From a031b83a09a8628435317a03f199cdc18b78262f Mon Sep 17 00:00:00 2001 From: Matthew Heon Date: Wed, 1 Nov 2017 11:24:59 -0400 Subject: Initial checkin from CRI-O repo Signed-off-by: Matthew Heon --- vendor/github.com/Microsoft/go-winio/LICENSE | 22 + vendor/github.com/Microsoft/go-winio/README.md | 22 + .../Microsoft/go-winio/archive/tar/LICENSE | 27 + .../Microsoft/go-winio/archive/tar/common.go | 344 +++++++ .../Microsoft/go-winio/archive/tar/reader.go | 1002 +++++++++++++++++++ .../Microsoft/go-winio/archive/tar/stat_atim.go | 20 + .../go-winio/archive/tar/stat_atimespec.go | 20 + .../Microsoft/go-winio/archive/tar/stat_unix.go | 32 + .../Microsoft/go-winio/archive/tar/writer.go | 444 +++++++++ vendor/github.com/Microsoft/go-winio/backup.go | 280 ++++++ .../Microsoft/go-winio/backuptar/noop.go | 4 + .../github.com/Microsoft/go-winio/backuptar/tar.go | 439 +++++++++ vendor/github.com/Microsoft/go-winio/ea.go | 137 +++ vendor/github.com/Microsoft/go-winio/file.go | 310 ++++++ vendor/github.com/Microsoft/go-winio/fileinfo.go | 60 ++ vendor/github.com/Microsoft/go-winio/pipe.go | 404 ++++++++ vendor/github.com/Microsoft/go-winio/privilege.go | 202 ++++ vendor/github.com/Microsoft/go-winio/reparse.go | 128 +++ vendor/github.com/Microsoft/go-winio/sd.go | 98 ++ vendor/github.com/Microsoft/go-winio/syscall.go | 3 + .../Microsoft/go-winio/zsyscall_windows.go | 528 ++++++++++ vendor/github.com/Microsoft/hcsshim/LICENSE | 21 + vendor/github.com/Microsoft/hcsshim/README.md | 12 + .../github.com/Microsoft/hcsshim/activatelayer.go | 28 + vendor/github.com/Microsoft/hcsshim/baselayer.go | 183 ++++ vendor/github.com/Microsoft/hcsshim/callback.go | 79 ++ vendor/github.com/Microsoft/hcsshim/cgo.go | 7 + vendor/github.com/Microsoft/hcsshim/container.go | 794 +++++++++++++++ vendor/github.com/Microsoft/hcsshim/createlayer.go | 27 + .../Microsoft/hcsshim/createsandboxlayer.go | 35 + .../Microsoft/hcsshim/deactivatelayer.go | 26 + .../github.com/Microsoft/hcsshim/destroylayer.go | 27 + vendor/github.com/Microsoft/hcsshim/errors.go | 239 +++++ .../Microsoft/hcsshim/expandsandboxsize.go | 26 + vendor/github.com/Microsoft/hcsshim/exportlayer.go | 156 +++ .../Microsoft/hcsshim/getlayermountpath.go | 55 ++ .../Microsoft/hcsshim/getsharedbaseimages.go | 22 + vendor/github.com/Microsoft/hcsshim/guid.go | 19 + vendor/github.com/Microsoft/hcsshim/hcsshim.go | 166 ++++ vendor/github.com/Microsoft/hcsshim/hnsendpoint.go | 318 ++++++ vendor/github.com/Microsoft/hcsshim/hnsfuncs.go | 40 + vendor/github.com/Microsoft/hcsshim/hnsnetwork.go | 142 +++ vendor/github.com/Microsoft/hcsshim/hnspolicy.go | 95 ++ .../github.com/Microsoft/hcsshim/hnspolicylist.go | 196 ++++ vendor/github.com/Microsoft/hcsshim/importlayer.go | 212 ++++ vendor/github.com/Microsoft/hcsshim/interface.go | 187 ++++ vendor/github.com/Microsoft/hcsshim/layerexists.go | 30 + vendor/github.com/Microsoft/hcsshim/layerutils.go | 111 +++ vendor/github.com/Microsoft/hcsshim/legacy.go | 741 ++++++++++++++ vendor/github.com/Microsoft/hcsshim/nametoguid.go | 20 + .../github.com/Microsoft/hcsshim/preparelayer.go | 46 + vendor/github.com/Microsoft/hcsshim/process.go | 384 ++++++++ .../github.com/Microsoft/hcsshim/processimage.go | 23 + .../github.com/Microsoft/hcsshim/unpreparelayer.go | 27 + vendor/github.com/Microsoft/hcsshim/utils.go | 33 + vendor/github.com/Microsoft/hcsshim/version.go | 7 + vendor/github.com/Microsoft/hcsshim/waithelper.go | 63 ++ vendor/github.com/Microsoft/hcsshim/zhcsshim.go | 1042 ++++++++++++++++++++ 58 files changed, 10165 insertions(+) create mode 100644 vendor/github.com/Microsoft/go-winio/LICENSE create mode 100644 vendor/github.com/Microsoft/go-winio/README.md create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/common.go create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/reader.go create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/writer.go create mode 100644 vendor/github.com/Microsoft/go-winio/backup.go create mode 100644 vendor/github.com/Microsoft/go-winio/backuptar/noop.go create mode 100644 vendor/github.com/Microsoft/go-winio/backuptar/tar.go create mode 100644 vendor/github.com/Microsoft/go-winio/ea.go create mode 100644 vendor/github.com/Microsoft/go-winio/file.go create mode 100644 vendor/github.com/Microsoft/go-winio/fileinfo.go create mode 100644 vendor/github.com/Microsoft/go-winio/pipe.go create mode 100644 vendor/github.com/Microsoft/go-winio/privilege.go create mode 100644 vendor/github.com/Microsoft/go-winio/reparse.go create mode 100644 vendor/github.com/Microsoft/go-winio/sd.go create mode 100644 vendor/github.com/Microsoft/go-winio/syscall.go create mode 100644 vendor/github.com/Microsoft/go-winio/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/LICENSE create mode 100644 vendor/github.com/Microsoft/hcsshim/README.md create mode 100644 vendor/github.com/Microsoft/hcsshim/activatelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/baselayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/callback.go create mode 100644 vendor/github.com/Microsoft/hcsshim/cgo.go create mode 100644 vendor/github.com/Microsoft/hcsshim/container.go create mode 100644 vendor/github.com/Microsoft/hcsshim/createlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/deactivatelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/destroylayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/errors.go create mode 100644 vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go create mode 100644 vendor/github.com/Microsoft/hcsshim/exportlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/getlayermountpath.go create mode 100644 vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go create mode 100644 vendor/github.com/Microsoft/hcsshim/guid.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hcsshim.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnsendpoint.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnsfuncs.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnsnetwork.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnspolicy.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnspolicylist.go create mode 100644 vendor/github.com/Microsoft/hcsshim/importlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/interface.go create mode 100644 vendor/github.com/Microsoft/hcsshim/layerexists.go create mode 100644 vendor/github.com/Microsoft/hcsshim/layerutils.go create mode 100644 vendor/github.com/Microsoft/hcsshim/legacy.go create mode 100644 vendor/github.com/Microsoft/hcsshim/nametoguid.go create mode 100644 vendor/github.com/Microsoft/hcsshim/preparelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/process.go create mode 100644 vendor/github.com/Microsoft/hcsshim/processimage.go create mode 100644 vendor/github.com/Microsoft/hcsshim/unpreparelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/utils.go create mode 100644 vendor/github.com/Microsoft/hcsshim/version.go create mode 100644 vendor/github.com/Microsoft/hcsshim/waithelper.go create mode 100644 vendor/github.com/Microsoft/hcsshim/zhcsshim.go (limited to 'vendor/github.com/Microsoft') diff --git a/vendor/github.com/Microsoft/go-winio/LICENSE b/vendor/github.com/Microsoft/go-winio/LICENSE new file mode 100644 index 000000000..b8b569d77 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. + diff --git a/vendor/github.com/Microsoft/go-winio/README.md b/vendor/github.com/Microsoft/go-winio/README.md new file mode 100644 index 000000000..568001057 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/README.md @@ -0,0 +1,22 @@ +# go-winio + +This repository contains utilities for efficiently performing Win32 IO operations in +Go. Currently, this is focused on accessing named pipes and other file handles, and +for using named pipes as a net transport. + +This code relies on IO completion ports to avoid blocking IO on system threads, allowing Go +to reuse the thread to schedule another goroutine. This limits support to Windows Vista and +newer operating systems. This is similar to the implementation of network sockets in Go's net +package. + +Please see the LICENSE file for licensing information. + +This project has adopted the [Microsoft Open Source Code of +Conduct](https://opensource.microsoft.com/codeofconduct/). For more information +see the [Code of Conduct +FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact +[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional +questions or comments. + +Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe +for another named pipe implementation. diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE b/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE new file mode 100644 index 000000000..744875676 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2012 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/common.go b/vendor/github.com/Microsoft/go-winio/archive/tar/common.go new file mode 100644 index 000000000..0378401c0 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/common.go @@ -0,0 +1,344 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package tar implements access to tar archives. +// It aims to cover most of the variations, including those produced +// by GNU and BSD tars. +// +// References: +// http://www.freebsd.org/cgi/man.cgi?query=tar&sektion=5 +// http://www.gnu.org/software/tar/manual/html_node/Standard.html +// http://pubs.opengroup.org/onlinepubs/9699919799/utilities/pax.html +package tar + +import ( + "bytes" + "errors" + "fmt" + "os" + "path" + "time" +) + +const ( + blockSize = 512 + + // Types + TypeReg = '0' // regular file + TypeRegA = '\x00' // regular file + TypeLink = '1' // hard link + TypeSymlink = '2' // symbolic link + TypeChar = '3' // character device node + TypeBlock = '4' // block device node + TypeDir = '5' // directory + TypeFifo = '6' // fifo node + TypeCont = '7' // reserved + TypeXHeader = 'x' // extended header + TypeXGlobalHeader = 'g' // global extended header + TypeGNULongName = 'L' // Next file has a long name + TypeGNULongLink = 'K' // Next file symlinks to a file w/ a long name + TypeGNUSparse = 'S' // sparse file +) + +// A Header represents a single header in a tar archive. +// Some fields may not be populated. +type Header struct { + Name string // name of header file entry + Mode int64 // permission and mode bits + Uid int // user id of owner + Gid int // group id of owner + Size int64 // length in bytes + ModTime time.Time // modified time + Typeflag byte // type of header entry + Linkname string // target name of link + Uname string // user name of owner + Gname string // group name of owner + Devmajor int64 // major number of character or block device + Devminor int64 // minor number of character or block device + AccessTime time.Time // access time + ChangeTime time.Time // status change time + CreationTime time.Time // creation time + Xattrs map[string]string + Winheaders map[string]string +} + +// File name constants from the tar spec. +const ( + fileNameSize = 100 // Maximum number of bytes in a standard tar name. + fileNamePrefixSize = 155 // Maximum number of ustar extension bytes. +) + +// FileInfo returns an os.FileInfo for the Header. +func (h *Header) FileInfo() os.FileInfo { + return headerFileInfo{h} +} + +// headerFileInfo implements os.FileInfo. +type headerFileInfo struct { + h *Header +} + +func (fi headerFileInfo) Size() int64 { return fi.h.Size } +func (fi headerFileInfo) IsDir() bool { return fi.Mode().IsDir() } +func (fi headerFileInfo) ModTime() time.Time { return fi.h.ModTime } +func (fi headerFileInfo) Sys() interface{} { return fi.h } + +// Name returns the base name of the file. +func (fi headerFileInfo) Name() string { + if fi.IsDir() { + return path.Base(path.Clean(fi.h.Name)) + } + return path.Base(fi.h.Name) +} + +// Mode returns the permission and mode bits for the headerFileInfo. +func (fi headerFileInfo) Mode() (mode os.FileMode) { + // Set file permission bits. + mode = os.FileMode(fi.h.Mode).Perm() + + // Set setuid, setgid and sticky bits. + if fi.h.Mode&c_ISUID != 0 { + // setuid + mode |= os.ModeSetuid + } + if fi.h.Mode&c_ISGID != 0 { + // setgid + mode |= os.ModeSetgid + } + if fi.h.Mode&c_ISVTX != 0 { + // sticky + mode |= os.ModeSticky + } + + // Set file mode bits. + // clear perm, setuid, setgid and sticky bits. + m := os.FileMode(fi.h.Mode) &^ 07777 + if m == c_ISDIR { + // directory + mode |= os.ModeDir + } + if m == c_ISFIFO { + // named pipe (FIFO) + mode |= os.ModeNamedPipe + } + if m == c_ISLNK { + // symbolic link + mode |= os.ModeSymlink + } + if m == c_ISBLK { + // device file + mode |= os.ModeDevice + } + if m == c_ISCHR { + // Unix character device + mode |= os.ModeDevice + mode |= os.ModeCharDevice + } + if m == c_ISSOCK { + // Unix domain socket + mode |= os.ModeSocket + } + + switch fi.h.Typeflag { + case TypeSymlink: + // symbolic link + mode |= os.ModeSymlink + case TypeChar: + // character device node + mode |= os.ModeDevice + mode |= os.ModeCharDevice + case TypeBlock: + // block device node + mode |= os.ModeDevice + case TypeDir: + // directory + mode |= os.ModeDir + case TypeFifo: + // fifo node + mode |= os.ModeNamedPipe + } + + return mode +} + +// sysStat, if non-nil, populates h from system-dependent fields of fi. +var sysStat func(fi os.FileInfo, h *Header) error + +// Mode constants from the tar spec. +const ( + c_ISUID = 04000 // Set uid + c_ISGID = 02000 // Set gid + c_ISVTX = 01000 // Save text (sticky bit) + c_ISDIR = 040000 // Directory + c_ISFIFO = 010000 // FIFO + c_ISREG = 0100000 // Regular file + c_ISLNK = 0120000 // Symbolic link + c_ISBLK = 060000 // Block special file + c_ISCHR = 020000 // Character special file + c_ISSOCK = 0140000 // Socket +) + +// Keywords for the PAX Extended Header +const ( + paxAtime = "atime" + paxCharset = "charset" + paxComment = "comment" + paxCtime = "ctime" // please note that ctime is not a valid pax header. + paxCreationTime = "LIBARCHIVE.creationtime" + paxGid = "gid" + paxGname = "gname" + paxLinkpath = "linkpath" + paxMtime = "mtime" + paxPath = "path" + paxSize = "size" + paxUid = "uid" + paxUname = "uname" + paxXattr = "SCHILY.xattr." + paxWindows = "MSWINDOWS." + paxNone = "" +) + +// FileInfoHeader creates a partially-populated Header from fi. +// If fi describes a symlink, FileInfoHeader records link as the link target. +// If fi describes a directory, a slash is appended to the name. +// Because os.FileInfo's Name method returns only the base name of +// the file it describes, it may be necessary to modify the Name field +// of the returned header to provide the full path name of the file. +func FileInfoHeader(fi os.FileInfo, link string) (*Header, error) { + if fi == nil { + return nil, errors.New("tar: FileInfo is nil") + } + fm := fi.Mode() + h := &Header{ + Name: fi.Name(), + ModTime: fi.ModTime(), + Mode: int64(fm.Perm()), // or'd with c_IS* constants later + } + switch { + case fm.IsRegular(): + h.Mode |= c_ISREG + h.Typeflag = TypeReg + h.Size = fi.Size() + case fi.IsDir(): + h.Typeflag = TypeDir + h.Mode |= c_ISDIR + h.Name += "/" + case fm&os.ModeSymlink != 0: + h.Typeflag = TypeSymlink + h.Mode |= c_ISLNK + h.Linkname = link + case fm&os.ModeDevice != 0: + if fm&os.ModeCharDevice != 0 { + h.Mode |= c_ISCHR + h.Typeflag = TypeChar + } else { + h.Mode |= c_ISBLK + h.Typeflag = TypeBlock + } + case fm&os.ModeNamedPipe != 0: + h.Typeflag = TypeFifo + h.Mode |= c_ISFIFO + case fm&os.ModeSocket != 0: + h.Mode |= c_ISSOCK + default: + return nil, fmt.Errorf("archive/tar: unknown file mode %v", fm) + } + if fm&os.ModeSetuid != 0 { + h.Mode |= c_ISUID + } + if fm&os.ModeSetgid != 0 { + h.Mode |= c_ISGID + } + if fm&os.ModeSticky != 0 { + h.Mode |= c_ISVTX + } + // If possible, populate additional fields from OS-specific + // FileInfo fields. + if sys, ok := fi.Sys().(*Header); ok { + // This FileInfo came from a Header (not the OS). Use the + // original Header to populate all remaining fields. + h.Uid = sys.Uid + h.Gid = sys.Gid + h.Uname = sys.Uname + h.Gname = sys.Gname + h.AccessTime = sys.AccessTime + h.ChangeTime = sys.ChangeTime + if sys.Xattrs != nil { + h.Xattrs = make(map[string]string) + for k, v := range sys.Xattrs { + h.Xattrs[k] = v + } + } + if sys.Typeflag == TypeLink { + // hard link + h.Typeflag = TypeLink + h.Size = 0 + h.Linkname = sys.Linkname + } + } + if sysStat != nil { + return h, sysStat(fi, h) + } + return h, nil +} + +var zeroBlock = make([]byte, blockSize) + +// POSIX specifies a sum of the unsigned byte values, but the Sun tar uses signed byte values. +// We compute and return both. +func checksum(header []byte) (unsigned int64, signed int64) { + for i := 0; i < len(header); i++ { + if i == 148 { + // The chksum field (header[148:156]) is special: it should be treated as space bytes. + unsigned += ' ' * 8 + signed += ' ' * 8 + i += 7 + continue + } + unsigned += int64(header[i]) + signed += int64(int8(header[i])) + } + return +} + +type slicer []byte + +func (sp *slicer) next(n int) (b []byte) { + s := *sp + b, *sp = s[0:n], s[n:] + return +} + +func isASCII(s string) bool { + for _, c := range s { + if c >= 0x80 { + return false + } + } + return true +} + +func toASCII(s string) string { + if isASCII(s) { + return s + } + var buf bytes.Buffer + for _, c := range s { + if c < 0x80 { + buf.WriteByte(byte(c)) + } + } + return buf.String() +} + +// isHeaderOnlyType checks if the given type flag is of the type that has no +// data section even if a size is specified. +func isHeaderOnlyType(flag byte) bool { + switch flag { + case TypeLink, TypeSymlink, TypeChar, TypeBlock, TypeDir, TypeFifo: + return true + default: + return false + } +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/reader.go b/vendor/github.com/Microsoft/go-winio/archive/tar/reader.go new file mode 100644 index 000000000..e210c618a --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/reader.go @@ -0,0 +1,1002 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package tar + +// TODO(dsymonds): +// - pax extensions + +import ( + "bytes" + "errors" + "io" + "io/ioutil" + "math" + "os" + "strconv" + "strings" + "time" +) + +var ( + ErrHeader = errors.New("archive/tar: invalid tar header") +) + +const maxNanoSecondIntSize = 9 + +// A Reader provides sequential access to the contents of a tar archive. +// A tar archive consists of a sequence of files. +// The Next method advances to the next file in the archive (including the first), +// and then it can be treated as an io.Reader to access the file's data. +type Reader struct { + r io.Reader + err error + pad int64 // amount of padding (ignored) after current file entry + curr numBytesReader // reader for current file entry + hdrBuff [blockSize]byte // buffer to use in readHeader +} + +type parser struct { + err error // Last error seen +} + +// A numBytesReader is an io.Reader with a numBytes method, returning the number +// of bytes remaining in the underlying encoded data. +type numBytesReader interface { + io.Reader + numBytes() int64 +} + +// A regFileReader is a numBytesReader for reading file data from a tar archive. +type regFileReader struct { + r io.Reader // underlying reader + nb int64 // number of unread bytes for current file entry +} + +// A sparseFileReader is a numBytesReader for reading sparse file data from a +// tar archive. +type sparseFileReader struct { + rfr numBytesReader // Reads the sparse-encoded file data + sp []sparseEntry // The sparse map for the file + pos int64 // Keeps track of file position + total int64 // Total size of the file +} + +// A sparseEntry holds a single entry in a sparse file's sparse map. +// +// Sparse files are represented using a series of sparseEntrys. +// Despite the name, a sparseEntry represents an actual data fragment that +// references data found in the underlying archive stream. All regions not +// covered by a sparseEntry are logically filled with zeros. +// +// For example, if the underlying raw file contains the 10-byte data: +// var compactData = "abcdefgh" +// +// And the sparse map has the following entries: +// var sp = []sparseEntry{ +// {offset: 2, numBytes: 5} // Data fragment for [2..7] +// {offset: 18, numBytes: 3} // Data fragment for [18..21] +// } +// +// Then the content of the resulting sparse file with a "real" size of 25 is: +// var sparseData = "\x00"*2 + "abcde" + "\x00"*11 + "fgh" + "\x00"*4 +type sparseEntry struct { + offset int64 // Starting position of the fragment + numBytes int64 // Length of the fragment +} + +// Keywords for GNU sparse files in a PAX extended header +const ( + paxGNUSparseNumBlocks = "GNU.sparse.numblocks" + paxGNUSparseOffset = "GNU.sparse.offset" + paxGNUSparseNumBytes = "GNU.sparse.numbytes" + paxGNUSparseMap = "GNU.sparse.map" + paxGNUSparseName = "GNU.sparse.name" + paxGNUSparseMajor = "GNU.sparse.major" + paxGNUSparseMinor = "GNU.sparse.minor" + paxGNUSparseSize = "GNU.sparse.size" + paxGNUSparseRealSize = "GNU.sparse.realsize" +) + +// Keywords for old GNU sparse headers +const ( + oldGNUSparseMainHeaderOffset = 386 + oldGNUSparseMainHeaderIsExtendedOffset = 482 + oldGNUSparseMainHeaderNumEntries = 4 + oldGNUSparseExtendedHeaderIsExtendedOffset = 504 + oldGNUSparseExtendedHeaderNumEntries = 21 + oldGNUSparseOffsetSize = 12 + oldGNUSparseNumBytesSize = 12 +) + +// NewReader creates a new Reader reading from r. +func NewReader(r io.Reader) *Reader { return &Reader{r: r} } + +// Next advances to the next entry in the tar archive. +// +// io.EOF is returned at the end of the input. +func (tr *Reader) Next() (*Header, error) { + if tr.err != nil { + return nil, tr.err + } + + var hdr *Header + var extHdrs map[string]string + + // Externally, Next iterates through the tar archive as if it is a series of + // files. Internally, the tar format often uses fake "files" to add meta + // data that describes the next file. These meta data "files" should not + // normally be visible to the outside. As such, this loop iterates through + // one or more "header files" until it finds a "normal file". +loop: + for { + tr.err = tr.skipUnread() + if tr.err != nil { + return nil, tr.err + } + + hdr = tr.readHeader() + if tr.err != nil { + return nil, tr.err + } + + // Check for PAX/GNU special headers and files. + switch hdr.Typeflag { + case TypeXHeader: + extHdrs, tr.err = parsePAX(tr) + if tr.err != nil { + return nil, tr.err + } + continue loop // This is a meta header affecting the next header + case TypeGNULongName, TypeGNULongLink: + var realname []byte + realname, tr.err = ioutil.ReadAll(tr) + if tr.err != nil { + return nil, tr.err + } + + // Convert GNU extensions to use PAX headers. + if extHdrs == nil { + extHdrs = make(map[string]string) + } + var p parser + switch hdr.Typeflag { + case TypeGNULongName: + extHdrs[paxPath] = p.parseString(realname) + case TypeGNULongLink: + extHdrs[paxLinkpath] = p.parseString(realname) + } + if p.err != nil { + tr.err = p.err + return nil, tr.err + } + continue loop // This is a meta header affecting the next header + default: + mergePAX(hdr, extHdrs) + + // Check for a PAX format sparse file + sp, err := tr.checkForGNUSparsePAXHeaders(hdr, extHdrs) + if err != nil { + tr.err = err + return nil, err + } + if sp != nil { + // Current file is a PAX format GNU sparse file. + // Set the current file reader to a sparse file reader. + tr.curr, tr.err = newSparseFileReader(tr.curr, sp, hdr.Size) + if tr.err != nil { + return nil, tr.err + } + } + break loop // This is a file, so stop + } + } + return hdr, nil +} + +// checkForGNUSparsePAXHeaders checks the PAX headers for GNU sparse headers. If they are found, then +// this function reads the sparse map and returns it. Unknown sparse formats are ignored, causing the file to +// be treated as a regular file. +func (tr *Reader) checkForGNUSparsePAXHeaders(hdr *Header, headers map[string]string) ([]sparseEntry, error) { + var sparseFormat string + + // Check for sparse format indicators + major, majorOk := headers[paxGNUSparseMajor] + minor, minorOk := headers[paxGNUSparseMinor] + sparseName, sparseNameOk := headers[paxGNUSparseName] + _, sparseMapOk := headers[paxGNUSparseMap] + sparseSize, sparseSizeOk := headers[paxGNUSparseSize] + sparseRealSize, sparseRealSizeOk := headers[paxGNUSparseRealSize] + + // Identify which, if any, sparse format applies from which PAX headers are set + if majorOk && minorOk { + sparseFormat = major + "." + minor + } else if sparseNameOk && sparseMapOk { + sparseFormat = "0.1" + } else if sparseSizeOk { + sparseFormat = "0.0" + } else { + // Not a PAX format GNU sparse file. + return nil, nil + } + + // Check for unknown sparse format + if sparseFormat != "0.0" && sparseFormat != "0.1" && sparseFormat != "1.0" { + return nil, nil + } + + // Update hdr from GNU sparse PAX headers + if sparseNameOk { + hdr.Name = sparseName + } + if sparseSizeOk { + realSize, err := strconv.ParseInt(sparseSize, 10, 0) + if err != nil { + return nil, ErrHeader + } + hdr.Size = realSize + } else if sparseRealSizeOk { + realSize, err := strconv.ParseInt(sparseRealSize, 10, 0) + if err != nil { + return nil, ErrHeader + } + hdr.Size = realSize + } + + // Set up the sparse map, according to the particular sparse format in use + var sp []sparseEntry + var err error + switch sparseFormat { + case "0.0", "0.1": + sp, err = readGNUSparseMap0x1(headers) + case "1.0": + sp, err = readGNUSparseMap1x0(tr.curr) + } + return sp, err +} + +// mergePAX merges well known headers according to PAX standard. +// In general headers with the same name as those found +// in the header struct overwrite those found in the header +// struct with higher precision or longer values. Esp. useful +// for name and linkname fields. +func mergePAX(hdr *Header, headers map[string]string) error { + for k, v := range headers { + switch k { + case paxPath: + hdr.Name = v + case paxLinkpath: + hdr.Linkname = v + case paxGname: + hdr.Gname = v + case paxUname: + hdr.Uname = v + case paxUid: + uid, err := strconv.ParseInt(v, 10, 0) + if err != nil { + return err + } + hdr.Uid = int(uid) + case paxGid: + gid, err := strconv.ParseInt(v, 10, 0) + if err != nil { + return err + } + hdr.Gid = int(gid) + case paxAtime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.AccessTime = t + case paxMtime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.ModTime = t + case paxCtime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.ChangeTime = t + case paxCreationTime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.CreationTime = t + case paxSize: + size, err := strconv.ParseInt(v, 10, 0) + if err != nil { + return err + } + hdr.Size = int64(size) + default: + if strings.HasPrefix(k, paxXattr) { + if hdr.Xattrs == nil { + hdr.Xattrs = make(map[string]string) + } + hdr.Xattrs[k[len(paxXattr):]] = v + } else if strings.HasPrefix(k, paxWindows) { + if hdr.Winheaders == nil { + hdr.Winheaders = make(map[string]string) + } + hdr.Winheaders[k[len(paxWindows):]] = v + } + } + } + return nil +} + +// parsePAXTime takes a string of the form %d.