beginning := int64(4)
+
+		// Find the accurate file size.
+		if !fe.fi.IsDir() {
+			size, err = findBackupStreamSize(f)
+			if err != nil {
+				err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err}
+				return
+			}
+		}
+
+		// Return back to the beginning of the backup stream.
+		_, err = f.Seek(beginning, 0)
+		if err != nil {
+			return
+		}
+	}
+
+	r.currentFile = f
+	f = nil
+	return
+}
+
+func (r *legacyLayerReader) Read(b []byte) (int, error) {
+	if r.backupReader == nil {
+		if r.currentFile == nil {
+			return 0, io.EOF
+		}
+		return r.currentFile.Read(b)
+	}
+	return r.backupReader.Read(b)
+}
+
+func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) {
+	if r.backupReader == nil {
+		if r.currentFile == nil {
+			return 0, errors.New("no current file")
+		}
+		return r.currentFile.Seek(offset, whence)
+	}
+	return 0, errors.New("seek not supported on this stream")
+}
+
+func (r *legacyLayerReader) Close() error {
+	r.proceed <- false
+	<-r.result
+	r.reset()
+	return nil
+}
+
+type pendingLink struct {
+	Path, Target string
+}
+
+type legacyLayerWriter struct {
+	root         string
+	parentRoots  []string
+	destRoot     string
+	currentFile  *os.File
+	backupWriter *winio.BackupFileWriter
+	tombstones   []string
+	pathFixed    bool
+	HasUtilityVM bool
+	uvmDi        []dirInfo
+	addedFiles   map[string]bool
+	PendingLinks []pendingLink
+}
+
+// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer
+// transport format to disk.
+func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) *legacyLayerWriter {
+	return &legacyLayerWriter{
+		root:        root,
+		parentRoots: parentRoots,
+		destRoot:    destRoot,
+		addedFiles:  make(map[string]bool),
+	}
+}
+
+func (w *legacyLayerWriter) init() error {
+	if !w.pathFixed {
+		path, err := makeLongAbsPath(w.root)
+		if err != nil {
+			return err
+		}
+		for i, p := range w.parentRoots {
+			w.parentRoots[i], err = makeLongAbsPath(p)
+			if err != nil {
+				return err
+			}
+		}
+		destPath, err := makeLongAbsPath(w.destRoot)
+		if err != nil {
+			return err
+		}
+		w.root = path
+		w.destRoot = destPath
+		w.pathFixed = true
+	}
+	return nil
+}
+
+func (w *legacyLayerWriter) initUtilityVM() error {
+	if !w.HasUtilityVM {
+		err := os.Mkdir(filepath.Join(w.destRoot, utilityVMPath), 0)
+		if err != nil {
+			return err
+		}
+		// Server 2016 does not support multiple layers for the utility VM, so
+		// clone the utility VM from the parent layer into this layer. Use hard
+		// links to avoid unnecessary copying, since most of the files are
+		// immutable.
+		err = cloneTree(filepath.Join(w.parentRoots[0], utilityVMFilesPath), filepath.Join(w.destRoot, utilityVMFilesPath), mutatedUtilityVMFiles)
+		if err != nil {
+			return fmt.Errorf("cloning the parent utility VM image failed: %s", err)
+		}
+		w.HasUtilityVM = true
+	}
+	return nil
+}
+
+func (w *legacyLayerWriter) reset() {
+	if w.backupWriter != nil {
+		w.backupWriter.Close()
+		w.backupWriter = nil
+	}
+	if w.currentFile != nil {
+		w.currentFile.Close()
+		w.currentFile = nil
+	}
+}
+
+// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata
+func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
+	createDisposition := uint32(syscall.CREATE_NEW)
+	if isDir {
+		err = os.Mkdir(destPath, 0)
+		if err != nil {
+			return nil, err
+		}
+		createDisposition = syscall.OPEN_EXISTING
+	}
+
+	src, err := openFileOrDir(srcPath, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.OPEN_EXISTING)
+	if err != nil {
+		return nil, err
+	}
+	defer src.Close()
+	srcr := winio.NewBackupFileReader(src, true)
+	defer srcr.Close()
+
+	fileInfo, err = winio.GetFileBasicInfo(src)
+	if err != nil {
+		return nil, err
+	}
+
+	dest, err := openFileOrDir(destPath, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition)
+	if err != nil {
+		return nil, err
+	}
+	defer dest.Close()
+
+	err = winio.SetFileBasicInfo(dest, fileInfo)
+	if err != nil {
+		return nil, err
+	}
+
+	destw := winio.NewBackupFileWriter(dest, true)
+	defer func() {
+		cerr := destw.Close()
+		if err == nil {
+			err = cerr
+		}
+	}()
+
+	_, err = io.Copy(destw, srcr)
+	if err != nil {
+		return nil, err
+	}
+
+	return fileInfo, nil
+}
+
+// cloneTree clones a directory tree using hard links. It skips hard links for
+// the file names in the provided map and just copies those files.
