diff options
Diffstat (limited to 'vendor/github.com/Microsoft')
104 files changed, 2125 insertions, 1069 deletions
diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod index b3846826b..50b9d6e2e 100644 --- a/vendor/github.com/Microsoft/go-winio/go.mod +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -5,5 +5,5 @@ go 1.12 require ( github.com/pkg/errors v0.8.1 github.com/sirupsen/logrus v1.4.1 - golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 ) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum index babb4a70d..209aa8cf4 100644 --- a/vendor/github.com/Microsoft/go-winio/go.sum +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -14,3 +14,5 @@ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXf golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 000000000..47d7650fb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,54 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +# Lock down runhcs config + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" +target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" +target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +]
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml index a8ec5a593..7f0f81632 100644 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml @@ -8,22 +8,34 @@ environment: GOPATH: c:\gopath PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% -stack: go 1.11 +stack: go 1.12.9 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer + - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 + - go build ./cmd/wclayer + - go build ./internal/tools/grantvmgroupaccess + - go build ./internal/tools/uvmboot + - go build ./internal/tools/zapdir - go test -v ./... -tags admin + - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional + - go test -c ./test/cri-containerd/ -tags functional - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration + - go test -c ./test/runhcs/ -tags functional artifacts: - - path: 'wclayer.exe' + - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' + - path: 'wclayer.exe' + - path: 'grantvmgroupaccess.exe' + - path: 'uvmboot.exe' + - path: 'zapdir.exe' + - path: 'containerd-shim-runhcs-v1.test.exe' + - path: 'cri-containerd.test.exe' - path: 'functional.test.exe' - path: 'runhcs.test.exe'
\ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c3154..53c0a3854 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcessNoStdio(c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 000000000..5f76d444d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,37 @@ +module github.com/Microsoft/hcsshim + +go 1.12 + +require ( + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/prometheus/procfs v0.0.5 // indirect + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 000000000..578b78e81 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,131 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c4..09b3860a7 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 000000000..8193315f0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,83 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfef..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c030..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4b..62ba81751 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b56535..9a4705a49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbcf..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a2..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf9..d366f629f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,45 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,7 +55,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -86,120 +83,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) if err != nil { - return makeProcessError(process, operation, err, nil) + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") - return nil + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) - } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; but this function can only +// be called once on each Process. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,96 +334,116 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + if process.stdin != nil { + process.stdin.Close() + } return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + if process.stdin != nil { + process.stdin.Close() + } + if process.stdout != nil { + process.stdout.Close() + } + if process.stderr != nil { + process.stderr.Close() + } + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b242524..98df25bd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,24 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,49 +44,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, - } -} - -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" + id: id, + waitBlock: make(chan struct{}), } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) } // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + computeSystem.handle = handle defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) + if err != nil { + computeSystem.Close() } }() + if err = computeSystem.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } + return computeSystem, nil +} - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) if err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, events) + return err } - - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, nil) + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" } + return nil +} - return computeSystem, nil +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" } // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -271,360 +255,388 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError +} - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::System::Properties" + + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - return nil + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + return properties, nil } -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +// PropertiesV2 returns the requested container properties targeting a V2 schema container. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::PropertiesV2" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + properties := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) + } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) +// CreateProcessNoStdio launches a new process within the computeSystem. The +// Stdio handles are not cached on the process struct. +func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) { + operation := "hcsshim::System::CreateProcessNoStdio" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() + + // We don't do anything with these handles. Close them so they don't leak. + syscall.Close(processInfo.StdInput) + syscall.Close(processInfo.StdOutput) + syscall.Close(processInfo.StdError) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() + + return process, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,15 +644,15 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 @@ -649,36 +661,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c57..f07f532c1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed3187..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = <syscall>(args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004c..6a1c41e15 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b263..2df4a57f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de91..b7ae96fdd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 2318a4fce..61da242ee 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -55,8 +55,9 @@ type PaPolicy struct { type OutboundNatPolicy struct { Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` } type ActionType string diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029e..922f7c679 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 000000000..ba6b1a4a5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 000000000..f428bdaf7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 000000000..fee4765cb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ace..fb23617f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc2..bcfeb34d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779eab..c1ea3953b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707a..b4f9c315b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d5..8bf8cab60 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d285..10cea67e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d9..1d5dfe68a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -}
\ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe5..68aa04a57 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28bc..4fb231076 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e21..1fd7ca5d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c571..781a88401 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f71..85450c41e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe4..fe86cab65 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa76735..af8280048 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c3..8838519a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c5..ea3084bca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8dd..23b2ee9e7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c1..a017691f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef12..176c49d49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3b..9b86a4045 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604a..208074e9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3a..ec93d004e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go index 27d0b8c48..b4a36954d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -22,4 +22,9 @@ type Memory2 struct { // EnableDeferredCommit is private in the schema. If regenerated need to add back. EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dffd..811779b04 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,8 +10,7 @@ package hcsschema type MemoryInformationForVm struct { - - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f6..906ba597f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,10 +11,9 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` - - MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c2..a9c750b34 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827c..e5ea187a2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d179..d96c9501f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae2..21707a88e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e1..29d8c8012 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817a..41f8fdea0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8f..e9a662dd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d0..e4ed095c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c55734..82b0d0532 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d150..ad9a4fa9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b0245..bb24e88da 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e7356..21fe46062 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e57..6157e2522 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,10 +11,9 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` - RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` - - RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f6..17558cba0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -9,8 +9,11 @@ package hcsschema -type Properties struct { +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) +type Properties struct { Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` @@ -44,4 +47,8 @@ type Properties struct { SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffdf..d6d80df13 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - - PropertyTypes []string `json:"PropertyTypes,omitempty"` + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go new file mode 100644 index 000000000..f092b737f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e453128..8d5f5c171 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc8..006906f6e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc60..26fde99c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f4841..3f203176c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6cd..df9baa921 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba7..825b71865 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7d..f67b08eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8a..5eaf6a7f4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93b..ba7a6b396 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,12 +15,11 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` - Uptime100ns int32 `json:"Uptime100ns,omitempty"` + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` Processor *ProcessorStats `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df1..9c5e6eb53 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d7..4f042ffd9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,12 +11,11 @@ package hcsschema // Storage runtime statistics type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` - ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` - WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` - - WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c823..834869940 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f9..0e48ece50 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2bc..3ab409d82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d12..2abfccca3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e5606..ec5d0fb93 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8ec..91a3c83d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444a..70cf2d90d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a7..362df363e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a42..915e9b638 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279d..75196bd8c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f628667..8e1836dd6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,14 +10,13 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` - ReservedMemory int32 `json:"ReservedMemory,omitempty"` + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` - AssignedMemory int32 `json:"AssignedMemory,omitempty"` + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` SlpActive bool `json:"SlpActive,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc8..8ed7e566d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 000000000..7c2a0dc28 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,565 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc87..0f2a69f6a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 651676fb2..b3b431e35 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,7 +1,13 @@ package wclayer import ( + "os" + "path/filepath" + "syscall" + "unsafe" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" ) @@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) { if err != nil { return hcserror.New(err, title+" - failed", "") } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bedc..443596fba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a07..06671309d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf65..a259c1b82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd8..dc40bf519 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go @@ -24,4 +24,9 @@ import "github.com/Microsoft/hcsshim/internal/guid" //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index d853ab259..67f917f07 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") @@ -57,6 +59,9 @@ var ( procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") ) func activateLayer(info *driverInfo, id string) (hr error) { @@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bbd..f60ba5501 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 916950c02..477fe7078 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -46,6 +46,12 @@ func Get() OSVersion { return osv } +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + func (osv OSVersion) ToString() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index 2d9567f6f..3488cc451 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,10 +1,27 @@ package osversion const ( - - // RS2 was a client-only release in case you're asking why it's not in the list. + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Sever 1903 (semi-annual + // channel). + V19H1 = 18362 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7c..3362c6833 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed1566..000000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb
\ No newline at end of file |