%d as described in +// the PAX specification. +func parsePAXTime(t string) (time.Time, error) { + buf := []byte(t) + pos := bytes.IndexByte(buf, '.') + var seconds, nanoseconds int64 + var err error + if pos == -1 { + seconds, err = strconv.ParseInt(t, 10, 0) + if err != nil { + return time.Time{}, err + } + } else { + seconds, err = strconv.ParseInt(string(buf[:pos]), 10, 0) + if err != nil { + return time.Time{}, err + } + nano_buf := string(buf[pos+1:]) + // Pad as needed before converting to a decimal. + // For example .030 -> .030000000 -> 30000000 nanoseconds + if len(nano_buf) < maxNanoSecondIntSize { + // Right pad + nano_buf += strings.Repeat("0", maxNanoSecondIntSize-len(nano_buf)) + } else if len(nano_buf) > maxNanoSecondIntSize { + // Right truncate + nano_buf = nano_buf[:maxNanoSecondIntSize] + } + nanoseconds, err = strconv.ParseInt(string(nano_buf), 10, 0) + if err != nil { + return time.Time{}, err + } + } + ts := time.Unix(seconds, nanoseconds) + return ts, nil +} + +// parsePAX parses PAX headers. +// If an extended header (type 'x') is invalid, ErrHeader is returned +func parsePAX(r io.Reader) (map[string]string, error) { + buf, err := ioutil.ReadAll(r) + if err != nil { + return nil, err + } + sbuf := string(buf) + + // For GNU PAX sparse format 0.0 support. + // This function transforms the sparse format 0.0 headers into sparse format 0.1 headers. + var sparseMap bytes.Buffer + + headers := make(map[string]string) + // Each record is constructed as + // "%d %s=%s\n", length, keyword, value + for len(sbuf) > 0 { + key, value, residual, err := parsePAXRecord(sbuf) + if err != nil { + return nil, ErrHeader + } + sbuf = residual + + keyStr := string(key) + if keyStr == paxGNUSparseOffset || keyStr == paxGNUSparseNumBytes { + // GNU sparse format 0.0 special key. Write to sparseMap instead of using the headers map. + sparseMap.WriteString(value) + sparseMap.Write([]byte{','}) + } else { + // Normal key. Set the value in the headers map. + headers[keyStr] = string(value) + } + } + if sparseMap.Len() != 0 { + // Add sparse info to headers, chopping off the extra comma + sparseMap.Truncate(sparseMap.Len() - 1) + headers[paxGNUSparseMap] = sparseMap.String() + } + return headers, nil +} + +// parsePAXRecord parses the input PAX record string into a key-value pair. +// If parsing is successful, it will slice off the currently read record and +// return the remainder as r. +// +// A PAX record is of the following form: +// "%d %s=%s\n" % (size, key, value) +func parsePAXRecord(s string) (k, v, r string, err error) { + // The size field ends at the first space. + sp := strings.IndexByte(s, ' ') + if sp == -1 { + return "", "", s, ErrHeader + } + + // Parse the first token as a decimal integer. + n, perr := strconv.ParseInt(s[:sp], 10, 0) // Intentionally parse as native int + if perr != nil || n < 5 || int64(len(s)) < n { + return "", "", s, ErrHeader + } + + // Extract everything between the space and the final newline. + rec, nl, rem := s[sp+1:n-1], s[n-1:n], s[n:] + if nl != "\n" { + return "", "", s, ErrHeader + } + + // The first equals separates the key from the value. + eq := strings.IndexByte(rec, '=') + if eq == -1 { + return "", "", s, ErrHeader + } + return rec[:eq], rec[eq+1:], rem, nil +} + +// parseString parses bytes as a NUL-terminated C-style string. +// If a NUL byte is not found then the whole slice is returned as a string. +func (*parser) parseString(b []byte) string { + n := 0 + for n < len(b) && b[n] != 0 { + n++ + } + return string(b[0:n]) +} + +// parseNumeric parses the input as being encoded in either base-256 or octal. +// This function may return negative numbers. +// If parsing fails or an integer overflow occurs, err will be set. +func (p *parser) parseNumeric(b []byte) int64 { + // Check for base-256 (binary) format first. + // If the first bit is set, then all following bits constitute a two's + // complement encoded number in big-endian byte order. + if len(b) > 0 && b[0]&0x80 != 0 { + // Handling negative numbers relies on the following identity: + // -a-1 == ^a + // + // If the number is negative, we use an inversion mask to invert the + // data bytes and treat the value as an unsigned number. + var inv byte // 0x00 if positive or zero, 0xff if negative + if b[0]&0x40 != 0 { + inv = 0xff + } + + var x uint64 + for i, c := range b { + c ^= inv // Inverts c only if inv is 0xff, otherwise does nothing + if i == 0 { + c &= 0x7f // Ignore signal bit in first byte + } + if (x >> 56) > 0 { + p.err = ErrHeader // Integer overflow + return 0 + } + x = x<<8 | uint64(c) + } + if (x >> 63) > 0 { + p.err = ErrHeader // Integer overflow + return 0 + } + if inv == 0xff { + return ^int64(x) + } + return int64(x) + } + + // Normal case is base-8 (octal) format. + return p.parseOctal(b) +} + +func (p *parser) parseOctal(b []byte) int64 { + // Because unused fields are filled with NULs, we need + // to skip leading NULs. Fields may also be padded with + // spaces or NULs. + // So we remove leading and trailing NULs and spaces to + // be sure. + b = bytes.Trim(b, " \x00") + + if len(b) == 0 { + return 0 + } + x, perr := strconv.ParseUint(p.parseString(b), 8, 64) + if perr != nil { + p.err = ErrHeader + } + return int64(x) +} + +// skipUnread skips any unread bytes in the existing file entry, as well as any +// alignment padding. It returns io.ErrUnexpectedEOF if any io.EOF is +// encountered in the data portion; it is okay to hit io.EOF in the padding. +// +// Note that this function still works properly even when sparse files are being +// used since numBytes returns the bytes remaining in the underlying io.Reader. +func (tr *Reader) skipUnread() error { + dataSkip := tr.numBytes() // Number of data bytes to skip + totalSkip := dataSkip + tr.pad // Total number of bytes to skip + tr.curr, tr.pad = nil, 0 + + // If possible, Seek to the last byte before the end of the data section. + // Do this because Seek is often lazy about reporting errors; this will mask + // the fact that the tar stream may be truncated. We can rely on the + // io.CopyN done shortly afterwards to trigger any IO errors. + var seekSkipped int64 // Number of bytes skipped via Seek + if sr, ok := tr.r.(io.Seeker); ok && dataSkip > 1 { + // Not all io.Seeker can actually Seek. For example, os.Stdin implements + // io.Seeker, but calling Seek always returns an error and performs + // no action. Thus, we try an innocent seek to the current position + // to see if Seek is really supported. + pos1, err := sr.Seek(0, os.SEEK_CUR) + if err == nil { + // Seek seems supported, so perform the real Seek. + pos2, err := sr.Seek(dataSkip-1, os.SEEK_CUR) + if err != nil { + tr.err = err + return tr.err + } + seekSkipped = pos2 - pos1 + } + } + + var copySkipped int64 // Number of bytes skipped via CopyN + copySkipped, tr.err = io.CopyN(ioutil.Discard, tr.r, totalSkip-seekSkipped) + if tr.err == io.EOF && seekSkipped+copySkipped < dataSkip { + tr.err = io.ErrUnexpectedEOF + } + return tr.err +} + +func (tr *Reader) verifyChecksum(header []byte) bool { + if tr.err != nil { + return false + } + + var p parser + given := p.parseOctal(header[148:156]) + unsigned, signed := checksum(header) + return p.err == nil && (given == unsigned || given == signed) +} + +// readHeader reads the next block header and assumes that the underlying reader +// is already aligned to a block boundary. +// +// The err will be set to io.EOF only when one of the following occurs: +// * Exactly 0 bytes are read and EOF is hit. +// * Exactly 1 block of zeros is read and EOF is hit. +// * At least 2 blocks of zeros are read. +func (tr *Reader) readHeader() *Header { + header := tr.hdrBuff[:] + copy(header, zeroBlock) + + if _, tr.err = io.ReadFull(tr.r, header); tr.err != nil { + return nil // io.EOF is okay here + } + + // Two blocks of zero bytes marks the end of the archive. + if bytes.Equal(header, zeroBlock[0:blockSize]) { + if _, tr.err = io.ReadFull(tr.r, header); tr.err != nil { + return nil // io.EOF is okay here + } + if bytes.Equal(header, zeroBlock[0:blockSize]) { + tr.err = io.EOF + } else { + tr.err = ErrHeader // zero block and then non-zero block + } + return nil + } + + if !tr.verifyChecksum(header) { + tr.err = ErrHeader + return nil + } + + // Unpack + var p parser + hdr := new(Header) + s := slicer(header) + + hdr.Name = p.parseString(s.next(100)) + hdr.Mode = p.parseNumeric(s.next(8)) + hdr.Uid = int(p.parseNumeric(s.next(8))) + hdr.Gid = int(p.parseNumeric(s.next(8))) + hdr.Size = p.parseNumeric(s.next(12)) + hdr.ModTime = time.Unix(p.parseNumeric(s.next(12)), 0) + s.next(8) // chksum + hdr.Typeflag = s.next(1)[0] + hdr.Linkname = p.parseString(s.next(100)) + + // The remainder of the header depends on the value of magic. + // The original (v7) version of tar had no explicit magic field, + // so its magic bytes, like the rest of the block, are NULs. + magic := string(s.next(8)) // contains version field as well. + var format string + switch { + case magic[:6] == "ustar\x00": // POSIX tar (1003.1-1988) + if string(header[508:512]) == "tar\x00" { + format = "star" + } else { + format = "posix" + } + case magic == "ustar \x00": // old GNU tar + format = "gnu" + } + + switch format { + case "posix", "gnu", "star": + hdr.Uname = p.parseString(s.next(32)) + hdr.Gname = p.parseString(s.next(32)) + devmajor := s.next(8) + devminor := s.next(8) + if hdr.Typeflag == TypeChar || hdr.Typeflag == TypeBlock { + hdr.Devmajor = p.parseNumeric(devmajor) + hdr.Devminor = p.parseNumeric(devminor) + } + var prefix string + switch format { + case "posix", "gnu": + prefix = p.parseString(s.next(155)) + case "star": + prefix = p.parseString(s.next(131)) + hdr.AccessTime = time.Unix(p.parseNumeric(s.next(12)), 0) + hdr.ChangeTime = time.Unix(p.parseNumeric(s.next(12)), 0) + } + if len(prefix) > 0 { + hdr.Name = prefix + "/" + hdr.Name + } + } + + if p.err != nil { + tr.err = p.err + return nil + } + + nb := hdr.Size + if isHeaderOnlyType(hdr.Typeflag) { + nb = 0 + } + if nb < 0 { + tr.err = ErrHeader + return nil + } + + // Set the current file reader. + tr.pad = -nb & (blockSize - 1) // blockSize is a power of two + tr.curr = ®FileReader{r: tr.r, nb: nb} + + // Check for old GNU sparse format entry. + if hdr.Typeflag == TypeGNUSparse { + // Get the real size of the file. + hdr.Size = p.parseNumeric(header[483:495]) + if p.err != nil { + tr.err = p.err + return nil + } + + // Read the sparse map. + sp := tr.readOldGNUSparseMap(header) + if tr.err != nil { + return nil + } + + // Current file is a GNU sparse file. Update the current file reader. + tr.curr, tr.err = newSparseFileReader(tr.curr, sp, hdr.Size) + if tr.err != nil { + return nil + } + } + + return hdr +} + +// readOldGNUSparseMap reads the sparse map as stored in the old GNU sparse format. +// The sparse map is stored in the tar header if it's small enough. If it's larger than four entries, +// then one or more extension headers are used to store the rest of the sparse map. +func (tr *Reader) readOldGNUSparseMap(header []byte) []sparseEntry { + var p parser + isExtended := header[oldGNUSparseMainHeaderIsExtendedOffset] != 0 + spCap := oldGNUSparseMainHeaderNumEntries + if isExtended { + spCap += oldGNUSparseExtendedHeaderNumEntries + } + sp := make([]sparseEntry, 0, spCap) + s := slicer(header[oldGNUSparseMainHeaderOffset:]) + + // Read the four entries from the main tar header + for i := 0; i < oldGNUSparseMainHeaderNumEntries; i++ { + offset := p.parseNumeric(s.next(oldGNUSparseOffsetSize)) + numBytes := p.parseNumeric(s.next(oldGNUSparseNumBytesSize)) + if p.err != nil { + tr.err = p.err + return nil + } + if offset == 0 && numBytes == 0 { + break + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + + for isExtended { + // There are more entries. Read an extension header and parse its entries. + sparseHeader := make([]byte, blockSize) + if _, tr.err = io.ReadFull(tr.r, sparseHeader); tr.err != nil { + return nil + } + isExtended = sparseHeader[oldGNUSparseExtendedHeaderIsExtendedOffset] != 0 + s = slicer(sparseHeader) + for i := 0; i < oldGNUSparseExtendedHeaderNumEntries; i++ { + offset := p.parseNumeric(s.next(oldGNUSparseOffsetSize)) + numBytes := p.parseNumeric(s.next(oldGNUSparseNumBytesSize)) + if p.err != nil { + tr.err = p.err + return nil + } + if offset == 0 && numBytes == 0 { + break + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + } + return sp +} + +// readGNUSparseMap1x0 reads the sparse map as stored in GNU's PAX sparse format +// version 1.0. The format of the sparse map consists of a series of +// newline-terminated numeric fields. The first field is the number of entries +// and is always present. Following this are the entries, consisting of two +// fields (offset, numBytes). This function must stop reading at the end +// boundary of the block containing the last newline. +// +// Note that the GNU manual says that numeric values should be encoded in octal +// format. However, the GNU tar utility itself outputs these values in decimal. +// As such, this library treats values as being encoded in decimal. +func readGNUSparseMap1x0(r io.Reader) ([]sparseEntry, error) { + var cntNewline int64 + var buf bytes.Buffer + var blk = make([]byte, blockSize) + + // feedTokens copies data in numBlock chunks from r into buf until there are + // at least cnt newlines in buf. It will not read more blocks than needed. + var feedTokens = func(cnt int64) error { + for cntNewline < cnt { + if _, err := io.ReadFull(r, blk); err != nil { + if err == io.EOF { + err = io.ErrUnexpectedEOF + } + return err + } + buf.Write(blk) + for _, c := range blk { + if c == '\n' { + cntNewline++ + } + } + } + return nil + } + + // nextToken gets the next token delimited by a newline. This assumes that + // at least one newline exists in the buffer. + var nextToken = func() string { + cntNewline-- + tok, _ := buf.ReadString('\n') + return tok[:len(tok)-1] // Cut off newline + } + + // Parse for the number of entries. + // Use integer overflow resistant math to check this. + if err := feedTokens(1); err != nil { + return nil, err + } + numEntries, err := strconv.ParseInt(nextToken(), 10, 0) // Intentionally parse as native int + if err != nil || numEntries < 0 || int(2*numEntries) < int(numEntries) { + return nil, ErrHeader + } + + // Parse for all member entries. + // numEntries is trusted after this since a potential attacker must have + // committed resources proportional to what this library used. + if err := feedTokens(2 * numEntries); err != nil { + return nil, err + } + sp := make([]sparseEntry, 0, numEntries) + for i := int64(0); i < numEntries; i++ { + offset, err := strconv.ParseInt(nextToken(), 10, 64) + if err != nil { + return nil, ErrHeader + } + numBytes, err := strconv.ParseInt(nextToken(), 10, 64) + if err != nil { + return nil, ErrHeader + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + return sp, nil +} + +// readGNUSparseMap0x1 reads the sparse map as stored in GNU's PAX sparse format +// version 0.1. The sparse map is stored in the PAX headers. +func readGNUSparseMap0x1(extHdrs map[string]string) ([]sparseEntry, error) { + // Get number of entries. + // Use integer overflow resistant math to check this. + numEntriesStr := extHdrs[paxGNUSparseNumBlocks] + numEntries, err := strconv.ParseInt(numEntriesStr, 10, 0) // Intentionally parse as native int + if err != nil || numEntries < 0 || int(2*numEntries) < int(numEntries) { + return nil, ErrHeader + } + + // There should be two numbers in sparseMap for each entry. + sparseMap := strings.Split(extHdrs[paxGNUSparseMap], ",") + if int64(len(sparseMap)) != 2*numEntries { + return nil, ErrHeader + } + + // Loop through the entries in the sparse map. + // numEntries is trusted now. + sp := make([]sparseEntry, 0, numEntries) + for i := int64(0); i < numEntries; i++ { + offset, err := strconv.ParseInt(sparseMap[2*i], 10, 64) + if err != nil { + return nil, ErrHeader + } + numBytes, err := strconv.ParseInt(sparseMap[2*i+1], 10, 64) + if err != nil { + return nil, ErrHeader + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + return sp, nil +} + +// numBytes returns the number of bytes left to read in the current file's entry +// in the tar archive, or 0 if there is no current file. +func (tr *Reader) numBytes() int64 { + if tr.curr == nil { + // No current file, so no bytes + return 0 + } + return tr.curr.numBytes() +} + +// Read reads from the current entry in the tar archive. +// It returns 0, io.EOF when it reaches the end of that entry, +// until Next is called to advance to the next entry. +// +// Calling Read on special types like TypeLink, TypeSymLink, TypeChar, +// TypeBlock, TypeDir, and TypeFifo returns 0, io.EOF regardless of what +// the Header.Size claims. +func (tr *Reader) Read(b []byte) (n int, err error) { + if tr.err != nil { + return 0, tr.err + } + if tr.curr == nil { + return 0, io.EOF + } + + n, err = tr.curr.Read(b) + if err != nil && err != io.EOF { + tr.err = err + } + return +} + +func (rfr *regFileReader) Read(b []byte) (n int, err error) { + if rfr.nb == 0 { + // file consumed + return 0, io.EOF + } + if int64(len(b)) > rfr.nb { + b = b[0:rfr.nb] + } + n, err = rfr.r.Read(b) + rfr.nb -= int64(n) + + if err == io.EOF && rfr.nb > 0 { + err = io.ErrUnexpectedEOF + } + return +} + +// numBytes returns the number of bytes left to read in the file's data in the tar archive. +func (rfr *regFileReader) numBytes() int64 { + return rfr.nb +} + +// newSparseFileReader creates a new sparseFileReader, but validates all of the +// sparse entries before doing so. +func newSparseFileReader(rfr numBytesReader, sp []sparseEntry, total int64) (*sparseFileReader, error) { + if total < 0 { + return nil, ErrHeader // Total size cannot be negative + } + + // Validate all sparse entries. These are the same checks as performed by + // the BSD tar utility. + for i, s := range sp { + switch { + case s.offset < 0 || s.numBytes < 0: + return nil, ErrHeader // Negative values are never okay + case s.offset > math.MaxInt64-s.numBytes: + return nil, ErrHeader // Integer overflow with large length + case s.offset+s.numBytes > total: + return nil, ErrHeader // Region extends beyond the "real" size + case i > 0 && sp[i-1].offset+sp[i-1].numBytes > s.offset: + return nil, ErrHeader // Regions can't overlap and must be in order + } + } + return &sparseFileReader{rfr: rfr, sp: sp, total: total}, nil +} + +// readHole reads a sparse hole ending at endOffset. +func (sfr *sparseFileReader) readHole(b []byte, endOffset int64) int { + n64 := endOffset - sfr.pos + if n64 > int64(len(b)) { + n64 = int64(len(b)) + } + n := int(n64) + for i := 0; i < n; i++ { + b[i] = 0 + } + sfr.pos += n64 + return n +} + +// Read reads the sparse file data in expanded form. +func (sfr *sparseFileReader) Read(b []byte) (n int, err error) { + // Skip past all empty fragments. + for len(sfr.sp) > 0 && sfr.sp[0].numBytes == 0 { + sfr.sp = sfr.sp[1:] + } + + // If there are no more fragments, then it is possible that there + // is one last sparse hole. + if len(sfr.sp) == 0 { + // This behavior matches the BSD tar utility. + // However, GNU tar stops returning data even if sfr.total is unmet. + if sfr.pos < sfr.total { + return sfr.readHole(b, sfr.total), nil + } + return 0, io.EOF + } + + // In front of a data fragment, so read a hole. + if sfr.pos < sfr.sp[0].offset { + return sfr.readHole(b, sfr.sp[0].offset), nil + } + + // In a data fragment, so read from it. + // This math is overflow free since we verify that offset and numBytes can + // be safely added when creating the sparseFileReader. + endPos := sfr.sp[0].offset + sfr.sp[0].numBytes // End offset of fragment + bytesLeft := endPos - sfr.pos // Bytes left in fragment + if int64(len(b)) > bytesLeft { + b = b[:bytesLeft] + } + + n, err = sfr.rfr.Read(b) + sfr.pos += int64(n) + if err == io.EOF { + if sfr.pos < endPos { + err = io.ErrUnexpectedEOF // There was supposed to be more data + } else if sfr.pos < sfr.total { + err = nil // There is still an implicit sparse hole at the end + } + } + + if sfr.pos == endPos { + sfr.sp = sfr.sp[1:] // We are done with this fragment, so pop it + } + return n, err +} + +// numBytes returns the number of bytes left to read in the sparse file's +// sparse-encoded data in the tar archive. +func (sfr *sparseFileReader) numBytes() int64 { + return sfr.rfr.numBytes() +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go new file mode 100644 index 000000000..cf9cc79c5 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go @@ -0,0 +1,20 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux dragonfly openbsd solaris + +package tar + +import ( + "syscall" + "time" +) + +func statAtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Atim.Unix()) +} + +func statCtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Ctim.Unix()) +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go new file mode 100644 index 000000000..6f17dbe30 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go @@ -0,0 +1,20 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build darwin freebsd netbsd + +package tar + +import ( + "syscall" + "time" +) + +func statAtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Atimespec.Unix()) +} + +func statCtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Ctimespec.Unix()) +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go new file mode 100644 index 000000000..cb843db4c --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go @@ -0,0 +1,32 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux darwin dragonfly freebsd openbsd netbsd solaris + +package tar + +import ( + "os" + "syscall" +) + +func init() { + sysStat = statUnix +} + +func statUnix(fi os.FileInfo, h *Header) error { + sys, ok := fi.Sys().