+func cloneTree(srcPath, destPath string, mutatedFiles map[string]bool) error {
+	var di []dirInfo
+	err := filepath.Walk(srcPath, func(srcFilePath string, info os.FileInfo, err error) error {
+		if err != nil {
+			return err
+		}
+
+		relPath, err := filepath.Rel(srcPath, srcFilePath)
+		if err != nil {
+			return err
+		}
+		destFilePath := filepath.Join(destPath, relPath)
+
+		// Directories, reparse points, and files that will be mutated during
+		// utility VM import must be copied. All other files can be hard linked.
+		isReparsePoint := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0
+		if info.IsDir() || isReparsePoint || mutatedFiles[relPath] {
+			fi, err := copyFileWithMetadata(srcFilePath, destFilePath, info.IsDir())
+			if err != nil {
+				return err
+			}
+			if info.IsDir() && !isReparsePoint {
+				di = append(di, dirInfo{path: destFilePath, fileInfo: *fi})
+			}
+		} else {
+			err = os.Link(srcFilePath, destFilePath)
+			if err != nil {
+				return err
+			}
+		}
+
+		// Don't recurse on reparse points.
+		if info.IsDir() && isReparsePoint {
+			return filepath.SkipDir
+		}
+
+		return nil
+	})
+	if err != nil {
+		return err
+	}
+
+	return reapplyDirectoryTimes(di)
+}
+
+func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
+	w.reset()
+	err := w.init()
+	if err != nil {
+		return err
+	}
+
+	if name == utilityVMPath {
+		return w.initUtilityVM()
+	}
+
+	if hasPathPrefix(name, utilityVMPath) {
+		if !w.HasUtilityVM {
+			return errors.New("missing UtilityVM directory")
+		}
+		if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath {
+			return errors.New("invalid UtilityVM layer")
+		}
+		path := filepath.Join(w.destRoot, name)
+		createDisposition := uint32(syscall.OPEN_EXISTING)
+		if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
+			st, err := os.Lstat(path)
+			if err != nil && !os.IsNotExist(err) {
+				return err
+			}
+			if st != nil {
+				// Delete the existing file/directory if it is not the same type as this directory.
+				existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+				if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
+					if err = os.RemoveAll(path); err != nil {
+						return err
+					}
+					st = nil
+				}
+			}
+			if st == nil {
+				if err = os.Mkdir(path, 0); err != nil {
+					return err
+				}
+			}
+			if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
+				w.uvmDi = append(w.uvmDi, dirInfo{path: path, fileInfo: *fileInfo})
+			}
+		} else {
+			// Overwrite any existing hard link.
+			err = os.Remove(path)
+			if err != nil && !os.IsNotExist(err) {
+				return err
+			}
+			createDisposition = syscall.CREATE_NEW
+		}
+
+		f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition)
+		if err != nil {
+			return err
+		}
+		defer func() {
+			if f != nil {
+				f.Close()
+				os.Remove(path)
+			}
+		}()
+
+		err = winio.SetFileBasicInfo(f, fileInfo)
+		if err != nil {
+			return err
+		}
+
+		w.backupWriter = winio.NewBackupFileWriter(f, true)
+		w.currentFile = f
+		w.addedFiles[name] = true
+		f = nil
+		return nil
+	}
+
+	path := filepath.Join(w.root, name)
+	if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
+		err := os.Mkdir(path, 0)
+		if err != nil {
+			return err
+		}
+		path += ".$wcidirs$"
+	}
+
+	f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.CREATE_NEW)
+	if err != nil {
+		return err
+	}
+	defer func() {
+		if f != nil {
+			f.Close()
+			os.Remove(path)
+		}
+	}()
+
+	strippedFi := *fileInfo
+	strippedFi.FileAttributes = 0
+	err = winio.SetFileBasicInfo(f, &strippedFi)
+	if err != nil {
+		return err
+	}
+
+	if hasPathPrefix(name, hivesPath) {
+		w.backupWriter = winio.NewBackupFileWriter(f, false)
+	} else {
+		// The file attributes are written before the stream.
+		err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes))
+		if err != nil {
+			return err
+		}
+	}
+
+	w.currentFile = f
+	w.addedFiles[name] = true
+	f = nil
+	return nil
+}
+
+func (w *legacyLayerWriter) AddLink(name string, target string) error {
+	w.reset()
+	err := w.init()
+	if err != nil {
+		return err
+	}
+
+	var roots []string
+	if hasPathPrefix(target, filesPath) {
+		// Look for cross-layer hard link targets in the parent layers, since
+		// nothing is in the destination path yet.
+		roots = w.parentRoots
+	} else if hasPathPrefix(target, utilityVMFilesPath) {
+		// Since the utility VM is fully cloned into the destination path
+		// already, look for cross-layer hard link targets directly in the
+		// destination path.
+		roots = []string{w.destRoot}
+	}
+
+	if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) {
+		return errors.New("invalid hard link in layer")
+	}
+
+	// Find to try the target of the link in a previously added file. If that
+	// fails, search in parent layers.
+	var selectedRoot string
+	if _, ok := w.addedFiles[target]; ok {
+		selectedRoot = w.destRoot
+	} else {
+		for _, r := range roots {
+			if _, err = os.Lstat(filepath.Join(r, target)); err != nil {
+				if !os.IsNotExist(err) {
+					return err
+				}
+			} else {
+				selectedRoot = r
+				break
+			}
+		}
+		if selectedRoot == "" {
+			return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target)
+		}
+	}
+	// The link can't be written until after the ImportLayer call.
+	w.PendingLinks = append(w.PendingLinks, pendingLink{
+		Path:   filepath.Join(w.destRoot, name),
+		Target: filepath.Join(selectedRoot, target),
+	})
+	w.addedFiles[name] = true
+	return nil
+}
+
+func (w *legacyLayerWriter) Remove(name string) error {
+	if hasPathPrefix(name, filesPath) {
+		w.tombstones = append(w.tombstones, name[len(filesPath)+1:])
+	} else if hasPathPrefix(name, utilityVMFilesPath) {
+		err := w.initUtilityVM()
+		if err != nil {
+			return err
+		}
+		// Make sure the path exists; os.RemoveAll will not fail if the file is
+		// already gone, and this needs to be a fatal error for diagnostics
+		// purposes.
+		path := filepath.Join(w.destRoot, name)
+		if _, err := os.Lstat(path); err != nil {
+			return err
+		}
+		err = os.RemoveAll(path)
+		if err != nil {
+			return err
+		}
+	} else {
+		return fmt.Errorf("invalid tombstone %s", name)
+	}
+
+	return nil
+}
+
+func (w *legacyLayerWriter) Write(b []byte) (int, error) {
+	if w.backupWriter == nil {
+		if w.currentFile == nil {
+			return 0, errors.New("closed")
+		}
+		return w.currentFile.Write(b)
+	}
+	return w.backupWriter.Write(b)
+}
+
+func (w *legacyLayerWriter) Close() error {
+	w.reset()
+	err := w.init()
+	if err != nil {
+		return err
+	}
+	tf, err := os.Create(filepath.Join(w.root, "tombstones.txt"))
+	if err != nil {
+		return err
+	}
+	defer tf.Close()
+	_, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n"))
+	if err != nil {
+		return err
+	}
+	for _, t := range w.tombstones {
+		_, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n"))
+		if err != nil {
+			return err
+		}
+	}
+	if w.HasUtilityVM {
+		err = reapplyDirectoryTimes(w.uvmDi)
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go
new file mode 100644
index 000000000..b7c6d020c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/nametoguid.go
@@ -0,0 +1,20 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// NameToGuid converts the given string into a GUID using the algorithm in the
+// Host Compute Service, ensuring GUIDs generated with the same string are common
+// across all clients.