(*syscall.Stat_t) + if !ok { + return nil + } + h.Uid = int(sys.Uid) + h.Gid = int(sys.Gid) + // TODO(bradfitz): populate username & group. os/user + // doesn't cache LookupId lookups, and lacks group + // lookup functions. + h.AccessTime = statAtime(sys) + h.ChangeTime = statCtime(sys) + // TODO(bradfitz): major/minor device numbers? + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/writer.go b/vendor/github.com/Microsoft/go-winio/archive/tar/writer.go new file mode 100644 index 000000000..30d7e606d --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/writer.go @@ -0,0 +1,444 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package tar + +// TODO(dsymonds): +// - catch more errors (no first header, etc.) + +import ( + "bytes" + "errors" + "fmt" + "io" + "path" + "sort" + "strconv" + "strings" + "time" +) + +var ( + ErrWriteTooLong = errors.New("archive/tar: write too long") + ErrFieldTooLong = errors.New("archive/tar: header field too long") + ErrWriteAfterClose = errors.New("archive/tar: write after close") + errInvalidHeader = errors.New("archive/tar: header field too long or contains invalid values") +) + +// A Writer provides sequential writing of a tar archive in POSIX.1 format. +// A tar archive consists of a sequence of files. +// Call WriteHeader to begin a new file, and then call Write to supply that file's data, +// writing at most hdr.Size bytes in total. +type Writer struct { + w io.Writer + err error + nb int64 // number of unwritten bytes for current file entry + pad int64 // amount of padding to write after current file entry + closed bool + usedBinary bool // whether the binary numeric field extension was used + preferPax bool // use pax header instead of binary numeric header + hdrBuff [blockSize]byte // buffer to use in writeHeader when writing a regular header + paxHdrBuff [blockSize]byte // buffer to use in writeHeader when writing a pax header +} + +type formatter struct { + err error // Last error seen +} + +// NewWriter creates a new Writer writing to w. +func NewWriter(w io.Writer) *Writer { return &Writer{w: w, preferPax: true} } + +// Flush finishes writing the current file (optional). +func (tw *Writer) Flush() error { + if tw.nb > 0 { + tw.err = fmt.Errorf("archive/tar: missed writing %d bytes", tw.nb) + return tw.err + } + + n := tw.nb + tw.pad + for n > 0 && tw.err == nil { + nr := n + if nr > blockSize { + nr = blockSize + } + var nw int + nw, tw.err = tw.w.Write(zeroBlock[0:nr]) + n -= int64(nw) + } + tw.nb = 0 + tw.pad = 0 + return tw.err +} + +// Write s into b, terminating it with a NUL if there is room. +func (f *formatter) formatString(b []byte, s string) { + if len(s) > len(b) { + f.err = ErrFieldTooLong + return + } + ascii := toASCII(s) + copy(b, ascii) + if len(ascii) < len(b) { + b[len(ascii)] = 0 + } +} + +// Encode x as an octal ASCII string and write it into b with leading zeros. +func (f *formatter) formatOctal(b []byte, x int64) { + s := strconv.FormatInt(x, 8) + // leading zeros, but leave room for a NUL. + for len(s)+1 < len(b) { + s = "0" + s + } + f.formatString(b, s) +} + +// fitsInBase256 reports whether x can be encoded into n bytes using base-256 +// encoding. Unlike octal encoding, base-256 encoding does not require that the +// string ends with a NUL character. Thus, all n bytes are available for output. +// +// If operating in binary mode, this assumes strict GNU binary mode; which means +// that the first byte can only be either 0x80 or 0xff. Thus, the first byte is +// equivalent to the sign bit in two's complement form. +func fitsInBase256(n int, x int64) bool { + var binBits = uint(n-1) * 8 + return n >= 9 || (x >= -1<= 0; i-- { + b[i] = byte(x) + x >>= 8 + } + b[0] |= 0x80 // Highest bit indicates binary format + return + } + + f.formatOctal(b, 0) // Last resort, just write zero + f.err = ErrFieldTooLong +} + +var ( + minTime = time.Unix(0, 0) + // There is room for 11 octal digits (33 bits) of mtime. + maxTime = minTime.Add((1<<33 - 1) * time.Second) +) + +// WriteHeader writes hdr and prepares to accept the file's contents. +// WriteHeader calls Flush if it is not the first header. +// Calling after a Close will return ErrWriteAfterClose. +func (tw *Writer) WriteHeader(hdr *Header) error { + return tw.writeHeader(hdr, true) +} + +// WriteHeader writes hdr and prepares to accept the file's contents. +// WriteHeader calls Flush if it is not the first header. +// Calling after a Close will return ErrWriteAfterClose. +// As this method is called internally by writePax header to allow it to +// suppress writing the pax header. +func (tw *Writer) writeHeader(hdr *Header, allowPax bool) error { + if tw.closed { + return ErrWriteAfterClose + } + if tw.err == nil { + tw.Flush() + } + if tw.err != nil { + return tw.err + } + + // a map to hold pax header records, if any are needed + paxHeaders := make(map[string]string) + + // TODO(shanemhansen): we might want to use PAX headers for + // subsecond time resolution, but for now let's just capture + // too long fields or non ascii characters + + var f formatter + var header []byte + + // We need to select which scratch buffer to use carefully, + // since this method is called recursively to write PAX headers. + // If allowPax is true, this is the non-recursive call, and we will use hdrBuff. + // If allowPax is false, we are being called by writePAXHeader, and hdrBuff is + // already being used by the non-recursive call, so we must use paxHdrBuff. + header = tw.hdrBuff[:] + if !allowPax { + header = tw.paxHdrBuff[:] + } + copy(header, zeroBlock) + s := slicer(header) + + // Wrappers around formatter that automatically sets paxHeaders if the + // argument extends beyond the capacity of the input byte slice. + var formatString = func(b []byte, s string, paxKeyword string) { + needsPaxHeader := paxKeyword != paxNone && len(s) > len(b) || !isASCII(s) + if needsPaxHeader { + paxHeaders[paxKeyword] = s + return + } + f.formatString(b, s) + } + var formatNumeric = func(b []byte, x int64, paxKeyword string) { + // Try octal first. + s := strconv.FormatInt(x, 8) + if len(s) < len(b) { + f.formatOctal(b, x) + return + } + + // If it is too long for octal, and PAX is preferred, use a PAX header. + if paxKeyword != paxNone && tw.preferPax { + f.formatOctal(b, 0) + s := strconv.FormatInt(x, 10) + paxHeaders[paxKeyword] = s + return + } + + tw.usedBinary = true + f.formatNumeric(b, x) + } + var formatTime = func(b []byte, t time.Time, paxKeyword string) { + var unixTime int64 + if !t.Before(minTime) && !t.After(maxTime) { + unixTime = t.Unix() + } + formatNumeric(b, unixTime, paxNone) + + // Write a PAX header if the time didn't fit precisely. + if paxKeyword != "" && tw.preferPax && allowPax && (t.Nanosecond() != 0 || !t.Before(minTime) || !t.After(maxTime)) { + paxHeaders[paxKeyword] = formatPAXTime(t) + } + } + + // keep a reference to the filename to allow to overwrite it later if we detect that we can use ustar longnames instead of pax + pathHeaderBytes := s.next(fileNameSize) + + formatString(pathHeaderBytes, hdr.Name, paxPath) + + f.formatOctal(s.next(8), hdr.Mode) // 100:108 + formatNumeric(s.next(8), int64(hdr.Uid), paxUid) // 108:116 + formatNumeric(s.next(8), int64(hdr.Gid), paxGid) // 116:124 + formatNumeric(s.next(12), hdr.Size, paxSize) // 124:136 + formatTime(s.next(12), hdr.ModTime, paxMtime) // 136:148 + s.next(8) // chksum (148:156) + s.next(1)[0] = hdr.Typeflag // 156:157 + + formatString(s.next(100), hdr.Linkname, paxLinkpath) + + copy(s.next(8), []byte("ustar\x0000")) // 257:265 + formatString(s.next(32), hdr.Uname, paxUname) // 265:297 + formatString(s.next(32), hdr.Gname, paxGname) // 297:329 + formatNumeric(s.next(8), hdr.Devmajor, paxNone) // 329:337 + formatNumeric(s.next(8), hdr.Devminor, paxNone) // 337:345 + + // keep a reference to the prefix to allow to overwrite it later if we detect that we can use ustar longnames instead of pax + prefixHeaderBytes := s.next(155) + formatString(prefixHeaderBytes, "", paxNone) // 345:500 prefix + + // Use the GNU magic instead of POSIX magic if we used any GNU extensions. + if tw.usedBinary { + copy(header[257:265], []byte("ustar \x00")) + } + + _, paxPathUsed := paxHeaders[paxPath] + // try to use a ustar header when only the name is too long + if !tw.preferPax && len(paxHeaders) == 1 && paxPathUsed { + prefix, suffix, ok := splitUSTARPath(hdr.Name) + if ok { + // Since we can encode in USTAR format, disable PAX header. + delete(paxHeaders, paxPath) + + // Update the path fields + formatString(pathHeaderBytes, suffix, paxNone) + formatString(prefixHeaderBytes, prefix, paxNone) + } + } + + // The chksum field is terminated by a NUL and a space. + // This is different from the other octal fields. + chksum, _ := checksum(header) + f.formatOctal(header[148:155], chksum) // Never fails + header[155] = ' ' + + // Check if there were any formatting errors. + if f.err != nil { + tw.err = f.err + return tw.err + } + + if allowPax { + if !hdr.AccessTime.IsZero() { + paxHeaders[paxAtime] = formatPAXTime(hdr.AccessTime) + } + if !hdr.ChangeTime.IsZero() { + paxHeaders[paxCtime] = formatPAXTime(hdr.ChangeTime) + } + if !hdr.CreationTime.IsZero() { + paxHeaders[paxCreationTime] = formatPAXTime(hdr.CreationTime) + } + for k, v := range hdr.Xattrs { + paxHeaders[paxXattr+k] = v + } + for k, v := range hdr.Winheaders { + paxHeaders[paxWindows+k] = v + } + } + + if len(paxHeaders) > 0 { + if !allowPax { + return errInvalidHeader + } + if err := tw.writePAXHeader(hdr, paxHeaders); err != nil { + return err + } + } + tw.nb = int64(hdr.Size) + tw.pad = (blockSize - (tw.nb % blockSize)) % blockSize + + _, tw.err = tw.w.Write(header) + return tw.err +} + +func formatPAXTime(t time.Time) string { + sec := t.Unix() + usec := t.Nanosecond() + s := strconv.FormatInt(sec, 10) + if usec != 0 { + s = fmt.Sprintf("%s.%09d", s, usec) + } + return s +} + +// splitUSTARPath splits a path according to USTAR prefix and suffix rules. +// If the path is not splittable, then it will return ("", "", false). +func splitUSTARPath(name string) (prefix, suffix string, ok bool) { + length := len(name) + if length <= fileNameSize || !isASCII(name) { + return "", "", false + } else if length > fileNamePrefixSize+1 { + length = fileNamePrefixSize + 1 + } else if name[length-1] == '/' { + length-- + } + + i := strings.LastIndex(name[:length], "/") + nlen := len(name) - i - 1 // nlen is length of suffix + plen := i // plen is length of prefix + if i <= 0 || nlen > fileNameSize || nlen == 0 || plen > fileNamePrefixSize { + return "", "", false + } + return name[:i], name[i+1:], true +} + +// writePaxHeader writes an extended pax header to the +// archive. +func (tw *Writer) writePAXHeader(hdr *Header, paxHeaders map[string]string) error { + // Prepare extended header + ext := new(Header) + ext.Typeflag = TypeXHeader + // Setting ModTime is required for reader parsing to + // succeed, and seems harmless enough. + ext.ModTime = hdr.ModTime + // The spec asks that we namespace our pseudo files + // with the current pid. However, this results in differing outputs + // for identical inputs. As such, the constant 0 is now used instead. + // golang.org/issue/12358 + dir, file := path.Split(hdr.Name) + fullName := path.Join(dir, "PaxHeaders.0", file) + + ascii := toASCII(fullName) + if len(ascii) > 100 { + ascii = ascii[:100] + } + ext.Name = ascii + // Construct the body + var buf bytes.Buffer + + // Keys are sorted before writing to body to allow deterministic output. + var keys []string + for k := range paxHeaders { + keys = append(keys, k) + } + sort.Strings(keys) + + for _, k := range keys { + fmt.Fprint(&buf, formatPAXRecord(k, paxHeaders[k])) + } + + ext.Size = int64(len(buf.Bytes())) + if err := tw.writeHeader(ext, false); err != nil { + return err + } + if _, err := tw.Write(buf.Bytes()); err != nil { + return err + } + if err := tw.Flush(); err != nil { + return err + } + return nil +} + +// formatPAXRecord formats a single PAX record, prefixing it with the +// appropriate length. +func formatPAXRecord(k, v string) string { + const padding = 3 // Extra padding for ' ', '=', and '\n' + size := len(k) + len(v) + padding + size += len(strconv.Itoa(size)) + record := fmt.Sprintf("%d %s=%s\n", size, k, v) + + // Final adjustment if adding size field increased the record size. + if len(record) != size { + size = len(record) + record = fmt.Sprintf("%d %s=%s\n", size, k, v) + } + return record +} + +// Write writes to the current entry in the tar archive. +// Write returns the error ErrWriteTooLong if more than +// hdr.Size bytes are written after WriteHeader. +func (tw *Writer) Write(b []byte) (n int, err error) { + if tw.closed { + err = ErrWriteAfterClose + return + } + overwrite := false + if int64(len(b)) > tw.nb { + b = b[0:tw.nb] + overwrite = true + } + n, err = tw.w.Write(b) + tw.nb -= int64(n) + if err == nil && overwrite { + err = ErrWriteTooLong + return + } + tw.err = err + return +} + +// Close closes the tar archive, flushing any unwritten +// data to the underlying writer. +func (tw *Writer) Close() error { + if tw.err != nil || tw.closed { + return tw.err + } + tw.Flush() + tw.closed = true + if tw.err != nil { + return tw.err + } + + // trailer: two zero blocks + for i := 0; i < 2; i++ { + _, tw.err = tw.w.Write(zeroBlock) + if tw.err != nil { + break + } + } + return tw.err +} diff --git a/vendor/github.com/Microsoft/go-winio/backup.go b/vendor/github.com/Microsoft/go-winio/backup.go new file mode 100644 index 000000000..2be34af43 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/backup.go @@ -0,0 +1,280 @@ +// +build windows + +package winio + +import ( + "encoding/binary" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "runtime" + "syscall" + "unicode/utf16" +) + +//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead +//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite + +const ( + BackupData = uint32(iota + 1) + BackupEaData + BackupSecurity + BackupAlternateData + BackupLink + BackupPropertyData + BackupObjectId + BackupReparseData + BackupSparseBlock + BackupTxfsData +) + +const ( + StreamSparseAttributes = uint32(8) +) + +const ( + WRITE_DAC = 0x40000 + WRITE_OWNER = 0x80000 + ACCESS_SYSTEM_SECURITY = 0x1000000 +) + +// BackupHeader represents a backup stream of a file. +type BackupHeader struct { + Id uint32 // The backup stream ID + Attributes uint32 // Stream attributes + Size int64 // The size of the stream in bytes + Name string // The name of the stream (for BackupAlternateData only). + Offset int64 // The offset of the stream in the file (for BackupSparseBlock only). +} + +type win32StreamId struct { + StreamId uint32 + Attributes uint32 + Size uint64 + NameSize uint32 +} + +// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series +// of BackupHeader values. +type BackupStreamReader struct { + r io.Reader + bytesLeft int64 +} + +// NewBackupStreamReader produces a BackupStreamReader from any io.Reader. +func NewBackupStreamReader(r io.Reader) *BackupStreamReader { + return &BackupStreamReader{r, 0} +} + +// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if +// it was not completely read. +func (r *BackupStreamReader) Next() (*BackupHeader, error) { + if r.bytesLeft > 0 { + if s, ok := r.r.(io.Seeker); ok { + // Make sure Seek on io.SeekCurrent sometimes succeeds + // before trying the actual seek. + if _, err := s.Seek(0, io.SeekCurrent); err == nil { + if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil { + return nil, err + } + r.bytesLeft = 0 + } + } + if _, err := io.Copy(ioutil.Discard, r); err != nil { + return nil, err + } + } + var wsi win32StreamId + if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil { + return nil, err + } + hdr := &BackupHeader{ + Id: wsi.StreamId, + Attributes: wsi.Attributes, + Size: int64(wsi.Size), + } + if wsi.NameSize != 0 { + name := make([]uint16, int(wsi.NameSize/2)) + if err := binary.Read(r.r, binary.LittleEndian, name); err != nil { + return nil, err + } + hdr.Name = syscall.UTF16ToString(name) + } + if wsi.StreamId == BackupSparseBlock { + if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil { + return nil, err + } + hdr.Size -= 8 + } + r.bytesLeft = hdr.Size + return hdr, nil +} + +// Read reads from the current backup stream. +func (r *BackupStreamReader) Read(b []byte) (int, error) { + if r.bytesLeft == 0 { + return 0, io.EOF + } + if int64(len(b)) > r.bytesLeft { + b = b[:r.bytesLeft] + } + n, err := r.r.Read(b) + r.bytesLeft -= int64(n) + if err == io.EOF { + err = io.ErrUnexpectedEOF + } else if r.bytesLeft == 0 && err == nil { + err = io.EOF + } + return n, err +} + +// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API. +type BackupStreamWriter struct { + w io.Writer + bytesLeft int64 +} + +// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer. +func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter { + return &BackupStreamWriter{w, 0} +} + +// WriteHeader writes the next backup stream header and prepares for calls to Write(). +func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error { + if w.bytesLeft != 0 { + return fmt.Errorf("missing %d bytes", w.bytesLeft) + } + name := utf16.Encode([]rune(hdr.Name)) + wsi := win32StreamId{ + StreamId: hdr.Id, + Attributes: hdr.Attributes, + Size: uint64(hdr.Size), + NameSize: uint32(len(name) * 2), + } + if hdr.Id == BackupSparseBlock { + // Include space for the int64 block offset + wsi.Size += 8 + } + if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil { + return err + } + if len(name) != 0 { + if err := binary.Write(w.w, binary.LittleEndian, name); err != nil { + return err + } + } + if hdr.Id == BackupSparseBlock { + if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil { + return err + } + } + w.bytesLeft = hdr.Size + return nil +} + +// Write writes to the current backup stream. +func (w *BackupStreamWriter) Write(b []byte) (int, error) { + if w.bytesLeft < int64(len(b)) { + return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft) + } + n, err := w.w.Write(b) + w.bytesLeft -= int64(n) + return n, err +} + +// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API. +type BackupFileReader struct { + f *os.File + includeSecurity bool + ctx uintptr +} + +// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true, +// Read will attempt to read the security descriptor of the file. +func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader { + r := &BackupFileReader{f, includeSecurity, 0} + return r +} + +// Read reads a backup stream from the file by calling the Win32 API BackupRead(). +func (r *BackupFileReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx) + if err != nil { + return 0, &os.PathError{"BackupRead", r.f.Name(), err} + } + runtime.KeepAlive(r.f) + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees Win32 resources associated with the BackupFileReader. It does not close +// the underlying file. +func (r *BackupFileReader) Close() error { + if r.ctx != 0 { + backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx) + runtime.KeepAlive(r.f) + r.ctx = 0 + } + return nil +} + +// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API. +type BackupFileWriter struct { + f *os.File + includeSecurity bool + ctx uintptr +} + +// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true, +// Write() will attempt to restore the security descriptor from the stream. +func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter { + w := &BackupFileWriter{f, includeSecurity, 0} + return w +} + +// Write restores a portion of the file using the provided backup stream. +func (w *BackupFileWriter) Write(b []byte) (int, error) { + var bytesWritten uint32 + err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx) + if err != nil { + return 0, &os.PathError{"BackupWrite", w.f.Name(), err} + } + runtime.KeepAlive(w.f) + if int(bytesWritten) != len(b) { + return int(bytesWritten), errors.New("not all bytes could be written") + } + return len(b), nil +} + +// Close frees Win32 resources associated with the BackupFileWriter. It does not +// close the underlying file. +func (w *BackupFileWriter) Close() error { + if w.ctx != 0 { + backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx) + runtime.KeepAlive(w.f) + w.ctx = 0 + } + return nil +} + +// OpenForBackup opens a file or directory, potentially skipping access checks if the backup +// or restore privileges have been acquired. +// +// If the file opened was a directory, it cannot be used with Readdir(). +func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) { + winPath, err := syscall.UTF16FromString(path) + if err != nil { + return nil, err + } + h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0) + if err != nil { + err = &os.PathError{Op: "open", Path: path, Err: err} + return nil, err + } + return os.NewFile(uintptr(h), path), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/noop.go b/vendor/github.com/Microsoft/go-winio/backuptar/noop.go new file mode 100644 index 000000000..d39eccf02 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/backuptar/noop.go @@ -0,0 +1,4 @@ +// +build !windows +// This file only exists to allow go get on non-Windows platforms. + +package backuptar diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/tar.go b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go new file mode 100644 index 000000000..53da908f1 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go @@ -0,0 +1,439 @@ +// +build windows + +package backuptar + +import ( + "encoding/base64" + "errors" + "fmt" + "io" + "io/ioutil" + "path/filepath" + "strconv" + "strings" + "syscall" + "time" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/go-winio/archive/tar" // until archive/tar supports pax extensions in its interface +) + +const ( + c_ISUID = 04000 // Set uid + c_ISGID = 02000 // Set gid + c_ISVTX = 01000 // Save text (sticky bit) + c_ISDIR = 040000 // Directory + c_ISFIFO = 010000 // FIFO + c_ISREG = 0100000 // Regular file + c_ISLNK = 0120000 // Symbolic link + c_ISBLK = 060000 // Block special file + c_ISCHR = 020000 // Character special file + c_ISSOCK = 0140000 // Socket +) + +const ( + hdrFileAttributes = "fileattr" + hdrSecurityDescriptor = "sd" + hdrRawSecurityDescriptor = "rawsd" + hdrMountPoint = "mountpoint" + hdrEaPrefix = "xattr." +) + +func writeZeroes(w io.Writer, count int64) error { + buf := make([]byte, 8192) + c := len(buf) + for i := int64(0); i < count; i += int64(c) { + if int64(c) > count-i { + c = int(count - i) + } + _, err := w.Write(buf[:c]) + if err != nil { + return err + } + } + return nil +} + +func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error { + curOffset := int64(0) + for { + bhdr, err := br.Next() + if err == io.EOF { + err = io.ErrUnexpectedEOF + } + if err != nil { + return err + } + if bhdr.Id != winio.BackupSparseBlock { + return fmt.Errorf("unexpected stream %d", bhdr.Id) + } + + // archive/tar does not support writing sparse files + // so just write zeroes to catch up to the current offset. + err = writeZeroes(t, bhdr.Offset-curOffset) + if bhdr.Size == 0 { + break + } + n, err := io.Copy(t, br) + if err != nil { + return err + } + curOffset = bhdr.Offset + n + } + return nil +} + +// BasicInfoHeader creates a tar header from basic file information. +func BasicInfoHeader(name string, size int64, fileInfo *winio.FileBasicInfo) *tar.Header { + hdr := &tar.Header{ + Name: filepath.ToSlash(name), + Size: size, + Typeflag: tar.TypeReg, + ModTime: time.Unix(0, fileInfo.LastWriteTime.Nanoseconds()), + ChangeTime: time.Unix(0, fileInfo.ChangeTime.Nanoseconds()), + AccessTime: time.Unix(0, fileInfo.LastAccessTime.Nanoseconds()), + CreationTime: time.Unix(0, fileInfo.CreationTime.Nanoseconds()), + Winheaders: make(map[string]string), + } + hdr.Winheaders[hdrFileAttributes] = fmt.Sprintf("%d", fileInfo.FileAttributes) + + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + hdr.Mode |= c_ISDIR + hdr.Size = 0 + hdr.Typeflag = tar.TypeDir + } + return hdr +} + +// WriteTarFileFromBackupStream writes a file to a tar writer using data from a Win32 backup stream. +// +// This encodes Win32 metadata as tar pax vendor extensions starting with MSWINDOWS. +// +// The additional Win32 metadata is: +// +// MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value +// +// MSWINDOWS.rawsd: The Win32 security descriptor, in raw binary format +// +// MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink) +func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size int64, fileInfo *winio.FileBasicInfo) error { + name = filepath.ToSlash(name) + hdr := BasicInfoHeader(name, size, fileInfo) + + // If r can be seeked, then this function is two-pass: pass 1 collects the + // tar header data, and pass 2 copies the data stream. If r cannot be + // seeked, then some header data (in particular EAs) will be silently lost. + var ( + restartPos int64 + err error + ) + sr, readTwice := r.