+func NameToGuid(name string) (id GUID, err error) {
+	title := "hcsshim::NameToGuid "
+	logrus.Debugf(title+"Name %s", name)
+
+	err = nameToGuid(name, &id)
+	if err != nil {
+		err = makeErrorf(err, title, "name=%s", name)
+		logrus.Error(err)
+		return
+	}
+
+	return
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/preparelayer.go
new file mode 100644
index 000000000..5c5b61841
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/preparelayer.go
@@ -0,0 +1,46 @@
+package hcsshim
+
+import (
+	"sync"
+
+	"github.com/sirupsen/logrus"
+)
+
+var prepareLayerLock sync.Mutex
+
+// PrepareLayer finds a mounted read-write layer matching layerId and enables the
+// the filesystem filter for use on that layer.  This requires the paths to all
+// parent layers, and is necessary in order to view or interact with the layer
+// as an actual filesystem (reading and writing files, creating directories, etc).
+// Disabling the filter must be done via UnprepareLayer.
+func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
+	title := "hcsshim::PrepareLayer "
+	logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	// This lock is a temporary workaround for a Windows bug. Only allowing one
+	// call to prepareLayer at a time vastly reduces the chance of a timeout.
+	prepareLayerLock.Lock()
+	defer prepareLayerLock.Unlock()
+	err = prepareLayer(&infop, layerId, layers)
+	if err != nil {
+		err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go
new file mode 100644
index 000000000..faee2cfee
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/process.go
@@ -0,0 +1,384 @@
+package hcsshim
+
+import (
+	"encoding/json"
+	"io"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+// ContainerError is an error encountered in HCS
+type process struct {
+	handleLock     sync.RWMutex
+	handle         hcsProcess
+	processID      int
+	container      *container
+	cachedPipes    *cachedPipes
+	callbackNumber uintptr
+}
+
+type cachedPipes struct {
+	stdIn  syscall.Handle
+	stdOut syscall.Handle
+	stdErr syscall.Handle
+}
+
+type processModifyRequest struct {
+	Operation   string
+	ConsoleSize *consoleSize `json:",omitempty"`
+	CloseHandle *closeHandle `json:",omitempty"`
+}
+
+type consoleSize struct {
+	Height uint16
+	Width  uint16
+}
+
+type closeHandle struct {
+	Handle string
+}
+
+type processStatus struct {
+	ProcessID      uint32
+	Exited         bool
+	ExitCode       uint32
+	LastWaitResult int32
+}
+
+const (
+	stdIn  string = "StdIn"
+	stdOut string = "StdOut"
+	stdErr string = "StdErr"
+)
+
+const (
+	modifyConsoleSize string = "ConsoleSize"
+	modifyCloseHandle string = "CloseHandle"
+)
+
+// Pid returns the process ID of the process within the container.
+func (process *process) Pid() int {
+	return process.processID
+}
+
+// Kill signals the process to terminate but does not wait for it to finish terminating.
+func (process *process) Kill() error {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "Kill"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, "", ErrAlreadyClosed)
+	}
+
+	var resultp *uint16
+	err := hcsTerminateProcess(process.handle, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// Wait waits for the process to exit.
+func (process *process) Wait() error {
+	operation := "Wait"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+// false if timeout occurs.
+func (process *process) WaitTimeout(timeout time.Duration) error {
+	operation := "WaitTimeout"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
+	if err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// ExitCode returns the exit code of the process. The process must have
+// already terminated.
+func (process *process) ExitCode() (int, error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "ExitCode"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return 0, makeProcessError(process, operation, "", ErrAlreadyClosed)
+	}
+
+	properties, err := process.properties()
+	if err != nil {
+		return 0, makeProcessError(process, operation, "", err)
+	}
+
+	if properties.Exited == false {
+		return 0, makeProcessError(process, operation, "", ErrInvalidProcessState)
+	}
+
+	if properties.LastWaitResult != 0 {
+		return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult))
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode)
+	return int(properties.ExitCode), nil
+}
+
+// ResizeConsole resizes the console of the process.
+func (process *process) ResizeConsole(width, height uint16) error {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "ResizeConsole"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, "", ErrAlreadyClosed)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyConsoleSize,
+		ConsoleSize: &consoleSize{
+			Height: height,
+			Width:  width,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+func (process *process) properties() (*processStatus, error) {
+	operation := "properties"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return nil, err
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
+
+	properties := &processStatus{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, err
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
+	return properties, nil
+}
+
+// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; it should be possible to
+// call this multiple times to get multiple interfaces.
+func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "Stdio"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed)
+	}
+
+	var stdIn, stdOut, stdErr syscall.Handle
+
+	if process.cachedPipes == nil {
+		var (
+			processInfo hcsProcessInformation
+			resultp     *uint16
+		)
+		err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
+		err = processHcsResult(err, resultp)
+		if err != nil {
+			return nil, nil, nil, makeProcessError(process, operation, "", err)
+		}
+
+		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
+	} else {
+		// Use cached pipes
+		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
+
+		// Invalidate the cache
+		process.cachedPipes = nil
+	}
+
+	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return pipes[0], pipes[1], pipes[2], nil
+}
+
+// CloseStdin closes the write side of the stdin pipe so that the process is
+// notified on the read side that there is no more data in stdin.
+func (process *process) CloseStdin() error {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "CloseStdin"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, "", ErrAlreadyClosed)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyCloseHandle,
+		CloseHandle: &closeHandle{
+			Handle: stdIn,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	err = processHcsResult(err, resultp)
+	if err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// Close cleans up any state associated with the process but does not kill
+// or wait on it.
+func (process *process) Close() error {
+	process.handleLock.Lock()
+	defer process.handleLock.Unlock()
+	operation := "Close"
+	title := "HCSShim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	// Don't double free this
+	if process.handle == 0 {
+		return nil
+	}
+
+	if err := process.unregisterCallback(); err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	if err := hcsCloseProcess(process.handle); err != nil {
+		return makeProcessError(process, operation, "", err)
+	}
+
+	process.handle = 0
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+func (process *process) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	process.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (process *process) unregisterCallback() error {
+	callbackNumber := process.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterProcessCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterProcessCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/processimage.go
new file mode 100644
index 000000000..fadb1b92c
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/processimage.go
@@ -0,0 +1,23 @@
+package hcsshim
+
+import "os"
+
+// ProcessBaseLayer post-processes a base layer that has had its files extracted.
+// The files should have been extracted to <path>\Files.
+func ProcessBaseLayer(path string) error {
+	err := processBaseImage(path)
+	if err != nil {
+		return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err}
+	}
+	return nil
+}
+
+// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted.
+// The files should have been extracted to <path>\Files.
+func ProcessUtilityVMImage(path string) error {
+	err := processUtilityImage(path)
+	if err != nil {
+		return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err}
+	}
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go
new file mode 100644
index 000000000..e8a3b507b
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go
@@ -0,0 +1,27 @@
+package hcsshim
+
+import "github.com/sirupsen/logrus"
+
+// UnprepareLayer disables the filesystem filter for the read-write layer with
+// the given id.
+func UnprepareLayer(info DriverInfo, layerId string) error {
+	title := "hcsshim::UnprepareLayer "
+	logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
+
+	// Convert info to API calling convention
+	infop, err := convertDriverInfo(info)
+	if err != nil {
+		logrus.Error(err)
+		return err
+	}
+
+	err = unprepareLayer(&infop, layerId)
+	if err != nil {
+		err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId)
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/utils.go
new file mode 100644
index 000000000..bd6e2d94a
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/utils.go
@@ -0,0 +1,33 @@
+package hcsshim
+
+import (
+	"io"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
+// if there is an error.
+func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
+	fs := make([]io.ReadWriteCloser, len(hs))
+	for i, h := range hs {
+		if h != syscall.Handle(0) {
+			if err == nil {
+				fs[i], err = winio.MakeOpenFile(h)
+			}
+			if err != nil {
+				syscall.Close(h)
+			}
+		}
+	}
+	if err != nil {
+		for _, f := range fs {
+			if f != nil {
+				f.Close()
+			}
+		}
+		return nil, err
+	}
+	return fs, nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go
new file mode 100644
index 000000000..ae10c23d4
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/version.go
@@ -0,0 +1,7 @@
+package hcsshim
+
+// IsTP4 returns whether the currently running Windows build is at least TP4.