(io.Seeker) + if readTwice { + if restartPos, err = sr.Seek(0, io.SeekCurrent); err != nil { + readTwice = false + } + } + + br := winio.NewBackupStreamReader(r) + var dataHdr *winio.BackupHeader + for dataHdr == nil { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupData: + hdr.Mode |= c_ISREG + if !readTwice { + dataHdr = bhdr + } + case winio.BackupSecurity: + sd, err := ioutil.ReadAll(br) + if err != nil { + return err + } + hdr.Winheaders[hdrRawSecurityDescriptor] = base64.StdEncoding.EncodeToString(sd) + + case winio.BackupReparseData: + hdr.Mode |= c_ISLNK + hdr.Typeflag = tar.TypeSymlink + reparseBuffer, err := ioutil.ReadAll(br) + rp, err := winio.DecodeReparsePoint(reparseBuffer) + if err != nil { + return err + } + if rp.IsMountPoint { + hdr.Winheaders[hdrMountPoint] = "1" + } + hdr.Linkname = rp.Target + + case winio.BackupEaData: + eab, err := ioutil.ReadAll(br) + if err != nil { + return err + } + eas, err := winio.DecodeExtendedAttributes(eab) + if err != nil { + return err + } + for _, ea := range eas { + // Use base64 encoding for the binary value. Note that there + // is no way to encode the EA's flags, since their use doesn't + // make any sense for persisted EAs. + hdr.Winheaders[hdrEaPrefix+ea.Name] = base64.StdEncoding.EncodeToString(ea.Value) + } + + case winio.BackupAlternateData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: + // ignore these streams + default: + return fmt.Errorf("%s: unknown stream ID %d", name, bhdr.Id) + } + } + + err = t.WriteHeader(hdr) + if err != nil { + return err + } + + if readTwice { + // Get back to the data stream. + if _, err = sr.Seek(restartPos, io.SeekStart); err != nil { + return err + } + for dataHdr == nil { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + if bhdr.Id == winio.BackupData { + dataHdr = bhdr + } + } + } + + if dataHdr != nil { + // A data stream was found. Copy the data. + if (dataHdr.Attributes & winio.StreamSparseAttributes) == 0 { + if size != dataHdr.Size { + return fmt.Errorf("%s: mismatch between file size %d and header size %d", name, size, dataHdr.Size) + } + _, err = io.Copy(t, br) + if err != nil { + return err + } + } else { + err = copySparse(t, br) + if err != nil { + return err + } + } + } + + // Look for streams after the data stream. The only ones we handle are alternate data streams. + // Other streams may have metadata that could be serialized, but the tar header has already + // been written. In practice, this means that we don't get EA or TXF metadata. + for { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupAlternateData: + altName := bhdr.Name + if strings.HasSuffix(altName, ":$DATA") { + altName = altName[:len(altName)-len(":$DATA")] + } + if (bhdr.Attributes & winio.StreamSparseAttributes) == 0 { + hdr = &tar.Header{ + Name: name + altName, + Mode: hdr.Mode, + Typeflag: tar.TypeReg, + Size: bhdr.Size, + ModTime: hdr.ModTime, + AccessTime: hdr.AccessTime, + ChangeTime: hdr.ChangeTime, + } + err = t.WriteHeader(hdr) + if err != nil { + return err + } + _, err = io.Copy(t, br) + if err != nil { + return err + } + + } else { + // Unsupported for now, since the size of the alternate stream is not present + // in the backup stream until after the data has been read. + return errors.New("tar of sparse alternate data streams is unsupported") + } + case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: + // ignore these streams + default: + return fmt.Errorf("%s: unknown stream ID %d after data", name, bhdr.Id) + } + } + return nil +} + +// FileInfoFromHeader retrieves basic Win32 file information from a tar header, using the additional metadata written by +// WriteTarFileFromBackupStream. +func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *winio.FileBasicInfo, err error) { + name = hdr.Name + if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { + size = hdr.Size + } + fileInfo = &winio.FileBasicInfo{ + LastAccessTime: syscall.NsecToFiletime(hdr.AccessTime.UnixNano()), + LastWriteTime: syscall.NsecToFiletime(hdr.ModTime.UnixNano()), + ChangeTime: syscall.NsecToFiletime(hdr.ChangeTime.UnixNano()), + CreationTime: syscall.NsecToFiletime(hdr.CreationTime.UnixNano()), + } + if attrStr, ok := hdr.Winheaders[hdrFileAttributes]; ok { + attr, err := strconv.ParseUint(attrStr, 10, 32) + if err != nil { + return "", 0, nil, err + } + fileInfo.FileAttributes = uintptr(attr) + } else { + if hdr.Typeflag == tar.TypeDir { + fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY + } + } + return +} + +// WriteBackupStreamFromTarFile writes a Win32 backup stream from the current tar file. Since this function may process multiple +// tar file entries in order to collect all the alternate data streams for the file, it returns the next +// tar file that was not processed, or io.EOF is there are no more. +func WriteBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) (*tar.Header, error) { + bw := winio.NewBackupStreamWriter(w) + var sd []byte + var err error + // Maintaining old SDDL-based behavior for backward compatibility. All new tar headers written + // by this library will have raw binary for the security descriptor. + if sddl, ok := hdr.Winheaders[hdrSecurityDescriptor]; ok { + sd, err = winio.SddlToSecurityDescriptor(sddl) + if err != nil { + return nil, err + } + } + if sdraw, ok := hdr.Winheaders[hdrRawSecurityDescriptor]; ok { + sd, err = base64.StdEncoding.DecodeString(sdraw) + if err != nil { + return nil, err + } + } + if len(sd) != 0 { + bhdr := winio.BackupHeader{ + Id: winio.BackupSecurity, + Size: int64(len(sd)), + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(sd) + if err != nil { + return nil, err + } + } + var eas []winio.ExtendedAttribute + for k, v := range hdr.Winheaders { + if !strings.HasPrefix(k, hdrEaPrefix) { + continue + } + data, err := base64.StdEncoding.DecodeString(v) + if err != nil { + return nil, err + } + eas = append(eas, winio.ExtendedAttribute{ + Name: k[len(hdrEaPrefix):], + Value: data, + }) + } + if len(eas) != 0 { + eadata, err := winio.EncodeExtendedAttributes(eas) + if err != nil { + return nil, err + } + bhdr := winio.BackupHeader{ + Id: winio.BackupEaData, + Size: int64(len(eadata)), + } + err = bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(eadata) + if err != nil { + return nil, err + } + } + if hdr.Typeflag == tar.TypeSymlink { + _, isMountPoint := hdr.Winheaders[hdrMountPoint] + rp := winio.ReparsePoint{ + Target: filepath.FromSlash(hdr.Linkname), + IsMountPoint: isMountPoint, + } + reparse := winio.EncodeReparsePoint(&rp) + bhdr := winio.BackupHeader{ + Id: winio.BackupReparseData, + Size: int64(len(reparse)), + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(reparse) + if err != nil { + return nil, err + } + } + if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { + bhdr := winio.BackupHeader{ + Id: winio.BackupData, + Size: hdr.Size, + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = io.Copy(bw, t) + if err != nil { + return nil, err + } + } + // Copy all the alternate data streams and return the next non-ADS header. + for { + ahdr, err := t.Next() + if err != nil { + return nil, err + } + if ahdr.Typeflag != tar.TypeReg || !strings.HasPrefix(ahdr.Name, hdr.Name+":") { + return ahdr, nil + } + bhdr := winio.BackupHeader{ + Id: winio.BackupAlternateData, + Size: ahdr.Size, + Name: ahdr.Name[len(hdr.Name):] + ":$DATA", + } + err = bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = io.Copy(bw, t) + if err != nil { + return nil, err + } + } +} diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go new file mode 100644 index 000000000..b37e930d6 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/ea.go @@ -0,0 +1,137 @@ +package winio + +import ( + "bytes" + "encoding/binary" + "errors" +) + +type fileFullEaInformation struct { + NextEntryOffset uint32 + Flags uint8 + NameLength uint8 + ValueLength uint16 +} + +var ( + fileFullEaInformationSize = binary.Size(&fileFullEaInformation{}) + + errInvalidEaBuffer = errors.New("invalid extended attribute buffer") + errEaNameTooLarge = errors.New("extended attribute name too large") + errEaValueTooLarge = errors.New("extended attribute value too large") +) + +// ExtendedAttribute represents a single Windows EA. +type ExtendedAttribute struct { + Name string + Value []byte + Flags uint8 +} + +func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { + var info fileFullEaInformation + err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) + if err != nil { + err = errInvalidEaBuffer + return + } + + nameOffset := fileFullEaInformationSize + nameLen := int(info.NameLength) + valueOffset := nameOffset + int(info.NameLength) + 1 + valueLen := int(info.ValueLength) + nextOffset := int(info.NextEntryOffset) + if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { + err = errInvalidEaBuffer + return + } + + ea.Name = string(b[nameOffset : nameOffset+nameLen]) + ea.Value = b[valueOffset : valueOffset+valueLen] + ea.Flags = info.Flags + if info.NextEntryOffset != 0 { + nb = b[info.NextEntryOffset:] + } + return +} + +// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION +// buffer retrieved from BackupRead, ZwQueryEaFile, etc. +func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { + for len(b) != 0 { + ea, nb, err := parseEa(b) + if err != nil { + return nil, err + } + + eas = append(eas, ea) + b = nb + } + return +} + +func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { + if int(uint8(len(ea.Name))) != len(ea.Name) { + return errEaNameTooLarge + } + if int(uint16(len(ea.Value))) != len(ea.Value) { + return errEaValueTooLarge + } + entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value)) + withPadding := (entrySize + 3) &^ 3 + nextOffset := uint32(0) + if !last { + nextOffset = withPadding + } + info := fileFullEaInformation{ + NextEntryOffset: nextOffset, + Flags: ea.Flags, + NameLength: uint8(len(ea.Name)), + ValueLength: uint16(len(ea.Value)), + } + + err := binary.Write(buf, binary.LittleEndian, &info) + if err != nil { + return err + } + + _, err = buf.Write([]byte(ea.Name)) + if err != nil { + return err + } + + err = buf.WriteByte(0) + if err != nil { + return err + } + + _, err = buf.Write(ea.Value) + if err != nil { + return err + } + + _, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize]) + if err != nil { + return err + } + + return nil +} + +// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION +// buffer for use with BackupWrite, ZwSetEaFile, etc. +func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) { + var buf bytes.Buffer + for i := range eas { + last := false + if i == len(eas)-1 { + last = true + } + + err := writeEa(&buf, &eas[i], last) + if err != nil { + return nil, err + } + } + return buf.Bytes(), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go new file mode 100644 index 000000000..57ac3696a --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -0,0 +1,310 @@ +// +build windows + +package winio + +import ( + "errors" + "io" + "runtime" + "sync" + "sync/atomic" + "syscall" + "time" +) + +//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx +//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort +//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus +//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes +//sys timeBeginPeriod(period uint32) (n int32) = winmm.timeBeginPeriod + +type atomicBool int32 + +func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 } +func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) } +func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) } +func (b *atomicBool) swap(new bool) bool { + var newInt int32 + if new { + newInt = 1 + } + return atomic.SwapInt32((*int32)(b), newInt) == 1 +} + +const ( + cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1 + cFILE_SKIP_SET_EVENT_ON_HANDLE = 2 +) + +var ( + ErrFileClosed = errors.New("file has already been closed") + ErrTimeout = &timeoutError{} +) + +type timeoutError struct{} + +func (e *timeoutError) Error() string { return "i/o timeout" } +func (e *timeoutError) Timeout() bool { return true } +func (e *timeoutError) Temporary() bool { return true } + +type timeoutChan chan struct{} + +var ioInitOnce sync.Once +var ioCompletionPort syscall.Handle + +// ioResult contains the result of an asynchronous IO operation +type ioResult struct { + bytes uint32 + err error +} + +// ioOperation represents an outstanding asynchronous Win32 IO +type ioOperation struct { + o syscall.Overlapped + ch chan ioResult +} + +func initIo() { + h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff) + if err != nil { + panic(err) + } + ioCompletionPort = h + go ioCompletionProcessor(h) +} + +// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall. +// It takes ownership of this handle and will close it if it is garbage collected. +type win32File struct { + handle syscall.Handle + wg sync.WaitGroup + wgLock sync.RWMutex + closing atomicBool + readDeadline deadlineHandler + writeDeadline deadlineHandler +} + +type deadlineHandler struct { + setLock sync.Mutex + channel timeoutChan + channelLock sync.RWMutex + timer *time.Timer + timedout atomicBool +} + +// makeWin32File makes a new win32File from an existing file handle +func makeWin32File(h syscall.Handle) (*win32File, error) { + f := &win32File{handle: h} + ioInitOnce.Do(initIo) + _, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff) + if err != nil { + return nil, err + } + err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE) + if err != nil { + return nil, err + } + f.readDeadline.channel = make(timeoutChan) + f.writeDeadline.channel = make(timeoutChan) + return f, nil +} + +func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { + return makeWin32File(h) +} + +// closeHandle closes the resources associated with a Win32 handle +func (f *win32File) closeHandle() { + f.wgLock.Lock() + // Atomically set that we are closing, releasing the resources only once. + if !f.closing.swap(true) { + f.wgLock.Unlock() + // cancel all IO and wait for it to complete + cancelIoEx(f.handle, nil) + f.wg.Wait() + // at this point, no new IO can start + syscall.Close(f.handle) + f.handle = 0 + } else { + f.wgLock.Unlock() + } +} + +// Close closes a win32File. +func (f *win32File) Close() error { + f.closeHandle() + return nil +} + +// prepareIo prepares for a new IO operation. +// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning. +func (f *win32File) prepareIo() (*ioOperation, error) { + f.wgLock.RLock() + if f.closing.isSet() { + f.wgLock.RUnlock() + return nil, ErrFileClosed + } + f.wg.Add(1) + f.wgLock.RUnlock() + c := &ioOperation{} + c.ch = make(chan ioResult) + return c, nil +} + +// ioCompletionProcessor processes completed async IOs forever +func ioCompletionProcessor(h syscall.Handle) { + // Set the timer resolution to 1. This fixes a performance regression in golang 1.6. + timeBeginPeriod(1) + for { + var bytes uint32 + var key uintptr + var op *ioOperation + err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE) + if op == nil { + panic(err) + } + op.ch <- ioResult{bytes, err} + } +} + +// asyncIo processes the return value from ReadFile or WriteFile, blocking until +// the operation has actually completed. +func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) { + if err != syscall.ERROR_IO_PENDING { + return int(bytes), err + } + + if f.closing.isSet() { + cancelIoEx(f.handle, &c.o) + } + + var timeout timeoutChan + if d != nil { + d.channelLock.Lock() + timeout = d.channel + d.channelLock.Unlock() + } + + var r ioResult + select { + case r = <-c.ch: + err = r.err + if err == syscall.ERROR_OPERATION_ABORTED { + if f.closing.isSet() { + err = ErrFileClosed + } + } + case <-timeout: + cancelIoEx(f.handle, &c.o) + r = <-c.ch + err = r.err + if err == syscall.ERROR_OPERATION_ABORTED { + err = ErrTimeout + } + } + + // runtime.KeepAlive is needed, as c is passed via native + // code to ioCompletionProcessor, c must remain alive + // until the channel read is complete. + runtime.KeepAlive(c) + return int(r.bytes), err +} + +// Read reads from a file handle. +func (f *win32File) Read(b []byte) (int, error) { + c, err := f.prepareIo() + if err != nil { + return 0, err + } + defer f.wg.Done() + + if f.readDeadline.timedout.isSet() { + return 0, ErrTimeout + } + + var bytes uint32 + err = syscall.ReadFile(f.handle, b, &bytes, &c.o) + n, err := f.asyncIo(c, &f.readDeadline, bytes, err) + runtime.KeepAlive(b) + + // Handle EOF conditions. + if err == nil && n == 0 && len(b) != 0 { + return 0, io.EOF + } else if err == syscall.ERROR_BROKEN_PIPE { + return 0, io.EOF + } else { + return n, err + } +} + +// Write writes to a file handle. +func (f *win32File) Write(b []byte) (int, error) { + c, err := f.prepareIo() + if err != nil { + return 0, err + } + defer f.wg.Done() + + if f.writeDeadline.timedout.isSet() { + return 0, ErrTimeout + } + + var bytes uint32 + err = syscall.WriteFile(f.handle, b, &bytes, &c.o) + n, err := f.asyncIo(c, &f.writeDeadline, bytes, err) + runtime.KeepAlive(b) + return n, err +} + +func (f *win32File) SetReadDeadline(deadline time.Time) error { + return f.readDeadline.set(deadline) +} + +func (f *win32File) SetWriteDeadline(deadline time.Time) error { + return f.writeDeadline.set(deadline) +} + +func (f *win32File) Flush() error { + return syscall.FlushFileBuffers(f.handle) +} + +func (d *deadlineHandler) set(deadline time.Time) error { + d.setLock.Lock() + defer d.setLock.Unlock() + + if d.timer != nil { + if !d.timer.Stop() { + <-d.channel + } + d.timer = nil + } + d.timedout.setFalse() + + select { + case <-d.channel: + d.channelLock.Lock() + d.channel = make(chan struct{}) + d.channelLock.Unlock() + default: + } + + if deadline.IsZero() { + return nil + } + + timeoutIO := func() { + d.timedout.setTrue() + close(d.channel) + } + + now := time.Now() + duration := deadline.Sub(now) + if deadline.After(now) { + // Deadline is in the future, set a timer to wait + d.timer = time.AfterFunc(duration, timeoutIO) + } else { + // Deadline is in the past. Cancel all pending IO now. + timeoutIO() + } + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go new file mode 100644 index 000000000..b1d60abb8 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go @@ -0,0 +1,60 @@ +// +build windows + +package winio + +import ( + "os" + "runtime" + "syscall" + "unsafe" +) + +//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx +//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle + +const ( + fileBasicInfo = 0 + fileIDInfo = 0x12 +) + +// FileBasicInfo contains file access time and file attributes information. +type FileBasicInfo struct { + CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime + FileAttributes uintptr // includes padding +} + +// GetFileBasicInfo retrieves times and attributes for a file. +func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { + bi := &FileBasicInfo{} + if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return bi, nil +} + +// SetFileBasicInfo sets times and attributes for a file. +func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error { + if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return nil +} + +// FileIDInfo contains the volume serial number and file ID for a file. This pair should be +// unique on a system. +type FileIDInfo struct { + VolumeSerialNumber uint64 + FileID [16]byte +} + +// GetFileID retrieves the unique (volume, file ID) pair for a file. +func GetFileID(f *os.File) (*FileIDInfo, error) { + fileID := &FileIDInfo{} + if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil { + return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return fileID, nil +} diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go new file mode 100644 index 000000000..44340b816 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -0,0 +1,404 @@ +// +build windows + +package winio + +import ( + "errors" + "io" + "net" + "os" + "syscall" + "time" + "unsafe" +) + +//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe +//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW +//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW +//sys waitNamedPipe(name string, timeout uint32) (err error) = WaitNamedPipeW +//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo +//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW +//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc + +const ( + cERROR_PIPE_BUSY = syscall.Errno(231) + cERROR_PIPE_CONNECTED = syscall.Errno(535) + cERROR_SEM_TIMEOUT = syscall.Errno(121) + + cPIPE_ACCESS_DUPLEX = 0x3 + cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000 + cSECURITY_SQOS_PRESENT = 0x100000 + cSECURITY_ANONYMOUS = 0 + + cPIPE_REJECT_REMOTE_CLIENTS = 0x8 + + cPIPE_UNLIMITED_INSTANCES = 255 + + cNMPWAIT_USE_DEFAULT_WAIT = 0 + cNMPWAIT_NOWAIT = 1 + + cPIPE_TYPE_MESSAGE = 4 + + cPIPE_READMODE_MESSAGE = 2 +) + +var ( + // ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed. + // This error should match net.errClosing since docker takes a dependency on its text. + ErrPipeListenerClosed = errors.New("use of closed network connection") + + errPipeWriteClosed = errors.New("pipe