+func IsTP4() bool {
+	// HNSCall was not present in TP4
+	return procHNSCall.Find() != nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/waithelper.go
new file mode 100644
index 000000000..b7be20ea0
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/waithelper.go
@@ -0,0 +1,63 @@
+package hcsshim
+
+import (
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+	err = processHcsResult(err, resultp)
+	if IsPending(err) {
+		return waitForNotification(callbackNumber, expectedNotification, timeout)
+	}
+
+	return err
+}
+
+func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+	callbackMapLock.RLock()
+	channels := callbackMap[callbackNumber].channels
+	callbackMapLock.RUnlock()
+
+	expectedChannel := channels[expectedNotification]
+	if expectedChannel == nil {
+		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		return ErrInvalidNotificationType
+	}
+
+	var c <-chan time.Time
+	if timeout != nil {
+		timer := time.NewTimer(*timeout)
+		c = timer.C
+		defer timer.Stop()
+	}
+
+	select {
+	case err, ok := <-expectedChannel:
+		if !ok {
+			return ErrHandleClose
+		}
+		return err
+	case err, ok := <-channels[hcsNotificationSystemExited]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// If the expected notification is hcsNotificationSystemExited which of the two selects
+		// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
+		if channels[hcsNotificationSystemExited] == expectedChannel {
+			return err
+		}
+		return ErrUnexpectedContainerExit
+	case _, ok := <-channels[hcsNotificationServiceDisconnect]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// hcsNotificationServiceDisconnect should never be an expected notification
+		// it does not need the same handling as hcsNotificationSystemExited
+		return ErrUnexpectedProcessAbort
+	case <-c:
+		return ErrTimeout
+	}
+	return nil
+}
diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go
new file mode 100644
index 000000000..5d1a851ae
--- /dev/null
+++ b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go
@@ -0,0 +1,1042 @@
+// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
+
+package hcsshim
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/go-winio"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modole32     = windows.NewLazySystemDLL("ole32.dll")
+	modiphlpapi  = windows.NewLazySystemDLL("iphlpapi.dll")
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procCoTaskMemFree                      = modole32.NewProc("CoTaskMemFree")
+	procSetCurrentThreadCompartmentId      = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
+	procActivateLayer                      = modvmcompute.NewProc("ActivateLayer")
+	procCopyLayer                          = modvmcompute.NewProc("CopyLayer")
+	procCreateLayer                        = modvmcompute.NewProc("CreateLayer")
+	procCreateSandboxLayer                 = modvmcompute.NewProc("CreateSandboxLayer")
+	procExpandSandboxSize                  = modvmcompute.NewProc("ExpandSandboxSize")
+	procDeactivateLayer                    = modvmcompute.NewProc("DeactivateLayer")
+	procDestroyLayer                       = modvmcompute.NewProc("DestroyLayer")
+	procExportLayer                        = modvmcompute.NewProc("ExportLayer")
+	procGetLayerMountPath                  = modvmcompute.NewProc("GetLayerMountPath")
+	procGetBaseImages                      = modvmcompute.NewProc("GetBaseImages")
+	procImportLayer                        = modvmcompute.NewProc("ImportLayer")
+	procLayerExists                        = modvmcompute.NewProc("LayerExists")
+	procNameToGuid                         = modvmcompute.NewProc("NameToGuid")
+	procPrepareLayer                       = modvmcompute.NewProc("PrepareLayer")
+	procUnprepareLayer                     = modvmcompute.NewProc("UnprepareLayer")
+	procProcessBaseImage                   = modvmcompute.NewProc("ProcessBaseImage")
+	procProcessUtilityImage                = modvmcompute.NewProc("ProcessUtilityImage")
+	procImportLayerBegin                   = modvmcompute.NewProc("ImportLayerBegin")
+	procImportLayerNext                    = modvmcompute.NewProc("ImportLayerNext")
+	procImportLayerWrite                   = modvmcompute.NewProc("ImportLayerWrite")
+	procImportLayerEnd                     = modvmcompute.NewProc("ImportLayerEnd")
+	procExportLayerBegin                   = modvmcompute.NewProc("ExportLayerBegin")
+	procExportLayerNext                    = modvmcompute.NewProc("ExportLayerNext")
+	procExportLayerRead                    = modvmcompute.NewProc("ExportLayerRead")
+	procExportLayerEnd                     = modvmcompute.NewProc("ExportLayerEnd")
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+	procHcsGetProcessInfo                  = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties            = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess                   = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties            = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback         = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback       = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+	procHcsModifyServiceSettings           = modvmcompute.NewProc("HcsModifyServiceSettings")
+	procHNSCall                            = modvmcompute.NewProc("HNSCall")
+)
+
+func coTaskMemFree(buffer unsafe.Pointer) {
+	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
+	return
+}
+
+func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
+	r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func activateLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _activateLayer(info, _p0)
+}
+
+func _activateLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procActivateLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(srcId)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(dstId)
+	if hr != nil {
+		return
+	}
+	return _copyLayer(info, _p0, _p1, descriptors)
+}
+
+func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procCopyLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func createLayer(info *driverInfo, id string, parent string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(parent)
+	if hr != nil {
+		return
+	}
+	return _createLayer(info, _p0, _p1)
+}
+
+func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) {
+	if hr = procCreateLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(parent)
+	if hr != nil {
+		return
+	}
+	return _createSandboxLayer(info, _p0, _p1, descriptors)
+}
+
+func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procCreateSandboxLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _expandSandboxSize(info, _p0, size)
+}
+
+func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) {
+	if hr = procExpandSandboxSize.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func deactivateLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _deactivateLayer(info, _p0)
+}
+
+func _deactivateLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procDeactivateLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func destroyLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _destroyLayer(info, _p0)
+}
+
+func _destroyLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procDestroyLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _exportLayer(info, _p0, _p1, descriptors)
+}
+
+func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procExportLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _getLayerMountPath(info, _p0, length, buffer)
+}
+
+func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) {
+	if hr = procGetLayerMountPath.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func getBaseImages(buffer **uint16) (hr error) {
+	if hr = procGetBaseImages.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _importLayer(info, _p0, _p1, descriptors)
+}
+
+func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p2 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p2 = &descriptors[0]
+	}
+	if hr = procImportLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func layerExists(info *driverInfo, id string, exists *uint32) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _layerExists(info, _p0, exists)
+}
+
+func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) {
+	if hr = procLayerExists.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func nameToGuid(name string, guid *GUID) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(name)
+	if hr != nil {
+		return
+	}
+	return _nameToGuid(_p0, guid)
+}
+
+func _nameToGuid(name *uint16, guid *GUID) (hr error) {
+	if hr = procNameToGuid.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _prepareLayer(info, _p0, descriptors)
+}
+
+func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
+	var _p1 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p1 = &descriptors[0]
+	}
+	if hr = procPrepareLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func unprepareLayer(info *driverInfo, id string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _unprepareLayer(info, _p0)
+}
+
+func _unprepareLayer(info *driverInfo, id *uint16) (hr error) {
+	if hr = procUnprepareLayer.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func processBaseImage(path string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _processBaseImage(_p0)
+}
+
+func _processBaseImage(path *uint16) (hr error) {
+	if hr = procProcessBaseImage.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func processUtilityImage(path string) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	return _processUtilityImage(_p0)
+}
+
+func _processUtilityImage(path *uint16) (hr error) {
+	if hr = procProcessUtilityImage.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _importLayerBegin(info, _p0, descriptors, context)
+}
+
+func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
+	var _p1 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p1 = &descriptors[0]
+	}
+	if hr = procImportLayerBegin.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(fileName)
+	if hr != nil {
+		return
+	}
+	return _importLayerNext(context, _p0, fileInfo)
+}
+
+func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) {
+	if hr = procImportLayerNext.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func importLayerWrite(context uintptr, buffer []byte) (hr error) {
+	var _p0 *byte
+	if len(buffer) > 0 {
+		_p0 = &buffer[0]
+	}
+	if hr = procImportLayerWrite.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func importLayerEnd(context uintptr) (hr error) {
+	if hr = procImportLayerEnd.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _exportLayerBegin(info, _p0, descriptors, context)
+}
+
+func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
+	var _p1 *WC_LAYER_DESCRIPTOR
+	if len(descriptors) > 0 {
+		_p1 = &descriptors[0]
+	}
+	if hr = procExportLayerBegin.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) {
+	if hr = procExportLayerNext.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) {
+	var _p0 *byte
+	if len(buffer) > 0 {
+		_p0 = &buffer[0]
+	}
+	if hr = procExportLayerRead.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func exportLayerEnd(context uintptr) (hr error) {
+	if hr = procExportLayerEnd.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsCloseProcess(process hcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func hcsModifyServiceSettings(settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyServiceSettings(_p0, result)
+}
+
+func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyServiceSettings.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}
+
+func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(method)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	var _p2 *uint16
+	_p2, hr = syscall.UTF16PtrFromString(object)
+	if hr != nil {
+		return
+	}
+	return __hnsCall(_p0, _p1, _p2, response)
+}
+
+func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
+	if hr = procHNSCall.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
+	if int32(r0) < 0 {
+		hr = syscall.Errno(win32FromHresult(r0))
+	}
+	return
+}