has been closed for write") +) + +type win32Pipe struct { + *win32File + path string +} + +type win32MessageBytePipe struct { + win32Pipe + writeClosed bool + readEOF bool +} + +type pipeAddress string + +func (f *win32Pipe) LocalAddr() net.Addr { + return pipeAddress(f.path) +} + +func (f *win32Pipe) RemoteAddr() net.Addr { + return pipeAddress(f.path) +} + +func (f *win32Pipe) SetDeadline(t time.Time) error { + f.SetReadDeadline(t) + f.SetWriteDeadline(t) + return nil +} + +// CloseWrite closes the write side of a message pipe in byte mode. +func (f *win32MessageBytePipe) CloseWrite() error { + if f.writeClosed { + return errPipeWriteClosed + } + err := f.win32File.Flush() + if err != nil { + return err + } + _, err = f.win32File.Write(nil) + if err != nil { + return err + } + f.writeClosed = true + return nil +} + +// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since +// they are used to implement CloseWrite(). +func (f *win32MessageBytePipe) Write(b []byte) (int, error) { + if f.writeClosed { + return 0, errPipeWriteClosed + } + if len(b) == 0 { + return 0, nil + } + return f.win32File.Write(b) +} + +// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message +// mode pipe will return io.EOF, as will all subsequent reads. +func (f *win32MessageBytePipe) Read(b []byte) (int, error) { + if f.readEOF { + return 0, io.EOF + } + n, err := f.win32File.Read(b) + if err == io.EOF { + // If this was the result of a zero-byte read, then + // it is possible that the read was due to a zero-size + // message. Since we are simulating CloseWrite with a + // zero-byte message, ensure that all future Read() calls + // also return EOF. + f.readEOF = true + } + return n, err +} + +func (s pipeAddress) Network() string { + return "pipe" +} + +func (s pipeAddress) String() string { + return string(s) +} + +// DialPipe connects to a named pipe by path, timing out if the connection +// takes longer than the specified duration. If timeout is nil, then the timeout +// is the default timeout established by the pipe server. +func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { + var absTimeout time.Time + if timeout != nil { + absTimeout = time.Now().Add(*timeout) + } + var err error + var h syscall.Handle + for { + h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + if err != cERROR_PIPE_BUSY { + break + } + now := time.Now() + var ms uint32 + if absTimeout.IsZero() { + ms = cNMPWAIT_USE_DEFAULT_WAIT + } else if now.After(absTimeout) { + ms = cNMPWAIT_NOWAIT + } else { + ms = uint32(absTimeout.Sub(now).Nanoseconds() / 1000 / 1000) + } + err = waitNamedPipe(path, ms) + if err != nil { + if err == cERROR_SEM_TIMEOUT { + return nil, ErrTimeout + } + break + } + } + if err != nil { + return nil, &os.PathError{Op: "open", Path: path, Err: err} + } + + var flags uint32 + err = getNamedPipeInfo(h, &flags, nil, nil, nil) + if err != nil { + return nil, err + } + + var state uint32 + err = getNamedPipeHandleState(h, &state, nil, nil, nil, nil, 0) + if err != nil { + return nil, err + } + + if state&cPIPE_READMODE_MESSAGE != 0 { + return nil, &os.PathError{Op: "open", Path: path, Err: errors.New("message readmode pipes not supported")} + } + + f, err := makeWin32File(h) + if err != nil { + syscall.Close(h) + return nil, err + } + + // If the pipe is in message mode, return a message byte pipe, which + // supports CloseWrite(). + if flags&cPIPE_TYPE_MESSAGE != 0 { + return &win32MessageBytePipe{ + win32Pipe: win32Pipe{win32File: f, path: path}, + }, nil + } + return &win32Pipe{win32File: f, path: path}, nil +} + +type acceptResponse struct { + f *win32File + err error +} + +type win32PipeListener struct { + firstHandle syscall.Handle + path string + securityDescriptor []byte + config PipeConfig + acceptCh chan (chan acceptResponse) + closeCh chan int + doneCh chan int +} + +func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) { + var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED + if first { + flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE + } + + var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS + if c.MessageMode { + mode |= cPIPE_TYPE_MESSAGE + } + + sa := &syscall.SecurityAttributes{} + sa.Length = uint32(unsafe.Sizeof(*sa)) + if securityDescriptor != nil { + len := uint32(len(securityDescriptor)) + sa.SecurityDescriptor = localAlloc(0, len) + defer localFree(sa.SecurityDescriptor) + copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor) + } + h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa) + if err != nil { + return 0, &os.PathError{Op: "open", Path: path, Err: err} + } + return h, nil +} + +func (l *win32PipeListener) makeServerPipe() (*win32File, error) { + h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false) + if err != nil { + return nil, err + } + f, err := makeWin32File(h) + if err != nil { + syscall.Close(h) + return nil, err + } + return f, nil +} + +func (l *win32PipeListener) listenerRoutine() { + closed := false + for !closed { + select { + case <-l.closeCh: + closed = true + case responseCh := <-l.acceptCh: + p, err := l.makeServerPipe() + if err == nil { + // Wait for the client to connect. + ch := make(chan error) + go func(p *win32File) { + ch <- connectPipe(p) + }(p) + select { + case err = <-ch: + if err != nil { + p.Close() + p = nil + } + case <-l.closeCh: + // Abort the connect request by closing the handle. + p.Close() + p = nil + err = <-ch + if err == nil || err == ErrFileClosed { + err = ErrPipeListenerClosed + } + closed = true + } + } + responseCh <- acceptResponse{p, err} + } + } + syscall.Close(l.firstHandle) + l.firstHandle = 0 + // Notify Close() and Accept() callers that the handle has been closed. + close(l.doneCh) +} + +// PipeConfig contain configuration for the pipe listener. +type PipeConfig struct { + // SecurityDescriptor contains a Windows security descriptor in SDDL format. + SecurityDescriptor string + + // MessageMode determines whether the pipe is in byte or message mode. In either + // case the pipe is read in byte mode by default. The only practical difference in + // this implementation is that CloseWrite() is only supported for message mode pipes; + // CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only + // transferred to the reader (and returned as io.EOF in this implementation) + // when the pipe is in message mode. + MessageMode bool + + // InputBufferSize specifies the size the input buffer, in bytes. + InputBufferSize int32 + + // OutputBufferSize specifies the size the input buffer, in bytes. + OutputBufferSize int32 +} + +// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe. +// The pipe must not already exist. +func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { + var ( + sd []byte + err error + ) + if c == nil { + c = &PipeConfig{} + } + if c.SecurityDescriptor != "" { + sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor) + if err != nil { + return nil, err + } + } + h, err := makeServerPipeHandle(path, sd, c, true) + if err != nil { + return nil, err + } + // Immediately open and then close a client handle so that the named pipe is + // created but not currently accepting connections. + h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + if err != nil { + syscall.Close(h) + return nil, err + } + syscall.Close(h2) + l := &win32PipeListener{ + firstHandle: h, + path: path, + securityDescriptor: sd, + config: *c, + acceptCh: make(chan (chan acceptResponse)), + closeCh: make(chan int), + doneCh: make(chan int), + } + go l.listenerRoutine() + return l, nil +} + +func connectPipe(p *win32File) error { + c, err := p.prepareIo() + if err != nil { + return err + } + defer p.wg.Done() + + err = connectNamedPipe(p.handle, &c.o) + _, err = p.asyncIo(c, nil, 0, err) + if err != nil && err != cERROR_PIPE_CONNECTED { + return err + } + return nil +} + +func (l *win32PipeListener) Accept() (net.Conn, error) { + ch := make(chan acceptResponse) + select { + case l.acceptCh <- ch: + response := <-ch + err := response.err + if err != nil { + return nil, err + } + if l.config.MessageMode { + return &win32MessageBytePipe{ + win32Pipe: win32Pipe{win32File: response.f, path: l.path}, + }, nil + } + return &win32Pipe{win32File: response.f, path: l.path}, nil + case <-l.doneCh: + return nil, ErrPipeListenerClosed + } +} + +func (l *win32PipeListener) Close() error { + select { + case l.closeCh <- 1: + <-l.doneCh + case <-l.doneCh: + } + return nil +} + +func (l *win32PipeListener) Addr() net.Addr { + return pipeAddress(l.path) +} diff --git a/vendor/github.com/Microsoft/go-winio/privilege.go b/vendor/github.com/Microsoft/go-winio/privilege.go new file mode 100644 index 000000000..9c83d36fe --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/privilege.go @@ -0,0 +1,202 @@ +// +build windows + +package winio + +import ( + "bytes" + "encoding/binary" + "fmt" + "runtime" + "sync" + "syscall" + "unicode/utf16" + + "golang.org/x/sys/windows" +) + +//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges +//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf +//sys revertToSelf() (err error) = advapi32.RevertToSelf +//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken +//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread +//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW +//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW +//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW + +const ( + SE_PRIVILEGE_ENABLED = 2 + + ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300 + + SeBackupPrivilege = "SeBackupPrivilege" + SeRestorePrivilege = "SeRestorePrivilege" +) + +const ( + securityAnonymous = iota + securityIdentification + securityImpersonation + securityDelegation +) + +var ( + privNames = make(map[string]uint64) + privNameMutex sync.Mutex +) + +// PrivilegeError represents an error enabling privileges. +type PrivilegeError struct { + privileges []uint64 +} + +func (e *PrivilegeError) Error() string { + s := "" + if len(e.privileges) > 1 { + s = "Could not enable privileges " + } else { + s = "Could not enable privilege " + } + for i, p := range e.privileges { + if i != 0 { + s += ", " + } + s += `"` + s += getPrivilegeName(p) + s += `"` + } + return s +} + +// RunWithPrivilege enables a single privilege for a function call. +func RunWithPrivilege(name string, fn func() error) error { + return RunWithPrivileges([]string{name}, fn) +} + +// RunWithPrivileges enables privileges for a function call. +func RunWithPrivileges(names []string, fn func() error) error { + privileges, err := mapPrivileges(names) + if err != nil { + return err + } + runtime.LockOSThread() + defer runtime.UnlockOSThread() + token, err := newThreadToken() + if err != nil { + return err + } + defer releaseThreadToken(token) + err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED) + if err != nil { + return err + } + return fn() +} + +func mapPrivileges(names []string) ([]uint64, error) { + var privileges []uint64 + privNameMutex.Lock() + defer privNameMutex.Unlock() + for _, name := range names { + p, ok := privNames[name] + if !ok { + err := lookupPrivilegeValue("", name, &p) + if err != nil { + return nil, err + } + privNames[name] = p + } + privileges = append(privileges, p) + } + return privileges, nil +} + +// EnableProcessPrivileges enables privileges globally for the process. +func EnableProcessPrivileges(names []string) error { + return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED) +} + +// DisableProcessPrivileges disables privileges globally for the process. +func DisableProcessPrivileges(names []string) error { + return enableDisableProcessPrivilege(names, 0) +} + +func enableDisableProcessPrivilege(names []string, action uint32) error { + privileges, err := mapPrivileges(names) + if err != nil { + return err + } + + p, _ := windows.GetCurrentProcess() + var token windows.Token + err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token) + if err != nil { + return err + } + + defer token.Close() + return adjustPrivileges(token, privileges, action) +} + +func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error { + var b bytes.Buffer + binary.Write(&b, binary.LittleEndian, uint32(len(privileges))) + for _, p := range privileges { + binary.Write(&b, binary.LittleEndian, p) + binary.Write(&b, binary.LittleEndian, action) + } + prevState := make([]byte, b.Len()) + reqSize := uint32(0) + success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize) + if !success { + return err + } + if err == ERROR_NOT_ALL_ASSIGNED { + return &PrivilegeError{privileges} + } + return nil +} + +func getPrivilegeName(luid uint64) string { + var nameBuffer [256]uint16 + bufSize := uint32(len(nameBuffer)) + err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize) + if err != nil { + return fmt.Sprintf("", luid) + } + + var displayNameBuffer [256]uint16 + displayBufSize := uint32(len(displayNameBuffer)) + var langID uint32 + err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID) + if err != nil { + return fmt.Sprintf("", string(utf16.Decode(nameBuffer[:bufSize]))) + } + + return string(utf16.Decode(displayNameBuffer[:displayBufSize])) +} + +func newThreadToken() (windows.Token, error) { + err := impersonateSelf(securityImpersonation) + if err != nil { + return 0, err + } + + var token windows.Token + err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token) + if err != nil { + rerr := revertToSelf() + if rerr != nil { + panic(rerr) + } + return 0, err + } + return token, nil +} + +func releaseThreadToken(h windows.Token) { + err := revertToSelf() + if err != nil { + panic(err) + } + h.Close() +} diff --git a/vendor/github.com/Microsoft/go-winio/reparse.go b/vendor/github.com/Microsoft/go-winio/reparse.go new file mode 100644 index 000000000..fc1ee4d3a --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/reparse.go @@ -0,0 +1,128 @@ +package winio + +import ( + "bytes" + "encoding/binary" + "fmt" + "strings" + "unicode/utf16" + "unsafe" +) + +const ( + reparseTagMountPoint = 0xA0000003 + reparseTagSymlink = 0xA000000C +) + +type reparseDataBuffer struct { + ReparseTag uint32 + ReparseDataLength uint16 + Reserved uint16 + SubstituteNameOffset uint16 + SubstituteNameLength uint16 + PrintNameOffset uint16 + PrintNameLength uint16 +} + +// ReparsePoint describes a Win32 symlink or mount point. +type ReparsePoint struct { + Target string + IsMountPoint bool +} + +// UnsupportedReparsePointError is returned when trying to decode a non-symlink or +// mount point reparse point. +type UnsupportedReparsePointError struct { + Tag uint32 +} + +func (e *UnsupportedReparsePointError) Error() string { + return fmt.Sprintf("unsupported reparse point %x", e.Tag) +} + +// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink +// or a mount point. +func DecodeReparsePoint(b []byte) (*ReparsePoint, error) { + tag := binary.LittleEndian.Uint32(b[0:4]) + return DecodeReparsePointData(tag, b[8:]) +} + +func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) { + isMountPoint := false + switch tag { + case reparseTagMountPoint: + isMountPoint = true + case reparseTagSymlink: + default: + return nil, &UnsupportedReparsePointError{tag} + } + nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6]) + if !isMountPoint { + nameOffset += 4 + } + nameLength := binary.LittleEndian.Uint16(b[6:8]) + name := make([]uint16, nameLength/2) + err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name) + if err != nil { + return nil, err + } + return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil +} + +func isDriveLetter(c byte) bool { + return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z') +} + +// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or +// mount point. +func EncodeReparsePoint(rp *ReparsePoint) []byte { + // Generate an NT path and determine if this is a relative path. + var ntTarget string + relative := false + if strings.HasPrefix(rp.Target, `\\?\`) { + ntTarget = `\??\` + rp.Target[4:] + } else if strings.HasPrefix(rp.Target, `\\`) { + ntTarget = `\??\UNC\` + rp.Target[2:] + } else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' { + ntTarget = `\??\` + rp.Target + } else { + ntTarget = rp.Target + relative = true + } + + // The paths must be NUL-terminated even though they are counted strings. + target16 := utf16.Encode([]rune(rp.Target + "\x00")) + ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00")) + + size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8 + size += len(ntTarget16)*2 + len(target16)*2 + + tag := uint32(reparseTagMountPoint) + if !rp.IsMountPoint { + tag = reparseTagSymlink + size += 4 // Add room for symlink flags + } + + data := reparseDataBuffer{ + ReparseTag: tag, + ReparseDataLength: uint16(size), + SubstituteNameOffset: 0, + SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2), + PrintNameOffset: uint16(len(ntTarget16) * 2), + PrintNameLength: uint16((len(target16) - 1) * 2), + } + + var b bytes.Buffer + binary.Write(&b, binary.LittleEndian, &data) + if !rp.IsMountPoint { + flags := uint32(0) + if relative { + flags |= 1 + } + binary.Write(&b, binary.LittleEndian, flags) + } + + binary.Write(&b, binary.LittleEndian, ntTarget16) + binary.Write(&b, binary.LittleEndian, target16) + return b.Bytes() +} diff --git a/vendor/github.com/Microsoft/go-winio/sd.go b/vendor/github.com/Microsoft/go-winio/sd.go new file mode 100644 index 000000000..db1b370a1 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/sd.go @@ -0,0 +1,98 @@ +// +build windows + +package winio + +import ( + "syscall" + "unsafe" +) + +//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW +//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW +//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW +//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW +//sys localFree(mem uintptr) = LocalFree +//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength + +const ( + cERROR_NONE_MAPPED = syscall.Errno(1332) +) + +type AccountLookupError struct { + Name string + Err error +} + +func (e *AccountLookupError) Error() string { + if e.Name == "" { + return "lookup account: empty account name specified" + } + var s string + switch e.Err { + case cERROR_NONE_MAPPED: + s = "not found" + default: + s = e.Err.Error() + } + return "lookup account " + e.Name + ": " + s +} + +type SddlConversionError struct { + Sddl string + Err error +} + +func (e *SddlConversionError) Error() string { + return "convert " + e.Sddl + ": " + e.Err.Error() +} + +// LookupSidByName looks up the SID of an account by name +func LookupSidByName(name string) (sid string, err error) { + if name == "" { + return "", &AccountLookupError{name, cERROR_NONE_MAPPED} + } + + var sidSize, sidNameUse, refDomainSize uint32 + err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse) + if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER { + return "", &AccountLookupError{name, err} + } + sidBuffer := make([]byte, sidSize) + refDomainBuffer := make([]uint16, refDomainSize) + err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse) + if err != nil { + return "", &AccountLookupError{name, err} + } + var strBuffer *uint16 + err = convertSidToStringSid(&sidBuffer[0], &strBuffer) + if err != nil { + return "", &AccountLookupError{name, err} + } + sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:]) + localFree(uintptr(unsafe.Pointer(strBuffer))) + return sid, nil +} + +func SddlToSecurityDescriptor(sddl string) ([]byte, error) { + var sdBuffer uintptr + err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil) + if err != nil { + return nil, &SddlConversionError{sddl, err} + } + defer localFree(sdBuffer) + sd := make([]byte, getSecurityDescriptorLength(sdBuffer)) + copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)]) + return sd, nil +} + +func SecurityDescriptorToSddl(sd []byte) (string, error) { + var sddl *uint16 + // The returned string length seems to including an aribtrary number of terminating NULs. + // Don't use it. + err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil) + if err != nil { + return "", err + } + defer localFree(uintptr(unsafe.Pointer(sddl))) + return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/syscall.go b/vendor/github.com/Microsoft/go-winio/syscall.go new file mode 100644 index 000000000..20d64cf41 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/syscall.go @@ -0,0 +1,3 @@ +package winio + +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go new file mode 100644 index 000000000..4f7a52eeb --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go @@ -0,0 +1,528 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package winio + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modwinmm = windows.NewLazySystemDLL("winmm.dll") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + + procCancelIoEx = modkernel32.NewProc("CancelIoEx") + procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort") + procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") + procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes") + proctimeBeginPeriod = modwinmm.NewProc("timeBeginPeriod") + procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe") + procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW") + procCreateFileW = modkernel32.NewProc("CreateFileW") + procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW") + procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo") + procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") + procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW") + procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW") + procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW") + procLocalFree = modkernel32.NewProc("LocalFree") + procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength") + procGetFileInformationByHandleEx = modkernel32.NewProc("GetFileInformationByHandleEx") + procSetFileInformationByHandle = modkernel32.NewProc("SetFileInformationByHandle") + procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges") + procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf") + procRevertToSelf = modadvapi32.NewProc("RevertToSelf") + procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken") + procGetCurrentThread = modkernel32.NewProc("GetCurrentThread") + procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW") + procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW") + procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW") + procBackupRead = modkernel32.NewProc("BackupRead") + procBackupWrite = modkernel32.NewProc("BackupWrite") +) + +func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0) + newport = syscall.Handle(r0) + if newport == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) { + r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func timeBeginPeriod(period uint32) (n int32) { + r0, _, _ := syscall.Syscall(proctimeBeginPeriod.Addr(), 1, uintptr(period), 0, 0) + n = int32(r0) + return +} + +func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa) +} + +func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile) +} + +func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func waitNamedPipe(name string, timeout uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _waitNamedPipe(_p0, timeout) +} + +func _waitNamedPipe(name *uint16, timeout uint32) (err error) { + r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func localAlloc(uFlags uint32, length uint32) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0) + ptr = uintptr(r0) + return +} + +func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(accountName) + if err != nil { + return + } + return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse) +} + +func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func convertSidToStringSid(sid *byte, str **uint16) (err error) { + r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(str) + if err != nil { + return + } + return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size) +} + +func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func localFree(mem uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0) + return +} + +func getSecurityDescriptorLength(sd uintptr) (len uint32) { + r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0) + len = uint32(r0) + return +} + +func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) { + var _p0 uint32 + if releaseAll { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize))) + success = r0 != 0 + if true { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func impersonateSelf(level uint32) (err error) { + r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func revertToSelf() (err error) { + r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) { + var _p0 uint32 + if openAsSelf { + _p0 = 1 + } else { + _p0 = 0 + } + r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getCurrentThread() (h syscall.Handle) { + r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0) + h = syscall.Handle(r0) + return +} + +func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + var _p1 *uint16 + _p1, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _lookupPrivilegeValue(_p0, _p1, luid) +} + +func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) { + r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + return _lookupPrivilegeName(_p0, luid, buffer, size) +} + +func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId) +} + +func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) { + var _p0 *byte + if len(b) > 0 { + _p0 = &b[0] + } + var _p1 uint32 + if abort { + _p1 = 1 + } else { + _p1 = 0 + } + var _p2 uint32 + if processSecurity { + _p2 = 1 + } else { + _p2 = 0 + } + r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) { + var _p0 *byte + if len(b) > 0 { + _p0 = &b[0] + } + var _p1 uint32 + if abort { + _p1 = 1 + } else { + _p1 = 0 + } + var _p2 uint32 + if processSecurity { + _p2 = 1 + } else { + _p2 = 0 + } + r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/LICENSE b/vendor/github.com/Microsoft/hcsshim/LICENSE new file mode 100644 index 000000000..49d21669a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md new file mode 100644 index 000000000..30991a12e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -0,0 +1,12 @@ +# hcsshim + +This package supports launching Windows Server containers from Go. It is +primarily used in the [Docker Engine](https://github.com/docker/docker) project, +but it can be freely used by other projects as well. + +This project has adopted the [Microsoft Open Source Code of +Conduct](https://opensource.microsoft.com/codeofconduct/). For more information +see the [Code of Conduct +FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact +[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional +questions or comments. diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go new file mode 100644 index 000000000..6d824d7a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/activatelayer.go @@ -0,0 +1,28 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(info DriverInfo, id string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = activateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/baselayer.go new file mode 100644 index 000000000..9babd4e18 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/baselayer.go @@ -0,0 +1,183 @@ +package hcsshim + +import ( + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio" +) + +type baseLayerWriter struct { + root string + f *os.File + bw *winio.BackupFileWriter + err error + hasUtilityVM bool + dirInfo []dirInfo +} + +type dirInfo struct { + path string + fileInfo winio.FileBasicInfo +} + +// reapplyDirectoryTimes reapplies directory modification, creation, etc. times +// after processing of the directory tree has completed. The times are expected +// to be ordered such that parent directories come before child directories. +func reapplyDirectoryTimes(dis []dirInfo) error { + for i := range dis { + di := &dis[len(dis)-i-1] // reverse order: process child directories first + f, err := winio.OpenForBackup(di.path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING) + if err != nil { + return err + } + + err = winio.SetFileBasicInfo(f, &di.fileInfo) + f.Close() + if err != nil { + return err + } + } + return nil +} + +func (w *baseLayerWriter) closeCurrentFile() error { + if w.f != nil { + err := w.bw.Close() + err2 := w.f.Close() + w.f = nil + w.bw = nil + if err != nil { + return err + } + if err2 != nil { + return err2 + } + } + return nil +} + +func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + if filepath.ToSlash(name) == `UtilityVM/Files` { + w.hasUtilityVM = true + } + + path := filepath.Join(w.root, name) + path, err = makeLongAbsPath(path) + if err != nil { + return err + } + + var f *os.File + defer func() { + if f != nil { + f.Close() + } + }() + + createmode := uint32(syscall.CREATE_NEW) + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { + err := os.Mkdir(path, 0) + if err != nil && !os.IsExist(err) { + return err + } + createmode = syscall.OPEN_EXISTING + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo}) + } + } + + mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) + f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode) + if err != nil { + return makeError(err, "Failed to OpenForBackup", path) + } + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return makeError(err, "Failed to SetFileBasicInfo", path) + } + + w.f = f + w.bw = winio.NewBackupFileWriter(f, true) + f = nil + return nil +} + +func (w *baseLayerWriter) AddLink(name string, target string) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + linkpath, err := makeLongAbsPath(filepath.Join(w.root, name)) + if err != nil { + return err + } + + linktarget, err := makeLongAbsPath(filepath.Join(w.root, target)) + if err != nil { + return err + } + + return os.Link(linktarget, linkpath) +} + +func (w *baseLayerWriter) Remove(name string) error { + return errors.New("base layer cannot have tombstones") +} + +func (w *baseLayerWriter) Write(b []byte) (int, error) { + n, err := w.bw.Write(b) + if err != nil { + w.err = err + } + return n, err +} + +func (w *baseLayerWriter) Close() error { + err := w.closeCurrentFile() + if err != nil { + return err + } + if w.err == nil { + // Restore the file times of all the directories, since they may have + // been modified by creating child directories. + err = reapplyDirectoryTimes(w.dirInfo) + if err != nil { + return err + } + + err = ProcessBaseLayer(w.root) + if err != nil { + return err + } + + if w.hasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM")) + if err != nil { + return err + } + } + } + return w.err +} diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/callback.go new file mode 100644 index 000000000..e8c2b00c8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/callback.go @@ -0,0 +1,79 @@ +package hcsshim + +import ( + "sync" + "syscall" +) + +var ( + nextCallback uintptr + callbackMap = map[uintptr]*notifcationWatcherContext{} + callbackMapLock = sync.RWMutex{} + + notificationWatcherCallback = syscall.NewCallback(notificationWatcher) + + // Notifications for HCS_SYSTEM handles + hcsNotificationSystemExited hcsNotification = 0x00000001 + hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 + hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 + hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 + hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 + + // Notifications for HCS_PROCESS handles + hcsNotificationProcessExited hcsNotification = 0x00010000 + + // Common notifications + hcsNotificationInvalid hcsNotification = 0x00000000 + hcsNotificationServiceDisconnect hcsNotification = 0x01000000 +) + +type hcsNotification uint32 +type notificationChannel chan error + +type notifcationWatcherContext struct { + channels notificationChannels + handle hcsCallback +} + +type notificationChannels map[hcsNotification]notificationChannel + +func newChannels() notificationChannels { + channels := make(notificationChannels) + + channels[hcsNotificationSystemExited] = make(notificationChannel, 1) + channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) + channels[hcsNotificationProcessExited] = make(notificationChannel, 1) + channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) + return channels +} +func closeChannels(channels notificationChannels) { + close(channels[hcsNotificationSystemExited]) + close(channels[hcsNotificationSystemCreateCompleted]) + close(channels[hcsNotificationSystemStartCompleted]) + close(channels[hcsNotificationSystemPauseCompleted]) + close(channels[hcsNotificationSystemResumeCompleted]) + close(channels[hcsNotificationProcessExited]) + close(channels[hcsNotificationServiceDisconnect]) +} + +func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { + var result error + if int32(notificationStatus) < 0 { + result = syscall.Errno(win32FromHresult(notificationStatus)) + } + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return 0 + } + + context.channels[notificationType] <- result + + return 0 +} diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/cgo.go new file mode 100644 index 000000000..200333233 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cgo.go @@ -0,0 +1,7 @@ +package hcsshim + +import "C" + +// This import is needed to make the library compile as CGO because HCSSHIM +// only works with CGO due to callbacks from HCS comming back from a C thread +// which is not supported without CGO. See https://github.com/golang/go/issues/10973 diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go new file mode 100644 index 000000000..b924d39f4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -0,0 +1,794 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "os" + "sync" + "syscall" + "time" + + "github.com/sirupsen/logrus" +) + +var ( + defaultTimeout = time.Minute * 4 +) + +const ( + pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}` + statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}` + processListQuery = `{ "PropertyTypes" : ["ProcessList"]}` + mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}` +) + +type container struct { + handleLock sync.RWMutex + handle hcsSystem + id string + callbackNumber uintptr +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} + +// createContainerAdditionalJSON is read from the environment at initialisation +// time. It allows an environment variable to define additional JSON which +// is merged in the CreateContainer call to HCS. +var createContainerAdditionalJSON string + +func init() { + createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON") +} + +// CreateContainer creates a new container with the given configuration but does not start it. +func CreateContainer(id string, c *ContainerConfig) (Container, error) { + return createContainerWithJSON(id, c, "") +} + +// CreateContainerWithJSON creates a new container with the given configuration but does not start it. +// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS. +func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { + return createContainerWithJSON(id, c, additionalJSON) +} + +func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { + operation := "CreateContainer" + title := "HCSShim::" + operation + + container := &container{ + id: id, + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, err + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", id, configuration) + + // Merge any additional JSON. Priority is given to what is passed in explicitly, + // falling back to what's set in the environment. + if additionalJSON == "" && createContainerAdditionalJSON != "" { + additionalJSON = createContainerAdditionalJSON + } + if additionalJSON != "" { + configurationMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil { + return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err) + } + + additionalMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil { + return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err) + } + + mergedMap := mergeMaps(additionalMap, configurationMap) + mergedJSON, err := json.Marshal(mergedMap) + if err != nil { + return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err) + } + + configuration = string(mergedJSON) + logrus.Debugf(title+" id=%s merged config=%s", id, configuration) + } + + var ( + resultp *uint16 + identity syscall.Handle + ) + createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp) + + if createError == nil || IsPending(createError) { + if err := container.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + } + + err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle) + return container, nil +} + +// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func mergeMaps(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// OpenContainer opens an existing container by ID. +func OpenContainer(id string) (Container, error) { + operation := "OpenContainer" + title := "HCSShim::" + operation + logrus.Debugf(title+" id=%s", id) + + container := &container{ + id: id, + } + + var ( + handle hcsSystem + resultp *uint16 + ) + err := hcsOpenComputeSystem(id, &handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + container.handle = handle + + if err := container.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) + return container, nil +} + +// GetContainers gets a list of the containers on the system that match the query +func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { + operation := "GetContainers" + title := "HCSShim::" + operation + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + query := string(queryb) + logrus.Debugf(title+" query=%s", query) + + var ( + resultp *uint16 + computeSystemsp *uint16 + ) + err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if computeSystemsp == nil { + return nil, ErrUnexpectedValue + } + computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp) + computeSystems := []ContainerProperties{} + if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + return nil, err + } + + logrus.Debugf(title + " succeeded") + return computeSystems, nil +} + +// Start synchronously starts the container. +func (container *container) Start() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Start" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsStartComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Shutdown requests a container shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Shutdown() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Shutdown" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsShutdownComputeSystem(container.handle, "", &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Terminate requests a container terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Terminate() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Terminate" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsTerminateComputeSystem(container.handle, "", &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Wait synchronously waits for the container to shutdown or terminate. +func (container *container) Wait() error { + operation := "Wait" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (container *container) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) properties(query string) (*ContainerProperties, error) { + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + properties := &ContainerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + return properties, nil +} + +// HasPendingUpdates returns true if the container has updates pending to install +func (container *container) HasPendingUpdates() (bool, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "HasPendingUpdates" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return false, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(pendingUpdatesQuery) + if err != nil { + return false, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.AreUpdatesPending, nil +} + +// Statistics returns statistics for the container +func (container *container) Statistics() (Statistics, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Statistics" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(statisticsQuery) + if err != nil { + return Statistics{}, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.Statistics, nil +} + +// ProcessList returns an array of ProcessListItems for the container +func (container *container) ProcessList() ([]ProcessListItem, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "ProcessList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(processListQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.ProcessList, nil +} + +// MappedVirtualDisks returns a map of the controllers and the disks mapped +// to a container. +// +// Example of JSON returned by the query. +//{ +// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm", +// "SystemType":"Container", +// "RuntimeOsType":"Linux", +// "RuntimeId":"00000000-0000-0000-0000-000000000000", +// "State":"Running", +// "MappedVirtualDiskControllers":{ +// "0":{ +// "MappedVirtualDisks":{ +// "2":{ +// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx", +// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch", +// "Lun":2, +// "CreateInUtilityVM":true +// }, +// "3":{ +// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx", +// "Lun":3, +// "CreateInUtilityVM":true, +// "AttachOnly":true +// } +// } +// } +// } +//} +func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "MappedVirtualDiskList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(mappedVirtualDiskQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.MappedVirtualDiskControllers, nil +} + +// Pause pauses the execution of the container. This feature is not enabled in TP5. +func (container *container) Pause() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Pause" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsPauseComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Resume resumes the execution of the container. This feature is not enabled in TP5. +func (container *container) Resume() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Resume" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsResumeComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// CreateProcess launches a new process within the container. +func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "CreateProcess" + title := "HCSShim::Container::" + operation + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + // If we are not emulating a console, ignore any console size passed to us + if !c.EmulateConsole { + c.ConsoleSize[0] = 0 + c.ConsoleSize[1] = 0 + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", container.id, configuration) + + err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + process := &process{ + handle: processHandle, + processID: int(processInfo.ProcessId), + container: container, + cachedPipes: &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + }, + } + + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID) + return process, nil +} + +// OpenProcess gets an interface to an existing process within the container. +func (container *container) OpenProcess(pid int) (Process, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "OpenProcess" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s, processid=%d", container.id, pid) + var ( + processHandle hcsProcess + resultp *uint16 + ) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + process := &process{ + handle: processHandle, + processID: pid, + container: container, + } + + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) + return process, nil +} + +// Close cleans up any state associated with the container but does not terminate or wait for it. +func (container *container) Close() error { + container.handleLock.Lock() + defer container.handleLock.Unlock() + operation := "Close" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + // Don't double free this + if container.handle == 0 { + return nil + } + + if err := container.unregisterCallback(); err != nil { + return makeContainerError(container, operation, "", err) + } + + if err := hcsCloseComputeSystem(container.handle); err != nil { + return makeContainerError(container, operation, "", err) + } + + container.handle = 0 + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + container.callbackNumber = callbackNumber + + return nil +} + +func (container *container) unregisterCallback() error { + callbackNumber := container.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} + +// Modifies the System by sending a request to HCS +func (container *container) Modify(config *ResourceModificationRequestResponse) error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Modify" + title := "HCSShim::Container::" + operation + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + requestJSON, err := json.Marshal(config) + if err != nil { + return err + } + + requestString := string(requestJSON) + logrus.Debugf(title+" id=%s request=%s", container.id, requestString) + + var resultp *uint16 + err = hcsModifyComputeSystem(container.handle, requestString, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go new file mode 100644 index 000000000..035d9c394 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createlayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(info DriverInfo, id, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createLayer(&infop, id, parent) + if err != nil { + err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go new file mode 100644 index 000000000..7a6a8854c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go @@ -0,0 +1,35 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// CreateSandboxLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + title := "hcsshim::CreateSandboxLayer " + logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createSandboxLayer(&infop, layerId, parentId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go new file mode 100644 index 000000000..fd785030f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(info DriverInfo, id string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = deactivateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go new file mode 100644 index 000000000..b1e3b89fc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/destroylayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// DestroyLayer will remove the on-disk files representing the layer with the given +// id, including that layer's containing folder, if any. +func DestroyLayer(info DriverInfo, id string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = destroyLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go new file mode 100644 index 000000000..d2f9cc8bd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -0,0 +1,239 @@ +package hcsshim + +import ( + "errors" + "fmt" + "syscall" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") +) + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + Process *process + Operation string + ExtraInfo string + Err error +} + +// ContainerError is an error encountered in HCS during an operation on a Container object +type ContainerError struct { + Container *container + Operation string + ExtraInfo string + Err error +} + +func (e *ContainerError) Error() string { + if e == nil { + return "" + } + + if e.Container == nil { + return "unexpected nil container for error: " + e.Err.Error() + } + + s := "container " + e.Container.id + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + if e.ExtraInfo != "" { + s += " extra info: " + e.ExtraInfo + } + + return s +} + +func makeContainerError(container *container, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ContainerError); ok { + return err + } + containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} + return containerError +} + +func (e *ProcessError) Error() string { + if e == nil { + return "" + } + + if e.Process == nil { + return "Unexpected nil process for error: " + e.Err.Error() + } + + s := fmt.Sprintf("process %d", e.Process.processID) + + if e.Process.container != nil { + s += " in container " + e.Process.container.id + } + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + return s +} + +func makeProcessError(process *process, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} + return processError +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *ContainerError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go new file mode 100644 index 000000000..6946c6a84 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// ExpandSandboxSize expands the size of a layer to at least size bytes. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + title := "hcsshim::ExpandSandboxSize " + logrus.Debugf(title+"layerId=%s size=%d", layerId, size) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = expandSandboxSize(&infop, layerId, size) + if err != nil { + err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go new file mode 100644 index 000000000..d7025f20b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/exportlayer.go @@ -0,0 +1,156 @@ +package hcsshim + +import ( + "io" + "io/ioutil" + "os" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/sirupsen/logrus" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ExportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = exportLayer(&infop, layerId, exportFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath) + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// FilterLayerReader provides an interface for extracting the contents of an on-disk layer. +type FilterLayerReader struct { + context uintptr +} + +// Next reads the next available file from a layer, ensuring that parent directories are always read +// before child files and directories. +// +// Next returns the file's relative path, size, and basic file metadata. Read() should be used to +// extract a Win32 backup stream with the remainder of the metadata and the data. +func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) { + var fileNamep *uint16 + fileInfo := &winio.FileBasicInfo{} + var deleted uint32 + var fileSize int64 + err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted) + if err != nil { + if err == syscall.ERROR_NO_MORE_FILES { + err = io.EOF + } else { + err = makeError(err, "ExportLayerNext", "") + } + return "", 0, nil, err + } + fileName := convertAndFreeCoTaskMemString(fileNamep) + if deleted != 0 { + fileInfo = nil + } + if fileName[0] == '\\' { + fileName = fileName[1:] + } + return fileName, fileSize, fileInfo, nil +} + +// Read reads from the current file's Win32 backup stream. +func (r *FilterLayerReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := exportLayerRead(r.context, b, &bytesRead) + if err != nil { + return 0, makeError(err, "ExportLayerRead", "") + } + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees resources associated with the layer reader. It will return an +// error if there was an error while reading the layer or of the layer was not +// completely read. +func (r *FilterLayerReader) Close() (err error) { + if r.context != 0 { + err = exportLayerEnd(r.context) + if err != nil { + err = makeError(err, "ExportLayerEnd", "") + } + r.context = 0 + } + return +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + if procExportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(info, layerID, path, parentLayerPaths) + if err != nil { + os.RemoveAll(path) + return nil, err + } + return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil + } + + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + r := &FilterLayerReader{} + err = exportLayerBegin(&infop, layerID, layers, &r.context) + if err != nil { + return nil, makeError(err, "ExportLayerBegin", "") + } + return r, err +} + +type legacyLayerReaderWrapper struct { + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() error { + err := r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go new file mode 100644 index 000000000..89f8079d0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go @@ -0,0 +1,55 @@ +package hcsshim + +import ( + "syscall" + + "github.com/sirupsen/logrus" +) + +// GetLayerMountPath will look for a mounted layer with the given id and return +// the path at which that layer can be accessed. This path may be a volume path +// if the layer is a mounted read-write layer, otherwise it is expected to be the +// folder path at which the layer is stored. +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + title := "hcsshim::GetLayerMountPath " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return "", err + } + + var mountPathLength uintptr + mountPathLength = 0 + + // Call the procedure itself. + logrus.Debugf("Calling proc (1)") + err = getLayerMountPath(&infop, id, &mountPathLength, nil) + if err != nil { + err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + // Allocate a mount path of the returned length. + if mountPathLength == 0 { + return "", nil + } + mountPathp := make([]uint16, mountPathLength) + mountPathp[0] = 0 + + // Call the procedure again + logrus.Debugf("Calling proc (2)") + err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) + if err != nil { + err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + path := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) + return path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go new file mode 100644 index 000000000..05d3d9532 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go @@ -0,0 +1,22 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// GetSharedBaseImages will enumerate the images stored in the common central +// image store and return descriptive info about those images for the purpose +// of registering them with the graphdriver, graph, and tagstore. +func GetSharedBaseImages() (imageData string, err error) { + title := "hcsshim::GetSharedBaseImages " + + logrus.Debugf("Calling proc") + var buffer *uint16 + err = getBaseImages(&buffer) + if err != nil { + err = makeError(err, title, "") + logrus.Error(err) + return + } + imageData = convertAndFreeCoTaskMemString(buffer) + logrus.Debugf(title+" - succeeded output=%s", imageData) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go new file mode 100644 index 000000000..620aba123 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/guid.go @@ -0,0 +1,19 @@ +package hcsshim + +import ( + "crypto/sha1" + "fmt" +) + +type GUID [16]byte + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go new file mode 100644 index 000000000..236ba1fa3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -0,0 +1,166 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcsshim + +import ( + "fmt" + "syscall" + "unsafe" + + "github.com/sirupsen/logrus" +) + +//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? +//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? +//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? +//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? + +//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? +//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? +//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? +//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +const ( + // Specific user-visible exit codes + WaitErrExecFailed = 32767 + + ERROR_GEN_FAILURE = syscall.Errno(31) + ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) + WSAEINVAL = syscall.Errno(10022) + + // Timeout on wait calls + TimeoutInfinite = 0xFFFFFFFF +) + +type HcsError struct { + title string + rest string + Err error +} + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} + +func makeError(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func makeErrorf(err error, title, format string, a ...interface{}) error { + return makeError(err, title, fmt.Sprintf(format, a...)) +} + +func win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} + +func win32FromHresult(hr uintptr) uintptr { + if hr&0x1fff0000 == 0x00070000 { + return hr & 0xffff + } + return hr +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func convertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(convertAndFreeCoTaskMemString(buffer)) +} + +func processHcsResult(err error, resultp *uint16) error { + if resultp != nil { + result := convertAndFreeCoTaskMemString(resultp) + logrus.Debugf("Result: %s", result) + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go new file mode 100644 index 000000000..92afc0c24 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -0,0 +1,318 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "net" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container +func HotAttachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Add) +} + +// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container +func HotDetachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Remove) +} + +// ModifyContainer corresponding to the container id, by sending a request +func modifyContainer(id string, request *ResourceModificationRequestResponse) error { + container, err := OpenContainer(id) + if err != nil { + if IsNotExist(err) { + return ErrComputeSystemDoesNotExist + } + return getInnerError(err) + } + defer container.Close() + err = container.Modify(request) + if err != nil { + if IsNotSupported(err) { + return ErrPlatformNotSupported + } + return getInnerError(err) + } + + return nil +} + +func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { + requestMessage := &ResourceModificationRequestResponse{ + Resource: Network, + Request: request, + Data: endpointID, + } + err := modifyContainer(containerID, requestMessage) + + if err != nil { + return err + } + + return nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, fmt.Errorf("Endpoint %v not found", endpointName) +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ContainerHotAttach attaches an endpoint to a running container +func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error { + operation := "ContainerHotAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) + + return modifyNetworkEndpoint(containerID, endpoint.Id, Add) +} + +// ContainerHotDetach detaches an endpoint from a running container +func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error { + operation := "ContainerHotDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) + + return modifyNetworkEndpoint(containerID, endpoint.Id, Remove) +} + +// ApplyACLPolicy applies Acl Policy on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies[0] = jsonString + _, err = endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go new file mode 100644 index 000000000..2c1b979ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go @@ -0,0 +1,40 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + + "github.com/sirupsen/logrus" +) + +func hnsCall(method, path, request string, returnResponse interface{}) error { + var responseBuffer *uint16 + logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) + + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return makeError(err, "hnsCall ", "") + } + response := convertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return err + } + + if !hnsresponse.Success { + return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go new file mode 100644 index 000000000..3345bfa3f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -0,0 +1,142 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "net" + + "github.com/sirupsen/logrus" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, fmt.Errorf("Network %v not found", networkName) +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go new file mode 100644 index 000000000..ecfbf0eda --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -0,0 +1,95 @@ +package hcsshim + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Protocol uint16 + InternalPort uint16 + Action ActionType + Direction DirectionType + LocalAddress string + RemoteAddress string + LocalPort uint16 + RemotePort uint16 + RuleType RuleType `json:"RuleType,omitempty"` + + Priority uint16 + ServiceName string +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go new file mode 100644 index 000000000..15653b4f4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -0,0 +1,196 @@ +package hcsshim + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" Vip:%s", vip) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + VIPs: []string{vip}, + ILB: isILB, + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go new file mode 100644 index 000000000..3aed14376 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/importlayer.go @@ -0,0 +1,212 @@ +package hcsshim + +import ( + "errors" + "io/ioutil" + "os" + "path/filepath" + + "github.com/Microsoft/go-winio" + "github.com/sirupsen/logrus" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ImportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = importLayer(&infop, layerID, importFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath) + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +// FilterLayerWriter provides an interface to write the contents of a layer to the file system. +type FilterLayerWriter struct { + context uintptr +} + +// Add adds a file or directory to the layer. The file's parent directory must have already been added. +// +// name contains the file's relative path. fileInfo contains file times and file attributes; the rest +// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method. +// winio.BackupStreamWriter can be used to facilitate this. +func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, fileInfo) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// AddLink adds a hard link to the layer. The target of the link must have already been added. +func (w *FilterLayerWriter) AddLink(name string, target string) error { + return errors.New("hard links not yet supported") +} + +// Remove removes a file from the layer. The file must have been present in the parent layer. +// +// name contains the file's relative path. +func (w *FilterLayerWriter) Remove(name string) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, nil) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// Write writes more backup stream data to the current file. +func (w *FilterLayerWriter) Write(b []byte) (int, error) { + err := importLayerWrite(w.context, b) + if err != nil { + err = makeError(err, "ImportLayerWrite", "") + return 0, err + } + return len(b), err +} + +// Close completes the layer write operation. The error must be checked to ensure that the +// operation was successful. +func (w *FilterLayerWriter) Close() (err error) { + if w.context != 0 { + err = importLayerEnd(w.context) + if err != nil { + err = makeError(err, "ImportLayerEnd", "") + } + w.context = 0 + } + return +} + +type legacyLayerWriterWrapper struct { + *legacyLayerWriter + info DriverInfo + layerID string + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() error { + defer os.RemoveAll(r.root) + err := r.legacyLayerWriter.Close() + if err != nil { + return err + } + + // Use the original path here because ImportLayer does not support long paths for the source in TP5. + // But do use a long path for the destination to work around another bug with directories + // with MAX_PATH - 12 < length < MAX_PATH. + info := r.info + fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID)) + if err != nil { + return err + } + + info.HomeDir = "" + if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil { + return err + } + // Add any hard links that were collected. + for _, lnk := range r.PendingLinks { + if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) { + return err + } + if err = os.Link(lnk.Target, lnk.Path); err != nil { + return err + } + } + // Prepare the utility VM for use if one is present in the layer. + if r.HasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM")) + if err != nil { + return err + } + } + return nil +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + return &baseLayerWriter{ + root: filepath.Join(info.HomeDir, layerID), + }, nil + } + + if procImportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)), + info: info, + layerID: layerID, + path: path, + parentLayerPaths: parentLayerPaths, + }, nil + } + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + + w := &FilterLayerWriter{} + err = importLayerBegin(&infop, layerID, layers, &w.context) + if err != nil { + return nil, makeError(err, "ImportLayerStart", "") + } + return w, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go new file mode 100644 index 000000000..9fc7852e4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -0,0 +1,187 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "time" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty:` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +// Container represents a created (but not necessarily running) container. +type Container interface { + // Start synchronously starts the container. + Start() error + + // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. + Shutdown() error + + // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. + Terminate() error + + // Waits synchronously waits for the container to shutdown or terminate. + Wait() error + + // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It + // returns false if timeout occurs. + WaitTimeout(time.Duration) error + + // Pause pauses the execution of a container. + Pause() error + + // Resume resumes the execution of a container. + Resume() error + + // HasPendingUpdates returns true if the container has updates pending to install. + HasPendingUpdates() (bool, error) + + // Statistics returns statistics for a container. + Statistics() (Statistics, error) + + // ProcessList returns details for the processes in a container. + ProcessList() ([]ProcessListItem, error) + + // MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller + MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) + + // CreateProcess launches a new process within the container. + CreateProcess(c *ProcessConfig) (Process, error) + + // OpenProcess gets an interface to an existing process within the container. + OpenProcess(pid int) (Process, error) + + // Close cleans up any state associated with the container but does not terminate or wait for it. + Close() error + + // Modify the System + Modify(config *ResourceModificationRequestResponse) error +} + +// Process represents a running or exited process. +type Process interface { + // Pid returns the process ID of the process within the container. + Pid() int + + // Kill signals the process to terminate but does not wait for it to finish terminating. + Kill() error + + // Wait waits for the process to exit. + Wait() error + + // WaitTimeout waits for the process to exit or the duration to elapse. It returns + // false if timeout occurs. + WaitTimeout(time.Duration) error + + // ExitCode returns the exit code of the process. The process must have + // already terminated. + ExitCode() (int, error) + + // ResizeConsole resizes the console of the process. + ResizeConsole(width, height uint16) error + + // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing + // these pipes does not close the underlying pipes; it should be possible to + // call this multiple times to get multiple interfaces. + Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) + + // CloseStdin closes the write side of the stdin pipe so that the process is + // notified on the read side that there is no more data in stdin. + CloseStdin() error + + // Close cleans up any state associated with the process but does not kill + // or wait on it. + Close() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go new file mode 100644 index 000000000..fe46f404c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerexists.go @@ -0,0 +1,30 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(info DriverInfo, id string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return false, err + } + + // Call the procedure itself. + var exists uint32 + + err = layerExists(&infop, id, &exists) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/layerutils.go new file mode 100644 index 000000000..c0e550377 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerutils.go @@ -0,0 +1,111 @@ +package hcsshim + +// This file contains utility functions to support storage (graph) related +// functionality. + +import ( + "path/filepath" + "syscall" + + "github.com/sirupsen/logrus" +) + +/* To pass into syscall, we need a struct matching the following: +enum GraphDriverType +{ + DiffDriver, + FilterDriver +}; + +struct DriverInfo { + GraphDriverType Flavour; + LPCWSTR HomeDir; +}; +*/ +type DriverInfo struct { + Flavour int + HomeDir string +} + +type driverInfo struct { + Flavour int + HomeDirp *uint16 +} + +func convertDriverInfo(info DriverInfo) (driverInfo, error) { + homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) + if err != nil { + logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) + return driverInfo{}, err + } + + return driverInfo{ + Flavour: info.Flavour, + HomeDirp: homedirp, + }, nil +} + +/* To pass into syscall, we need a struct matching the following: +typedef struct _WC_LAYER_DESCRIPTOR { + + // + // The ID of the layer + // + + GUID LayerId; + + // + // Additional flags + // + + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; + + // + // Path to the layer root directory, null-terminated + // + + PCWSTR Path; + +} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; +*/ +type WC_LAYER_DESCRIPTOR struct { + LayerId GUID + Flags uint32 + Pathp *uint16 +} + +func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { + // Array of descriptors that gets constructed. + var layers []WC_LAYER_DESCRIPTOR + + for i := 0; i < len(parentLayerPaths); i++ { + // Create a layer descriptor, using the folder name + // as the source for a GUID LayerId + _, folderName := filepath.Split(parentLayerPaths[i]) + g, err := NameToGuid(folderName) + if err != nil { + logrus.Debugf("Failed to convert name to guid %s", err) + return nil, err + } + + p, err := syscall.UTF16PtrFromString(parentLayerPaths[i]) + if err != nil { + logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err) + return nil, err + } + + layers = append(layers, WC_LAYER_DESCRIPTOR{ + LayerId: g, + Flags: 0, + Pathp: p, + }) + } + + return layers, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/legacy.go new file mode 100644 index 000000000..c7f6073ac --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/legacy.go @@ -0,0 +1,741 @@ +package hcsshim + +import ( + "bufio" + "encoding/binary" + "errors" + "fmt" + "io" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" +) + +var errorIterationCanceled = errors.New("") + +var mutatedUtilityVMFiles = map[string]bool{ + `EFI\Microsoft\Boot\BCD`: true, + `EFI\Microsoft\Boot\BCD.LOG`: true, + `EFI\Microsoft\Boot\BCD.LOG1`: true, + `EFI\Microsoft\Boot\BCD.LOG2`: true, +} + +const ( + filesPath = `Files` + hivesPath = `Hives` + utilityVMPath = `UtilityVM` + utilityVMFilesPath = `UtilityVM\Files` +) + +func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) { + return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) +} + +func makeLongAbsPath(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} + +func hasPathPrefix(p, prefix string) bool { + return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' +} + +type fileEntry struct { + path string + fi os.FileInfo + err error +} + +type legacyLayerReader struct { + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +// newLegacyLayerReader returns a new LayerReader that can read the Windows +// container layer transport format from disk. +func newLegacyLayerReader(root string) *legacyLayerReader { + r := &legacyLayerReader{ + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func readTombstones(path string) (map[string]([]string), error) { + tf, err := os.Open(filepath.Join(path, "tombstones.txt")) + if err != nil { + return nil, err + } + defer tf.Close() + s := bufio.NewScanner(tf) + if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { + return nil, errors.New("Invalid tombstones file") + } + + ts := make(map[string]([]string)) + for s.Scan() { + t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\` + dir := filepath.Dir(t) + ts[dir] = append(ts[dir], t) + } + if err = s.Err(); err != nil { + return nil, err + } + + return ts, nil +} + +func (r *legacyLayerReader) walkUntilCancelled() error { + root, err := makeLongAbsPath(r.root) + if err != nil { + return err + } + + r.root = root + ts, err := readTombstones(r.root) + if err != nil { + return err + } + + err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + // List all the tombstones. + if info.IsDir() { + relPath, err := filepath.Rel(r.root, path) + if err != nil { + return err + } + if dts, ok := ts[relPath]; ok { + for _, t := range dts { + r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil} + if !<-r.proceed { + return errorIterationCanceled + } + } + } + } + return nil + }) + if err == errorIterationCanceled { + return nil + } + if err == nil { + return io.EOF + } + return err +} + +func (r *legacyLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *legacyLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func findBackupStreamSize(r io.Reader) (int64, error) { + br := winio.NewBackupStreamReader(r) + for { + hdr, err := br.Next() + if err != nil { + if err == io.EOF { + err = nil + } + return 0, err + } + if hdr.Id == winio.BackupData { + return hdr.Size, nil + } + } +} + +func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("LegacyLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + if fe.fi == nil { + // This is a tombstone. Return a nil fileInfo. + return + } + + if fe.fi.IsDir() && hasPathPrefix(path, filesPath) { + fe.path += ".$wcidirs$" + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + if !hasPathPrefix(path, filesPath) { + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, false) + if path == hivesPath || path == filesPath { + // The Hives directory has a non-deterministic file time because of the + // nature of the import process. Use the times from System_Delta. + var g *os.File + g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`)) + if err != nil { + return + } + attr := fileInfo.FileAttributes + fileInfo, err = winio.GetFileBasicInfo(g) + g.Close() + if err != nil { + return + } + fileInfo.FileAttributes = attr + } + + // The creation time and access time get reset for files outside of the Files path. + fileInfo.CreationTime = fileInfo.LastWriteTime + fileInfo.LastAccessTime = fileInfo.LastWriteTime + + } else { + // The file attributes are written before the backup stream. + var attr uint32 + err = binary.Read(f, binary.LittleEndian, &attr) + if err != nil { + return + } + fileInfo.FileAttributes = uintptr(attr) + beginning := int64(4) + + // Find the accurate file size. + if !fe.fi.IsDir() { + size, err = findBackupStreamSize(f) + if err != nil { + err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err} + return + } + } + + // Return back to the beginning of the backup stream. + _, err = f.Seek(beginning, 0) + if err != nil { + return + } + } + + r.currentFile = f + f = nil + return +} + +func (r *legacyLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, io.EOF + } + return r.currentFile.Read(b) + } + return r.backupReader.Read(b) +} + +func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, errors.New("no current file") + } + return r.currentFile.Seek(offset, whence) + } + return 0, errors.New("seek not supported on this stream") +} + +func (r *legacyLayerReader) Close() error { + r.proceed <- false + <-r.result + r.reset() + return nil +} + +type pendingLink struct { + Path, Target string +} + +type legacyLayerWriter struct { + root string + parentRoots []string + destRoot string + currentFile *os.File + backupWriter *winio.BackupFileWriter + tombstones []string + pathFixed bool + HasUtilityVM bool + uvmDi []dirInfo + addedFiles map[string]bool + PendingLinks []pendingLink +} + +// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// transport format to disk. +func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) *legacyLayerWriter { + return &legacyLayerWriter{ + root: root, + parentRoots: parentRoots, + destRoot: destRoot, + addedFiles: make(map[string]bool), + } +} + +func (w *legacyLayerWriter) init() error { + if !w.pathFixed { + path, err := makeLongAbsPath(w.root) + if err != nil { + return err + } + for i, p := range w.parentRoots { + w.parentRoots[i], err = makeLongAbsPath(p) + if err != nil { + return err + } + } + destPath, err := makeLongAbsPath(w.destRoot) + if err != nil { + return err + } + w.root = path + w.destRoot = destPath + w.pathFixed = true + } + return nil +} + +func (w *legacyLayerWriter) initUtilityVM() error { + if !w.HasUtilityVM { + err := os.Mkdir(filepath.Join(w.destRoot, utilityVMPath), 0) + if err != nil { + return err + } + // Server 2016 does not support multiple layers for the utility VM, so + // clone the utility VM from the parent layer into this layer. Use hard + // links to avoid unnecessary copying, since most of the files are + // immutable. + err = cloneTree(filepath.Join(w.parentRoots[0], utilityVMFilesPath), filepath.Join(w.destRoot, utilityVMFilesPath), mutatedUtilityVMFiles) + if err != nil { + return fmt.Errorf("cloning the parent utility VM image failed: %s", err) + } + w.HasUtilityVM = true + } + return nil +} + +func (w *legacyLayerWriter) reset() { + if w.backupWriter != nil { + w.backupWriter.Close() + w.backupWriter = nil + } + if w.currentFile != nil { + w.currentFile.Close() + w.currentFile = nil + } +} + +// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata +func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { + createDisposition := uint32(syscall.CREATE_NEW) + if isDir { + err = os.Mkdir(destPath, 0) + if err != nil { + return nil, err + } + createDisposition = syscall.OPEN_EXISTING + } + + src, err := openFileOrDir(srcPath, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.OPEN_EXISTING) + if err != nil { + return nil, err + } + defer src.Close() + srcr := winio.NewBackupFileReader(src, true) + defer srcr.Close() + + fileInfo, err = winio.GetFileBasicInfo(src) + if err != nil { + return nil, err + } + + dest, err := openFileOrDir(destPath, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + if err != nil { + return nil, err + } + defer dest.Close() + + err = winio.SetFileBasicInfo(dest, fileInfo) + if err != nil { + return nil, err + } + + destw := winio.NewBackupFileWriter(dest, true) + defer func() { + cerr := destw.Close() + if err == nil { + err = cerr + } + }() + + _, err = io.Copy(destw, srcr) + if err != nil { + return nil, err + } + + return fileInfo, nil +} + +// cloneTree clones a directory tree using hard links. It skips hard links for +// the file names in the provided map and just copies those files. +func cloneTree(srcPath, destPath string, mutatedFiles map[string]bool) error { + var di []dirInfo + err := filepath.Walk(srcPath, func(srcFilePath string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + relPath, err := filepath.Rel(srcPath, srcFilePath) + if err != nil { + return err + } + destFilePath := filepath.Join(destPath, relPath) + + // Directories, reparse points, and files that will be mutated during + // utility VM import must be copied. All other files can be hard linked. + isReparsePoint := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 + if info.IsDir() || isReparsePoint || mutatedFiles[relPath] { + fi, err := copyFileWithMetadata(srcFilePath, destFilePath, info.IsDir()) + if err != nil { + return err + } + if info.IsDir() && !isReparsePoint { + di = append(di, dirInfo{path: destFilePath, fileInfo: *fi}) + } + } else { + err = os.Link(srcFilePath, destFilePath) + if err != nil { + return err + } + } + + // Don't recurse on reparse points. + if info.IsDir() && isReparsePoint { + return filepath.SkipDir + } + + return nil + }) + if err != nil { + return err + } + + return reapplyDirectoryTimes(di) +} + +func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + w.reset() + err := w.init() + if err != nil { + return err + } + + if name == utilityVMPath { + return w.initUtilityVM() + } + + if hasPathPrefix(name, utilityVMPath) { + if !w.HasUtilityVM { + return errors.New("missing UtilityVM directory") + } + if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { + return errors.New("invalid UtilityVM layer") + } + path := filepath.Join(w.destRoot, name) + createDisposition := uint32(syscall.OPEN_EXISTING) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + st, err := os.Lstat(path) + if err != nil && !os.IsNotExist(err) { + return err + } + if st != nil { + // Delete the existing file/directory if it is not the same type as this directory. + existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + if err = os.RemoveAll(path); err != nil { + return err + } + st = nil + } + } + if st == nil { + if err = os.Mkdir(path, 0); err != nil { + return err + } + } + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.uvmDi = append(w.uvmDi, dirInfo{path: path, fileInfo: *fileInfo}) + } + } else { + // Overwrite any existing hard link. + err = os.Remove(path) + if err != nil && !os.IsNotExist(err) { + return err + } + createDisposition = syscall.CREATE_NEW + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return err + } + + w.backupWriter = winio.NewBackupFileWriter(f, true) + w.currentFile = f + w.addedFiles[name] = true + f = nil + return nil + } + + path := filepath.Join(w.root, name) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + err := os.Mkdir(path, 0) + if err != nil { + return err + } + path += ".$wcidirs$" + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.CREATE_NEW) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + strippedFi := *fileInfo + strippedFi.FileAttributes = 0 + err = winio.SetFileBasicInfo(f, &strippedFi) + if err != nil { + return err + } + + if hasPathPrefix(name, hivesPath) { + w.backupWriter = winio.NewBackupFileWriter(f, false) + } else { + // The file attributes are written before the stream. + err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + if err != nil { + return err + } + } + + w.currentFile = f + w.addedFiles[name] = true + f = nil + return nil +} + +func (w *legacyLayerWriter) AddLink(name string, target string) error { + w.reset() + err := w.init() + if err != nil { + return err + } + + var roots []string + if hasPathPrefix(target, filesPath) { + // Look for cross-layer hard link targets in the parent layers, since + // nothing is in the destination path yet. + roots = w.parentRoots + } else if hasPathPrefix(target, utilityVMFilesPath) { + // Since the utility VM is fully cloned into the destination path + // already, look for cross-layer hard link targets directly in the + // destination path. + roots = []string{w.destRoot} + } + + if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) { + return errors.New("invalid hard link in layer") + } + + // Find to try the target of the link in a previously added file. If that + // fails, search in parent layers. + var selectedRoot string + if _, ok := w.addedFiles[target]; ok { + selectedRoot = w.destRoot + } else { + for _, r := range roots { + if _, err = os.Lstat(filepath.Join(r, target)); err != nil { + if !os.IsNotExist(err) { + return err + } + } else { + selectedRoot = r + break + } + } + if selectedRoot == "" { + return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target) + } + } + // The link can't be written until after the ImportLayer call. + w.PendingLinks = append(w.PendingLinks, pendingLink{ + Path: filepath.Join(w.destRoot, name), + Target: filepath.Join(selectedRoot, target), + }) + w.addedFiles[name] = true + return nil +} + +func (w *legacyLayerWriter) Remove(name string) error { + if hasPathPrefix(name, filesPath) { + w.tombstones = append(w.tombstones, name[len(filesPath)+1:]) + } else if hasPathPrefix(name, utilityVMFilesPath) { + err := w.initUtilityVM() + if err != nil { + return err + } + // Make sure the path exists; os.RemoveAll will not fail if the file is + // already gone, and this needs to be a fatal error for diagnostics + // purposes. + path := filepath.Join(w.destRoot, name) + if _, err := os.Lstat(path); err != nil { + return err + } + err = os.RemoveAll(path) + if err != nil { + return err + } + } else { + return fmt.Errorf("invalid tombstone %s", name) + } + + return nil +} + +func (w *legacyLayerWriter) Write(b []byte) (int, error) { + if w.backupWriter == nil { + if w.currentFile == nil { + return 0, errors.New("closed") + } + return w.currentFile.Write(b) + } + return w.backupWriter.Write(b) +} + +func (w *legacyLayerWriter) Close() error { + w.reset() + err := w.init() + if err != nil { + return err + } + tf, err := os.Create(filepath.Join(w.root, "tombstones.txt")) + if err != nil { + return err + } + defer tf.Close() + _, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n")) + if err != nil { + return err + } + for _, t := range w.tombstones { + _, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n")) + if err != nil { + return err + } + } + if w.HasUtilityVM { + err = reapplyDirectoryTimes(w.uvmDi) + if err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go new file mode 100644 index 000000000..b7c6d020c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/nametoguid.go @@ -0,0 +1,20 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id GUID, err error) { + title := "hcsshim::NameToGuid " + logrus.Debugf(title+"Name %s", name) + + err = nameToGuid(name, &id) + if err != nil { + err = makeErrorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/preparelayer.go new file mode 100644 index 000000000..5c5b61841 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/preparelayer.go @@ -0,0 +1,46 @@ +package hcsshim + +import ( + "sync" + + "github.com/sirupsen/logrus" +) + +var prepareLayerLock sync.Mutex + +// PrepareLayer finds a mounted read-write layer matching layerId and enables the +// the filesystem filter for use on that layer. This requires the paths to all +// parent layers, and is necessary in order to view or interact with the layer +// as an actual filesystem (reading and writing files, creating directories, etc). +// Disabling the filter must be done via UnprepareLayer. +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + title := "hcsshim::PrepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + // This lock is a temporary workaround for a Windows bug. Only allowing one + // call to prepareLayer at a time vastly reduces the chance of a timeout. + prepareLayerLock.Lock() + defer prepareLayerLock.Unlock() + err = prepareLayer(&infop, layerId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go new file mode 100644 index 000000000..faee2cfee --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -0,0 +1,384 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "sync" + "syscall" + "time" + + "github.com/sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type process struct { + handleLock sync.RWMutex + handle hcsProcess + processID int + container *container + cachedPipes *cachedPipes + callbackNumber uintptr +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type processStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *process) Pid() int { + return process.processID +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *process) Kill() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Kill" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsTerminateProcess(process.handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Wait waits for the process to exit. +func (process *process) Wait() error { + operation := "Wait" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *process) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *process) ExitCode() (int, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ExitCode" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return 0, makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + properties, err := process.properties() + if err != nil { + return 0, makeProcessError(process, operation, "", err) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, "", ErrInvalidProcessState) + } + + if properties.LastWaitResult != 0 { + return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult)) + } + + logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode) + return int(properties.ExitCode), nil +} + +// ResizeConsole resizes the console of the process. +func (process *process) ResizeConsole(width, height uint16) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ResizeConsole" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) properties() (*processStatus, error) { + operation := "properties" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + + properties := &processStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + + logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) + return properties, nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Stdio" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *process) CloseStdin() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "CloseStdin" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *process) Close() error { + process.handleLock.Lock() + defer process.handleLock.Unlock() + operation := "Close" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if err := process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, "", err) + } + + if err := hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, "", err) + } + + process.handle = 0 + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/processimage.go new file mode 100644 index 000000000..fadb1b92c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/processimage.go @@ -0,0 +1,23 @@ +package hcsshim + +import "os" + +// ProcessBaseLayer post-processes a base layer that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessBaseLayer(path string) error { + err := processBaseImage(path) + if err != nil { + return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err} + } + return nil +} + +// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessUtilityVMImage(path string) error { + err := processUtilityImage(path) + if err != nil { + return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err} + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go new file mode 100644 index 000000000..e8a3b507b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(info DriverInfo, layerId string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = unprepareLayer(&infop, layerId) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/utils.go new file mode 100644 index 000000000..bd6e2d94a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/utils.go @@ -0,0 +1,33 @@ +package hcsshim + +import ( + "io" + "syscall" + + "github.com/Microsoft/go-winio" +) + +// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles +// if there is an error. +func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { + fs := make([]io.ReadWriteCloser, len(hs)) + for i, h := range hs { + if h != syscall.Handle(0) { + if err == nil { + fs[i], err = winio.MakeOpenFile(h) + } + if err != nil { + syscall.Close(h) + } + } + } + if err != nil { + for _, f := range fs { + if f != nil { + f.Close() + } + } + return nil, err + } + return fs, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go new file mode 100644 index 000000000..ae10c23d4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/version.go @@ -0,0 +1,7 @@ +package hcsshim + +// IsTP4 returns whether the currently running Windows build is at least TP4. +func IsTP4() bool { + // HNSCall was not present in TP4 + return procHNSCall.Find() != nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/waithelper.go new file mode 100644 index 000000000..b7be20ea0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/waithelper.go @@ -0,0 +1,63 @@ +package hcsshim + +import ( + "time" + + "github.com/sirupsen/logrus" +) + +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + err = processHcsResult(err, resultp) + if IsPending(err) { + return waitForNotification(callbackNumber, expectedNotification, timeout) + } + + return err +} + +func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + callbackMapLock.RLock() + channels := callbackMap[callbackNumber].channels + callbackMapLock.RUnlock() + + expectedChannel := channels[expectedNotification] + if expectedChannel == nil { + logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + return ErrInvalidNotificationType + } + + var c <-chan time.Time + if timeout != nil { + timer := time.NewTimer(*timeout) + c = timer.C + defer timer.Stop() + } + + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + case <-c: + return ErrTimeout + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go new file mode 100644 index 000000000..5d1a851ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go @@ -0,0 +1,1042 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modole32 = windows.NewLazySystemDLL("ole32.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") + procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") + procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") + procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") + procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") + procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") + procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") + procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, _p1, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func nameToGuid(name string, guid *GUID) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *GUID) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _importLayerBegin(info, _p0, descriptors, context) +} + +func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procImportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(fileName) + if hr != nil { + return + } + return _importLayerNext(context, _p0, fileInfo) +} + +func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { + if hr = procImportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerWrite(context uintptr, buffer []byte) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procImportLayerWrite.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerEnd(context uintptr) (hr error) { + if hr = procImportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _exportLayerBegin(info, _p0, descriptors, context) +} + +func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procExportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { + if hr = procExportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procExportLayerRead.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerEnd(context uintptr) (hr error) { + if hr = procExportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyServiceSettings.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} -- cgit v1.2.3-54-g00ecf